summaryrefslogtreecommitdiffstats
path: root/lib/libc/sys
Commit message (Expand)AuthorAgeFilesLines
* MFC r304285:kib2017-05-092-10/+19
* MF11 304617: Fix various nits in the aio operation manpages.jhb2016-08-224-26/+15
* MFS r304512:bdrewery2016-08-201-6/+0
* MFC r303104, r303106:brooks2016-08-031-2/+21
* MFC 303164: Add more documentation regarding unsafe AIO requests.jhb2016-07-284-20/+16
* MFC 302899: Add documentation for the sigevent structure.jhb2016-07-257-22/+175
* fcntl(2): Document interrupt/restart for file locks.jilles2016-07-071-1/+22
* Replace use of the pipe(2) system call with pipe2(2) with a zero flagsbrooks2016-06-223-1/+53
* utimes(2),utime(3): Add deprecation in favour of utimensat(2) and futimens(2).jilles2016-06-091-2/+15
* Introduce the PD_CLOEXEC for pdfork(2).oshogbo2016-06-081-1/+5
* Fix markup.kib2016-06-041-1/+1
* Improve errno documentation in pthread_create(3) and thr_new(2)vangyzen2016-06-032-4/+11
* thr_*(2): Add xrefs to what libthr implements using each syscall.jilles2016-06-015-8/+29
* Document behavior of wait introduced in the r286698.oshogbo2016-06-011-1/+9
* Mark jail(2), and the sysctls that it (and only it) uses as deprecated.jamie2016-05-301-1/+1
* _umtx_op(2): Note deprecation of UMTX_OP_MUTEX_WAKE.jilles2016-05-291-1/+15
* _umtx_op(2),thr_*(2): Various spelling, grammar and mdoc fixes.jilles2016-05-296-60/+73
* vfork(2): Mention some risks of calling vfork() from application code.jilles2016-05-221-12/+28
* Document _umtx_op(2) interface for the implementation of robust mutexes.kib2016-05-191-12/+183
* Add thr*.2 and _umtx_op.2 manpages to the build.kib2016-05-141-1/+8
* Document the non-obsoleted kernel interfaces used by libthr.kib2016-05-146-0/+1858
* Correct wording.kib2016-05-031-1/+1
* Add EVFILT_VNODE open, read and close notifications.kib2016-05-031-8/+26
* Issue NOTE_EXTEND when a directory entry is added to or removed fromkib2016-05-021-2/+8
* As a reader service, explain NOTE_LINK reporting for the directories.kib2016-05-011-0/+4
* Provide an example to the kqueue man page, showingbcr2016-05-011-1/+52
* libc: spelling fixes.pfg2016-04-301-1/+1
* Document KTRFAC_FAULT and KTRFAC_FAULTEND.brooks2016-03-311-1/+3
* Fix bunch of .Xrs.trasz2016-03-281-1/+1
* Fully handle size_t lengths in AIO requests.jhb2016-03-212-4/+4
* Use the right argumant namejulian2016-03-181-1/+1
* Remove Symbol.map entries for old AIO system calls for FreeBSD 6 compat.jhb2016-03-121-9/+0
* Fix spelling of MAXNAMLEN.trasz2016-03-091-2/+2
* kenv(8) -> kenv(1)trasz2016-02-291-1/+1
* sysconf(2) -> sysconf(3)trasz2016-02-291-1/+1
* Bump .Dd for r295764bjk2016-02-181-3/+3
* Right now, the "virtual hole" API feature of lseek(2) is very vaguelysobomax2016-02-181-4/+12
* Remove man page references to rndassociates.com, which has been taken overjamie2016-02-101-1/+0
* If libthr.so is dlopened without RTLD_GLOBAL flag, the libthr symbolskib2016-02-081-0/+1
* semget(2): Add missing [EINVAL] conditions.jilles2016-02-071-1/+12
* - connect(2) Clarify namelenjgh2016-02-041-1/+9
* Add implementations of sendmmsg(3) and recvmmsg(3) functions whichkib2016-01-293-20/+135
* Restore flushing of output for revoke(2) again. Document revoke()'skib2016-01-261-2/+6
* mdoc: sort Xrjoel2016-01-181-1/+1
* utimensat(2): Correct description of [EINVAL] error.jilles2016-01-171-3/+6
* - Add the 'restrict' type qualifier to match function prototype.kevlo2016-01-141-4/+3
* Update futimens/utimensat for MFC to stable/10:jilles2016-01-123-4/+10
* New sendfile(2) syscall. A joint effort of NGINX and Netflix from 2013 andglebius2016-01-081-32/+91
* Document the recently added support for ptrace(2) LWP events.jhb2015-12-301-1/+38
* Verify that tv_sec value specified in settimeofday() and clock_settime()dchagin2015-12-272-2/+8
OpenPOWER on IntegriCloud