diff options
Diffstat (limited to 'bindings/python')
-rw-r--r-- | bindings/python/python.i | 7 | ||||
-rw-r--r-- | bindings/python/tinyWRAP.py | 2148 | ||||
-rw-r--r-- | bindings/python/tinyWRAP_wrap.cxx | 28268 | ||||
-rw-r--r-- | bindings/python/tinyWRAP_wrap.h | 495 |
4 files changed, 30918 insertions, 0 deletions
diff --git a/bindings/python/python.i b/bindings/python/python.i new file mode 100644 index 0000000..390e054 --- /dev/null +++ b/bindings/python/python.i @@ -0,0 +1,7 @@ +/* File : python.i */ + +/* http://www.swig.org/Doc1.3/Library.html#Library_carrays +* 8.3.2 Passing binary data */ +%apply (char *STRING, int LENGTH) { (const void* buffer, int len) }; + +%include ../_common/tinyWRAP.i diff --git a/bindings/python/tinyWRAP.py b/bindings/python/tinyWRAP.py new file mode 100644 index 0000000..f08ac2e --- /dev/null +++ b/bindings/python/tinyWRAP.py @@ -0,0 +1,2148 @@ +# This file was automatically generated by SWIG (http://www.swig.org). +# Version 2.0.9 +# +# Do not make changes to this file unless you know what you are doing--modify +# the SWIG interface file instead. + + + +from sys import version_info +if version_info >= (2,6,0): + def swig_import_helper(): + from os.path import dirname + import imp + fp = None + try: + fp, pathname, description = imp.find_module('_tinyWRAP', [dirname(__file__)]) + except ImportError: + import _tinyWRAP + return _tinyWRAP + if fp is not None: + try: + _mod = imp.load_module('_tinyWRAP', fp, pathname, description) + finally: + fp.close() + return _mod + _tinyWRAP = swig_import_helper() + del swig_import_helper +else: + import _tinyWRAP +del version_info +try: + _swig_property = property +except NameError: + pass # Python < 2.2 doesn't have 'property'. +def _swig_setattr_nondynamic(self,class_type,name,value,static=1): + if (name == "thisown"): return self.this.own(value) + if (name == "this"): + if type(value).__name__ == 'SwigPyObject': + self.__dict__[name] = value + return + method = class_type.__swig_setmethods__.get(name,None) + if method: return method(self,value) + if (not static): + self.__dict__[name] = value + else: + raise AttributeError("You cannot add attributes to %s" % self) + +def _swig_setattr(self,class_type,name,value): + return _swig_setattr_nondynamic(self,class_type,name,value,0) + +def _swig_getattr(self,class_type,name): + if (name == "thisown"): return self.this.own() + method = class_type.__swig_getmethods__.get(name,None) + if method: return method(self) + raise AttributeError(name) + +def _swig_repr(self): + try: strthis = "proxy of " + self.this.__repr__() + except: strthis = "" + return "<%s.%s; %s >" % (self.__class__.__module__, self.__class__.__name__, strthis,) + +try: + _object = object + _newclass = 1 +except AttributeError: + class _object : pass + _newclass = 0 + + +try: + import weakref + weakref_proxy = weakref.proxy +except: + weakref_proxy = lambda x: x + + +class DDebugCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, DDebugCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, DDebugCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == DDebugCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_DDebugCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_DDebugCallback + __del__ = lambda self : None; + def OnDebugInfo(self, *args): return _tinyWRAP.DDebugCallback_OnDebugInfo(self, *args) + def OnDebugWarn(self, *args): return _tinyWRAP.DDebugCallback_OnDebugWarn(self, *args) + def OnDebugError(self, *args): return _tinyWRAP.DDebugCallback_OnDebugError(self, *args) + def OnDebugFatal(self, *args): return _tinyWRAP.DDebugCallback_OnDebugFatal(self, *args) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_DDebugCallback(self) + return weakref_proxy(self) +DDebugCallback_swigregister = _tinyWRAP.DDebugCallback_swigregister +DDebugCallback_swigregister(DDebugCallback) + +class AudioResampler(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, AudioResampler, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, AudioResampler, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_AudioResampler(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_AudioResampler + __del__ = lambda self : None; + def isValid(self): return _tinyWRAP.AudioResampler_isValid(self) + def getOutputRequiredSizeInShort(self): return _tinyWRAP.AudioResampler_getOutputRequiredSizeInShort(self) + def getInputRequiredSizeInShort(self): return _tinyWRAP.AudioResampler_getInputRequiredSizeInShort(self) + def process(self, *args): return _tinyWRAP.AudioResampler_process(self, *args) +AudioResampler_swigregister = _tinyWRAP.AudioResampler_swigregister +AudioResampler_swigregister(AudioResampler) + +twrap_media_none = _tinyWRAP.twrap_media_none +twrap_media_audio = _tinyWRAP.twrap_media_audio +twrap_media_video = _tinyWRAP.twrap_media_video +twrap_media_msrp = _tinyWRAP.twrap_media_msrp +twrap_media_t140 = _tinyWRAP.twrap_media_t140 +twrap_media_bfcp = _tinyWRAP.twrap_media_bfcp +twrap_media_bfcp_audio = _tinyWRAP.twrap_media_bfcp_audio +twrap_media_bfcp_video = _tinyWRAP.twrap_media_bfcp_video +twrap_media_audiovideo = _tinyWRAP.twrap_media_audiovideo +twrap_media_audio_video = _tinyWRAP.twrap_media_audio_video +class ActionConfig(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ActionConfig, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ActionConfig, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_ActionConfig() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_ActionConfig + __del__ = lambda self : None; + def addHeader(self, *args): return _tinyWRAP.ActionConfig_addHeader(self, *args) + def addPayload(self, *args): return _tinyWRAP.ActionConfig_addPayload(self, *args) + def setActiveMedia(self, *args): return _tinyWRAP.ActionConfig_setActiveMedia(self, *args) + def setResponseLine(self, *args): return _tinyWRAP.ActionConfig_setResponseLine(self, *args) + def setMediaString(self, *args): return _tinyWRAP.ActionConfig_setMediaString(self, *args) + def setMediaInt(self, *args): return _tinyWRAP.ActionConfig_setMediaInt(self, *args) +ActionConfig_swigregister = _tinyWRAP.ActionConfig_swigregister +ActionConfig_swigregister(ActionConfig) + +class Codec(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, Codec, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, Codec, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_Codec + __del__ = lambda self : None; + def getMediaType(self): return _tinyWRAP.Codec_getMediaType(self) + def getName(self): return _tinyWRAP.Codec_getName(self) + def getDescription(self): return _tinyWRAP.Codec_getDescription(self) + def getNegFormat(self): return _tinyWRAP.Codec_getNegFormat(self) + def getAudioSamplingRate(self): return _tinyWRAP.Codec_getAudioSamplingRate(self) + def getAudioChannels(self): return _tinyWRAP.Codec_getAudioChannels(self) + def getAudioPTime(self): return _tinyWRAP.Codec_getAudioPTime(self) +Codec_swigregister = _tinyWRAP.Codec_swigregister +Codec_swigregister(Codec) + +class MediaSessionMgr(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, MediaSessionMgr, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, MediaSessionMgr, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_MediaSessionMgr + __del__ = lambda self : None; + def sessionSetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_sessionSetInt32(self, *args) + def sessionGetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_sessionGetInt32(self, *args) + def consumerSetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_consumerSetInt32(self, *args) + def consumerSetInt64(self, *args): return _tinyWRAP.MediaSessionMgr_consumerSetInt64(self, *args) + def producerSetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_producerSetInt32(self, *args) + def producerSetInt64(self, *args): return _tinyWRAP.MediaSessionMgr_producerSetInt64(self, *args) + def producerGetCodec(self, *args): return _tinyWRAP.MediaSessionMgr_producerGetCodec(self, *args) + def findProxyPluginConsumer(self, *args): return _tinyWRAP.MediaSessionMgr_findProxyPluginConsumer(self, *args) + def findProxyPluginProducer(self, *args): return _tinyWRAP.MediaSessionMgr_findProxyPluginProducer(self, *args) + __swig_getmethods__["registerAudioPluginFromFile"] = lambda x: _tinyWRAP.MediaSessionMgr_registerAudioPluginFromFile + if _newclass:registerAudioPluginFromFile = staticmethod(_tinyWRAP.MediaSessionMgr_registerAudioPluginFromFile) + def getSessionId(self, *args): return _tinyWRAP.MediaSessionMgr_getSessionId(self, *args) + __swig_getmethods__["defaultsSetProfile"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetProfile + if _newclass:defaultsSetProfile = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetProfile) + __swig_getmethods__["defaultsGetProfile"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetProfile + if _newclass:defaultsGetProfile = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetProfile) + __swig_getmethods__["defaultsSetBandwidthLevel"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthLevel + if _newclass:defaultsSetBandwidthLevel = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetBandwidthLevel) + __swig_getmethods__["defaultsGetBandwidthLevel"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetBandwidthLevel + if _newclass:defaultsGetBandwidthLevel = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetBandwidthLevel) + __swig_getmethods__["defaultsSetCongestionCtrlEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetCongestionCtrlEnabled + if _newclass:defaultsSetCongestionCtrlEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetCongestionCtrlEnabled) + __swig_getmethods__["defaultsSetVideoMotionRank"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetVideoMotionRank + if _newclass:defaultsSetVideoMotionRank = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetVideoMotionRank) + __swig_getmethods__["defaultsSetVideoFps"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetVideoFps + if _newclass:defaultsSetVideoFps = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetVideoFps) + __swig_getmethods__["defaultsSetBandwidthVideoUploadMax"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoUploadMax + if _newclass:defaultsSetBandwidthVideoUploadMax = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoUploadMax) + __swig_getmethods__["defaultsSetBandwidthVideoDownloadMax"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax + if _newclass:defaultsSetBandwidthVideoDownloadMax = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax) + __swig_getmethods__["defaultsSetPrefVideoSize"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetPrefVideoSize + if _newclass:defaultsSetPrefVideoSize = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetPrefVideoSize) + __swig_getmethods__["defaultsSetJbMargin"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetJbMargin + if _newclass:defaultsSetJbMargin = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetJbMargin) + __swig_getmethods__["defaultsSetJbMaxLateRate"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetJbMaxLateRate + if _newclass:defaultsSetJbMaxLateRate = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetJbMaxLateRate) + __swig_getmethods__["defaultsSetEchoTail"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetEchoTail + if _newclass:defaultsSetEchoTail = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetEchoTail) + __swig_getmethods__["defaultsGetEchoTail"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetEchoTail + if _newclass:defaultsGetEchoTail = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetEchoTail) + __swig_getmethods__["defaultsSetEchoSkew"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetEchoSkew + if _newclass:defaultsSetEchoSkew = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetEchoSkew) + __swig_getmethods__["defaultsSetEchoSuppEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetEchoSuppEnabled + if _newclass:defaultsSetEchoSuppEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetEchoSuppEnabled) + __swig_getmethods__["defaultsGetEchoSuppEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetEchoSuppEnabled + if _newclass:defaultsGetEchoSuppEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetEchoSuppEnabled) + __swig_getmethods__["defaultsSetAgcEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAgcEnabled + if _newclass:defaultsSetAgcEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAgcEnabled) + __swig_getmethods__["defaultsGetAgcEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetAgcEnabled + if _newclass:defaultsGetAgcEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetAgcEnabled) + __swig_getmethods__["defaultsSetAgcLevel"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAgcLevel + if _newclass:defaultsSetAgcLevel = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAgcLevel) + __swig_getmethods__["defaultsGetAgcLevel"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetAgcLevel + if _newclass:defaultsGetAgcLevel = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetAgcLevel) + __swig_getmethods__["defaultsSetVadEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetVadEnabled + if _newclass:defaultsSetVadEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetVadEnabled) + __swig_getmethods__["defaultsGetGetVadEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetGetVadEnabled + if _newclass:defaultsGetGetVadEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetGetVadEnabled) + __swig_getmethods__["defaultsSetNoiseSuppEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppEnabled + if _newclass:defaultsSetNoiseSuppEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppEnabled) + __swig_getmethods__["defaultsGetNoiseSuppEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppEnabled + if _newclass:defaultsGetNoiseSuppEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppEnabled) + __swig_getmethods__["defaultsSetNoiseSuppLevel"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppLevel + if _newclass:defaultsSetNoiseSuppLevel = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppLevel) + __swig_getmethods__["defaultsGetNoiseSuppLevel"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppLevel + if _newclass:defaultsGetNoiseSuppLevel = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppLevel) + __swig_getmethods__["defaultsSet100relEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSet100relEnabled + if _newclass:defaultsSet100relEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSet100relEnabled) + __swig_getmethods__["defaultsGet100relEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGet100relEnabled + if _newclass:defaultsGet100relEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGet100relEnabled) + __swig_getmethods__["defaultsSetScreenSize"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetScreenSize + if _newclass:defaultsSetScreenSize = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetScreenSize) + __swig_getmethods__["defaultsSetAudioGain"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAudioGain + if _newclass:defaultsSetAudioGain = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAudioGain) + __swig_getmethods__["defaultsSetAudioPtime"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAudioPtime + if _newclass:defaultsSetAudioPtime = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAudioPtime) + __swig_getmethods__["defaultsSetAudioChannels"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAudioChannels + if _newclass:defaultsSetAudioChannels = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAudioChannels) + __swig_getmethods__["defaultsSetRtpPortRange"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetRtpPortRange + if _newclass:defaultsSetRtpPortRange = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetRtpPortRange) + __swig_getmethods__["defaultsSetRtpSymetricEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetRtpSymetricEnabled + if _newclass:defaultsSetRtpSymetricEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetRtpSymetricEnabled) + __swig_getmethods__["defaultsSetMediaType"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetMediaType + if _newclass:defaultsSetMediaType = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetMediaType) + __swig_getmethods__["defaultsSetVolume"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetVolume + if _newclass:defaultsSetVolume = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetVolume) + __swig_getmethods__["defaultsGetVolume"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetVolume + if _newclass:defaultsGetVolume = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetVolume) + __swig_getmethods__["defaultsSetInviteSessionTimers"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetInviteSessionTimers + if _newclass:defaultsSetInviteSessionTimers = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetInviteSessionTimers) + __swig_getmethods__["defaultsSetSRtpMode"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetSRtpMode + if _newclass:defaultsSetSRtpMode = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetSRtpMode) + __swig_getmethods__["defaultsGetSRtpMode"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetSRtpMode + if _newclass:defaultsGetSRtpMode = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetSRtpMode) + __swig_getmethods__["defaultsSetSRtpType"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetSRtpType + if _newclass:defaultsSetSRtpType = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetSRtpType) + __swig_getmethods__["defaultsGetSRtpType"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetSRtpType + if _newclass:defaultsGetSRtpType = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetSRtpType) + __swig_getmethods__["defaultsSetRtcpEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetRtcpEnabled + if _newclass:defaultsSetRtcpEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetRtcpEnabled) + __swig_getmethods__["defaultsGetRtcpEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetRtcpEnabled + if _newclass:defaultsGetRtcpEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetRtcpEnabled) + __swig_getmethods__["defaultsSetRtcpMuxEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetRtcpMuxEnabled + if _newclass:defaultsSetRtcpMuxEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetRtcpMuxEnabled) + __swig_getmethods__["defaultsGetRtcpMuxEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetRtcpMuxEnabled + if _newclass:defaultsGetRtcpMuxEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetRtcpMuxEnabled) + __swig_getmethods__["defaultsSetStunEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetStunEnabled + if _newclass:defaultsSetStunEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetStunEnabled) + __swig_getmethods__["defaultsSetIceStunEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetIceStunEnabled + if _newclass:defaultsSetIceStunEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetIceStunEnabled) + __swig_getmethods__["defaultsSetIceTurnEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetIceTurnEnabled + if _newclass:defaultsSetIceTurnEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetIceTurnEnabled) + __swig_getmethods__["defaultsSetStunServer"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetStunServer + if _newclass:defaultsSetStunServer = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetStunServer) + __swig_getmethods__["defaultsSetStunCred"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetStunCred + if _newclass:defaultsSetStunCred = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetStunCred) + __swig_getmethods__["defaultsSetIceEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetIceEnabled + if _newclass:defaultsSetIceEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetIceEnabled) + __swig_getmethods__["defaultsSetByPassEncoding"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetByPassEncoding + if _newclass:defaultsSetByPassEncoding = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetByPassEncoding) + __swig_getmethods__["defaultsGetByPassEncoding"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetByPassEncoding + if _newclass:defaultsGetByPassEncoding = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetByPassEncoding) + __swig_getmethods__["defaultsSetByPassDecoding"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetByPassDecoding + if _newclass:defaultsSetByPassDecoding = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetByPassDecoding) + __swig_getmethods__["defaultsGetByPassDecoding"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetByPassDecoding + if _newclass:defaultsGetByPassDecoding = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetByPassDecoding) + __swig_getmethods__["defaultsSetVideoJbEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetVideoJbEnabled + if _newclass:defaultsSetVideoJbEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetVideoJbEnabled) + __swig_getmethods__["defaultsGetVideoJbEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetVideoJbEnabled + if _newclass:defaultsGetVideoJbEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetVideoJbEnabled) + __swig_getmethods__["defaultsSetVideoZeroArtifactsEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled + if _newclass:defaultsSetVideoZeroArtifactsEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled) + __swig_getmethods__["defaultsGetVideoZeroArtifactsEnabled"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled + if _newclass:defaultsGetVideoZeroArtifactsEnabled = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled) + __swig_getmethods__["defaultsSetRtpBuffSize"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetRtpBuffSize + if _newclass:defaultsSetRtpBuffSize = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetRtpBuffSize) + __swig_getmethods__["defaultsGetRtpBuffSize"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsGetRtpBuffSize + if _newclass:defaultsGetRtpBuffSize = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsGetRtpBuffSize) + __swig_getmethods__["defaultsSetAvpfTail"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAvpfTail + if _newclass:defaultsSetAvpfTail = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAvpfTail) + __swig_getmethods__["defaultsSetAvpfMode"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetAvpfMode + if _newclass:defaultsSetAvpfMode = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetAvpfMode) + __swig_getmethods__["defaultsSetOpusMaxCaptureRate"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxCaptureRate + if _newclass:defaultsSetOpusMaxCaptureRate = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxCaptureRate) + __swig_getmethods__["defaultsSetOpusMaxPlaybackRate"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxPlaybackRate + if _newclass:defaultsSetOpusMaxPlaybackRate = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxPlaybackRate) + __swig_getmethods__["defaultsSetMaxFds"] = lambda x: _tinyWRAP.MediaSessionMgr_defaultsSetMaxFds + if _newclass:defaultsSetMaxFds = staticmethod(_tinyWRAP.MediaSessionMgr_defaultsSetMaxFds) +MediaSessionMgr_swigregister = _tinyWRAP.MediaSessionMgr_swigregister +MediaSessionMgr_swigregister(MediaSessionMgr) + +def MediaSessionMgr_registerAudioPluginFromFile(*args): + return _tinyWRAP.MediaSessionMgr_registerAudioPluginFromFile(*args) +MediaSessionMgr_registerAudioPluginFromFile = _tinyWRAP.MediaSessionMgr_registerAudioPluginFromFile + +def MediaSessionMgr_defaultsSetProfile(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetProfile(*args) +MediaSessionMgr_defaultsSetProfile = _tinyWRAP.MediaSessionMgr_defaultsSetProfile + +def MediaSessionMgr_defaultsGetProfile(): + return _tinyWRAP.MediaSessionMgr_defaultsGetProfile() +MediaSessionMgr_defaultsGetProfile = _tinyWRAP.MediaSessionMgr_defaultsGetProfile + +def MediaSessionMgr_defaultsSetBandwidthLevel(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthLevel(*args) +MediaSessionMgr_defaultsSetBandwidthLevel = _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthLevel + +def MediaSessionMgr_defaultsGetBandwidthLevel(): + return _tinyWRAP.MediaSessionMgr_defaultsGetBandwidthLevel() +MediaSessionMgr_defaultsGetBandwidthLevel = _tinyWRAP.MediaSessionMgr_defaultsGetBandwidthLevel + +def MediaSessionMgr_defaultsSetCongestionCtrlEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetCongestionCtrlEnabled(*args) +MediaSessionMgr_defaultsSetCongestionCtrlEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetCongestionCtrlEnabled + +def MediaSessionMgr_defaultsSetVideoMotionRank(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetVideoMotionRank(*args) +MediaSessionMgr_defaultsSetVideoMotionRank = _tinyWRAP.MediaSessionMgr_defaultsSetVideoMotionRank + +def MediaSessionMgr_defaultsSetVideoFps(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetVideoFps(*args) +MediaSessionMgr_defaultsSetVideoFps = _tinyWRAP.MediaSessionMgr_defaultsSetVideoFps + +def MediaSessionMgr_defaultsSetBandwidthVideoUploadMax(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoUploadMax(*args) +MediaSessionMgr_defaultsSetBandwidthVideoUploadMax = _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoUploadMax + +def MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax(*args) +MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax = _tinyWRAP.MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax + +def MediaSessionMgr_defaultsSetPrefVideoSize(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetPrefVideoSize(*args) +MediaSessionMgr_defaultsSetPrefVideoSize = _tinyWRAP.MediaSessionMgr_defaultsSetPrefVideoSize + +def MediaSessionMgr_defaultsSetJbMargin(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetJbMargin(*args) +MediaSessionMgr_defaultsSetJbMargin = _tinyWRAP.MediaSessionMgr_defaultsSetJbMargin + +def MediaSessionMgr_defaultsSetJbMaxLateRate(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetJbMaxLateRate(*args) +MediaSessionMgr_defaultsSetJbMaxLateRate = _tinyWRAP.MediaSessionMgr_defaultsSetJbMaxLateRate + +def MediaSessionMgr_defaultsSetEchoTail(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetEchoTail(*args) +MediaSessionMgr_defaultsSetEchoTail = _tinyWRAP.MediaSessionMgr_defaultsSetEchoTail + +def MediaSessionMgr_defaultsGetEchoTail(): + return _tinyWRAP.MediaSessionMgr_defaultsGetEchoTail() +MediaSessionMgr_defaultsGetEchoTail = _tinyWRAP.MediaSessionMgr_defaultsGetEchoTail + +def MediaSessionMgr_defaultsSetEchoSkew(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetEchoSkew(*args) +MediaSessionMgr_defaultsSetEchoSkew = _tinyWRAP.MediaSessionMgr_defaultsSetEchoSkew + +def MediaSessionMgr_defaultsSetEchoSuppEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetEchoSuppEnabled(*args) +MediaSessionMgr_defaultsSetEchoSuppEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetEchoSuppEnabled + +def MediaSessionMgr_defaultsGetEchoSuppEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetEchoSuppEnabled() +MediaSessionMgr_defaultsGetEchoSuppEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetEchoSuppEnabled + +def MediaSessionMgr_defaultsSetAgcEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAgcEnabled(*args) +MediaSessionMgr_defaultsSetAgcEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetAgcEnabled + +def MediaSessionMgr_defaultsGetAgcEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetAgcEnabled() +MediaSessionMgr_defaultsGetAgcEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetAgcEnabled + +def MediaSessionMgr_defaultsSetAgcLevel(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAgcLevel(*args) +MediaSessionMgr_defaultsSetAgcLevel = _tinyWRAP.MediaSessionMgr_defaultsSetAgcLevel + +def MediaSessionMgr_defaultsGetAgcLevel(): + return _tinyWRAP.MediaSessionMgr_defaultsGetAgcLevel() +MediaSessionMgr_defaultsGetAgcLevel = _tinyWRAP.MediaSessionMgr_defaultsGetAgcLevel + +def MediaSessionMgr_defaultsSetVadEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetVadEnabled(*args) +MediaSessionMgr_defaultsSetVadEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetVadEnabled + +def MediaSessionMgr_defaultsGetGetVadEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetGetVadEnabled() +MediaSessionMgr_defaultsGetGetVadEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetGetVadEnabled + +def MediaSessionMgr_defaultsSetNoiseSuppEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppEnabled(*args) +MediaSessionMgr_defaultsSetNoiseSuppEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppEnabled + +def MediaSessionMgr_defaultsGetNoiseSuppEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppEnabled() +MediaSessionMgr_defaultsGetNoiseSuppEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppEnabled + +def MediaSessionMgr_defaultsSetNoiseSuppLevel(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppLevel(*args) +MediaSessionMgr_defaultsSetNoiseSuppLevel = _tinyWRAP.MediaSessionMgr_defaultsSetNoiseSuppLevel + +def MediaSessionMgr_defaultsGetNoiseSuppLevel(): + return _tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppLevel() +MediaSessionMgr_defaultsGetNoiseSuppLevel = _tinyWRAP.MediaSessionMgr_defaultsGetNoiseSuppLevel + +def MediaSessionMgr_defaultsSet100relEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSet100relEnabled(*args) +MediaSessionMgr_defaultsSet100relEnabled = _tinyWRAP.MediaSessionMgr_defaultsSet100relEnabled + +def MediaSessionMgr_defaultsGet100relEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGet100relEnabled() +MediaSessionMgr_defaultsGet100relEnabled = _tinyWRAP.MediaSessionMgr_defaultsGet100relEnabled + +def MediaSessionMgr_defaultsSetScreenSize(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetScreenSize(*args) +MediaSessionMgr_defaultsSetScreenSize = _tinyWRAP.MediaSessionMgr_defaultsSetScreenSize + +def MediaSessionMgr_defaultsSetAudioGain(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAudioGain(*args) +MediaSessionMgr_defaultsSetAudioGain = _tinyWRAP.MediaSessionMgr_defaultsSetAudioGain + +def MediaSessionMgr_defaultsSetAudioPtime(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAudioPtime(*args) +MediaSessionMgr_defaultsSetAudioPtime = _tinyWRAP.MediaSessionMgr_defaultsSetAudioPtime + +def MediaSessionMgr_defaultsSetAudioChannels(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAudioChannels(*args) +MediaSessionMgr_defaultsSetAudioChannels = _tinyWRAP.MediaSessionMgr_defaultsSetAudioChannels + +def MediaSessionMgr_defaultsSetRtpPortRange(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetRtpPortRange(*args) +MediaSessionMgr_defaultsSetRtpPortRange = _tinyWRAP.MediaSessionMgr_defaultsSetRtpPortRange + +def MediaSessionMgr_defaultsSetRtpSymetricEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetRtpSymetricEnabled(*args) +MediaSessionMgr_defaultsSetRtpSymetricEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetRtpSymetricEnabled + +def MediaSessionMgr_defaultsSetMediaType(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetMediaType(*args) +MediaSessionMgr_defaultsSetMediaType = _tinyWRAP.MediaSessionMgr_defaultsSetMediaType + +def MediaSessionMgr_defaultsSetVolume(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetVolume(*args) +MediaSessionMgr_defaultsSetVolume = _tinyWRAP.MediaSessionMgr_defaultsSetVolume + +def MediaSessionMgr_defaultsGetVolume(): + return _tinyWRAP.MediaSessionMgr_defaultsGetVolume() +MediaSessionMgr_defaultsGetVolume = _tinyWRAP.MediaSessionMgr_defaultsGetVolume + +def MediaSessionMgr_defaultsSetInviteSessionTimers(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetInviteSessionTimers(*args) +MediaSessionMgr_defaultsSetInviteSessionTimers = _tinyWRAP.MediaSessionMgr_defaultsSetInviteSessionTimers + +def MediaSessionMgr_defaultsSetSRtpMode(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetSRtpMode(*args) +MediaSessionMgr_defaultsSetSRtpMode = _tinyWRAP.MediaSessionMgr_defaultsSetSRtpMode + +def MediaSessionMgr_defaultsGetSRtpMode(): + return _tinyWRAP.MediaSessionMgr_defaultsGetSRtpMode() +MediaSessionMgr_defaultsGetSRtpMode = _tinyWRAP.MediaSessionMgr_defaultsGetSRtpMode + +def MediaSessionMgr_defaultsSetSRtpType(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetSRtpType(*args) +MediaSessionMgr_defaultsSetSRtpType = _tinyWRAP.MediaSessionMgr_defaultsSetSRtpType + +def MediaSessionMgr_defaultsGetSRtpType(): + return _tinyWRAP.MediaSessionMgr_defaultsGetSRtpType() +MediaSessionMgr_defaultsGetSRtpType = _tinyWRAP.MediaSessionMgr_defaultsGetSRtpType + +def MediaSessionMgr_defaultsSetRtcpEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetRtcpEnabled(*args) +MediaSessionMgr_defaultsSetRtcpEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetRtcpEnabled + +def MediaSessionMgr_defaultsGetRtcpEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetRtcpEnabled() +MediaSessionMgr_defaultsGetRtcpEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetRtcpEnabled + +def MediaSessionMgr_defaultsSetRtcpMuxEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetRtcpMuxEnabled(*args) +MediaSessionMgr_defaultsSetRtcpMuxEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetRtcpMuxEnabled + +def MediaSessionMgr_defaultsGetRtcpMuxEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetRtcpMuxEnabled() +MediaSessionMgr_defaultsGetRtcpMuxEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetRtcpMuxEnabled + +def MediaSessionMgr_defaultsSetStunEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetStunEnabled(*args) +MediaSessionMgr_defaultsSetStunEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetStunEnabled + +def MediaSessionMgr_defaultsSetIceStunEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetIceStunEnabled(*args) +MediaSessionMgr_defaultsSetIceStunEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetIceStunEnabled + +def MediaSessionMgr_defaultsSetIceTurnEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetIceTurnEnabled(*args) +MediaSessionMgr_defaultsSetIceTurnEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetIceTurnEnabled + +def MediaSessionMgr_defaultsSetStunServer(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetStunServer(*args) +MediaSessionMgr_defaultsSetStunServer = _tinyWRAP.MediaSessionMgr_defaultsSetStunServer + +def MediaSessionMgr_defaultsSetStunCred(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetStunCred(*args) +MediaSessionMgr_defaultsSetStunCred = _tinyWRAP.MediaSessionMgr_defaultsSetStunCred + +def MediaSessionMgr_defaultsSetIceEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetIceEnabled(*args) +MediaSessionMgr_defaultsSetIceEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetIceEnabled + +def MediaSessionMgr_defaultsSetByPassEncoding(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetByPassEncoding(*args) +MediaSessionMgr_defaultsSetByPassEncoding = _tinyWRAP.MediaSessionMgr_defaultsSetByPassEncoding + +def MediaSessionMgr_defaultsGetByPassEncoding(): + return _tinyWRAP.MediaSessionMgr_defaultsGetByPassEncoding() +MediaSessionMgr_defaultsGetByPassEncoding = _tinyWRAP.MediaSessionMgr_defaultsGetByPassEncoding + +def MediaSessionMgr_defaultsSetByPassDecoding(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetByPassDecoding(*args) +MediaSessionMgr_defaultsSetByPassDecoding = _tinyWRAP.MediaSessionMgr_defaultsSetByPassDecoding + +def MediaSessionMgr_defaultsGetByPassDecoding(): + return _tinyWRAP.MediaSessionMgr_defaultsGetByPassDecoding() +MediaSessionMgr_defaultsGetByPassDecoding = _tinyWRAP.MediaSessionMgr_defaultsGetByPassDecoding + +def MediaSessionMgr_defaultsSetVideoJbEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetVideoJbEnabled(*args) +MediaSessionMgr_defaultsSetVideoJbEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetVideoJbEnabled + +def MediaSessionMgr_defaultsGetVideoJbEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetVideoJbEnabled() +MediaSessionMgr_defaultsGetVideoJbEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetVideoJbEnabled + +def MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled(*args) +MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled = _tinyWRAP.MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled + +def MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled(): + return _tinyWRAP.MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled() +MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled = _tinyWRAP.MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled + +def MediaSessionMgr_defaultsSetRtpBuffSize(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetRtpBuffSize(*args) +MediaSessionMgr_defaultsSetRtpBuffSize = _tinyWRAP.MediaSessionMgr_defaultsSetRtpBuffSize + +def MediaSessionMgr_defaultsGetRtpBuffSize(): + return _tinyWRAP.MediaSessionMgr_defaultsGetRtpBuffSize() +MediaSessionMgr_defaultsGetRtpBuffSize = _tinyWRAP.MediaSessionMgr_defaultsGetRtpBuffSize + +def MediaSessionMgr_defaultsSetAvpfTail(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAvpfTail(*args) +MediaSessionMgr_defaultsSetAvpfTail = _tinyWRAP.MediaSessionMgr_defaultsSetAvpfTail + +def MediaSessionMgr_defaultsSetAvpfMode(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetAvpfMode(*args) +MediaSessionMgr_defaultsSetAvpfMode = _tinyWRAP.MediaSessionMgr_defaultsSetAvpfMode + +def MediaSessionMgr_defaultsSetOpusMaxCaptureRate(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxCaptureRate(*args) +MediaSessionMgr_defaultsSetOpusMaxCaptureRate = _tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxCaptureRate + +def MediaSessionMgr_defaultsSetOpusMaxPlaybackRate(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxPlaybackRate(*args) +MediaSessionMgr_defaultsSetOpusMaxPlaybackRate = _tinyWRAP.MediaSessionMgr_defaultsSetOpusMaxPlaybackRate + +def MediaSessionMgr_defaultsSetMaxFds(*args): + return _tinyWRAP.MediaSessionMgr_defaultsSetMaxFds(*args) +MediaSessionMgr_defaultsSetMaxFds = _tinyWRAP.MediaSessionMgr_defaultsSetMaxFds + +class MediaContent(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, MediaContent, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, MediaContent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined - class is abstract") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_MediaContent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.MediaContent_getType(self) + def getDataLength(self): return _tinyWRAP.MediaContent_getDataLength(self) + def getData(self, *args): return _tinyWRAP.MediaContent_getData(self, *args) + __swig_getmethods__["parse"] = lambda x: _tinyWRAP.MediaContent_parse + if _newclass:parse = staticmethod(_tinyWRAP.MediaContent_parse) + def getPayloadLength(self): return _tinyWRAP.MediaContent_getPayloadLength(self) + def getPayload(self, *args): return _tinyWRAP.MediaContent_getPayload(self, *args) +MediaContent_swigregister = _tinyWRAP.MediaContent_swigregister +MediaContent_swigregister(MediaContent) + +def MediaContent_parse(*args): + return _tinyWRAP.MediaContent_parse(*args) +MediaContent_parse = _tinyWRAP.MediaContent_parse + +class MediaContentCPIM(MediaContent): + __swig_setmethods__ = {} + for _s in [MediaContent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, MediaContentCPIM, name, value) + __swig_getmethods__ = {} + for _s in [MediaContent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, MediaContentCPIM, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_MediaContentCPIM + __del__ = lambda self : None; + def getPayloadLength(self): return _tinyWRAP.MediaContentCPIM_getPayloadLength(self) + def getPayload(self, *args): return _tinyWRAP.MediaContentCPIM_getPayload(self, *args) + def getHeaderValue(self, *args): return _tinyWRAP.MediaContentCPIM_getHeaderValue(self, *args) +MediaContentCPIM_swigregister = _tinyWRAP.MediaContentCPIM_swigregister +MediaContentCPIM_swigregister(MediaContentCPIM) + +class SipUri(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SipUri, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SipUri, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_SipUri(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SipUri + __del__ = lambda self : None; + def isValid(self, *args): return _tinyWRAP.SipUri_isValid(self, *args) + def getScheme(self): return _tinyWRAP.SipUri_getScheme(self) + def getHost(self): return _tinyWRAP.SipUri_getHost(self) + def getPort(self): return _tinyWRAP.SipUri_getPort(self) + def getUserName(self): return _tinyWRAP.SipUri_getUserName(self) + def getPassword(self): return _tinyWRAP.SipUri_getPassword(self) + def getDisplayName(self): return _tinyWRAP.SipUri_getDisplayName(self) + def getParamValue(self, *args): return _tinyWRAP.SipUri_getParamValue(self, *args) + def setDisplayName(self, *args): return _tinyWRAP.SipUri_setDisplayName(self, *args) +SipUri_swigregister = _tinyWRAP.SipUri_swigregister +SipUri_swigregister(SipUri) + +class SdpMessage(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SdpMessage, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SdpMessage, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_SdpMessage() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SdpMessage + __del__ = lambda self : None; + def getSdpHeaderValue(self, *args): return _tinyWRAP.SdpMessage_getSdpHeaderValue(self, *args) + def getSdpHeaderAValue(self, *args): return _tinyWRAP.SdpMessage_getSdpHeaderAValue(self, *args) +SdpMessage_swigregister = _tinyWRAP.SdpMessage_swigregister +SdpMessage_swigregister(SdpMessage) + +class SipMessage(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SipMessage, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SipMessage, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_SipMessage() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SipMessage + __del__ = lambda self : None; + def isResponse(self): return _tinyWRAP.SipMessage_isResponse(self) + def getRequestType(self): return _tinyWRAP.SipMessage_getRequestType(self) + def getResponseCode(self): return _tinyWRAP.SipMessage_getResponseCode(self) + def getResponsePhrase(self): return _tinyWRAP.SipMessage_getResponsePhrase(self) + def getSipHeaderValue(self, *args): return _tinyWRAP.SipMessage_getSipHeaderValue(self, *args) + def getSipHeaderParamValue(self, *args): return _tinyWRAP.SipMessage_getSipHeaderParamValue(self, *args) + def getSipContentLength(self): return _tinyWRAP.SipMessage_getSipContentLength(self) + def getSipContent(self, *args): return _tinyWRAP.SipMessage_getSipContent(self, *args) + def getSdpMessage(self): return _tinyWRAP.SipMessage_getSdpMessage(self) +SipMessage_swigregister = _tinyWRAP.SipMessage_swigregister +SipMessage_swigregister(SipMessage) + +class SipEvent(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SipEvent, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SipEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_SipEvent + __del__ = lambda self : None; + def getCode(self): return _tinyWRAP.SipEvent_getCode(self) + def getPhrase(self): return _tinyWRAP.SipEvent_getPhrase(self) + def getBaseSession(self): return _tinyWRAP.SipEvent_getBaseSession(self) + def getSipMessage(self): return _tinyWRAP.SipEvent_getSipMessage(self) +SipEvent_swigregister = _tinyWRAP.SipEvent_swigregister +SipEvent_swigregister(SipEvent) + +class DialogEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, DialogEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, DialogEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_DialogEvent + __del__ = lambda self : None; +DialogEvent_swigregister = _tinyWRAP.DialogEvent_swigregister +DialogEvent_swigregister(DialogEvent) + +class StackEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, StackEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, StackEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_StackEvent + __del__ = lambda self : None; +StackEvent_swigregister = _tinyWRAP.StackEvent_swigregister +StackEvent_swigregister(StackEvent) + +class InviteEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, InviteEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, InviteEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_InviteEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.InviteEvent_getType(self) + def getMediaType(self): return _tinyWRAP.InviteEvent_getMediaType(self) + def getSession(self): return _tinyWRAP.InviteEvent_getSession(self) + def takeCallSessionOwnership(self): return _tinyWRAP.InviteEvent_takeCallSessionOwnership(self) + def takeMsrpSessionOwnership(self): return _tinyWRAP.InviteEvent_takeMsrpSessionOwnership(self) +InviteEvent_swigregister = _tinyWRAP.InviteEvent_swigregister +InviteEvent_swigregister(InviteEvent) + +class MessagingEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, MessagingEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, MessagingEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_MessagingEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.MessagingEvent_getType(self) + def getSession(self): return _tinyWRAP.MessagingEvent_getSession(self) + def takeSessionOwnership(self): return _tinyWRAP.MessagingEvent_takeSessionOwnership(self) +MessagingEvent_swigregister = _tinyWRAP.MessagingEvent_swigregister +MessagingEvent_swigregister(MessagingEvent) + +class InfoEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, InfoEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, InfoEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_InfoEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.InfoEvent_getType(self) + def getSession(self): return _tinyWRAP.InfoEvent_getSession(self) + def takeSessionOwnership(self): return _tinyWRAP.InfoEvent_takeSessionOwnership(self) +InfoEvent_swigregister = _tinyWRAP.InfoEvent_swigregister +InfoEvent_swigregister(InfoEvent) + +class OptionsEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, OptionsEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, OptionsEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_OptionsEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.OptionsEvent_getType(self) + def getSession(self): return _tinyWRAP.OptionsEvent_getSession(self) + def takeSessionOwnership(self): return _tinyWRAP.OptionsEvent_takeSessionOwnership(self) +OptionsEvent_swigregister = _tinyWRAP.OptionsEvent_swigregister +OptionsEvent_swigregister(OptionsEvent) + +class PublicationEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, PublicationEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, PublicationEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_PublicationEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.PublicationEvent_getType(self) + def getSession(self): return _tinyWRAP.PublicationEvent_getSession(self) + def takeSessionOwnership(self): return _tinyWRAP.PublicationEvent_takeSessionOwnership(self) +PublicationEvent_swigregister = _tinyWRAP.PublicationEvent_swigregister +PublicationEvent_swigregister(PublicationEvent) + +class RegistrationEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, RegistrationEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, RegistrationEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_RegistrationEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.RegistrationEvent_getType(self) + def getSession(self): return _tinyWRAP.RegistrationEvent_getSession(self) + def takeSessionOwnership(self): return _tinyWRAP.RegistrationEvent_takeSessionOwnership(self) +RegistrationEvent_swigregister = _tinyWRAP.RegistrationEvent_swigregister +RegistrationEvent_swigregister(RegistrationEvent) + +class SubscriptionEvent(SipEvent): + __swig_setmethods__ = {} + for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, SubscriptionEvent, name, value) + __swig_getmethods__ = {} + for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, SubscriptionEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_SubscriptionEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.SubscriptionEvent_getType(self) + def getSession(self): return _tinyWRAP.SubscriptionEvent_getSession(self) + def takeSessionOwnership(self): return _tinyWRAP.SubscriptionEvent_takeSessionOwnership(self) +SubscriptionEvent_swigregister = _tinyWRAP.SubscriptionEvent_swigregister +SubscriptionEvent_swigregister(SubscriptionEvent) + +class T140CallbackData(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, T140CallbackData, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, T140CallbackData, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_T140CallbackData + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.T140CallbackData_getType(self) + def getSize(self): return _tinyWRAP.T140CallbackData_getSize(self) + def getData(self, *args): return _tinyWRAP.T140CallbackData_getData(self, *args) +T140CallbackData_swigregister = _tinyWRAP.T140CallbackData_swigregister +T140CallbackData_swigregister(T140CallbackData) + +class T140Callback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, T140Callback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, T140Callback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == T140Callback: + _self = None + else: + _self = self + this = _tinyWRAP.new_T140Callback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_T140Callback + __del__ = lambda self : None; + def ondata(self, *args): return _tinyWRAP.T140Callback_ondata(self, *args) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_T140Callback(self) + return weakref_proxy(self) +T140Callback_swigregister = _tinyWRAP.T140Callback_swigregister +T140Callback_swigregister(T140Callback) + +class SipSession(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SipSession, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SipSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_SipSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SipSession + __del__ = lambda self : None; + def haveOwnership(self): return _tinyWRAP.SipSession_haveOwnership(self) + def addHeader(self, *args): return _tinyWRAP.SipSession_addHeader(self, *args) + def removeHeader(self, *args): return _tinyWRAP.SipSession_removeHeader(self, *args) + def addCaps(self, *args): return _tinyWRAP.SipSession_addCaps(self, *args) + def removeCaps(self, *args): return _tinyWRAP.SipSession_removeCaps(self, *args) + def setExpires(self, *args): return _tinyWRAP.SipSession_setExpires(self, *args) + def setFromUri(self, *args): return _tinyWRAP.SipSession_setFromUri(self, *args) + def setToUri(self, *args): return _tinyWRAP.SipSession_setToUri(self, *args) + def setSilentHangup(self, *args): return _tinyWRAP.SipSession_setSilentHangup(self, *args) + def addSigCompCompartment(self, *args): return _tinyWRAP.SipSession_addSigCompCompartment(self, *args) + def removeSigCompCompartment(self): return _tinyWRAP.SipSession_removeSigCompCompartment(self) + def getId(self): return _tinyWRAP.SipSession_getId(self) +SipSession_swigregister = _tinyWRAP.SipSession_swigregister +SipSession_swigregister(SipSession) + +class InviteSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, InviteSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, InviteSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_InviteSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_InviteSession + __del__ = lambda self : None; + def accept(self, *args): return _tinyWRAP.InviteSession_accept(self, *args) + def hangup(self, *args): return _tinyWRAP.InviteSession_hangup(self, *args) + def reject(self, *args): return _tinyWRAP.InviteSession_reject(self, *args) + def sendInfo(self, *args): return _tinyWRAP.InviteSession_sendInfo(self, *args) + def getMediaMgr(self): return _tinyWRAP.InviteSession_getMediaMgr(self) +InviteSession_swigregister = _tinyWRAP.InviteSession_swigregister +InviteSession_swigregister(InviteSession) + +class CallSession(InviteSession): + __swig_setmethods__ = {} + for _s in [InviteSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, CallSession, name, value) + __swig_getmethods__ = {} + for _s in [InviteSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, CallSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_CallSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_CallSession + __del__ = lambda self : None; + def callAudio(self, *args): return _tinyWRAP.CallSession_callAudio(self, *args) + def callAudioVideo(self, *args): return _tinyWRAP.CallSession_callAudioVideo(self, *args) + def callVideo(self, *args): return _tinyWRAP.CallSession_callVideo(self, *args) + def call(self, *args): return _tinyWRAP.CallSession_call(self, *args) + def setSessionTimer(self, *args): return _tinyWRAP.CallSession_setSessionTimer(self, *args) + def set100rel(self, *args): return _tinyWRAP.CallSession_set100rel(self, *args) + def setRtcp(self, *args): return _tinyWRAP.CallSession_setRtcp(self, *args) + def setRtcpMux(self, *args): return _tinyWRAP.CallSession_setRtcpMux(self, *args) + def setSRtpMode(self, *args): return _tinyWRAP.CallSession_setSRtpMode(self, *args) + def setAvpfMode(self, *args): return _tinyWRAP.CallSession_setAvpfMode(self, *args) + def setICE(self, *args): return _tinyWRAP.CallSession_setICE(self, *args) + def setICEStun(self, *args): return _tinyWRAP.CallSession_setICEStun(self, *args) + def setICETurn(self, *args): return _tinyWRAP.CallSession_setICETurn(self, *args) + def setSTUNServer(self, *args): return _tinyWRAP.CallSession_setSTUNServer(self, *args) + def setSTUNCred(self, *args): return _tinyWRAP.CallSession_setSTUNCred(self, *args) + def setVideoFps(self, *args): return _tinyWRAP.CallSession_setVideoFps(self, *args) + def setVideoBandwidthUploadMax(self, *args): return _tinyWRAP.CallSession_setVideoBandwidthUploadMax(self, *args) + def setVideoBandwidthDownloadMax(self, *args): return _tinyWRAP.CallSession_setVideoBandwidthDownloadMax(self, *args) + def setVideoPrefSize(self, *args): return _tinyWRAP.CallSession_setVideoPrefSize(self, *args) + def setQoS(self, *args): return _tinyWRAP.CallSession_setQoS(self, *args) + def hold(self, *args): return _tinyWRAP.CallSession_hold(self, *args) + def resume(self, *args): return _tinyWRAP.CallSession_resume(self, *args) + def transfer(self, *args): return _tinyWRAP.CallSession_transfer(self, *args) + def acceptTransfer(self, *args): return _tinyWRAP.CallSession_acceptTransfer(self, *args) + def rejectTransfer(self, *args): return _tinyWRAP.CallSession_rejectTransfer(self, *args) + def sendDTMF(self, *args): return _tinyWRAP.CallSession_sendDTMF(self, *args) + def getSessionTransferId(self): return _tinyWRAP.CallSession_getSessionTransferId(self) + def sendT140Data(self, *args): return _tinyWRAP.CallSession_sendT140Data(self, *args) + def setT140Callback(self, *args): return _tinyWRAP.CallSession_setT140Callback(self, *args) +CallSession_swigregister = _tinyWRAP.CallSession_swigregister +CallSession_swigregister(CallSession) + +class MsrpSession(InviteSession): + __swig_setmethods__ = {} + for _s in [InviteSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpSession, name, value) + __swig_getmethods__ = {} + for _s in [InviteSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, MsrpSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_MsrpSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_MsrpSession + __del__ = lambda self : None; + def setCallback(self, *args): return _tinyWRAP.MsrpSession_setCallback(self, *args) + def callMsrp(self, *args): return _tinyWRAP.MsrpSession_callMsrp(self, *args) + def sendMessage(self, *args): return _tinyWRAP.MsrpSession_sendMessage(self, *args) + def sendFile(self, *args): return _tinyWRAP.MsrpSession_sendFile(self, *args) +MsrpSession_swigregister = _tinyWRAP.MsrpSession_swigregister +MsrpSession_swigregister(MsrpSession) + +class MessagingSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, MessagingSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, MessagingSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_MessagingSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_MessagingSession + __del__ = lambda self : None; + def send(self, *args): return _tinyWRAP.MessagingSession_send(self, *args) + def accept(self, *args): return _tinyWRAP.MessagingSession_accept(self, *args) + def reject(self, *args): return _tinyWRAP.MessagingSession_reject(self, *args) +MessagingSession_swigregister = _tinyWRAP.MessagingSession_swigregister +MessagingSession_swigregister(MessagingSession) + +class InfoSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, InfoSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, InfoSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_InfoSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_InfoSession + __del__ = lambda self : None; + def send(self, *args): return _tinyWRAP.InfoSession_send(self, *args) + def accept(self, *args): return _tinyWRAP.InfoSession_accept(self, *args) + def reject(self, *args): return _tinyWRAP.InfoSession_reject(self, *args) +InfoSession_swigregister = _tinyWRAP.InfoSession_swigregister +InfoSession_swigregister(InfoSession) + +class OptionsSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, OptionsSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, OptionsSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_OptionsSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_OptionsSession + __del__ = lambda self : None; + def send(self, *args): return _tinyWRAP.OptionsSession_send(self, *args) + def accept(self, *args): return _tinyWRAP.OptionsSession_accept(self, *args) + def reject(self, *args): return _tinyWRAP.OptionsSession_reject(self, *args) +OptionsSession_swigregister = _tinyWRAP.OptionsSession_swigregister +OptionsSession_swigregister(OptionsSession) + +class PublicationSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, PublicationSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, PublicationSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_PublicationSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_PublicationSession + __del__ = lambda self : None; + def publish(self, *args): return _tinyWRAP.PublicationSession_publish(self, *args) + def unPublish(self, *args): return _tinyWRAP.PublicationSession_unPublish(self, *args) +PublicationSession_swigregister = _tinyWRAP.PublicationSession_swigregister +PublicationSession_swigregister(PublicationSession) + +class RegistrationSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, RegistrationSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, RegistrationSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_RegistrationSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_RegistrationSession + __del__ = lambda self : None; + def register_(self, *args): return _tinyWRAP.RegistrationSession_register_(self, *args) + def unRegister(self, *args): return _tinyWRAP.RegistrationSession_unRegister(self, *args) + def accept(self, *args): return _tinyWRAP.RegistrationSession_accept(self, *args) + def reject(self, *args): return _tinyWRAP.RegistrationSession_reject(self, *args) +RegistrationSession_swigregister = _tinyWRAP.RegistrationSession_swigregister +RegistrationSession_swigregister(RegistrationSession) + +class SubscriptionSession(SipSession): + __swig_setmethods__ = {} + for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, SubscriptionSession, name, value) + __swig_getmethods__ = {} + for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, SubscriptionSession, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_SubscriptionSession(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SubscriptionSession + __del__ = lambda self : None; + def subscribe(self): return _tinyWRAP.SubscriptionSession_subscribe(self) + def unSubscribe(self): return _tinyWRAP.SubscriptionSession_unSubscribe(self) +SubscriptionSession_swigregister = _tinyWRAP.SubscriptionSession_swigregister +SubscriptionSession_swigregister(SubscriptionSession) + +twrap_proxy_plugin_audio_producer = _tinyWRAP.twrap_proxy_plugin_audio_producer +twrap_proxy_plugin_video_producer = _tinyWRAP.twrap_proxy_plugin_video_producer +twrap_proxy_plugin_audio_consumer = _tinyWRAP.twrap_proxy_plugin_audio_consumer +twrap_proxy_plugin_video_consumer = _tinyWRAP.twrap_proxy_plugin_video_consumer +class ProxyPluginMgr(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyPluginMgr, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyPluginMgr, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyPluginMgr + __del__ = lambda self : None; + __swig_getmethods__["createInstance"] = lambda x: _tinyWRAP.ProxyPluginMgr_createInstance + if _newclass:createInstance = staticmethod(_tinyWRAP.ProxyPluginMgr_createInstance) + __swig_getmethods__["getInstance"] = lambda x: _tinyWRAP.ProxyPluginMgr_getInstance + if _newclass:getInstance = staticmethod(_tinyWRAP.ProxyPluginMgr_getInstance) + def findPlugin(self, *args): return _tinyWRAP.ProxyPluginMgr_findPlugin(self, *args) + def findAudioConsumer(self, *args): return _tinyWRAP.ProxyPluginMgr_findAudioConsumer(self, *args) + def findVideoConsumer(self, *args): return _tinyWRAP.ProxyPluginMgr_findVideoConsumer(self, *args) + def findAudioProducer(self, *args): return _tinyWRAP.ProxyPluginMgr_findAudioProducer(self, *args) + def findVideoProducer(self, *args): return _tinyWRAP.ProxyPluginMgr_findVideoProducer(self, *args) +ProxyPluginMgr_swigregister = _tinyWRAP.ProxyPluginMgr_swigregister +ProxyPluginMgr_swigregister(ProxyPluginMgr) + +def ProxyPluginMgr_createInstance(*args): + return _tinyWRAP.ProxyPluginMgr_createInstance(*args) +ProxyPluginMgr_createInstance = _tinyWRAP.ProxyPluginMgr_createInstance + +def ProxyPluginMgr_getInstance(): + return _tinyWRAP.ProxyPluginMgr_getInstance() +ProxyPluginMgr_getInstance = _tinyWRAP.ProxyPluginMgr_getInstance + +class ProxyPluginMgrCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyPluginMgrCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyPluginMgrCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == ProxyPluginMgrCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_ProxyPluginMgrCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_ProxyPluginMgrCallback + __del__ = lambda self : None; + def OnPluginCreated(self, *args): return _tinyWRAP.ProxyPluginMgrCallback_OnPluginCreated(self, *args) + def OnPluginDestroyed(self, *args): return _tinyWRAP.ProxyPluginMgrCallback_OnPluginDestroyed(self, *args) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_ProxyPluginMgrCallback(self) + return weakref_proxy(self) +ProxyPluginMgrCallback_swigregister = _tinyWRAP.ProxyPluginMgrCallback_swigregister +ProxyPluginMgrCallback_swigregister(ProxyPluginMgrCallback) + +class ProxyPlugin(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyPlugin, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyPlugin, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyPlugin + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.ProxyPlugin_getType(self) + def getId(self): return _tinyWRAP.ProxyPlugin_getId(self) +ProxyPlugin_swigregister = _tinyWRAP.ProxyPlugin_swigregister +ProxyPlugin_swigregister(ProxyPlugin) + +class ProxyAudioConsumerCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioConsumerCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioConsumerCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == ProxyAudioConsumerCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_ProxyAudioConsumerCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_ProxyAudioConsumerCallback + __del__ = lambda self : None; + def prepare(self, *args): return _tinyWRAP.ProxyAudioConsumerCallback_prepare(self, *args) + def start(self): return _tinyWRAP.ProxyAudioConsumerCallback_start(self) + def pause(self): return _tinyWRAP.ProxyAudioConsumerCallback_pause(self) + def stop(self): return _tinyWRAP.ProxyAudioConsumerCallback_stop(self) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_ProxyAudioConsumerCallback(self) + return weakref_proxy(self) +ProxyAudioConsumerCallback_swigregister = _tinyWRAP.ProxyAudioConsumerCallback_swigregister +ProxyAudioConsumerCallback_swigregister(ProxyAudioConsumerCallback) + +class ProxyAudioConsumer(ProxyPlugin): + __swig_setmethods__ = {} + for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioConsumer, name, value) + __swig_getmethods__ = {} + for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioConsumer, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyAudioConsumer + __del__ = lambda self : None; + def setActualSndCardPlaybackParams(self, *args): return _tinyWRAP.ProxyAudioConsumer_setActualSndCardPlaybackParams(self, *args) + def queryForResampler(self, *args): return _tinyWRAP.ProxyAudioConsumer_queryForResampler(self, *args) + def setPullBuffer(self, *args): return _tinyWRAP.ProxyAudioConsumer_setPullBuffer(self, *args) + def pull(self, *args): return _tinyWRAP.ProxyAudioConsumer_pull(self, *args) + def setGain(self, *args): return _tinyWRAP.ProxyAudioConsumer_setGain(self, *args) + def getGain(self): return _tinyWRAP.ProxyAudioConsumer_getGain(self) + def reset(self): return _tinyWRAP.ProxyAudioConsumer_reset(self) + def setCallback(self, *args): return _tinyWRAP.ProxyAudioConsumer_setCallback(self, *args) + def getMediaSessionId(self): return _tinyWRAP.ProxyAudioConsumer_getMediaSessionId(self) + __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyAudioConsumer_registerPlugin + if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyAudioConsumer_registerPlugin) +ProxyAudioConsumer_swigregister = _tinyWRAP.ProxyAudioConsumer_swigregister +ProxyAudioConsumer_swigregister(ProxyAudioConsumer) + +def ProxyAudioConsumer_registerPlugin(): + return _tinyWRAP.ProxyAudioConsumer_registerPlugin() +ProxyAudioConsumer_registerPlugin = _tinyWRAP.ProxyAudioConsumer_registerPlugin + +class ProxyVideoConsumerCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoConsumerCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoConsumerCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == ProxyVideoConsumerCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_ProxyVideoConsumerCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_ProxyVideoConsumerCallback + __del__ = lambda self : None; + def prepare(self, *args): return _tinyWRAP.ProxyVideoConsumerCallback_prepare(self, *args) + def consume(self, *args): return _tinyWRAP.ProxyVideoConsumerCallback_consume(self, *args) + def bufferCopied(self, *args): return _tinyWRAP.ProxyVideoConsumerCallback_bufferCopied(self, *args) + def start(self): return _tinyWRAP.ProxyVideoConsumerCallback_start(self) + def pause(self): return _tinyWRAP.ProxyVideoConsumerCallback_pause(self) + def stop(self): return _tinyWRAP.ProxyVideoConsumerCallback_stop(self) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_ProxyVideoConsumerCallback(self) + return weakref_proxy(self) +ProxyVideoConsumerCallback_swigregister = _tinyWRAP.ProxyVideoConsumerCallback_swigregister +ProxyVideoConsumerCallback_swigregister(ProxyVideoConsumerCallback) + +class ProxyVideoConsumer(ProxyPlugin): + __swig_setmethods__ = {} + for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoConsumer, name, value) + __swig_getmethods__ = {} + for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoConsumer, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyVideoConsumer + __del__ = lambda self : None; + def setDisplaySize(self, *args): return _tinyWRAP.ProxyVideoConsumer_setDisplaySize(self, *args) + def getDisplayWidth(self): return _tinyWRAP.ProxyVideoConsumer_getDisplayWidth(self) + def getDisplayHeight(self): return _tinyWRAP.ProxyVideoConsumer_getDisplayHeight(self) + def getDecodedWidth(self): return _tinyWRAP.ProxyVideoConsumer_getDecodedWidth(self) + def getDecodedHeight(self): return _tinyWRAP.ProxyVideoConsumer_getDecodedHeight(self) + def setCallback(self, *args): return _tinyWRAP.ProxyVideoConsumer_setCallback(self, *args) + def setAutoResizeDisplay(self, *args): return _tinyWRAP.ProxyVideoConsumer_setAutoResizeDisplay(self, *args) + def getAutoResizeDisplay(self): return _tinyWRAP.ProxyVideoConsumer_getAutoResizeDisplay(self) + def setConsumeBuffer(self, *args): return _tinyWRAP.ProxyVideoConsumer_setConsumeBuffer(self, *args) + def pull(self, *args): return _tinyWRAP.ProxyVideoConsumer_pull(self, *args) + def reset(self): return _tinyWRAP.ProxyVideoConsumer_reset(self) + def getMediaSessionId(self): return _tinyWRAP.ProxyVideoConsumer_getMediaSessionId(self) + __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyVideoConsumer_registerPlugin + if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyVideoConsumer_registerPlugin) + __swig_getmethods__["setDefaultChroma"] = lambda x: _tinyWRAP.ProxyVideoConsumer_setDefaultChroma + if _newclass:setDefaultChroma = staticmethod(_tinyWRAP.ProxyVideoConsumer_setDefaultChroma) + __swig_getmethods__["setDefaultAutoResizeDisplay"] = lambda x: _tinyWRAP.ProxyVideoConsumer_setDefaultAutoResizeDisplay + if _newclass:setDefaultAutoResizeDisplay = staticmethod(_tinyWRAP.ProxyVideoConsumer_setDefaultAutoResizeDisplay) +ProxyVideoConsumer_swigregister = _tinyWRAP.ProxyVideoConsumer_swigregister +ProxyVideoConsumer_swigregister(ProxyVideoConsumer) + +def ProxyVideoConsumer_registerPlugin(): + return _tinyWRAP.ProxyVideoConsumer_registerPlugin() +ProxyVideoConsumer_registerPlugin = _tinyWRAP.ProxyVideoConsumer_registerPlugin + +def ProxyVideoConsumer_setDefaultChroma(*args): + return _tinyWRAP.ProxyVideoConsumer_setDefaultChroma(*args) +ProxyVideoConsumer_setDefaultChroma = _tinyWRAP.ProxyVideoConsumer_setDefaultChroma + +def ProxyVideoConsumer_setDefaultAutoResizeDisplay(*args): + return _tinyWRAP.ProxyVideoConsumer_setDefaultAutoResizeDisplay(*args) +ProxyVideoConsumer_setDefaultAutoResizeDisplay = _tinyWRAP.ProxyVideoConsumer_setDefaultAutoResizeDisplay + +class ProxyVideoFrame(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoFrame, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoFrame, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyVideoFrame + __del__ = lambda self : None; + def getSize(self): return _tinyWRAP.ProxyVideoFrame_getSize(self) + def getContent(self, *args): return _tinyWRAP.ProxyVideoFrame_getContent(self, *args) + def getFrameWidth(self): return _tinyWRAP.ProxyVideoFrame_getFrameWidth(self) + def getFrameHeight(self): return _tinyWRAP.ProxyVideoFrame_getFrameHeight(self) +ProxyVideoFrame_swigregister = _tinyWRAP.ProxyVideoFrame_swigregister +ProxyVideoFrame_swigregister(ProxyVideoFrame) + +class ProxyAudioProducerCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioProducerCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioProducerCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == ProxyAudioProducerCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_ProxyAudioProducerCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_ProxyAudioProducerCallback + __del__ = lambda self : None; + def prepare(self, *args): return _tinyWRAP.ProxyAudioProducerCallback_prepare(self, *args) + def start(self): return _tinyWRAP.ProxyAudioProducerCallback_start(self) + def pause(self): return _tinyWRAP.ProxyAudioProducerCallback_pause(self) + def stop(self): return _tinyWRAP.ProxyAudioProducerCallback_stop(self) + def fillPushBuffer(self): return _tinyWRAP.ProxyAudioProducerCallback_fillPushBuffer(self) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_ProxyAudioProducerCallback(self) + return weakref_proxy(self) +ProxyAudioProducerCallback_swigregister = _tinyWRAP.ProxyAudioProducerCallback_swigregister +ProxyAudioProducerCallback_swigregister(ProxyAudioProducerCallback) + +class ProxyAudioProducer(ProxyPlugin): + __swig_setmethods__ = {} + for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioProducer, name, value) + __swig_getmethods__ = {} + for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioProducer, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyAudioProducer + __del__ = lambda self : None; + def setActualSndCardRecordParams(self, *args): return _tinyWRAP.ProxyAudioProducer_setActualSndCardRecordParams(self, *args) + def setPushBuffer(self, *args): return _tinyWRAP.ProxyAudioProducer_setPushBuffer(self, *args) + def push(self, *args): return _tinyWRAP.ProxyAudioProducer_push(self, *args) + def setGain(self, *args): return _tinyWRAP.ProxyAudioProducer_setGain(self, *args) + def getGain(self): return _tinyWRAP.ProxyAudioProducer_getGain(self) + def setCallback(self, *args): return _tinyWRAP.ProxyAudioProducer_setCallback(self, *args) + def getMediaSessionId(self): return _tinyWRAP.ProxyAudioProducer_getMediaSessionId(self) + __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyAudioProducer_registerPlugin + if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyAudioProducer_registerPlugin) +ProxyAudioProducer_swigregister = _tinyWRAP.ProxyAudioProducer_swigregister +ProxyAudioProducer_swigregister(ProxyAudioProducer) + +def ProxyAudioProducer_registerPlugin(): + return _tinyWRAP.ProxyAudioProducer_registerPlugin() +ProxyAudioProducer_registerPlugin = _tinyWRAP.ProxyAudioProducer_registerPlugin + +class ProxyVideoProducerCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoProducerCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoProducerCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == ProxyVideoProducerCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_ProxyVideoProducerCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_ProxyVideoProducerCallback + __del__ = lambda self : None; + def prepare(self, *args): return _tinyWRAP.ProxyVideoProducerCallback_prepare(self, *args) + def start(self): return _tinyWRAP.ProxyVideoProducerCallback_start(self) + def pause(self): return _tinyWRAP.ProxyVideoProducerCallback_pause(self) + def stop(self): return _tinyWRAP.ProxyVideoProducerCallback_stop(self) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_ProxyVideoProducerCallback(self) + return weakref_proxy(self) +ProxyVideoProducerCallback_swigregister = _tinyWRAP.ProxyVideoProducerCallback_swigregister +ProxyVideoProducerCallback_swigregister(ProxyVideoProducerCallback) + +class ProxyVideoProducer(ProxyPlugin): + __swig_setmethods__ = {} + for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoProducer, name, value) + __swig_getmethods__ = {} + for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoProducer, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_ProxyVideoProducer + __del__ = lambda self : None; + def getRotation(self): return _tinyWRAP.ProxyVideoProducer_getRotation(self) + def setRotation(self, *args): return _tinyWRAP.ProxyVideoProducer_setRotation(self, *args) + def getMirror(self): return _tinyWRAP.ProxyVideoProducer_getMirror(self) + def setMirror(self, *args): return _tinyWRAP.ProxyVideoProducer_setMirror(self, *args) + def setActualCameraOutputSize(self, *args): return _tinyWRAP.ProxyVideoProducer_setActualCameraOutputSize(self, *args) + def push(self, *args): return _tinyWRAP.ProxyVideoProducer_push(self, *args) + def setCallback(self, *args): return _tinyWRAP.ProxyVideoProducer_setCallback(self, *args) + def getMediaSessionId(self): return _tinyWRAP.ProxyVideoProducer_getMediaSessionId(self) + __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyVideoProducer_registerPlugin + if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyVideoProducer_registerPlugin) + __swig_getmethods__["setDefaultChroma"] = lambda x: _tinyWRAP.ProxyVideoProducer_setDefaultChroma + if _newclass:setDefaultChroma = staticmethod(_tinyWRAP.ProxyVideoProducer_setDefaultChroma) +ProxyVideoProducer_swigregister = _tinyWRAP.ProxyVideoProducer_swigregister +ProxyVideoProducer_swigregister(ProxyVideoProducer) + +def ProxyVideoProducer_registerPlugin(): + return _tinyWRAP.ProxyVideoProducer_registerPlugin() +ProxyVideoProducer_registerPlugin = _tinyWRAP.ProxyVideoProducer_registerPlugin + +def ProxyVideoProducer_setDefaultChroma(*args): + return _tinyWRAP.ProxyVideoProducer_setDefaultChroma(*args) +ProxyVideoProducer_setDefaultChroma = _tinyWRAP.ProxyVideoProducer_setDefaultChroma + +class SipCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SipCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SipCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == SipCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_SipCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SipCallback + __del__ = lambda self : None; + def OnDialogEvent(self, *args): return _tinyWRAP.SipCallback_OnDialogEvent(self, *args) + def OnStackEvent(self, *args): return _tinyWRAP.SipCallback_OnStackEvent(self, *args) + def OnInviteEvent(self, *args): return _tinyWRAP.SipCallback_OnInviteEvent(self, *args) + def OnMessagingEvent(self, *args): return _tinyWRAP.SipCallback_OnMessagingEvent(self, *args) + def OnInfoEvent(self, *args): return _tinyWRAP.SipCallback_OnInfoEvent(self, *args) + def OnOptionsEvent(self, *args): return _tinyWRAP.SipCallback_OnOptionsEvent(self, *args) + def OnPublicationEvent(self, *args): return _tinyWRAP.SipCallback_OnPublicationEvent(self, *args) + def OnRegistrationEvent(self, *args): return _tinyWRAP.SipCallback_OnRegistrationEvent(self, *args) + def OnSubscriptionEvent(self, *args): return _tinyWRAP.SipCallback_OnSubscriptionEvent(self, *args) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_SipCallback(self) + return weakref_proxy(self) +SipCallback_swigregister = _tinyWRAP.SipCallback_swigregister +SipCallback_swigregister(SipCallback) + +class SafeObject(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SafeObject, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SafeObject, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_SafeObject() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SafeObject + __del__ = lambda self : None; + def Lock(self): return _tinyWRAP.SafeObject_Lock(self) + def UnLock(self): return _tinyWRAP.SafeObject_UnLock(self) +SafeObject_swigregister = _tinyWRAP.SafeObject_swigregister +SafeObject_swigregister(SafeObject) + +class SipStack(SafeObject): + __swig_setmethods__ = {} + for _s in [SafeObject]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{})) + __setattr__ = lambda self, name, value: _swig_setattr(self, SipStack, name, value) + __swig_getmethods__ = {} + for _s in [SafeObject]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{})) + __getattr__ = lambda self, name: _swig_getattr(self, SipStack, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_SipStack(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SipStack + __del__ = lambda self : None; + def start(self): return _tinyWRAP.SipStack_start(self) + def setDebugCallback(self, *args): return _tinyWRAP.SipStack_setDebugCallback(self, *args) + def setDisplayName(self, *args): return _tinyWRAP.SipStack_setDisplayName(self, *args) + def setRealm(self, *args): return _tinyWRAP.SipStack_setRealm(self, *args) + def setIMPI(self, *args): return _tinyWRAP.SipStack_setIMPI(self, *args) + def setIMPU(self, *args): return _tinyWRAP.SipStack_setIMPU(self, *args) + def setPassword(self, *args): return _tinyWRAP.SipStack_setPassword(self, *args) + def setAMF(self, *args): return _tinyWRAP.SipStack_setAMF(self, *args) + def setOperatorId(self, *args): return _tinyWRAP.SipStack_setOperatorId(self, *args) + def setProxyCSCF(self, *args): return _tinyWRAP.SipStack_setProxyCSCF(self, *args) + def setLocalIP(self, *args): return _tinyWRAP.SipStack_setLocalIP(self, *args) + def setLocalPort(self, *args): return _tinyWRAP.SipStack_setLocalPort(self, *args) + def setEarlyIMS(self, *args): return _tinyWRAP.SipStack_setEarlyIMS(self, *args) + def addHeader(self, *args): return _tinyWRAP.SipStack_addHeader(self, *args) + def removeHeader(self, *args): return _tinyWRAP.SipStack_removeHeader(self, *args) + def addDnsServer(self, *args): return _tinyWRAP.SipStack_addDnsServer(self, *args) + def setDnsDiscovery(self, *args): return _tinyWRAP.SipStack_setDnsDiscovery(self, *args) + def setAoR(self, *args): return _tinyWRAP.SipStack_setAoR(self, *args) + def setSigCompParams(self, *args): return _tinyWRAP.SipStack_setSigCompParams(self, *args) + def addSigCompCompartment(self, *args): return _tinyWRAP.SipStack_addSigCompCompartment(self, *args) + def removeSigCompCompartment(self, *args): return _tinyWRAP.SipStack_removeSigCompCompartment(self, *args) + def setSTUNEnabledForICE(self, *args): return _tinyWRAP.SipStack_setSTUNEnabledForICE(self, *args) + def setSTUNServer(self, *args): return _tinyWRAP.SipStack_setSTUNServer(self, *args) + def setSTUNCred(self, *args): return _tinyWRAP.SipStack_setSTUNCred(self, *args) + def setSTUNEnabled(self, *args): return _tinyWRAP.SipStack_setSTUNEnabled(self, *args) + def setTLSSecAgree(self, *args): return _tinyWRAP.SipStack_setTLSSecAgree(self, *args) + def setSSLCertificates(self, *args): return _tinyWRAP.SipStack_setSSLCertificates(self, *args) + def setSSLCretificates(self, *args): return _tinyWRAP.SipStack_setSSLCretificates(self, *args) + def setIPSecSecAgree(self, *args): return _tinyWRAP.SipStack_setIPSecSecAgree(self, *args) + def setIPSecParameters(self, *args): return _tinyWRAP.SipStack_setIPSecParameters(self, *args) + def dnsENUM(self, *args): return _tinyWRAP.SipStack_dnsENUM(self, *args) + def dnsNaptrSrv(self, *args): return _tinyWRAP.SipStack_dnsNaptrSrv(self, *args) + def dnsSrv(self, *args): return _tinyWRAP.SipStack_dnsSrv(self, *args) + def setMaxFDs(self, *args): return _tinyWRAP.SipStack_setMaxFDs(self, *args) + def getLocalIPnPort(self, *args): return _tinyWRAP.SipStack_getLocalIPnPort(self, *args) + def getPreferredIdentity(self): return _tinyWRAP.SipStack_getPreferredIdentity(self) + def isValid(self): return _tinyWRAP.SipStack_isValid(self) + def stop(self): return _tinyWRAP.SipStack_stop(self) + __swig_getmethods__["initialize"] = lambda x: _tinyWRAP.SipStack_initialize + if _newclass:initialize = staticmethod(_tinyWRAP.SipStack_initialize) + __swig_getmethods__["deInitialize"] = lambda x: _tinyWRAP.SipStack_deInitialize + if _newclass:deInitialize = staticmethod(_tinyWRAP.SipStack_deInitialize) + __swig_getmethods__["setCodecs"] = lambda x: _tinyWRAP.SipStack_setCodecs + if _newclass:setCodecs = staticmethod(_tinyWRAP.SipStack_setCodecs) + __swig_getmethods__["setCodecs_2"] = lambda x: _tinyWRAP.SipStack_setCodecs_2 + if _newclass:setCodecs_2 = staticmethod(_tinyWRAP.SipStack_setCodecs_2) + __swig_getmethods__["setCodecPriority"] = lambda x: _tinyWRAP.SipStack_setCodecPriority + if _newclass:setCodecPriority = staticmethod(_tinyWRAP.SipStack_setCodecPriority) + __swig_getmethods__["setCodecPriority_2"] = lambda x: _tinyWRAP.SipStack_setCodecPriority_2 + if _newclass:setCodecPriority_2 = staticmethod(_tinyWRAP.SipStack_setCodecPriority_2) + __swig_getmethods__["isCodecSupported"] = lambda x: _tinyWRAP.SipStack_isCodecSupported + if _newclass:isCodecSupported = staticmethod(_tinyWRAP.SipStack_isCodecSupported) + __swig_getmethods__["isIPSecSupported"] = lambda x: _tinyWRAP.SipStack_isIPSecSupported + if _newclass:isIPSecSupported = staticmethod(_tinyWRAP.SipStack_isIPSecSupported) +SipStack_swigregister = _tinyWRAP.SipStack_swigregister +SipStack_swigregister(SipStack) + +def SipStack_initialize(): + return _tinyWRAP.SipStack_initialize() +SipStack_initialize = _tinyWRAP.SipStack_initialize + +def SipStack_deInitialize(): + return _tinyWRAP.SipStack_deInitialize() +SipStack_deInitialize = _tinyWRAP.SipStack_deInitialize + +def SipStack_setCodecs(*args): + return _tinyWRAP.SipStack_setCodecs(*args) +SipStack_setCodecs = _tinyWRAP.SipStack_setCodecs + +def SipStack_setCodecs_2(*args): + return _tinyWRAP.SipStack_setCodecs_2(*args) +SipStack_setCodecs_2 = _tinyWRAP.SipStack_setCodecs_2 + +def SipStack_setCodecPriority(*args): + return _tinyWRAP.SipStack_setCodecPriority(*args) +SipStack_setCodecPriority = _tinyWRAP.SipStack_setCodecPriority + +def SipStack_setCodecPriority_2(*args): + return _tinyWRAP.SipStack_setCodecPriority_2(*args) +SipStack_setCodecPriority_2 = _tinyWRAP.SipStack_setCodecPriority_2 + +def SipStack_isCodecSupported(*args): + return _tinyWRAP.SipStack_isCodecSupported(*args) +SipStack_isCodecSupported = _tinyWRAP.SipStack_isCodecSupported + +def SipStack_isIPSecSupported(): + return _tinyWRAP.SipStack_isIPSecSupported() +SipStack_isIPSecSupported = _tinyWRAP.SipStack_isIPSecSupported + +tsip_stack_mode_ua = _tinyWRAP.tsip_stack_mode_ua +tsip_stack_mode_p2p = _tinyWRAP.tsip_stack_mode_p2p +tsip_stack_mode_mediaproxy = _tinyWRAP.tsip_stack_mode_mediaproxy +tsip_stack_mode_mcu = _tinyWRAP.tsip_stack_mode_mcu +tsip_NONE = _tinyWRAP.tsip_NONE +tsip_ACK = _tinyWRAP.tsip_ACK +tsip_BYE = _tinyWRAP.tsip_BYE +tsip_CANCEL = _tinyWRAP.tsip_CANCEL +tsip_INVITE = _tinyWRAP.tsip_INVITE +tsip_OPTIONS = _tinyWRAP.tsip_OPTIONS +tsip_REGISTER = _tinyWRAP.tsip_REGISTER +tsip_SUBSCRIBE = _tinyWRAP.tsip_SUBSCRIBE +tsip_NOTIFY = _tinyWRAP.tsip_NOTIFY +tsip_REFER = _tinyWRAP.tsip_REFER +tsip_INFO = _tinyWRAP.tsip_INFO +tsip_UPDATE = _tinyWRAP.tsip_UPDATE +tsip_MESSAGE = _tinyWRAP.tsip_MESSAGE +tsip_PUBLISH = _tinyWRAP.tsip_PUBLISH +tsip_PRACK = _tinyWRAP.tsip_PRACK +tsip_event_invite = _tinyWRAP.tsip_event_invite +tsip_event_message = _tinyWRAP.tsip_event_message +tsip_event_info = _tinyWRAP.tsip_event_info +tsip_event_options = _tinyWRAP.tsip_event_options +tsip_event_publish = _tinyWRAP.tsip_event_publish +tsip_event_register = _tinyWRAP.tsip_event_register +tsip_event_subscribe = _tinyWRAP.tsip_event_subscribe +tsip_event_dialog = _tinyWRAP.tsip_event_dialog +tsip_event_code_dialog_transport_error = _tinyWRAP.tsip_event_code_dialog_transport_error +tsip_event_code_dialog_global_error = _tinyWRAP.tsip_event_code_dialog_global_error +tsip_event_code_dialog_message_error = _tinyWRAP.tsip_event_code_dialog_message_error +tsip_event_code_dialog_request_incoming = _tinyWRAP.tsip_event_code_dialog_request_incoming +tsip_event_code_dialog_request_outgoing = _tinyWRAP.tsip_event_code_dialog_request_outgoing +tsip_event_code_dialog_request_cancelled = _tinyWRAP.tsip_event_code_dialog_request_cancelled +tsip_event_code_dialog_request_sent = _tinyWRAP.tsip_event_code_dialog_request_sent +tsip_event_code_dialog_connecting = _tinyWRAP.tsip_event_code_dialog_connecting +tsip_event_code_dialog_connected = _tinyWRAP.tsip_event_code_dialog_connected +tsip_event_code_dialog_terminating = _tinyWRAP.tsip_event_code_dialog_terminating +tsip_event_code_dialog_terminated = _tinyWRAP.tsip_event_code_dialog_terminated +tsip_event_code_stack_starting = _tinyWRAP.tsip_event_code_stack_starting +tsip_event_code_stack_started = _tinyWRAP.tsip_event_code_stack_started +tsip_event_code_stack_stopping = _tinyWRAP.tsip_event_code_stack_stopping +tsip_event_code_stack_stopped = _tinyWRAP.tsip_event_code_stack_stopped +tsip_event_code_stack_failed_to_start = _tinyWRAP.tsip_event_code_stack_failed_to_start +tsip_event_code_stack_failed_to_stop = _tinyWRAP.tsip_event_code_stack_failed_to_stop +tsip_event_code_stack_disconnected = _tinyWRAP.tsip_event_code_stack_disconnected +tsip_i_newreg = _tinyWRAP.tsip_i_newreg +tsip_i_register = _tinyWRAP.tsip_i_register +tsip_ao_register = _tinyWRAP.tsip_ao_register +tsip_i_unregister = _tinyWRAP.tsip_i_unregister +tsip_ao_unregister = _tinyWRAP.tsip_ao_unregister +tsip_i_subscribe = _tinyWRAP.tsip_i_subscribe +tsip_ao_subscribe = _tinyWRAP.tsip_ao_subscribe +tsip_i_unsubscribe = _tinyWRAP.tsip_i_unsubscribe +tsip_ao_unsubscribe = _tinyWRAP.tsip_ao_unsubscribe +tsip_i_notify = _tinyWRAP.tsip_i_notify +tsip_ao_notify = _tinyWRAP.tsip_ao_notify +tsip_i_publish = _tinyWRAP.tsip_i_publish +tsip_ao_publish = _tinyWRAP.tsip_ao_publish +tsip_i_unpublish = _tinyWRAP.tsip_i_unpublish +tsip_ao_unpublish = _tinyWRAP.tsip_ao_unpublish +tsip_i_message = _tinyWRAP.tsip_i_message +tsip_ao_message = _tinyWRAP.tsip_ao_message +tsip_i_info = _tinyWRAP.tsip_i_info +tsip_ao_info = _tinyWRAP.tsip_ao_info +tsip_i_options = _tinyWRAP.tsip_i_options +tsip_ao_options = _tinyWRAP.tsip_ao_options +tsip_i_newcall = _tinyWRAP.tsip_i_newcall +tsip_i_request = _tinyWRAP.tsip_i_request +tsip_ao_request = _tinyWRAP.tsip_ao_request +tsip_o_ect_trying = _tinyWRAP.tsip_o_ect_trying +tsip_o_ect_accepted = _tinyWRAP.tsip_o_ect_accepted +tsip_o_ect_completed = _tinyWRAP.tsip_o_ect_completed +tsip_o_ect_failed = _tinyWRAP.tsip_o_ect_failed +tsip_o_ect_notify = _tinyWRAP.tsip_o_ect_notify +tsip_i_ect_requested = _tinyWRAP.tsip_i_ect_requested +tsip_i_ect_newcall = _tinyWRAP.tsip_i_ect_newcall +tsip_i_ect_completed = _tinyWRAP.tsip_i_ect_completed +tsip_i_ect_failed = _tinyWRAP.tsip_i_ect_failed +tsip_i_ect_notify = _tinyWRAP.tsip_i_ect_notify +tsip_m_early_media = _tinyWRAP.tsip_m_early_media +tsip_m_updating = _tinyWRAP.tsip_m_updating +tsip_m_updated = _tinyWRAP.tsip_m_updated +tsip_m_local_hold_ok = _tinyWRAP.tsip_m_local_hold_ok +tsip_m_local_hold_nok = _tinyWRAP.tsip_m_local_hold_nok +tsip_m_local_resume_ok = _tinyWRAP.tsip_m_local_resume_ok +tsip_m_local_resume_nok = _tinyWRAP.tsip_m_local_resume_nok +tsip_m_remote_hold = _tinyWRAP.tsip_m_remote_hold +tsip_m_remote_resume = _tinyWRAP.tsip_m_remote_resume +tmedia_qos_stype_none = _tinyWRAP.tmedia_qos_stype_none +tmedia_qos_stype_segmented = _tinyWRAP.tmedia_qos_stype_segmented +tmedia_qos_stype_e2e = _tinyWRAP.tmedia_qos_stype_e2e +tmedia_qos_strength_none = _tinyWRAP.tmedia_qos_strength_none +tmedia_qos_strength_failure = _tinyWRAP.tmedia_qos_strength_failure +tmedia_qos_strength_unknown = _tinyWRAP.tmedia_qos_strength_unknown +tmedia_qos_strength_optional = _tinyWRAP.tmedia_qos_strength_optional +tmedia_qos_strength_mandatory = _tinyWRAP.tmedia_qos_strength_mandatory +tmedia_chroma_none = _tinyWRAP.tmedia_chroma_none +tmedia_chroma_rgb24 = _tinyWRAP.tmedia_chroma_rgb24 +tmedia_chroma_bgr24 = _tinyWRAP.tmedia_chroma_bgr24 +tmedia_chroma_rgb32 = _tinyWRAP.tmedia_chroma_rgb32 +tmedia_chroma_rgb565le = _tinyWRAP.tmedia_chroma_rgb565le +tmedia_chroma_rgb565be = _tinyWRAP.tmedia_chroma_rgb565be +tmedia_chroma_nv12 = _tinyWRAP.tmedia_chroma_nv12 +tmedia_chroma_nv21 = _tinyWRAP.tmedia_chroma_nv21 +tmedia_chroma_yuv422p = _tinyWRAP.tmedia_chroma_yuv422p +tmedia_chroma_uyvy422 = _tinyWRAP.tmedia_chroma_uyvy422 +tmedia_chroma_yuv420p = _tinyWRAP.tmedia_chroma_yuv420p +tmedia_chroma_mjpeg = _tinyWRAP.tmedia_chroma_mjpeg +tmedia_chroma_yuyv422 = _tinyWRAP.tmedia_chroma_yuyv422 +tmedia_mode_none = _tinyWRAP.tmedia_mode_none +tmedia_mode_optional = _tinyWRAP.tmedia_mode_optional +tmedia_mode_mandatory = _tinyWRAP.tmedia_mode_mandatory +tmedia_srtp_mode_none = _tinyWRAP.tmedia_srtp_mode_none +tmedia_srtp_mode_optional = _tinyWRAP.tmedia_srtp_mode_optional +tmedia_srtp_mode_mandatory = _tinyWRAP.tmedia_srtp_mode_mandatory +tmedia_srtp_type_none = _tinyWRAP.tmedia_srtp_type_none +tmedia_srtp_type_sdes = _tinyWRAP.tmedia_srtp_type_sdes +tmedia_srtp_type_dtls = _tinyWRAP.tmedia_srtp_type_dtls +tmedia_srtp_type_sdes_dtls = _tinyWRAP.tmedia_srtp_type_sdes_dtls +tmedia_t140_data_type_utf8 = _tinyWRAP.tmedia_t140_data_type_utf8 +tmedia_t140_data_type_zero_width_no_break_space = _tinyWRAP.tmedia_t140_data_type_zero_width_no_break_space +tmedia_t140_data_type_backspace = _tinyWRAP.tmedia_t140_data_type_backspace +tmedia_t140_data_type_esc = _tinyWRAP.tmedia_t140_data_type_esc +tmedia_t140_data_type_cr = _tinyWRAP.tmedia_t140_data_type_cr +tmedia_t140_data_type_lf = _tinyWRAP.tmedia_t140_data_type_lf +tmedia_t140_data_type_cr_lf = _tinyWRAP.tmedia_t140_data_type_cr_lf +tmedia_t140_data_type_interrupt2 = _tinyWRAP.tmedia_t140_data_type_interrupt2 +tmedia_t140_data_type_bell = _tinyWRAP.tmedia_t140_data_type_bell +tmedia_t140_data_type_sos = _tinyWRAP.tmedia_t140_data_type_sos +tmedia_t140_data_type_string_term = _tinyWRAP.tmedia_t140_data_type_string_term +tmedia_t140_data_type_graphic_start = _tinyWRAP.tmedia_t140_data_type_graphic_start +tmedia_t140_data_type_graphic_end = _tinyWRAP.tmedia_t140_data_type_graphic_end +tmedia_t140_data_type_loss_char_char = _tinyWRAP.tmedia_t140_data_type_loss_char_char +tmedia_t140_data_type_loss_utf8 = _tinyWRAP.tmedia_t140_data_type_loss_utf8 +tmedia_profile_default = _tinyWRAP.tmedia_profile_default +tmedia_profile_rtcweb = _tinyWRAP.tmedia_profile_rtcweb +tmedia_bl_low = _tinyWRAP.tmedia_bl_low +tmedia_bl_medium = _tinyWRAP.tmedia_bl_medium +tmedia_bl_hight = _tinyWRAP.tmedia_bl_hight +tmedia_bl_unrestricted = _tinyWRAP.tmedia_bl_unrestricted +tmedia_pref_video_size_sqcif = _tinyWRAP.tmedia_pref_video_size_sqcif +tmedia_pref_video_size_qcif = _tinyWRAP.tmedia_pref_video_size_qcif +tmedia_pref_video_size_qvga = _tinyWRAP.tmedia_pref_video_size_qvga +tmedia_pref_video_size_cif = _tinyWRAP.tmedia_pref_video_size_cif +tmedia_pref_video_size_hvga = _tinyWRAP.tmedia_pref_video_size_hvga +tmedia_pref_video_size_vga = _tinyWRAP.tmedia_pref_video_size_vga +tmedia_pref_video_size_4cif = _tinyWRAP.tmedia_pref_video_size_4cif +tmedia_pref_video_size_wvga = _tinyWRAP.tmedia_pref_video_size_wvga +tmedia_pref_video_size_svga = _tinyWRAP.tmedia_pref_video_size_svga +tmedia_pref_video_size_480p = _tinyWRAP.tmedia_pref_video_size_480p +tmedia_pref_video_size_xga = _tinyWRAP.tmedia_pref_video_size_xga +tmedia_pref_video_size_720p = _tinyWRAP.tmedia_pref_video_size_720p +tmedia_pref_video_size_16cif = _tinyWRAP.tmedia_pref_video_size_16cif +tmedia_pref_video_size_1080p = _tinyWRAP.tmedia_pref_video_size_1080p +tmedia_pref_video_size_2160p = _tinyWRAP.tmedia_pref_video_size_2160p +tmedia_codec_id_none = _tinyWRAP.tmedia_codec_id_none +tmedia_codec_id_amr_nb_oa = _tinyWRAP.tmedia_codec_id_amr_nb_oa +tmedia_codec_id_amr_nb_be = _tinyWRAP.tmedia_codec_id_amr_nb_be +tmedia_codec_id_amr_wb_oa = _tinyWRAP.tmedia_codec_id_amr_wb_oa +tmedia_codec_id_amr_wb_be = _tinyWRAP.tmedia_codec_id_amr_wb_be +tmedia_codec_id_gsm = _tinyWRAP.tmedia_codec_id_gsm +tmedia_codec_id_pcma = _tinyWRAP.tmedia_codec_id_pcma +tmedia_codec_id_pcmu = _tinyWRAP.tmedia_codec_id_pcmu +tmedia_codec_id_ilbc = _tinyWRAP.tmedia_codec_id_ilbc +tmedia_codec_id_speex_nb = _tinyWRAP.tmedia_codec_id_speex_nb +tmedia_codec_id_speex_wb = _tinyWRAP.tmedia_codec_id_speex_wb +tmedia_codec_id_speex_uwb = _tinyWRAP.tmedia_codec_id_speex_uwb +tmedia_codec_id_bv16 = _tinyWRAP.tmedia_codec_id_bv16 +tmedia_codec_id_bv32 = _tinyWRAP.tmedia_codec_id_bv32 +tmedia_codec_id_opus = _tinyWRAP.tmedia_codec_id_opus +tmedia_codec_id_g729ab = _tinyWRAP.tmedia_codec_id_g729ab +tmedia_codec_id_g722 = _tinyWRAP.tmedia_codec_id_g722 +tmedia_codec_id_h261 = _tinyWRAP.tmedia_codec_id_h261 +tmedia_codec_id_h263 = _tinyWRAP.tmedia_codec_id_h263 +tmedia_codec_id_h263p = _tinyWRAP.tmedia_codec_id_h263p +tmedia_codec_id_h263pp = _tinyWRAP.tmedia_codec_id_h263pp +tmedia_codec_id_h264_bp = _tinyWRAP.tmedia_codec_id_h264_bp +tmedia_codec_id_h264_mp = _tinyWRAP.tmedia_codec_id_h264_mp +tmedia_codec_id_h264_hp = _tinyWRAP.tmedia_codec_id_h264_hp +tmedia_codec_id_h264_bp10 = _tinyWRAP.tmedia_codec_id_h264_bp10 +tmedia_codec_id_h264_bp20 = _tinyWRAP.tmedia_codec_id_h264_bp20 +tmedia_codec_id_h264_bp30 = _tinyWRAP.tmedia_codec_id_h264_bp30 +tmedia_codec_id_h264_svc = _tinyWRAP.tmedia_codec_id_h264_svc +tmedia_codec_id_theora = _tinyWRAP.tmedia_codec_id_theora +tmedia_codec_id_mp4ves_es = _tinyWRAP.tmedia_codec_id_mp4ves_es +tmedia_codec_id_vp8 = _tinyWRAP.tmedia_codec_id_vp8 +tmedia_codec_id_t140 = _tinyWRAP.tmedia_codec_id_t140 +tmedia_codec_id_red = _tinyWRAP.tmedia_codec_id_red +tdav_codec_id_none = _tinyWRAP.tdav_codec_id_none +tdav_codec_id_amr_nb_oa = _tinyWRAP.tdav_codec_id_amr_nb_oa +tdav_codec_id_amr_nb_be = _tinyWRAP.tdav_codec_id_amr_nb_be +tdav_codec_id_amr_wb_oa = _tinyWRAP.tdav_codec_id_amr_wb_oa +tdav_codec_id_amr_wb_be = _tinyWRAP.tdav_codec_id_amr_wb_be +tdav_codec_id_gsm = _tinyWRAP.tdav_codec_id_gsm +tdav_codec_id_pcma = _tinyWRAP.tdav_codec_id_pcma +tdav_codec_id_pcmu = _tinyWRAP.tdav_codec_id_pcmu +tdav_codec_id_ilbc = _tinyWRAP.tdav_codec_id_ilbc +tdav_codec_id_speex_nb = _tinyWRAP.tdav_codec_id_speex_nb +tdav_codec_id_speex_wb = _tinyWRAP.tdav_codec_id_speex_wb +tdav_codec_id_speex_uwb = _tinyWRAP.tdav_codec_id_speex_uwb +tdav_codec_id_bv16 = _tinyWRAP.tdav_codec_id_bv16 +tdav_codec_id_bv32 = _tinyWRAP.tdav_codec_id_bv32 +tdav_codec_id_opus = _tinyWRAP.tdav_codec_id_opus +tdav_codec_id_g729ab = _tinyWRAP.tdav_codec_id_g729ab +tdav_codec_id_g722 = _tinyWRAP.tdav_codec_id_g722 +tdav_codec_id_h261 = _tinyWRAP.tdav_codec_id_h261 +tdav_codec_id_h263 = _tinyWRAP.tdav_codec_id_h263 +tdav_codec_id_h263p = _tinyWRAP.tdav_codec_id_h263p +tdav_codec_id_h263pp = _tinyWRAP.tdav_codec_id_h263pp +tdav_codec_id_h264_bp = _tinyWRAP.tdav_codec_id_h264_bp +tdav_codec_id_h264_mp = _tinyWRAP.tdav_codec_id_h264_mp +tdav_codec_id_h264_hp = _tinyWRAP.tdav_codec_id_h264_hp +tdav_codec_id_h264_bp10 = _tinyWRAP.tdav_codec_id_h264_bp10 +tdav_codec_id_h264_bp20 = _tinyWRAP.tdav_codec_id_h264_bp20 +tdav_codec_id_h264_bp30 = _tinyWRAP.tdav_codec_id_h264_bp30 +tdav_codec_id_h264_svc = _tinyWRAP.tdav_codec_id_h264_svc +tdav_codec_id_theora = _tinyWRAP.tdav_codec_id_theora +tdav_codec_id_mp4ves_es = _tinyWRAP.tdav_codec_id_mp4ves_es +tdav_codec_id_vp8 = _tinyWRAP.tdav_codec_id_vp8 +tdav_codec_id_t140 = _tinyWRAP.tdav_codec_id_t140 +tdav_codec_id_red = _tinyWRAP.tdav_codec_id_red +class XcapSelector(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, XcapSelector, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, XcapSelector, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_XcapSelector(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_XcapSelector + __del__ = lambda self : None; + def setAUID(self, *args): return _tinyWRAP.XcapSelector_setAUID(self, *args) + def setName(self, *args): return _tinyWRAP.XcapSelector_setName(self, *args) + def setAttribute(self, *args): return _tinyWRAP.XcapSelector_setAttribute(self, *args) + def setPos(self, *args): return _tinyWRAP.XcapSelector_setPos(self, *args) + def setPosAttribute(self, *args): return _tinyWRAP.XcapSelector_setPosAttribute(self, *args) + def setNamespace(self, *args): return _tinyWRAP.XcapSelector_setNamespace(self, *args) + def getString(self): return _tinyWRAP.XcapSelector_getString(self) + def reset(self): return _tinyWRAP.XcapSelector_reset(self) +XcapSelector_swigregister = _tinyWRAP.XcapSelector_swigregister +XcapSelector_swigregister(XcapSelector) + +class XcapMessage(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, XcapMessage, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, XcapMessage, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_XcapMessage() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_XcapMessage + __del__ = lambda self : None; + def getCode(self): return _tinyWRAP.XcapMessage_getCode(self) + def getPhrase(self): return _tinyWRAP.XcapMessage_getPhrase(self) + def getXcapHeaderValue(self, *args): return _tinyWRAP.XcapMessage_getXcapHeaderValue(self, *args) + def getXcapHeaderParamValue(self, *args): return _tinyWRAP.XcapMessage_getXcapHeaderParamValue(self, *args) + def getXcapContentLength(self): return _tinyWRAP.XcapMessage_getXcapContentLength(self) + def getXcapContent(self, *args): return _tinyWRAP.XcapMessage_getXcapContent(self, *args) +XcapMessage_swigregister = _tinyWRAP.XcapMessage_swigregister +XcapMessage_swigregister(XcapMessage) + +class XcapEvent(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, XcapEvent, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, XcapEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_XcapEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.XcapEvent_getType(self) + def getXcapMessage(self): return _tinyWRAP.XcapEvent_getXcapMessage(self) +XcapEvent_swigregister = _tinyWRAP.XcapEvent_swigregister +XcapEvent_swigregister(XcapEvent) + +class XcapCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, XcapCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, XcapCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == XcapCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_XcapCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_XcapCallback + __del__ = lambda self : None; + def onEvent(self, *args): return _tinyWRAP.XcapCallback_onEvent(self, *args) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_XcapCallback(self) + return weakref_proxy(self) +XcapCallback_swigregister = _tinyWRAP.XcapCallback_swigregister +XcapCallback_swigregister(XcapCallback) + +class XcapStack(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, XcapStack, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, XcapStack, name) + __repr__ = _swig_repr + def __init__(self, *args): + this = _tinyWRAP.new_XcapStack(*args) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_XcapStack + __del__ = lambda self : None; + def registerAUID(self, *args): return _tinyWRAP.XcapStack_registerAUID(self, *args) + def start(self): return _tinyWRAP.XcapStack_start(self) + def setCredentials(self, *args): return _tinyWRAP.XcapStack_setCredentials(self, *args) + def setXcapRoot(self, *args): return _tinyWRAP.XcapStack_setXcapRoot(self, *args) + def setLocalIP(self, *args): return _tinyWRAP.XcapStack_setLocalIP(self, *args) + def setLocalPort(self, *args): return _tinyWRAP.XcapStack_setLocalPort(self, *args) + def addHeader(self, *args): return _tinyWRAP.XcapStack_addHeader(self, *args) + def removeHeader(self, *args): return _tinyWRAP.XcapStack_removeHeader(self, *args) + def setTimeout(self, *args): return _tinyWRAP.XcapStack_setTimeout(self, *args) + def getDocument(self, *args): return _tinyWRAP.XcapStack_getDocument(self, *args) + def getElement(self, *args): return _tinyWRAP.XcapStack_getElement(self, *args) + def getAttribute(self, *args): return _tinyWRAP.XcapStack_getAttribute(self, *args) + def deleteDocument(self, *args): return _tinyWRAP.XcapStack_deleteDocument(self, *args) + def deleteElement(self, *args): return _tinyWRAP.XcapStack_deleteElement(self, *args) + def deleteAttribute(self, *args): return _tinyWRAP.XcapStack_deleteAttribute(self, *args) + def putDocument(self, *args): return _tinyWRAP.XcapStack_putDocument(self, *args) + def putElement(self, *args): return _tinyWRAP.XcapStack_putElement(self, *args) + def putAttribute(self, *args): return _tinyWRAP.XcapStack_putAttribute(self, *args) + def stop(self): return _tinyWRAP.XcapStack_stop(self) +XcapStack_swigregister = _tinyWRAP.XcapStack_swigregister +XcapStack_swigregister(XcapStack) + +thttp_event_dialog_started = _tinyWRAP.thttp_event_dialog_started +thttp_event_message = _tinyWRAP.thttp_event_message +thttp_event_auth_failed = _tinyWRAP.thttp_event_auth_failed +thttp_event_closed = _tinyWRAP.thttp_event_closed +thttp_event_transport_error = _tinyWRAP.thttp_event_transport_error +thttp_event_dialog_terminated = _tinyWRAP.thttp_event_dialog_terminated +twrap_rpmessage_type_sms_none = _tinyWRAP.twrap_rpmessage_type_sms_none +twrap_rpmessage_type_sms_submit = _tinyWRAP.twrap_rpmessage_type_sms_submit +twrap_rpmessage_type_sms_deliver = _tinyWRAP.twrap_rpmessage_type_sms_deliver +twrap_rpmessage_type_sms_ack = _tinyWRAP.twrap_rpmessage_type_sms_ack +twrap_rpmessage_type_sms_error = _tinyWRAP.twrap_rpmessage_type_sms_error +twrap_sms_type_none = _tinyWRAP.twrap_sms_type_none +twrap_sms_type_rpdata = _tinyWRAP.twrap_sms_type_rpdata +twrap_sms_type_smma = _tinyWRAP.twrap_sms_type_smma +twrap_sms_type_ack = _tinyWRAP.twrap_sms_type_ack +twrap_sms_type_error = _tinyWRAP.twrap_sms_type_error +class RPMessage(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, RPMessage, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, RPMessage, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_RPMessage() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_RPMessage + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.RPMessage_getType(self) + def getPayloadLength(self): return _tinyWRAP.RPMessage_getPayloadLength(self) + def getPayload(self, *args): return _tinyWRAP.RPMessage_getPayload(self, *args) +RPMessage_swigregister = _tinyWRAP.RPMessage_swigregister +RPMessage_swigregister(RPMessage) + +class SMSData(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SMSData, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SMSData, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_SMSData() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_SMSData + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.SMSData_getType(self) + def getMR(self): return _tinyWRAP.SMSData_getMR(self) + def getPayloadLength(self): return _tinyWRAP.SMSData_getPayloadLength(self) + def getPayload(self, *args): return _tinyWRAP.SMSData_getPayload(self, *args) + def getOA(self): return _tinyWRAP.SMSData_getOA(self) + def getDA(self): return _tinyWRAP.SMSData_getDA(self) +SMSData_swigregister = _tinyWRAP.SMSData_swigregister +SMSData_swigregister(SMSData) + +class SMSEncoder(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, SMSEncoder, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, SMSEncoder, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_getmethods__["encodeSubmit"] = lambda x: _tinyWRAP.SMSEncoder_encodeSubmit + if _newclass:encodeSubmit = staticmethod(_tinyWRAP.SMSEncoder_encodeSubmit) + __swig_getmethods__["encodeDeliver"] = lambda x: _tinyWRAP.SMSEncoder_encodeDeliver + if _newclass:encodeDeliver = staticmethod(_tinyWRAP.SMSEncoder_encodeDeliver) + __swig_getmethods__["encodeACK"] = lambda x: _tinyWRAP.SMSEncoder_encodeACK + if _newclass:encodeACK = staticmethod(_tinyWRAP.SMSEncoder_encodeACK) + __swig_getmethods__["encodeError"] = lambda x: _tinyWRAP.SMSEncoder_encodeError + if _newclass:encodeError = staticmethod(_tinyWRAP.SMSEncoder_encodeError) + __swig_getmethods__["decode"] = lambda x: _tinyWRAP.SMSEncoder_decode + if _newclass:decode = staticmethod(_tinyWRAP.SMSEncoder_decode) + __swig_destroy__ = _tinyWRAP.delete_SMSEncoder + __del__ = lambda self : None; +SMSEncoder_swigregister = _tinyWRAP.SMSEncoder_swigregister +SMSEncoder_swigregister(SMSEncoder) + +def SMSEncoder_encodeSubmit(*args): + return _tinyWRAP.SMSEncoder_encodeSubmit(*args) +SMSEncoder_encodeSubmit = _tinyWRAP.SMSEncoder_encodeSubmit + +def SMSEncoder_encodeDeliver(*args): + return _tinyWRAP.SMSEncoder_encodeDeliver(*args) +SMSEncoder_encodeDeliver = _tinyWRAP.SMSEncoder_encodeDeliver + +def SMSEncoder_encodeACK(*args): + return _tinyWRAP.SMSEncoder_encodeACK(*args) +SMSEncoder_encodeACK = _tinyWRAP.SMSEncoder_encodeACK + +def SMSEncoder_encodeError(*args): + return _tinyWRAP.SMSEncoder_encodeError(*args) +SMSEncoder_encodeError = _tinyWRAP.SMSEncoder_encodeError + +def SMSEncoder_decode(*args): + return _tinyWRAP.SMSEncoder_decode(*args) +SMSEncoder_decode = _tinyWRAP.SMSEncoder_decode + +class MsrpMessage(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpMessage, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, MsrpMessage, name) + __repr__ = _swig_repr + def __init__(self): + this = _tinyWRAP.new_MsrpMessage() + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_MsrpMessage + __del__ = lambda self : None; + def isRequest(self): return _tinyWRAP.MsrpMessage_isRequest(self) + def getCode(self): return _tinyWRAP.MsrpMessage_getCode(self) + def getPhrase(self): return _tinyWRAP.MsrpMessage_getPhrase(self) + def getRequestType(self): return _tinyWRAP.MsrpMessage_getRequestType(self) + def getByteRange(self): return _tinyWRAP.MsrpMessage_getByteRange(self) + def isLastChunck(self): return _tinyWRAP.MsrpMessage_isLastChunck(self) + def isFirstChunck(self): return _tinyWRAP.MsrpMessage_isFirstChunck(self) + def isSuccessReport(self): return _tinyWRAP.MsrpMessage_isSuccessReport(self) + def getMsrpHeaderValue(self, *args): return _tinyWRAP.MsrpMessage_getMsrpHeaderValue(self, *args) + def getMsrpHeaderParamValue(self, *args): return _tinyWRAP.MsrpMessage_getMsrpHeaderParamValue(self, *args) + def getMsrpContentLength(self): return _tinyWRAP.MsrpMessage_getMsrpContentLength(self) + def getMsrpContent(self, *args): return _tinyWRAP.MsrpMessage_getMsrpContent(self, *args) +MsrpMessage_swigregister = _tinyWRAP.MsrpMessage_swigregister +MsrpMessage_swigregister(MsrpMessage) + +class MsrpEvent(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpEvent, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, MsrpEvent, name) + def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined") + __repr__ = _swig_repr + __swig_destroy__ = _tinyWRAP.delete_MsrpEvent + __del__ = lambda self : None; + def getType(self): return _tinyWRAP.MsrpEvent_getType(self) + def getSipSession(self): return _tinyWRAP.MsrpEvent_getSipSession(self) + def getMessage(self): return _tinyWRAP.MsrpEvent_getMessage(self) +MsrpEvent_swigregister = _tinyWRAP.MsrpEvent_swigregister +MsrpEvent_swigregister(MsrpEvent) + +class MsrpCallback(_object): + __swig_setmethods__ = {} + __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpCallback, name, value) + __swig_getmethods__ = {} + __getattr__ = lambda self, name: _swig_getattr(self, MsrpCallback, name) + __repr__ = _swig_repr + def __init__(self): + if self.__class__ == MsrpCallback: + _self = None + else: + _self = self + this = _tinyWRAP.new_MsrpCallback(_self, ) + try: self.this.append(this) + except: self.this = this + __swig_destroy__ = _tinyWRAP.delete_MsrpCallback + __del__ = lambda self : None; + def OnEvent(self, *args): return _tinyWRAP.MsrpCallback_OnEvent(self, *args) + def __disown__(self): + self.this.disown() + _tinyWRAP.disown_MsrpCallback(self) + return weakref_proxy(self) +MsrpCallback_swigregister = _tinyWRAP.MsrpCallback_swigregister +MsrpCallback_swigregister(MsrpCallback) + +tmsrp_NONE = _tinyWRAP.tmsrp_NONE +tmsrp_SEND = _tinyWRAP.tmsrp_SEND +tmsrp_REPORT = _tinyWRAP.tmsrp_REPORT +tmsrp_AUTH = _tinyWRAP.tmsrp_AUTH +tmsrp_event_type_none = _tinyWRAP.tmsrp_event_type_none +tmsrp_event_type_connected = _tinyWRAP.tmsrp_event_type_connected +tmsrp_event_type_disconnected = _tinyWRAP.tmsrp_event_type_disconnected +tmsrp_event_type_message = _tinyWRAP.tmsrp_event_type_message +# This file is compatible with both classic and new-style classes. + + diff --git a/bindings/python/tinyWRAP_wrap.cxx b/bindings/python/tinyWRAP_wrap.cxx new file mode 100644 index 0000000..1c61908 --- /dev/null +++ b/bindings/python/tinyWRAP_wrap.cxx @@ -0,0 +1,28268 @@ +/* ---------------------------------------------------------------------------- + * This file was automatically generated by SWIG (http://www.swig.org). + * Version 2.0.9 + * + * This file is not intended to be easily readable and contains a number of + * coding conventions designed to improve portability and efficiency. Do not make + * changes to this file unless you know what you are doing--modify the SWIG + * interface file instead. + * ----------------------------------------------------------------------------- */ + +#define SWIGPYTHON +#define SWIG_DIRECTORS +#define SWIG_PYTHON_DIRECTOR_NO_VTABLE + + +#ifdef __cplusplus +/* SwigValueWrapper is described in swig.swg */ +template<typename T> class SwigValueWrapper { + struct SwigMovePointer { + T *ptr; + SwigMovePointer(T *p) : ptr(p) { } + ~SwigMovePointer() { delete ptr; } + SwigMovePointer& operator=(SwigMovePointer& rhs) { T* oldptr = ptr; ptr = 0; delete oldptr; ptr = rhs.ptr; rhs.ptr = 0; return *this; } + } pointer; + SwigValueWrapper& operator=(const SwigValueWrapper<T>& rhs); + SwigValueWrapper(const SwigValueWrapper<T>& rhs); +public: + SwigValueWrapper() : pointer(0) { } + SwigValueWrapper& operator=(const T& t) { SwigMovePointer tmp(new T(t)); pointer = tmp; return *this; } + operator T&() const { return *pointer.ptr; } + T *operator&() { return pointer.ptr; } +}; + +template <typename T> T SwigValueInit() { + return T(); +} +#endif + +/* ----------------------------------------------------------------------------- + * This section contains generic SWIG labels for method/variable + * declarations/attributes, and other compiler dependent labels. + * ----------------------------------------------------------------------------- */ + +/* template workaround for compilers that cannot correctly implement the C++ standard */ +#ifndef SWIGTEMPLATEDISAMBIGUATOR +# if defined(__SUNPRO_CC) && (__SUNPRO_CC <= 0x560) +# define SWIGTEMPLATEDISAMBIGUATOR template +# elif defined(__HP_aCC) +/* Needed even with `aCC -AA' when `aCC -V' reports HP ANSI C++ B3910B A.03.55 */ +/* If we find a maximum version that requires this, the test would be __HP_aCC <= 35500 for A.03.55 */ +# define SWIGTEMPLATEDISAMBIGUATOR template +# else +# define SWIGTEMPLATEDISAMBIGUATOR +# endif +#endif + +/* inline attribute */ +#ifndef SWIGINLINE +# if defined(__cplusplus) || (defined(__GNUC__) && !defined(__STRICT_ANSI__)) +# define SWIGINLINE inline +# else +# define SWIGINLINE +# endif +#endif + +/* attribute recognised by some compilers to avoid 'unused' warnings */ +#ifndef SWIGUNUSED +# if defined(__GNUC__) +# if !(defined(__cplusplus)) || (__GNUC__ > 3 || (__GNUC__ == 3 && __GNUC_MINOR__ >= 4)) +# define SWIGUNUSED __attribute__ ((__unused__)) +# else +# define SWIGUNUSED +# endif +# elif defined(__ICC) +# define SWIGUNUSED __attribute__ ((__unused__)) +# else +# define SWIGUNUSED +# endif +#endif + +#ifndef SWIG_MSC_UNSUPPRESS_4505 +# if defined(_MSC_VER) +# pragma warning(disable : 4505) /* unreferenced local function has been removed */ +# endif +#endif + +#ifndef SWIGUNUSEDPARM +# ifdef __cplusplus +# define SWIGUNUSEDPARM(p) +# else +# define SWIGUNUSEDPARM(p) p SWIGUNUSED +# endif +#endif + +/* internal SWIG method */ +#ifndef SWIGINTERN +# define SWIGINTERN static SWIGUNUSED +#endif + +/* internal inline SWIG method */ +#ifndef SWIGINTERNINLINE +# define SWIGINTERNINLINE SWIGINTERN SWIGINLINE +#endif + +/* exporting methods */ +#if (__GNUC__ >= 4) || (__GNUC__ == 3 && __GNUC_MINOR__ >= 4) +# ifndef GCC_HASCLASSVISIBILITY +# define GCC_HASCLASSVISIBILITY +# endif +#endif + +#ifndef SWIGEXPORT +# if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__) +# if defined(STATIC_LINKED) +# define SWIGEXPORT +# else +# define SWIGEXPORT __declspec(dllexport) +# endif +# else +# if defined(__GNUC__) && defined(GCC_HASCLASSVISIBILITY) +# define SWIGEXPORT __attribute__ ((visibility("default"))) +# else +# define SWIGEXPORT +# endif +# endif +#endif + +/* calling conventions for Windows */ +#ifndef SWIGSTDCALL +# if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__) +# define SWIGSTDCALL __stdcall +# else +# define SWIGSTDCALL +# endif +#endif + +/* Deal with Microsoft's attempt at deprecating C standard runtime functions */ +#if !defined(SWIG_NO_CRT_SECURE_NO_DEPRECATE) && defined(_MSC_VER) && !defined(_CRT_SECURE_NO_DEPRECATE) +# define _CRT_SECURE_NO_DEPRECATE +#endif + +/* Deal with Microsoft's attempt at deprecating methods in the standard C++ library */ +#if !defined(SWIG_NO_SCL_SECURE_NO_DEPRECATE) && defined(_MSC_VER) && !defined(_SCL_SECURE_NO_DEPRECATE) +# define _SCL_SECURE_NO_DEPRECATE +#endif + + + +/* Python.h has to appear first */ +#include <Python.h> + +/* ----------------------------------------------------------------------------- + * swigrun.swg + * + * This file contains generic C API SWIG runtime support for pointer + * type checking. + * ----------------------------------------------------------------------------- */ + +/* This should only be incremented when either the layout of swig_type_info changes, + or for whatever reason, the runtime changes incompatibly */ +#define SWIG_RUNTIME_VERSION "4" + +/* define SWIG_TYPE_TABLE_NAME as "SWIG_TYPE_TABLE" */ +#ifdef SWIG_TYPE_TABLE +# define SWIG_QUOTE_STRING(x) #x +# define SWIG_EXPAND_AND_QUOTE_STRING(x) SWIG_QUOTE_STRING(x) +# define SWIG_TYPE_TABLE_NAME SWIG_EXPAND_AND_QUOTE_STRING(SWIG_TYPE_TABLE) +#else +# define SWIG_TYPE_TABLE_NAME +#endif + +/* + You can use the SWIGRUNTIME and SWIGRUNTIMEINLINE macros for + creating a static or dynamic library from the SWIG runtime code. + In 99.9% of the cases, SWIG just needs to declare them as 'static'. + + But only do this if strictly necessary, ie, if you have problems + with your compiler or suchlike. +*/ + +#ifndef SWIGRUNTIME +# define SWIGRUNTIME SWIGINTERN +#endif + +#ifndef SWIGRUNTIMEINLINE +# define SWIGRUNTIMEINLINE SWIGRUNTIME SWIGINLINE +#endif + +/* Generic buffer size */ +#ifndef SWIG_BUFFER_SIZE +# define SWIG_BUFFER_SIZE 1024 +#endif + +/* Flags for pointer conversions */ +#define SWIG_POINTER_DISOWN 0x1 +#define SWIG_CAST_NEW_MEMORY 0x2 + +/* Flags for new pointer objects */ +#define SWIG_POINTER_OWN 0x1 + + +/* + Flags/methods for returning states. + + The SWIG conversion methods, as ConvertPtr, return an integer + that tells if the conversion was successful or not. And if not, + an error code can be returned (see swigerrors.swg for the codes). + + Use the following macros/flags to set or process the returning + states. + + In old versions of SWIG, code such as the following was usually written: + + if (SWIG_ConvertPtr(obj,vptr,ty.flags) != -1) { + // success code + } else { + //fail code + } + + Now you can be more explicit: + + int res = SWIG_ConvertPtr(obj,vptr,ty.flags); + if (SWIG_IsOK(res)) { + // success code + } else { + // fail code + } + + which is the same really, but now you can also do + + Type *ptr; + int res = SWIG_ConvertPtr(obj,(void **)(&ptr),ty.flags); + if (SWIG_IsOK(res)) { + // success code + if (SWIG_IsNewObj(res) { + ... + delete *ptr; + } else { + ... + } + } else { + // fail code + } + + I.e., now SWIG_ConvertPtr can return new objects and you can + identify the case and take care of the deallocation. Of course that + also requires SWIG_ConvertPtr to return new result values, such as + + int SWIG_ConvertPtr(obj, ptr,...) { + if (<obj is ok>) { + if (<need new object>) { + *ptr = <ptr to new allocated object>; + return SWIG_NEWOBJ; + } else { + *ptr = <ptr to old object>; + return SWIG_OLDOBJ; + } + } else { + return SWIG_BADOBJ; + } + } + + Of course, returning the plain '0(success)/-1(fail)' still works, but you can be + more explicit by returning SWIG_BADOBJ, SWIG_ERROR or any of the + SWIG errors code. + + Finally, if the SWIG_CASTRANK_MODE is enabled, the result code + allows to return the 'cast rank', for example, if you have this + + int food(double) + int fooi(int); + + and you call + + food(1) // cast rank '1' (1 -> 1.0) + fooi(1) // cast rank '0' + + just use the SWIG_AddCast()/SWIG_CheckState() +*/ + +#define SWIG_OK (0) +#define SWIG_ERROR (-1) +#define SWIG_IsOK(r) (r >= 0) +#define SWIG_ArgError(r) ((r != SWIG_ERROR) ? r : SWIG_TypeError) + +/* The CastRankLimit says how many bits are used for the cast rank */ +#define SWIG_CASTRANKLIMIT (1 << 8) +/* The NewMask denotes the object was created (using new/malloc) */ +#define SWIG_NEWOBJMASK (SWIG_CASTRANKLIMIT << 1) +/* The TmpMask is for in/out typemaps that use temporal objects */ +#define SWIG_TMPOBJMASK (SWIG_NEWOBJMASK << 1) +/* Simple returning values */ +#define SWIG_BADOBJ (SWIG_ERROR) +#define SWIG_OLDOBJ (SWIG_OK) +#define SWIG_NEWOBJ (SWIG_OK | SWIG_NEWOBJMASK) +#define SWIG_TMPOBJ (SWIG_OK | SWIG_TMPOBJMASK) +/* Check, add and del mask methods */ +#define SWIG_AddNewMask(r) (SWIG_IsOK(r) ? (r | SWIG_NEWOBJMASK) : r) +#define SWIG_DelNewMask(r) (SWIG_IsOK(r) ? (r & ~SWIG_NEWOBJMASK) : r) +#define SWIG_IsNewObj(r) (SWIG_IsOK(r) && (r & SWIG_NEWOBJMASK)) +#define SWIG_AddTmpMask(r) (SWIG_IsOK(r) ? (r | SWIG_TMPOBJMASK) : r) +#define SWIG_DelTmpMask(r) (SWIG_IsOK(r) ? (r & ~SWIG_TMPOBJMASK) : r) +#define SWIG_IsTmpObj(r) (SWIG_IsOK(r) && (r & SWIG_TMPOBJMASK)) + +/* Cast-Rank Mode */ +#if defined(SWIG_CASTRANK_MODE) +# ifndef SWIG_TypeRank +# define SWIG_TypeRank unsigned long +# endif +# ifndef SWIG_MAXCASTRANK /* Default cast allowed */ +# define SWIG_MAXCASTRANK (2) +# endif +# define SWIG_CASTRANKMASK ((SWIG_CASTRANKLIMIT) -1) +# define SWIG_CastRank(r) (r & SWIG_CASTRANKMASK) +SWIGINTERNINLINE int SWIG_AddCast(int r) { + return SWIG_IsOK(r) ? ((SWIG_CastRank(r) < SWIG_MAXCASTRANK) ? (r + 1) : SWIG_ERROR) : r; +} +SWIGINTERNINLINE int SWIG_CheckState(int r) { + return SWIG_IsOK(r) ? SWIG_CastRank(r) + 1 : 0; +} +#else /* no cast-rank mode */ +# define SWIG_AddCast +# define SWIG_CheckState(r) (SWIG_IsOK(r) ? 1 : 0) +#endif + + +#include <string.h> + +#ifdef __cplusplus +extern "C" { +#endif + +typedef void *(*swig_converter_func)(void *, int *); +typedef struct swig_type_info *(*swig_dycast_func)(void **); + +/* Structure to store information on one type */ +typedef struct swig_type_info { + const char *name; /* mangled name of this type */ + const char *str; /* human readable name of this type */ + swig_dycast_func dcast; /* dynamic cast function down a hierarchy */ + struct swig_cast_info *cast; /* linked list of types that can cast into this type */ + void *clientdata; /* language specific type data */ + int owndata; /* flag if the structure owns the clientdata */ +} swig_type_info; + +/* Structure to store a type and conversion function used for casting */ +typedef struct swig_cast_info { + swig_type_info *type; /* pointer to type that is equivalent to this type */ + swig_converter_func converter; /* function to cast the void pointers */ + struct swig_cast_info *next; /* pointer to next cast in linked list */ + struct swig_cast_info *prev; /* pointer to the previous cast */ +} swig_cast_info; + +/* Structure used to store module information + * Each module generates one structure like this, and the runtime collects + * all of these structures and stores them in a circularly linked list.*/ +typedef struct swig_module_info { + swig_type_info **types; /* Array of pointers to swig_type_info structures that are in this module */ + size_t size; /* Number of types in this module */ + struct swig_module_info *next; /* Pointer to next element in circularly linked list */ + swig_type_info **type_initial; /* Array of initially generated type structures */ + swig_cast_info **cast_initial; /* Array of initially generated casting structures */ + void *clientdata; /* Language specific module data */ +} swig_module_info; + +/* + Compare two type names skipping the space characters, therefore + "char*" == "char *" and "Class<int>" == "Class<int >", etc. + + Return 0 when the two name types are equivalent, as in + strncmp, but skipping ' '. +*/ +SWIGRUNTIME int +SWIG_TypeNameComp(const char *f1, const char *l1, + const char *f2, const char *l2) { + for (;(f1 != l1) && (f2 != l2); ++f1, ++f2) { + while ((*f1 == ' ') && (f1 != l1)) ++f1; + while ((*f2 == ' ') && (f2 != l2)) ++f2; + if (*f1 != *f2) return (*f1 > *f2) ? 1 : -1; + } + return (int)((l1 - f1) - (l2 - f2)); +} + +/* + Check type equivalence in a name list like <name1>|<name2>|... + Return 0 if not equal, 1 if equal +*/ +SWIGRUNTIME int +SWIG_TypeEquiv(const char *nb, const char *tb) { + int equiv = 0; + const char* te = tb + strlen(tb); + const char* ne = nb; + while (!equiv && *ne) { + for (nb = ne; *ne; ++ne) { + if (*ne == '|') break; + } + equiv = (SWIG_TypeNameComp(nb, ne, tb, te) == 0) ? 1 : 0; + if (*ne) ++ne; + } + return equiv; +} + +/* + Check type equivalence in a name list like <name1>|<name2>|... + Return 0 if equal, -1 if nb < tb, 1 if nb > tb +*/ +SWIGRUNTIME int +SWIG_TypeCompare(const char *nb, const char *tb) { + int equiv = 0; + const char* te = tb + strlen(tb); + const char* ne = nb; + while (!equiv && *ne) { + for (nb = ne; *ne; ++ne) { + if (*ne == '|') break; + } + equiv = (SWIG_TypeNameComp(nb, ne, tb, te) == 0) ? 1 : 0; + if (*ne) ++ne; + } + return equiv; +} + + +/* + Check the typename +*/ +SWIGRUNTIME swig_cast_info * +SWIG_TypeCheck(const char *c, swig_type_info *ty) { + if (ty) { + swig_cast_info *iter = ty->cast; + while (iter) { + if (strcmp(iter->type->name, c) == 0) { + if (iter == ty->cast) + return iter; + /* Move iter to the top of the linked list */ + iter->prev->next = iter->next; + if (iter->next) + iter->next->prev = iter->prev; + iter->next = ty->cast; + iter->prev = 0; + if (ty->cast) ty->cast->prev = iter; + ty->cast = iter; + return iter; + } + iter = iter->next; + } + } + return 0; +} + +/* + Identical to SWIG_TypeCheck, except strcmp is replaced with a pointer comparison +*/ +SWIGRUNTIME swig_cast_info * +SWIG_TypeCheckStruct(swig_type_info *from, swig_type_info *ty) { + if (ty) { + swig_cast_info *iter = ty->cast; + while (iter) { + if (iter->type == from) { + if (iter == ty->cast) + return iter; + /* Move iter to the top of the linked list */ + iter->prev->next = iter->next; + if (iter->next) + iter->next->prev = iter->prev; + iter->next = ty->cast; + iter->prev = 0; + if (ty->cast) ty->cast->prev = iter; + ty->cast = iter; + return iter; + } + iter = iter->next; + } + } + return 0; +} + +/* + Cast a pointer up an inheritance hierarchy +*/ +SWIGRUNTIMEINLINE void * +SWIG_TypeCast(swig_cast_info *ty, void *ptr, int *newmemory) { + return ((!ty) || (!ty->converter)) ? ptr : (*ty->converter)(ptr, newmemory); +} + +/* + Dynamic pointer casting. Down an inheritance hierarchy +*/ +SWIGRUNTIME swig_type_info * +SWIG_TypeDynamicCast(swig_type_info *ty, void **ptr) { + swig_type_info *lastty = ty; + if (!ty || !ty->dcast) return ty; + while (ty && (ty->dcast)) { + ty = (*ty->dcast)(ptr); + if (ty) lastty = ty; + } + return lastty; +} + +/* + Return the name associated with this type +*/ +SWIGRUNTIMEINLINE const char * +SWIG_TypeName(const swig_type_info *ty) { + return ty->name; +} + +/* + Return the pretty name associated with this type, + that is an unmangled type name in a form presentable to the user. +*/ +SWIGRUNTIME const char * +SWIG_TypePrettyName(const swig_type_info *type) { + /* The "str" field contains the equivalent pretty names of the + type, separated by vertical-bar characters. We choose + to print the last name, as it is often (?) the most + specific. */ + if (!type) return NULL; + if (type->str != NULL) { + const char *last_name = type->str; + const char *s; + for (s = type->str; *s; s++) + if (*s == '|') last_name = s+1; + return last_name; + } + else + return type->name; +} + +/* + Set the clientdata field for a type +*/ +SWIGRUNTIME void +SWIG_TypeClientData(swig_type_info *ti, void *clientdata) { + swig_cast_info *cast = ti->cast; + /* if (ti->clientdata == clientdata) return; */ + ti->clientdata = clientdata; + + while (cast) { + if (!cast->converter) { + swig_type_info *tc = cast->type; + if (!tc->clientdata) { + SWIG_TypeClientData(tc, clientdata); + } + } + cast = cast->next; + } +} +SWIGRUNTIME void +SWIG_TypeNewClientData(swig_type_info *ti, void *clientdata) { + SWIG_TypeClientData(ti, clientdata); + ti->owndata = 1; +} + +/* + Search for a swig_type_info structure only by mangled name + Search is a O(log #types) + + We start searching at module start, and finish searching when start == end. + Note: if start == end at the beginning of the function, we go all the way around + the circular list. +*/ +SWIGRUNTIME swig_type_info * +SWIG_MangledTypeQueryModule(swig_module_info *start, + swig_module_info *end, + const char *name) { + swig_module_info *iter = start; + do { + if (iter->size) { + register size_t l = 0; + register size_t r = iter->size - 1; + do { + /* since l+r >= 0, we can (>> 1) instead (/ 2) */ + register size_t i = (l + r) >> 1; + const char *iname = iter->types[i]->name; + if (iname) { + register int compare = strcmp(name, iname); + if (compare == 0) { + return iter->types[i]; + } else if (compare < 0) { + if (i) { + r = i - 1; + } else { + break; + } + } else if (compare > 0) { + l = i + 1; + } + } else { + break; /* should never happen */ + } + } while (l <= r); + } + iter = iter->next; + } while (iter != end); + return 0; +} + +/* + Search for a swig_type_info structure for either a mangled name or a human readable name. + It first searches the mangled names of the types, which is a O(log #types) + If a type is not found it then searches the human readable names, which is O(#types). + + We start searching at module start, and finish searching when start == end. + Note: if start == end at the beginning of the function, we go all the way around + the circular list. +*/ +SWIGRUNTIME swig_type_info * +SWIG_TypeQueryModule(swig_module_info *start, + swig_module_info *end, + const char *name) { + /* STEP 1: Search the name field using binary search */ + swig_type_info *ret = SWIG_MangledTypeQueryModule(start, end, name); + if (ret) { + return ret; + } else { + /* STEP 2: If the type hasn't been found, do a complete search + of the str field (the human readable name) */ + swig_module_info *iter = start; + do { + register size_t i = 0; + for (; i < iter->size; ++i) { + if (iter->types[i]->str && (SWIG_TypeEquiv(iter->types[i]->str, name))) + return iter->types[i]; + } + iter = iter->next; + } while (iter != end); + } + + /* neither found a match */ + return 0; +} + +/* + Pack binary data into a string +*/ +SWIGRUNTIME char * +SWIG_PackData(char *c, void *ptr, size_t sz) { + static const char hex[17] = "0123456789abcdef"; + register const unsigned char *u = (unsigned char *) ptr; + register const unsigned char *eu = u + sz; + for (; u != eu; ++u) { + register unsigned char uu = *u; + *(c++) = hex[(uu & 0xf0) >> 4]; + *(c++) = hex[uu & 0xf]; + } + return c; +} + +/* + Unpack binary data from a string +*/ +SWIGRUNTIME const char * +SWIG_UnpackData(const char *c, void *ptr, size_t sz) { + register unsigned char *u = (unsigned char *) ptr; + register const unsigned char *eu = u + sz; + for (; u != eu; ++u) { + register char d = *(c++); + register unsigned char uu; + if ((d >= '0') && (d <= '9')) + uu = ((d - '0') << 4); + else if ((d >= 'a') && (d <= 'f')) + uu = ((d - ('a'-10)) << 4); + else + return (char *) 0; + d = *(c++); + if ((d >= '0') && (d <= '9')) + uu |= (d - '0'); + else if ((d >= 'a') && (d <= 'f')) + uu |= (d - ('a'-10)); + else + return (char *) 0; + *u = uu; + } + return c; +} + +/* + Pack 'void *' into a string buffer. +*/ +SWIGRUNTIME char * +SWIG_PackVoidPtr(char *buff, void *ptr, const char *name, size_t bsz) { + char *r = buff; + if ((2*sizeof(void *) + 2) > bsz) return 0; + *(r++) = '_'; + r = SWIG_PackData(r,&ptr,sizeof(void *)); + if (strlen(name) + 1 > (bsz - (r - buff))) return 0; + strcpy(r,name); + return buff; +} + +SWIGRUNTIME const char * +SWIG_UnpackVoidPtr(const char *c, void **ptr, const char *name) { + if (*c != '_') { + if (strcmp(c,"NULL") == 0) { + *ptr = (void *) 0; + return name; + } else { + return 0; + } + } + return SWIG_UnpackData(++c,ptr,sizeof(void *)); +} + +SWIGRUNTIME char * +SWIG_PackDataName(char *buff, void *ptr, size_t sz, const char *name, size_t bsz) { + char *r = buff; + size_t lname = (name ? strlen(name) : 0); + if ((2*sz + 2 + lname) > bsz) return 0; + *(r++) = '_'; + r = SWIG_PackData(r,ptr,sz); + if (lname) { + strncpy(r,name,lname+1); + } else { + *r = 0; + } + return buff; +} + +SWIGRUNTIME const char * +SWIG_UnpackDataName(const char *c, void *ptr, size_t sz, const char *name) { + if (*c != '_') { + if (strcmp(c,"NULL") == 0) { + memset(ptr,0,sz); + return name; + } else { + return 0; + } + } + return SWIG_UnpackData(++c,ptr,sz); +} + +#ifdef __cplusplus +} +#endif + +/* Errors in SWIG */ +#define SWIG_UnknownError -1 +#define SWIG_IOError -2 +#define SWIG_RuntimeError -3 +#define SWIG_IndexError -4 +#define SWIG_TypeError -5 +#define SWIG_DivisionByZero -6 +#define SWIG_OverflowError -7 +#define SWIG_SyntaxError -8 +#define SWIG_ValueError -9 +#define SWIG_SystemError -10 +#define SWIG_AttributeError -11 +#define SWIG_MemoryError -12 +#define SWIG_NullReferenceError -13 + + + +/* Compatibility macros for Python 3 */ +#if PY_VERSION_HEX >= 0x03000000 + +#define PyClass_Check(obj) PyObject_IsInstance(obj, (PyObject *)&PyType_Type) +#define PyInt_Check(x) PyLong_Check(x) +#define PyInt_AsLong(x) PyLong_AsLong(x) +#define PyInt_FromLong(x) PyLong_FromLong(x) +#define PyInt_FromSize_t(x) PyLong_FromSize_t(x) +#define PyString_Check(name) PyBytes_Check(name) +#define PyString_FromString(x) PyUnicode_FromString(x) +#define PyString_Format(fmt, args) PyUnicode_Format(fmt, args) +#define PyString_AsString(str) PyBytes_AsString(str) +#define PyString_Size(str) PyBytes_Size(str) +#define PyString_InternFromString(key) PyUnicode_InternFromString(key) +#define Py_TPFLAGS_HAVE_CLASS Py_TPFLAGS_BASETYPE +#define PyString_AS_STRING(x) PyUnicode_AS_STRING(x) +#define _PyLong_FromSsize_t(x) PyLong_FromSsize_t(x) + +#endif + +#ifndef Py_TYPE +# define Py_TYPE(op) ((op)->ob_type) +#endif + +/* SWIG APIs for compatibility of both Python 2 & 3 */ + +#if PY_VERSION_HEX >= 0x03000000 +# define SWIG_Python_str_FromFormat PyUnicode_FromFormat +#else +# define SWIG_Python_str_FromFormat PyString_FromFormat +#endif + + +/* Warning: This function will allocate a new string in Python 3, + * so please call SWIG_Python_str_DelForPy3(x) to free the space. + */ +SWIGINTERN char* +SWIG_Python_str_AsChar(PyObject *str) +{ +#if PY_VERSION_HEX >= 0x03000000 + char *cstr; + char *newstr; + Py_ssize_t len; + str = PyUnicode_AsUTF8String(str); + PyBytes_AsStringAndSize(str, &cstr, &len); + newstr = (char *) malloc(len+1); + memcpy(newstr, cstr, len+1); + Py_XDECREF(str); + return newstr; +#else + return PyString_AsString(str); +#endif +} + +#if PY_VERSION_HEX >= 0x03000000 +# define SWIG_Python_str_DelForPy3(x) free( (void*) (x) ) +#else +# define SWIG_Python_str_DelForPy3(x) +#endif + + +SWIGINTERN PyObject* +SWIG_Python_str_FromChar(const char *c) +{ +#if PY_VERSION_HEX >= 0x03000000 + return PyUnicode_FromString(c); +#else + return PyString_FromString(c); +#endif +} + +/* Add PyOS_snprintf for old Pythons */ +#if PY_VERSION_HEX < 0x02020000 +# if defined(_MSC_VER) || defined(__BORLANDC__) || defined(_WATCOM) +# define PyOS_snprintf _snprintf +# else +# define PyOS_snprintf snprintf +# endif +#endif + +/* A crude PyString_FromFormat implementation for old Pythons */ +#if PY_VERSION_HEX < 0x02020000 + +#ifndef SWIG_PYBUFFER_SIZE +# define SWIG_PYBUFFER_SIZE 1024 +#endif + +static PyObject * +PyString_FromFormat(const char *fmt, ...) { + va_list ap; + char buf[SWIG_PYBUFFER_SIZE * 2]; + int res; + va_start(ap, fmt); + res = vsnprintf(buf, sizeof(buf), fmt, ap); + va_end(ap); + return (res < 0 || res >= (int)sizeof(buf)) ? 0 : PyString_FromString(buf); +} +#endif + +/* Add PyObject_Del for old Pythons */ +#if PY_VERSION_HEX < 0x01060000 +# define PyObject_Del(op) PyMem_DEL((op)) +#endif +#ifndef PyObject_DEL +# define PyObject_DEL PyObject_Del +#endif + +/* A crude PyExc_StopIteration exception for old Pythons */ +#if PY_VERSION_HEX < 0x02020000 +# ifndef PyExc_StopIteration +# define PyExc_StopIteration PyExc_RuntimeError +# endif +# ifndef PyObject_GenericGetAttr +# define PyObject_GenericGetAttr 0 +# endif +#endif + +/* Py_NotImplemented is defined in 2.1 and up. */ +#if PY_VERSION_HEX < 0x02010000 +# ifndef Py_NotImplemented +# define Py_NotImplemented PyExc_RuntimeError +# endif +#endif + +/* A crude PyString_AsStringAndSize implementation for old Pythons */ +#if PY_VERSION_HEX < 0x02010000 +# ifndef PyString_AsStringAndSize +# define PyString_AsStringAndSize(obj, s, len) {*s = PyString_AsString(obj); *len = *s ? strlen(*s) : 0;} +# endif +#endif + +/* PySequence_Size for old Pythons */ +#if PY_VERSION_HEX < 0x02000000 +# ifndef PySequence_Size +# define PySequence_Size PySequence_Length +# endif +#endif + +/* PyBool_FromLong for old Pythons */ +#if PY_VERSION_HEX < 0x02030000 +static +PyObject *PyBool_FromLong(long ok) +{ + PyObject *result = ok ? Py_True : Py_False; + Py_INCREF(result); + return result; +} +#endif + +/* Py_ssize_t for old Pythons */ +/* This code is as recommended by: */ +/* http://www.python.org/dev/peps/pep-0353/#conversion-guidelines */ +#if PY_VERSION_HEX < 0x02050000 && !defined(PY_SSIZE_T_MIN) +typedef int Py_ssize_t; +# define PY_SSIZE_T_MAX INT_MAX +# define PY_SSIZE_T_MIN INT_MIN +typedef inquiry lenfunc; +typedef intargfunc ssizeargfunc; +typedef intintargfunc ssizessizeargfunc; +typedef intobjargproc ssizeobjargproc; +typedef intintobjargproc ssizessizeobjargproc; +typedef getreadbufferproc readbufferproc; +typedef getwritebufferproc writebufferproc; +typedef getsegcountproc segcountproc; +typedef getcharbufferproc charbufferproc; +static long PyNumber_AsSsize_t (PyObject *x, void *SWIGUNUSEDPARM(exc)) +{ + long result = 0; + PyObject *i = PyNumber_Int(x); + if (i) { + result = PyInt_AsLong(i); + Py_DECREF(i); + } + return result; +} +#endif + +#if PY_VERSION_HEX < 0x02050000 +#define PyInt_FromSize_t(x) PyInt_FromLong((long)x) +#endif + +#if PY_VERSION_HEX < 0x02040000 +#define Py_VISIT(op) \ + do { \ + if (op) { \ + int vret = visit((op), arg); \ + if (vret) \ + return vret; \ + } \ + } while (0) +#endif + +#if PY_VERSION_HEX < 0x02030000 +typedef struct { + PyTypeObject type; + PyNumberMethods as_number; + PyMappingMethods as_mapping; + PySequenceMethods as_sequence; + PyBufferProcs as_buffer; + PyObject *name, *slots; +} PyHeapTypeObject; +#endif + +#if PY_VERSION_HEX < 0x02030000 +typedef destructor freefunc; +#endif + +#if ((PY_MAJOR_VERSION == 2 && PY_MINOR_VERSION > 6) || \ + (PY_MAJOR_VERSION == 3 && PY_MINOR_VERSION > 0) || \ + (PY_MAJOR_VERSION > 3)) +# define SWIGPY_USE_CAPSULE +# define SWIGPY_CAPSULE_NAME ((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION ".type_pointer_capsule" SWIG_TYPE_TABLE_NAME) +#endif + +#if PY_VERSION_HEX < 0x03020000 +#define PyDescr_TYPE(x) (((PyDescrObject *)(x))->d_type) +#define PyDescr_NAME(x) (((PyDescrObject *)(x))->d_name) +#endif + +/* ----------------------------------------------------------------------------- + * error manipulation + * ----------------------------------------------------------------------------- */ + +SWIGRUNTIME PyObject* +SWIG_Python_ErrorType(int code) { + PyObject* type = 0; + switch(code) { + case SWIG_MemoryError: + type = PyExc_MemoryError; + break; + case SWIG_IOError: + type = PyExc_IOError; + break; + case SWIG_RuntimeError: + type = PyExc_RuntimeError; + break; + case SWIG_IndexError: + type = PyExc_IndexError; + break; + case SWIG_TypeError: + type = PyExc_TypeError; + break; + case SWIG_DivisionByZero: + type = PyExc_ZeroDivisionError; + break; + case SWIG_OverflowError: + type = PyExc_OverflowError; + break; + case SWIG_SyntaxError: + type = PyExc_SyntaxError; + break; + case SWIG_ValueError: + type = PyExc_ValueError; + break; + case SWIG_SystemError: + type = PyExc_SystemError; + break; + case SWIG_AttributeError: + type = PyExc_AttributeError; + break; + default: + type = PyExc_RuntimeError; + } + return type; +} + + +SWIGRUNTIME void +SWIG_Python_AddErrorMsg(const char* mesg) +{ + PyObject *type = 0; + PyObject *value = 0; + PyObject *traceback = 0; + + if (PyErr_Occurred()) PyErr_Fetch(&type, &value, &traceback); + if (value) { + char *tmp; + PyObject *old_str = PyObject_Str(value); + PyErr_Clear(); + Py_XINCREF(type); + + PyErr_Format(type, "%s %s", tmp = SWIG_Python_str_AsChar(old_str), mesg); + SWIG_Python_str_DelForPy3(tmp); + Py_DECREF(old_str); + Py_DECREF(value); + } else { + PyErr_SetString(PyExc_RuntimeError, mesg); + } +} + +#if defined(SWIG_PYTHON_NO_THREADS) +# if defined(SWIG_PYTHON_THREADS) +# undef SWIG_PYTHON_THREADS +# endif +#endif +#if defined(SWIG_PYTHON_THREADS) /* Threading support is enabled */ +# if !defined(SWIG_PYTHON_USE_GIL) && !defined(SWIG_PYTHON_NO_USE_GIL) +# if (PY_VERSION_HEX >= 0x02030000) /* For 2.3 or later, use the PyGILState calls */ +# define SWIG_PYTHON_USE_GIL +# endif +# endif +# if defined(SWIG_PYTHON_USE_GIL) /* Use PyGILState threads calls */ +# ifndef SWIG_PYTHON_INITIALIZE_THREADS +# define SWIG_PYTHON_INITIALIZE_THREADS PyEval_InitThreads() +# endif +# ifdef __cplusplus /* C++ code */ + class SWIG_Python_Thread_Block { + bool status; + PyGILState_STATE state; + public: + void end() { if (status) { PyGILState_Release(state); status = false;} } + SWIG_Python_Thread_Block() : status(true), state(PyGILState_Ensure()) {} + ~SWIG_Python_Thread_Block() { end(); } + }; + class SWIG_Python_Thread_Allow { + bool status; + PyThreadState *save; + public: + void end() { if (status) { PyEval_RestoreThread(save); status = false; }} + SWIG_Python_Thread_Allow() : status(true), save(PyEval_SaveThread()) {} + ~SWIG_Python_Thread_Allow() { end(); } + }; +# define SWIG_PYTHON_THREAD_BEGIN_BLOCK SWIG_Python_Thread_Block _swig_thread_block +# define SWIG_PYTHON_THREAD_END_BLOCK _swig_thread_block.end() +# define SWIG_PYTHON_THREAD_BEGIN_ALLOW SWIG_Python_Thread_Allow _swig_thread_allow +# define SWIG_PYTHON_THREAD_END_ALLOW _swig_thread_allow.end() +# else /* C code */ +# define SWIG_PYTHON_THREAD_BEGIN_BLOCK PyGILState_STATE _swig_thread_block = PyGILState_Ensure() +# define SWIG_PYTHON_THREAD_END_BLOCK PyGILState_Release(_swig_thread_block) +# define SWIG_PYTHON_THREAD_BEGIN_ALLOW PyThreadState *_swig_thread_allow = PyEval_SaveThread() +# define SWIG_PYTHON_THREAD_END_ALLOW PyEval_RestoreThread(_swig_thread_allow) +# endif +# else /* Old thread way, not implemented, user must provide it */ +# if !defined(SWIG_PYTHON_INITIALIZE_THREADS) +# define SWIG_PYTHON_INITIALIZE_THREADS +# endif +# if !defined(SWIG_PYTHON_THREAD_BEGIN_BLOCK) +# define SWIG_PYTHON_THREAD_BEGIN_BLOCK +# endif +# if !defined(SWIG_PYTHON_THREAD_END_BLOCK) +# define SWIG_PYTHON_THREAD_END_BLOCK +# endif +# if !defined(SWIG_PYTHON_THREAD_BEGIN_ALLOW) +# define SWIG_PYTHON_THREAD_BEGIN_ALLOW +# endif +# if !defined(SWIG_PYTHON_THREAD_END_ALLOW) +# define SWIG_PYTHON_THREAD_END_ALLOW +# endif +# endif +#else /* No thread support */ +# define SWIG_PYTHON_INITIALIZE_THREADS +# define SWIG_PYTHON_THREAD_BEGIN_BLOCK +# define SWIG_PYTHON_THREAD_END_BLOCK +# define SWIG_PYTHON_THREAD_BEGIN_ALLOW +# define SWIG_PYTHON_THREAD_END_ALLOW +#endif + +/* ----------------------------------------------------------------------------- + * Python API portion that goes into the runtime + * ----------------------------------------------------------------------------- */ + +#ifdef __cplusplus +extern "C" { +#endif + +/* ----------------------------------------------------------------------------- + * Constant declarations + * ----------------------------------------------------------------------------- */ + +/* Constant Types */ +#define SWIG_PY_POINTER 4 +#define SWIG_PY_BINARY 5 + +/* Constant information structure */ +typedef struct swig_const_info { + int type; + char *name; + long lvalue; + double dvalue; + void *pvalue; + swig_type_info **ptype; +} swig_const_info; + + +/* ----------------------------------------------------------------------------- + * Wrapper of PyInstanceMethod_New() used in Python 3 + * It is exported to the generated module, used for -fastproxy + * ----------------------------------------------------------------------------- */ +#if PY_VERSION_HEX >= 0x03000000 +SWIGRUNTIME PyObject* SWIG_PyInstanceMethod_New(PyObject *SWIGUNUSEDPARM(self), PyObject *func) +{ + return PyInstanceMethod_New(func); +} +#else +SWIGRUNTIME PyObject* SWIG_PyInstanceMethod_New(PyObject *SWIGUNUSEDPARM(self), PyObject *SWIGUNUSEDPARM(func)) +{ + return NULL; +} +#endif + +#ifdef __cplusplus +} +#endif + + +/* ----------------------------------------------------------------------------- + * pyrun.swg + * + * This file contains the runtime support for Python modules + * and includes code for managing global variables and pointer + * type checking. + * + * ----------------------------------------------------------------------------- */ + +/* Common SWIG API */ + +/* for raw pointers */ +#define SWIG_Python_ConvertPtr(obj, pptr, type, flags) SWIG_Python_ConvertPtrAndOwn(obj, pptr, type, flags, 0) +#define SWIG_ConvertPtr(obj, pptr, type, flags) SWIG_Python_ConvertPtr(obj, pptr, type, flags) +#define SWIG_ConvertPtrAndOwn(obj,pptr,type,flags,own) SWIG_Python_ConvertPtrAndOwn(obj, pptr, type, flags, own) + +#ifdef SWIGPYTHON_BUILTIN +#define SWIG_NewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(self, ptr, type, flags) +#else +#define SWIG_NewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(NULL, ptr, type, flags) +#endif + +#define SWIG_InternalNewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(NULL, ptr, type, flags) + +#define SWIG_CheckImplicit(ty) SWIG_Python_CheckImplicit(ty) +#define SWIG_AcquirePtr(ptr, src) SWIG_Python_AcquirePtr(ptr, src) +#define swig_owntype int + +/* for raw packed data */ +#define SWIG_ConvertPacked(obj, ptr, sz, ty) SWIG_Python_ConvertPacked(obj, ptr, sz, ty) +#define SWIG_NewPackedObj(ptr, sz, type) SWIG_Python_NewPackedObj(ptr, sz, type) + +/* for class or struct pointers */ +#define SWIG_ConvertInstance(obj, pptr, type, flags) SWIG_ConvertPtr(obj, pptr, type, flags) +#define SWIG_NewInstanceObj(ptr, type, flags) SWIG_NewPointerObj(ptr, type, flags) + +/* for C or C++ function pointers */ +#define SWIG_ConvertFunctionPtr(obj, pptr, type) SWIG_Python_ConvertFunctionPtr(obj, pptr, type) +#define SWIG_NewFunctionPtrObj(ptr, type) SWIG_Python_NewPointerObj(NULL, ptr, type, 0) + +/* for C++ member pointers, ie, member methods */ +#define SWIG_ConvertMember(obj, ptr, sz, ty) SWIG_Python_ConvertPacked(obj, ptr, sz, ty) +#define SWIG_NewMemberObj(ptr, sz, type) SWIG_Python_NewPackedObj(ptr, sz, type) + + +/* Runtime API */ + +#define SWIG_GetModule(clientdata) SWIG_Python_GetModule(clientdata) +#define SWIG_SetModule(clientdata, pointer) SWIG_Python_SetModule(pointer) +#define SWIG_NewClientData(obj) SwigPyClientData_New(obj) + +#define SWIG_SetErrorObj SWIG_Python_SetErrorObj +#define SWIG_SetErrorMsg SWIG_Python_SetErrorMsg +#define SWIG_ErrorType(code) SWIG_Python_ErrorType(code) +#define SWIG_Error(code, msg) SWIG_Python_SetErrorMsg(SWIG_ErrorType(code), msg) +#define SWIG_fail goto fail + + +/* Runtime API implementation */ + +/* Error manipulation */ + +SWIGINTERN void +SWIG_Python_SetErrorObj(PyObject *errtype, PyObject *obj) { + SWIG_PYTHON_THREAD_BEGIN_BLOCK; + PyErr_SetObject(errtype, obj); + Py_DECREF(obj); + SWIG_PYTHON_THREAD_END_BLOCK; +} + +SWIGINTERN void +SWIG_Python_SetErrorMsg(PyObject *errtype, const char *msg) { + SWIG_PYTHON_THREAD_BEGIN_BLOCK; + PyErr_SetString(errtype, msg); + SWIG_PYTHON_THREAD_END_BLOCK; +} + +#define SWIG_Python_Raise(obj, type, desc) SWIG_Python_SetErrorObj(SWIG_Python_ExceptionType(desc), obj) + +/* Set a constant value */ + +#if defined(SWIGPYTHON_BUILTIN) + +SWIGINTERN void +SwigPyBuiltin_AddPublicSymbol(PyObject *seq, const char *key) { + PyObject *s = PyString_InternFromString(key); + PyList_Append(seq, s); + Py_DECREF(s); +} + +SWIGINTERN void +SWIG_Python_SetConstant(PyObject *d, PyObject *public_interface, const char *name, PyObject *obj) { +#if PY_VERSION_HEX < 0x02030000 + PyDict_SetItemString(d, (char *)name, obj); +#else + PyDict_SetItemString(d, name, obj); +#endif + Py_DECREF(obj); + if (public_interface) + SwigPyBuiltin_AddPublicSymbol(public_interface, name); +} + +#else + +SWIGINTERN void +SWIG_Python_SetConstant(PyObject *d, const char *name, PyObject *obj) { +#if PY_VERSION_HEX < 0x02030000 + PyDict_SetItemString(d, (char *)name, obj); +#else + PyDict_SetItemString(d, name, obj); +#endif + Py_DECREF(obj); +} + +#endif + +/* Append a value to the result obj */ + +SWIGINTERN PyObject* +SWIG_Python_AppendOutput(PyObject* result, PyObject* obj) { +#if !defined(SWIG_PYTHON_OUTPUT_TUPLE) + if (!result) { + result = obj; + } else if (result == Py_None) { + Py_DECREF(result); + result = obj; + } else { + if (!PyList_Check(result)) { + PyObject *o2 = result; + result = PyList_New(1); + PyList_SetItem(result, 0, o2); + } + PyList_Append(result,obj); + Py_DECREF(obj); + } + return result; +#else + PyObject* o2; + PyObject* o3; + if (!result) { + result = obj; + } else if (result == Py_None) { + Py_DECREF(result); + result = obj; + } else { + if (!PyTuple_Check(result)) { + o2 = result; + result = PyTuple_New(1); + PyTuple_SET_ITEM(result, 0, o2); + } + o3 = PyTuple_New(1); + PyTuple_SET_ITEM(o3, 0, obj); + o2 = result; + result = PySequence_Concat(o2, o3); + Py_DECREF(o2); + Py_DECREF(o3); + } + return result; +#endif +} + +/* Unpack the argument tuple */ + +SWIGINTERN int +SWIG_Python_UnpackTuple(PyObject *args, const char *name, Py_ssize_t min, Py_ssize_t max, PyObject **objs) +{ + if (!args) { + if (!min && !max) { + return 1; + } else { + PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got none", + name, (min == max ? "" : "at least "), (int)min); + return 0; + } + } + if (!PyTuple_Check(args)) { + if (min <= 1 && max >= 1) { + register int i; + objs[0] = args; + for (i = 1; i < max; ++i) { + objs[i] = 0; + } + return 2; + } + PyErr_SetString(PyExc_SystemError, "UnpackTuple() argument list is not a tuple"); + return 0; + } else { + register Py_ssize_t l = PyTuple_GET_SIZE(args); + if (l < min) { + PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got %d", + name, (min == max ? "" : "at least "), (int)min, (int)l); + return 0; + } else if (l > max) { + PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got %d", + name, (min == max ? "" : "at most "), (int)max, (int)l); + return 0; + } else { + register int i; + for (i = 0; i < l; ++i) { + objs[i] = PyTuple_GET_ITEM(args, i); + } + for (; l < max; ++l) { + objs[l] = 0; + } + return i + 1; + } + } +} + +/* A functor is a function object with one single object argument */ +#if PY_VERSION_HEX >= 0x02020000 +#define SWIG_Python_CallFunctor(functor, obj) PyObject_CallFunctionObjArgs(functor, obj, NULL); +#else +#define SWIG_Python_CallFunctor(functor, obj) PyObject_CallFunction(functor, "O", obj); +#endif + +/* + Helper for static pointer initialization for both C and C++ code, for example + static PyObject *SWIG_STATIC_POINTER(MyVar) = NewSomething(...); +*/ +#ifdef __cplusplus +#define SWIG_STATIC_POINTER(var) var +#else +#define SWIG_STATIC_POINTER(var) var = 0; if (!var) var +#endif + +/* ----------------------------------------------------------------------------- + * Pointer declarations + * ----------------------------------------------------------------------------- */ + +/* Flags for new pointer objects */ +#define SWIG_POINTER_NOSHADOW (SWIG_POINTER_OWN << 1) +#define SWIG_POINTER_NEW (SWIG_POINTER_NOSHADOW | SWIG_POINTER_OWN) + +#define SWIG_POINTER_IMPLICIT_CONV (SWIG_POINTER_DISOWN << 1) + +#define SWIG_BUILTIN_TP_INIT (SWIG_POINTER_OWN << 2) +#define SWIG_BUILTIN_INIT (SWIG_BUILTIN_TP_INIT | SWIG_POINTER_OWN) + +#ifdef __cplusplus +extern "C" { +#endif + +/* How to access Py_None */ +#if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__) +# ifndef SWIG_PYTHON_NO_BUILD_NONE +# ifndef SWIG_PYTHON_BUILD_NONE +# define SWIG_PYTHON_BUILD_NONE +# endif +# endif +#endif + +#ifdef SWIG_PYTHON_BUILD_NONE +# ifdef Py_None +# undef Py_None +# define Py_None SWIG_Py_None() +# endif +SWIGRUNTIMEINLINE PyObject * +_SWIG_Py_None(void) +{ + PyObject *none = Py_BuildValue((char*)""); + Py_DECREF(none); + return none; +} +SWIGRUNTIME PyObject * +SWIG_Py_None(void) +{ + static PyObject *SWIG_STATIC_POINTER(none) = _SWIG_Py_None(); + return none; +} +#endif + +/* The python void return value */ + +SWIGRUNTIMEINLINE PyObject * +SWIG_Py_Void(void) +{ + PyObject *none = Py_None; + Py_INCREF(none); + return none; +} + +/* SwigPyClientData */ + +typedef struct { + PyObject *klass; + PyObject *newraw; + PyObject *newargs; + PyObject *destroy; + int delargs; + int implicitconv; + PyTypeObject *pytype; +} SwigPyClientData; + +SWIGRUNTIMEINLINE int +SWIG_Python_CheckImplicit(swig_type_info *ty) +{ + SwigPyClientData *data = (SwigPyClientData *)ty->clientdata; + return data ? data->implicitconv : 0; +} + +SWIGRUNTIMEINLINE PyObject * +SWIG_Python_ExceptionType(swig_type_info *desc) { + SwigPyClientData *data = desc ? (SwigPyClientData *) desc->clientdata : 0; + PyObject *klass = data ? data->klass : 0; + return (klass ? klass : PyExc_RuntimeError); +} + + +SWIGRUNTIME SwigPyClientData * +SwigPyClientData_New(PyObject* obj) +{ + if (!obj) { + return 0; + } else { + SwigPyClientData *data = (SwigPyClientData *)malloc(sizeof(SwigPyClientData)); + /* the klass element */ + data->klass = obj; + Py_INCREF(data->klass); + /* the newraw method and newargs arguments used to create a new raw instance */ + if (PyClass_Check(obj)) { + data->newraw = 0; + data->newargs = obj; + Py_INCREF(obj); + } else { +#if (PY_VERSION_HEX < 0x02020000) + data->newraw = 0; +#else + data->newraw = PyObject_GetAttrString(data->klass, (char *)"__new__"); +#endif + if (data->newraw) { + Py_INCREF(data->newraw); + data->newargs = PyTuple_New(1); + PyTuple_SetItem(data->newargs, 0, obj); + } else { + data->newargs = obj; + } + Py_INCREF(data->newargs); + } + /* the destroy method, aka as the C++ delete method */ + data->destroy = PyObject_GetAttrString(data->klass, (char *)"__swig_destroy__"); + if (PyErr_Occurred()) { + PyErr_Clear(); + data->destroy = 0; + } + if (data->destroy) { + int flags; + Py_INCREF(data->destroy); + flags = PyCFunction_GET_FLAGS(data->destroy); +#ifdef METH_O + data->delargs = !(flags & (METH_O)); +#else + data->delargs = 0; +#endif + } else { + data->delargs = 0; + } + data->implicitconv = 0; + data->pytype = 0; + return data; + } +} + +SWIGRUNTIME void +SwigPyClientData_Del(SwigPyClientData *data) { + Py_XDECREF(data->newraw); + Py_XDECREF(data->newargs); + Py_XDECREF(data->destroy); +} + +/* =============== SwigPyObject =====================*/ + +typedef struct { + PyObject_HEAD + void *ptr; + swig_type_info *ty; + int own; + PyObject *next; +#ifdef SWIGPYTHON_BUILTIN + PyObject *dict; +#endif +} SwigPyObject; + +SWIGRUNTIME PyObject * +SwigPyObject_long(SwigPyObject *v) +{ + return PyLong_FromVoidPtr(v->ptr); +} + +SWIGRUNTIME PyObject * +SwigPyObject_format(const char* fmt, SwigPyObject *v) +{ + PyObject *res = NULL; + PyObject *args = PyTuple_New(1); + if (args) { + if (PyTuple_SetItem(args, 0, SwigPyObject_long(v)) == 0) { + PyObject *ofmt = SWIG_Python_str_FromChar(fmt); + if (ofmt) { +#if PY_VERSION_HEX >= 0x03000000 + res = PyUnicode_Format(ofmt,args); +#else + res = PyString_Format(ofmt,args); +#endif + Py_DECREF(ofmt); + } + Py_DECREF(args); + } + } + return res; +} + +SWIGRUNTIME PyObject * +SwigPyObject_oct(SwigPyObject *v) +{ + return SwigPyObject_format("%o",v); +} + +SWIGRUNTIME PyObject * +SwigPyObject_hex(SwigPyObject *v) +{ + return SwigPyObject_format("%x",v); +} + +SWIGRUNTIME PyObject * +#ifdef METH_NOARGS +SwigPyObject_repr(SwigPyObject *v) +#else +SwigPyObject_repr(SwigPyObject *v, PyObject *args) +#endif +{ + const char *name = SWIG_TypePrettyName(v->ty); + PyObject *repr = SWIG_Python_str_FromFormat("<Swig Object of type '%s' at %p>", (name ? name : "unknown"), (void *)v); + if (v->next) { +# ifdef METH_NOARGS + PyObject *nrep = SwigPyObject_repr((SwigPyObject *)v->next); +# else + PyObject *nrep = SwigPyObject_repr((SwigPyObject *)v->next, args); +# endif +# if PY_VERSION_HEX >= 0x03000000 + PyObject *joined = PyUnicode_Concat(repr, nrep); + Py_DecRef(repr); + Py_DecRef(nrep); + repr = joined; +# else + PyString_ConcatAndDel(&repr,nrep); +# endif + } + return repr; +} + +SWIGRUNTIME int +SwigPyObject_print(SwigPyObject *v, FILE *fp, int SWIGUNUSEDPARM(flags)) +{ + char *str; +#ifdef METH_NOARGS + PyObject *repr = SwigPyObject_repr(v); +#else + PyObject *repr = SwigPyObject_repr(v, NULL); +#endif + if (repr) { + str = SWIG_Python_str_AsChar(repr); + fputs(str, fp); + SWIG_Python_str_DelForPy3(str); + Py_DECREF(repr); + return 0; + } else { + return 1; + } +} + +SWIGRUNTIME PyObject * +SwigPyObject_str(SwigPyObject *v) +{ + char result[SWIG_BUFFER_SIZE]; + return SWIG_PackVoidPtr(result, v->ptr, v->ty->name, sizeof(result)) ? + SWIG_Python_str_FromChar(result) : 0; +} + +SWIGRUNTIME int +SwigPyObject_compare(SwigPyObject *v, SwigPyObject *w) +{ + void *i = v->ptr; + void *j = w->ptr; + return (i < j) ? -1 : ((i > j) ? 1 : 0); +} + +/* Added for Python 3.x, would it also be useful for Python 2.x? */ +SWIGRUNTIME PyObject* +SwigPyObject_richcompare(SwigPyObject *v, SwigPyObject *w, int op) +{ + PyObject* res; + if( op != Py_EQ && op != Py_NE ) { + Py_INCREF(Py_NotImplemented); + return Py_NotImplemented; + } + res = PyBool_FromLong( (SwigPyObject_compare(v, w)==0) == (op == Py_EQ) ? 1 : 0); + return res; +} + + +SWIGRUNTIME PyTypeObject* SwigPyObject_TypeOnce(void); + +#ifdef SWIGPYTHON_BUILTIN +static swig_type_info *SwigPyObject_stype = 0; +SWIGRUNTIME PyTypeObject* +SwigPyObject_type(void) { + SwigPyClientData *cd; + assert(SwigPyObject_stype); + cd = (SwigPyClientData*) SwigPyObject_stype->clientdata; + assert(cd); + assert(cd->pytype); + return cd->pytype; +} +#else +SWIGRUNTIME PyTypeObject* +SwigPyObject_type(void) { + static PyTypeObject *SWIG_STATIC_POINTER(type) = SwigPyObject_TypeOnce(); + return type; +} +#endif + +SWIGRUNTIMEINLINE int +SwigPyObject_Check(PyObject *op) { +#ifdef SWIGPYTHON_BUILTIN + PyTypeObject *target_tp = SwigPyObject_type(); + if (PyType_IsSubtype(op->ob_type, target_tp)) + return 1; + return (strcmp(op->ob_type->tp_name, "SwigPyObject") == 0); +#else + return (Py_TYPE(op) == SwigPyObject_type()) + || (strcmp(Py_TYPE(op)->tp_name,"SwigPyObject") == 0); +#endif +} + +SWIGRUNTIME PyObject * +SwigPyObject_New(void *ptr, swig_type_info *ty, int own); + +SWIGRUNTIME void +SwigPyObject_dealloc(PyObject *v) +{ + SwigPyObject *sobj = (SwigPyObject *) v; + PyObject *next = sobj->next; + if (sobj->own == SWIG_POINTER_OWN) { + swig_type_info *ty = sobj->ty; + SwigPyClientData *data = ty ? (SwigPyClientData *) ty->clientdata : 0; + PyObject *destroy = data ? data->destroy : 0; + if (destroy) { + /* destroy is always a VARARGS method */ + PyObject *res; + if (data->delargs) { + /* we need to create a temporary object to carry the destroy operation */ + PyObject *tmp = SwigPyObject_New(sobj->ptr, ty, 0); + res = SWIG_Python_CallFunctor(destroy, tmp); + Py_DECREF(tmp); + } else { + PyCFunction meth = PyCFunction_GET_FUNCTION(destroy); + PyObject *mself = PyCFunction_GET_SELF(destroy); + res = ((*meth)(mself, v)); + } + Py_XDECREF(res); + } +#if !defined(SWIG_PYTHON_SILENT_MEMLEAK) + else { + const char *name = SWIG_TypePrettyName(ty); + printf("swig/python detected a memory leak of type '%s', no destructor found.