summaryrefslogtreecommitdiffstats
path: root/lib/libc
Commit message (Expand)AuthorAgeFilesLines
* MFC r304285:kib2017-05-0910-113/+130
* Discard first 3072 bytes of RC4 keystream, this is a bandaiddelphij2017-03-251-1/+1
* Merge r309688: address regressions in SA-16:37.libc.glebius2016-12-071-6/+5
* Fix possible login(1) argument injection in telnetd(8). [SA-16:36]glebius2016-12-061-17/+34
* MF11 304617: Fix various nits in the aio operation manpages.jhb2016-08-224-26/+15
* MFC r303794:kib2016-08-2210-2/+458
* MFS r304512:bdrewery2016-08-201-6/+0
* MFC r303687:bdrewery2016-08-081-0/+1
* MFC r303486:ed2016-08-052-7/+16
* MFC r303104, r303106:brooks2016-08-031-2/+21
* MFC 303164: Add more documentation regarding unsafe AIO requests.jhb2016-07-284-20/+16
* MFC r303046:pfg2016-07-261-12/+12
* MFC 302899: Add documentation for the sigevent structure.jhb2016-07-257-22/+175
* MFC: r302916bapt2016-07-201-1/+5
* fcntl(2): Document interrupt/restart for file locks.jilles2016-07-071-1/+22
* Fix a bad test resulting in a segfault with ISO-8859-5 localesbapt2016-07-031-1/+1
* Use on crypto.x and rpc.x from the source tree.bdrewery2016-06-282-2/+2
* This commit addresses regression introduceded in r302177cy2016-06-281-0/+14
* Replace use of the pipe(2) system call with pipe2(2) with a zero flagsbrooks2016-06-2220-457/+29
* Fix regression from r301461.pfg2016-06-101-3/+3
* libc/rpc: Make use of some xdr_* macros. (part 2)pfg2016-06-093-19/+19
* utimes(2),utime(3): Add deprecation in favour of utimensat(2) and futimens(2).jilles2016-06-092-4/+19
* libc/rpc: Make use of some xdr_* macros.pfg2016-06-092-7/+7
* Fix the rpcb_getaddr() definition to match its declaration.kevlo2016-06-091-1/+1
* Implement an NSS backend for netgroups and add getnetgrent_r(3).markj2016-06-093-115/+470
* Fix an infinite loop in setnetgrent(3) with NIS netgroups.markj2016-06-091-0/+4
* Use a more common spelling for "(char *)0" in the getnetgrent man page.markj2016-06-091-2/+2
* Revert r301707ngie2016-06-081-2/+2
* Use NULL instead of `0` in _ht_getnetbyname(..)ngie2016-06-081-2/+2
* Test for strchr(3) returning NULL, not 0ngie2016-06-081-1/+1
* Update to a June 8th snapshot of (un)vis form NetBSD.brooks2016-06-081-0/+1
* Don't leak olinep if malloc() fails.truckman2016-06-081-0/+2
* Don't leak addrinfo if ai->ai_addrlen <= minsiz test fails.truckman2016-06-081-12/+13
* Introduce the PD_CLOEXEC for pdfork(2).oshogbo2016-06-081-1/+5
* libc/locale: Fix type breakage in __collate_range_cmp().pfg2016-06-055-11/+25
* Reflect error indication according to POSIX and what those functionsache2016-06-051-2/+2
* Fix markup.kib2016-06-041-1/+1
* Improve errno documentation in pthread_create(3) and thr_new(2)vangyzen2016-06-032-4/+11
* citrus: Remove redundant code in _citrus_esdb_get_list().pfg2016-06-021-12/+6
* thr_*(2): Add xrefs to what libthr implements using each syscall.jilles2016-06-015-8/+29
* Document behavior of wait introduced in the r286698.oshogbo2016-06-011-1/+9
* Don't use fixup for C99 and up, the compiler result is already correct.ache2016-06-014-0/+8
* For EILSEQ case in mbsnrtowcs() and wcsnrtombs() update src to point toache2016-05-312-0/+3
* Fix prototype of dbm_open().ed2016-05-312-2/+2
* Let dbm's datum::dptr use the right type.ed2016-05-301-2/+2
* Fix the signature of the psignal() function.ed2016-05-302-4/+4
* Mark jail(2), and the sysctls that it (and only it) uses as deprecated.jamie2016-05-301-1/+1
* Micro optimize: C standard guarantees that right shift for unsigned valueache2016-05-291-1/+1
* _umtx_op(2): Note deprecation of UMTX_OP_MUTEX_WAKE.jilles2016-05-291-1/+15
* _umtx_op(2),thr_*(2): Various spelling, grammar and mdoc fixes.jilles2016-05-296-60/+73
OpenPOWER on IntegriCloud