\n", (name ? name : "unknown")); + } +#endif + } + Py_XDECREF(next); + PyObject_DEL(v); +} + +SWIGRUNTIME PyObject* +SwigPyObject_append(PyObject* v, PyObject* next) +{ + SwigPyObject *sobj = (SwigPyObject *) v; +#ifndef METH_O + PyObject *tmp = 0; + if (!PyArg_ParseTuple(next,(char *)"O:append", &tmp)) return NULL; + next = tmp; +#endif + if (!SwigPyObject_Check(next)) { + return NULL; + } + sobj->next = next; + Py_INCREF(next); + return SWIG_Py_Void(); +} + +SWIGRUNTIME PyObject* +#ifdef METH_NOARGS +SwigPyObject_next(PyObject* v) +#else +SwigPyObject_next(PyObject* v, PyObject *SWIGUNUSEDPARM(args)) +#endif +{ + SwigPyObject *sobj = (SwigPyObject *) v; + if (sobj->next) { + Py_INCREF(sobj->next); + return sobj->next; + } else { + return SWIG_Py_Void(); + } +} + +SWIGINTERN PyObject* +#ifdef METH_NOARGS +SwigPyObject_disown(PyObject *v) +#else +SwigPyObject_disown(PyObject* v, PyObject *SWIGUNUSEDPARM(args)) +#endif +{ + SwigPyObject *sobj = (SwigPyObject *)v; + sobj->own = 0; + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject* +#ifdef METH_NOARGS +SwigPyObject_acquire(PyObject *v) +#else +SwigPyObject_acquire(PyObject* v, PyObject *SWIGUNUSEDPARM(args)) +#endif +{ + SwigPyObject *sobj = (SwigPyObject *)v; + sobj->own = SWIG_POINTER_OWN; + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject* +SwigPyObject_own(PyObject *v, PyObject *args) +{ + PyObject *val = 0; +#if (PY_VERSION_HEX < 0x02020000) + if (!PyArg_ParseTuple(args,(char *)"|O:own",&val)) +#elif (PY_VERSION_HEX < 0x02050000) + if (!PyArg_UnpackTuple(args, (char *)"own", 0, 1, &val)) +#else + if (!PyArg_UnpackTuple(args, "own", 0, 1, &val)) +#endif + { + return NULL; + } + else + { + SwigPyObject *sobj = (SwigPyObject *)v; + PyObject *obj = PyBool_FromLong(sobj->own); + if (val) { +#ifdef METH_NOARGS + if (PyObject_IsTrue(val)) { + SwigPyObject_acquire(v); + } else { + SwigPyObject_disown(v); + } +#else + if (PyObject_IsTrue(val)) { + SwigPyObject_acquire(v,args); + } else { + SwigPyObject_disown(v,args); + } +#endif + } + return obj; + } +} + +#ifdef METH_O +static PyMethodDef +swigobject_methods[] = { + {(char *)"disown", (PyCFunction)SwigPyObject_disown, METH_NOARGS, (char *)"releases ownership of the pointer"}, + {(char *)"acquire", (PyCFunction)SwigPyObject_acquire, METH_NOARGS, (char *)"aquires ownership of the pointer"}, + {(char *)"own", (PyCFunction)SwigPyObject_own, METH_VARARGS, (char *)"returns/sets ownership of the pointer"}, + {(char *)"append", (PyCFunction)SwigPyObject_append, METH_O, (char *)"appends another 'this' object"}, + {(char *)"next", (PyCFunction)SwigPyObject_next, METH_NOARGS, (char *)"returns the next 'this' object"}, + {(char *)"__repr__",(PyCFunction)SwigPyObject_repr, METH_NOARGS, (char *)"returns object representation"}, + {0, 0, 0, 0} +}; +#else +static PyMethodDef +swigobject_methods[] = { + {(char *)"disown", (PyCFunction)SwigPyObject_disown, METH_VARARGS, (char *)"releases ownership of the pointer"}, + {(char *)"acquire", (PyCFunction)SwigPyObject_acquire, METH_VARARGS, (char *)"aquires ownership of the pointer"}, + {(char *)"own", (PyCFunction)SwigPyObject_own, METH_VARARGS, (char *)"returns/sets ownership of the pointer"}, + {(char *)"append", (PyCFunction)SwigPyObject_append, METH_VARARGS, (char *)"appends another 'this' object"}, + {(char *)"next", (PyCFunction)SwigPyObject_next, METH_VARARGS, (char *)"returns the next 'this' object"}, + {(char *)"__repr__",(PyCFunction)SwigPyObject_repr, METH_VARARGS, (char *)"returns object representation"}, + {0, 0, 0, 0} +}; +#endif + +#if PY_VERSION_HEX < 0x02020000 +SWIGINTERN PyObject * +SwigPyObject_getattr(SwigPyObject *sobj,char *name) +{ + return Py_FindMethod(swigobject_methods, (PyObject *)sobj, name); +} +#endif + +SWIGRUNTIME PyTypeObject* +SwigPyObject_TypeOnce(void) { + static char swigobject_doc[] = "Swig object carries a C/C++ instance pointer"; + + static PyNumberMethods SwigPyObject_as_number = { + (binaryfunc)0, /*nb_add*/ + (binaryfunc)0, /*nb_subtract*/ + (binaryfunc)0, /*nb_multiply*/ + /* nb_divide removed in Python 3 */ +#if PY_VERSION_HEX < 0x03000000 + (binaryfunc)0, /*nb_divide*/ +#endif + (binaryfunc)0, /*nb_remainder*/ + (binaryfunc)0, /*nb_divmod*/ + (ternaryfunc)0,/*nb_power*/ + (unaryfunc)0, /*nb_negative*/ + (unaryfunc)0, /*nb_positive*/ + (unaryfunc)0, /*nb_absolute*/ + (inquiry)0, /*nb_nonzero*/ + 0, /*nb_invert*/ + 0, /*nb_lshift*/ + 0, /*nb_rshift*/ + 0, /*nb_and*/ + 0, /*nb_xor*/ + 0, /*nb_or*/ +#if PY_VERSION_HEX < 0x03000000 + 0, /*nb_coerce*/ +#endif + (unaryfunc)SwigPyObject_long, /*nb_int*/ +#if PY_VERSION_HEX < 0x03000000 + (unaryfunc)SwigPyObject_long, /*nb_long*/ +#else + 0, /*nb_reserved*/ +#endif + (unaryfunc)0, /*nb_float*/ +#if PY_VERSION_HEX < 0x03000000 + (unaryfunc)SwigPyObject_oct, /*nb_oct*/ + (unaryfunc)SwigPyObject_hex, /*nb_hex*/ +#endif +#if PY_VERSION_HEX >= 0x03000000 /* 3.0 */ + 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_index, nb_inplace_divide removed */ +#elif PY_VERSION_HEX >= 0x02050000 /* 2.5.0 */ + 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_index */ +#elif PY_VERSION_HEX >= 0x02020000 /* 2.2.0 */ + 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_inplace_true_divide */ +#elif PY_VERSION_HEX >= 0x02000000 /* 2.0.0 */ + 0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_inplace_or */ +#endif + }; + + static PyTypeObject swigpyobject_type; + static int type_init = 0; + if (!type_init) { + const PyTypeObject tmp = { + /* PyObject header changed in Python 3 */ +#if PY_VERSION_HEX >= 0x03000000 + PyVarObject_HEAD_INIT(NULL, 0) +#else + PyObject_HEAD_INIT(NULL) + 0, /* ob_size */ +#endif + (char *)"SwigPyObject", /* tp_name */ + sizeof(SwigPyObject), /* tp_basicsize */ + 0, /* tp_itemsize */ + (destructor)SwigPyObject_dealloc, /* tp_dealloc */ + (printfunc)SwigPyObject_print, /* tp_print */ +#if PY_VERSION_HEX < 0x02020000 + (getattrfunc)SwigPyObject_getattr, /* tp_getattr */ +#else + (getattrfunc)0, /* tp_getattr */ +#endif + (setattrfunc)0, /* tp_setattr */ +#if PY_VERSION_HEX >= 0x03000000 + 0, /* tp_reserved in 3.0.1, tp_compare in 3.0.0 but not used */ +#else + (cmpfunc)SwigPyObject_compare, /* tp_compare */ +#endif + (reprfunc)SwigPyObject_repr, /* tp_repr */ + &SwigPyObject_as_number, /* tp_as_number */ + 0, /* tp_as_sequence */ + 0, /* tp_as_mapping */ + (hashfunc)0, /* tp_hash */ + (ternaryfunc)0, /* tp_call */ + (reprfunc)SwigPyObject_str, /* tp_str */ + PyObject_GenericGetAttr, /* tp_getattro */ + 0, /* tp_setattro */ + 0, /* tp_as_buffer */ + Py_TPFLAGS_DEFAULT, /* tp_flags */ + swigobject_doc, /* tp_doc */ + 0, /* tp_traverse */ + 0, /* tp_clear */ + (richcmpfunc)SwigPyObject_richcompare,/* tp_richcompare */ + 0, /* tp_weaklistoffset */ +#if PY_VERSION_HEX >= 0x02020000 + 0, /* tp_iter */ + 0, /* tp_iternext */ + swigobject_methods, /* tp_methods */ + 0, /* tp_members */ + 0, /* tp_getset */ + 0, /* tp_base */ + 0, /* tp_dict */ + 0, /* tp_descr_get */ + 0, /* tp_descr_set */ + 0, /* tp_dictoffset */ + 0, /* tp_init */ + 0, /* tp_alloc */ + 0, /* tp_new */ + 0, /* tp_free */ + 0, /* tp_is_gc */ + 0, /* tp_bases */ + 0, /* tp_mro */ + 0, /* tp_cache */ + 0, /* tp_subclasses */ + 0, /* tp_weaklist */ +#endif +#if PY_VERSION_HEX >= 0x02030000 + 0, /* tp_del */ +#endif +#if PY_VERSION_HEX >= 0x02060000 + 0, /* tp_version */ +#endif +#ifdef COUNT_ALLOCS + 0,0,0,0 /* tp_alloc -> tp_next */ +#endif + }; + swigpyobject_type = tmp; + type_init = 1; +#if PY_VERSION_HEX < 0x02020000 + swigpyobject_type.ob_type = &PyType_Type; +#else + if (PyType_Ready(&swigpyobject_type) < 0) + return NULL; +#endif + } + return &swigpyobject_type; +} + +SWIGRUNTIME PyObject * +SwigPyObject_New(void *ptr, swig_type_info *ty, int own) +{ + SwigPyObject *sobj = PyObject_NEW(SwigPyObject, SwigPyObject_type()); + if (sobj) { + sobj->ptr = ptr; + sobj->ty = ty; + sobj->own = own; + sobj->next = 0; + } + return (PyObject *)sobj; +} + +/* ----------------------------------------------------------------------------- + * Implements a simple Swig Packed type, and use it instead of string + * ----------------------------------------------------------------------------- */ + +typedef struct { + PyObject_HEAD + void *pack; + swig_type_info *ty; + size_t size; +} SwigPyPacked; + +SWIGRUNTIME int +SwigPyPacked_print(SwigPyPacked *v, FILE *fp, int SWIGUNUSEDPARM(flags)) +{ + char result[SWIG_BUFFER_SIZE]; + fputs("<Swig Packed ", fp); + if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))) { + fputs("at ", fp); + fputs(result, fp); + } + fputs(v->ty->name,fp); + fputs(">", fp); + return 0; +} + +SWIGRUNTIME PyObject * +SwigPyPacked_repr(SwigPyPacked *v) +{ + char result[SWIG_BUFFER_SIZE]; + if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))) { + return SWIG_Python_str_FromFormat("<Swig Packed at %s%s>", result, v->ty->name); + } else { + return SWIG_Python_str_FromFormat("<Swig Packed %s>", v->ty->name); + } +} + +SWIGRUNTIME PyObject * +SwigPyPacked_str(SwigPyPacked *v) +{ + char result[SWIG_BUFFER_SIZE]; + if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))){ + return SWIG_Python_str_FromFormat("%s%s", result, v->ty->name); + } else { + return SWIG_Python_str_FromChar(v->ty->name); + } +} + +SWIGRUNTIME int +SwigPyPacked_compare(SwigPyPacked *v, SwigPyPacked *w) +{ + size_t i = v->size; + size_t j = w->size; + int s = (i < j) ? -1 : ((i > j) ? 1 : 0); + return s ? s : strncmp((char *)v->pack, (char *)w->pack, 2*v->size); +} + +SWIGRUNTIME PyTypeObject* SwigPyPacked_TypeOnce(void); + +SWIGRUNTIME PyTypeObject* +SwigPyPacked_type(void) { + static PyTypeObject *SWIG_STATIC_POINTER(type) = SwigPyPacked_TypeOnce(); + return type; +} + +SWIGRUNTIMEINLINE int +SwigPyPacked_Check(PyObject *op) { + return ((op)->ob_type == SwigPyPacked_TypeOnce()) + || (strcmp((op)->ob_type->tp_name,"SwigPyPacked") == 0); +} + +SWIGRUNTIME void +SwigPyPacked_dealloc(PyObject *v) +{ + if (SwigPyPacked_Check(v)) { + SwigPyPacked *sobj = (SwigPyPacked *) v; + free(sobj->pack); + } + PyObject_DEL(v); +} + +SWIGRUNTIME PyTypeObject* +SwigPyPacked_TypeOnce(void) { + static char swigpacked_doc[] = "Swig object carries a C/C++ instance pointer"; + static PyTypeObject swigpypacked_type; + static int type_init = 0; + if (!type_init) { + const PyTypeObject tmp = { + /* PyObject header changed in Python 3 */ +#if PY_VERSION_HEX>=0x03000000 + PyVarObject_HEAD_INIT(NULL, 0) +#else + PyObject_HEAD_INIT(NULL) + 0, /* ob_size */ +#endif + (char *)"SwigPyPacked", /* tp_name */ + sizeof(SwigPyPacked), /* tp_basicsize */ + 0, /* tp_itemsize */ + (destructor)SwigPyPacked_dealloc, /* tp_dealloc */ + (printfunc)SwigPyPacked_print, /* tp_print */ + (getattrfunc)0, /* tp_getattr */ + (setattrfunc)0, /* tp_setattr */ +#if PY_VERSION_HEX>=0x03000000 + 0, /* tp_reserved in 3.0.1 */ +#else + (cmpfunc)SwigPyPacked_compare, /* tp_compare */ +#endif + (reprfunc)SwigPyPacked_repr, /* tp_repr */ + 0, /* tp_as_number */ + 0, /* tp_as_sequence */ + 0, /* tp_as_mapping */ + (hashfunc)0, /* tp_hash */ + (ternaryfunc)0, /* tp_call */ + (reprfunc)SwigPyPacked_str, /* tp_str */ + PyObject_GenericGetAttr, /* tp_getattro */ + 0, /* tp_setattro */ + 0, /* tp_as_buffer */ + Py_TPFLAGS_DEFAULT, /* tp_flags */ + swigpacked_doc, /* tp_doc */ + 0, /* tp_traverse */ + 0, /* tp_clear */ + 0, /* tp_richcompare */ + 0, /* tp_weaklistoffset */ +#if PY_VERSION_HEX >= 0x02020000 + 0, /* tp_iter */ + 0, /* tp_iternext */ + 0, /* tp_methods */ + 0, /* tp_members */ + 0, /* tp_getset */ + 0, /* tp_base */ + 0, /* tp_dict */ + 0, /* tp_descr_get */ + 0, /* tp_descr_set */ + 0, /* tp_dictoffset */ + 0, /* tp_init */ + 0, /* tp_alloc */ + 0, /* tp_new */ + 0, /* tp_free */ + 0, /* tp_is_gc */ + 0, /* tp_bases */ + 0, /* tp_mro */ + 0, /* tp_cache */ + 0, /* tp_subclasses */ + 0, /* tp_weaklist */ +#endif +#if PY_VERSION_HEX >= 0x02030000 + 0, /* tp_del */ +#endif +#if PY_VERSION_HEX >= 0x02060000 + 0, /* tp_version */ +#endif +#ifdef COUNT_ALLOCS + 0,0,0,0 /* tp_alloc -> tp_next */ +#endif + }; + swigpypacked_type = tmp; + type_init = 1; +#if PY_VERSION_HEX < 0x02020000 + swigpypacked_type.ob_type = &PyType_Type; +#else + if (PyType_Ready(&swigpypacked_type) < 0) + return NULL; +#endif + } + return &swigpypacked_type; +} + +SWIGRUNTIME PyObject * +SwigPyPacked_New(void *ptr, size_t size, swig_type_info *ty) +{ + SwigPyPacked *sobj = PyObject_NEW(SwigPyPacked, SwigPyPacked_type()); + if (sobj) { + void *pack = malloc(size); + if (pack) { + memcpy(pack, ptr, size); + sobj->pack = pack; + sobj->ty = ty; + sobj->size = size; + } else { + PyObject_DEL((PyObject *) sobj); + sobj = 0; + } + } + return (PyObject *) sobj; +} + +SWIGRUNTIME swig_type_info * +SwigPyPacked_UnpackData(PyObject *obj, void *ptr, size_t size) +{ + if (SwigPyPacked_Check(obj)) { + SwigPyPacked *sobj = (SwigPyPacked *)obj; + if (sobj->size != size) return 0; + memcpy(ptr, sobj->pack, size); + return sobj->ty; + } else { + return 0; + } +} + +/* ----------------------------------------------------------------------------- + * pointers/data manipulation + * ----------------------------------------------------------------------------- */ + +SWIGRUNTIMEINLINE PyObject * +_SWIG_This(void) +{ + return SWIG_Python_str_FromChar("this"); +} + +static PyObject *swig_this = NULL; + +SWIGRUNTIME PyObject * +SWIG_This(void) +{ + if (swig_this == NULL) + swig_this = _SWIG_This(); + return swig_this; +} + +/* #define SWIG_PYTHON_SLOW_GETSET_THIS */ + +/* TODO: I don't know how to implement the fast getset in Python 3 right now */ +#if PY_VERSION_HEX>=0x03000000 +#define SWIG_PYTHON_SLOW_GETSET_THIS +#endif + +SWIGRUNTIME SwigPyObject * +SWIG_Python_GetSwigThis(PyObject *pyobj) +{ + PyObject *obj; + + if (SwigPyObject_Check(pyobj)) + return (SwigPyObject *) pyobj; + +#ifdef SWIGPYTHON_BUILTIN + (void)obj; +# ifdef PyWeakref_CheckProxy + if (PyWeakref_CheckProxy(pyobj)) { + pyobj = PyWeakref_GET_OBJECT(pyobj); + if (pyobj && SwigPyObject_Check(pyobj)) + return (SwigPyObject*) pyobj; + } +# endif + return NULL; +#else + + obj = 0; + +#if (!defined(SWIG_PYTHON_SLOW_GETSET_THIS) && (PY_VERSION_HEX >= 0x02030000)) + if (PyInstance_Check(pyobj)) { + obj = _PyInstance_Lookup(pyobj, SWIG_This()); + } else { + PyObject **dictptr = _PyObject_GetDictPtr(pyobj); + if (dictptr != NULL) { + PyObject *dict = *dictptr; + obj = dict ? PyDict_GetItem(dict, SWIG_This()) : 0; + } else { +#ifdef PyWeakref_CheckProxy + if (PyWeakref_CheckProxy(pyobj)) { + PyObject *wobj = PyWeakref_GET_OBJECT(pyobj); + return wobj ? SWIG_Python_GetSwigThis(wobj) : 0; + } +#endif + obj = PyObject_GetAttr(pyobj,SWIG_This()); + if (obj) { + Py_DECREF(obj); + } else { + if (PyErr_Occurred()) PyErr_Clear(); + return 0; + } + } + } +#else + obj = PyObject_GetAttr(pyobj,SWIG_This()); + if (obj) { + Py_DECREF(obj); + } else { + if (PyErr_Occurred()) PyErr_Clear(); + return 0; + } +#endif + if (obj && !SwigPyObject_Check(obj)) { + /* a PyObject is called 'this', try to get the 'real this' + SwigPyObject from it */ + return SWIG_Python_GetSwigThis(obj); + } + return (SwigPyObject *)obj; +#endif +} + +/* Acquire a pointer value */ + +SWIGRUNTIME int +SWIG_Python_AcquirePtr(PyObject *obj, int own) { + if (own == SWIG_POINTER_OWN) { + SwigPyObject *sobj = SWIG_Python_GetSwigThis(obj); + if (sobj) { + int oldown = sobj->own; + sobj->own = own; + return oldown; + } + } + return 0; +} + +/* Convert a pointer value */ + +SWIGRUNTIME int +SWIG_Python_ConvertPtrAndOwn(PyObject *obj, void **ptr, swig_type_info *ty, int flags, int *own) { + int res; + SwigPyObject *sobj; + + if (!obj) + return SWIG_ERROR; + if (obj == Py_None) { + if (ptr) + *ptr = 0; + return SWIG_OK; + } + + res = SWIG_ERROR; + + sobj = SWIG_Python_GetSwigThis(obj); + if (own) + *own = 0; + while (sobj) { + void *vptr = sobj->ptr; + if (ty) { + swig_type_info *to = sobj->ty; + if (to == ty) { + /* no type cast needed */ + if (ptr) *ptr = vptr; + break; + } else { + swig_cast_info *tc = SWIG_TypeCheck(to->name,ty); + if (!tc) { + sobj = (SwigPyObject *)sobj->next; + } else { + if (ptr) { + int newmemory = 0; + *ptr = SWIG_TypeCast(tc,vptr,&newmemory); + if (newmemory == SWIG_CAST_NEW_MEMORY) { + assert(own); /* badly formed typemap which will lead to a memory leak - it must set and use own to delete *ptr */ + if (own) + *own = *own | SWIG_CAST_NEW_MEMORY; + } + } + break; + } + } + } else { + if (ptr) *ptr = vptr; + break; + } + } + if (sobj) { + if (own) + *own = *own | sobj->own; + if (flags & SWIG_POINTER_DISOWN) { + sobj->own = 0; + } + res = SWIG_OK; + } else { + if (flags & SWIG_POINTER_IMPLICIT_CONV) { + SwigPyClientData *data = ty ? (SwigPyClientData *) ty->clientdata : 0; + if (data && !data->implicitconv) { + PyObject *klass = data->klass; + if (klass) { + PyObject *impconv; + data->implicitconv = 1; /* avoid recursion and call 'explicit' constructors*/ + impconv = SWIG_Python_CallFunctor(klass, obj); + data->implicitconv = 0; + if (PyErr_Occurred()) { + PyErr_Clear(); + impconv = 0; + } + if (impconv) { + SwigPyObject *iobj = SWIG_Python_GetSwigThis(impconv); + if (iobj) { + void *vptr; + res = SWIG_Python_ConvertPtrAndOwn((PyObject*)iobj, &vptr, ty, 0, 0); + if (SWIG_IsOK(res)) { + if (ptr) { + *ptr = vptr; + /* transfer the ownership to 'ptr' */ + iobj->own = 0; + res = SWIG_AddCast(res); + res = SWIG_AddNewMask(res); + } else { + res = SWIG_AddCast(res); + } + } + } + Py_DECREF(impconv); + } + } + } + } + } + return res; +} + +/* Convert a function ptr value */ + +SWIGRUNTIME int +SWIG_Python_ConvertFunctionPtr(PyObject *obj, void **ptr, swig_type_info *ty) { + if (!PyCFunction_Check(obj)) { + return SWIG_ConvertPtr(obj, ptr, ty, 0); + } else { + void *vptr = 0; + + /* here we get the method pointer for callbacks */ + const char *doc = (((PyCFunctionObject *)obj) -> m_ml -> ml_doc); + const char *desc = doc ? strstr(doc, "swig_ptr: ") : 0; + if (desc) + desc = ty ? SWIG_UnpackVoidPtr(desc + 10, &vptr, ty->name) : 0; + if (!desc) + return SWIG_ERROR; + if (ty) { + swig_cast_info *tc = SWIG_TypeCheck(desc,ty); + if (tc) { + int newmemory = 0; + *ptr = SWIG_TypeCast(tc,vptr,&newmemory); + assert(!newmemory); /* newmemory handling not yet implemented */ + } else { + return SWIG_ERROR; + } + } else { + *ptr = vptr; + } + return SWIG_OK; + } +} + +/* Convert a packed value value */ + +SWIGRUNTIME int +SWIG_Python_ConvertPacked(PyObject *obj, void *ptr, size_t sz, swig_type_info *ty) { + swig_type_info *to = SwigPyPacked_UnpackData(obj, ptr, sz); + if (!to) return SWIG_ERROR; + if (ty) { + if (to != ty) { + /* check type cast? */ + swig_cast_info *tc = SWIG_TypeCheck(to->name,ty); + if (!tc) return SWIG_ERROR; + } + } + return SWIG_OK; +} + +/* ----------------------------------------------------------------------------- + * Create a new pointer object + * ----------------------------------------------------------------------------- */ + +/* + Create a new instance object, without calling __init__, and set the + 'this' attribute. +*/ + +SWIGRUNTIME PyObject* +SWIG_Python_NewShadowInstance(SwigPyClientData *data, PyObject *swig_this) +{ +#if (PY_VERSION_HEX >= 0x02020000) + PyObject *inst = 0; + PyObject *newraw = data->newraw; + if (newraw) { + inst = PyObject_Call(newraw, data->newargs, NULL); + if (inst) { +#if !defined(SWIG_PYTHON_SLOW_GETSET_THIS) + PyObject **dictptr = _PyObject_GetDictPtr(inst); + if (dictptr != NULL) { + PyObject *dict = *dictptr; + if (dict == NULL) { + dict = PyDict_New(); + *dictptr = dict; + PyDict_SetItem(dict, SWIG_This(), swig_this); + } + } +#else + PyObject *key = SWIG_This(); + PyObject_SetAttr(inst, key, swig_this); +#endif + } + } else { +#if PY_VERSION_HEX >= 0x03000000 + inst = PyBaseObject_Type.tp_new((PyTypeObject*) data->newargs, Py_None, Py_None); + if (inst) { + PyObject_SetAttr(inst, SWIG_This(), swig_this); + Py_TYPE(inst)->tp_flags &= ~Py_TPFLAGS_VALID_VERSION_TAG; + } +#else + PyObject *dict = PyDict_New(); + if (dict) { + PyDict_SetItem(dict, SWIG_This(), swig_this); + inst = PyInstance_NewRaw(data->newargs, dict); + Py_DECREF(dict); + } +#endif + } + return inst; +#else +#if (PY_VERSION_HEX >= 0x02010000) + PyObject *inst = 0; + PyObject *dict = PyDict_New(); + if (dict) { + PyDict_SetItem(dict, SWIG_This(), swig_this); + inst = PyInstance_NewRaw(data->newargs, dict); + Py_DECREF(dict); + } + return (PyObject *) inst; +#else + PyInstanceObject *inst = PyObject_NEW(PyInstanceObject, &PyInstance_Type); + if (inst == NULL) { + return NULL; + } + inst->in_class = (PyClassObject *)data->newargs; + Py_INCREF(inst->in_class); + inst->in_dict = PyDict_New(); + if (inst->in_dict == NULL) { + Py_DECREF(inst); + return NULL; + } +#ifdef Py_TPFLAGS_HAVE_WEAKREFS + inst->in_weakreflist = NULL; +#endif +#ifdef Py_TPFLAGS_GC + PyObject_GC_Init(inst); +#endif + PyDict_SetItem(inst->in_dict, SWIG_This(), swig_this); + return (PyObject *) inst; +#endif +#endif +} + +SWIGRUNTIME void +SWIG_Python_SetSwigThis(PyObject *inst, PyObject *swig_this) +{ + PyObject *dict; +#if (PY_VERSION_HEX >= 0x02020000) && !defined(SWIG_PYTHON_SLOW_GETSET_THIS) + PyObject **dictptr = _PyObject_GetDictPtr(inst); + if (dictptr != NULL) { + dict = *dictptr; + if (dict == NULL) { + dict = PyDict_New(); + *dictptr = dict; + } + PyDict_SetItem(dict, SWIG_This(), swig_this); + return; + } +#endif + dict = PyObject_GetAttrString(inst, (char*)"__dict__"); + PyDict_SetItem(dict, SWIG_This(), swig_this); + Py_DECREF(dict); +} + + +SWIGINTERN PyObject * +SWIG_Python_InitShadowInstance(PyObject *args) { + PyObject *obj[2]; + if (!SWIG_Python_UnpackTuple(args, "swiginit", 2, 2, obj)) { + return NULL; + } else { + SwigPyObject *sthis = SWIG_Python_GetSwigThis(obj[0]); + if (sthis) { + SwigPyObject_append((PyObject*) sthis, obj[1]); + } else { + SWIG_Python_SetSwigThis(obj[0], obj[1]); + } + return SWIG_Py_Void(); + } +} + +/* Create a new pointer object */ + +SWIGRUNTIME PyObject * +SWIG_Python_NewPointerObj(PyObject *self, void *ptr, swig_type_info *type, int flags) { + SwigPyClientData *clientdata; + PyObject * robj; + int own; + + if (!ptr) + return SWIG_Py_Void(); + + clientdata = type ? (SwigPyClientData *)(type->clientdata) : 0; + own = (flags & SWIG_POINTER_OWN) ? SWIG_POINTER_OWN : 0; + if (clientdata && clientdata->pytype) { + SwigPyObject *newobj; + if (flags & SWIG_BUILTIN_TP_INIT) { + newobj = (SwigPyObject*) self; + if (newobj->ptr) { + PyObject *next_self = clientdata->pytype->tp_alloc(clientdata->pytype, 0); + while (newobj->next) + newobj = (SwigPyObject *) newobj->next; + newobj->next = next_self; + newobj = (SwigPyObject *)next_self; + } + } else { + newobj = PyObject_New(SwigPyObject, clientdata->pytype); + } + if (newobj) { + newobj->ptr = ptr; + newobj->ty = type; + newobj->own = own; + newobj->next = 0; +#ifdef SWIGPYTHON_BUILTIN + newobj->dict = 0; +#endif + return (PyObject*) newobj; + } + return SWIG_Py_Void(); + } + + assert(!(flags & SWIG_BUILTIN_TP_INIT)); + + robj = SwigPyObject_New(ptr, type, own); + if (robj && clientdata && !(flags & SWIG_POINTER_NOSHADOW)) { + PyObject *inst = SWIG_Python_NewShadowInstance(clientdata, robj); + Py_DECREF(robj); + robj = inst; + } + return robj; +} + +/* Create a new packed object */ + +SWIGRUNTIMEINLINE PyObject * +SWIG_Python_NewPackedObj(void *ptr, size_t sz, swig_type_info *type) { + return ptr ? SwigPyPacked_New((void *) ptr, sz, type) : SWIG_Py_Void(); +} + +/* -----------------------------------------------------------------------------* + * Get type list + * -----------------------------------------------------------------------------*/ + +#ifdef SWIG_LINK_RUNTIME +void *SWIG_ReturnGlobalTypeList(void *); +#endif + +SWIGRUNTIME swig_module_info * +SWIG_Python_GetModule(void *SWIGUNUSEDPARM(clientdata)) { + static void *type_pointer = (void *)0; + /* first check if module already created */ + if (!type_pointer) { +#ifdef SWIG_LINK_RUNTIME + type_pointer = SWIG_ReturnGlobalTypeList((void *)0); +#else +# ifdef SWIGPY_USE_CAPSULE + type_pointer = PyCapsule_Import(SWIGPY_CAPSULE_NAME, 0); +# else + type_pointer = PyCObject_Import((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION, + (char*)"type_pointer" SWIG_TYPE_TABLE_NAME); +# endif + if (PyErr_Occurred()) { + PyErr_Clear(); + type_pointer = (void *)0; + } +#endif + } + return (swig_module_info *) type_pointer; +} + +#if PY_MAJOR_VERSION < 2 +/* PyModule_AddObject function was introduced in Python 2.0. The following function + is copied out of Python/modsupport.c in python version 2.3.4 */ +SWIGINTERN int +PyModule_AddObject(PyObject *m, char *name, PyObject *o) +{ + PyObject *dict; + if (!PyModule_Check(m)) { + PyErr_SetString(PyExc_TypeError, + "PyModule_AddObject() needs module as first arg"); + return SWIG_ERROR; + } + if (!o) { + PyErr_SetString(PyExc_TypeError, + "PyModule_AddObject() needs non-NULL value"); + return SWIG_ERROR; + } + + dict = PyModule_GetDict(m); + if (dict == NULL) { + /* Internal error -- modules must have a dict! */ + PyErr_Format(PyExc_SystemError, "module '%s' has no __dict__", + PyModule_GetName(m)); + return SWIG_ERROR; + } + if (PyDict_SetItemString(dict, name, o)) + return SWIG_ERROR; + Py_DECREF(o); + return SWIG_OK; +} +#endif + +SWIGRUNTIME void +#ifdef SWIGPY_USE_CAPSULE +SWIG_Python_DestroyModule(PyObject *obj) +#else +SWIG_Python_DestroyModule(void *vptr) +#endif +{ +#ifdef SWIGPY_USE_CAPSULE + swig_module_info *swig_module = (swig_module_info *) PyCapsule_GetPointer(obj, SWIGPY_CAPSULE_NAME); +#else + swig_module_info *swig_module = (swig_module_info *) vptr; +#endif + swig_type_info **types = swig_module->types; + size_t i; + for (i =0; i < swig_module->size; ++i) { + swig_type_info *ty = types[i]; + if (ty->owndata) { + SwigPyClientData *data = (SwigPyClientData *) ty->clientdata; + if (data) SwigPyClientData_Del(data); + } + } + Py_DECREF(SWIG_This()); + swig_this = NULL; +} + +SWIGRUNTIME void +SWIG_Python_SetModule(swig_module_info *swig_module) { +#if PY_VERSION_HEX >= 0x03000000 + /* Add a dummy module object into sys.modules */ + PyObject *module = PyImport_AddModule((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION); +#else + static PyMethodDef swig_empty_runtime_method_table[] = { {NULL, NULL, 0, NULL} }; /* Sentinel */ + PyObject *module = Py_InitModule((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION, swig_empty_runtime_method_table); +#endif +#ifdef SWIGPY_USE_CAPSULE + PyObject *pointer = PyCapsule_New((void *) swig_module, SWIGPY_CAPSULE_NAME, SWIG_Python_DestroyModule); + if (pointer && module) { + PyModule_AddObject(module, (char*)"type_pointer_capsule" SWIG_TYPE_TABLE_NAME, pointer); + } else { + Py_XDECREF(pointer); + } +#else + PyObject *pointer = PyCObject_FromVoidPtr((void *) swig_module, SWIG_Python_DestroyModule); + if (pointer && module) { + PyModule_AddObject(module, (char*)"type_pointer" SWIG_TYPE_TABLE_NAME, pointer); + } else { + Py_XDECREF(pointer); + } +#endif +} + +/* The python cached type query */ +SWIGRUNTIME PyObject * +SWIG_Python_TypeCache(void) { + static PyObject *SWIG_STATIC_POINTER(cache) = PyDict_New(); + return cache; +} + +SWIGRUNTIME swig_type_info * +SWIG_Python_TypeQuery(const char *type) +{ + PyObject *cache = SWIG_Python_TypeCache(); + PyObject *key = SWIG_Python_str_FromChar(type); + PyObject *obj = PyDict_GetItem(cache, key); + swig_type_info *descriptor; + if (obj) { +#ifdef SWIGPY_USE_CAPSULE + descriptor = (swig_type_info *) PyCapsule_GetPointer(obj, NULL); +#else + descriptor = (swig_type_info *) PyCObject_AsVoidPtr(obj); +#endif + } else { + swig_module_info *swig_module = SWIG_GetModule(0); + descriptor = SWIG_TypeQueryModule(swig_module, swig_module, type); + if (descriptor) { +#ifdef SWIGPY_USE_CAPSULE + obj = PyCapsule_New((void*) descriptor, NULL, NULL); +#else + obj = PyCObject_FromVoidPtr(descriptor, NULL); +#endif + PyDict_SetItem(cache, key, obj); + Py_DECREF(obj); + } + } + Py_DECREF(key); + return descriptor; +} + +/* + For backward compatibility only +*/ +#define SWIG_POINTER_EXCEPTION 0 +#define SWIG_arg_fail(arg) SWIG_Python_ArgFail(arg) +#define SWIG_MustGetPtr(p, type, argnum, flags) SWIG_Python_MustGetPtr(p, type, argnum, flags) + +SWIGRUNTIME int +SWIG_Python_AddErrMesg(const char* mesg, int infront) +{ + if (PyErr_Occurred()) { + PyObject *type = 0; + PyObject *value = 0; + PyObject *traceback = 0; + PyErr_Fetch(&type, &value, &traceback); + if (value) { + char *tmp; + PyObject *old_str = PyObject_Str(value); + Py_XINCREF(type); + PyErr_Clear(); + if (infront) { + PyErr_Format(type, "%s %s", mesg, tmp = SWIG_Python_str_AsChar(old_str)); + } else { + PyErr_Format(type, "%s %s", tmp = SWIG_Python_str_AsChar(old_str), mesg); + } + SWIG_Python_str_DelForPy3(tmp); + Py_DECREF(old_str); + } + return 1; + } else { + return 0; + } +} + +SWIGRUNTIME int +SWIG_Python_ArgFail(int argnum) +{ + if (PyErr_Occurred()) { + /* add information about failing argument */ + char mesg[256]; + PyOS_snprintf(mesg, sizeof(mesg), "argument number %d:", argnum); + return SWIG_Python_AddErrMesg(mesg, 1); + } else { + return 0; + } +} + +SWIGRUNTIMEINLINE const char * +SwigPyObject_GetDesc(PyObject *self) +{ + SwigPyObject *v = (SwigPyObject *)self; + swig_type_info *ty = v ? v->ty : 0; + return ty ? ty->str : ""; +} + +SWIGRUNTIME void +SWIG_Python_TypeError(const char *type, PyObject *obj) +{ + if (type) { +#if defined(SWIG_COBJECT_TYPES) + if (obj && SwigPyObject_Check(obj)) { + const char *otype = (const char *) SwigPyObject_GetDesc(obj); + if (otype) { + PyErr_Format(PyExc_TypeError, "a '%s' is expected, 'SwigPyObject(%s)' is received", + type, otype); + return; + } + } else +#endif + { + const char *otype = (obj ? obj->ob_type->tp_name : 0); + if (otype) { + PyObject *str = PyObject_Str(obj); + const char *cstr = str ? SWIG_Python_str_AsChar(str) : 0; + if (cstr) { + PyErr_Format(PyExc_TypeError, "a '%s' is expected, '%s(%s)' is received", + type, otype, cstr); + SWIG_Python_str_DelForPy3(cstr); + } else { + PyErr_Format(PyExc_TypeError, "a '%s' is expected, '%s' is received", + type, otype); + } + Py_XDECREF(str); + return; + } + } + PyErr_Format(PyExc_TypeError, "a '%s' is expected", type); + } else { + PyErr_Format(PyExc_TypeError, "unexpected type is received"); + } +} + + +/* Convert a pointer value, signal an exception on a type mismatch */ +SWIGRUNTIME void * +SWIG_Python_MustGetPtr(PyObject *obj, swig_type_info *ty, int SWIGUNUSEDPARM(argnum), int flags) { + void *result; + if (SWIG_Python_ConvertPtr(obj, &result, ty, flags) == -1) { + PyErr_Clear(); +#if SWIG_POINTER_EXCEPTION + if (flags) { + SWIG_Python_TypeError(SWIG_TypePrettyName(ty), obj); + SWIG_Python_ArgFail(argnum); + } +#endif + } + return result; +} + +#ifdef SWIGPYTHON_BUILTIN +SWIGRUNTIME int +SWIG_Python_NonDynamicSetAttr(PyObject *obj, PyObject *name, PyObject *value) { + PyTypeObject *tp = obj->ob_type; + PyObject *descr; + PyObject *encoded_name; + descrsetfunc f; + int res; + +# ifdef Py_USING_UNICODE + if (PyString_Check(name)) { + name = PyUnicode_Decode(PyString_AsString(name), PyString_Size(name), NULL, NULL); + if (!name) + return -1; + } else if (!PyUnicode_Check(name)) +# else + if (!PyString_Check(name)) +# endif + { + PyErr_Format(PyExc_TypeError, "attribute name must be string, not '%.200s'", name->ob_type->tp_name); + return -1; + } else { + Py_INCREF(name); + } + + if (!tp->tp_dict) { + if (PyType_Ready(tp) < 0) + goto done; + } + + res = -1; + descr = _PyType_Lookup(tp, name); + f = NULL; + if (descr != NULL) + f = descr->ob_type->tp_descr_set; + if (!f) { + if (PyString_Check(name)) { + encoded_name = name; + Py_INCREF(name); + } else { + encoded_name = PyUnicode_AsUTF8String(name); + } + PyErr_Format(PyExc_AttributeError, "'%.100s' object has no attribute '%.200s'", tp->tp_name, PyString_AsString(encoded_name)); + Py_DECREF(encoded_name); + } else { + res = f(descr, obj, value); + } + + done: + Py_DECREF(name); + return res; +} +#endif + + +#ifdef __cplusplus +} +#endif + + + +#define SWIG_exception_fail(code, msg) do { SWIG_Error(code, msg); SWIG_fail; } while(0) + +#define SWIG_contract_assert(expr, msg) if (!(expr)) { SWIG_Error(SWIG_RuntimeError, msg); SWIG_fail; } else + + +/* ----------------------------------------------------------------------------- + * director.swg + * + * This file contains support for director classes that proxy + * method calls from C++ to Python extensions. + * ----------------------------------------------------------------------------- */ + +#ifndef SWIG_DIRECTOR_PYTHON_HEADER_ +#define SWIG_DIRECTOR_PYTHON_HEADER_ + +#ifdef __cplusplus + +#include <string> +#include <iostream> +#include <exception> +#include <vector> +#include <map> + + +/* + Use -DSWIG_PYTHON_DIRECTOR_NO_VTABLE if you don't want to generate a 'virtual + table', and avoid multiple GetAttr calls to retrieve the python + methods. +*/ + +#ifndef SWIG_PYTHON_DIRECTOR_NO_VTABLE +#ifndef SWIG_PYTHON_DIRECTOR_VTABLE +#define SWIG_PYTHON_DIRECTOR_VTABLE +#endif +#endif + + + +/* + Use -DSWIG_DIRECTOR_NO_UEH if you prefer to avoid the use of the + Undefined Exception Handler provided by swift +*/ +#ifndef SWIG_DIRECTOR_NO_UEH +#ifndef SWIG_DIRECTOR_UEH +#define SWIG_DIRECTOR_UEH +#endif +#endif + + +/* + Use -DSWIG_DIRECTOR_STATIC if you prefer to avoid the use of the + 'Swig' namespace. This could be useful for multi-modules projects. +*/ +#ifdef SWIG_DIRECTOR_STATIC +/* Force anonymous (static) namespace */ +#define Swig +#endif + + +/* + Use -DSWIG_DIRECTOR_NORTTI if you prefer to avoid the use of the + native C++ RTTI and dynamic_cast<>. But be aware that directors + could stop working when using this option. +*/ +#ifdef SWIG_DIRECTOR_NORTTI +/* + When we don't use the native C++ RTTI, we implement a minimal one + only for Directors. +*/ +# ifndef SWIG_DIRECTOR_RTDIR +# define SWIG_DIRECTOR_RTDIR +#include <map> + +namespace Swig { + class Director; + SWIGINTERN std::map<void*,Director*>& get_rtdir_map() { + static std::map<void*,Director*> rtdir_map; + return rtdir_map; + } + + SWIGINTERNINLINE void set_rtdir(void *vptr, Director *rtdir) { + get_rtdir_map()[vptr] = rtdir; + } + + SWIGINTERNINLINE Director *get_rtdir(void *vptr) { + std::map<void*,Director*>::const_iterator pos = get_rtdir_map().find(vptr); + Director *rtdir = (pos != get_rtdir_map().end()) ? pos->second : 0; + return rtdir; + } +} +# endif /* SWIG_DIRECTOR_RTDIR */ + +# define SWIG_DIRECTOR_CAST(ARG) Swig::get_rtdir(static_cast<void*>(ARG)) +# define SWIG_DIRECTOR_RGTR(ARG1, ARG2) Swig::set_rtdir(static_cast<void*>(ARG1), ARG2) + +#else + +# define SWIG_DIRECTOR_CAST(ARG) dynamic_cast<Swig::Director *>(ARG) +# define SWIG_DIRECTOR_RGTR(ARG1, ARG2) + +#endif /* SWIG_DIRECTOR_NORTTI */ + +extern "C" { + struct swig_type_info; +} + +namespace Swig { + + /* memory handler */ + struct GCItem + { + virtual ~GCItem() {} + + virtual int get_own() const + { + return 0; + } + }; + + struct GCItem_var + { + GCItem_var(GCItem *item = 0) : _item(item) + { + } + + GCItem_var& operator=(GCItem *item) + { + GCItem *tmp = _item; + _item = item; + delete tmp; + return *this; + } + + ~GCItem_var() + { + delete _item; + } + + GCItem * operator->() const + { + return _item; + } + + private: + GCItem *_item; + }; + + struct GCItem_Object : GCItem + { + GCItem_Object(int own) : _own(own) + { + } + + virtual ~GCItem_Object() + { + } + + int get_own() const + { + return _own; + } + + private: + int _own; + }; + + template <typename Type> + struct GCItem_T : GCItem + { + GCItem_T(Type *ptr) : _ptr(ptr) + { + } + + virtual ~GCItem_T() + { + delete _ptr; + } + + private: + Type *_ptr; + }; + + template <typename Type> + struct GCArray_T : GCItem + { + GCArray_T(Type *ptr) : _ptr(ptr) + { + } + + virtual ~GCArray_T() + { + delete[] _ptr; + } + + private: + Type *_ptr; + }; + + /* base class for director exceptions */ + class DirectorException { + protected: + std::string swig_msg; + public: + DirectorException(PyObject *error, const char* hdr ="", const char* msg ="") + : swig_msg(hdr) + { + SWIG_PYTHON_THREAD_BEGIN_BLOCK; + if (strlen(msg)) { + swig_msg += " "; + swig_msg += msg; + } + if (!PyErr_Occurred()) { + PyErr_SetString(error, getMessage()); + } + SWIG_PYTHON_THREAD_END_BLOCK; + } + + const char *getMessage() const + { + return swig_msg.c_str(); + } + + static void raise(PyObject *error, const char *msg) + { + throw DirectorException(error, msg); + } + + static void raise(const char *msg) + { + raise(PyExc_RuntimeError, msg); + } + }; + + /* unknown exception handler */ + class UnknownExceptionHandler + { +#ifdef SWIG_DIRECTOR_UEH + static void handler() { + try { + throw; + } catch (DirectorException& e) { + std::cerr << "SWIG Director exception caught:" << std::endl + << e.getMessage() << std::endl; + } catch (std::exception& e) { + std::cerr << "std::exception caught: "<< e.what() << std::endl; + } catch (...) { + std::cerr << "Unknown exception caught." << std::endl; + } + + std::cerr << std::endl + << "Python interpreter traceback:" << std::endl; + PyErr_Print(); + std::cerr << std::endl; + + std::cerr << "This exception was caught by the SWIG unexpected exception handler." << std::endl + << "Try using %feature(\"director:except\") to avoid reaching this point." << std::endl + << std::endl + << "Exception is being re-thrown, program will likely abort/terminate." << std::endl; + throw; + } + + public: + + std::unexpected_handler old; + UnknownExceptionHandler(std::unexpected_handler nh = handler) + { + old = std::set_unexpected(nh); + } + + ~UnknownExceptionHandler() + { + std::set_unexpected(old); + } +#endif + }; + + /* type mismatch in the return value from a python method call */ + class DirectorTypeMismatchException : public Swig::DirectorException { + public: + DirectorTypeMismatchException(PyObject *error, const char* msg="") + : Swig::DirectorException(error, "SWIG director type mismatch", msg) + { + } + + DirectorTypeMismatchException(const char* msg="") + : Swig::DirectorException(PyExc_TypeError, "SWIG director type mismatch", msg) + { + } + + static void raise(PyObject *error, const char *msg) + { + throw DirectorTypeMismatchException(error, msg); + } + + static void raise(const char *msg) + { + throw DirectorTypeMismatchException(msg); + } + }; + + /* any python exception that occurs during a director method call */ + class DirectorMethodException : public Swig::DirectorException { + public: + DirectorMethodException(const char* msg = "") + : DirectorException(PyExc_RuntimeError, "SWIG director method error.", msg) + { + } + + static void raise(const char *msg) + { + throw DirectorMethodException(msg); + } + }; + + /* attempt to call a pure virtual method via a director method */ + class DirectorPureVirtualException : public Swig::DirectorException + { + public: + DirectorPureVirtualException(const char* msg = "") + : DirectorException(PyExc_RuntimeError, "SWIG director pure virtual method called", msg) + { + } + + static void raise(const char *msg) + { + throw DirectorPureVirtualException(msg); + } + }; + + +#if defined(SWIG_PYTHON_THREADS) +/* __THREAD__ is the old macro to activate some thread support */ +# if !defined(__THREAD__) +# define __THREAD__ 1 +# endif +#endif + +#ifdef __THREAD__ +# include "pythread.h" + class Guard + { + PyThread_type_lock & mutex_; + + public: + Guard(PyThread_type_lock & mutex) : mutex_(mutex) + { + PyThread_acquire_lock(mutex_, WAIT_LOCK); + } + + ~Guard() + { + PyThread_release_lock(mutex_); + } + }; +# define SWIG_GUARD(mutex) Guard _guard(mutex) +#else +# define SWIG_GUARD(mutex) +#endif + + /* director base class */ + class Director { + private: + /* pointer to the wrapped python object */ + PyObject* swig_self; + /* flag indicating whether the object is owned by python or c++ */ + mutable bool swig_disown_flag; + + /* decrement the reference count of the wrapped python object */ + void swig_decref() const { + if (swig_disown_flag) { + SWIG_PYTHON_THREAD_BEGIN_BLOCK; + Py_DECREF(swig_self); + SWIG_PYTHON_THREAD_END_BLOCK; + } + } + + public: + /* wrap a python object, optionally taking ownership */ + Director(PyObject* self) : swig_self(self), swig_disown_flag(false) { + swig_incref(); + } + + + /* discard our reference at destruction */ + virtual ~Director() { + swig_decref(); + } + + + /* return a pointer to the wrapped python object */ + PyObject *swig_get_self() const { + return swig_self; + } + + /* acquire ownership of the wrapped python object (the sense of "disown" + * is from python) */ + void swig_disown() const { + if (!swig_disown_flag) { + swig_disown_flag=true; + swig_incref(); + } + } + + /* increase the reference count of the wrapped python object */ + void swig_incref() const { + if (swig_disown_flag) { + Py_INCREF(swig_self); + } + } + + /* methods to implement pseudo protected director members */ + virtual bool swig_get_inner(const char* /* swig_protected_method_name */) const { + return true; + } + + virtual void swig_set_inner(const char* /* swig_protected_method_name */, bool /* swig_val */) const { + } + + /* ownership management */ + private: + typedef std::map<void*, GCItem_var> swig_ownership_map; + mutable swig_ownership_map swig_owner; +#ifdef __THREAD__ + static PyThread_type_lock swig_mutex_own; +#endif + + public: + template <typename Type> + void swig_acquire_ownership_array(Type *vptr) const + { + if (vptr) { + SWIG_GUARD(swig_mutex_own); + swig_owner[vptr] = new GCArray_T<Type>(vptr); + } + } + + template <typename Type> + void swig_acquire_ownership(Type *vptr) const + { + if (vptr) { + SWIG_GUARD(swig_mutex_own); + swig_owner[vptr] = new GCItem_T<Type>(vptr); + } + } + + void swig_acquire_ownership_obj(void *vptr, int own) const + { + if (vptr && own) { + SWIG_GUARD(swig_mutex_own); + swig_owner[vptr] = new GCItem_Object(own); + } + } + + int swig_release_ownership(void *vptr) const + { + int own = 0; + if (vptr) { + SWIG_GUARD(swig_mutex_own); + swig_ownership_map::iterator iter = swig_owner.find(vptr); + if (iter != swig_owner.end()) { + own = iter->second->get_own(); + swig_owner.erase(iter); + } + } + return own; + } + + template <typename Type> + static PyObject* swig_pyobj_disown(PyObject *pyobj, PyObject *SWIGUNUSEDPARM(args)) + { + SwigPyObject *sobj = (SwigPyObject *)pyobj; + sobj->own = 0; + Director *d = SWIG_DIRECTOR_CAST(reinterpret_cast<Type *>(sobj->ptr)); + if (d) + d->swig_disown(); + return PyWeakref_NewProxy(pyobj, NULL); + } + + }; + +#ifdef __THREAD__ + PyThread_type_lock Director::swig_mutex_own = PyThread_allocate_lock(); +#endif +} + +#endif /* __cplusplus */ + + +#endif + +/* -------- TYPES TABLE (BEGIN) -------- */ + +#define SWIGTYPE_p_ActionConfig swig_types[0] +#define SWIGTYPE_p_AudioResampler swig_types[1] +#define SWIGTYPE_p_CallSession swig_types[2] +#define SWIGTYPE_p_Codec swig_types[3] +#define SWIGTYPE_p_DDebugCallback swig_types[4] +#define SWIGTYPE_p_DialogEvent swig_types[5] +#define SWIGTYPE_p_InfoEvent swig_types[6] +#define SWIGTYPE_p_InfoSession swig_types[7] +#define SWIGTYPE_p_InviteEvent swig_types[8] +#define SWIGTYPE_p_InviteSession swig_types[9] +#define SWIGTYPE_p_MediaContent swig_types[10] +#define SWIGTYPE_p_MediaContentCPIM swig_types[11] +#define SWIGTYPE_p_MediaSessionMgr swig_types[12] +#define SWIGTYPE_p_MessagingEvent swig_types[13] +#define SWIGTYPE_p_MessagingSession swig_types[14] +#define SWIGTYPE_p_MsrpCallback swig_types[15] +#define SWIGTYPE_p_MsrpEvent swig_types[16] +#define SWIGTYPE_p_MsrpMessage swig_types[17] +#define SWIGTYPE_p_MsrpSession swig_types[18] +#define SWIGTYPE_p_OptionsEvent swig_types[19] +#define SWIGTYPE_p_OptionsSession swig_types[20] +#define SWIGTYPE_p_ProxyAudioConsumer swig_types[21] +#define SWIGTYPE_p_ProxyAudioConsumerCallback swig_types[22] +#define SWIGTYPE_p_ProxyAudioProducer swig_types[23] +#define SWIGTYPE_p_ProxyAudioProducerCallback swig_types[24] +#define SWIGTYPE_p_ProxyPlugin swig_types[25] +#define SWIGTYPE_p_ProxyPluginMgr swig_types[26] +#define SWIGTYPE_p_ProxyPluginMgrCallback swig_types[27] +#define SWIGTYPE_p_ProxyVideoConsumer swig_types[28] +#define SWIGTYPE_p_ProxyVideoConsumerCallback swig_types[29] +#define SWIGTYPE_p_ProxyVideoFrame swig_types[30] +#define SWIGTYPE_p_ProxyVideoProducer swig_types[31] +#define SWIGTYPE_p_ProxyVideoProducerCallback swig_types[32] +#define SWIGTYPE_p_PublicationEvent swig_types[33] +#define SWIGTYPE_p_PublicationSession swig_types[34] +#define SWIGTYPE_p_RPMessage swig_types[35] +#define SWIGTYPE_p_RegistrationEvent swig_types[36] +#define SWIGTYPE_p_RegistrationSession swig_types[37] +#define SWIGTYPE_p_SMSData swig_types[38] +#define SWIGTYPE_p_SMSEncoder swig_types[39] +#define SWIGTYPE_p_SafeObject swig_types[40] +#define SWIGTYPE_p_SdpMessage swig_types[41] +#define SWIGTYPE_p_SipCallback swig_types[42] +#define SWIGTYPE_p_SipEvent swig_types[43] +#define SWIGTYPE_p_SipMessage swig_types[44] +#define SWIGTYPE_p_SipSession swig_types[45] +#define SWIGTYPE_p_SipStack swig_types[46] +#define SWIGTYPE_p_SipUri swig_types[47] +#define SWIGTYPE_p_StackEvent swig_types[48] +#define SWIGTYPE_p_SubscriptionEvent swig_types[49] +#define SWIGTYPE_p_SubscriptionSession swig_types[50] +#define SWIGTYPE_p_T140Callback swig_types[51] +#define SWIGTYPE_p_T140CallbackData swig_types[52] +#define SWIGTYPE_p_XcapCallback swig_types[53] +#define SWIGTYPE_p_XcapEvent swig_types[54] +#define SWIGTYPE_p_XcapMessage swig_types[55] +#define SWIGTYPE_p_XcapSelector swig_types[56] +#define SWIGTYPE_p_XcapStack swig_types[57] +#define SWIGTYPE_p_char swig_types[58] +#define SWIGTYPE_p_int swig_types[59] +#define SWIGTYPE_p_long_long swig_types[60] +#define SWIGTYPE_p_short swig_types[61] +#define SWIGTYPE_p_signed_char swig_types[62] +#define SWIGTYPE_p_tdav_codec_id_e swig_types[63] +#define SWIGTYPE_p_thttp_event_type_e swig_types[64] +#define SWIGTYPE_p_tmedia_bandwidth_level_e swig_types[65] +#define SWIGTYPE_p_tmedia_chroma_e swig_types[66] +#define SWIGTYPE_p_tmedia_codec_id_e swig_types[67] +#define SWIGTYPE_p_tmedia_mode_e swig_types[68] +#define SWIGTYPE_p_tmedia_pref_video_size_s swig_types[69] +#define SWIGTYPE_p_tmedia_profile_e swig_types[70] +#define SWIGTYPE_p_tmedia_qos_strength_e swig_types[71] +#define SWIGTYPE_p_tmedia_qos_stype_e swig_types[72] +#define SWIGTYPE_p_tmedia_srtp_mode_e swig_types[73] +#define SWIGTYPE_p_tmedia_srtp_type_e swig_types[74] +#define SWIGTYPE_p_tmedia_t140_data_type_e swig_types[75] +#define SWIGTYPE_p_tmsrp_event_type_e swig_types[76] +#define SWIGTYPE_p_tmsrp_request_type_e swig_types[77] +#define SWIGTYPE_p_tsip_event_type_e swig_types[78] +#define SWIGTYPE_p_tsip_info_event_type_e swig_types[79] +#define SWIGTYPE_p_tsip_invite_event_type_e swig_types[80] +#define SWIGTYPE_p_tsip_message_event_type_e swig_types[81] +#define SWIGTYPE_p_tsip_options_event_type_e swig_types[82] +#define SWIGTYPE_p_tsip_publish_event_type_e swig_types[83] +#define SWIGTYPE_p_tsip_register_event_type_e swig_types[84] +#define SWIGTYPE_p_tsip_request_type_e swig_types[85] +#define SWIGTYPE_p_tsip_stack_mode_e swig_types[86] +#define SWIGTYPE_p_tsip_subscribe_event_type_e swig_types[87] +#define SWIGTYPE_p_tsk_list_t swig_types[88] +#define SWIGTYPE_p_twrap_media_type_e swig_types[89] +#define SWIGTYPE_p_twrap_proxy_plugin_type_e swig_types[90] +#define SWIGTYPE_p_twrap_rpmessage_type_e swig_types[91] +#define SWIGTYPE_p_twrap_sms_type_e swig_types[92] +#define SWIGTYPE_p_unsigned_char swig_types[93] +#define SWIGTYPE_p_unsigned_int swig_types[94] +#define SWIGTYPE_p_unsigned_long_long swig_types[95] +#define SWIGTYPE_p_unsigned_short swig_types[96] +static swig_type_info *swig_types[98]; +static swig_module_info swig_module = {swig_types, 97, 0, 0, 0, 0}; +#define SWIG_TypeQuery(name) SWIG_TypeQueryModule(&swig_module, &swig_module, name) +#define SWIG_MangledTypeQuery(name) SWIG_MangledTypeQueryModule(&swig_module, &swig_module, name) + +/* -------- TYPES TABLE (END) -------- */ + +#if (PY_VERSION_HEX <= 0x02000000) +# if !defined(SWIG_PYTHON_CLASSIC) +# error "This python version requires swig to be run with the '-classic' option" +# endif +#endif + +/*----------------------------------------------- + @(target):= _tinyWRAP.so + ------------------------------------------------*/ +#if PY_VERSION_HEX >= 0x03000000 +# define SWIG_init PyInit__tinyWRAP + +#else +# define SWIG_init init_tinyWRAP + +#endif +#define SWIG_name "_tinyWRAP" + +#define SWIGVERSION 0x020009 +#define SWIG_VERSION SWIGVERSION + + +#define SWIG_as_voidptr(a) const_cast< void * >(static_cast< const void * >(a)) +#define SWIG_as_voidptrptr(a) ((void)SWIG_as_voidptr(*a),reinterpret_cast< void** >(a)) + + +#include <stdexcept> + + +namespace swig { + class SwigPtr_PyObject { + protected: + PyObject *_obj; + + public: + SwigPtr_PyObject() :_obj(0) + { + } + + SwigPtr_PyObject(const SwigPtr_PyObject& item) : _obj(item._obj) + { + Py_XINCREF(_obj); + } + + SwigPtr_PyObject(PyObject *obj, bool initial_ref = true) :_obj(obj) + { + if (initial_ref) { + Py_XINCREF(_obj); + } + } + + SwigPtr_PyObject & operator=(const SwigPtr_PyObject& item) + { + Py_XINCREF(item._obj); + Py_XDECREF(_obj); + _obj = item._obj; + return *this; + } + + ~SwigPtr_PyObject() + { + Py_XDECREF(_obj); + } + + operator PyObject *() const + { + return _obj; + } + + PyObject *operator->() const + { + return _obj; + } + }; +} + + +namespace swig { + struct SwigVar_PyObject : SwigPtr_PyObject { + SwigVar_PyObject(PyObject* obj = 0) : SwigPtr_PyObject(obj, false) { } + + SwigVar_PyObject & operator = (PyObject* obj) + { + Py_XDECREF(_obj); + _obj = obj; + return *this; + } + }; +} + + +#include <stdint.h> // Use the C99 official header + + +#include "tinyWRAP_config.h" +#include "DDebug.h" +#include "AudioResampler.h" + + +SWIGINTERN swig_type_info* +SWIG_pchar_descriptor(void) +{ + static int init = 0; + static swig_type_info* info = 0; + if (!init) { + info = SWIG_TypeQuery("_p_char"); + init = 1; + } + return info; +} + + +SWIGINTERN int +SWIG_AsCharPtrAndSize(PyObject *obj, char** cptr, size_t* psize, int *alloc) +{ +#if PY_VERSION_HEX>=0x03000000 + if (PyUnicode_Check(obj)) +#else + if (PyString_Check(obj)) +#endif + { + char *cstr; Py_ssize_t len; +#if PY_VERSION_HEX>=0x03000000 + if (!alloc && cptr) { + /* We can't allow converting without allocation, since the internal + representation of string in Python 3 is UCS-2/UCS-4 but we require + a UTF-8 representation. + TODO(bhy) More detailed explanation */ + return SWIG_RuntimeError; + } + obj = PyUnicode_AsUTF8String(obj); + PyBytes_AsStringAndSize(obj, &cstr, &len); + if(alloc) *alloc = SWIG_NEWOBJ; +#else + PyString_AsStringAndSize(obj, &cstr, &len); +#endif + if (cptr) { + if (alloc) { + /* + In python the user should not be able to modify the inner + string representation. To warranty that, if you define + SWIG_PYTHON_SAFE_CSTRINGS, a new/copy of the python string + buffer is always returned. + + The default behavior is just to return the pointer value, + so, be careful. + */ +#if defined(SWIG_PYTHON_SAFE_CSTRINGS) + if (*alloc != SWIG_OLDOBJ) +#else + if (*alloc == SWIG_NEWOBJ) +#endif + { + *cptr = reinterpret_cast< char* >(memcpy((new char[len + 1]), cstr, sizeof(char)*(len + 1))); + *alloc = SWIG_NEWOBJ; + } + else { + *cptr = cstr; + *alloc = SWIG_OLDOBJ; + } + } else { + #if PY_VERSION_HEX>=0x03000000 + assert(0); /* Should never reach here in Python 3 */ + #endif + *cptr = SWIG_Python_str_AsChar(obj); + } + } + if (psize) *psize = len + 1; +#if PY_VERSION_HEX>=0x03000000 + Py_XDECREF(obj); +#endif + return SWIG_OK; + } else { + swig_type_info* pchar_descriptor = SWIG_pchar_descriptor(); + if (pchar_descriptor) { + void* vptr = 0; + if (SWIG_ConvertPtr(obj, &vptr, pchar_descriptor, 0) == SWIG_OK) { + if (cptr) *cptr = (char *) vptr; + if (psize) *psize = vptr ? (strlen((char *)vptr) + 1) : 0; + if (alloc) *alloc = SWIG_OLDOBJ; + return SWIG_OK; + } + } + } + return SWIG_TypeError; +} + + + + + +SWIGINTERNINLINE PyObject * +SWIG_FromCharPtrAndSize(const char* carray, size_t size) +{ + if (carray) { + if (size > INT_MAX) { + swig_type_info* pchar_descriptor = SWIG_pchar_descriptor(); + return pchar_descriptor ? + SWIG_InternalNewPointerObj(const_cast< char * >(carray), pchar_descriptor, 0) : SWIG_Py_Void(); + } else { +#if PY_VERSION_HEX >= 0x03000000 + return PyUnicode_FromStringAndSize(carray, static_cast< int >(size)); +#else + return PyString_FromStringAndSize(carray, static_cast< int >(size)); +#endif + } + } else { + return SWIG_Py_Void(); + } +} + + +SWIGINTERNINLINE PyObject * +SWIG_FromCharPtr(const char *cptr) +{ + return SWIG_FromCharPtrAndSize(cptr, (cptr ? strlen(cptr) : 0)); +} + + +#include <limits.h> +#if !defined(SWIG_NO_LLONG_MAX) +# if !defined(LLONG_MAX) && defined(__GNUC__) && defined (__LONG_LONG_MAX__) +# define LLONG_MAX __LONG_LONG_MAX__ +# define LLONG_MIN (-LLONG_MAX - 1LL) +# define ULLONG_MAX (LLONG_MAX * 2ULL + 1ULL) +# endif +#endif + + +SWIGINTERN int +SWIG_AsVal_double (PyObject *obj, double *val) +{ + int res = SWIG_TypeError; + if (PyFloat_Check(obj)) { + if (val) *val = PyFloat_AsDouble(obj); + return SWIG_OK; + } else if (PyInt_Check(obj)) { + if (val) *val = PyInt_AsLong(obj); + return SWIG_OK; + } else if (PyLong_Check(obj)) { + double v = PyLong_AsDouble(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_OK; + } else { + PyErr_Clear(); + } + } +#ifdef SWIG_PYTHON_CAST_MODE + { + int dispatch = 0; + double d = PyFloat_AsDouble(obj); + if (!PyErr_Occurred()) { + if (val) *val = d; + return SWIG_AddCast(SWIG_OK); + } else { + PyErr_Clear(); + } + if (!dispatch) { + long v = PyLong_AsLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_AddCast(SWIG_AddCast(SWIG_OK)); + } else { + PyErr_Clear(); + } + } + } +#endif + return res; +} + + +#include <float.h> + + +#include <math.h> + + +SWIGINTERNINLINE int +SWIG_CanCastAsInteger(double *d, double min, double max) { + double x = *d; + if ((min <= x && x <= max)) { + double fx = floor(x); + double cx = ceil(x); + double rd = ((x - fx) < 0.5) ? fx : cx; /* simple rint */ + if ((errno == EDOM) || (errno == ERANGE)) { + errno = 0; + } else { + double summ, reps, diff; + if (rd < x) { + diff = x - rd; + } else if (rd > x) { + diff = rd - x; + } else { + return 1; + } + summ = rd + x; + reps = diff/summ; + if (reps < 8*DBL_EPSILON) { + *d = rd; + return 1; + } + } + } + return 0; +} + + +SWIGINTERN int +SWIG_AsVal_long (PyObject *obj, long* val) +{ + if (PyInt_Check(obj)) { + if (val) *val = PyInt_AsLong(obj); + return SWIG_OK; + } else if (PyLong_Check(obj)) { + long v = PyLong_AsLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_OK; + } else { + PyErr_Clear(); + } + } +#ifdef SWIG_PYTHON_CAST_MODE + { + int dispatch = 0; + long v = PyInt_AsLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_AddCast(SWIG_OK); + } else { + PyErr_Clear(); + } + if (!dispatch) { + double d; + int res = SWIG_AddCast(SWIG_AsVal_double (obj,&d)); + if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, LONG_MIN, LONG_MAX)) { + if (val) *val = (long)(d); + return res; + } + } + } +#endif + return SWIG_TypeError; +} + + +SWIGINTERN int +SWIG_AsVal_int (PyObject * obj, int *val) +{ + long v; + int res = SWIG_AsVal_long (obj, &v); + if (SWIG_IsOK(res)) { + if ((v < INT_MIN || v > INT_MAX)) { + return SWIG_OverflowError; + } else { + if (val) *val = static_cast< int >(v); + } + } + return res; +} + + +SWIGINTERNINLINE PyObject* + SWIG_From_int (int value) +{ + return PyInt_FromLong((long) value); +} + + +SWIGINTERN int +SWIG_AsVal_unsigned_SS_long (PyObject *obj, unsigned long *val) +{ +#if PY_VERSION_HEX < 0x03000000 + if (PyInt_Check(obj)) { + long v = PyInt_AsLong(obj); + if (v >= 0) { + if (val) *val = v; + return SWIG_OK; + } else { + return SWIG_OverflowError; + } + } else +#endif + if (PyLong_Check(obj)) { + unsigned long v = PyLong_AsUnsignedLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_OK; + } else { + PyErr_Clear(); + } + } +#ifdef SWIG_PYTHON_CAST_MODE + { + int dispatch = 0; + unsigned long v = PyLong_AsUnsignedLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_AddCast(SWIG_OK); + } else { + PyErr_Clear(); + } + if (!dispatch) { + double d; + int res = SWIG_AddCast(SWIG_AsVal_double (obj,&d)); + if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, 0, ULONG_MAX)) { + if (val) *val = (unsigned long)(d); + return res; + } + } + } +#endif + return SWIG_TypeError; +} + + +SWIGINTERN int +SWIG_AsVal_unsigned_SS_int (PyObject * obj, unsigned int *val) +{ + unsigned long v; + int res = SWIG_AsVal_unsigned_SS_long (obj, &v); + if (SWIG_IsOK(res)) { + if ((v > UINT_MAX)) { + return SWIG_OverflowError; + } else { + if (val) *val = static_cast< unsigned int >(v); + } + } + return res; +} + + +SWIGINTERNINLINE PyObject* + SWIG_From_bool (bool value) +{ + return PyBool_FromLong(value ? 1 : 0); +} + + +SWIGINTERNINLINE PyObject* + SWIG_From_unsigned_SS_int (unsigned int value) +{ + return PyInt_FromSize_t((size_t) value); +} + + +#include "ActionConfig.h" +#include "MediaSessionMgr.h" +#include "MediaContent.h" +#include "SipUri.h" +#include "SipMessage.h" +#include "SipEvent.h" +#include "SipSession.h" + +#include "ProxyPluginMgr.h" +#include "ProxyConsumer.h" +#include "ProxyProducer.h" + +#include "SipCallback.h" +#include "SafeObject.h" +#include "SipStack.h" + + +SWIGINTERN int +SWIG_AsVal_short (PyObject * obj, short *val) +{ + long v; + int res = SWIG_AsVal_long (obj, &v); + if (SWIG_IsOK(res)) { + if ((v < SHRT_MIN || v > SHRT_MAX)) { + return SWIG_OverflowError; + } else { + if (val) *val = static_cast< short >(v); + } + } + return res; +} + + +SWIGINTERN int +SWIG_AsVal_long_SS_long (PyObject *obj, long long *val) +{ + int res = SWIG_TypeError; + if (PyLong_Check(obj)) { + long long v = PyLong_AsLongLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_OK; + } else { + PyErr_Clear(); + } + } else { + long v; + res = SWIG_AsVal_long (obj,&v); + if (SWIG_IsOK(res)) { + if (val) *val = v; + return res; + } + } +#ifdef SWIG_PYTHON_CAST_MODE + { + const double mant_max = 1LL << DBL_MANT_DIG; + const double mant_min = -mant_max; + double d; + res = SWIG_AsVal_double (obj,&d); + if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, mant_min, mant_max)) { + if (val) *val = (long long)(d); + return SWIG_AddCast(res); + } + res = SWIG_TypeError; + } +#endif + return res; +} + + + #define SWIG_From_long PyLong_FromLong + + +SWIGINTERNINLINE PyObject* +SWIG_From_long_SS_long (long long value) +{ + return ((value < LONG_MIN) || (value > LONG_MAX)) ? + PyLong_FromLongLong(value) : PyLong_FromLong(static_cast< long >(value)); +} + + +SWIGINTERNINLINE PyObject* +SWIG_From_unsigned_SS_long_SS_long (unsigned long long value) +{ + return (value > LONG_MAX) ? + PyLong_FromUnsignedLongLong(value) : PyLong_FromLong(static_cast< long >(value)); +} + + +SWIGINTERN int +SWIG_AsVal_bool (PyObject *obj, bool *val) +{ + int r = PyObject_IsTrue(obj); + if (r == -1) + return SWIG_ERROR; + if (val) *val = r ? true : false; + return SWIG_OK; +} + + +SWIGINTERN int +SWIG_AsVal_float (PyObject * obj, float *val) +{ + double v; + int res = SWIG_AsVal_double (obj, &v); + if (SWIG_IsOK(res)) { + if ((v < -FLT_MAX || v > FLT_MAX)) { + return SWIG_OverflowError; + } else { + if (val) *val = static_cast< float >(v); + } + } + return res; +} + + + #define SWIG_From_double PyFloat_FromDouble + + +SWIGINTERNINLINE PyObject * +SWIG_From_float (float value) +{ + return SWIG_From_double (value); +} + + +SWIGINTERN int +SWIG_AsVal_unsigned_SS_short (PyObject * obj, unsigned short *val) +{ + unsigned long v; + int res = SWIG_AsVal_unsigned_SS_long (obj, &v); + if (SWIG_IsOK(res)) { + if ((v > USHRT_MAX)) { + return SWIG_OverflowError; + } else { + if (val) *val = static_cast< unsigned short >(v); + } + } + return res; +} + + +SWIGINTERNINLINE PyObject* +SWIG_From_unsigned_SS_long (unsigned long value) +{ + return (value > LONG_MAX) ? + PyLong_FromUnsignedLong(value) : PyLong_FromLong(static_cast< long >(value)); +} + + +SWIGINTERNINLINE PyObject * +SWIG_From_unsigned_SS_short (unsigned short value) +{ + return SWIG_From_unsigned_SS_long (value); +} + + +SWIGINTERN int +SWIG_AsCharArray(PyObject * obj, char *val, size_t size) +{ + char* cptr = 0; size_t csize = 0; int alloc = SWIG_OLDOBJ; + int res = SWIG_AsCharPtrAndSize(obj, &cptr, &csize, &alloc); + if (SWIG_IsOK(res)) { + if ((csize == size + 1) && cptr && !(cptr[csize-1])) --csize; + if (csize <= size) { + if (val) { + if (csize) memcpy(val, cptr, csize*sizeof(char)); + if (csize < size) memset(val + csize, 0, (size - csize)*sizeof(char)); + } + if (alloc == SWIG_NEWOBJ) { + delete[] cptr; + res = SWIG_DelNewMask(res); + } + return res; + } + if (alloc == SWIG_NEWOBJ) delete[] cptr; + } + return SWIG_TypeError; +} + + +SWIGINTERN int +SWIG_AsVal_char (PyObject * obj, char *val) +{ + int res = SWIG_AsCharArray(obj, val, 1); + if (!SWIG_IsOK(res)) { + long v; + res = SWIG_AddCast(SWIG_AsVal_long (obj, &v)); + if (SWIG_IsOK(res)) { + if ((CHAR_MIN <= v) && (v <= CHAR_MAX)) { + if (val) *val = static_cast< char >(v); + } else { + res = SWIG_OverflowError; + } + } + } + return res; +} + + +SWIGINTERNINLINE PyObject * +SWIG_From_short (short value) +{ + return SWIG_From_long (value); +} + + +SWIGINTERN int +SWIG_AsVal_unsigned_SS_long_SS_long (PyObject *obj, unsigned long long *val) +{ + int res = SWIG_TypeError; + if (PyLong_Check(obj)) { + unsigned long long v = PyLong_AsUnsignedLongLong(obj); + if (!PyErr_Occurred()) { + if (val) *val = v; + return SWIG_OK; + } else { + PyErr_Clear(); + } + } else { + unsigned long v; + res = SWIG_AsVal_unsigned_SS_long (obj,&v); + if (SWIG_IsOK(res)) { + if (val) *val = v; + return res; + } + } +#ifdef SWIG_PYTHON_CAST_MODE + { + const double mant_max = 1LL << DBL_MANT_DIG; + double d; + res = SWIG_AsVal_double (obj,&d); + if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, 0, mant_max)) { + if (val) *val = (unsigned long long)(d); + return SWIG_AddCast(res); + } + res = SWIG_TypeError; + } +#endif + return res; +} + + +#include "Xcap.h" + + +#include "SMSEncoder.h" + + +#include "Msrp.h" + + + +/* --------------------------------------------------- + * C++ director class methods + * --------------------------------------------------- */ + +#include "tinyWRAP_wrap.h" + +SwigDirector_DDebugCallback::SwigDirector_DDebugCallback(PyObject *self): DDebugCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((DDebugCallback *)this, this); +} + + + + +SwigDirector_DDebugCallback::~SwigDirector_DDebugCallback() { +} + +int SwigDirector_DDebugCallback::OnDebugInfo(char const *message) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_FromCharPtr((const char *)message); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "OnDebugInfo"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugInfo", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugInfo'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_DDebugCallback::OnDebugWarn(char const *message) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_FromCharPtr((const char *)message); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "OnDebugWarn"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugWarn", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugWarn'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_DDebugCallback::OnDebugError(char const *message) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_FromCharPtr((const char *)message); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 2; + const char * const swig_method_name = "OnDebugError"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugError", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugError'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_DDebugCallback::OnDebugFatal(char const *message) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_FromCharPtr((const char *)message); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 3; + const char * const swig_method_name = "OnDebugFatal"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugFatal", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugFatal'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_T140Callback::SwigDirector_T140Callback(PyObject *self): T140Callback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((T140Callback *)this, this); +} + + + + +SwigDirector_T140Callback::~SwigDirector_T140Callback() { +} + +int SwigDirector_T140Callback::ondata(T140CallbackData const *pData) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(pData), SWIGTYPE_p_T140CallbackData, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call T140Callback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "ondata"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"ondata", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'T140Callback.ondata'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_ProxyPluginMgrCallback::SwigDirector_ProxyPluginMgrCallback(PyObject *self): ProxyPluginMgrCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((ProxyPluginMgrCallback *)this, this); +} + + + + +SwigDirector_ProxyPluginMgrCallback::~SwigDirector_ProxyPluginMgrCallback() { +} + +int SwigDirector_ProxyPluginMgrCallback::OnPluginCreated(uint64_t id, enum twrap_proxy_plugin_type_e type) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(id)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_int(static_cast< int >(type)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyPluginMgrCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "OnPluginCreated"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnPluginCreated", (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyPluginMgrCallback.OnPluginCreated'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyPluginMgrCallback::OnPluginDestroyed(uint64_t id, enum twrap_proxy_plugin_type_e type) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(id)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_int(static_cast< int >(type)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyPluginMgrCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "OnPluginDestroyed"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnPluginDestroyed", (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyPluginMgrCallback.OnPluginDestroyed'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_ProxyAudioConsumerCallback::SwigDirector_ProxyAudioConsumerCallback(PyObject *self): ProxyAudioConsumerCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((ProxyAudioConsumerCallback *)this, this); +} + + + + +SwigDirector_ProxyAudioConsumerCallback::~SwigDirector_ProxyAudioConsumerCallback() { +} + +int SwigDirector_ProxyAudioConsumerCallback::prepare(int ptime, int rate, int channels) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_int(static_cast< int >(ptime)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_int(static_cast< int >(rate)); + swig::SwigVar_PyObject obj2; + obj2 = SWIG_From_int(static_cast< int >(channels)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "prepare"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.prepare'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioConsumerCallback::start() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "start"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.start'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioConsumerCallback::pause() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 2; + const char * const swig_method_name = "pause"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.pause'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioConsumerCallback::stop() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 3; + const char * const swig_method_name = "stop"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.stop'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_ProxyVideoConsumerCallback::SwigDirector_ProxyVideoConsumerCallback(PyObject *self): ProxyVideoConsumerCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((ProxyVideoConsumerCallback *)this, this); +} + + + + +SwigDirector_ProxyVideoConsumerCallback::~SwigDirector_ProxyVideoConsumerCallback() { +} + +int SwigDirector_ProxyVideoConsumerCallback::prepare(int nWidth, int nHeight, int nFps) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_int(static_cast< int >(nWidth)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_int(static_cast< int >(nHeight)); + swig::SwigVar_PyObject obj2; + obj2 = SWIG_From_int(static_cast< int >(nFps)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "prepare"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.prepare'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoConsumerCallback::consume(ProxyVideoFrame const *frame) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(frame), SWIGTYPE_p_ProxyVideoFrame, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "consume"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"consume", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.consume'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoConsumerCallback::bufferCopied(unsigned int nCopiedSize, unsigned int nAvailableSize) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(nCopiedSize)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(nAvailableSize)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 2; + const char * const swig_method_name = "bufferCopied"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"bufferCopied", (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.bufferCopied'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoConsumerCallback::start() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 3; + const char * const swig_method_name = "start"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.start'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoConsumerCallback::pause() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 4; + const char * const swig_method_name = "pause"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.pause'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoConsumerCallback::stop() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 5; + const char * const swig_method_name = "stop"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.stop'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_ProxyAudioProducerCallback::SwigDirector_ProxyAudioProducerCallback(PyObject *self): ProxyAudioProducerCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((ProxyAudioProducerCallback *)this, this); +} + + + + +SwigDirector_ProxyAudioProducerCallback::~SwigDirector_ProxyAudioProducerCallback() { +} + +int SwigDirector_ProxyAudioProducerCallback::prepare(int ptime, int rate, int channels) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_int(static_cast< int >(ptime)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_int(static_cast< int >(rate)); + swig::SwigVar_PyObject obj2; + obj2 = SWIG_From_int(static_cast< int >(channels)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "prepare"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.prepare'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioProducerCallback::start() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "start"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.start'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioProducerCallback::pause() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 2; + const char * const swig_method_name = "pause"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.pause'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioProducerCallback::stop() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 3; + const char * const swig_method_name = "stop"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.stop'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyAudioProducerCallback::fillPushBuffer() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 4; + const char * const swig_method_name = "fillPushBuffer"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "fillPushBuffer", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.fillPushBuffer'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_ProxyVideoProducerCallback::SwigDirector_ProxyVideoProducerCallback(PyObject *self): ProxyVideoProducerCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((ProxyVideoProducerCallback *)this, this); +} + + + + +SwigDirector_ProxyVideoProducerCallback::~SwigDirector_ProxyVideoProducerCallback() { +} + +int SwigDirector_ProxyVideoProducerCallback::prepare(int width, int height, int fps) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_From_int(static_cast< int >(width)); + swig::SwigVar_PyObject obj1; + obj1 = SWIG_From_int(static_cast< int >(height)); + swig::SwigVar_PyObject obj2; + obj2 = SWIG_From_int(static_cast< int >(fps)); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "prepare"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.prepare'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoProducerCallback::start() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "start"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.start'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoProducerCallback::pause() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 2; + const char * const swig_method_name = "pause"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.pause'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_ProxyVideoProducerCallback::stop() { + int c_result; + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 3; + const char * const swig_method_name = "stop"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.stop'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_SipCallback::SwigDirector_SipCallback(PyObject *self): SipCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((SipCallback *)this, this); +} + + + + +SwigDirector_SipCallback::~SwigDirector_SipCallback() { +} + +int SwigDirector_SipCallback::OnDialogEvent(DialogEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_DialogEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "OnDialogEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDialogEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnDialogEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnStackEvent(StackEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_StackEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 1; + const char * const swig_method_name = "OnStackEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnStackEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnStackEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnInviteEvent(InviteEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_InviteEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 2; + const char * const swig_method_name = "OnInviteEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnInviteEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnInviteEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnMessagingEvent(MessagingEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_MessagingEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 3; + const char * const swig_method_name = "OnMessagingEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnMessagingEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnMessagingEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnInfoEvent(InfoEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_InfoEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 4; + const char * const swig_method_name = "OnInfoEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnInfoEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnInfoEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnOptionsEvent(OptionsEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_OptionsEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 5; + const char * const swig_method_name = "OnOptionsEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnOptionsEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnOptionsEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnPublicationEvent(PublicationEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_PublicationEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 6; + const char * const swig_method_name = "OnPublicationEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnPublicationEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnPublicationEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnRegistrationEvent(RegistrationEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_RegistrationEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 7; + const char * const swig_method_name = "OnRegistrationEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnRegistrationEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnRegistrationEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +int SwigDirector_SipCallback::OnSubscriptionEvent(SubscriptionEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_SubscriptionEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 8; + const char * const swig_method_name = "OnSubscriptionEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnSubscriptionEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnSubscriptionEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_XcapCallback::SwigDirector_XcapCallback(PyObject *self): XcapCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((XcapCallback *)this, this); +} + + + + +SwigDirector_XcapCallback::~SwigDirector_XcapCallback() { +} + +int SwigDirector_XcapCallback::onEvent(XcapEvent const *e) const { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_XcapEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call XcapCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "onEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"onEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'XcapCallback.onEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +SwigDirector_MsrpCallback::SwigDirector_MsrpCallback(PyObject *self): MsrpCallback(), Swig::Director(self) { + SWIG_DIRECTOR_RGTR((MsrpCallback *)this, this); +} + + + + +SwigDirector_MsrpCallback::~SwigDirector_MsrpCallback() { +} + +int SwigDirector_MsrpCallback::OnEvent(MsrpEvent const *e) { + int c_result; + swig::SwigVar_PyObject obj0; + obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_MsrpEvent, 0 ); + if (!swig_get_self()) { + Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call MsrpCallback.__init__."); + } +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) + const size_t swig_method_index = 0; + const char * const swig_method_name = "OnEvent"; + PyObject* method = swig_get_method(swig_method_index, swig_method_name); + swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0); +#else + swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnEvent", (char *)"(O)" ,(PyObject *)obj0); +#endif + if (!result) { + PyObject *error = PyErr_Occurred(); + if (error) { + Swig::DirectorMethodException::raise("Error detected when calling 'MsrpCallback.OnEvent'"); + } + } + int swig_val; + int swig_res = SWIG_AsVal_int(result, &swig_val); + if (!SWIG_IsOK(swig_res)) { + Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'"); + } + c_result = static_cast< int >(swig_val); + return (int) c_result; +} + + +#ifdef __cplusplus +extern "C" { +#endif +SWIGINTERN PyObject *_wrap_new_DDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + DDebugCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_DDebugCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (DDebugCallback *)new SwigDirector_DDebugCallback(arg1); + } else { + result = (DDebugCallback *)new DDebugCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_DDebugCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_DDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DDebugCallback *arg1 = (DDebugCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_DDebugCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_DDebugCallback" "', argument " "1"" of type '" "DDebugCallback *""'"); + } + arg1 = reinterpret_cast< DDebugCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugInfo(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DDebugCallback *arg1 = (DDebugCallback *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugInfo",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugInfo" "', argument " "1"" of type '" "DDebugCallback *""'"); + } + arg1 = reinterpret_cast< DDebugCallback * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugInfo" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->DDebugCallback::OnDebugInfo((char const *)arg2); + } else { + result = (int)(arg1)->OnDebugInfo((char const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugWarn(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DDebugCallback *arg1 = (DDebugCallback *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugWarn",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugWarn" "', argument " "1"" of type '" "DDebugCallback *""'"); + } + arg1 = reinterpret_cast< DDebugCallback * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugWarn" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->DDebugCallback::OnDebugWarn((char const *)arg2); + } else { + result = (int)(arg1)->OnDebugWarn((char const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugError(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DDebugCallback *arg1 = (DDebugCallback *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugError",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugError" "', argument " "1"" of type '" "DDebugCallback *""'"); + } + arg1 = reinterpret_cast< DDebugCallback * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugError" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->DDebugCallback::OnDebugError((char const *)arg2); + } else { + result = (int)(arg1)->OnDebugError((char const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugFatal(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DDebugCallback *arg1 = (DDebugCallback *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugFatal",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugFatal" "', argument " "1"" of type '" "DDebugCallback *""'"); + } + arg1 = reinterpret_cast< DDebugCallback * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugFatal" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->DDebugCallback::OnDebugFatal((char const *)arg2); + } else { + result = (int)(arg1)->OnDebugFatal((char const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_DDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DDebugCallback *arg1 = (DDebugCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_DDebugCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_DDebugCallback" "', argument " "1"" of type '" "DDebugCallback *""'"); + } + arg1 = reinterpret_cast< DDebugCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *DDebugCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_DDebugCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_AudioResampler(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + uint32_t arg2 ; + uint32_t arg3 ; + uint32_t arg4 ; + uint32_t arg5 ; + unsigned int val1 ; + int ecode1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + unsigned int val4 ; + int ecode4 = 0 ; + unsigned int val5 ; + int ecode5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + AudioResampler *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:new_AudioResampler",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "new_AudioResampler" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "new_AudioResampler" "', argument " "2"" of type '" "uint32_t""'"); + } + arg2 = static_cast< uint32_t >(val2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "new_AudioResampler" "', argument " "3"" of type '" "uint32_t""'"); + } + arg3 = static_cast< uint32_t >(val3); + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "new_AudioResampler" "', argument " "4"" of type '" "uint32_t""'"); + } + arg4 = static_cast< uint32_t >(val4); + ecode5 = SWIG_AsVal_unsigned_SS_int(obj4, &val5); + if (!SWIG_IsOK(ecode5)) { + SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "new_AudioResampler" "', argument " "5"" of type '" "uint32_t""'"); + } + arg5 = static_cast< uint32_t >(val5); + result = (AudioResampler *)new AudioResampler(arg1,arg2,arg3,arg4,arg5); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_AudioResampler, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_AudioResampler(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + AudioResampler *arg1 = (AudioResampler *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_AudioResampler",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_AudioResampler, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_AudioResampler" "', argument " "1"" of type '" "AudioResampler *""'"); + } + arg1 = reinterpret_cast< AudioResampler * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_AudioResampler_isValid(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + AudioResampler *arg1 = (AudioResampler *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:AudioResampler_isValid",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_AudioResampler, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "AudioResampler_isValid" "', argument " "1"" of type '" "AudioResampler *""'"); + } + arg1 = reinterpret_cast< AudioResampler * >(argp1); + result = (bool)(arg1)->isValid(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_AudioResampler_getOutputRequiredSizeInShort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + AudioResampler *arg1 = (AudioResampler *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint32_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:AudioResampler_getOutputRequiredSizeInShort",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_AudioResampler, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "AudioResampler_getOutputRequiredSizeInShort" "', argument " "1"" of type '" "AudioResampler *""'"); + } + arg1 = reinterpret_cast< AudioResampler * >(argp1); + result = (uint32_t)(arg1)->getOutputRequiredSizeInShort(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_AudioResampler_getInputRequiredSizeInShort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + AudioResampler *arg1 = (AudioResampler *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint32_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:AudioResampler_getInputRequiredSizeInShort",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_AudioResampler, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "AudioResampler_getInputRequiredSizeInShort" "', argument " "1"" of type '" "AudioResampler *""'"); + } + arg1 = reinterpret_cast< AudioResampler * >(argp1); + result = (uint32_t)(arg1)->getInputRequiredSizeInShort(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_AudioResampler_process(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + AudioResampler *arg1 = (AudioResampler *) 0 ; + void *arg2 = (void *) 0 ; + uint32_t arg3 ; + void *arg4 = (void *) 0 ; + uint32_t arg5 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + int res4 ; + unsigned int val5 ; + int ecode5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + uint32_t result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:AudioResampler_process",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_AudioResampler, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "AudioResampler_process" "', argument " "1"" of type '" "AudioResampler *""'"); + } + arg1 = reinterpret_cast< AudioResampler * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "AudioResampler_process" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "AudioResampler_process" "', argument " "3"" of type '" "uint32_t""'"); + } + arg3 = static_cast< uint32_t >(val3); + res4 = SWIG_ConvertPtr(obj3,SWIG_as_voidptrptr(&arg4), 0, 0); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "AudioResampler_process" "', argument " "4"" of type '" "void *""'"); + } + ecode5 = SWIG_AsVal_unsigned_SS_int(obj4, &val5); + if (!SWIG_IsOK(ecode5)) { + SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "AudioResampler_process" "', argument " "5"" of type '" "uint32_t""'"); + } + arg5 = static_cast< uint32_t >(val5); + result = (uint32_t)(arg1)->process((void const *)arg2,arg3,arg4,arg5); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *AudioResampler_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_AudioResampler, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_ActionConfig(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_ActionConfig")) SWIG_fail; + result = (ActionConfig *)new ActionConfig(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_ActionConfig(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ActionConfig",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ActionConfig" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ActionConfig_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ActionConfig_addHeader",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_addHeader" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ActionConfig_addHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_addHeader" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ActionConfig_addPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ActionConfig_addPayload",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_addPayload" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ActionConfig_addPayload" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ActionConfig_addPayload" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->addPayload((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ActionConfig_setActiveMedia(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + twrap_media_type_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ActionConfig_setActiveMedia",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setActiveMedia" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setActiveMedia" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + result = (bool)(arg1)->setActiveMedia(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ActionConfig_setResponseLine(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + short arg2 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + short val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + ActionConfig *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ActionConfig_setResponseLine",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setResponseLine" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + ecode2 = SWIG_AsVal_short(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setResponseLine" "', argument " "2"" of type '" "short""'"); + } + arg2 = static_cast< short >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_setResponseLine" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (ActionConfig *)(arg1)->setResponseLine(arg2,(char const *)arg3); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ActionConfig_setMediaString(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + ActionConfig *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ActionConfig_setMediaString",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setMediaString" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setMediaString" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_setMediaString" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "ActionConfig_setMediaString" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (ActionConfig *)(arg1)->setMediaString(arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ActionConfig_setMediaInt(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ActionConfig *arg1 = (ActionConfig *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + ActionConfig *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ActionConfig_setMediaInt",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setMediaInt" "', argument " "1"" of type '" "ActionConfig *""'"); + } + arg1 = reinterpret_cast< ActionConfig * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setMediaInt" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_setMediaInt" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ActionConfig_setMediaInt" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + result = (ActionConfig *)(arg1)->setMediaInt(arg2,(char const *)arg3,arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *ActionConfig_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ActionConfig, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_Codec(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_Codec",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_Codec" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getMediaType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + twrap_media_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getMediaType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getMediaType" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (twrap_media_type_t)(arg1)->getMediaType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getName",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getName" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (char *)(arg1)->getName(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getDescription(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getDescription",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getDescription" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (char *)(arg1)->getDescription(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getNegFormat(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getNegFormat",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getNegFormat" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (char *)(arg1)->getNegFormat(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getAudioSamplingRate(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getAudioSamplingRate",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getAudioSamplingRate" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (int)(arg1)->getAudioSamplingRate(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getAudioChannels(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getAudioChannels",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getAudioChannels" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (int)(arg1)->getAudioChannels(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_Codec_getAudioPTime(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + Codec *arg1 = (Codec *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:Codec_getAudioPTime",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_Codec, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "Codec_getAudioPTime" "', argument " "1"" of type '" "Codec *""'"); + } + arg1 = reinterpret_cast< Codec * >(argp1); + result = (int)(arg1)->getAudioPTime(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *Codec_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_Codec, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_MediaSessionMgr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MediaSessionMgr",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MediaSessionMgr" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_sessionSetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + int32_t arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_sessionSetInt32",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "4"" of type '" "int32_t""'"); + } + arg4 = static_cast< int32_t >(val4); + result = (bool)(arg1)->sessionSetInt32(arg2,(char const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_sessionGetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + int32_t result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MediaSessionMgr_sessionGetInt32",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_sessionGetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_sessionGetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_sessionGetInt32" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (int32_t)(arg1)->sessionGetInt32(arg2,(char const *)arg3); + resultobj = SWIG_From_int(static_cast< int >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_consumerSetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + int32_t arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_consumerSetInt32",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "4"" of type '" "int32_t""'"); + } + arg4 = static_cast< int32_t >(val4); + result = (bool)(arg1)->consumerSetInt32(arg2,(char const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_consumerSetInt64(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + int64_t arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + long long val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_consumerSetInt64",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_long_SS_long(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "4"" of type '" "int64_t""'"); + } + arg4 = static_cast< int64_t >(val4); + result = (bool)(arg1)->consumerSetInt64(arg2,(char const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_producerSetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + int32_t arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_producerSetInt32",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "4"" of type '" "int32_t""'"); + } + arg4 = static_cast< int32_t >(val4); + result = (bool)(arg1)->producerSetInt32(arg2,(char const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_producerSetInt64(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + char *arg3 = (char *) 0 ; + int64_t arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + long long val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_producerSetInt64",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_long_SS_long(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "4"" of type '" "int64_t""'"); + } + arg4 = static_cast< int64_t >(val4); + result = (bool)(arg1)->producerSetInt64(arg2,(char const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_producerGetCodec(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Codec *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_producerGetCodec",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_producerGetCodec" "', argument " "1"" of type '" "MediaSessionMgr *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_producerGetCodec" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + result = (Codec *)(arg1)->producerGetCodec(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_Codec, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_findProxyPluginConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyPlugin *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_findProxyPluginConsumer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_findProxyPluginConsumer" "', argument " "1"" of type '" "MediaSessionMgr const *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_findProxyPluginConsumer" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + result = (ProxyPlugin *)((MediaSessionMgr const *)arg1)->findProxyPluginConsumer(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPlugin, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_findProxyPluginProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyPlugin *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_findProxyPluginProducer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_findProxyPluginProducer" "', argument " "1"" of type '" "MediaSessionMgr const *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_findProxyPluginProducer" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + result = (ProxyPlugin *)((MediaSessionMgr const *)arg1)->findProxyPluginProducer(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPlugin, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_registerAudioPluginFromFile(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + char *arg1 = (char *) 0 ; + int res1 ; + char *buf1 = 0 ; + int alloc1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_registerAudioPluginFromFile",&obj0)) SWIG_fail; + res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_registerAudioPluginFromFile" "', argument " "1"" of type '" "char const *""'"); + } + arg1 = reinterpret_cast< char * >(buf1); + result = (unsigned int)MediaSessionMgr::registerAudioPluginFromFile((char const *)arg1); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return resultobj; +fail: + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_getSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ; + twrap_media_type_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + uint64_t result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_getSessionId",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_getSessionId" "', argument " "1"" of type '" "MediaSessionMgr const *""'"); + } + arg1 = reinterpret_cast< MediaSessionMgr * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_getSessionId" "', argument " "2"" of type '" "twrap_media_type_t""'"); + } + arg2 = static_cast< twrap_media_type_t >(val2); + result = (uint64_t)((MediaSessionMgr const *)arg1)->getSessionId(arg2); + resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetProfile(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_profile_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetProfile",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetProfile" "', argument " "1"" of type '" "tmedia_profile_t""'"); + } + arg1 = static_cast< tmedia_profile_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetProfile(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetProfile(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_profile_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetProfile")) SWIG_fail; + result = (tmedia_profile_t)MediaSessionMgr::defaultsGetProfile(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetBandwidthLevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_bandwidth_level_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetBandwidthLevel",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetBandwidthLevel" "', argument " "1"" of type '" "tmedia_bandwidth_level_t""'"); + } + arg1 = static_cast< tmedia_bandwidth_level_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetBandwidthLevel(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetBandwidthLevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_bandwidth_level_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetBandwidthLevel")) SWIG_fail; + result = (tmedia_bandwidth_level_t)MediaSessionMgr::defaultsGetBandwidthLevel(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetCongestionCtrlEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetCongestionCtrlEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetCongestionCtrlEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetCongestionCtrlEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetVideoMotionRank(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetVideoMotionRank",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetVideoMotionRank" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetVideoMotionRank(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetVideoFps(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetVideoFps",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetVideoFps" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetVideoFps(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetBandwidthVideoUploadMax(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetBandwidthVideoUploadMax",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetBandwidthVideoUploadMax" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetBandwidthVideoUploadMax(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetBandwidthVideoDownloadMax(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetPrefVideoSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_pref_video_size_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetPrefVideoSize",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetPrefVideoSize" "', argument " "1"" of type '" "tmedia_pref_video_size_t""'"); + } + arg1 = static_cast< tmedia_pref_video_size_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetPrefVideoSize(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetJbMargin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetJbMargin",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetJbMargin" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetJbMargin(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetJbMaxLateRate(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetJbMaxLateRate",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetJbMaxLateRate" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetJbMaxLateRate(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetEchoTail(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetEchoTail",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetEchoTail" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetEchoTail(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetEchoTail(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetEchoTail")) SWIG_fail; + result = (uint32_t)MediaSessionMgr::defaultsGetEchoTail(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetEchoSkew(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetEchoSkew",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetEchoSkew" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetEchoSkew(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetEchoSuppEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetEchoSuppEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetEchoSuppEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetEchoSuppEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetEchoSuppEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetEchoSuppEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetEchoSuppEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAgcEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetAgcEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAgcEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetAgcEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetAgcEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetAgcEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetAgcEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAgcLevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + float arg1 ; + float val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetAgcLevel",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_float(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAgcLevel" "', argument " "1"" of type '" "float""'"); + } + arg1 = static_cast< float >(val1); + result = (bool)MediaSessionMgr::defaultsSetAgcLevel(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetAgcLevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + float result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetAgcLevel")) SWIG_fail; + result = (float)MediaSessionMgr::defaultsGetAgcLevel(); + resultobj = SWIG_From_float(static_cast< float >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetVadEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetVadEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetVadEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetVadEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetGetVadEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetGetVadEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetGetVadEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetNoiseSuppEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetNoiseSuppEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetNoiseSuppEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetNoiseSuppEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetNoiseSuppEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetNoiseSuppEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetNoiseSuppEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetNoiseSuppLevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetNoiseSuppLevel",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetNoiseSuppLevel" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetNoiseSuppLevel(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetNoiseSuppLevel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetNoiseSuppLevel")) SWIG_fail; + result = (int32_t)MediaSessionMgr::defaultsGetNoiseSuppLevel(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSet100relEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSet100relEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSet100relEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSet100relEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGet100relEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGet100relEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGet100relEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetScreenSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int32_t arg2 ; + int val1 ; + int ecode1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetScreenSize",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetScreenSize" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_defaultsSetScreenSize" "', argument " "2"" of type '" "int32_t""'"); + } + arg2 = static_cast< int32_t >(val2); + result = (bool)MediaSessionMgr::defaultsSetScreenSize(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAudioGain(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int32_t arg2 ; + int val1 ; + int ecode1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetAudioGain",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAudioGain" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_defaultsSetAudioGain" "', argument " "2"" of type '" "int32_t""'"); + } + arg2 = static_cast< int32_t >(val2); + result = (bool)MediaSessionMgr::defaultsSetAudioGain(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAudioPtime(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetAudioPtime",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAudioPtime" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetAudioPtime(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAudioChannels(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int32_t arg2 ; + int val1 ; + int ecode1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetAudioChannels",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAudioChannels" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_defaultsSetAudioChannels" "', argument " "2"" of type '" "int32_t""'"); + } + arg2 = static_cast< int32_t >(val2); + result = (bool)MediaSessionMgr::defaultsSetAudioChannels(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetRtpPortRange(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint16_t arg1 ; + uint16_t arg2 ; + unsigned short val1 ; + int ecode1 = 0 ; + unsigned short val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetRtpPortRange",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_short(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetRtpPortRange" "', argument " "1"" of type '" "uint16_t""'"); + } + arg1 = static_cast< uint16_t >(val1); + ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_defaultsSetRtpPortRange" "', argument " "2"" of type '" "uint16_t""'"); + } + arg2 = static_cast< uint16_t >(val2); + result = (bool)MediaSessionMgr::defaultsSetRtpPortRange(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetRtpSymetricEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetRtpSymetricEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetRtpSymetricEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetRtpSymetricEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetMediaType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + twrap_media_type_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetMediaType",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetMediaType" "', argument " "1"" of type '" "twrap_media_type_t""'"); + } + arg1 = static_cast< twrap_media_type_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetMediaType(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetVolume(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetVolume",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetVolume" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetVolume(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetVolume(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetVolume")) SWIG_fail; + result = (int32_t)MediaSessionMgr::defaultsGetVolume(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetInviteSessionTimers(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + char *arg2 = (char *) 0 ; + int val1 ; + int ecode1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetInviteSessionTimers",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetInviteSessionTimers" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaSessionMgr_defaultsSetInviteSessionTimers" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)MediaSessionMgr::defaultsSetInviteSessionTimers(arg1,(char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetSRtpMode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_srtp_mode_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetSRtpMode",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetSRtpMode" "', argument " "1"" of type '" "tmedia_srtp_mode_t""'"); + } + arg1 = static_cast< tmedia_srtp_mode_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetSRtpMode(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetSRtpMode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_srtp_mode_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetSRtpMode")) SWIG_fail; + result = (tmedia_srtp_mode_t)MediaSessionMgr::defaultsGetSRtpMode(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetSRtpType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_srtp_type_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetSRtpType",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetSRtpType" "', argument " "1"" of type '" "tmedia_srtp_type_t""'"); + } + arg1 = static_cast< tmedia_srtp_type_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetSRtpType(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetSRtpType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_srtp_type_t result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetSRtpType")) SWIG_fail; + result = (tmedia_srtp_type_t)MediaSessionMgr::defaultsGetSRtpType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetRtcpEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetRtcpEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetRtcpEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetRtcpEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetRtcpEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetRtcpEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetRtcpEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetRtcpMuxEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetRtcpMuxEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetRtcpMuxEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetRtcpMuxEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetRtcpMuxEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetRtcpMuxEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetRtcpMuxEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetStunEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetStunEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetStunEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetStunEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetIceStunEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetIceStunEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetIceStunEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetIceStunEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetIceTurnEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetIceTurnEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetIceTurnEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetIceTurnEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetStunServer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + char *arg1 = (char *) 0 ; + uint16_t arg2 ; + int res1 ; + char *buf1 = 0 ; + int alloc1 = 0 ; + unsigned short val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetStunServer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_defaultsSetStunServer" "', argument " "1"" of type '" "char const *""'"); + } + arg1 = reinterpret_cast< char * >(buf1); + ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_defaultsSetStunServer" "', argument " "2"" of type '" "uint16_t""'"); + } + arg2 = static_cast< uint16_t >(val2); + result = (bool)MediaSessionMgr::defaultsSetStunServer((char const *)arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return resultobj; +fail: + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetStunCred(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + char *arg1 = (char *) 0 ; + char *arg2 = (char *) 0 ; + int res1 ; + char *buf1 = 0 ; + int alloc1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetStunCred",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_defaultsSetStunCred" "', argument " "1"" of type '" "char const *""'"); + } + arg1 = reinterpret_cast< char * >(buf1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaSessionMgr_defaultsSetStunCred" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)MediaSessionMgr::defaultsSetStunCred((char const *)arg1,(char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetIceEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetIceEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetIceEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetIceEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetByPassEncoding(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetByPassEncoding",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetByPassEncoding" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetByPassEncoding(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetByPassEncoding(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetByPassEncoding")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetByPassEncoding(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetByPassDecoding(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetByPassDecoding",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetByPassDecoding" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetByPassDecoding(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetByPassDecoding(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetByPassDecoding")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetByPassDecoding(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetVideoJbEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetVideoJbEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetVideoJbEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetVideoJbEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetVideoJbEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetVideoJbEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetVideoJbEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + result = (bool)MediaSessionMgr::defaultsSetVideoZeroArtifactsEnabled(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled")) SWIG_fail; + result = (bool)MediaSessionMgr::defaultsGetVideoZeroArtifactsEnabled(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetRtpBuffSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + unsigned int arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetRtpBuffSize",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetRtpBuffSize" "', argument " "1"" of type '" "unsigned int""'"); + } + arg1 = static_cast< unsigned int >(val1); + result = (bool)MediaSessionMgr::defaultsSetRtpBuffSize(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsGetRtpBuffSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)":MediaSessionMgr_defaultsGetRtpBuffSize")) SWIG_fail; + result = (unsigned int)MediaSessionMgr::defaultsGetRtpBuffSize(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAvpfTail(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + unsigned int arg1 ; + unsigned int arg2 ; + unsigned int val1 ; + int ecode1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_defaultsSetAvpfTail",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAvpfTail" "', argument " "1"" of type '" "unsigned int""'"); + } + arg1 = static_cast< unsigned int >(val1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_defaultsSetAvpfTail" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)MediaSessionMgr::defaultsSetAvpfTail(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetAvpfMode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + enum tmedia_mode_e arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetAvpfMode",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetAvpfMode" "', argument " "1"" of type '" "enum tmedia_mode_e""'"); + } + arg1 = static_cast< enum tmedia_mode_e >(val1); + result = (bool)MediaSessionMgr::defaultsSetAvpfMode(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetOpusMaxCaptureRate(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetOpusMaxCaptureRate",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetOpusMaxCaptureRate" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetOpusMaxCaptureRate(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetOpusMaxPlaybackRate(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + uint32_t arg1 ; + unsigned int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetOpusMaxPlaybackRate",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_unsigned_SS_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetOpusMaxPlaybackRate" "', argument " "1"" of type '" "uint32_t""'"); + } + arg1 = static_cast< uint32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetOpusMaxPlaybackRate(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaSessionMgr_defaultsSetMaxFds(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int32_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaSessionMgr_defaultsSetMaxFds",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "MediaSessionMgr_defaultsSetMaxFds" "', argument " "1"" of type '" "int32_t""'"); + } + arg1 = static_cast< int32_t >(val1); + result = (bool)MediaSessionMgr::defaultsSetMaxFds(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *MediaSessionMgr_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MediaSessionMgr, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_MediaContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContent *arg1 = (MediaContent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MediaContent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MediaContent" "', argument " "1"" of type '" "MediaContent *""'"); + } + arg1 = reinterpret_cast< MediaContent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContent *arg1 = (MediaContent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaContent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getType" "', argument " "1"" of type '" "MediaContent *""'"); + } + arg1 = reinterpret_cast< MediaContent * >(argp1); + result = (char *)(arg1)->getType(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_getDataLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContent *arg1 = (MediaContent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaContent_getDataLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getDataLength" "', argument " "1"" of type '" "MediaContent *""'"); + } + arg1 = reinterpret_cast< MediaContent * >(argp1); + result = (unsigned int)(arg1)->getDataLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_getData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContent *arg1 = (MediaContent *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContent_getData",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getData" "', argument " "1"" of type '" "MediaContent *""'"); + } + arg1 = reinterpret_cast< MediaContent * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContent_getData" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MediaContent_getData" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getData(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_parse__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + void *arg1 = (void *) 0 ; + unsigned int arg2 ; + char *arg3 = (char *) 0 ; + int res1 ; + unsigned int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + MediaContent *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContent_parse",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_parse" "', argument " "1"" of type '" "void const *""'"); + } + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaContent_parse" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaContent_parse" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (MediaContent *)MediaContent::parse((void const *)arg1,arg2,(char const *)arg3); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MediaContent, SWIG_POINTER_OWN | 0 ); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_parse__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + void *arg1 = (void *) 0 ; + unsigned int arg2 ; + int res1 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + MediaContentCPIM *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaContent_parse",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_parse" "', argument " "1"" of type '" "void const *""'"); + } + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaContent_parse" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (MediaContentCPIM *)MediaContent::parse((void const *)arg1,arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MediaContentCPIM, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_parse(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[0], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_MediaContent_parse__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[0], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MediaContent_parse__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MediaContent_parse'.\n" + " Possible C/C++ prototypes are:\n" + " MediaContent::parse(void const *,unsigned int,char const *)\n" + " MediaContent::parse(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContent *arg1 = (MediaContent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaContent_getPayloadLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getPayloadLength" "', argument " "1"" of type '" "MediaContent *""'"); + } + arg1 = reinterpret_cast< MediaContent * >(argp1); + result = (unsigned int)(arg1)->getPayloadLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContent_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContent *arg1 = (MediaContent *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContent_getPayload",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getPayload" "', argument " "1"" of type '" "MediaContent *""'"); + } + arg1 = reinterpret_cast< MediaContent * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContent_getPayload" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MediaContent_getPayload" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getPayload(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *MediaContent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MediaContent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_MediaContentCPIM(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MediaContentCPIM",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MediaContentCPIM" "', argument " "1"" of type '" "MediaContentCPIM *""'"); + } + arg1 = reinterpret_cast< MediaContentCPIM * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContentCPIM_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:MediaContentCPIM_getPayloadLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContentCPIM_getPayloadLength" "', argument " "1"" of type '" "MediaContentCPIM *""'"); + } + arg1 = reinterpret_cast< MediaContentCPIM * >(argp1); + result = (unsigned int)(arg1)->getPayloadLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContentCPIM_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContentCPIM_getPayload",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContentCPIM_getPayload" "', argument " "1"" of type '" "MediaContentCPIM *""'"); + } + arg1 = reinterpret_cast< MediaContentCPIM * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContentCPIM_getPayload" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MediaContentCPIM_getPayload" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getPayload(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MediaContentCPIM_getHeaderValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:MediaContentCPIM_getHeaderValue",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContentCPIM_getHeaderValue" "', argument " "1"" of type '" "MediaContentCPIM *""'"); + } + arg1 = reinterpret_cast< MediaContentCPIM * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContentCPIM_getHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->getHeaderValue((char const *)arg2); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *MediaContentCPIM_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MediaContentCPIM, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SipUri__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + char *arg1 = (char *) 0 ; + char *arg2 = (char *) 0 ; + int res1 ; + char *buf1 = 0 ; + int alloc1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + SipUri *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:new_SipUri",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipUri" "', argument " "1"" of type '" "char const *""'"); + } + arg1 = reinterpret_cast< char * >(buf1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_SipUri" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (SipUri *)new SipUri((char const *)arg1,(char const *)arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipUri, SWIG_POINTER_NEW | 0 ); + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_new_SipUri__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + char *arg1 = (char *) 0 ; + int res1 ; + char *buf1 = 0 ; + int alloc1 = 0 ; + PyObject * obj0 = 0 ; + SipUri *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_SipUri",&obj0)) SWIG_fail; + res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipUri" "', argument " "1"" of type '" "char const *""'"); + } + arg1 = reinterpret_cast< char * >(buf1); + result = (SipUri *)new SipUri((char const *)arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipUri, SWIG_POINTER_NEW | 0 ); + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return resultobj; +fail: + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_new_SipUri(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + int res = SWIG_AsCharPtrAndSize(argv[0], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_new_SipUri__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + int res = SWIG_AsCharPtrAndSize(argv[0], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_new_SipUri__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'new_SipUri'.\n" + " Possible C/C++ prototypes are:\n" + " SipUri::SipUri(char const *,char const *)\n" + " SipUri::SipUri(char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_delete_SipUri(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SipUri",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipUri" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_isValid__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + char *arg1 = (char *) 0 ; + int res1 ; + char *buf1 = 0 ; + int alloc1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_isValid",&obj0)) SWIG_fail; + res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_isValid" "', argument " "1"" of type '" "char const *""'"); + } + arg1 = reinterpret_cast< char * >(buf1); + result = (bool)SipUri::isValid((char const *)arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return resultobj; +fail: + if (alloc1 == SWIG_NEWOBJ) delete[] buf1; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_isValid__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_isValid",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_isValid" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (bool)(arg1)->isValid(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_isValid(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[2]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 1) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipUri_isValid__SWIG_1(self, args); + } + } + if (argc == 1) { + int _v; + int res = SWIG_AsCharPtrAndSize(argv[0], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipUri_isValid__SWIG_0(self, args); + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipUri_isValid'.\n" + " Possible C/C++ prototypes are:\n" + " SipUri::isValid(char const *)\n" + " SipUri::isValid()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getScheme(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getScheme",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getScheme" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (char *)(arg1)->getScheme(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getHost(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getHost",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getHost" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (char *)(arg1)->getHost(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned short result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getPort",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getPort" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (unsigned short)(arg1)->getPort(); + resultobj = SWIG_From_unsigned_SS_short(static_cast< unsigned short >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getUserName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getUserName",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getUserName" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (char *)(arg1)->getUserName(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getPassword(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getPassword",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getPassword" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (char *)(arg1)->getPassword(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getDisplayName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getDisplayName",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getDisplayName" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + result = (char *)(arg1)->getDisplayName(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_getParamValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipUri_getParamValue",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getParamValue" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipUri_getParamValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->getParamValue((char const *)arg2); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipUri_setDisplayName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipUri *arg1 = (SipUri *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipUri_setDisplayName",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_setDisplayName" "', argument " "1"" of type '" "SipUri *""'"); + } + arg1 = reinterpret_cast< SipUri * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipUri_setDisplayName" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + (arg1)->setDisplayName((char const *)arg2); + resultobj = SWIG_Py_Void(); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *SipUri_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SipUri, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SdpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SdpMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_SdpMessage")) SWIG_fail; + result = (SdpMessage *)new SdpMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SdpMessage, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SdpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SdpMessage *arg1 = (SdpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SdpMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SdpMessage" "', argument " "1"" of type '" "SdpMessage *""'"); + } + arg1 = reinterpret_cast< SdpMessage * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SdpMessage *arg1 = (SdpMessage *) 0 ; + char *arg2 = (char *) 0 ; + char arg3 ; + unsigned int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + char val3 ; + int ecode3 = 0 ; + unsigned int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SdpMessage_getSdpHeaderValue",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "1"" of type '" "SdpMessage *""'"); + } + arg1 = reinterpret_cast< SdpMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_char(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "3"" of type '" "char""'"); + } + arg3 = static_cast< char >(val3); + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + result = (char *)(arg1)->getSdpHeaderValue((char const *)arg2,arg3,arg4); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SdpMessage *arg1 = (SdpMessage *) 0 ; + char *arg2 = (char *) 0 ; + char arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + char val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SdpMessage_getSdpHeaderValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "1"" of type '" "SdpMessage *""'"); + } + arg1 = reinterpret_cast< SdpMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_char(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "3"" of type '" "char""'"); + } + arg3 = static_cast< char >(val3); + result = (char *)(arg1)->getSdpHeaderValue((char const *)arg2,arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderValue(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SdpMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_char(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SdpMessage_getSdpHeaderValue__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SdpMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_char(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SdpMessage_getSdpHeaderValue__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SdpMessage_getSdpHeaderValue'.\n" + " Possible C/C++ prototypes are:\n" + " SdpMessage::getSdpHeaderValue(char const *,char,unsigned int)\n" + " SdpMessage::getSdpHeaderValue(char const *,char)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderAValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SdpMessage *arg1 = (SdpMessage *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SdpMessage_getSdpHeaderAValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SdpMessage_getSdpHeaderAValue" "', argument " "1"" of type '" "SdpMessage *""'"); + } + arg1 = reinterpret_cast< SdpMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SdpMessage_getSdpHeaderAValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SdpMessage_getSdpHeaderAValue" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (char *)(arg1)->getSdpHeaderAValue((char const *)arg2,(char const *)arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *SdpMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SdpMessage, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SipMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_SipMessage")) SWIG_fail; + result = (SipMessage *)new SipMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipMessage, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SipMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SipMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipMessage" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_isResponse(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_isResponse",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_isResponse" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + result = (bool)(arg1)->isResponse(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getRequestType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_request_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getRequestType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getRequestType" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + result = (tsip_request_type_t)(arg1)->getRequestType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getResponseCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + short result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getResponseCode",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getResponseCode" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + result = (short)(arg1)->getResponseCode(); + resultobj = SWIG_From_short(static_cast< short >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getResponsePhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getResponsePhrase",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getResponsePhrase" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + result = (char *)(arg1)->getResponsePhrase(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + char *arg2 = (char *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipMessage_getSipHeaderValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderValue" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipMessage_getSipHeaderValue" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (char *)(arg1)->getSipHeaderValue((char const *)arg2,arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipMessage_getSipHeaderValue",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderValue" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->getSipHeaderValue((char const *)arg2); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderValue(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipMessage_getSipHeaderValue__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SipMessage_getSipHeaderValue__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipMessage_getSipHeaderValue'.\n" + " Possible C/C++ prototypes are:\n" + " SipMessage::getSipHeaderValue(char const *,unsigned int)\n" + " SipMessage::getSipHeaderValue(char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderParamValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + unsigned int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + unsigned int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SipMessage_getSipHeaderParamValue",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + result = (char *)(arg1)->getSipHeaderParamValue((char const *)arg2,(char const *)arg3,arg4); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderParamValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipMessage_getSipHeaderParamValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (char *)(arg1)->getSipHeaderParamValue((char const *)arg2,(char const *)arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderParamValue(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipMessage_getSipHeaderParamValue__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SipMessage_getSipHeaderParamValue__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipMessage_getSipHeaderParamValue'.\n" + " Possible C/C++ prototypes are:\n" + " SipMessage::getSipHeaderParamValue(char const *,char const *,unsigned int)\n" + " SipMessage::getSipHeaderParamValue(char const *,char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipContentLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getSipContentLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipContentLength" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + result = (unsigned int)(arg1)->getSipContentLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSipContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipMessage_getSipContent",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipContent" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipContent" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipMessage_getSipContent" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getSipContent(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipMessage_getSdpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipMessage *arg1 = (SipMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SdpMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getSdpMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSdpMessage" "', argument " "1"" of type '" "SipMessage *""'"); + } + arg1 = reinterpret_cast< SipMessage * >(argp1); + result = (SdpMessage *)(arg1)->getSdpMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SdpMessage, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SipMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SipMessage, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_SipEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipEvent *arg1 = (SipEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SipEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipEvent" "', argument " "1"" of type '" "SipEvent *""'"); + } + arg1 = reinterpret_cast< SipEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipEvent_getCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipEvent *arg1 = (SipEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + short result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getCode",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getCode" "', argument " "1"" of type '" "SipEvent const *""'"); + } + arg1 = reinterpret_cast< SipEvent * >(argp1); + result = (short)((SipEvent const *)arg1)->getCode(); + resultobj = SWIG_From_short(static_cast< short >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipEvent_getPhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipEvent *arg1 = (SipEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getPhrase",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getPhrase" "', argument " "1"" of type '" "SipEvent const *""'"); + } + arg1 = reinterpret_cast< SipEvent * >(argp1); + result = (char *)((SipEvent const *)arg1)->getPhrase(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipEvent_getBaseSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipEvent *arg1 = (SipEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SipSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getBaseSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getBaseSession" "', argument " "1"" of type '" "SipEvent const *""'"); + } + arg1 = reinterpret_cast< SipEvent * >(argp1); + result = (SipSession *)((SipEvent const *)arg1)->getBaseSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipEvent_getSipMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipEvent *arg1 = (SipEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SipMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getSipMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getSipMessage" "', argument " "1"" of type '" "SipEvent const *""'"); + } + arg1 = reinterpret_cast< SipEvent * >(argp1); + result = (SipMessage *)((SipEvent const *)arg1)->getSipMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipMessage, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SipEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SipEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_DialogEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + DialogEvent *arg1 = (DialogEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_DialogEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DialogEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_DialogEvent" "', argument " "1"" of type '" "DialogEvent *""'"); + } + arg1 = reinterpret_cast< DialogEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *DialogEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_DialogEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_StackEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + StackEvent *arg1 = (StackEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_StackEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_StackEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_StackEvent" "', argument " "1"" of type '" "StackEvent *""'"); + } + arg1 = reinterpret_cast< StackEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *StackEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_StackEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_InviteEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteEvent *arg1 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_InviteEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_InviteEvent" "', argument " "1"" of type '" "InviteEvent *""'"); + } + arg1 = reinterpret_cast< InviteEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteEvent *arg1 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_invite_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_getType" "', argument " "1"" of type '" "InviteEvent const *""'"); + } + arg1 = reinterpret_cast< InviteEvent * >(argp1); + result = (tsip_invite_event_type_t)((InviteEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteEvent_getMediaType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteEvent *arg1 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + twrap_media_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_getMediaType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_getMediaType" "', argument " "1"" of type '" "InviteEvent const *""'"); + } + arg1 = reinterpret_cast< InviteEvent * >(argp1); + result = (twrap_media_type_t)((InviteEvent const *)arg1)->getMediaType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteEvent *arg1 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + InviteSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_getSession" "', argument " "1"" of type '" "InviteEvent const *""'"); + } + arg1 = reinterpret_cast< InviteEvent * >(argp1); + result = (InviteSession *)((InviteEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InviteSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteEvent_takeCallSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteEvent *arg1 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + CallSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_takeCallSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_takeCallSessionOwnership" "', argument " "1"" of type '" "InviteEvent const *""'"); + } + arg1 = reinterpret_cast< InviteEvent * >(argp1); + result = (CallSession *)((InviteEvent const *)arg1)->takeCallSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_CallSession, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteEvent_takeMsrpSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteEvent *arg1 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MsrpSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_takeMsrpSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_takeMsrpSessionOwnership" "', argument " "1"" of type '" "InviteEvent const *""'"); + } + arg1 = reinterpret_cast< InviteEvent * >(argp1); + result = (MsrpSession *)((InviteEvent const *)arg1)->takeMsrpSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpSession, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *InviteEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_InviteEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_MessagingEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingEvent *arg1 = (MessagingEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MessagingEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MessagingEvent" "', argument " "1"" of type '" "MessagingEvent *""'"); + } + arg1 = reinterpret_cast< MessagingEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingEvent *arg1 = (MessagingEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_message_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:MessagingEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingEvent_getType" "', argument " "1"" of type '" "MessagingEvent const *""'"); + } + arg1 = reinterpret_cast< MessagingEvent * >(argp1); + result = (tsip_message_event_type_t)((MessagingEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingEvent *arg1 = (MessagingEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MessagingSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:MessagingEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingEvent_getSession" "', argument " "1"" of type '" "MessagingEvent const *""'"); + } + arg1 = reinterpret_cast< MessagingEvent * >(argp1); + result = (MessagingSession *)((MessagingEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MessagingSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingEvent *arg1 = (MessagingEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MessagingSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:MessagingEvent_takeSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingEvent_takeSessionOwnership" "', argument " "1"" of type '" "MessagingEvent const *""'"); + } + arg1 = reinterpret_cast< MessagingEvent * >(argp1); + result = (MessagingSession *)((MessagingEvent const *)arg1)->takeSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MessagingSession, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *MessagingEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MessagingEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_InfoEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoEvent *arg1 = (InfoEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_InfoEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_InfoEvent" "', argument " "1"" of type '" "InfoEvent *""'"); + } + arg1 = reinterpret_cast< InfoEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoEvent *arg1 = (InfoEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_info_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:InfoEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoEvent_getType" "', argument " "1"" of type '" "InfoEvent const *""'"); + } + arg1 = reinterpret_cast< InfoEvent * >(argp1); + result = (tsip_info_event_type_t)((InfoEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoEvent *arg1 = (InfoEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + InfoSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:InfoEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoEvent_getSession" "', argument " "1"" of type '" "InfoEvent const *""'"); + } + arg1 = reinterpret_cast< InfoEvent * >(argp1); + result = (InfoSession *)((InfoEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InfoSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoEvent *arg1 = (InfoEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + InfoSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:InfoEvent_takeSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoEvent_takeSessionOwnership" "', argument " "1"" of type '" "InfoEvent const *""'"); + } + arg1 = reinterpret_cast< InfoEvent * >(argp1); + result = (InfoSession *)((InfoEvent const *)arg1)->takeSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InfoSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *InfoEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_InfoEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_OptionsEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsEvent *arg1 = (OptionsEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_OptionsEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_OptionsEvent" "', argument " "1"" of type '" "OptionsEvent *""'"); + } + arg1 = reinterpret_cast< OptionsEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsEvent *arg1 = (OptionsEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_options_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:OptionsEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsEvent_getType" "', argument " "1"" of type '" "OptionsEvent const *""'"); + } + arg1 = reinterpret_cast< OptionsEvent * >(argp1); + result = (tsip_options_event_type_t)((OptionsEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsEvent *arg1 = (OptionsEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + OptionsSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:OptionsEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsEvent_getSession" "', argument " "1"" of type '" "OptionsEvent const *""'"); + } + arg1 = reinterpret_cast< OptionsEvent * >(argp1); + result = (OptionsSession *)((OptionsEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_OptionsSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsEvent *arg1 = (OptionsEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + OptionsSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:OptionsEvent_takeSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsEvent_takeSessionOwnership" "', argument " "1"" of type '" "OptionsEvent const *""'"); + } + arg1 = reinterpret_cast< OptionsEvent * >(argp1); + result = (OptionsSession *)((OptionsEvent const *)arg1)->takeSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_OptionsSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *OptionsEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_OptionsEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_PublicationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationEvent *arg1 = (PublicationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_PublicationEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_PublicationEvent" "', argument " "1"" of type '" "PublicationEvent *""'"); + } + arg1 = reinterpret_cast< PublicationEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationEvent *arg1 = (PublicationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_publish_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:PublicationEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationEvent_getType" "', argument " "1"" of type '" "PublicationEvent const *""'"); + } + arg1 = reinterpret_cast< PublicationEvent * >(argp1); + result = (tsip_publish_event_type_t)((PublicationEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationEvent *arg1 = (PublicationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + PublicationSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:PublicationEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationEvent_getSession" "', argument " "1"" of type '" "PublicationEvent const *""'"); + } + arg1 = reinterpret_cast< PublicationEvent * >(argp1); + result = (PublicationSession *)((PublicationEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_PublicationSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationEvent *arg1 = (PublicationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + PublicationSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:PublicationEvent_takeSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationEvent_takeSessionOwnership" "', argument " "1"" of type '" "PublicationEvent const *""'"); + } + arg1 = reinterpret_cast< PublicationEvent * >(argp1); + result = (PublicationSession *)((PublicationEvent const *)arg1)->takeSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_PublicationSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *PublicationEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_PublicationEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_RegistrationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationEvent *arg1 = (RegistrationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_RegistrationEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_RegistrationEvent" "', argument " "1"" of type '" "RegistrationEvent *""'"); + } + arg1 = reinterpret_cast< RegistrationEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationEvent *arg1 = (RegistrationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_register_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationEvent_getType" "', argument " "1"" of type '" "RegistrationEvent const *""'"); + } + arg1 = reinterpret_cast< RegistrationEvent * >(argp1); + result = (tsip_register_event_type_t)((RegistrationEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationEvent *arg1 = (RegistrationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + RegistrationSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationEvent_getSession" "', argument " "1"" of type '" "RegistrationEvent const *""'"); + } + arg1 = reinterpret_cast< RegistrationEvent * >(argp1); + result = (RegistrationSession *)((RegistrationEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RegistrationSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationEvent *arg1 = (RegistrationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + RegistrationSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationEvent_takeSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationEvent_takeSessionOwnership" "', argument " "1"" of type '" "RegistrationEvent const *""'"); + } + arg1 = reinterpret_cast< RegistrationEvent * >(argp1); + result = (RegistrationSession *)((RegistrationEvent const *)arg1)->takeSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RegistrationSession, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *RegistrationEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_RegistrationEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_SubscriptionEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SubscriptionEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SubscriptionEvent" "', argument " "1"" of type '" "SubscriptionEvent *""'"); + } + arg1 = reinterpret_cast< SubscriptionEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SubscriptionEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tsip_subscribe_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionEvent_getType" "', argument " "1"" of type '" "SubscriptionEvent const *""'"); + } + arg1 = reinterpret_cast< SubscriptionEvent * >(argp1); + result = (tsip_subscribe_event_type_t)((SubscriptionEvent const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SubscriptionEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SubscriptionSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionEvent_getSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionEvent_getSession" "', argument " "1"" of type '" "SubscriptionEvent const *""'"); + } + arg1 = reinterpret_cast< SubscriptionEvent * >(argp1); + result = (SubscriptionSession *)((SubscriptionEvent const *)arg1)->getSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SubscriptionSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SubscriptionEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SubscriptionSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionEvent_takeSessionOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionEvent_takeSessionOwnership" "', argument " "1"" of type '" "SubscriptionEvent const *""'"); + } + arg1 = reinterpret_cast< SubscriptionEvent * >(argp1); + result = (SubscriptionSession *)((SubscriptionEvent const *)arg1)->takeSessionOwnership(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SubscriptionSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SubscriptionEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SubscriptionEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_T140CallbackData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140CallbackData *arg1 = (T140CallbackData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_T140CallbackData",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140CallbackData, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_T140CallbackData" "', argument " "1"" of type '" "T140CallbackData *""'"); + } + arg1 = reinterpret_cast< T140CallbackData * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_T140CallbackData_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140CallbackData *arg1 = (T140CallbackData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + enum tmedia_t140_data_type_e result; + + if (!PyArg_ParseTuple(args,(char *)"O:T140CallbackData_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140CallbackData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "T140CallbackData_getType" "', argument " "1"" of type '" "T140CallbackData const *""'"); + } + arg1 = reinterpret_cast< T140CallbackData * >(argp1); + result = (enum tmedia_t140_data_type_e)((T140CallbackData const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_T140CallbackData_getSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140CallbackData *arg1 = (T140CallbackData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:T140CallbackData_getSize",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140CallbackData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "T140CallbackData_getSize" "', argument " "1"" of type '" "T140CallbackData const *""'"); + } + arg1 = reinterpret_cast< T140CallbackData * >(argp1); + result = (unsigned int)((T140CallbackData const *)arg1)->getSize(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_T140CallbackData_getData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140CallbackData *arg1 = (T140CallbackData *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:T140CallbackData_getData",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140CallbackData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "T140CallbackData_getData" "', argument " "1"" of type '" "T140CallbackData const *""'"); + } + arg1 = reinterpret_cast< T140CallbackData * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "T140CallbackData_getData" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "T140CallbackData_getData" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)((T140CallbackData const *)arg1)->getData(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *T140CallbackData_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_T140CallbackData, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_T140Callback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + T140Callback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_T140Callback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (T140Callback *)new SwigDirector_T140Callback(arg1); + } else { + result = (T140Callback *)new T140Callback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_T140Callback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_T140Callback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140Callback *arg1 = (T140Callback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_T140Callback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140Callback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_T140Callback" "', argument " "1"" of type '" "T140Callback *""'"); + } + arg1 = reinterpret_cast< T140Callback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_T140Callback_ondata(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140Callback *arg1 = (T140Callback *) 0 ; + T140CallbackData *arg2 = (T140CallbackData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:T140Callback_ondata",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140Callback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "T140Callback_ondata" "', argument " "1"" of type '" "T140Callback *""'"); + } + arg1 = reinterpret_cast< T140Callback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_T140CallbackData, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "T140Callback_ondata" "', argument " "2"" of type '" "T140CallbackData const *""'"); + } + arg2 = reinterpret_cast< T140CallbackData * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->T140Callback::ondata((T140CallbackData const *)arg2); + } else { + result = (int)(arg1)->ondata((T140CallbackData const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_T140Callback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + T140Callback *arg1 = (T140Callback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_T140Callback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_T140Callback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_T140Callback" "', argument " "1"" of type '" "T140Callback *""'"); + } + arg1 = reinterpret_cast< T140Callback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *T140Callback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_T140Callback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SipSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SipSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_SipSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (SipSession *)new SipSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SipSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SipSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipSession" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_haveOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipSession_haveOwnership",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_haveOwnership" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + result = (bool)(arg1)->haveOwnership(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipSession_addHeader",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addHeader" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipSession_addHeader" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_removeHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_removeHeader",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_removeHeader" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_removeHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->removeHeader((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_addCaps__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipSession_addCaps",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addCaps" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addCaps" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipSession_addCaps" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->addCaps((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_addCaps__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_addCaps",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addCaps" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addCaps" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->addCaps((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_addCaps(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipSession_addCaps__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipSession_addCaps__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipSession_addCaps'.\n" + " Possible C/C++ prototypes are:\n" + " SipSession::addCaps(char const *,char const *)\n" + " SipSession::addCaps(char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipSession_removeCaps(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_removeCaps",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_removeCaps" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_removeCaps" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->removeCaps((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setExpires(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + unsigned int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setExpires",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setExpires" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipSession_setExpires" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)(arg1)->setExpires(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setFromUri__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setFromUri",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setFromUri" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_setFromUri" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setFromUri((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setFromUri__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setFromUri",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setFromUri" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_setFromUri" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + result = (bool)(arg1)->setFromUri((SipUri const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setFromUri(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipSession_setFromUri__SWIG_1(self, args); + } + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipSession_setFromUri__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipSession_setFromUri'.\n" + " Possible C/C++ prototypes are:\n" + " SipSession::setFromUri(char const *)\n" + " SipSession::setFromUri(SipUri const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setToUri__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setToUri",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setToUri" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_setToUri" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setToUri((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setToUri__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setToUri",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setToUri" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_setToUri" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + result = (bool)(arg1)->setToUri((SipUri const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setToUri(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipSession_setToUri__SWIG_1(self, args); + } + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipSession_setToUri__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipSession_setToUri'.\n" + " Possible C/C++ prototypes are:\n" + " SipSession::setToUri(char const *)\n" + " SipSession::setToUri(SipUri const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipSession_setSilentHangup(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setSilentHangup",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setSilentHangup" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipSession_setSilentHangup" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setSilentHangup(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_addSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_addSigCompCompartment",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addSigCompCompartment" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addSigCompCompartment" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->addSigCompCompartment((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_removeSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipSession_removeSigCompCompartment",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_removeSigCompCompartment" "', argument " "1"" of type '" "SipSession *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + result = (bool)(arg1)->removeSigCompCompartment(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipSession_getId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipSession *arg1 = (SipSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipSession_getId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_getId" "', argument " "1"" of type '" "SipSession const *""'"); + } + arg1 = reinterpret_cast< SipSession * >(argp1); + result = (unsigned int)((SipSession const *)arg1)->getId(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SipSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SipSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_InviteSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + InviteSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_InviteSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_InviteSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (InviteSession *)new InviteSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InviteSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_InviteSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_InviteSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_InviteSession" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:InviteSession_accept",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_accept" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_accept" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->accept(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_accept",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_accept" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + result = (bool)(arg1)->accept(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_accept(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_accept__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_accept__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InviteSession_accept'.\n" + " Possible C/C++ prototypes are:\n" + " InviteSession::accept(ActionConfig *)\n" + " InviteSession::accept()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_hangup__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:InviteSession_hangup",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_hangup" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_hangup" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->hangup(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_hangup__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_hangup",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_hangup" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + result = (bool)(arg1)->hangup(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_hangup(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_hangup__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_hangup__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InviteSession_hangup'.\n" + " Possible C/C++ prototypes are:\n" + " InviteSession::hangup(ActionConfig *)\n" + " InviteSession::hangup()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:InviteSession_reject",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_reject" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_reject" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->reject(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_reject",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_reject" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + result = (bool)(arg1)->reject(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_reject(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_reject__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_reject__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InviteSession_reject'.\n" + " Possible C/C++ prototypes are:\n" + " InviteSession::reject(ActionConfig *)\n" + " InviteSession::reject()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_sendInfo__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:InviteSession_sendInfo",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_sendInfo" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_sendInfo" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "InviteSession_sendInfo" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "InviteSession_sendInfo" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->sendInfo((void const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_sendInfo__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:InviteSession_sendInfo",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_sendInfo" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_sendInfo" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "InviteSession_sendInfo" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->sendInfo((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_sendInfo(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_InviteSession_sendInfo__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InviteSession_sendInfo__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InviteSession_sendInfo'.\n" + " Possible C/C++ prototypes are:\n" + " InviteSession::sendInfo(void const *,unsigned int,ActionConfig *)\n" + " InviteSession::sendInfo(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_InviteSession_getMediaMgr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InviteSession *arg1 = (InviteSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MediaSessionMgr *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_getMediaMgr",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_getMediaMgr" "', argument " "1"" of type '" "InviteSession *""'"); + } + arg1 = reinterpret_cast< InviteSession * >(argp1); + result = (MediaSessionMgr *)(arg1)->getMediaMgr(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MediaSessionMgr, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *InviteSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_InviteSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_CallSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + CallSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_CallSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_CallSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (CallSession *)new CallSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_CallSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_CallSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_CallSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_CallSession" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudio__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callAudio",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudio" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudio" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callAudio" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callAudio((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudio__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callAudio",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudio" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudio" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->callAudio((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudio__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callAudio",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudio" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudio" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callAudio" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callAudio((SipUri const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudio__SWIG_3(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callAudio",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudio" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudio" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + result = (bool)(arg1)->callAudio((SipUri const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudio(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudio__SWIG_3(self, args); + } + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudio__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudio__SWIG_2(self, args); + } + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudio__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_callAudio'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::callAudio(char const *,ActionConfig *)\n" + " CallSession::callAudio(char const *)\n" + " CallSession::callAudio(SipUri const *,ActionConfig *)\n" + " CallSession::callAudio(SipUri const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callAudioVideo",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudioVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudioVideo" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callAudioVideo" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callAudioVideo((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callAudioVideo",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudioVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudioVideo" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->callAudioVideo((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callAudioVideo",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudioVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudioVideo" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callAudioVideo" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callAudioVideo((SipUri const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo__SWIG_3(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callAudioVideo",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudioVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudioVideo" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + result = (bool)(arg1)->callAudioVideo((SipUri const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudioVideo__SWIG_3(self, args); + } + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudioVideo__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudioVideo__SWIG_2(self, args); + } + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callAudioVideo__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_callAudioVideo'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::callAudioVideo(char const *,ActionConfig *)\n" + " CallSession::callAudioVideo(char const *)\n" + " CallSession::callAudioVideo(SipUri const *,ActionConfig *)\n" + " CallSession::callAudioVideo(SipUri const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callVideo__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callVideo",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callVideo" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callVideo" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callVideo((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callVideo__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callVideo",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callVideo" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->callVideo((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callVideo__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callVideo",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callVideo" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callVideo" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callVideo((SipUri const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callVideo__SWIG_3(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callVideo",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callVideo" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callVideo" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + result = (bool)(arg1)->callVideo((SipUri const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_callVideo(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callVideo__SWIG_3(self, args); + } + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callVideo__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callVideo__SWIG_2(self, args); + } + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_callVideo__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_callVideo'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::callVideo(char const *,ActionConfig *)\n" + " CallSession::callVideo(char const *)\n" + " CallSession::callVideo(SipUri const *,ActionConfig *)\n" + " CallSession::callVideo(SipUri const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_call__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + twrap_media_type_t arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:CallSession_call",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_call" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_call" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_call" "', argument " "3"" of type '" "twrap_media_type_t""'"); + } + arg3 = static_cast< twrap_media_type_t >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "CallSession_call" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->call((char const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_call__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + twrap_media_type_t arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_call",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_call" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_call" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_call" "', argument " "3"" of type '" "twrap_media_type_t""'"); + } + arg3 = static_cast< twrap_media_type_t >(val3); + result = (bool)(arg1)->call((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_call__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + twrap_media_type_t arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:CallSession_call",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_call" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_call" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_call" "', argument " "3"" of type '" "twrap_media_type_t""'"); + } + arg3 = static_cast< twrap_media_type_t >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "CallSession_call" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->call((SipUri const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_call__SWIG_3(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + twrap_media_type_t arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_call",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_call" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_call" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_call" "', argument " "3"" of type '" "twrap_media_type_t""'"); + } + arg3 = static_cast< twrap_media_type_t >(val3); + result = (bool)(arg1)->call((SipUri const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_call(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_CallSession_call__SWIG_3(self, args); + } + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_CallSession_call__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_call__SWIG_2(self, args); + } + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_call__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_call'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::call(char const *,twrap_media_type_t,ActionConfig *)\n" + " CallSession::call(char const *,twrap_media_type_t)\n" + " CallSession::call(SipUri const *,twrap_media_type_t,ActionConfig *)\n" + " CallSession::call(SipUri const *,twrap_media_type_t)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setSessionTimer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + unsigned int arg2 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_setSessionTimer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setSessionTimer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setSessionTimer" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_setSessionTimer" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->setSessionTimer(arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_set100rel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_set100rel",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_set100rel" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_set100rel" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->set100rel(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setRtcp(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setRtcp",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setRtcp" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setRtcp" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setRtcp(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setRtcpMux(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setRtcpMux",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setRtcpMux" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setRtcpMux" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setRtcpMux(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setSRtpMode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + enum tmedia_srtp_mode_e arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setSRtpMode",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setSRtpMode" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setSRtpMode" "', argument " "2"" of type '" "enum tmedia_srtp_mode_e""'"); + } + arg2 = static_cast< enum tmedia_srtp_mode_e >(val2); + result = (bool)(arg1)->setSRtpMode(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setAvpfMode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + enum tmedia_mode_e arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setAvpfMode",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setAvpfMode" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setAvpfMode" "', argument " "2"" of type '" "enum tmedia_mode_e""'"); + } + arg2 = static_cast< enum tmedia_mode_e >(val2); + result = (bool)(arg1)->setAvpfMode(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setICE(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setICE",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setICE" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setICE" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setICE(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setICEStun(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setICEStun",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setICEStun" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setICEStun" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setICEStun(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setICETurn(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setICETurn",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setICETurn" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setICETurn" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setICETurn(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setSTUNServer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + uint16_t arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned short val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_setSTUNServer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setSTUNServer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_setSTUNServer" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_setSTUNServer" "', argument " "3"" of type '" "uint16_t""'"); + } + arg3 = static_cast< uint16_t >(val3); + result = (bool)(arg1)->setSTUNServer((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setSTUNCred(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_setSTUNCred",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setSTUNCred" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_setSTUNCred" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_setSTUNCred" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->setSTUNCred((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setVideoFps(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + int32_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setVideoFps",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setVideoFps" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setVideoFps" "', argument " "2"" of type '" "int32_t""'"); + } + arg2 = static_cast< int32_t >(val2); + result = (bool)(arg1)->setVideoFps(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setVideoBandwidthUploadMax(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + int32_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setVideoBandwidthUploadMax",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setVideoBandwidthUploadMax" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setVideoBandwidthUploadMax" "', argument " "2"" of type '" "int32_t""'"); + } + arg2 = static_cast< int32_t >(val2); + result = (bool)(arg1)->setVideoBandwidthUploadMax(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setVideoBandwidthDownloadMax(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + int32_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setVideoBandwidthDownloadMax",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setVideoBandwidthDownloadMax" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setVideoBandwidthDownloadMax" "', argument " "2"" of type '" "int32_t""'"); + } + arg2 = static_cast< int32_t >(val2); + result = (bool)(arg1)->setVideoBandwidthDownloadMax(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setVideoPrefSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + tmedia_pref_video_size_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setVideoPrefSize",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setVideoPrefSize" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setVideoPrefSize" "', argument " "2"" of type '" "tmedia_pref_video_size_t""'"); + } + arg2 = static_cast< tmedia_pref_video_size_t >(val2); + result = (bool)(arg1)->setVideoPrefSize(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setQoS(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + tmedia_qos_stype_t arg2 ; + tmedia_qos_strength_t arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_setQoS",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setQoS" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setQoS" "', argument " "2"" of type '" "tmedia_qos_stype_t""'"); + } + arg2 = static_cast< tmedia_qos_stype_t >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_setQoS" "', argument " "3"" of type '" "tmedia_qos_strength_t""'"); + } + arg3 = static_cast< tmedia_qos_strength_t >(val3); + result = (bool)(arg1)->setQoS(arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_hold__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_hold",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_hold" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_hold" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->hold(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_hold__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:CallSession_hold",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_hold" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + result = (bool)(arg1)->hold(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_hold(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_hold__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_hold__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_hold'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::hold(ActionConfig *)\n" + " CallSession::hold()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_resume__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_resume",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_resume" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_resume" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->resume(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_resume__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:CallSession_resume",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_resume" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + result = (bool)(arg1)->resume(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_resume(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_resume__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_resume__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_resume'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::resume(ActionConfig *)\n" + " CallSession::resume()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_transfer__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_transfer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_transfer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_transfer" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_transfer" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->transfer((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_transfer__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_transfer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_transfer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_transfer" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->transfer((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_transfer(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_transfer__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_transfer__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_transfer'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::transfer(char const *,ActionConfig *)\n" + " CallSession::transfer(char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_acceptTransfer__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_acceptTransfer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_acceptTransfer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_acceptTransfer" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->acceptTransfer(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_acceptTransfer__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:CallSession_acceptTransfer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_acceptTransfer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + result = (bool)(arg1)->acceptTransfer(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_acceptTransfer(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_acceptTransfer__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_acceptTransfer__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_acceptTransfer'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::acceptTransfer(ActionConfig *)\n" + " CallSession::acceptTransfer()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_rejectTransfer__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_rejectTransfer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_rejectTransfer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_rejectTransfer" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->rejectTransfer(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_rejectTransfer__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:CallSession_rejectTransfer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_rejectTransfer" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + result = (bool)(arg1)->rejectTransfer(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_rejectTransfer(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_rejectTransfer__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_rejectTransfer__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_rejectTransfer'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::rejectTransfer(ActionConfig *)\n" + " CallSession::rejectTransfer()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_sendDTMF(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_sendDTMF",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_sendDTMF" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_sendDTMF" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + result = (bool)(arg1)->sendDTMF(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_getSessionTransferId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:CallSession_getSessionTransferId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_getSessionTransferId" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + result = (unsigned int)(arg1)->getSessionTransferId(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_sendT140Data__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + enum tmedia_t140_data_type_e arg2 ; + void *arg3 = (void *) 0 ; + unsigned int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + unsigned int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:CallSession_sendT140Data",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_sendT140Data" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_sendT140Data" "', argument " "2"" of type '" "enum tmedia_t140_data_type_e""'"); + } + arg2 = static_cast< enum tmedia_t140_data_type_e >(val2); + res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_sendT140Data" "', argument " "3"" of type '" "void const *""'"); + } + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "CallSession_sendT140Data" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + result = (bool)(arg1)->sendT140Data(arg2,(void const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_sendT140Data__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + enum tmedia_t140_data_type_e arg2 ; + void *arg3 = (void *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int res3 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_sendT140Data",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_sendT140Data" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_sendT140Data" "', argument " "2"" of type '" "enum tmedia_t140_data_type_e""'"); + } + arg2 = static_cast< enum tmedia_t140_data_type_e >(val2); + res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_sendT140Data" "', argument " "3"" of type '" "void const *""'"); + } + result = (bool)(arg1)->sendT140Data(arg2,(void const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_sendT140Data__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + enum tmedia_t140_data_type_e arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_sendT140Data",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_sendT140Data" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_sendT140Data" "', argument " "2"" of type '" "enum tmedia_t140_data_type_e""'"); + } + arg2 = static_cast< enum tmedia_t140_data_type_e >(val2); + result = (bool)(arg1)->sendT140Data(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_CallSession_sendT140Data(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_CallSession_sendT140Data__SWIG_2(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[2], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_CallSession_sendT140Data__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_int(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[2], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_CallSession_sendT140Data__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'CallSession_sendT140Data'.\n" + " Possible C/C++ prototypes are:\n" + " CallSession::sendT140Data(enum tmedia_t140_data_type_e,void const *,unsigned int)\n" + " CallSession::sendT140Data(enum tmedia_t140_data_type_e,void const *)\n" + " CallSession::sendT140Data(enum tmedia_t140_data_type_e)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_CallSession_setT140Callback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + CallSession *arg1 = (CallSession *) 0 ; + T140Callback *arg2 = (T140Callback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_setT140Callback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setT140Callback" "', argument " "1"" of type '" "CallSession *""'"); + } + arg1 = reinterpret_cast< CallSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_T140Callback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_setT140Callback" "', argument " "2"" of type '" "T140Callback const *""'"); + } + arg2 = reinterpret_cast< T140Callback * >(argp2); + result = (bool)(arg1)->setT140Callback((T140Callback const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *CallSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_CallSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_MsrpSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + MsrpCallback *arg2 = (MsrpCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + MsrpSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:new_MsrpSession",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_MsrpSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MsrpCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_MsrpSession" "', argument " "2"" of type '" "MsrpCallback *""'"); + } + arg2 = reinterpret_cast< MsrpCallback * >(argp2); + result = (MsrpSession *)new MsrpSession(arg1,arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_MsrpSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpSession" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + MsrpCallback *arg2 = (MsrpCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_setCallback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_setCallback" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MsrpCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_setCallback" "', argument " "2"" of type '" "MsrpCallback *""'"); + } + arg2 = reinterpret_cast< MsrpCallback * >(argp2); + result = (bool)(arg1)->setCallback(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + char *arg2 = (char *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpSession_callMsrp",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_callMsrp" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_callMsrp" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MsrpSession_callMsrp" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callMsrp((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_callMsrp",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_callMsrp" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_callMsrp" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->callMsrp((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + ActionConfig *arg3 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + void *argp3 = 0 ; + int res3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpSession_callMsrp",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_callMsrp" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_callMsrp" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MsrpSession_callMsrp" "', argument " "3"" of type '" "ActionConfig *""'"); + } + arg3 = reinterpret_cast< ActionConfig * >(argp3); + result = (bool)(arg1)->callMsrp((SipUri const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp__SWIG_3(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + SipUri *arg2 = (SipUri *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_callMsrp",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_callMsrp" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SipUri, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_callMsrp" "', argument " "2"" of type '" "SipUri const *""'"); + } + arg2 = reinterpret_cast< SipUri * >(argp2); + result = (bool)(arg1)->callMsrp((SipUri const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_callMsrp__SWIG_3(self, args); + } + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_callMsrp__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_SipUri, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_callMsrp__SWIG_2(self, args); + } + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_callMsrp__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MsrpSession_callMsrp'.\n" + " Possible C/C++ prototypes are:\n" + " MsrpSession::callMsrp(char const *,ActionConfig *)\n" + " MsrpSession::callMsrp(char const *)\n" + " MsrpSession::callMsrp(SipUri const *,ActionConfig *)\n" + " MsrpSession::callMsrp(SipUri const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_sendMessage__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MsrpSession_sendMessage",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendMessage" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_sendMessage" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MsrpSession_sendMessage" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "MsrpSession_sendMessage" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->sendMessage((void const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_sendMessage__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpSession_sendMessage",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendMessage" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_sendMessage" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MsrpSession_sendMessage" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->sendMessage((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_sendMessage(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_MsrpSession_sendMessage__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_sendMessage__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MsrpSession_sendMessage'.\n" + " Possible C/C++ prototypes are:\n" + " MsrpSession::sendMessage(void const *,unsigned int,ActionConfig *)\n" + " MsrpSession::sendMessage(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_sendFile__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_sendFile",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendFile" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_sendFile" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->sendFile(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_sendFile__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpSession *arg1 = (MsrpSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpSession_sendFile",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendFile" "', argument " "1"" of type '" "MsrpSession *""'"); + } + arg1 = reinterpret_cast< MsrpSession * >(argp1); + result = (bool)(arg1)->sendFile(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpSession_sendFile(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_sendFile__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MsrpSession_sendFile__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MsrpSession_sendFile'.\n" + " Possible C/C++ prototypes are:\n" + " MsrpSession::sendFile(ActionConfig *)\n" + " MsrpSession::sendFile()\n"); + return 0; +} + + +SWIGINTERN PyObject *MsrpSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MsrpSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_MessagingSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MessagingSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_MessagingSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_MessagingSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (MessagingSession *)new MessagingSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MessagingSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_MessagingSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MessagingSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MessagingSession" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_send__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:MessagingSession_send",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_send" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MessagingSession_send" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MessagingSession_send" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "MessagingSession_send" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->send((void const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_send__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MessagingSession_send",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_send" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MessagingSession_send" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MessagingSession_send" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->send((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_send(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MessagingSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_MessagingSession_send__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MessagingSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MessagingSession_send__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MessagingSession_send'.\n" + " Possible C/C++ prototypes are:\n" + " MessagingSession::send(void const *,unsigned int,ActionConfig *)\n" + " MessagingSession::send(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MessagingSession_accept",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_accept" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MessagingSession_accept" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->accept(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MessagingSession_accept",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_accept" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + result = (bool)(arg1)->accept(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_accept(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MessagingSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MessagingSession_accept__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MessagingSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MessagingSession_accept__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MessagingSession_accept'.\n" + " Possible C/C++ prototypes are:\n" + " MessagingSession::accept(ActionConfig *)\n" + " MessagingSession::accept()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MessagingSession_reject",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_reject" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MessagingSession_reject" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->reject(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MessagingSession *arg1 = (MessagingSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MessagingSession_reject",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_reject" "', argument " "1"" of type '" "MessagingSession *""'"); + } + arg1 = reinterpret_cast< MessagingSession * >(argp1); + result = (bool)(arg1)->reject(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MessagingSession_reject(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MessagingSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MessagingSession_reject__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MessagingSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_MessagingSession_reject__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'MessagingSession_reject'.\n" + " Possible C/C++ prototypes are:\n" + " MessagingSession::reject(ActionConfig *)\n" + " MessagingSession::reject()\n"); + return 0; +} + + +SWIGINTERN PyObject *MessagingSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MessagingSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_InfoSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + InfoSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_InfoSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_InfoSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (InfoSession *)new InfoSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InfoSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_InfoSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_InfoSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_InfoSession" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_send__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:InfoSession_send",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoSession_send" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InfoSession_send" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "InfoSession_send" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "InfoSession_send" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->send((void const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_send__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:InfoSession_send",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoSession_send" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InfoSession_send" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "InfoSession_send" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->send((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_send(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InfoSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_InfoSession_send__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InfoSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InfoSession_send__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InfoSession_send'.\n" + " Possible C/C++ prototypes are:\n" + " InfoSession::send(void const *,unsigned int,ActionConfig *)\n" + " InfoSession::send(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:InfoSession_accept",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoSession_accept" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InfoSession_accept" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->accept(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:InfoSession_accept",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoSession_accept" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + result = (bool)(arg1)->accept(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_accept(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InfoSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InfoSession_accept__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InfoSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InfoSession_accept__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InfoSession_accept'.\n" + " Possible C/C++ prototypes are:\n" + " InfoSession::accept(ActionConfig *)\n" + " InfoSession::accept()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:InfoSession_reject",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoSession_reject" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InfoSession_reject" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->reject(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + InfoSession *arg1 = (InfoSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:InfoSession_reject",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InfoSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InfoSession_reject" "', argument " "1"" of type '" "InfoSession *""'"); + } + arg1 = reinterpret_cast< InfoSession * >(argp1); + result = (bool)(arg1)->reject(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_InfoSession_reject(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InfoSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InfoSession_reject__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InfoSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_InfoSession_reject__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'InfoSession_reject'.\n" + " Possible C/C++ prototypes are:\n" + " InfoSession::reject(ActionConfig *)\n" + " InfoSession::reject()\n"); + return 0; +} + + +SWIGINTERN PyObject *InfoSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_InfoSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_OptionsSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + OptionsSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_OptionsSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_OptionsSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (OptionsSession *)new OptionsSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_OptionsSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_OptionsSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_OptionsSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_OptionsSession" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_send__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:OptionsSession_send",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_send" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "OptionsSession_send" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->send(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_send__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:OptionsSession_send",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_send" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + result = (bool)(arg1)->send(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_send(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_OptionsSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_OptionsSession_send__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_OptionsSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_OptionsSession_send__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'OptionsSession_send'.\n" + " Possible C/C++ prototypes are:\n" + " OptionsSession::send(ActionConfig *)\n" + " OptionsSession::send()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:OptionsSession_accept",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_accept" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "OptionsSession_accept" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->accept(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:OptionsSession_accept",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_accept" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + result = (bool)(arg1)->accept(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_accept(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_OptionsSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_OptionsSession_accept__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_OptionsSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_OptionsSession_accept__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'OptionsSession_accept'.\n" + " Possible C/C++ prototypes are:\n" + " OptionsSession::accept(ActionConfig *)\n" + " OptionsSession::accept()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:OptionsSession_reject",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_reject" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "OptionsSession_reject" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->reject(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + OptionsSession *arg1 = (OptionsSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:OptionsSession_reject",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_reject" "', argument " "1"" of type '" "OptionsSession *""'"); + } + arg1 = reinterpret_cast< OptionsSession * >(argp1); + result = (bool)(arg1)->reject(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_OptionsSession_reject(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_OptionsSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_OptionsSession_reject__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_OptionsSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_OptionsSession_reject__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'OptionsSession_reject'.\n" + " Possible C/C++ prototypes are:\n" + " OptionsSession::reject(ActionConfig *)\n" + " OptionsSession::reject()\n"); + return 0; +} + + +SWIGINTERN PyObject *OptionsSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_OptionsSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_PublicationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + PublicationSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_PublicationSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_PublicationSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (PublicationSession *)new PublicationSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_PublicationSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_PublicationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationSession *arg1 = (PublicationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_PublicationSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_PublicationSession" "', argument " "1"" of type '" "PublicationSession *""'"); + } + arg1 = reinterpret_cast< PublicationSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationSession_publish__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationSession *arg1 = (PublicationSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + ActionConfig *arg4 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + void *argp4 = 0 ; + int res4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:PublicationSession_publish",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationSession_publish" "', argument " "1"" of type '" "PublicationSession *""'"); + } + arg1 = reinterpret_cast< PublicationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "PublicationSession_publish" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "PublicationSession_publish" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "PublicationSession_publish" "', argument " "4"" of type '" "ActionConfig *""'"); + } + arg4 = reinterpret_cast< ActionConfig * >(argp4); + result = (bool)(arg1)->publish((void const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationSession_publish__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationSession *arg1 = (PublicationSession *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:PublicationSession_publish",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationSession_publish" "', argument " "1"" of type '" "PublicationSession *""'"); + } + arg1 = reinterpret_cast< PublicationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "PublicationSession_publish" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "PublicationSession_publish" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->publish((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationSession_publish(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_PublicationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_PublicationSession_publish__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_PublicationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_PublicationSession_publish__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'PublicationSession_publish'.\n" + " Possible C/C++ prototypes are:\n" + " PublicationSession::publish(void const *,unsigned int,ActionConfig *)\n" + " PublicationSession::publish(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_PublicationSession_unPublish__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationSession *arg1 = (PublicationSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:PublicationSession_unPublish",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationSession_unPublish" "', argument " "1"" of type '" "PublicationSession *""'"); + } + arg1 = reinterpret_cast< PublicationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "PublicationSession_unPublish" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->unPublish(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationSession_unPublish__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PublicationSession *arg1 = (PublicationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:PublicationSession_unPublish",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationSession_unPublish" "', argument " "1"" of type '" "PublicationSession *""'"); + } + arg1 = reinterpret_cast< PublicationSession * >(argp1); + result = (bool)(arg1)->unPublish(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_PublicationSession_unPublish(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_PublicationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_PublicationSession_unPublish__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_PublicationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_PublicationSession_unPublish__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'PublicationSession_unPublish'.\n" + " Possible C/C++ prototypes are:\n" + " PublicationSession::unPublish(ActionConfig *)\n" + " PublicationSession::unPublish()\n"); + return 0; +} + + +SWIGINTERN PyObject *PublicationSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_PublicationSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_RegistrationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + RegistrationSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_RegistrationSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_RegistrationSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (RegistrationSession *)new RegistrationSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RegistrationSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_RegistrationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_RegistrationSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_RegistrationSession" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_register___SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:RegistrationSession_register_",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_register_" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RegistrationSession_register_" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->register_(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_register___SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_register_",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_register_" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + result = (bool)(arg1)->register_(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_register_(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_register___SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_register___SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'RegistrationSession_register_'.\n" + " Possible C/C++ prototypes are:\n" + " RegistrationSession::register_(ActionConfig *)\n" + " RegistrationSession::register_()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_unRegister__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:RegistrationSession_unRegister",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_unRegister" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RegistrationSession_unRegister" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->unRegister(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_unRegister__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_unRegister",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_unRegister" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + result = (bool)(arg1)->unRegister(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_unRegister(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_unRegister__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_unRegister__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'RegistrationSession_unRegister'.\n" + " Possible C/C++ prototypes are:\n" + " RegistrationSession::unRegister(ActionConfig *)\n" + " RegistrationSession::unRegister()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:RegistrationSession_accept",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_accept" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RegistrationSession_accept" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->accept(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_accept",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_accept" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + result = (bool)(arg1)->accept(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_accept(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_accept__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_accept__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'RegistrationSession_accept'.\n" + " Possible C/C++ prototypes are:\n" + " RegistrationSession::accept(ActionConfig *)\n" + " RegistrationSession::accept()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + ActionConfig *arg2 = (ActionConfig *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:RegistrationSession_reject",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_reject" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RegistrationSession_reject" "', argument " "2"" of type '" "ActionConfig *""'"); + } + arg2 = reinterpret_cast< ActionConfig * >(argp2); + result = (bool)(arg1)->reject(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RegistrationSession *arg1 = (RegistrationSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_reject",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_reject" "', argument " "1"" of type '" "RegistrationSession *""'"); + } + arg1 = reinterpret_cast< RegistrationSession * >(argp1); + result = (bool)(arg1)->reject(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RegistrationSession_reject(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[3]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 2) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_reject__SWIG_1(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_RegistrationSession_reject__SWIG_0(self, args); + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'RegistrationSession_reject'.\n" + " Possible C/C++ prototypes are:\n" + " RegistrationSession::reject(ActionConfig *)\n" + " RegistrationSession::reject()\n"); + return 0; +} + + +SWIGINTERN PyObject *RegistrationSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_RegistrationSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SubscriptionSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + SubscriptionSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_SubscriptionSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SubscriptionSession" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (SubscriptionSession *)new SubscriptionSession(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SubscriptionSession, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SubscriptionSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionSession *arg1 = (SubscriptionSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SubscriptionSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionSession, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SubscriptionSession" "', argument " "1"" of type '" "SubscriptionSession *""'"); + } + arg1 = reinterpret_cast< SubscriptionSession * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SubscriptionSession_subscribe(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionSession *arg1 = (SubscriptionSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionSession_subscribe",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionSession_subscribe" "', argument " "1"" of type '" "SubscriptionSession *""'"); + } + arg1 = reinterpret_cast< SubscriptionSession * >(argp1); + result = (bool)(arg1)->subscribe(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SubscriptionSession_unSubscribe(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SubscriptionSession *arg1 = (SubscriptionSession *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionSession_unSubscribe",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionSession, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionSession_unSubscribe" "', argument " "1"" of type '" "SubscriptionSession *""'"); + } + arg1 = reinterpret_cast< SubscriptionSession * >(argp1); + result = (bool)(arg1)->unSubscribe(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SubscriptionSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SubscriptionSession, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyPluginMgr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyPluginMgr",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyPluginMgr" "', argument " "1"" of type '" "ProxyPluginMgr *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_createInstance(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + ProxyPluginMgr *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyPluginMgr_createInstance",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_createInstance" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1); + result = (ProxyPluginMgr *)ProxyPluginMgr::createInstance(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPluginMgr, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_getInstance(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":ProxyPluginMgr_getInstance")) SWIG_fail; + result = (ProxyPluginMgr *)ProxyPluginMgr::getInstance(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPluginMgr, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ; + uint64_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyPlugin *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findPlugin",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findPlugin" "', argument " "1"" of type '" "ProxyPluginMgr *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findPlugin" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + result = (ProxyPlugin *)(arg1)->findPlugin(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPlugin, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findAudioConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ; + uint64_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyAudioConsumer *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findAudioConsumer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findAudioConsumer" "', argument " "1"" of type '" "ProxyPluginMgr *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findAudioConsumer" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + result = (ProxyAudioConsumer *)(arg1)->findAudioConsumer(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findVideoConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ; + uint64_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyVideoConsumer *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findVideoConsumer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findVideoConsumer" "', argument " "1"" of type '" "ProxyPluginMgr *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findVideoConsumer" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + result = (ProxyVideoConsumer *)(arg1)->findVideoConsumer(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findAudioProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ; + uint64_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyAudioProducer *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findAudioProducer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findAudioProducer" "', argument " "1"" of type '" "ProxyPluginMgr *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findAudioProducer" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + result = (ProxyAudioProducer *)(arg1)->findAudioProducer(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findVideoProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ; + uint64_t arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + ProxyVideoProducer *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findVideoProducer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findVideoProducer" "', argument " "1"" of type '" "ProxyPluginMgr *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findVideoProducer" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + result = (ProxyVideoProducer *)(arg1)->findVideoProducer(arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyPluginMgr_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyPluginMgr, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_ProxyPluginMgrCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + ProxyPluginMgrCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyPluginMgrCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (ProxyPluginMgrCallback *)new SwigDirector_ProxyPluginMgrCallback(arg1); + } else { + result = (ProxyPluginMgrCallback *)new ProxyPluginMgrCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPluginMgrCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_ProxyPluginMgrCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyPluginMgrCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyPluginMgrCallback" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgrCallback_OnPluginCreated(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ; + uint64_t arg2 ; + enum twrap_proxy_plugin_type_e arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyPluginMgrCallback_OnPluginCreated",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgrCallback_OnPluginCreated" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgrCallback_OnPluginCreated" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyPluginMgrCallback_OnPluginCreated" "', argument " "3"" of type '" "enum twrap_proxy_plugin_type_e""'"); + } + arg3 = static_cast< enum twrap_proxy_plugin_type_e >(val3); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyPluginMgrCallback::OnPluginCreated(arg2,arg3); + } else { + result = (int)(arg1)->OnPluginCreated(arg2,arg3); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPluginMgrCallback_OnPluginDestroyed(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ; + uint64_t arg2 ; + enum twrap_proxy_plugin_type_e arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned long long val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyPluginMgrCallback_OnPluginDestroyed",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgrCallback_OnPluginDestroyed" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgrCallback_OnPluginDestroyed" "', argument " "2"" of type '" "uint64_t""'"); + } + arg2 = static_cast< uint64_t >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyPluginMgrCallback_OnPluginDestroyed" "', argument " "3"" of type '" "enum twrap_proxy_plugin_type_e""'"); + } + arg3 = static_cast< enum twrap_proxy_plugin_type_e >(val3); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyPluginMgrCallback::OnPluginDestroyed(arg2,arg3); + } else { + result = (int)(arg1)->OnPluginDestroyed(arg2,arg3); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_ProxyPluginMgrCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyPluginMgrCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyPluginMgrCallback" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'"); + } + arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyPluginMgrCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyPluginMgrCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPlugin *arg1 = (ProxyPlugin *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyPlugin",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPlugin, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyPlugin" "', argument " "1"" of type '" "ProxyPlugin *""'"); + } + arg1 = reinterpret_cast< ProxyPlugin * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPlugin_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPlugin *arg1 = (ProxyPlugin *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + twrap_proxy_plugin_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyPlugin_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPlugin, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPlugin_getType" "', argument " "1"" of type '" "ProxyPlugin const *""'"); + } + arg1 = reinterpret_cast< ProxyPlugin * >(argp1); + result = (twrap_proxy_plugin_type_t)((ProxyPlugin const *)arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyPlugin_getId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyPlugin *arg1 = (ProxyPlugin *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint64_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyPlugin_getId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPlugin, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPlugin_getId" "', argument " "1"" of type '" "ProxyPlugin const *""'"); + } + arg1 = reinterpret_cast< ProxyPlugin * >(argp1); + result = (uint64_t)((ProxyPlugin const *)arg1)->getId(); + resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyPlugin_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyPlugin, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_ProxyAudioConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + ProxyAudioConsumerCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyAudioConsumerCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (ProxyAudioConsumerCallback *)new SwigDirector_ProxyAudioConsumerCallback(arg1); + } else { + result = (ProxyAudioConsumerCallback *)new ProxyAudioConsumerCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioConsumerCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_ProxyAudioConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioConsumerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioConsumerCallback" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ; + int arg2 ; + int arg3 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioConsumerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioConsumerCallback::prepare(arg2,arg3,arg4); + } else { + result = (int)(arg1)->prepare(arg2,arg3,arg4); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumerCallback_start",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_start" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioConsumerCallback::start(); + } else { + result = (int)(arg1)->start(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumerCallback_pause",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_pause" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioConsumerCallback::pause(); + } else { + result = (int)(arg1)->pause(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumerCallback_stop",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_stop" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioConsumerCallback::stop(); + } else { + result = (int)(arg1)->stop(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_ProxyAudioConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyAudioConsumerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyAudioConsumerCallback" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyAudioConsumerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioConsumerCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyAudioConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioConsumer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioConsumer" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_setActualSndCardPlaybackParams(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + int arg2 ; + int arg3 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioConsumer_setActualSndCardPlaybackParams",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_setActualSndCardPlaybackParams" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioConsumer_setActualSndCardPlaybackParams" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumer_setActualSndCardPlaybackParams" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioConsumer_setActualSndCardPlaybackParams" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + result = (bool)(arg1)->setActualSndCardPlaybackParams(arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_queryForResampler(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + uint16_t arg2 ; + uint16_t arg3 ; + uint16_t arg4 ; + uint16_t arg5 ; + uint16_t arg6 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned short val2 ; + int ecode2 = 0 ; + unsigned short val3 ; + int ecode3 = 0 ; + unsigned short val4 ; + int ecode4 = 0 ; + unsigned short val5 ; + int ecode5 = 0 ; + unsigned short val6 ; + int ecode6 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + PyObject * obj5 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOOO:ProxyAudioConsumer_queryForResampler",&obj0,&obj1,&obj2,&obj3,&obj4,&obj5)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_queryForResampler" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioConsumer_queryForResampler" "', argument " "2"" of type '" "uint16_t""'"); + } + arg2 = static_cast< uint16_t >(val2); + ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumer_queryForResampler" "', argument " "3"" of type '" "uint16_t""'"); + } + arg3 = static_cast< uint16_t >(val3); + ecode4 = SWIG_AsVal_unsigned_SS_short(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioConsumer_queryForResampler" "', argument " "4"" of type '" "uint16_t""'"); + } + arg4 = static_cast< uint16_t >(val4); + ecode5 = SWIG_AsVal_unsigned_SS_short(obj4, &val5); + if (!SWIG_IsOK(ecode5)) { + SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "ProxyAudioConsumer_queryForResampler" "', argument " "5"" of type '" "uint16_t""'"); + } + arg5 = static_cast< uint16_t >(val5); + ecode6 = SWIG_AsVal_unsigned_SS_short(obj5, &val6); + if (!SWIG_IsOK(ecode6)) { + SWIG_exception_fail(SWIG_ArgError(ecode6), "in method '" "ProxyAudioConsumer_queryForResampler" "', argument " "6"" of type '" "uint16_t""'"); + } + arg6 = static_cast< uint16_t >(val6); + result = (bool)(arg1)->queryForResampler(arg2,arg3,arg4,arg5,arg6); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_setPullBuffer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyAudioConsumer_setPullBuffer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_setPullBuffer" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioConsumer_setPullBuffer" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumer_setPullBuffer" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->setPullBuffer((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_pull__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyAudioConsumer_pull",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_pull" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioConsumer_pull" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumer_pull" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->pull(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_pull__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *arg2 = (void *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioConsumer_pull",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_pull" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioConsumer_pull" "', argument " "2"" of type '" "void *""'"); + } + result = (unsigned int)(arg1)->pull(arg2); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_pull__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumer_pull",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_pull" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + result = (unsigned int)(arg1)->pull(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_pull(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioConsumer, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_ProxyAudioConsumer_pull__SWIG_2(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioConsumer, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_ProxyAudioConsumer_pull__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioConsumer, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_ProxyAudioConsumer_pull__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'ProxyAudioConsumer_pull'.\n" + " Possible C/C++ prototypes are:\n" + " ProxyAudioConsumer::pull(void *,unsigned int)\n" + " ProxyAudioConsumer::pull(void *)\n" + " ProxyAudioConsumer::pull()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_setGain(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + unsigned int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioConsumer_setGain",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_setGain" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioConsumer_setGain" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)(arg1)->setGain(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_getGain(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumer_getGain",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_getGain" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + result = (unsigned int)(arg1)->getGain(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_reset(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumer_reset",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_reset" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + result = (bool)(arg1)->reset(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + ProxyAudioConsumerCallback *arg2 = (ProxyAudioConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioConsumer_setCallback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_setCallback" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioConsumer_setCallback" "', argument " "2"" of type '" "ProxyAudioConsumerCallback *""'"); + } + arg2 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp2); + (arg1)->setCallback(arg2); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint64_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumer_getMediaSessionId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_getMediaSessionId" "', argument " "1"" of type '" "ProxyAudioConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1); + result = (uint64_t)(arg1)->getMediaSessionId(); + resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":ProxyAudioConsumer_registerPlugin")) SWIG_fail; + result = (bool)ProxyAudioConsumer::registerPlugin(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyAudioConsumer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioConsumer, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_ProxyVideoConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + ProxyVideoConsumerCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyVideoConsumerCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (ProxyVideoConsumerCallback *)new SwigDirector_ProxyVideoConsumerCallback(arg1); + } else { + result = (ProxyVideoConsumerCallback *)new ProxyVideoConsumerCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoConsumerCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_ProxyVideoConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoConsumerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoConsumerCallback" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + int arg2 ; + int arg3 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyVideoConsumerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoConsumerCallback::prepare(arg2,arg3,arg4); + } else { + result = (int)(arg1)->prepare(arg2,arg3,arg4); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_consume(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + ProxyVideoFrame *arg2 = (ProxyVideoFrame *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoConsumerCallback_consume",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_consume" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoConsumerCallback_consume" "', argument " "2"" of type '" "ProxyVideoFrame const *""'"); + } + arg2 = reinterpret_cast< ProxyVideoFrame * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoConsumerCallback::consume((ProxyVideoFrame const *)arg2); + } else { + result = (int)(arg1)->consume((ProxyVideoFrame const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_bufferCopied(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + unsigned int arg2 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoConsumerCallback_bufferCopied",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_bufferCopied" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoConsumerCallback_bufferCopied" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumerCallback_bufferCopied" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoConsumerCallback::bufferCopied(arg2,arg3); + } else { + result = (int)(arg1)->bufferCopied(arg2,arg3); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumerCallback_start",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_start" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoConsumerCallback::start(); + } else { + result = (int)(arg1)->start(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumerCallback_pause",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_pause" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoConsumerCallback::pause(); + } else { + result = (int)(arg1)->pause(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumerCallback_stop",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_stop" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoConsumerCallback::stop(); + } else { + result = (int)(arg1)->stop(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_ProxyVideoConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyVideoConsumerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyVideoConsumerCallback" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyVideoConsumerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoConsumerCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyVideoConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoConsumer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoConsumer" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setDisplaySize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + unsigned int arg2 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoConsumer_setDisplaySize",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_setDisplaySize" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoConsumer_setDisplaySize" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumer_setDisplaySize" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->setDisplaySize(arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getDisplayWidth(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getDisplayWidth",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getDisplayWidth" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (unsigned int)(arg1)->getDisplayWidth(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getDisplayHeight(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getDisplayHeight",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getDisplayHeight" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (unsigned int)(arg1)->getDisplayHeight(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getDecodedWidth(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getDecodedWidth",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getDecodedWidth" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (unsigned int)(arg1)->getDecodedWidth(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getDecodedHeight(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getDecodedHeight",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getDecodedHeight" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (unsigned int)(arg1)->getDecodedHeight(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + ProxyVideoConsumerCallback *arg2 = (ProxyVideoConsumerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoConsumer_setCallback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_setCallback" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoConsumer_setCallback" "', argument " "2"" of type '" "ProxyVideoConsumerCallback *""'"); + } + arg2 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp2); + (arg1)->setCallback(arg2); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setAutoResizeDisplay(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoConsumer_setAutoResizeDisplay",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_setAutoResizeDisplay" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoConsumer_setAutoResizeDisplay" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setAutoResizeDisplay(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getAutoResizeDisplay(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getAutoResizeDisplay",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getAutoResizeDisplay" "', argument " "1"" of type '" "ProxyVideoConsumer const *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (bool)((ProxyVideoConsumer const *)arg1)->getAutoResizeDisplay(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setConsumeBuffer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoConsumer_setConsumeBuffer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_setConsumeBuffer" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoConsumer_setConsumeBuffer" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumer_setConsumeBuffer" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->setConsumeBuffer((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_pull(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoConsumer_pull",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_pull" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoConsumer_pull" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumer_pull" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->pull(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_reset(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_reset",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_reset" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (bool)(arg1)->reset(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint64_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getMediaSessionId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getMediaSessionId" "', argument " "1"" of type '" "ProxyVideoConsumer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1); + result = (uint64_t)(arg1)->getMediaSessionId(); + resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":ProxyVideoConsumer_registerPlugin")) SWIG_fail; + result = (bool)ProxyVideoConsumer::registerPlugin(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setDefaultChroma(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_chroma_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_setDefaultChroma",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "ProxyVideoConsumer_setDefaultChroma" "', argument " "1"" of type '" "tmedia_chroma_t""'"); + } + arg1 = static_cast< tmedia_chroma_t >(val1); + ProxyVideoConsumer::setDefaultChroma(arg1); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setDefaultAutoResizeDisplay(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool arg1 ; + bool val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_setDefaultAutoResizeDisplay",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_bool(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "ProxyVideoConsumer_setDefaultAutoResizeDisplay" "', argument " "1"" of type '" "bool""'"); + } + arg1 = static_cast< bool >(val1); + ProxyVideoConsumer::setDefaultAutoResizeDisplay(arg1); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyVideoConsumer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoConsumer, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyVideoFrame(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoFrame",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoFrame" "', argument " "1"" of type '" "ProxyVideoFrame *""'"); + } + arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoFrame_getSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoFrame_getSize",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoFrame_getSize" "', argument " "1"" of type '" "ProxyVideoFrame *""'"); + } + arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1); + result = (unsigned int)(arg1)->getSize(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoFrame_getContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoFrame_getContent",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoFrame_getContent" "', argument " "1"" of type '" "ProxyVideoFrame *""'"); + } + arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoFrame_getContent" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoFrame_getContent" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getContent(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoFrame_getFrameWidth(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoFrame_getFrameWidth",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoFrame_getFrameWidth" "', argument " "1"" of type '" "ProxyVideoFrame const *""'"); + } + arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1); + result = (unsigned int)((ProxyVideoFrame const *)arg1)->getFrameWidth(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoFrame_getFrameHeight(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoFrame_getFrameHeight",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoFrame_getFrameHeight" "', argument " "1"" of type '" "ProxyVideoFrame const *""'"); + } + arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1); + result = (unsigned int)((ProxyVideoFrame const *)arg1)->getFrameHeight(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyVideoFrame_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoFrame, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_ProxyAudioProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + ProxyAudioProducerCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyAudioProducerCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (ProxyAudioProducerCallback *)new SwigDirector_ProxyAudioProducerCallback(arg1); + } else { + result = (ProxyAudioProducerCallback *)new ProxyAudioProducerCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioProducerCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_ProxyAudioProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioProducerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioProducerCallback" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + int arg2 ; + int arg3 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioProducerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioProducerCallback::prepare(arg2,arg3,arg4); + } else { + result = (int)(arg1)->prepare(arg2,arg3,arg4); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_start",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_start" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioProducerCallback::start(); + } else { + result = (int)(arg1)->start(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_pause",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_pause" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioProducerCallback::pause(); + } else { + result = (int)(arg1)->pause(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_stop",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_stop" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioProducerCallback::stop(); + } else { + result = (int)(arg1)->stop(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_fillPushBuffer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_fillPushBuffer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_fillPushBuffer" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyAudioProducerCallback::fillPushBuffer(); + } else { + result = (int)(arg1)->fillPushBuffer(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_ProxyAudioProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyAudioProducerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyAudioProducerCallback" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyAudioProducerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioProducerCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyAudioProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioProducer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioProducer" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setActualSndCardRecordParams(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + int arg2 ; + int arg3 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioProducer_setActualSndCardRecordParams",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_setActualSndCardRecordParams" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioProducer_setActualSndCardRecordParams" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducer_setActualSndCardRecordParams" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioProducer_setActualSndCardRecordParams" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + result = (bool)(arg1)->setActualSndCardRecordParams(arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setPushBuffer__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + bool arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + bool val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioProducer_setPushBuffer",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + ecode4 = SWIG_AsVal_bool(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "4"" of type '" "bool""'"); + } + arg4 = static_cast< bool >(val4); + result = (bool)(arg1)->setPushBuffer((void const *)arg2,arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setPushBuffer__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyAudioProducer_setPushBuffer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducer_setPushBuffer" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->setPushBuffer((void const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setPushBuffer(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioProducer, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_ProxyAudioProducer_setPushBuffer__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioProducer, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + { + int res = SWIG_AsVal_bool(argv[3], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_ProxyAudioProducer_setPushBuffer__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'ProxyAudioProducer_setPushBuffer'.\n" + " Possible C/C++ prototypes are:\n" + " ProxyAudioProducer::setPushBuffer(void const *,unsigned int,bool)\n" + " ProxyAudioProducer::setPushBuffer(void const *,unsigned int)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_push__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyAudioProducer_push",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_push" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_push" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducer_push" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (int)(arg1)->push((void const *)arg2,arg3); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_push__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *arg2 = (void *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioProducer_push",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_push" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_push" "', argument " "2"" of type '" "void const *""'"); + } + result = (int)(arg1)->push((void const *)arg2); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_push__SWIG_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducer_push",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_push" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + result = (int)(arg1)->push(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_push(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 1) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioProducer, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_ProxyAudioProducer_push__SWIG_2(self, args); + } + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioProducer, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_ProxyAudioProducer_push__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_ProxyAudioProducer, 0); + _v = SWIG_CheckState(res); + if (_v) { + void *ptr = 0; + int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_ProxyAudioProducer_push__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'ProxyAudioProducer_push'.\n" + " Possible C/C++ prototypes are:\n" + " ProxyAudioProducer::push(void const *,unsigned int)\n" + " ProxyAudioProducer::push(void const *)\n" + " ProxyAudioProducer::push()\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setGain(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + unsigned int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioProducer_setGain",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_setGain" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioProducer_setGain" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)(arg1)->setGain(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_getGain(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducer_getGain",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_getGain" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + result = (unsigned int)(arg1)->getGain(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + ProxyAudioProducerCallback *arg2 = (ProxyAudioProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioProducer_setCallback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_setCallback" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_setCallback" "', argument " "2"" of type '" "ProxyAudioProducerCallback *""'"); + } + arg2 = reinterpret_cast< ProxyAudioProducerCallback * >(argp2); + (arg1)->setCallback(arg2); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint64_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducer_getMediaSessionId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_getMediaSessionId" "', argument " "1"" of type '" "ProxyAudioProducer *""'"); + } + arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1); + result = (uint64_t)(arg1)->getMediaSessionId(); + resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyAudioProducer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":ProxyAudioProducer_registerPlugin")) SWIG_fail; + result = (bool)ProxyAudioProducer::registerPlugin(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyAudioProducer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioProducer, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_ProxyVideoProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + ProxyVideoProducerCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyVideoProducerCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (ProxyVideoProducerCallback *)new SwigDirector_ProxyVideoProducerCallback(arg1); + } else { + result = (ProxyVideoProducerCallback *)new ProxyVideoProducerCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoProducerCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_ProxyVideoProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoProducerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoProducerCallback" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ; + int arg2 ; + int arg3 ; + int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + int val3 ; + int ecode3 = 0 ; + int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyVideoProducerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + ecode4 = SWIG_AsVal_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "4"" of type '" "int""'"); + } + arg4 = static_cast< int >(val4); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoProducerCallback::prepare(arg2,arg3,arg4); + } else { + result = (int)(arg1)->prepare(arg2,arg3,arg4); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducerCallback_start",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_start" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoProducerCallback::start(); + } else { + result = (int)(arg1)->start(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducerCallback_pause",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_pause" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoProducerCallback::pause(); + } else { + result = (int)(arg1)->pause(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducerCallback_stop",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_stop" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->ProxyVideoProducerCallback::stop(); + } else { + result = (int)(arg1)->stop(); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_ProxyVideoProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyVideoProducerCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyVideoProducerCallback" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyVideoProducerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoProducerCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_ProxyVideoProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoProducer",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoProducer" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_getRotation(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_getRotation",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_getRotation" "', argument " "1"" of type '" "ProxyVideoProducer const *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + result = (int)((ProxyVideoProducer const *)arg1)->getRotation(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setRotation(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoProducer_setRotation",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_setRotation" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoProducer_setRotation" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + result = (bool)(arg1)->setRotation(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_getMirror(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_getMirror",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_getMirror" "', argument " "1"" of type '" "ProxyVideoProducer const *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + result = (bool)((ProxyVideoProducer const *)arg1)->getMirror(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setMirror(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoProducer_setMirror",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_setMirror" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoProducer_setMirror" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setMirror(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setActualCameraOutputSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + unsigned int arg2 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoProducer_setActualCameraOutputSize",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_setActualCameraOutputSize" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoProducer_setActualCameraOutputSize" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoProducer_setActualCameraOutputSize" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (bool)(arg1)->setActualCameraOutputSize(arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_push(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoProducer_push",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_push" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoProducer_push" "', argument " "2"" of type '" "void const *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoProducer_push" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (int)(arg1)->push((void const *)arg2,arg3); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + ProxyVideoProducerCallback *arg2 = (ProxyVideoProducerCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoProducer_setCallback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_setCallback" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoProducer_setCallback" "', argument " "2"" of type '" "ProxyVideoProducerCallback *""'"); + } + arg2 = reinterpret_cast< ProxyVideoProducerCallback * >(argp2); + (arg1)->setCallback(arg2); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + uint64_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_getMediaSessionId",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_getMediaSessionId" "', argument " "1"" of type '" "ProxyVideoProducer *""'"); + } + arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1); + result = (uint64_t)(arg1)->getMediaSessionId(); + resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":ProxyVideoProducer_registerPlugin")) SWIG_fail; + result = (bool)ProxyVideoProducer::registerPlugin(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setDefaultChroma(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tmedia_chroma_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_setDefaultChroma",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "ProxyVideoProducer_setDefaultChroma" "', argument " "1"" of type '" "tmedia_chroma_t""'"); + } + arg1 = static_cast< tmedia_chroma_t >(val1); + ProxyVideoProducer::setDefaultChroma(arg1); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *ProxyVideoProducer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoProducer, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SipCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + SipCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_SipCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (SipCallback *)new SwigDirector_SipCallback(arg1); + } else { + result = (SipCallback *)new SipCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SipCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SipCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipCallback" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnDialogEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + DialogEvent *arg2 = (DialogEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnDialogEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnDialogEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_DialogEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnDialogEvent" "', argument " "2"" of type '" "DialogEvent const *""'"); + } + arg2 = reinterpret_cast< DialogEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnDialogEvent((DialogEvent const *)arg2); + } else { + result = (int)(arg1)->OnDialogEvent((DialogEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnStackEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + StackEvent *arg2 = (StackEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnStackEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnStackEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_StackEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnStackEvent" "', argument " "2"" of type '" "StackEvent const *""'"); + } + arg2 = reinterpret_cast< StackEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnStackEvent((StackEvent const *)arg2); + } else { + result = (int)(arg1)->OnStackEvent((StackEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnInviteEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + InviteEvent *arg2 = (InviteEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnInviteEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnInviteEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_InviteEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnInviteEvent" "', argument " "2"" of type '" "InviteEvent const *""'"); + } + arg2 = reinterpret_cast< InviteEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnInviteEvent((InviteEvent const *)arg2); + } else { + result = (int)(arg1)->OnInviteEvent((InviteEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnMessagingEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + MessagingEvent *arg2 = (MessagingEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnMessagingEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnMessagingEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MessagingEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnMessagingEvent" "', argument " "2"" of type '" "MessagingEvent const *""'"); + } + arg2 = reinterpret_cast< MessagingEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnMessagingEvent((MessagingEvent const *)arg2); + } else { + result = (int)(arg1)->OnMessagingEvent((MessagingEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnInfoEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + InfoEvent *arg2 = (InfoEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnInfoEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnInfoEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_InfoEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnInfoEvent" "', argument " "2"" of type '" "InfoEvent const *""'"); + } + arg2 = reinterpret_cast< InfoEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnInfoEvent((InfoEvent const *)arg2); + } else { + result = (int)(arg1)->OnInfoEvent((InfoEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnOptionsEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + OptionsEvent *arg2 = (OptionsEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnOptionsEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnOptionsEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_OptionsEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnOptionsEvent" "', argument " "2"" of type '" "OptionsEvent const *""'"); + } + arg2 = reinterpret_cast< OptionsEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnOptionsEvent((OptionsEvent const *)arg2); + } else { + result = (int)(arg1)->OnOptionsEvent((OptionsEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnPublicationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + PublicationEvent *arg2 = (PublicationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnPublicationEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnPublicationEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_PublicationEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnPublicationEvent" "', argument " "2"" of type '" "PublicationEvent const *""'"); + } + arg2 = reinterpret_cast< PublicationEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnPublicationEvent((PublicationEvent const *)arg2); + } else { + result = (int)(arg1)->OnPublicationEvent((PublicationEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnRegistrationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + RegistrationEvent *arg2 = (RegistrationEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnRegistrationEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnRegistrationEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_RegistrationEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnRegistrationEvent" "', argument " "2"" of type '" "RegistrationEvent const *""'"); + } + arg2 = reinterpret_cast< RegistrationEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnRegistrationEvent((RegistrationEvent const *)arg2); + } else { + result = (int)(arg1)->OnRegistrationEvent((RegistrationEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipCallback_OnSubscriptionEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + SubscriptionEvent *arg2 = (SubscriptionEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnSubscriptionEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnSubscriptionEvent" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SubscriptionEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnSubscriptionEvent" "', argument " "2"" of type '" "SubscriptionEvent const *""'"); + } + arg2 = reinterpret_cast< SubscriptionEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->SipCallback::OnSubscriptionEvent((SubscriptionEvent const *)arg2); + } else { + result = (int)(arg1)->OnSubscriptionEvent((SubscriptionEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_SipCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_SipCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_SipCallback" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SipCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SipCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SafeObject(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SafeObject *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_SafeObject")) SWIG_fail; + result = (SafeObject *)new SafeObject(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SafeObject, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SafeObject(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SafeObject *arg1 = (SafeObject *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SafeObject",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SafeObject, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SafeObject" "', argument " "1"" of type '" "SafeObject *""'"); + } + arg1 = reinterpret_cast< SafeObject * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SafeObject_Lock(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SafeObject *arg1 = (SafeObject *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:SafeObject_Lock",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SafeObject, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SafeObject_Lock" "', argument " "1"" of type '" "SafeObject const *""'"); + } + arg1 = reinterpret_cast< SafeObject * >(argp1); + result = (int)((SafeObject const *)arg1)->Lock(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SafeObject_UnLock(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SafeObject *arg1 = (SafeObject *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:SafeObject_UnLock",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SafeObject, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SafeObject_UnLock" "', argument " "1"" of type '" "SafeObject const *""'"); + } + arg1 = reinterpret_cast< SafeObject * >(argp1); + result = (int)((SafeObject const *)arg1)->UnLock(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SafeObject_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SafeObject, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SipStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipCallback *arg1 = (SipCallback *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + SipStack *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:new_SipStack",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipStack" "', argument " "1"" of type '" "SipCallback *""'"); + } + arg1 = reinterpret_cast< SipCallback * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_SipStack" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_SipStack" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "new_SipStack" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (SipStack *)new SipStack(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipStack, SWIG_POINTER_NEW | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SipStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SipStack",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipStack" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_start",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_start" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (bool)(arg1)->start(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + DDebugCallback *arg2 = (DDebugCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setDebugCallback",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setDebugCallback" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_DDebugCallback, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setDebugCallback" "', argument " "2"" of type '" "DDebugCallback *""'"); + } + arg2 = reinterpret_cast< DDebugCallback * >(argp2); + result = (bool)(arg1)->setDebugCallback(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setDisplayName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setDisplayName",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setDisplayName" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setDisplayName" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setDisplayName((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setRealm(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setRealm",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setRealm" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setRealm" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setRealm((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setIMPI(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setIMPI",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIMPI" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setIMPI" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setIMPI((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setIMPU(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setIMPU",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIMPU" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setIMPU" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setIMPU((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setPassword(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setPassword",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setPassword" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setPassword" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setPassword((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setAMF(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setAMF",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setAMF" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setAMF" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setAMF((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setOperatorId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setOperatorId",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setOperatorId" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setOperatorId" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setOperatorId((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setProxyCSCF(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + unsigned short arg3 ; + char *arg4 = (char *) 0 ; + char *arg5 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned short val3 ; + int ecode3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + int res5 ; + char *buf5 = 0 ; + int alloc5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setProxyCSCF",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setProxyCSCF" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setProxyCSCF" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setProxyCSCF" "', argument " "3"" of type '" "unsigned short""'"); + } + arg3 = static_cast< unsigned short >(val3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setProxyCSCF" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5); + if (!SWIG_IsOK(res5)) { + SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "SipStack_setProxyCSCF" "', argument " "5"" of type '" "char const *""'"); + } + arg5 = reinterpret_cast< char * >(buf5); + result = (bool)(arg1)->setProxyCSCF((char const *)arg2,arg3,(char const *)arg4,(char const *)arg5); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setLocalIP__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setLocalIP",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setLocalIP" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setLocalIP" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setLocalIP" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->setLocalIP((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setLocalIP__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setLocalIP",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setLocalIP" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setLocalIP" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setLocalIP((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setLocalIP(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipStack_setLocalIP__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipStack_setLocalIP__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipStack_setLocalIP'.\n" + " Possible C/C++ prototypes are:\n" + " SipStack::setLocalIP(char const *,char const *)\n" + " SipStack::setLocalIP(char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setLocalPort__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + unsigned short arg2 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned short val2 ; + int ecode2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setLocalPort",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setLocalPort" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setLocalPort" "', argument " "2"" of type '" "unsigned short""'"); + } + arg2 = static_cast< unsigned short >(val2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setLocalPort" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->setLocalPort(arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setLocalPort__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + unsigned short arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned short val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setLocalPort",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setLocalPort" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setLocalPort" "', argument " "2"" of type '" "unsigned short""'"); + } + arg2 = static_cast< unsigned short >(val2); + result = (bool)(arg1)->setLocalPort(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setLocalPort(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_short(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SipStack_setLocalPort__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_short(argv[1], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipStack_setLocalPort__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipStack_setLocalPort'.\n" + " Possible C/C++ prototypes are:\n" + " SipStack::setLocalPort(unsigned short,char const *)\n" + " SipStack::setLocalPort(unsigned short)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setEarlyIMS(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setEarlyIMS",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setEarlyIMS" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setEarlyIMS" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setEarlyIMS(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_addHeader",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_addHeader" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_addHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_addHeader" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_removeHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_removeHeader",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_removeHeader" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_removeHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->removeHeader((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_addDnsServer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_addDnsServer",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_addDnsServer" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_addDnsServer" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->addDnsServer((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setDnsDiscovery(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setDnsDiscovery",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setDnsDiscovery" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setDnsDiscovery" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setDnsDiscovery(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setAoR(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setAoR",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setAoR" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setAoR" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setAoR" "', argument " "3"" of type '" "int""'"); + } + arg3 = static_cast< int >(val3); + result = (bool)(arg1)->setAoR((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSigCompParams(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + unsigned int arg2 ; + unsigned int arg3 ; + unsigned int arg4 ; + bool arg5 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + unsigned int val4 ; + int ecode4 = 0 ; + bool val5 ; + int ecode5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setSigCompParams",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSigCompParams" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setSigCompParams" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setSigCompParams" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SipStack_setSigCompParams" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + ecode5 = SWIG_AsVal_bool(obj4, &val5); + if (!SWIG_IsOK(ecode5)) { + SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "SipStack_setSigCompParams" "', argument " "5"" of type '" "bool""'"); + } + arg5 = static_cast< bool >(val5); + result = (bool)(arg1)->setSigCompParams(arg2,arg3,arg4,arg5); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_addSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_addSigCompCompartment",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_addSigCompCompartment" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_addSigCompCompartment" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->addSigCompCompartment((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_removeSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_removeSigCompCompartment",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_removeSigCompCompartment" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_removeSigCompCompartment" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->removeSigCompCompartment((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSTUNEnabledForICE(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setSTUNEnabledForICE",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSTUNEnabledForICE" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setSTUNEnabledForICE" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setSTUNEnabledForICE(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSTUNServer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + unsigned short arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned short val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setSTUNServer",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSTUNServer" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSTUNServer" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setSTUNServer" "', argument " "3"" of type '" "unsigned short""'"); + } + arg3 = static_cast< unsigned short >(val3); + result = (bool)(arg1)->setSTUNServer((char const *)arg2,arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSTUNCred(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setSTUNCred",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSTUNCred" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSTUNCred" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSTUNCred" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->setSTUNCred((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSTUNEnabled(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setSTUNEnabled",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSTUNEnabled" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setSTUNEnabled" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setSTUNEnabled(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setTLSSecAgree(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setTLSSecAgree",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setTLSSecAgree" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setTLSSecAgree" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setTLSSecAgree(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSSLCertificates__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + bool arg5 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + bool val5 ; + int ecode5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setSSLCertificates",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSSLCertificates" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSSLCertificates" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSSLCertificates" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setSSLCertificates" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + ecode5 = SWIG_AsVal_bool(obj4, &val5); + if (!SWIG_IsOK(ecode5)) { + SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "SipStack_setSSLCertificates" "', argument " "5"" of type '" "bool""'"); + } + arg5 = static_cast< bool >(val5); + result = (bool)(arg1)->setSSLCertificates((char const *)arg2,(char const *)arg3,(char const *)arg4,arg5); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSSLCertificates__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SipStack_setSSLCertificates",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSSLCertificates" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSSLCertificates" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSSLCertificates" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setSSLCertificates" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (bool)(arg1)->setSSLCertificates((char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSSLCertificates(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[6]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 5) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[3], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipStack_setSSLCertificates__SWIG_1(self, args); + } + } + } + } + } + if (argc == 5) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[3], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_bool(argv[4], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SipStack_setSSLCertificates__SWIG_0(self, args); + } + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipStack_setSSLCertificates'.\n" + " Possible C/C++ prototypes are:\n" + " SipStack::setSSLCertificates(char const *,char const *,char const *,bool)\n" + " SipStack::setSSLCertificates(char const *,char const *,char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSSLCretificates__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + bool arg5 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + bool val5 ; + int ecode5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setSSLCretificates",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSSLCretificates" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSSLCretificates" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSSLCretificates" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setSSLCretificates" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + ecode5 = SWIG_AsVal_bool(obj4, &val5); + if (!SWIG_IsOK(ecode5)) { + SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "SipStack_setSSLCretificates" "', argument " "5"" of type '" "bool""'"); + } + arg5 = static_cast< bool >(val5); + result = (bool)(arg1)->setSSLCretificates((char const *)arg2,(char const *)arg3,(char const *)arg4,arg5); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSSLCretificates__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SipStack_setSSLCretificates",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSSLCretificates" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSSLCretificates" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSSLCretificates" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setSSLCretificates" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (bool)(arg1)->setSSLCretificates((char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setSSLCretificates(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[6]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 5) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[3], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_SipStack_setSSLCretificates__SWIG_1(self, args); + } + } + } + } + } + if (argc == 5) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipStack, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[3], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_bool(argv[4], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_SipStack_setSSLCretificates__SWIG_0(self, args); + } + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'SipStack_setSSLCretificates'.\n" + " Possible C/C++ prototypes are:\n" + " SipStack::setSSLCretificates(char const *,char const *,char const *,bool)\n" + " SipStack::setSSLCretificates(char const *,char const *,char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setIPSecSecAgree(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + bool arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + bool val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setIPSecSecAgree",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIPSecSecAgree" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_bool(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setIPSecSecAgree" "', argument " "2"" of type '" "bool""'"); + } + arg2 = static_cast< bool >(val2); + result = (bool)(arg1)->setIPSecSecAgree(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setIPSecParameters(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + char *arg5 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + int res5 ; + char *buf5 = 0 ; + int alloc5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setIPSecParameters",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIPSecParameters" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setIPSecParameters" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setIPSecParameters" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setIPSecParameters" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5); + if (!SWIG_IsOK(res5)) { + SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "SipStack_setIPSecParameters" "', argument " "5"" of type '" "char const *""'"); + } + arg5 = reinterpret_cast< char * >(buf5); + result = (bool)(arg1)->setIPSecParameters((char const *)arg2,(char const *)arg3,(char const *)arg4,(char const *)arg5); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_dnsENUM(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SipStack_dnsENUM",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_dnsENUM" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_dnsENUM" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_dnsENUM" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_dnsENUM" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (char *)(arg1)->dnsENUM((char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_dnsNaptrSrv(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + unsigned short *arg4 = (unsigned short *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + unsigned short temp4 ; + int res4 = SWIG_TMPOBJ ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + arg4 = &temp4; + if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_dnsNaptrSrv",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_dnsNaptrSrv" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_dnsNaptrSrv" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_dnsNaptrSrv" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (char *)(arg1)->dnsNaptrSrv((char const *)arg2,(char const *)arg3,arg4); + resultobj = SWIG_FromCharPtr((const char *)result); + if (SWIG_IsTmpObj(res4)) { + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_unsigned_SS_short((*arg4))); + } else { + int new_flags = SWIG_IsNewObj(res4) ? (SWIG_POINTER_OWN | 0 ) : 0 ; + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg4), SWIGTYPE_p_unsigned_short, new_flags)); + } + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_dnsSrv(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + unsigned short *arg3 = (unsigned short *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned short temp3 ; + int res3 = SWIG_TMPOBJ ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + arg3 = &temp3; + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_dnsSrv",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_dnsSrv" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_dnsSrv" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->dnsSrv((char const *)arg2,arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (SWIG_IsTmpObj(res3)) { + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_unsigned_SS_short((*arg3))); + } else { + int new_flags = SWIG_IsNewObj(res3) ? (SWIG_POINTER_OWN | 0 ) : 0 ; + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg3), SWIGTYPE_p_unsigned_short, new_flags)); + } + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setMaxFDs(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + unsigned int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setMaxFDs",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setMaxFDs" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setMaxFDs" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)(arg1)->setMaxFDs(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_getLocalIPnPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + char *arg2 = (char *) 0 ; + unsigned short *arg3 = (unsigned short *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned short temp3 ; + int res3 = SWIG_TMPOBJ ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + arg3 = &temp3; + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_getLocalIPnPort",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_getLocalIPnPort" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_getLocalIPnPort" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->getLocalIPnPort((char const *)arg2,arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (SWIG_IsTmpObj(res3)) { + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_unsigned_SS_short((*arg3))); + } else { + int new_flags = SWIG_IsNewObj(res3) ? (SWIG_POINTER_OWN | 0 ) : 0 ; + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg3), SWIGTYPE_p_unsigned_short, new_flags)); + } + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_getPreferredIdentity(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_getPreferredIdentity",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_getPreferredIdentity" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (char *)(arg1)->getPreferredIdentity(); + resultobj = SWIG_FromCharPtr((const char *)result); + delete[] result; + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_isValid(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_isValid",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_isValid" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (bool)(arg1)->isValid(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SipStack *arg1 = (SipStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_stop",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_stop" "', argument " "1"" of type '" "SipStack *""'"); + } + arg1 = reinterpret_cast< SipStack * >(argp1); + result = (bool)(arg1)->stop(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_initialize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":SipStack_initialize")) SWIG_fail; + result = (bool)SipStack::initialize(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_deInitialize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":SipStack_deInitialize")) SWIG_fail; + result = (bool)SipStack::deInitialize(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setCodecs(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tdav_codec_id_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_setCodecs",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_setCodecs" "', argument " "1"" of type '" "tdav_codec_id_t""'"); + } + arg1 = static_cast< tdav_codec_id_t >(val1); + SipStack::setCodecs(arg1); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setCodecs_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int64_t arg1 ; + long long val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_setCodecs_2",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_long_SS_long(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_setCodecs_2" "', argument " "1"" of type '" "int64_t""'"); + } + arg1 = static_cast< int64_t >(val1); + SipStack::setCodecs_2(arg1); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setCodecPriority(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tdav_codec_id_t arg1 ; + int arg2 ; + int val1 ; + int ecode1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setCodecPriority",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_setCodecPriority" "', argument " "1"" of type '" "tdav_codec_id_t""'"); + } + arg1 = static_cast< tdav_codec_id_t >(val1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setCodecPriority" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + result = (bool)SipStack::setCodecPriority(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_setCodecPriority_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int arg1 ; + int arg2 ; + int val1 ; + int ecode1 = 0 ; + int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setCodecPriority_2",&obj0,&obj1)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_setCodecPriority_2" "', argument " "1"" of type '" "int""'"); + } + arg1 = static_cast< int >(val1); + ecode2 = SWIG_AsVal_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setCodecPriority_2" "', argument " "2"" of type '" "int""'"); + } + arg2 = static_cast< int >(val2); + result = (bool)SipStack::setCodecPriority_2(arg1,arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_isCodecSupported(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + tdav_codec_id_t arg1 ; + int val1 ; + int ecode1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:SipStack_isCodecSupported",&obj0)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_isCodecSupported" "', argument " "1"" of type '" "tdav_codec_id_t""'"); + } + arg1 = static_cast< tdav_codec_id_t >(val1); + result = (bool)SipStack::isCodecSupported(arg1); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SipStack_isIPSecSupported(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + bool result; + + if (!PyArg_ParseTuple(args,(char *)":SipStack_isIPSecSupported")) SWIG_fail; + result = (bool)SipStack::isIPSecSupported(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SipStack_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SipStack, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_XcapSelector(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_XcapSelector",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_XcapSelector" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + result = (XcapSelector *)new XcapSelector(arg1); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_XcapSelector(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapSelector",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapSelector" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_setAUID(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapSelector_setAUID",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setAUID" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setAUID" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (XcapSelector *)(arg1)->setAUID((char const *)arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_setName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapSelector_setName",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setName" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setName" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (XcapSelector *)(arg1)->setName((char const *)arg2); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_setAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapSelector_setAttribute",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setAttribute" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setAttribute" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapSelector_setAttribute" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "XcapSelector_setAttribute" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (XcapSelector *)(arg1)->setAttribute((char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_setPos(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + char *arg2 = (char *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapSelector_setPos",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setPos" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setPos" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapSelector_setPos" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (XcapSelector *)(arg1)->setPos((char const *)arg2,arg3); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_setPosAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + char *arg2 = (char *) 0 ; + unsigned int arg3 ; + char *arg4 = (char *) 0 ; + char *arg5 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + int res5 ; + char *buf5 = 0 ; + int alloc5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:XcapSelector_setPosAttribute",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setPosAttribute" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setPosAttribute" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapSelector_setPosAttribute" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "XcapSelector_setPosAttribute" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5); + if (!SWIG_IsOK(res5)) { + SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "XcapSelector_setPosAttribute" "', argument " "5"" of type '" "char const *""'"); + } + arg5 = reinterpret_cast< char * >(buf5); + result = (XcapSelector *)(arg1)->setPosAttribute((char const *)arg2,arg3,(char const *)arg4,(char const *)arg5); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_setNamespace(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + XcapSelector *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapSelector_setNamespace",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setNamespace" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setNamespace" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapSelector_setNamespace" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (XcapSelector *)(arg1)->setNamespace((char const *)arg2,(char const *)arg3); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_getString(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapSelector_getString",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_getString" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + result = (char *)(arg1)->getString(); + resultobj = SWIG_FromCharPtr((const char *)result); + delete[] result; + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapSelector_reset(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapSelector *arg1 = (XcapSelector *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapSelector_reset",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_reset" "', argument " "1"" of type '" "XcapSelector *""'"); + } + arg1 = reinterpret_cast< XcapSelector * >(argp1); + (arg1)->reset(); + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *XcapSelector_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_XcapSelector, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_XcapMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_XcapMessage")) SWIG_fail; + result = (XcapMessage *)new XcapMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapMessage, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_XcapMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapMessage" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + short result; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapMessage_getCode",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getCode" "', argument " "1"" of type '" "XcapMessage const *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + result = (short)((XcapMessage const *)arg1)->getCode(); + resultobj = SWIG_From_short(static_cast< short >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getPhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapMessage_getPhrase",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getPhrase" "', argument " "1"" of type '" "XcapMessage const *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + result = (char *)((XcapMessage const *)arg1)->getPhrase(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + char *arg2 = (char *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapMessage_getXcapHeaderValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (char *)(arg1)->getXcapHeaderValue((char const *)arg2,arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapMessage_getXcapHeaderValue",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->getXcapHeaderValue((char const *)arg2); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderValue(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[4]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 3) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 2) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_XcapMessage_getXcapHeaderValue__SWIG_1(self, args); + } + } + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_XcapMessage_getXcapHeaderValue__SWIG_0(self, args); + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'XcapMessage_getXcapHeaderValue'.\n" + " Possible C/C++ prototypes are:\n" + " XcapMessage::getXcapHeaderValue(char const *,unsigned int)\n" + " XcapMessage::getXcapHeaderValue(char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderParamValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + unsigned int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + unsigned int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapMessage_getXcapHeaderParamValue",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + result = (char *)(arg1)->getXcapHeaderParamValue((char const *)arg2,(char const *)arg3,arg4); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderParamValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapMessage_getXcapHeaderParamValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (char *)(arg1)->getXcapHeaderParamValue((char const *)arg2,(char const *)arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderParamValue(PyObject *self, PyObject *args) { + int argc; + PyObject *argv[5]; + int ii; + + if (!PyTuple_Check(args)) SWIG_fail; + argc = args ? (int)PyObject_Length(args) : 0; + for (ii = 0; (ii < 4) && (ii < argc); ii++) { + argv[ii] = PyTuple_GET_ITEM(args,ii); + } + if (argc == 3) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + return _wrap_XcapMessage_getXcapHeaderParamValue__SWIG_1(self, args); + } + } + } + } + if (argc == 4) { + int _v; + void *vptr = 0; + int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0); + _v = SWIG_CheckState(res); + if (_v) { + { + int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL); + _v = SWIG_CheckState(res); + } + if (_v) { + return _wrap_XcapMessage_getXcapHeaderParamValue__SWIG_0(self, args); + } + } + } + } + } + +fail: + SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number or type of arguments for overloaded function 'XcapMessage_getXcapHeaderParamValue'.\n" + " Possible C/C++ prototypes are:\n" + " XcapMessage::getXcapHeaderParamValue(char const *,char const *,unsigned int)\n" + " XcapMessage::getXcapHeaderParamValue(char const *,char const *)\n"); + return 0; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapContentLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapMessage_getXcapContentLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapContentLength" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + result = (unsigned int)(arg1)->getXcapContentLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapMessage_getXcapContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapMessage *arg1 = (XcapMessage *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapMessage_getXcapContent",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapContent" "', argument " "1"" of type '" "XcapMessage *""'"); + } + arg1 = reinterpret_cast< XcapMessage * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapContent" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapMessage_getXcapContent" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getXcapContent(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *XcapMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_XcapMessage, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_XcapEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapEvent *arg1 = (XcapEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapEvent" "', argument " "1"" of type '" "XcapEvent *""'"); + } + arg1 = reinterpret_cast< XcapEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapEvent *arg1 = (XcapEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + thttp_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapEvent_getType" "', argument " "1"" of type '" "XcapEvent *""'"); + } + arg1 = reinterpret_cast< XcapEvent * >(argp1); + result = (thttp_event_type_t)(arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapEvent_getXcapMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapEvent *arg1 = (XcapEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + XcapMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapEvent_getXcapMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapEvent_getXcapMessage" "', argument " "1"" of type '" "XcapEvent const *""'"); + } + arg1 = reinterpret_cast< XcapEvent * >(argp1); + result = (XcapMessage *)((XcapEvent const *)arg1)->getXcapMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapMessage, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *XcapEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_XcapEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_XcapCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + XcapCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_XcapCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (XcapCallback *)new SwigDirector_XcapCallback(arg1); + } else { + result = (XcapCallback *)new XcapCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_XcapCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapCallback *arg1 = (XcapCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapCallback" "', argument " "1"" of type '" "XcapCallback *""'"); + } + arg1 = reinterpret_cast< XcapCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapCallback_onEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapCallback *arg1 = (XcapCallback *) 0 ; + XcapEvent *arg2 = (XcapEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapCallback_onEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapCallback_onEvent" "', argument " "1"" of type '" "XcapCallback const *""'"); + } + arg1 = reinterpret_cast< XcapCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_XcapEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapCallback_onEvent" "', argument " "2"" of type '" "XcapEvent const *""'"); + } + arg2 = reinterpret_cast< XcapEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)((XcapCallback const *)arg1)->XcapCallback::onEvent((XcapEvent const *)arg2); + } else { + result = (int)((XcapCallback const *)arg1)->onEvent((XcapEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_XcapCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapCallback *arg1 = (XcapCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_XcapCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_XcapCallback" "', argument " "1"" of type '" "XcapCallback *""'"); + } + arg1 = reinterpret_cast< XcapCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *XcapCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_XcapCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_XcapStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapCallback *arg1 = (XcapCallback *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + XcapStack *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:new_XcapStack",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_XcapStack" "', argument " "1"" of type '" "XcapCallback *""'"); + } + arg1 = reinterpret_cast< XcapCallback * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_XcapStack" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_XcapStack" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "new_XcapStack" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (XcapStack *)new XcapStack(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapStack, SWIG_POINTER_NEW | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_XcapStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapStack",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapStack" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_registerAUID(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + char *arg5 = (char *) 0 ; + bool arg6 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + int res5 ; + char *buf5 = 0 ; + int alloc5 = 0 ; + bool val6 ; + int ecode6 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + PyObject * obj5 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOOO:XcapStack_registerAUID",&obj0,&obj1,&obj2,&obj3,&obj4,&obj5)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_registerAUID" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_registerAUID" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_registerAUID" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "XcapStack_registerAUID" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5); + if (!SWIG_IsOK(res5)) { + SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "XcapStack_registerAUID" "', argument " "5"" of type '" "char const *""'"); + } + arg5 = reinterpret_cast< char * >(buf5); + ecode6 = SWIG_AsVal_bool(obj5, &val6); + if (!SWIG_IsOK(ecode6)) { + SWIG_exception_fail(SWIG_ArgError(ecode6), "in method '" "XcapStack_registerAUID" "', argument " "6"" of type '" "bool""'"); + } + arg6 = static_cast< bool >(val6); + result = (bool)(arg1)->registerAUID((char const *)arg2,(char const *)arg3,(char const *)arg4,(char const *)arg5,arg6); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapStack_start",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_start" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + result = (bool)(arg1)->start(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_setCredentials(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapStack_setCredentials",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setCredentials" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_setCredentials" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_setCredentials" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->setCredentials((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_setXcapRoot(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setXcapRoot",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setXcapRoot" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_setXcapRoot" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setXcapRoot((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_setLocalIP(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setLocalIP",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setLocalIP" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_setLocalIP" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->setLocalIP((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_setLocalPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + unsigned int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setLocalPort",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setLocalPort" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "XcapStack_setLocalPort" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)(arg1)->setLocalPort(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:XcapStack_addHeader",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_addHeader" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_addHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_addHeader" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_removeHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_removeHeader",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_removeHeader" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_removeHeader" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->removeHeader((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_setTimeout(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + unsigned int arg2 ; + void *argp1 = 0 ; + int res1 = 0 ; + unsigned int val2 ; + int ecode2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setTimeout",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setTimeout" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "XcapStack_setTimeout" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + result = (bool)(arg1)->setTimeout(arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_getDocument(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_getDocument",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_getDocument" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_getDocument" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->getDocument((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_getElement(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_getElement",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_getElement" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_getElement" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->getElement((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_getAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_getAttribute",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_getAttribute" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_getAttribute" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->getAttribute((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_deleteDocument(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_deleteDocument",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_deleteDocument" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_deleteDocument" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->deleteDocument((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_deleteElement(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_deleteElement",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_deleteElement" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_deleteElement" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->deleteElement((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_deleteAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_deleteAttribute",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_deleteAttribute" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_deleteAttribute" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (bool)(arg1)->deleteAttribute((char const *)arg2); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_putDocument(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *arg3 = (void *) 0 ; + unsigned int arg4 ; + char *arg5 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + unsigned int val4 ; + int ecode4 = 0 ; + int res5 ; + char *buf5 = 0 ; + int alloc5 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + PyObject * obj4 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOOO:XcapStack_putDocument",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_putDocument" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_putDocument" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_putDocument" "', argument " "3"" of type '" "void const *""'"); + } + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapStack_putDocument" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5); + if (!SWIG_IsOK(res5)) { + SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "XcapStack_putDocument" "', argument " "5"" of type '" "char const *""'"); + } + arg5 = reinterpret_cast< char * >(buf5); + result = (bool)(arg1)->putDocument((char const *)arg2,(void const *)arg3,arg4,(char const *)arg5); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc5 == SWIG_NEWOBJ) delete[] buf5; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_putElement(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *arg3 = (void *) 0 ; + unsigned int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + unsigned int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapStack_putElement",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_putElement" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_putElement" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_putElement" "', argument " "3"" of type '" "void const *""'"); + } + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapStack_putElement" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + result = (bool)(arg1)->putElement((char const *)arg2,(void const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_putAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + char *arg2 = (char *) 0 ; + void *arg3 = (void *) 0 ; + unsigned int arg4 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + unsigned int val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapStack_putAttribute",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_putAttribute" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_putAttribute" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_putAttribute" "', argument " "3"" of type '" "void const *""'"); + } + ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapStack_putAttribute" "', argument " "4"" of type '" "unsigned int""'"); + } + arg4 = static_cast< unsigned int >(val4); + result = (bool)(arg1)->putAttribute((char const *)arg2,(void const *)arg3,arg4); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_XcapStack_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + XcapStack *arg1 = (XcapStack *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:XcapStack_stop",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_stop" "', argument " "1"" of type '" "XcapStack *""'"); + } + arg1 = reinterpret_cast< XcapStack * >(argp1); + result = (bool)(arg1)->stop(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *XcapStack_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_XcapStack, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_RPMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RPMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_RPMessage")) SWIG_fail; + result = (RPMessage *)new RPMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_RPMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RPMessage *arg1 = (RPMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_RPMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_RPMessage" "', argument " "1"" of type '" "RPMessage *""'"); + } + arg1 = reinterpret_cast< RPMessage * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RPMessage_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RPMessage *arg1 = (RPMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + twrap_rpmessage_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:RPMessage_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RPMessage_getType" "', argument " "1"" of type '" "RPMessage *""'"); + } + arg1 = reinterpret_cast< RPMessage * >(argp1); + result = (twrap_rpmessage_type_t)(arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RPMessage_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RPMessage *arg1 = (RPMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:RPMessage_getPayloadLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RPMessage_getPayloadLength" "', argument " "1"" of type '" "RPMessage *""'"); + } + arg1 = reinterpret_cast< RPMessage * >(argp1); + result = (unsigned int)(arg1)->getPayloadLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_RPMessage_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + RPMessage *arg1 = (RPMessage *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:RPMessage_getPayload",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RPMessage_getPayload" "', argument " "1"" of type '" "RPMessage *""'"); + } + arg1 = reinterpret_cast< RPMessage * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RPMessage_getPayload" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "RPMessage_getPayload" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getPayload(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *RPMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_RPMessage, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_SMSData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_SMSData")) SWIG_fail; + result = (SMSData *)new SMSData(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SMSData, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SMSData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SMSData",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SMSData" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSData_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + twrap_sms_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getType" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + result = (twrap_sms_type_t)(arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSData_getMR(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + int result; + + if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getMR",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getMR" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + result = (int)(arg1)->getMR(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSData_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getPayloadLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getPayloadLength" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + result = (unsigned int)(arg1)->getPayloadLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSData_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SMSData_getPayload",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getPayload" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSData_getPayload" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SMSData_getPayload" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getPayload(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSData_getOA(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getOA",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getOA" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + result = (char *)(arg1)->getOA(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSData_getDA(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSData *arg1 = (SMSData *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getDA",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getDA" "', argument " "1"" of type '" "SMSData *""'"); + } + arg1 = reinterpret_cast< SMSData * >(argp1); + result = (char *)(arg1)->getDA(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SMSData_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SMSData, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_SMSEncoder_encodeSubmit(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int arg1 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + int val1 ; + int ecode1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + RPMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeSubmit",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeSubmit" "', argument " "1"" of type '" "int""'"); + } + arg1 = static_cast< int >(val1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeSubmit" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeSubmit" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SMSEncoder_encodeSubmit" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (RPMessage *)SMSEncoder::encodeSubmit(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSEncoder_encodeDeliver(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int arg1 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + char *arg4 = (char *) 0 ; + int val1 ; + int ecode1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + int res4 ; + char *buf4 = 0 ; + int alloc4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + RPMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeDeliver",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeDeliver" "', argument " "1"" of type '" "int""'"); + } + arg1 = static_cast< int >(val1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeDeliver" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeDeliver" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4); + if (!SWIG_IsOK(res4)) { + SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SMSEncoder_encodeDeliver" "', argument " "4"" of type '" "char const *""'"); + } + arg4 = reinterpret_cast< char * >(buf4); + result = (RPMessage *)SMSEncoder::encodeDeliver(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + if (alloc4 == SWIG_NEWOBJ) delete[] buf4; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSEncoder_encodeACK(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int arg1 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + bool arg4 ; + int val1 ; + int ecode1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + bool val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + RPMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeACK",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeACK" "', argument " "1"" of type '" "int""'"); + } + arg1 = static_cast< int >(val1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeACK" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeACK" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_bool(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SMSEncoder_encodeACK" "', argument " "4"" of type '" "bool""'"); + } + arg4 = static_cast< bool >(val4); + result = (RPMessage *)SMSEncoder::encodeACK(arg1,(char const *)arg2,(char const *)arg3,arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSEncoder_encodeError(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + int arg1 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + bool arg4 ; + int val1 ; + int ecode1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + bool val4 ; + int ecode4 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + PyObject * obj3 = 0 ; + RPMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeError",&obj0,&obj1,&obj2,&obj3)) SWIG_fail; + ecode1 = SWIG_AsVal_int(obj0, &val1); + if (!SWIG_IsOK(ecode1)) { + SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeError" "', argument " "1"" of type '" "int""'"); + } + arg1 = static_cast< int >(val1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeError" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeError" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + ecode4 = SWIG_AsVal_bool(obj3, &val4); + if (!SWIG_IsOK(ecode4)) { + SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SMSEncoder_encodeError" "', argument " "4"" of type '" "bool""'"); + } + arg4 = static_cast< bool >(val4); + result = (RPMessage *)SMSEncoder::encodeError(arg1,(char const *)arg2,(char const *)arg3,arg4); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 ); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_SMSEncoder_decode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + void *arg1 = (void *) 0 ; + unsigned int arg2 ; + bool arg3 ; + int res1 ; + unsigned int val2 ; + int ecode2 = 0 ; + bool val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + SMSData *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:SMSEncoder_decode",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSEncoder_decode" "', argument " "1"" of type '" "void const *""'"); + } + ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2); + if (!SWIG_IsOK(ecode2)) { + SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SMSEncoder_decode" "', argument " "2"" of type '" "unsigned int""'"); + } + arg2 = static_cast< unsigned int >(val2); + ecode3 = SWIG_AsVal_bool(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SMSEncoder_decode" "', argument " "3"" of type '" "bool""'"); + } + arg3 = static_cast< bool >(val3); + result = (SMSData *)SMSEncoder::decode((void const *)arg1,arg2,arg3); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SMSData, SWIG_POINTER_OWN | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_SMSEncoder(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + SMSEncoder *arg1 = (SMSEncoder *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_SMSEncoder",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSEncoder, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SMSEncoder" "', argument " "1"" of type '" "SMSEncoder *""'"); + } + arg1 = reinterpret_cast< SMSEncoder * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *SMSEncoder_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_SMSEncoder, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_MsrpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)":new_MsrpMessage")) SWIG_fail; + result = (MsrpMessage *)new MsrpMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpMessage, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_MsrpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpMessage" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_isRequest(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isRequest",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isRequest" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (bool)(arg1)->isRequest(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + short result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getCode",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getCode" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (short)(arg1)->getCode(); + resultobj = SWIG_From_short(static_cast< short >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getPhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getPhrase",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getPhrase" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (char *)(arg1)->getPhrase(); + resultobj = SWIG_FromCharPtr((const char *)result); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getRequestType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tmsrp_request_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getRequestType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getRequestType" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (tmsrp_request_type_t)(arg1)->getRequestType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getByteRange(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + int64_t *arg2 = (int64_t *) 0 ; + int64_t *arg3 = (int64_t *) 0 ; + int64_t *arg4 = (int64_t *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int64_t temp2 ; + int res2 = SWIG_TMPOBJ ; + int64_t temp3 ; + int res3 = SWIG_TMPOBJ ; + int64_t temp4 ; + int res4 = SWIG_TMPOBJ ; + PyObject * obj0 = 0 ; + + arg2 = &temp2; + arg3 = &temp3; + arg4 = &temp4; + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getByteRange",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getByteRange" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + (arg1)->getByteRange(arg2,arg3,arg4); + resultobj = SWIG_Py_Void(); + if (SWIG_IsTmpObj(res2)) { + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_long_SS_long((*arg2))); + } else { + int new_flags = SWIG_IsNewObj(res2) ? (SWIG_POINTER_OWN | 0 ) : 0 ; + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg2), SWIGTYPE_p_long_long, new_flags)); + } + if (SWIG_IsTmpObj(res3)) { + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_long_SS_long((*arg3))); + } else { + int new_flags = SWIG_IsNewObj(res3) ? (SWIG_POINTER_OWN | 0 ) : 0 ; + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg3), SWIGTYPE_p_long_long, new_flags)); + } + if (SWIG_IsTmpObj(res4)) { + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_long_SS_long((*arg4))); + } else { + int new_flags = SWIG_IsNewObj(res4) ? (SWIG_POINTER_OWN | 0 ) : 0 ; + resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg4), SWIGTYPE_p_long_long, new_flags)); + } + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_isLastChunck(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isLastChunck",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isLastChunck" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (bool)(arg1)->isLastChunck(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_isFirstChunck(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isFirstChunck",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isFirstChunck" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (bool)(arg1)->isFirstChunck(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_isSuccessReport(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + bool result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isSuccessReport",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isSuccessReport" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (bool)(arg1)->isSuccessReport(); + resultobj = SWIG_From_bool(static_cast< bool >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpHeaderValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + char *arg2 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OO:MsrpMessage_getMsrpHeaderValue",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpHeaderValue" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpMessage_getMsrpHeaderValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + result = (char *)(arg1)->getMsrpHeaderValue((char const *)arg2); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpHeaderParamValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + char *arg2 = (char *) 0 ; + char *arg3 = (char *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + char *buf2 = 0 ; + int alloc2 = 0 ; + int res3 ; + char *buf3 = 0 ; + int alloc3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + char *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpMessage_getMsrpHeaderParamValue",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpHeaderParamValue" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpMessage_getMsrpHeaderParamValue" "', argument " "2"" of type '" "char const *""'"); + } + arg2 = reinterpret_cast< char * >(buf2); + res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3); + if (!SWIG_IsOK(res3)) { + SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MsrpMessage_getMsrpHeaderParamValue" "', argument " "3"" of type '" "char const *""'"); + } + arg3 = reinterpret_cast< char * >(buf3); + result = (char *)(arg1)->getMsrpHeaderParamValue((char const *)arg2,(char const *)arg3); + resultobj = SWIG_FromCharPtr((const char *)result); + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + delete[] result; + return resultobj; +fail: + if (alloc2 == SWIG_NEWOBJ) delete[] buf2; + if (alloc3 == SWIG_NEWOBJ) delete[] buf3; + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpContentLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getMsrpContentLength",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpContentLength" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + result = (unsigned int)(arg1)->getMsrpContentLength(); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpMessage *arg1 = (MsrpMessage *) 0 ; + void *arg2 = (void *) 0 ; + unsigned int arg3 ; + void *argp1 = 0 ; + int res1 = 0 ; + int res2 ; + unsigned int val3 ; + int ecode3 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + PyObject * obj2 = 0 ; + unsigned int result; + + if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpMessage_getMsrpContent",&obj0,&obj1,&obj2)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpContent" "', argument " "1"" of type '" "MsrpMessage *""'"); + } + arg1 = reinterpret_cast< MsrpMessage * >(argp1); + res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpMessage_getMsrpContent" "', argument " "2"" of type '" "void *""'"); + } + ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3); + if (!SWIG_IsOK(ecode3)) { + SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MsrpMessage_getMsrpContent" "', argument " "3"" of type '" "unsigned int""'"); + } + arg3 = static_cast< unsigned int >(val3); + result = (unsigned int)(arg1)->getMsrpContent(arg2,arg3); + resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *MsrpMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MsrpMessage, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_delete_MsrpEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpEvent *arg1 = (MsrpEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpEvent",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpEvent" "', argument " "1"" of type '" "MsrpEvent *""'"); + } + arg1 = reinterpret_cast< MsrpEvent * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpEvent *arg1 = (MsrpEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + tmsrp_event_type_t result; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpEvent_getType",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpEvent_getType" "', argument " "1"" of type '" "MsrpEvent *""'"); + } + arg1 = reinterpret_cast< MsrpEvent * >(argp1); + result = (tmsrp_event_type_t)(arg1)->getType(); + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpEvent_getSipSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpEvent *arg1 = (MsrpEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MsrpSession *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpEvent_getSipSession",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpEvent_getSipSession" "', argument " "1"" of type '" "MsrpEvent *""'"); + } + arg1 = reinterpret_cast< MsrpEvent * >(argp1); + result = (MsrpSession *)(arg1)->getSipSession(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpSession, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpEvent_getMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpEvent *arg1 = (MsrpEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + MsrpMessage *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:MsrpEvent_getMessage",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpEvent_getMessage" "', argument " "1"" of type '" "MsrpEvent const *""'"); + } + arg1 = reinterpret_cast< MsrpEvent * >(argp1); + result = (MsrpMessage *)((MsrpEvent const *)arg1)->getMessage(); + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpMessage, 0 | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *MsrpEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MsrpEvent, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +SWIGINTERN PyObject *_wrap_new_MsrpCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + PyObject *arg1 = (PyObject *) 0 ; + PyObject * obj0 = 0 ; + MsrpCallback *result = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:new_MsrpCallback",&obj0)) SWIG_fail; + arg1 = obj0; + if ( arg1 != Py_None ) { + /* subclassed */ + result = (MsrpCallback *)new SwigDirector_MsrpCallback(arg1); + } else { + result = (MsrpCallback *)new MsrpCallback(); + } + + resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpCallback, SWIG_POINTER_NEW | 0 ); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_delete_MsrpCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpCallback *arg1 = (MsrpCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpCallback, SWIG_POINTER_DISOWN | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpCallback" "', argument " "1"" of type '" "MsrpCallback *""'"); + } + arg1 = reinterpret_cast< MsrpCallback * >(argp1); + delete arg1; + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_MsrpCallback_OnEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpCallback *arg1 = (MsrpCallback *) 0 ; + MsrpEvent *arg2 = (MsrpEvent *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + void *argp2 = 0 ; + int res2 = 0 ; + PyObject * obj0 = 0 ; + PyObject * obj1 = 0 ; + Swig::Director *director = 0; + bool upcall = false; + int result; + + if (!PyArg_ParseTuple(args,(char *)"OO:MsrpCallback_OnEvent",&obj0,&obj1)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpCallback_OnEvent" "', argument " "1"" of type '" "MsrpCallback *""'"); + } + arg1 = reinterpret_cast< MsrpCallback * >(argp1); + res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MsrpEvent, 0 | 0 ); + if (!SWIG_IsOK(res2)) { + SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpCallback_OnEvent" "', argument " "2"" of type '" "MsrpEvent const *""'"); + } + arg2 = reinterpret_cast< MsrpEvent * >(argp2); + director = SWIG_DIRECTOR_CAST(arg1); + upcall = (director && (director->swig_get_self()==obj0)); + try { + if (upcall) { + result = (int)(arg1)->MsrpCallback::OnEvent((MsrpEvent const *)arg2); + } else { + result = (int)(arg1)->OnEvent((MsrpEvent const *)arg2); + } + } catch (Swig::DirectorException&) { + SWIG_fail; + } + resultobj = SWIG_From_int(static_cast< int >(result)); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *_wrap_disown_MsrpCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *resultobj = 0; + MsrpCallback *arg1 = (MsrpCallback *) 0 ; + void *argp1 = 0 ; + int res1 = 0 ; + PyObject * obj0 = 0 ; + + if (!PyArg_ParseTuple(args,(char *)"O:disown_MsrpCallback",&obj0)) SWIG_fail; + res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpCallback, 0 | 0 ); + if (!SWIG_IsOK(res1)) { + SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_MsrpCallback" "', argument " "1"" of type '" "MsrpCallback *""'"); + } + arg1 = reinterpret_cast< MsrpCallback * >(argp1); + { + Swig::Director *director = SWIG_DIRECTOR_CAST(arg1); + if (director) director->swig_disown(); + } + + resultobj = SWIG_Py_Void(); + return resultobj; +fail: + return NULL; +} + + +SWIGINTERN PyObject *MsrpCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) { + PyObject *obj; + if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL; + SWIG_TypeNewClientData(SWIGTYPE_p_MsrpCallback, SWIG_NewClientData(obj)); + return SWIG_Py_Void(); +} + +static PyMethodDef SwigMethods[] = { + { (char *)"SWIG_PyInstanceMethod_New", (PyCFunction)SWIG_PyInstanceMethod_New, METH_O, NULL}, + { (char *)"new_DDebugCallback", _wrap_new_DDebugCallback, METH_VARARGS, NULL}, + { (char *)"delete_DDebugCallback", _wrap_delete_DDebugCallback, METH_VARARGS, NULL}, + { (char *)"DDebugCallback_OnDebugInfo", _wrap_DDebugCallback_OnDebugInfo, METH_VARARGS, NULL}, + { (char *)"DDebugCallback_OnDebugWarn", _wrap_DDebugCallback_OnDebugWarn, METH_VARARGS, NULL}, + { (char *)"DDebugCallback_OnDebugError", _wrap_DDebugCallback_OnDebugError, METH_VARARGS, NULL}, + { (char *)"DDebugCallback_OnDebugFatal", _wrap_DDebugCallback_OnDebugFatal, METH_VARARGS, NULL}, + { (char *)"disown_DDebugCallback", _wrap_disown_DDebugCallback, METH_VARARGS, NULL}, + { (char *)"DDebugCallback_swigregister", DDebugCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"new_AudioResampler", _wrap_new_AudioResampler, METH_VARARGS, NULL}, + { (char *)"delete_AudioResampler", _wrap_delete_AudioResampler, METH_VARARGS, NULL}, + { (char *)"AudioResampler_isValid", _wrap_AudioResampler_isValid, METH_VARARGS, NULL}, + { (char *)"AudioResampler_getOutputRequiredSizeInShort", _wrap_AudioResampler_getOutputRequiredSizeInShort, METH_VARARGS, NULL}, + { (char *)"AudioResampler_getInputRequiredSizeInShort", _wrap_AudioResampler_getInputRequiredSizeInShort, METH_VARARGS, NULL}, + { (char *)"AudioResampler_process", _wrap_AudioResampler_process, METH_VARARGS, NULL}, + { (char *)"AudioResampler_swigregister", AudioResampler_swigregister, METH_VARARGS, NULL}, + { (char *)"new_ActionConfig", _wrap_new_ActionConfig, METH_VARARGS, NULL}, + { (char *)"delete_ActionConfig", _wrap_delete_ActionConfig, METH_VARARGS, NULL}, + { (char *)"ActionConfig_addHeader", _wrap_ActionConfig_addHeader, METH_VARARGS, NULL}, + { (char *)"ActionConfig_addPayload", _wrap_ActionConfig_addPayload, METH_VARARGS, NULL}, + { (char *)"ActionConfig_setActiveMedia", _wrap_ActionConfig_setActiveMedia, METH_VARARGS, NULL}, + { (char *)"ActionConfig_setResponseLine", _wrap_ActionConfig_setResponseLine, METH_VARARGS, NULL}, + { (char *)"ActionConfig_setMediaString", _wrap_ActionConfig_setMediaString, METH_VARARGS, NULL}, + { (char *)"ActionConfig_setMediaInt", _wrap_ActionConfig_setMediaInt, METH_VARARGS, NULL}, + { (char *)"ActionConfig_swigregister", ActionConfig_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_Codec", _wrap_delete_Codec, METH_VARARGS, NULL}, + { (char *)"Codec_getMediaType", _wrap_Codec_getMediaType, METH_VARARGS, NULL}, + { (char *)"Codec_getName", _wrap_Codec_getName, METH_VARARGS, NULL}, + { (char *)"Codec_getDescription", _wrap_Codec_getDescription, METH_VARARGS, NULL}, + { (char *)"Codec_getNegFormat", _wrap_Codec_getNegFormat, METH_VARARGS, NULL}, + { (char *)"Codec_getAudioSamplingRate", _wrap_Codec_getAudioSamplingRate, METH_VARARGS, NULL}, + { (char *)"Codec_getAudioChannels", _wrap_Codec_getAudioChannels, METH_VARARGS, NULL}, + { (char *)"Codec_getAudioPTime", _wrap_Codec_getAudioPTime, METH_VARARGS, NULL}, + { (char *)"Codec_swigregister", Codec_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_MediaSessionMgr", _wrap_delete_MediaSessionMgr, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_sessionSetInt32", _wrap_MediaSessionMgr_sessionSetInt32, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_sessionGetInt32", _wrap_MediaSessionMgr_sessionGetInt32, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_consumerSetInt32", _wrap_MediaSessionMgr_consumerSetInt32, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_consumerSetInt64", _wrap_MediaSessionMgr_consumerSetInt64, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_producerSetInt32", _wrap_MediaSessionMgr_producerSetInt32, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_producerSetInt64", _wrap_MediaSessionMgr_producerSetInt64, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_producerGetCodec", _wrap_MediaSessionMgr_producerGetCodec, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_findProxyPluginConsumer", _wrap_MediaSessionMgr_findProxyPluginConsumer, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_findProxyPluginProducer", _wrap_MediaSessionMgr_findProxyPluginProducer, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_registerAudioPluginFromFile", _wrap_MediaSessionMgr_registerAudioPluginFromFile, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_getSessionId", _wrap_MediaSessionMgr_getSessionId, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetProfile", _wrap_MediaSessionMgr_defaultsSetProfile, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetProfile", _wrap_MediaSessionMgr_defaultsGetProfile, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetBandwidthLevel", _wrap_MediaSessionMgr_defaultsSetBandwidthLevel, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetBandwidthLevel", _wrap_MediaSessionMgr_defaultsGetBandwidthLevel, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetCongestionCtrlEnabled", _wrap_MediaSessionMgr_defaultsSetCongestionCtrlEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetVideoMotionRank", _wrap_MediaSessionMgr_defaultsSetVideoMotionRank, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetVideoFps", _wrap_MediaSessionMgr_defaultsSetVideoFps, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetBandwidthVideoUploadMax", _wrap_MediaSessionMgr_defaultsSetBandwidthVideoUploadMax, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax", _wrap_MediaSessionMgr_defaultsSetBandwidthVideoDownloadMax, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetPrefVideoSize", _wrap_MediaSessionMgr_defaultsSetPrefVideoSize, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetJbMargin", _wrap_MediaSessionMgr_defaultsSetJbMargin, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetJbMaxLateRate", _wrap_MediaSessionMgr_defaultsSetJbMaxLateRate, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetEchoTail", _wrap_MediaSessionMgr_defaultsSetEchoTail, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetEchoTail", _wrap_MediaSessionMgr_defaultsGetEchoTail, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetEchoSkew", _wrap_MediaSessionMgr_defaultsSetEchoSkew, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetEchoSuppEnabled", _wrap_MediaSessionMgr_defaultsSetEchoSuppEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetEchoSuppEnabled", _wrap_MediaSessionMgr_defaultsGetEchoSuppEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAgcEnabled", _wrap_MediaSessionMgr_defaultsSetAgcEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetAgcEnabled", _wrap_MediaSessionMgr_defaultsGetAgcEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAgcLevel", _wrap_MediaSessionMgr_defaultsSetAgcLevel, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetAgcLevel", _wrap_MediaSessionMgr_defaultsGetAgcLevel, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetVadEnabled", _wrap_MediaSessionMgr_defaultsSetVadEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetGetVadEnabled", _wrap_MediaSessionMgr_defaultsGetGetVadEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetNoiseSuppEnabled", _wrap_MediaSessionMgr_defaultsSetNoiseSuppEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetNoiseSuppEnabled", _wrap_MediaSessionMgr_defaultsGetNoiseSuppEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetNoiseSuppLevel", _wrap_MediaSessionMgr_defaultsSetNoiseSuppLevel, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetNoiseSuppLevel", _wrap_MediaSessionMgr_defaultsGetNoiseSuppLevel, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSet100relEnabled", _wrap_MediaSessionMgr_defaultsSet100relEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGet100relEnabled", _wrap_MediaSessionMgr_defaultsGet100relEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetScreenSize", _wrap_MediaSessionMgr_defaultsSetScreenSize, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAudioGain", _wrap_MediaSessionMgr_defaultsSetAudioGain, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAudioPtime", _wrap_MediaSessionMgr_defaultsSetAudioPtime, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAudioChannels", _wrap_MediaSessionMgr_defaultsSetAudioChannels, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetRtpPortRange", _wrap_MediaSessionMgr_defaultsSetRtpPortRange, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetRtpSymetricEnabled", _wrap_MediaSessionMgr_defaultsSetRtpSymetricEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetMediaType", _wrap_MediaSessionMgr_defaultsSetMediaType, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetVolume", _wrap_MediaSessionMgr_defaultsSetVolume, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetVolume", _wrap_MediaSessionMgr_defaultsGetVolume, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetInviteSessionTimers", _wrap_MediaSessionMgr_defaultsSetInviteSessionTimers, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetSRtpMode", _wrap_MediaSessionMgr_defaultsSetSRtpMode, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetSRtpMode", _wrap_MediaSessionMgr_defaultsGetSRtpMode, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetSRtpType", _wrap_MediaSessionMgr_defaultsSetSRtpType, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetSRtpType", _wrap_MediaSessionMgr_defaultsGetSRtpType, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetRtcpEnabled", _wrap_MediaSessionMgr_defaultsSetRtcpEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetRtcpEnabled", _wrap_MediaSessionMgr_defaultsGetRtcpEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetRtcpMuxEnabled", _wrap_MediaSessionMgr_defaultsSetRtcpMuxEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetRtcpMuxEnabled", _wrap_MediaSessionMgr_defaultsGetRtcpMuxEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetStunEnabled", _wrap_MediaSessionMgr_defaultsSetStunEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetIceStunEnabled", _wrap_MediaSessionMgr_defaultsSetIceStunEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetIceTurnEnabled", _wrap_MediaSessionMgr_defaultsSetIceTurnEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetStunServer", _wrap_MediaSessionMgr_defaultsSetStunServer, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetStunCred", _wrap_MediaSessionMgr_defaultsSetStunCred, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetIceEnabled", _wrap_MediaSessionMgr_defaultsSetIceEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetByPassEncoding", _wrap_MediaSessionMgr_defaultsSetByPassEncoding, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetByPassEncoding", _wrap_MediaSessionMgr_defaultsGetByPassEncoding, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetByPassDecoding", _wrap_MediaSessionMgr_defaultsSetByPassDecoding, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetByPassDecoding", _wrap_MediaSessionMgr_defaultsGetByPassDecoding, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetVideoJbEnabled", _wrap_MediaSessionMgr_defaultsSetVideoJbEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetVideoJbEnabled", _wrap_MediaSessionMgr_defaultsGetVideoJbEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled", _wrap_MediaSessionMgr_defaultsSetVideoZeroArtifactsEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled", _wrap_MediaSessionMgr_defaultsGetVideoZeroArtifactsEnabled, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetRtpBuffSize", _wrap_MediaSessionMgr_defaultsSetRtpBuffSize, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsGetRtpBuffSize", _wrap_MediaSessionMgr_defaultsGetRtpBuffSize, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAvpfTail", _wrap_MediaSessionMgr_defaultsSetAvpfTail, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetAvpfMode", _wrap_MediaSessionMgr_defaultsSetAvpfMode, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetOpusMaxCaptureRate", _wrap_MediaSessionMgr_defaultsSetOpusMaxCaptureRate, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetOpusMaxPlaybackRate", _wrap_MediaSessionMgr_defaultsSetOpusMaxPlaybackRate, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_defaultsSetMaxFds", _wrap_MediaSessionMgr_defaultsSetMaxFds, METH_VARARGS, NULL}, + { (char *)"MediaSessionMgr_swigregister", MediaSessionMgr_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_MediaContent", _wrap_delete_MediaContent, METH_VARARGS, NULL}, + { (char *)"MediaContent_getType", _wrap_MediaContent_getType, METH_VARARGS, NULL}, + { (char *)"MediaContent_getDataLength", _wrap_MediaContent_getDataLength, METH_VARARGS, NULL}, + { (char *)"MediaContent_getData", _wrap_MediaContent_getData, METH_VARARGS, NULL}, + { (char *)"MediaContent_parse", _wrap_MediaContent_parse, METH_VARARGS, NULL}, + { (char *)"MediaContent_getPayloadLength", _wrap_MediaContent_getPayloadLength, METH_VARARGS, NULL}, + { (char *)"MediaContent_getPayload", _wrap_MediaContent_getPayload, METH_VARARGS, NULL}, + { (char *)"MediaContent_swigregister", MediaContent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_MediaContentCPIM", _wrap_delete_MediaContentCPIM, METH_VARARGS, NULL}, + { (char *)"MediaContentCPIM_getPayloadLength", _wrap_MediaContentCPIM_getPayloadLength, METH_VARARGS, NULL}, + { (char *)"MediaContentCPIM_getPayload", _wrap_MediaContentCPIM_getPayload, METH_VARARGS, NULL}, + { (char *)"MediaContentCPIM_getHeaderValue", _wrap_MediaContentCPIM_getHeaderValue, METH_VARARGS, NULL}, + { (char *)"MediaContentCPIM_swigregister", MediaContentCPIM_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SipUri", _wrap_new_SipUri, METH_VARARGS, NULL}, + { (char *)"delete_SipUri", _wrap_delete_SipUri, METH_VARARGS, NULL}, + { (char *)"SipUri_isValid", _wrap_SipUri_isValid, METH_VARARGS, NULL}, + { (char *)"SipUri_getScheme", _wrap_SipUri_getScheme, METH_VARARGS, NULL}, + { (char *)"SipUri_getHost", _wrap_SipUri_getHost, METH_VARARGS, NULL}, + { (char *)"SipUri_getPort", _wrap_SipUri_getPort, METH_VARARGS, NULL}, + { (char *)"SipUri_getUserName", _wrap_SipUri_getUserName, METH_VARARGS, NULL}, + { (char *)"SipUri_getPassword", _wrap_SipUri_getPassword, METH_VARARGS, NULL}, + { (char *)"SipUri_getDisplayName", _wrap_SipUri_getDisplayName, METH_VARARGS, NULL}, + { (char *)"SipUri_getParamValue", _wrap_SipUri_getParamValue, METH_VARARGS, NULL}, + { (char *)"SipUri_setDisplayName", _wrap_SipUri_setDisplayName, METH_VARARGS, NULL}, + { (char *)"SipUri_swigregister", SipUri_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SdpMessage", _wrap_new_SdpMessage, METH_VARARGS, NULL}, + { (char *)"delete_SdpMessage", _wrap_delete_SdpMessage, METH_VARARGS, NULL}, + { (char *)"SdpMessage_getSdpHeaderValue", _wrap_SdpMessage_getSdpHeaderValue, METH_VARARGS, NULL}, + { (char *)"SdpMessage_getSdpHeaderAValue", _wrap_SdpMessage_getSdpHeaderAValue, METH_VARARGS, NULL}, + { (char *)"SdpMessage_swigregister", SdpMessage_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SipMessage", _wrap_new_SipMessage, METH_VARARGS, NULL}, + { (char *)"delete_SipMessage", _wrap_delete_SipMessage, METH_VARARGS, NULL}, + { (char *)"SipMessage_isResponse", _wrap_SipMessage_isResponse, METH_VARARGS, NULL}, + { (char *)"SipMessage_getRequestType", _wrap_SipMessage_getRequestType, METH_VARARGS, NULL}, + { (char *)"SipMessage_getResponseCode", _wrap_SipMessage_getResponseCode, METH_VARARGS, NULL}, + { (char *)"SipMessage_getResponsePhrase", _wrap_SipMessage_getResponsePhrase, METH_VARARGS, NULL}, + { (char *)"SipMessage_getSipHeaderValue", _wrap_SipMessage_getSipHeaderValue, METH_VARARGS, NULL}, + { (char *)"SipMessage_getSipHeaderParamValue", _wrap_SipMessage_getSipHeaderParamValue, METH_VARARGS, NULL}, + { (char *)"SipMessage_getSipContentLength", _wrap_SipMessage_getSipContentLength, METH_VARARGS, NULL}, + { (char *)"SipMessage_getSipContent", _wrap_SipMessage_getSipContent, METH_VARARGS, NULL}, + { (char *)"SipMessage_getSdpMessage", _wrap_SipMessage_getSdpMessage, METH_VARARGS, NULL}, + { (char *)"SipMessage_swigregister", SipMessage_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_SipEvent", _wrap_delete_SipEvent, METH_VARARGS, NULL}, + { (char *)"SipEvent_getCode", _wrap_SipEvent_getCode, METH_VARARGS, NULL}, + { (char *)"SipEvent_getPhrase", _wrap_SipEvent_getPhrase, METH_VARARGS, NULL}, + { (char *)"SipEvent_getBaseSession", _wrap_SipEvent_getBaseSession, METH_VARARGS, NULL}, + { (char *)"SipEvent_getSipMessage", _wrap_SipEvent_getSipMessage, METH_VARARGS, NULL}, + { (char *)"SipEvent_swigregister", SipEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_DialogEvent", _wrap_delete_DialogEvent, METH_VARARGS, NULL}, + { (char *)"DialogEvent_swigregister", DialogEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_StackEvent", _wrap_delete_StackEvent, METH_VARARGS, NULL}, + { (char *)"StackEvent_swigregister", StackEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_InviteEvent", _wrap_delete_InviteEvent, METH_VARARGS, NULL}, + { (char *)"InviteEvent_getType", _wrap_InviteEvent_getType, METH_VARARGS, NULL}, + { (char *)"InviteEvent_getMediaType", _wrap_InviteEvent_getMediaType, METH_VARARGS, NULL}, + { (char *)"InviteEvent_getSession", _wrap_InviteEvent_getSession, METH_VARARGS, NULL}, + { (char *)"InviteEvent_takeCallSessionOwnership", _wrap_InviteEvent_takeCallSessionOwnership, METH_VARARGS, NULL}, + { (char *)"InviteEvent_takeMsrpSessionOwnership", _wrap_InviteEvent_takeMsrpSessionOwnership, METH_VARARGS, NULL}, + { (char *)"InviteEvent_swigregister", InviteEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_MessagingEvent", _wrap_delete_MessagingEvent, METH_VARARGS, NULL}, + { (char *)"MessagingEvent_getType", _wrap_MessagingEvent_getType, METH_VARARGS, NULL}, + { (char *)"MessagingEvent_getSession", _wrap_MessagingEvent_getSession, METH_VARARGS, NULL}, + { (char *)"MessagingEvent_takeSessionOwnership", _wrap_MessagingEvent_takeSessionOwnership, METH_VARARGS, NULL}, + { (char *)"MessagingEvent_swigregister", MessagingEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_InfoEvent", _wrap_delete_InfoEvent, METH_VARARGS, NULL}, + { (char *)"InfoEvent_getType", _wrap_InfoEvent_getType, METH_VARARGS, NULL}, + { (char *)"InfoEvent_getSession", _wrap_InfoEvent_getSession, METH_VARARGS, NULL}, + { (char *)"InfoEvent_takeSessionOwnership", _wrap_InfoEvent_takeSessionOwnership, METH_VARARGS, NULL}, + { (char *)"InfoEvent_swigregister", InfoEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_OptionsEvent", _wrap_delete_OptionsEvent, METH_VARARGS, NULL}, + { (char *)"OptionsEvent_getType", _wrap_OptionsEvent_getType, METH_VARARGS, NULL}, + { (char *)"OptionsEvent_getSession", _wrap_OptionsEvent_getSession, METH_VARARGS, NULL}, + { (char *)"OptionsEvent_takeSessionOwnership", _wrap_OptionsEvent_takeSessionOwnership, METH_VARARGS, NULL}, + { (char *)"OptionsEvent_swigregister", OptionsEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_PublicationEvent", _wrap_delete_PublicationEvent, METH_VARARGS, NULL}, + { (char *)"PublicationEvent_getType", _wrap_PublicationEvent_getType, METH_VARARGS, NULL}, + { (char *)"PublicationEvent_getSession", _wrap_PublicationEvent_getSession, METH_VARARGS, NULL}, + { (char *)"PublicationEvent_takeSessionOwnership", _wrap_PublicationEvent_takeSessionOwnership, METH_VARARGS, NULL}, + { (char *)"PublicationEvent_swigregister", PublicationEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_RegistrationEvent", _wrap_delete_RegistrationEvent, METH_VARARGS, NULL}, + { (char *)"RegistrationEvent_getType", _wrap_RegistrationEvent_getType, METH_VARARGS, NULL}, + { (char *)"RegistrationEvent_getSession", _wrap_RegistrationEvent_getSession, METH_VARARGS, NULL}, + { (char *)"RegistrationEvent_takeSessionOwnership", _wrap_RegistrationEvent_takeSessionOwnership, METH_VARARGS, NULL}, + { (char *)"RegistrationEvent_swigregister", RegistrationEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_SubscriptionEvent", _wrap_delete_SubscriptionEvent, METH_VARARGS, NULL}, + { (char *)"SubscriptionEvent_getType", _wrap_SubscriptionEvent_getType, METH_VARARGS, NULL}, + { (char *)"SubscriptionEvent_getSession", _wrap_SubscriptionEvent_getSession, METH_VARARGS, NULL}, + { (char *)"SubscriptionEvent_takeSessionOwnership", _wrap_SubscriptionEvent_takeSessionOwnership, METH_VARARGS, NULL}, + { (char *)"SubscriptionEvent_swigregister", SubscriptionEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_T140CallbackData", _wrap_delete_T140CallbackData, METH_VARARGS, NULL}, + { (char *)"T140CallbackData_getType", _wrap_T140CallbackData_getType, METH_VARARGS, NULL}, + { (char *)"T140CallbackData_getSize", _wrap_T140CallbackData_getSize, METH_VARARGS, NULL}, + { (char *)"T140CallbackData_getData", _wrap_T140CallbackData_getData, METH_VARARGS, NULL}, + { (char *)"T140CallbackData_swigregister", T140CallbackData_swigregister, METH_VARARGS, NULL}, + { (char *)"new_T140Callback", _wrap_new_T140Callback, METH_VARARGS, NULL}, + { (char *)"delete_T140Callback", _wrap_delete_T140Callback, METH_VARARGS, NULL}, + { (char *)"T140Callback_ondata", _wrap_T140Callback_ondata, METH_VARARGS, NULL}, + { (char *)"disown_T140Callback", _wrap_disown_T140Callback, METH_VARARGS, NULL}, + { (char *)"T140Callback_swigregister", T140Callback_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SipSession", _wrap_new_SipSession, METH_VARARGS, NULL}, + { (char *)"delete_SipSession", _wrap_delete_SipSession, METH_VARARGS, NULL}, + { (char *)"SipSession_haveOwnership", _wrap_SipSession_haveOwnership, METH_VARARGS, NULL}, + { (char *)"SipSession_addHeader", _wrap_SipSession_addHeader, METH_VARARGS, NULL}, + { (char *)"SipSession_removeHeader", _wrap_SipSession_removeHeader, METH_VARARGS, NULL}, + { (char *)"SipSession_addCaps", _wrap_SipSession_addCaps, METH_VARARGS, NULL}, + { (char *)"SipSession_removeCaps", _wrap_SipSession_removeCaps, METH_VARARGS, NULL}, + { (char *)"SipSession_setExpires", _wrap_SipSession_setExpires, METH_VARARGS, NULL}, + { (char *)"SipSession_setFromUri", _wrap_SipSession_setFromUri, METH_VARARGS, NULL}, + { (char *)"SipSession_setToUri", _wrap_SipSession_setToUri, METH_VARARGS, NULL}, + { (char *)"SipSession_setSilentHangup", _wrap_SipSession_setSilentHangup, METH_VARARGS, NULL}, + { (char *)"SipSession_addSigCompCompartment", _wrap_SipSession_addSigCompCompartment, METH_VARARGS, NULL}, + { (char *)"SipSession_removeSigCompCompartment", _wrap_SipSession_removeSigCompCompartment, METH_VARARGS, NULL}, + { (char *)"SipSession_getId", _wrap_SipSession_getId, METH_VARARGS, NULL}, + { (char *)"SipSession_swigregister", SipSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_InviteSession", _wrap_new_InviteSession, METH_VARARGS, NULL}, + { (char *)"delete_InviteSession", _wrap_delete_InviteSession, METH_VARARGS, NULL}, + { (char *)"InviteSession_accept", _wrap_InviteSession_accept, METH_VARARGS, NULL}, + { (char *)"InviteSession_hangup", _wrap_InviteSession_hangup, METH_VARARGS, NULL}, + { (char *)"InviteSession_reject", _wrap_InviteSession_reject, METH_VARARGS, NULL}, + { (char *)"InviteSession_sendInfo", _wrap_InviteSession_sendInfo, METH_VARARGS, NULL}, + { (char *)"InviteSession_getMediaMgr", _wrap_InviteSession_getMediaMgr, METH_VARARGS, NULL}, + { (char *)"InviteSession_swigregister", InviteSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_CallSession", _wrap_new_CallSession, METH_VARARGS, NULL}, + { (char *)"delete_CallSession", _wrap_delete_CallSession, METH_VARARGS, NULL}, + { (char *)"CallSession_callAudio", _wrap_CallSession_callAudio, METH_VARARGS, NULL}, + { (char *)"CallSession_callAudioVideo", _wrap_CallSession_callAudioVideo, METH_VARARGS, NULL}, + { (char *)"CallSession_callVideo", _wrap_CallSession_callVideo, METH_VARARGS, NULL}, + { (char *)"CallSession_call", _wrap_CallSession_call, METH_VARARGS, NULL}, + { (char *)"CallSession_setSessionTimer", _wrap_CallSession_setSessionTimer, METH_VARARGS, NULL}, + { (char *)"CallSession_set100rel", _wrap_CallSession_set100rel, METH_VARARGS, NULL}, + { (char *)"CallSession_setRtcp", _wrap_CallSession_setRtcp, METH_VARARGS, NULL}, + { (char *)"CallSession_setRtcpMux", _wrap_CallSession_setRtcpMux, METH_VARARGS, NULL}, + { (char *)"CallSession_setSRtpMode", _wrap_CallSession_setSRtpMode, METH_VARARGS, NULL}, + { (char *)"CallSession_setAvpfMode", _wrap_CallSession_setAvpfMode, METH_VARARGS, NULL}, + { (char *)"CallSession_setICE", _wrap_CallSession_setICE, METH_VARARGS, NULL}, + { (char *)"CallSession_setICEStun", _wrap_CallSession_setICEStun, METH_VARARGS, NULL}, + { (char *)"CallSession_setICETurn", _wrap_CallSession_setICETurn, METH_VARARGS, NULL}, + { (char *)"CallSession_setSTUNServer", _wrap_CallSession_setSTUNServer, METH_VARARGS, NULL}, + { (char *)"CallSession_setSTUNCred", _wrap_CallSession_setSTUNCred, METH_VARARGS, NULL}, + { (char *)"CallSession_setVideoFps", _wrap_CallSession_setVideoFps, METH_VARARGS, NULL}, + { (char *)"CallSession_setVideoBandwidthUploadMax", _wrap_CallSession_setVideoBandwidthUploadMax, METH_VARARGS, NULL}, + { (char *)"CallSession_setVideoBandwidthDownloadMax", _wrap_CallSession_setVideoBandwidthDownloadMax, METH_VARARGS, NULL}, + { (char *)"CallSession_setVideoPrefSize", _wrap_CallSession_setVideoPrefSize, METH_VARARGS, NULL}, + { (char *)"CallSession_setQoS", _wrap_CallSession_setQoS, METH_VARARGS, NULL}, + { (char *)"CallSession_hold", _wrap_CallSession_hold, METH_VARARGS, NULL}, + { (char *)"CallSession_resume", _wrap_CallSession_resume, METH_VARARGS, NULL}, + { (char *)"CallSession_transfer", _wrap_CallSession_transfer, METH_VARARGS, NULL}, + { (char *)"CallSession_acceptTransfer", _wrap_CallSession_acceptTransfer, METH_VARARGS, NULL}, + { (char *)"CallSession_rejectTransfer", _wrap_CallSession_rejectTransfer, METH_VARARGS, NULL}, + { (char *)"CallSession_sendDTMF", _wrap_CallSession_sendDTMF, METH_VARARGS, NULL}, + { (char *)"CallSession_getSessionTransferId", _wrap_CallSession_getSessionTransferId, METH_VARARGS, NULL}, + { (char *)"CallSession_sendT140Data", _wrap_CallSession_sendT140Data, METH_VARARGS, NULL}, + { (char *)"CallSession_setT140Callback", _wrap_CallSession_setT140Callback, METH_VARARGS, NULL}, + { (char *)"CallSession_swigregister", CallSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_MsrpSession", _wrap_new_MsrpSession, METH_VARARGS, NULL}, + { (char *)"delete_MsrpSession", _wrap_delete_MsrpSession, METH_VARARGS, NULL}, + { (char *)"MsrpSession_setCallback", _wrap_MsrpSession_setCallback, METH_VARARGS, NULL}, + { (char *)"MsrpSession_callMsrp", _wrap_MsrpSession_callMsrp, METH_VARARGS, NULL}, + { (char *)"MsrpSession_sendMessage", _wrap_MsrpSession_sendMessage, METH_VARARGS, NULL}, + { (char *)"MsrpSession_sendFile", _wrap_MsrpSession_sendFile, METH_VARARGS, NULL}, + { (char *)"MsrpSession_swigregister", MsrpSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_MessagingSession", _wrap_new_MessagingSession, METH_VARARGS, NULL}, + { (char *)"delete_MessagingSession", _wrap_delete_MessagingSession, METH_VARARGS, NULL}, + { (char *)"MessagingSession_send", _wrap_MessagingSession_send, METH_VARARGS, NULL}, + { (char *)"MessagingSession_accept", _wrap_MessagingSession_accept, METH_VARARGS, NULL}, + { (char *)"MessagingSession_reject", _wrap_MessagingSession_reject, METH_VARARGS, NULL}, + { (char *)"MessagingSession_swigregister", MessagingSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_InfoSession", _wrap_new_InfoSession, METH_VARARGS, NULL}, + { (char *)"delete_InfoSession", _wrap_delete_InfoSession, METH_VARARGS, NULL}, + { (char *)"InfoSession_send", _wrap_InfoSession_send, METH_VARARGS, NULL}, + { (char *)"InfoSession_accept", _wrap_InfoSession_accept, METH_VARARGS, NULL}, + { (char *)"InfoSession_reject", _wrap_InfoSession_reject, METH_VARARGS, NULL}, + { (char *)"InfoSession_swigregister", InfoSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_OptionsSession", _wrap_new_OptionsSession, METH_VARARGS, NULL}, + { (char *)"delete_OptionsSession", _wrap_delete_OptionsSession, METH_VARARGS, NULL}, + { (char *)"OptionsSession_send", _wrap_OptionsSession_send, METH_VARARGS, NULL}, + { (char *)"OptionsSession_accept", _wrap_OptionsSession_accept, METH_VARARGS, NULL}, + { (char *)"OptionsSession_reject", _wrap_OptionsSession_reject, METH_VARARGS, NULL}, + { (char *)"OptionsSession_swigregister", OptionsSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_PublicationSession", _wrap_new_PublicationSession, METH_VARARGS, NULL}, + { (char *)"delete_PublicationSession", _wrap_delete_PublicationSession, METH_VARARGS, NULL}, + { (char *)"PublicationSession_publish", _wrap_PublicationSession_publish, METH_VARARGS, NULL}, + { (char *)"PublicationSession_unPublish", _wrap_PublicationSession_unPublish, METH_VARARGS, NULL}, + { (char *)"PublicationSession_swigregister", PublicationSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_RegistrationSession", _wrap_new_RegistrationSession, METH_VARARGS, NULL}, + { (char *)"delete_RegistrationSession", _wrap_delete_RegistrationSession, METH_VARARGS, NULL}, + { (char *)"RegistrationSession_register_", _wrap_RegistrationSession_register_, METH_VARARGS, NULL}, + { (char *)"RegistrationSession_unRegister", _wrap_RegistrationSession_unRegister, METH_VARARGS, NULL}, + { (char *)"RegistrationSession_accept", _wrap_RegistrationSession_accept, METH_VARARGS, NULL}, + { (char *)"RegistrationSession_reject", _wrap_RegistrationSession_reject, METH_VARARGS, NULL}, + { (char *)"RegistrationSession_swigregister", RegistrationSession_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SubscriptionSession", _wrap_new_SubscriptionSession, METH_VARARGS, NULL}, + { (char *)"delete_SubscriptionSession", _wrap_delete_SubscriptionSession, METH_VARARGS, NULL}, + { (char *)"SubscriptionSession_subscribe", _wrap_SubscriptionSession_subscribe, METH_VARARGS, NULL}, + { (char *)"SubscriptionSession_unSubscribe", _wrap_SubscriptionSession_unSubscribe, METH_VARARGS, NULL}, + { (char *)"SubscriptionSession_swigregister", SubscriptionSession_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyPluginMgr", _wrap_delete_ProxyPluginMgr, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_createInstance", _wrap_ProxyPluginMgr_createInstance, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_getInstance", _wrap_ProxyPluginMgr_getInstance, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_findPlugin", _wrap_ProxyPluginMgr_findPlugin, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_findAudioConsumer", _wrap_ProxyPluginMgr_findAudioConsumer, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_findVideoConsumer", _wrap_ProxyPluginMgr_findVideoConsumer, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_findAudioProducer", _wrap_ProxyPluginMgr_findAudioProducer, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_findVideoProducer", _wrap_ProxyPluginMgr_findVideoProducer, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgr_swigregister", ProxyPluginMgr_swigregister, METH_VARARGS, NULL}, + { (char *)"new_ProxyPluginMgrCallback", _wrap_new_ProxyPluginMgrCallback, METH_VARARGS, NULL}, + { (char *)"delete_ProxyPluginMgrCallback", _wrap_delete_ProxyPluginMgrCallback, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgrCallback_OnPluginCreated", _wrap_ProxyPluginMgrCallback_OnPluginCreated, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgrCallback_OnPluginDestroyed", _wrap_ProxyPluginMgrCallback_OnPluginDestroyed, METH_VARARGS, NULL}, + { (char *)"disown_ProxyPluginMgrCallback", _wrap_disown_ProxyPluginMgrCallback, METH_VARARGS, NULL}, + { (char *)"ProxyPluginMgrCallback_swigregister", ProxyPluginMgrCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyPlugin", _wrap_delete_ProxyPlugin, METH_VARARGS, NULL}, + { (char *)"ProxyPlugin_getType", _wrap_ProxyPlugin_getType, METH_VARARGS, NULL}, + { (char *)"ProxyPlugin_getId", _wrap_ProxyPlugin_getId, METH_VARARGS, NULL}, + { (char *)"ProxyPlugin_swigregister", ProxyPlugin_swigregister, METH_VARARGS, NULL}, + { (char *)"new_ProxyAudioConsumerCallback", _wrap_new_ProxyAudioConsumerCallback, METH_VARARGS, NULL}, + { (char *)"delete_ProxyAudioConsumerCallback", _wrap_delete_ProxyAudioConsumerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumerCallback_prepare", _wrap_ProxyAudioConsumerCallback_prepare, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumerCallback_start", _wrap_ProxyAudioConsumerCallback_start, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumerCallback_pause", _wrap_ProxyAudioConsumerCallback_pause, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumerCallback_stop", _wrap_ProxyAudioConsumerCallback_stop, METH_VARARGS, NULL}, + { (char *)"disown_ProxyAudioConsumerCallback", _wrap_disown_ProxyAudioConsumerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumerCallback_swigregister", ProxyAudioConsumerCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyAudioConsumer", _wrap_delete_ProxyAudioConsumer, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_setActualSndCardPlaybackParams", _wrap_ProxyAudioConsumer_setActualSndCardPlaybackParams, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_queryForResampler", _wrap_ProxyAudioConsumer_queryForResampler, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_setPullBuffer", _wrap_ProxyAudioConsumer_setPullBuffer, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_pull", _wrap_ProxyAudioConsumer_pull, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_setGain", _wrap_ProxyAudioConsumer_setGain, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_getGain", _wrap_ProxyAudioConsumer_getGain, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_reset", _wrap_ProxyAudioConsumer_reset, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_setCallback", _wrap_ProxyAudioConsumer_setCallback, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_getMediaSessionId", _wrap_ProxyAudioConsumer_getMediaSessionId, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_registerPlugin", _wrap_ProxyAudioConsumer_registerPlugin, METH_VARARGS, NULL}, + { (char *)"ProxyAudioConsumer_swigregister", ProxyAudioConsumer_swigregister, METH_VARARGS, NULL}, + { (char *)"new_ProxyVideoConsumerCallback", _wrap_new_ProxyVideoConsumerCallback, METH_VARARGS, NULL}, + { (char *)"delete_ProxyVideoConsumerCallback", _wrap_delete_ProxyVideoConsumerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_prepare", _wrap_ProxyVideoConsumerCallback_prepare, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_consume", _wrap_ProxyVideoConsumerCallback_consume, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_bufferCopied", _wrap_ProxyVideoConsumerCallback_bufferCopied, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_start", _wrap_ProxyVideoConsumerCallback_start, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_pause", _wrap_ProxyVideoConsumerCallback_pause, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_stop", _wrap_ProxyVideoConsumerCallback_stop, METH_VARARGS, NULL}, + { (char *)"disown_ProxyVideoConsumerCallback", _wrap_disown_ProxyVideoConsumerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumerCallback_swigregister", ProxyVideoConsumerCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyVideoConsumer", _wrap_delete_ProxyVideoConsumer, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_setDisplaySize", _wrap_ProxyVideoConsumer_setDisplaySize, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_getDisplayWidth", _wrap_ProxyVideoConsumer_getDisplayWidth, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_getDisplayHeight", _wrap_ProxyVideoConsumer_getDisplayHeight, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_getDecodedWidth", _wrap_ProxyVideoConsumer_getDecodedWidth, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_getDecodedHeight", _wrap_ProxyVideoConsumer_getDecodedHeight, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_setCallback", _wrap_ProxyVideoConsumer_setCallback, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_setAutoResizeDisplay", _wrap_ProxyVideoConsumer_setAutoResizeDisplay, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_getAutoResizeDisplay", _wrap_ProxyVideoConsumer_getAutoResizeDisplay, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_setConsumeBuffer", _wrap_ProxyVideoConsumer_setConsumeBuffer, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_pull", _wrap_ProxyVideoConsumer_pull, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_reset", _wrap_ProxyVideoConsumer_reset, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_getMediaSessionId", _wrap_ProxyVideoConsumer_getMediaSessionId, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_registerPlugin", _wrap_ProxyVideoConsumer_registerPlugin, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_setDefaultChroma", _wrap_ProxyVideoConsumer_setDefaultChroma, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_setDefaultAutoResizeDisplay", _wrap_ProxyVideoConsumer_setDefaultAutoResizeDisplay, METH_VARARGS, NULL}, + { (char *)"ProxyVideoConsumer_swigregister", ProxyVideoConsumer_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyVideoFrame", _wrap_delete_ProxyVideoFrame, METH_VARARGS, NULL}, + { (char *)"ProxyVideoFrame_getSize", _wrap_ProxyVideoFrame_getSize, METH_VARARGS, NULL}, + { (char *)"ProxyVideoFrame_getContent", _wrap_ProxyVideoFrame_getContent, METH_VARARGS, NULL}, + { (char *)"ProxyVideoFrame_getFrameWidth", _wrap_ProxyVideoFrame_getFrameWidth, METH_VARARGS, NULL}, + { (char *)"ProxyVideoFrame_getFrameHeight", _wrap_ProxyVideoFrame_getFrameHeight, METH_VARARGS, NULL}, + { (char *)"ProxyVideoFrame_swigregister", ProxyVideoFrame_swigregister, METH_VARARGS, NULL}, + { (char *)"new_ProxyAudioProducerCallback", _wrap_new_ProxyAudioProducerCallback, METH_VARARGS, NULL}, + { (char *)"delete_ProxyAudioProducerCallback", _wrap_delete_ProxyAudioProducerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducerCallback_prepare", _wrap_ProxyAudioProducerCallback_prepare, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducerCallback_start", _wrap_ProxyAudioProducerCallback_start, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducerCallback_pause", _wrap_ProxyAudioProducerCallback_pause, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducerCallback_stop", _wrap_ProxyAudioProducerCallback_stop, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducerCallback_fillPushBuffer", _wrap_ProxyAudioProducerCallback_fillPushBuffer, METH_VARARGS, NULL}, + { (char *)"disown_ProxyAudioProducerCallback", _wrap_disown_ProxyAudioProducerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducerCallback_swigregister", ProxyAudioProducerCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyAudioProducer", _wrap_delete_ProxyAudioProducer, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_setActualSndCardRecordParams", _wrap_ProxyAudioProducer_setActualSndCardRecordParams, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_setPushBuffer", _wrap_ProxyAudioProducer_setPushBuffer, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_push", _wrap_ProxyAudioProducer_push, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_setGain", _wrap_ProxyAudioProducer_setGain, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_getGain", _wrap_ProxyAudioProducer_getGain, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_setCallback", _wrap_ProxyAudioProducer_setCallback, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_getMediaSessionId", _wrap_ProxyAudioProducer_getMediaSessionId, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_registerPlugin", _wrap_ProxyAudioProducer_registerPlugin, METH_VARARGS, NULL}, + { (char *)"ProxyAudioProducer_swigregister", ProxyAudioProducer_swigregister, METH_VARARGS, NULL}, + { (char *)"new_ProxyVideoProducerCallback", _wrap_new_ProxyVideoProducerCallback, METH_VARARGS, NULL}, + { (char *)"delete_ProxyVideoProducerCallback", _wrap_delete_ProxyVideoProducerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducerCallback_prepare", _wrap_ProxyVideoProducerCallback_prepare, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducerCallback_start", _wrap_ProxyVideoProducerCallback_start, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducerCallback_pause", _wrap_ProxyVideoProducerCallback_pause, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducerCallback_stop", _wrap_ProxyVideoProducerCallback_stop, METH_VARARGS, NULL}, + { (char *)"disown_ProxyVideoProducerCallback", _wrap_disown_ProxyVideoProducerCallback, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducerCallback_swigregister", ProxyVideoProducerCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_ProxyVideoProducer", _wrap_delete_ProxyVideoProducer, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_getRotation", _wrap_ProxyVideoProducer_getRotation, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_setRotation", _wrap_ProxyVideoProducer_setRotation, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_getMirror", _wrap_ProxyVideoProducer_getMirror, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_setMirror", _wrap_ProxyVideoProducer_setMirror, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_setActualCameraOutputSize", _wrap_ProxyVideoProducer_setActualCameraOutputSize, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_push", _wrap_ProxyVideoProducer_push, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_setCallback", _wrap_ProxyVideoProducer_setCallback, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_getMediaSessionId", _wrap_ProxyVideoProducer_getMediaSessionId, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_registerPlugin", _wrap_ProxyVideoProducer_registerPlugin, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_setDefaultChroma", _wrap_ProxyVideoProducer_setDefaultChroma, METH_VARARGS, NULL}, + { (char *)"ProxyVideoProducer_swigregister", ProxyVideoProducer_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SipCallback", _wrap_new_SipCallback, METH_VARARGS, NULL}, + { (char *)"delete_SipCallback", _wrap_delete_SipCallback, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnDialogEvent", _wrap_SipCallback_OnDialogEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnStackEvent", _wrap_SipCallback_OnStackEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnInviteEvent", _wrap_SipCallback_OnInviteEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnMessagingEvent", _wrap_SipCallback_OnMessagingEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnInfoEvent", _wrap_SipCallback_OnInfoEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnOptionsEvent", _wrap_SipCallback_OnOptionsEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnPublicationEvent", _wrap_SipCallback_OnPublicationEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnRegistrationEvent", _wrap_SipCallback_OnRegistrationEvent, METH_VARARGS, NULL}, + { (char *)"SipCallback_OnSubscriptionEvent", _wrap_SipCallback_OnSubscriptionEvent, METH_VARARGS, NULL}, + { (char *)"disown_SipCallback", _wrap_disown_SipCallback, METH_VARARGS, NULL}, + { (char *)"SipCallback_swigregister", SipCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SafeObject", _wrap_new_SafeObject, METH_VARARGS, NULL}, + { (char *)"delete_SafeObject", _wrap_delete_SafeObject, METH_VARARGS, NULL}, + { (char *)"SafeObject_Lock", _wrap_SafeObject_Lock, METH_VARARGS, NULL}, + { (char *)"SafeObject_UnLock", _wrap_SafeObject_UnLock, METH_VARARGS, NULL}, + { (char *)"SafeObject_swigregister", SafeObject_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SipStack", _wrap_new_SipStack, METH_VARARGS, NULL}, + { (char *)"delete_SipStack", _wrap_delete_SipStack, METH_VARARGS, NULL}, + { (char *)"SipStack_start", _wrap_SipStack_start, METH_VARARGS, NULL}, + { (char *)"SipStack_setDebugCallback", _wrap_SipStack_setDebugCallback, METH_VARARGS, NULL}, + { (char *)"SipStack_setDisplayName", _wrap_SipStack_setDisplayName, METH_VARARGS, NULL}, + { (char *)"SipStack_setRealm", _wrap_SipStack_setRealm, METH_VARARGS, NULL}, + { (char *)"SipStack_setIMPI", _wrap_SipStack_setIMPI, METH_VARARGS, NULL}, + { (char *)"SipStack_setIMPU", _wrap_SipStack_setIMPU, METH_VARARGS, NULL}, + { (char *)"SipStack_setPassword", _wrap_SipStack_setPassword, METH_VARARGS, NULL}, + { (char *)"SipStack_setAMF", _wrap_SipStack_setAMF, METH_VARARGS, NULL}, + { (char *)"SipStack_setOperatorId", _wrap_SipStack_setOperatorId, METH_VARARGS, NULL}, + { (char *)"SipStack_setProxyCSCF", _wrap_SipStack_setProxyCSCF, METH_VARARGS, NULL}, + { (char *)"SipStack_setLocalIP", _wrap_SipStack_setLocalIP, METH_VARARGS, NULL}, + { (char *)"SipStack_setLocalPort", _wrap_SipStack_setLocalPort, METH_VARARGS, NULL}, + { (char *)"SipStack_setEarlyIMS", _wrap_SipStack_setEarlyIMS, METH_VARARGS, NULL}, + { (char *)"SipStack_addHeader", _wrap_SipStack_addHeader, METH_VARARGS, NULL}, + { (char *)"SipStack_removeHeader", _wrap_SipStack_removeHeader, METH_VARARGS, NULL}, + { (char *)"SipStack_addDnsServer", _wrap_SipStack_addDnsServer, METH_VARARGS, NULL}, + { (char *)"SipStack_setDnsDiscovery", _wrap_SipStack_setDnsDiscovery, METH_VARARGS, NULL}, + { (char *)"SipStack_setAoR", _wrap_SipStack_setAoR, METH_VARARGS, NULL}, + { (char *)"SipStack_setSigCompParams", _wrap_SipStack_setSigCompParams, METH_VARARGS, NULL}, + { (char *)"SipStack_addSigCompCompartment", _wrap_SipStack_addSigCompCompartment, METH_VARARGS, NULL}, + { (char *)"SipStack_removeSigCompCompartment", _wrap_SipStack_removeSigCompCompartment, METH_VARARGS, NULL}, + { (char *)"SipStack_setSTUNEnabledForICE", _wrap_SipStack_setSTUNEnabledForICE, METH_VARARGS, NULL}, + { (char *)"SipStack_setSTUNServer", _wrap_SipStack_setSTUNServer, METH_VARARGS, NULL}, + { (char *)"SipStack_setSTUNCred", _wrap_SipStack_setSTUNCred, METH_VARARGS, NULL}, + { (char *)"SipStack_setSTUNEnabled", _wrap_SipStack_setSTUNEnabled, METH_VARARGS, NULL}, + { (char *)"SipStack_setTLSSecAgree", _wrap_SipStack_setTLSSecAgree, METH_VARARGS, NULL}, + { (char *)"SipStack_setSSLCertificates", _wrap_SipStack_setSSLCertificates, METH_VARARGS, NULL}, + { (char *)"SipStack_setSSLCretificates", _wrap_SipStack_setSSLCretificates, METH_VARARGS, NULL}, + { (char *)"SipStack_setIPSecSecAgree", _wrap_SipStack_setIPSecSecAgree, METH_VARARGS, NULL}, + { (char *)"SipStack_setIPSecParameters", _wrap_SipStack_setIPSecParameters, METH_VARARGS, NULL}, + { (char *)"SipStack_dnsENUM", _wrap_SipStack_dnsENUM, METH_VARARGS, NULL}, + { (char *)"SipStack_dnsNaptrSrv", _wrap_SipStack_dnsNaptrSrv, METH_VARARGS, NULL}, + { (char *)"SipStack_dnsSrv", _wrap_SipStack_dnsSrv, METH_VARARGS, NULL}, + { (char *)"SipStack_setMaxFDs", _wrap_SipStack_setMaxFDs, METH_VARARGS, NULL}, + { (char *)"SipStack_getLocalIPnPort", _wrap_SipStack_getLocalIPnPort, METH_VARARGS, NULL}, + { (char *)"SipStack_getPreferredIdentity", _wrap_SipStack_getPreferredIdentity, METH_VARARGS, NULL}, + { (char *)"SipStack_isValid", _wrap_SipStack_isValid, METH_VARARGS, NULL}, + { (char *)"SipStack_stop", _wrap_SipStack_stop, METH_VARARGS, NULL}, + { (char *)"SipStack_initialize", _wrap_SipStack_initialize, METH_VARARGS, NULL}, + { (char *)"SipStack_deInitialize", _wrap_SipStack_deInitialize, METH_VARARGS, NULL}, + { (char *)"SipStack_setCodecs", _wrap_SipStack_setCodecs, METH_VARARGS, NULL}, + { (char *)"SipStack_setCodecs_2", _wrap_SipStack_setCodecs_2, METH_VARARGS, NULL}, + { (char *)"SipStack_setCodecPriority", _wrap_SipStack_setCodecPriority, METH_VARARGS, NULL}, + { (char *)"SipStack_setCodecPriority_2", _wrap_SipStack_setCodecPriority_2, METH_VARARGS, NULL}, + { (char *)"SipStack_isCodecSupported", _wrap_SipStack_isCodecSupported, METH_VARARGS, NULL}, + { (char *)"SipStack_isIPSecSupported", _wrap_SipStack_isIPSecSupported, METH_VARARGS, NULL}, + { (char *)"SipStack_swigregister", SipStack_swigregister, METH_VARARGS, NULL}, + { (char *)"new_XcapSelector", _wrap_new_XcapSelector, METH_VARARGS, NULL}, + { (char *)"delete_XcapSelector", _wrap_delete_XcapSelector, METH_VARARGS, NULL}, + { (char *)"XcapSelector_setAUID", _wrap_XcapSelector_setAUID, METH_VARARGS, NULL}, + { (char *)"XcapSelector_setName", _wrap_XcapSelector_setName, METH_VARARGS, NULL}, + { (char *)"XcapSelector_setAttribute", _wrap_XcapSelector_setAttribute, METH_VARARGS, NULL}, + { (char *)"XcapSelector_setPos", _wrap_XcapSelector_setPos, METH_VARARGS, NULL}, + { (char *)"XcapSelector_setPosAttribute", _wrap_XcapSelector_setPosAttribute, METH_VARARGS, NULL}, + { (char *)"XcapSelector_setNamespace", _wrap_XcapSelector_setNamespace, METH_VARARGS, NULL}, + { (char *)"XcapSelector_getString", _wrap_XcapSelector_getString, METH_VARARGS, NULL}, + { (char *)"XcapSelector_reset", _wrap_XcapSelector_reset, METH_VARARGS, NULL}, + { (char *)"XcapSelector_swigregister", XcapSelector_swigregister, METH_VARARGS, NULL}, + { (char *)"new_XcapMessage", _wrap_new_XcapMessage, METH_VARARGS, NULL}, + { (char *)"delete_XcapMessage", _wrap_delete_XcapMessage, METH_VARARGS, NULL}, + { (char *)"XcapMessage_getCode", _wrap_XcapMessage_getCode, METH_VARARGS, NULL}, + { (char *)"XcapMessage_getPhrase", _wrap_XcapMessage_getPhrase, METH_VARARGS, NULL}, + { (char *)"XcapMessage_getXcapHeaderValue", _wrap_XcapMessage_getXcapHeaderValue, METH_VARARGS, NULL}, + { (char *)"XcapMessage_getXcapHeaderParamValue", _wrap_XcapMessage_getXcapHeaderParamValue, METH_VARARGS, NULL}, + { (char *)"XcapMessage_getXcapContentLength", _wrap_XcapMessage_getXcapContentLength, METH_VARARGS, NULL}, + { (char *)"XcapMessage_getXcapContent", _wrap_XcapMessage_getXcapContent, METH_VARARGS, NULL}, + { (char *)"XcapMessage_swigregister", XcapMessage_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_XcapEvent", _wrap_delete_XcapEvent, METH_VARARGS, NULL}, + { (char *)"XcapEvent_getType", _wrap_XcapEvent_getType, METH_VARARGS, NULL}, + { (char *)"XcapEvent_getXcapMessage", _wrap_XcapEvent_getXcapMessage, METH_VARARGS, NULL}, + { (char *)"XcapEvent_swigregister", XcapEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"new_XcapCallback", _wrap_new_XcapCallback, METH_VARARGS, NULL}, + { (char *)"delete_XcapCallback", _wrap_delete_XcapCallback, METH_VARARGS, NULL}, + { (char *)"XcapCallback_onEvent", _wrap_XcapCallback_onEvent, METH_VARARGS, NULL}, + { (char *)"disown_XcapCallback", _wrap_disown_XcapCallback, METH_VARARGS, NULL}, + { (char *)"XcapCallback_swigregister", XcapCallback_swigregister, METH_VARARGS, NULL}, + { (char *)"new_XcapStack", _wrap_new_XcapStack, METH_VARARGS, NULL}, + { (char *)"delete_XcapStack", _wrap_delete_XcapStack, METH_VARARGS, NULL}, + { (char *)"XcapStack_registerAUID", _wrap_XcapStack_registerAUID, METH_VARARGS, NULL}, + { (char *)"XcapStack_start", _wrap_XcapStack_start, METH_VARARGS, NULL}, + { (char *)"XcapStack_setCredentials", _wrap_XcapStack_setCredentials, METH_VARARGS, NULL}, + { (char *)"XcapStack_setXcapRoot", _wrap_XcapStack_setXcapRoot, METH_VARARGS, NULL}, + { (char *)"XcapStack_setLocalIP", _wrap_XcapStack_setLocalIP, METH_VARARGS, NULL}, + { (char *)"XcapStack_setLocalPort", _wrap_XcapStack_setLocalPort, METH_VARARGS, NULL}, + { (char *)"XcapStack_addHeader", _wrap_XcapStack_addHeader, METH_VARARGS, NULL}, + { (char *)"XcapStack_removeHeader", _wrap_XcapStack_removeHeader, METH_VARARGS, NULL}, + { (char *)"XcapStack_setTimeout", _wrap_XcapStack_setTimeout, METH_VARARGS, NULL}, + { (char *)"XcapStack_getDocument", _wrap_XcapStack_getDocument, METH_VARARGS, NULL}, + { (char *)"XcapStack_getElement", _wrap_XcapStack_getElement, METH_VARARGS, NULL}, + { (char *)"XcapStack_getAttribute", _wrap_XcapStack_getAttribute, METH_VARARGS, NULL}, + { (char *)"XcapStack_deleteDocument", _wrap_XcapStack_deleteDocument, METH_VARARGS, NULL}, + { (char *)"XcapStack_deleteElement", _wrap_XcapStack_deleteElement, METH_VARARGS, NULL}, + { (char *)"XcapStack_deleteAttribute", _wrap_XcapStack_deleteAttribute, METH_VARARGS, NULL}, + { (char *)"XcapStack_putDocument", _wrap_XcapStack_putDocument, METH_VARARGS, NULL}, + { (char *)"XcapStack_putElement", _wrap_XcapStack_putElement, METH_VARARGS, NULL}, + { (char *)"XcapStack_putAttribute", _wrap_XcapStack_putAttribute, METH_VARARGS, NULL}, + { (char *)"XcapStack_stop", _wrap_XcapStack_stop, METH_VARARGS, NULL}, + { (char *)"XcapStack_swigregister", XcapStack_swigregister, METH_VARARGS, NULL}, + { (char *)"new_RPMessage", _wrap_new_RPMessage, METH_VARARGS, NULL}, + { (char *)"delete_RPMessage", _wrap_delete_RPMessage, METH_VARARGS, NULL}, + { (char *)"RPMessage_getType", _wrap_RPMessage_getType, METH_VARARGS, NULL}, + { (char *)"RPMessage_getPayloadLength", _wrap_RPMessage_getPayloadLength, METH_VARARGS, NULL}, + { (char *)"RPMessage_getPayload", _wrap_RPMessage_getPayload, METH_VARARGS, NULL}, + { (char *)"RPMessage_swigregister", RPMessage_swigregister, METH_VARARGS, NULL}, + { (char *)"new_SMSData", _wrap_new_SMSData, METH_VARARGS, NULL}, + { (char *)"delete_SMSData", _wrap_delete_SMSData, METH_VARARGS, NULL}, + { (char *)"SMSData_getType", _wrap_SMSData_getType, METH_VARARGS, NULL}, + { (char *)"SMSData_getMR", _wrap_SMSData_getMR, METH_VARARGS, NULL}, + { (char *)"SMSData_getPayloadLength", _wrap_SMSData_getPayloadLength, METH_VARARGS, NULL}, + { (char *)"SMSData_getPayload", _wrap_SMSData_getPayload, METH_VARARGS, NULL}, + { (char *)"SMSData_getOA", _wrap_SMSData_getOA, METH_VARARGS, NULL}, + { (char *)"SMSData_getDA", _wrap_SMSData_getDA, METH_VARARGS, NULL}, + { (char *)"SMSData_swigregister", SMSData_swigregister, METH_VARARGS, NULL}, + { (char *)"SMSEncoder_encodeSubmit", _wrap_SMSEncoder_encodeSubmit, METH_VARARGS, NULL}, + { (char *)"SMSEncoder_encodeDeliver", _wrap_SMSEncoder_encodeDeliver, METH_VARARGS, NULL}, + { (char *)"SMSEncoder_encodeACK", _wrap_SMSEncoder_encodeACK, METH_VARARGS, NULL}, + { (char *)"SMSEncoder_encodeError", _wrap_SMSEncoder_encodeError, METH_VARARGS, NULL}, + { (char *)"SMSEncoder_decode", _wrap_SMSEncoder_decode, METH_VARARGS, NULL}, + { (char *)"delete_SMSEncoder", _wrap_delete_SMSEncoder, METH_VARARGS, NULL}, + { (char *)"SMSEncoder_swigregister", SMSEncoder_swigregister, METH_VARARGS, NULL}, + { (char *)"new_MsrpMessage", _wrap_new_MsrpMessage, METH_VARARGS, NULL}, + { (char *)"delete_MsrpMessage", _wrap_delete_MsrpMessage, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_isRequest", _wrap_MsrpMessage_isRequest, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getCode", _wrap_MsrpMessage_getCode, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getPhrase", _wrap_MsrpMessage_getPhrase, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getRequestType", _wrap_MsrpMessage_getRequestType, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getByteRange", _wrap_MsrpMessage_getByteRange, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_isLastChunck", _wrap_MsrpMessage_isLastChunck, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_isFirstChunck", _wrap_MsrpMessage_isFirstChunck, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_isSuccessReport", _wrap_MsrpMessage_isSuccessReport, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getMsrpHeaderValue", _wrap_MsrpMessage_getMsrpHeaderValue, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getMsrpHeaderParamValue", _wrap_MsrpMessage_getMsrpHeaderParamValue, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getMsrpContentLength", _wrap_MsrpMessage_getMsrpContentLength, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_getMsrpContent", _wrap_MsrpMessage_getMsrpContent, METH_VARARGS, NULL}, + { (char *)"MsrpMessage_swigregister", MsrpMessage_swigregister, METH_VARARGS, NULL}, + { (char *)"delete_MsrpEvent", _wrap_delete_MsrpEvent, METH_VARARGS, NULL}, + { (char *)"MsrpEvent_getType", _wrap_MsrpEvent_getType, METH_VARARGS, NULL}, + { (char *)"MsrpEvent_getSipSession", _wrap_MsrpEvent_getSipSession, METH_VARARGS, NULL}, + { (char *)"MsrpEvent_getMessage", _wrap_MsrpEvent_getMessage, METH_VARARGS, NULL}, + { (char *)"MsrpEvent_swigregister", MsrpEvent_swigregister, METH_VARARGS, NULL}, + { (char *)"new_MsrpCallback", _wrap_new_MsrpCallback, METH_VARARGS, NULL}, + { (char *)"delete_MsrpCallback", _wrap_delete_MsrpCallback, METH_VARARGS, NULL}, + { (char *)"MsrpCallback_OnEvent", _wrap_MsrpCallback_OnEvent, METH_VARARGS, NULL}, + { (char *)"disown_MsrpCallback", _wrap_disown_MsrpCallback, METH_VARARGS, NULL}, + { (char *)"MsrpCallback_swigregister", MsrpCallback_swigregister, METH_VARARGS, NULL}, + { NULL, NULL, 0, NULL } +}; + + +/* -------- TYPE CONVERSION AND EQUIVALENCE RULES (BEGIN) -------- */ + +static void *_p_ProxyAudioConsumerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((ProxyPlugin *) ((ProxyAudioConsumer *) x)); +} +static void *_p_ProxyVideoConsumerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((ProxyPlugin *) ((ProxyVideoConsumer *) x)); +} +static void *_p_ProxyAudioProducerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((ProxyPlugin *) ((ProxyAudioProducer *) x)); +} +static void *_p_ProxyVideoProducerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((ProxyPlugin *) ((ProxyVideoProducer *) x)); +} +static void *_p_SipStackTo_p_SafeObject(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SafeObject *) ((SipStack *) x)); +} +static void *_p_MediaContentCPIMTo_p_MediaContent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((MediaContent *) ((MediaContentCPIM *) x)); +} +static void *_p_CallSessionTo_p_InviteSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((InviteSession *) ((CallSession *) x)); +} +static void *_p_MsrpSessionTo_p_InviteSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((InviteSession *) ((MsrpSession *) x)); +} +static void *_p_InviteSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((InviteSession *) x)); +} +static void *_p_CallSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) (InviteSession *) ((CallSession *) x)); +} +static void *_p_MsrpSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) (InviteSession *) ((MsrpSession *) x)); +} +static void *_p_MessagingSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((MessagingSession *) x)); +} +static void *_p_InfoSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((InfoSession *) x)); +} +static void *_p_OptionsSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((OptionsSession *) x)); +} +static void *_p_PublicationSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((PublicationSession *) x)); +} +static void *_p_RegistrationSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((RegistrationSession *) x)); +} +static void *_p_SubscriptionSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipSession *) ((SubscriptionSession *) x)); +} +static void *_p_InfoEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((InfoEvent *) x)); +} +static void *_p_InviteEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((InviteEvent *) x)); +} +static void *_p_OptionsEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((OptionsEvent *) x)); +} +static void *_p_DialogEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((DialogEvent *) x)); +} +static void *_p_PublicationEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((PublicationEvent *) x)); +} +static void *_p_RegistrationEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((RegistrationEvent *) x)); +} +static void *_p_SubscriptionEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((SubscriptionEvent *) x)); +} +static void *_p_StackEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((StackEvent *) x)); +} +static void *_p_MessagingEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) { + return (void *)((SipEvent *) ((MessagingEvent *) x)); +} +static swig_type_info _swigt__p_ActionConfig = {"_p_ActionConfig", "ActionConfig *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_AudioResampler = {"_p_AudioResampler", "AudioResampler *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_CallSession = {"_p_CallSession", "CallSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_Codec = {"_p_Codec", "Codec *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_DDebugCallback = {"_p_DDebugCallback", "DDebugCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_DialogEvent = {"_p_DialogEvent", "DialogEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_InfoEvent = {"_p_InfoEvent", "InfoEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_InfoSession = {"_p_InfoSession", "InfoSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_InviteEvent = {"_p_InviteEvent", "InviteEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_InviteSession = {"_p_InviteSession", "InviteSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MediaContent = {"_p_MediaContent", "MediaContent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MediaContentCPIM = {"_p_MediaContentCPIM", "MediaContentCPIM *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MediaSessionMgr = {"_p_MediaSessionMgr", "MediaSessionMgr *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MessagingEvent = {"_p_MessagingEvent", "MessagingEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MessagingSession = {"_p_MessagingSession", "MessagingSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MsrpCallback = {"_p_MsrpCallback", "MsrpCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MsrpEvent = {"_p_MsrpEvent", "MsrpEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MsrpMessage = {"_p_MsrpMessage", "MsrpMessage *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_MsrpSession = {"_p_MsrpSession", "MsrpSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_OptionsEvent = {"_p_OptionsEvent", "OptionsEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_OptionsSession = {"_p_OptionsSession", "OptionsSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyAudioConsumer = {"_p_ProxyAudioConsumer", "ProxyAudioConsumer *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyAudioConsumerCallback = {"_p_ProxyAudioConsumerCallback", "ProxyAudioConsumerCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyAudioProducer = {"_p_ProxyAudioProducer", "ProxyAudioProducer *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyAudioProducerCallback = {"_p_ProxyAudioProducerCallback", "ProxyAudioProducerCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyPlugin = {"_p_ProxyPlugin", "ProxyPlugin *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyPluginMgr = {"_p_ProxyPluginMgr", "ProxyPluginMgr *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyPluginMgrCallback = {"_p_ProxyPluginMgrCallback", "ProxyPluginMgrCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyVideoConsumer = {"_p_ProxyVideoConsumer", "ProxyVideoConsumer *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyVideoConsumerCallback = {"_p_ProxyVideoConsumerCallback", "ProxyVideoConsumerCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyVideoFrame = {"_p_ProxyVideoFrame", "ProxyVideoFrame *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyVideoProducer = {"_p_ProxyVideoProducer", "ProxyVideoProducer *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_ProxyVideoProducerCallback = {"_p_ProxyVideoProducerCallback", "ProxyVideoProducerCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_PublicationEvent = {"_p_PublicationEvent", "PublicationEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_PublicationSession = {"_p_PublicationSession", "PublicationSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_RPMessage = {"_p_RPMessage", "RPMessage *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_RegistrationEvent = {"_p_RegistrationEvent", "RegistrationEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_RegistrationSession = {"_p_RegistrationSession", "RegistrationSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SMSData = {"_p_SMSData", "SMSData *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SMSEncoder = {"_p_SMSEncoder", "SMSEncoder *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SafeObject = {"_p_SafeObject", "SafeObject *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SdpMessage = {"_p_SdpMessage", "SdpMessage *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SipCallback = {"_p_SipCallback", "SipCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SipEvent = {"_p_SipEvent", "SipEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SipMessage = {"_p_SipMessage", "SipMessage *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SipSession = {"_p_SipSession", "SipSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SipStack = {"_p_SipStack", "SipStack *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SipUri = {"_p_SipUri", "SipUri *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_StackEvent = {"_p_StackEvent", "StackEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SubscriptionEvent = {"_p_SubscriptionEvent", "SubscriptionEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_SubscriptionSession = {"_p_SubscriptionSession", "SubscriptionSession *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_T140Callback = {"_p_T140Callback", "T140Callback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_T140CallbackData = {"_p_T140CallbackData", "T140CallbackData *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_XcapCallback = {"_p_XcapCallback", "XcapCallback *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_XcapEvent = {"_p_XcapEvent", "XcapEvent *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_XcapMessage = {"_p_XcapMessage", "XcapMessage *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_XcapSelector = {"_p_XcapSelector", "XcapSelector *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_XcapStack = {"_p_XcapStack", "XcapStack *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_char = {"_p_char", "char *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_int = {"_p_int", "intptr_t *|int *|int_least32_t *|int_fast32_t *|int32_t *|int_fast16_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_long_long = {"_p_long_long", "int_least64_t *|int_fast64_t *|int64_t *|long long *|intmax_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_short = {"_p_short", "short *|int_least16_t *|int16_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_signed_char = {"_p_signed_char", "signed char *|int_least8_t *|int_fast8_t *|int8_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tdav_codec_id_e = {"_p_tdav_codec_id_e", "enum tdav_codec_id_e *|tdav_codec_id_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_thttp_event_type_e = {"_p_thttp_event_type_e", "enum thttp_event_type_e *|thttp_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_bandwidth_level_e = {"_p_tmedia_bandwidth_level_e", "enum tmedia_bandwidth_level_e *|tmedia_bandwidth_level_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_chroma_e = {"_p_tmedia_chroma_e", "tmedia_chroma_t *|enum tmedia_chroma_e *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_codec_id_e = {"_p_tmedia_codec_id_e", "enum tmedia_codec_id_e *|tmedia_codec_id_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_mode_e = {"_p_tmedia_mode_e", "enum tmedia_mode_e *|tmedia_mode_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_pref_video_size_s = {"_p_tmedia_pref_video_size_s", "tmedia_pref_video_size_t *|enum tmedia_pref_video_size_s *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_profile_e = {"_p_tmedia_profile_e", "tmedia_profile_t *|enum tmedia_profile_e *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_qos_strength_e = {"_p_tmedia_qos_strength_e", "tmedia_qos_strength_t *|enum tmedia_qos_strength_e *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_qos_stype_e = {"_p_tmedia_qos_stype_e", "enum tmedia_qos_stype_e *|tmedia_qos_stype_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_srtp_mode_e = {"_p_tmedia_srtp_mode_e", "enum tmedia_srtp_mode_e *|tmedia_srtp_mode_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_srtp_type_e = {"_p_tmedia_srtp_type_e", "enum tmedia_srtp_type_e *|tmedia_srtp_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmedia_t140_data_type_e = {"_p_tmedia_t140_data_type_e", "enum tmedia_t140_data_type_e *|tmedia_t140_data_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmsrp_event_type_e = {"_p_tmsrp_event_type_e", "enum tmsrp_event_type_e *|tmsrp_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tmsrp_request_type_e = {"_p_tmsrp_request_type_e", "enum tmsrp_request_type_e *|tmsrp_request_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_event_type_e = {"_p_tsip_event_type_e", "enum tsip_event_type_e *|tsip_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_info_event_type_e = {"_p_tsip_info_event_type_e", "enum tsip_info_event_type_e *|tsip_info_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_invite_event_type_e = {"_p_tsip_invite_event_type_e", "enum tsip_invite_event_type_e *|tsip_invite_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_message_event_type_e = {"_p_tsip_message_event_type_e", "enum tsip_message_event_type_e *|tsip_message_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_options_event_type_e = {"_p_tsip_options_event_type_e", "enum tsip_options_event_type_e *|tsip_options_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_publish_event_type_e = {"_p_tsip_publish_event_type_e", "enum tsip_publish_event_type_e *|tsip_publish_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_register_event_type_e = {"_p_tsip_register_event_type_e", "enum tsip_register_event_type_e *|tsip_register_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_request_type_e = {"_p_tsip_request_type_e", "enum tsip_request_type_e *|tsip_request_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_stack_mode_e = {"_p_tsip_stack_mode_e", "enum tsip_stack_mode_e *|tsip_stack_mode_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsip_subscribe_event_type_e = {"_p_tsip_subscribe_event_type_e", "enum tsip_subscribe_event_type_e *|tsip_subscribe_event_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_tsk_list_t = {"_p_tsk_list_t", "twrap_xcap_steps_L_t *|twrap_proxy_plungins_L_t *|tsk_list_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_twrap_media_type_e = {"_p_twrap_media_type_e", "enum twrap_media_type_e *|twrap_media_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_twrap_proxy_plugin_type_e = {"_p_twrap_proxy_plugin_type_e", "enum twrap_proxy_plugin_type_e *|twrap_proxy_plugin_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_twrap_rpmessage_type_e = {"_p_twrap_rpmessage_type_e", "enum twrap_rpmessage_type_e *|twrap_rpmessage_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_twrap_sms_type_e = {"_p_twrap_sms_type_e", "enum twrap_sms_type_e *|twrap_sms_type_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_unsigned_char = {"_p_unsigned_char", "unsigned char *|uint_least8_t *|uint_fast8_t *|uint8_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_unsigned_int = {"_p_unsigned_int", "uintptr_t *|uint_least32_t *|uint_fast32_t *|uint32_t *|unsigned int *|uint_fast16_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_unsigned_long_long = {"_p_unsigned_long_long", "uint_least64_t *|uint_fast64_t *|uint64_t *|unsigned long long *|uintmax_t *", 0, 0, (void*)0, 0}; +static swig_type_info _swigt__p_unsigned_short = {"_p_unsigned_short", "unsigned short *|uint_least16_t *|uint16_t *", 0, 0, (void*)0, 0}; + +static swig_type_info *swig_type_initial[] = { + &_swigt__p_ActionConfig, + &_swigt__p_AudioResampler, + &_swigt__p_CallSession, + &_swigt__p_Codec, + &_swigt__p_DDebugCallback, + &_swigt__p_DialogEvent, + &_swigt__p_InfoEvent, + &_swigt__p_InfoSession, + &_swigt__p_InviteEvent, + &_swigt__p_InviteSession, + &_swigt__p_MediaContent, + &_swigt__p_MediaContentCPIM, + &_swigt__p_MediaSessionMgr, + &_swigt__p_MessagingEvent, + &_swigt__p_MessagingSession, + &_swigt__p_MsrpCallback, + &_swigt__p_MsrpEvent, + &_swigt__p_MsrpMessage, + &_swigt__p_MsrpSession, + &_swigt__p_OptionsEvent, + &_swigt__p_OptionsSession, + &_swigt__p_ProxyAudioConsumer, + &_swigt__p_ProxyAudioConsumerCallback, + &_swigt__p_ProxyAudioProducer, + &_swigt__p_ProxyAudioProducerCallback, + &_swigt__p_ProxyPlugin, + &_swigt__p_ProxyPluginMgr, + &_swigt__p_ProxyPluginMgrCallback, + &_swigt__p_ProxyVideoConsumer, + &_swigt__p_ProxyVideoConsumerCallback, + &_swigt__p_ProxyVideoFrame, + &_swigt__p_ProxyVideoProducer, + &_swigt__p_ProxyVideoProducerCallback, + &_swigt__p_PublicationEvent, + &_swigt__p_PublicationSession, + &_swigt__p_RPMessage, + &_swigt__p_RegistrationEvent, + &_swigt__p_RegistrationSession, + &_swigt__p_SMSData, + &_swigt__p_SMSEncoder, + &_swigt__p_SafeObject, + &_swigt__p_SdpMessage, + &_swigt__p_SipCallback, + &_swigt__p_SipEvent, + &_swigt__p_SipMessage, + &_swigt__p_SipSession, + &_swigt__p_SipStack, + &_swigt__p_SipUri, + &_swigt__p_StackEvent, + &_swigt__p_SubscriptionEvent, + &_swigt__p_SubscriptionSession, + &_swigt__p_T140Callback, + &_swigt__p_T140CallbackData, + &_swigt__p_XcapCallback, + &_swigt__p_XcapEvent, + &_swigt__p_XcapMessage, + &_swigt__p_XcapSelector, + &_swigt__p_XcapStack, + &_swigt__p_char, + &_swigt__p_int, + &_swigt__p_long_long, + &_swigt__p_short, + &_swigt__p_signed_char, + &_swigt__p_tdav_codec_id_e, + &_swigt__p_thttp_event_type_e, + &_swigt__p_tmedia_bandwidth_level_e, + &_swigt__p_tmedia_chroma_e, + &_swigt__p_tmedia_codec_id_e, + &_swigt__p_tmedia_mode_e, + &_swigt__p_tmedia_pref_video_size_s, + &_swigt__p_tmedia_profile_e, + &_swigt__p_tmedia_qos_strength_e, + &_swigt__p_tmedia_qos_stype_e, + &_swigt__p_tmedia_srtp_mode_e, + &_swigt__p_tmedia_srtp_type_e, + &_swigt__p_tmedia_t140_data_type_e, + &_swigt__p_tmsrp_event_type_e, + &_swigt__p_tmsrp_request_type_e, + &_swigt__p_tsip_event_type_e, + &_swigt__p_tsip_info_event_type_e, + &_swigt__p_tsip_invite_event_type_e, + &_swigt__p_tsip_message_event_type_e, + &_swigt__p_tsip_options_event_type_e, + &_swigt__p_tsip_publish_event_type_e, + &_swigt__p_tsip_register_event_type_e, + &_swigt__p_tsip_request_type_e, + &_swigt__p_tsip_stack_mode_e, + &_swigt__p_tsip_subscribe_event_type_e, + &_swigt__p_tsk_list_t, + &_swigt__p_twrap_media_type_e, + &_swigt__p_twrap_proxy_plugin_type_e, + &_swigt__p_twrap_rpmessage_type_e, + &_swigt__p_twrap_sms_type_e, + &_swigt__p_unsigned_char, + &_swigt__p_unsigned_int, + &_swigt__p_unsigned_long_long, + &_swigt__p_unsigned_short, +}; + +static swig_cast_info _swigc__p_ActionConfig[] = { {&_swigt__p_ActionConfig, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_AudioResampler[] = { {&_swigt__p_AudioResampler, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_CallSession[] = { {&_swigt__p_CallSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_Codec[] = { {&_swigt__p_Codec, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_DDebugCallback[] = { {&_swigt__p_DDebugCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_DialogEvent[] = { {&_swigt__p_DialogEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_InfoEvent[] = { {&_swigt__p_InfoEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_InfoSession[] = { {&_swigt__p_InfoSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_InviteEvent[] = { {&_swigt__p_InviteEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_InviteSession[] = { {&_swigt__p_InviteSession, 0, 0, 0}, {&_swigt__p_CallSession, _p_CallSessionTo_p_InviteSession, 0, 0}, {&_swigt__p_MsrpSession, _p_MsrpSessionTo_p_InviteSession, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MediaContent[] = { {&_swigt__p_MediaContent, 0, 0, 0}, {&_swigt__p_MediaContentCPIM, _p_MediaContentCPIMTo_p_MediaContent, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MediaContentCPIM[] = { {&_swigt__p_MediaContentCPIM, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MediaSessionMgr[] = { {&_swigt__p_MediaSessionMgr, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MessagingEvent[] = { {&_swigt__p_MessagingEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MessagingSession[] = { {&_swigt__p_MessagingSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MsrpCallback[] = { {&_swigt__p_MsrpCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MsrpEvent[] = { {&_swigt__p_MsrpEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MsrpMessage[] = { {&_swigt__p_MsrpMessage, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_MsrpSession[] = { {&_swigt__p_MsrpSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_OptionsEvent[] = { {&_swigt__p_OptionsEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_OptionsSession[] = { {&_swigt__p_OptionsSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyAudioConsumer[] = { {&_swigt__p_ProxyAudioConsumer, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyAudioConsumerCallback[] = { {&_swigt__p_ProxyAudioConsumerCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyAudioProducer[] = { {&_swigt__p_ProxyAudioProducer, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyAudioProducerCallback[] = { {&_swigt__p_ProxyAudioProducerCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyPlugin[] = { {&_swigt__p_ProxyPlugin, 0, 0, 0}, {&_swigt__p_ProxyAudioConsumer, _p_ProxyAudioConsumerTo_p_ProxyPlugin, 0, 0}, {&_swigt__p_ProxyVideoConsumer, _p_ProxyVideoConsumerTo_p_ProxyPlugin, 0, 0}, {&_swigt__p_ProxyAudioProducer, _p_ProxyAudioProducerTo_p_ProxyPlugin, 0, 0}, {&_swigt__p_ProxyVideoProducer, _p_ProxyVideoProducerTo_p_ProxyPlugin, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyPluginMgr[] = { {&_swigt__p_ProxyPluginMgr, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyPluginMgrCallback[] = { {&_swigt__p_ProxyPluginMgrCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyVideoConsumer[] = { {&_swigt__p_ProxyVideoConsumer, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyVideoConsumerCallback[] = { {&_swigt__p_ProxyVideoConsumerCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyVideoFrame[] = { {&_swigt__p_ProxyVideoFrame, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyVideoProducer[] = { {&_swigt__p_ProxyVideoProducer, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_ProxyVideoProducerCallback[] = { {&_swigt__p_ProxyVideoProducerCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_PublicationEvent[] = { {&_swigt__p_PublicationEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_PublicationSession[] = { {&_swigt__p_PublicationSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_RPMessage[] = { {&_swigt__p_RPMessage, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_RegistrationEvent[] = { {&_swigt__p_RegistrationEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_RegistrationSession[] = { {&_swigt__p_RegistrationSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SMSData[] = { {&_swigt__p_SMSData, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SMSEncoder[] = { {&_swigt__p_SMSEncoder, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SafeObject[] = { {&_swigt__p_SipStack, _p_SipStackTo_p_SafeObject, 0, 0}, {&_swigt__p_SafeObject, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SdpMessage[] = { {&_swigt__p_SdpMessage, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SipCallback[] = { {&_swigt__p_SipCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SipEvent[] = { {&_swigt__p_InfoEvent, _p_InfoEventTo_p_SipEvent, 0, 0}, {&_swigt__p_SipEvent, 0, 0, 0}, {&_swigt__p_InviteEvent, _p_InviteEventTo_p_SipEvent, 0, 0}, {&_swigt__p_OptionsEvent, _p_OptionsEventTo_p_SipEvent, 0, 0}, {&_swigt__p_DialogEvent, _p_DialogEventTo_p_SipEvent, 0, 0}, {&_swigt__p_PublicationEvent, _p_PublicationEventTo_p_SipEvent, 0, 0}, {&_swigt__p_RegistrationEvent, _p_RegistrationEventTo_p_SipEvent, 0, 0}, {&_swigt__p_SubscriptionEvent, _p_SubscriptionEventTo_p_SipEvent, 0, 0}, {&_swigt__p_StackEvent, _p_StackEventTo_p_SipEvent, 0, 0}, {&_swigt__p_MessagingEvent, _p_MessagingEventTo_p_SipEvent, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SipMessage[] = { {&_swigt__p_SipMessage, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SipSession[] = { {&_swigt__p_SipSession, 0, 0, 0}, {&_swigt__p_InviteSession, _p_InviteSessionTo_p_SipSession, 0, 0}, {&_swigt__p_CallSession, _p_CallSessionTo_p_SipSession, 0, 0}, {&_swigt__p_MsrpSession, _p_MsrpSessionTo_p_SipSession, 0, 0}, {&_swigt__p_MessagingSession, _p_MessagingSessionTo_p_SipSession, 0, 0}, {&_swigt__p_InfoSession, _p_InfoSessionTo_p_SipSession, 0, 0}, {&_swigt__p_OptionsSession, _p_OptionsSessionTo_p_SipSession, 0, 0}, {&_swigt__p_PublicationSession, _p_PublicationSessionTo_p_SipSession, 0, 0}, {&_swigt__p_RegistrationSession, _p_RegistrationSessionTo_p_SipSession, 0, 0}, {&_swigt__p_SubscriptionSession, _p_SubscriptionSessionTo_p_SipSession, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SipStack[] = { {&_swigt__p_SipStack, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SipUri[] = { {&_swigt__p_SipUri, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_StackEvent[] = { {&_swigt__p_StackEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SubscriptionEvent[] = { {&_swigt__p_SubscriptionEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_SubscriptionSession[] = { {&_swigt__p_SubscriptionSession, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_T140Callback[] = { {&_swigt__p_T140Callback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_T140CallbackData[] = { {&_swigt__p_T140CallbackData, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_XcapCallback[] = { {&_swigt__p_XcapCallback, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_XcapEvent[] = { {&_swigt__p_XcapEvent, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_XcapMessage[] = { {&_swigt__p_XcapMessage, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_XcapSelector[] = { {&_swigt__p_XcapSelector, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_XcapStack[] = { {&_swigt__p_XcapStack, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_char[] = { {&_swigt__p_char, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_int[] = { {&_swigt__p_int, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_long_long[] = { {&_swigt__p_long_long, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_short[] = { {&_swigt__p_short, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_signed_char[] = { {&_swigt__p_signed_char, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tdav_codec_id_e[] = { {&_swigt__p_tdav_codec_id_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_thttp_event_type_e[] = { {&_swigt__p_thttp_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_bandwidth_level_e[] = { {&_swigt__p_tmedia_bandwidth_level_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_chroma_e[] = { {&_swigt__p_tmedia_chroma_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_codec_id_e[] = { {&_swigt__p_tmedia_codec_id_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_mode_e[] = { {&_swigt__p_tmedia_mode_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_pref_video_size_s[] = { {&_swigt__p_tmedia_pref_video_size_s, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_profile_e[] = { {&_swigt__p_tmedia_profile_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_qos_strength_e[] = { {&_swigt__p_tmedia_qos_strength_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_qos_stype_e[] = { {&_swigt__p_tmedia_qos_stype_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_srtp_mode_e[] = { {&_swigt__p_tmedia_srtp_mode_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_srtp_type_e[] = { {&_swigt__p_tmedia_srtp_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmedia_t140_data_type_e[] = { {&_swigt__p_tmedia_t140_data_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmsrp_event_type_e[] = { {&_swigt__p_tmsrp_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tmsrp_request_type_e[] = { {&_swigt__p_tmsrp_request_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_event_type_e[] = { {&_swigt__p_tsip_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_info_event_type_e[] = { {&_swigt__p_tsip_info_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_invite_event_type_e[] = { {&_swigt__p_tsip_invite_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_message_event_type_e[] = { {&_swigt__p_tsip_message_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_options_event_type_e[] = { {&_swigt__p_tsip_options_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_publish_event_type_e[] = { {&_swigt__p_tsip_publish_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_register_event_type_e[] = { {&_swigt__p_tsip_register_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_request_type_e[] = { {&_swigt__p_tsip_request_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_stack_mode_e[] = { {&_swigt__p_tsip_stack_mode_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsip_subscribe_event_type_e[] = { {&_swigt__p_tsip_subscribe_event_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_tsk_list_t[] = { {&_swigt__p_tsk_list_t, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_twrap_media_type_e[] = { {&_swigt__p_twrap_media_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_twrap_proxy_plugin_type_e[] = { {&_swigt__p_twrap_proxy_plugin_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_twrap_rpmessage_type_e[] = { {&_swigt__p_twrap_rpmessage_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_twrap_sms_type_e[] = { {&_swigt__p_twrap_sms_type_e, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_unsigned_char[] = { {&_swigt__p_unsigned_char, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_unsigned_int[] = { {&_swigt__p_unsigned_int, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_unsigned_long_long[] = { {&_swigt__p_unsigned_long_long, 0, 0, 0},{0, 0, 0, 0}}; +static swig_cast_info _swigc__p_unsigned_short[] = { {&_swigt__p_unsigned_short, 0, 0, 0},{0, 0, 0, 0}}; + +static swig_cast_info *swig_cast_initial[] = { + _swigc__p_ActionConfig, + _swigc__p_AudioResampler, + _swigc__p_CallSession, + _swigc__p_Codec, + _swigc__p_DDebugCallback, + _swigc__p_DialogEvent, + _swigc__p_InfoEvent, + _swigc__p_InfoSession, + _swigc__p_InviteEvent, + _swigc__p_InviteSession, + _swigc__p_MediaContent, + _swigc__p_MediaContentCPIM, + _swigc__p_MediaSessionMgr, + _swigc__p_MessagingEvent, + _swigc__p_MessagingSession, + _swigc__p_MsrpCallback, + _swigc__p_MsrpEvent, + _swigc__p_MsrpMessage, + _swigc__p_MsrpSession, + _swigc__p_OptionsEvent, + _swigc__p_OptionsSession, + _swigc__p_ProxyAudioConsumer, + _swigc__p_ProxyAudioConsumerCallback, + _swigc__p_ProxyAudioProducer, + _swigc__p_ProxyAudioProducerCallback, + _swigc__p_ProxyPlugin, + _swigc__p_ProxyPluginMgr, + _swigc__p_ProxyPluginMgrCallback, + _swigc__p_ProxyVideoConsumer, + _swigc__p_ProxyVideoConsumerCallback, + _swigc__p_ProxyVideoFrame, + _swigc__p_ProxyVideoProducer, + _swigc__p_ProxyVideoProducerCallback, + _swigc__p_PublicationEvent, + _swigc__p_PublicationSession, + _swigc__p_RPMessage, + _swigc__p_RegistrationEvent, + _swigc__p_RegistrationSession, + _swigc__p_SMSData, + _swigc__p_SMSEncoder, + _swigc__p_SafeObject, + _swigc__p_SdpMessage, + _swigc__p_SipCallback, + _swigc__p_SipEvent, + _swigc__p_SipMessage, + _swigc__p_SipSession, + _swigc__p_SipStack, + _swigc__p_SipUri, + _swigc__p_StackEvent, + _swigc__p_SubscriptionEvent, + _swigc__p_SubscriptionSession, + _swigc__p_T140Callback, + _swigc__p_T140CallbackData, + _swigc__p_XcapCallback, + _swigc__p_XcapEvent, + _swigc__p_XcapMessage, + _swigc__p_XcapSelector, + _swigc__p_XcapStack, + _swigc__p_char, + _swigc__p_int, + _swigc__p_long_long, + _swigc__p_short, + _swigc__p_signed_char, + _swigc__p_tdav_codec_id_e, + _swigc__p_thttp_event_type_e, + _swigc__p_tmedia_bandwidth_level_e, + _swigc__p_tmedia_chroma_e, + _swigc__p_tmedia_codec_id_e, + _swigc__p_tmedia_mode_e, + _swigc__p_tmedia_pref_video_size_s, + _swigc__p_tmedia_profile_e, + _swigc__p_tmedia_qos_strength_e, + _swigc__p_tmedia_qos_stype_e, + _swigc__p_tmedia_srtp_mode_e, + _swigc__p_tmedia_srtp_type_e, + _swigc__p_tmedia_t140_data_type_e, + _swigc__p_tmsrp_event_type_e, + _swigc__p_tmsrp_request_type_e, + _swigc__p_tsip_event_type_e, + _swigc__p_tsip_info_event_type_e, + _swigc__p_tsip_invite_event_type_e, + _swigc__p_tsip_message_event_type_e, + _swigc__p_tsip_options_event_type_e, + _swigc__p_tsip_publish_event_type_e, + _swigc__p_tsip_register_event_type_e, + _swigc__p_tsip_request_type_e, + _swigc__p_tsip_stack_mode_e, + _swigc__p_tsip_subscribe_event_type_e, + _swigc__p_tsk_list_t, + _swigc__p_twrap_media_type_e, + _swigc__p_twrap_proxy_plugin_type_e, + _swigc__p_twrap_rpmessage_type_e, + _swigc__p_twrap_sms_type_e, + _swigc__p_unsigned_char, + _swigc__p_unsigned_int, + _swigc__p_unsigned_long_long, + _swigc__p_unsigned_short, +}; + + +/* -------- TYPE CONVERSION AND EQUIVALENCE RULES (END) -------- */ + +static swig_const_info swig_const_table[] = { +{0, 0, 0, 0.0, 0, 0}}; + +#ifdef __cplusplus +} +#endif +/* ----------------------------------------------------------------------------- + * Type initialization: + * This problem is tough by the requirement that no dynamic + * memory is used. Also, since swig_type_info structures store pointers to + * swig_cast_info structures and swig_cast_info structures store pointers back + * to swig_type_info structures, we need some lookup code at initialization. + * The idea is that swig generates all the structures that are needed. + * The runtime then collects these partially filled structures. + * The SWIG_InitializeModule function takes these initial arrays out of + * swig_module, and does all the lookup, filling in the swig_module.types + * array with the correct data and linking the correct swig_cast_info + * structures together. + * + * The generated swig_type_info structures are assigned staticly to an initial + * array. We just loop through that array, and handle each type individually. + * First we lookup if this type has been already loaded, and if so, use the + * loaded structure instead of the generated one. Then we have to fill in the + * cast linked list. The cast data is initially stored in something like a + * two-dimensional array. Each row corresponds to a type (there are the same + * number of rows as there are in the swig_type_initial array). Each entry in + * a column is one of the swig_cast_info structures for that type. + * The cast_initial array is actually an array of arrays, because each row has + * a variable number of columns. So to actually build the cast linked list, + * we find the array of casts associated with the type, and loop through it + * adding the casts to the list. The one last trick we need to do is making + * sure the type pointer in the swig_cast_info struct is correct. + * + * First off, we lookup the cast->type name to see if it is already loaded. + * There are three cases to handle: + * 1) If the cast->type has already been loaded AND the type we are adding + * casting info to has not been loaded (it is in this module), THEN we + * replace the cast->type pointer with the type pointer that has already + * been loaded. + * 2) If BOTH types (the one we are adding casting info to, and the + * cast->type) are loaded, THEN the cast info has already been loaded by + * the previous module so we just ignore it. + * 3) Finally, if cast->type has not already been loaded, then we add that + * swig_cast_info to the linked list (because the cast->type) pointer will + * be correct. + * ----------------------------------------------------------------------------- */ + +#ifdef __cplusplus +extern "C" { +#if 0 +} /* c-mode */ +#endif +#endif + +#if 0 +#define SWIGRUNTIME_DEBUG +#endif + + +SWIGRUNTIME void +SWIG_InitializeModule(void *clientdata) { + size_t i; + swig_module_info *module_head, *iter; + int found, init; + + /* check to see if the circular list has been setup, if not, set it up */ + if (swig_module.next==0) { + /* Initialize the swig_module */ + swig_module.type_initial = swig_type_initial; + swig_module.cast_initial = swig_cast_initial; + swig_module.next = &swig_module; + init = 1; + } else { + init = 0; + } + + /* Try and load any already created modules */ + module_head = SWIG_GetModule(clientdata); + if (!module_head) { + /* This is the first module loaded for this interpreter */ + /* so set the swig module into the interpreter */ + SWIG_SetModule(clientdata, &swig_module); + module_head = &swig_module; + } else { + /* the interpreter has loaded a SWIG module, but has it loaded this one? */ + found=0; + iter=module_head; + do { + if (iter==&swig_module) { + found=1; + break; + } + iter=iter->next; + } while (iter!= module_head); + + /* if the is found in the list, then all is done and we may leave */ + if (found) return; + /* otherwise we must add out module into the list */ + swig_module.next = module_head->next; + module_head->next = &swig_module; + } + + /* When multiple interpeters are used, a module could have already been initialized in + a different interpreter, but not yet have a pointer in this interpreter. + In this case, we do not want to continue adding types... everything should be + set up already */ + if (init == 0) return; + + /* Now work on filling in swig_module.types */ +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: size %d\n", swig_module.size); +#endif + for (i = 0; i < swig_module.size; ++i) { + swig_type_info *type = 0; + swig_type_info *ret; + swig_cast_info *cast; + +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: type %d %s\n", i, swig_module.type_initial[i]->name); +#endif + + /* if there is another module already loaded */ + if (swig_module.next != &swig_module) { + type = SWIG_MangledTypeQueryModule(swig_module.next, &swig_module, swig_module.type_initial[i]->name); + } + if (type) { + /* Overwrite clientdata field */ +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: found type %s\n", type->name); +#endif + if (swig_module.type_initial[i]->clientdata) { + type->clientdata = swig_module.type_initial[i]->clientdata; +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: found and overwrite type %s \n", type->name); +#endif + } + } else { + type = swig_module.type_initial[i]; + } + + /* Insert casting types */ + cast = swig_module.cast_initial[i]; + while (cast->type) { + /* Don't need to add information already in the list */ + ret = 0; +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: look cast %s\n", cast->type->name); +#endif + if (swig_module.next != &swig_module) { + ret = SWIG_MangledTypeQueryModule(swig_module.next, &swig_module, cast->type->name); +#ifdef SWIGRUNTIME_DEBUG + if (ret) printf("SWIG_InitializeModule: found cast %s\n", ret->name); +#endif + } + if (ret) { + if (type == swig_module.type_initial[i]) { +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: skip old type %s\n", ret->name); +#endif + cast->type = ret; + ret = 0; + } else { + /* Check for casting already in the list */ + swig_cast_info *ocast = SWIG_TypeCheck(ret->name, type); +#ifdef SWIGRUNTIME_DEBUG + if (ocast) printf("SWIG_InitializeModule: skip old cast %s\n", ret->name); +#endif + if (!ocast) ret = 0; + } + } + + if (!ret) { +#ifdef SWIGRUNTIME_DEBUG + printf("SWIG_InitializeModule: adding cast %s\n", cast->type->name); +#endif + if (type->cast) { + type->cast->prev = cast; + cast->next = type->cast; + } + type->cast = cast; + } + cast++; + } + /* Set entry in modules->types array equal to the type */ + swig_module.types[i] = type; + } + swig_module.types[i] = 0; + +#ifdef SWIGRUNTIME_DEBUG + printf("**** SWIG_InitializeModule: Cast List ******\n"); + for (i = 0; i < swig_module.size; ++i) { + int j = 0; + swig_cast_info *cast = swig_module.cast_initial[i]; + printf("SWIG_InitializeModule: type %d %s\n", i, swig_module.type_initial[i]->name); + while (cast->type) { + printf("SWIG_InitializeModule: cast type %s\n", cast->type->name); + cast++; + ++j; + } + printf("---- Total casts: %d\n",j); + } + printf("**** SWIG_InitializeModule: Cast List ******\n"); +#endif +} + +/* This function will propagate the clientdata field of type to +* any new swig_type_info structures that have been added into the list +* of equivalent types. It is like calling +* SWIG_TypeClientData(type, clientdata) a second time. +*/ +SWIGRUNTIME void +SWIG_PropagateClientData(void) { + size_t i; + swig_cast_info *equiv; + static int init_run = 0; + + if (init_run) return; + init_run = 1; + + for (i = 0; i < swig_module.size; i++) { + if (swig_module.types[i]->clientdata) { + equiv = swig_module.types[i]->cast; + while (equiv) { + if (!equiv->converter) { + if (equiv->type && !equiv->type->clientdata) + SWIG_TypeClientData(equiv->type, swig_module.types[i]->clientdata); + } + equiv = equiv->next; + } + } + } +} + +#ifdef __cplusplus +#if 0 +{ + /* c-mode */ +#endif +} +#endif + + + +#ifdef __cplusplus +extern "C" { +#endif + + /* Python-specific SWIG API */ +#define SWIG_newvarlink() SWIG_Python_newvarlink() +#define SWIG_addvarlink(p, name, get_attr, set_attr) SWIG_Python_addvarlink(p, name, get_attr, set_attr) +#define SWIG_InstallConstants(d, constants) SWIG_Python_InstallConstants(d, constants) + + /* ----------------------------------------------------------------------------- + * global variable support code. + * ----------------------------------------------------------------------------- */ + + typedef struct swig_globalvar { + char *name; /* Name of global variable */ + PyObject *(*get_attr)(void); /* Return the current value */ + int (*set_attr)(PyObject *); /* Set the value */ + struct swig_globalvar *next; + } swig_globalvar; + + typedef struct swig_varlinkobject { + PyObject_HEAD + swig_globalvar *vars; + } swig_varlinkobject; + + SWIGINTERN PyObject * + swig_varlink_repr(swig_varlinkobject *SWIGUNUSEDPARM(v)) { +#if PY_VERSION_HEX >= 0x03000000 + return PyUnicode_InternFromString("<Swig global variables>"); +#else + return PyString_FromString("<Swig global variables>"); +#endif + } + + SWIGINTERN PyObject * + swig_varlink_str(swig_varlinkobject *v) { +#if PY_VERSION_HEX >= 0x03000000 + PyObject *str = PyUnicode_InternFromString("("); + PyObject *tail; + PyObject *joined; + swig_globalvar *var; + for (var = v->vars; var; var=var->next) { + tail = PyUnicode_FromString(var->name); + joined = PyUnicode_Concat(str, tail); + Py_DecRef(str); + Py_DecRef(tail); + str = joined; + if (var->next) { + tail = PyUnicode_InternFromString(", "); + joined = PyUnicode_Concat(str, tail); + Py_DecRef(str); + Py_DecRef(tail); + str = joined; + } + } + tail = PyUnicode_InternFromString(")"); + joined = PyUnicode_Concat(str, tail); + Py_DecRef(str); + Py_DecRef(tail); + str = joined; +#else + PyObject *str = PyString_FromString("("); + swig_globalvar *var; + for (var = v->vars; var; var=var->next) { + PyString_ConcatAndDel(&str,PyString_FromString(var->name)); + if (var->next) PyString_ConcatAndDel(&str,PyString_FromString(", ")); + } + PyString_ConcatAndDel(&str,PyString_FromString(")")); +#endif + return str; + } + + SWIGINTERN int + swig_varlink_print(swig_varlinkobject *v, FILE *fp, int SWIGUNUSEDPARM(flags)) { + char *tmp; + PyObject *str = swig_varlink_str(v); + fprintf(fp,"Swig global variables "); + fprintf(fp,"%s\n", tmp = SWIG_Python_str_AsChar(str)); + SWIG_Python_str_DelForPy3(tmp); + Py_DECREF(str); + return 0; + } + + SWIGINTERN void + swig_varlink_dealloc(swig_varlinkobject *v) { + swig_globalvar *var = v->vars; + while (var) { + swig_globalvar *n = var->next; + free(var->name); + free(var); + var = n; + } + } + + SWIGINTERN PyObject * + swig_varlink_getattr(swig_varlinkobject *v, char *n) { + PyObject *res = NULL; + swig_globalvar *var = v->vars; + while (var) { + if (strcmp(var->name,n) == 0) { + res = (*var->get_attr)(); + break; + } + var = var->next; + } + if (res == NULL && !PyErr_Occurred()) { + PyErr_SetString(PyExc_NameError,"Unknown C global variable"); + } + return res; + } + + SWIGINTERN int + swig_varlink_setattr(swig_varlinkobject *v, char *n, PyObject *p) { + int res = 1; + swig_globalvar *var = v->vars; + while (var) { + if (strcmp(var->name,n) == 0) { + res = (*var->set_attr)(p); + break; + } + var = var->next; + } + if (res == 1 && !PyErr_Occurred()) { + PyErr_SetString(PyExc_NameError,"Unknown C global variable"); + } + return res; + } + + SWIGINTERN PyTypeObject* + swig_varlink_type(void) { + static char varlink__doc__[] = "Swig var link object"; + static PyTypeObject varlink_type; + static int type_init = 0; + if (!type_init) { + const PyTypeObject tmp = { + /* PyObject header changed in Python 3 */ +#if PY_VERSION_HEX >= 0x03000000 + PyVarObject_HEAD_INIT(NULL, 0) +#else + PyObject_HEAD_INIT(NULL) + 0, /* ob_size */ +#endif + (char *)"swigvarlink", /* tp_name */ + sizeof(swig_varlinkobject), /* tp_basicsize */ + 0, /* tp_itemsize */ + (destructor) swig_varlink_dealloc, /* tp_dealloc */ + (printfunc) swig_varlink_print, /* tp_print */ + (getattrfunc) swig_varlink_getattr, /* tp_getattr */ + (setattrfunc) swig_varlink_setattr, /* tp_setattr */ + 0, /* tp_compare */ + (reprfunc) swig_varlink_repr, /* tp_repr */ + 0, /* tp_as_number */ + 0, /* tp_as_sequence */ + 0, /* tp_as_mapping */ + 0, /* tp_hash */ + 0, /* tp_call */ + (reprfunc) swig_varlink_str, /* tp_str */ + 0, /* tp_getattro */ + 0, /* tp_setattro */ + 0, /* tp_as_buffer */ + 0, /* tp_flags */ + varlink__doc__, /* tp_doc */ + 0, /* tp_traverse */ + 0, /* tp_clear */ + 0, /* tp_richcompare */ + 0, /* tp_weaklistoffset */ +#if PY_VERSION_HEX >= 0x02020000 + 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0, /* tp_iter -> tp_weaklist */ +#endif +#if PY_VERSION_HEX >= 0x02030000 + 0, /* tp_del */ +#endif +#if PY_VERSION_HEX >= 0x02060000 + 0, /* tp_version */ +#endif +#ifdef COUNT_ALLOCS + 0,0,0,0 /* tp_alloc -> tp_next */ +#endif + }; + varlink_type = tmp; + type_init = 1; +#if PY_VERSION_HEX < 0x02020000 + varlink_type.ob_type = &PyType_Type; +#else + if (PyType_Ready(&varlink_type) < 0) + return NULL; +#endif + } + return &varlink_type; + } + + /* Create a variable linking object for use later */ + SWIGINTERN PyObject * + SWIG_Python_newvarlink(void) { + swig_varlinkobject *result = PyObject_NEW(swig_varlinkobject, swig_varlink_type()); + if (result) { + result->vars = 0; + } + return ((PyObject*) result); + } + + SWIGINTERN void + SWIG_Python_addvarlink(PyObject *p, char *name, PyObject *(*get_attr)(void), int (*set_attr)(PyObject *p)) { + swig_varlinkobject *v = (swig_varlinkobject *) p; + swig_globalvar *gv = (swig_globalvar *) malloc(sizeof(swig_globalvar)); + if (gv) { + size_t size = strlen(name)+1; + gv->name = (char *)malloc(size); + if (gv->name) { + strncpy(gv->name,name,size); + gv->get_attr = get_attr; + gv->set_attr = set_attr; + gv->next = v->vars; + } + } + v->vars = gv; + } + + SWIGINTERN PyObject * + SWIG_globals(void) { + static PyObject *_SWIG_globals = 0; + if (!_SWIG_globals) _SWIG_globals = SWIG_newvarlink(); + return _SWIG_globals; + } + + /* ----------------------------------------------------------------------------- + * constants/methods manipulation + * ----------------------------------------------------------------------------- */ + + /* Install Constants */ + SWIGINTERN void + SWIG_Python_InstallConstants(PyObject *d, swig_const_info constants[]) { + PyObject *obj = 0; + size_t i; + for (i = 0; constants[i].type; ++i) { + switch(constants[i].type) { + case SWIG_PY_POINTER: + obj = SWIG_InternalNewPointerObj(constants[i].pvalue, *(constants[i]).ptype,0); + break; + case SWIG_PY_BINARY: + obj = SWIG_NewPackedObj(constants[i].pvalue, constants[i].lvalue, *(constants[i].ptype)); + break; + default: + obj = 0; + break; + } + if (obj) { + PyDict_SetItemString(d, constants[i].name, obj); + Py_DECREF(obj); + } + } + } + + /* -----------------------------------------------------------------------------*/ + /* Fix SwigMethods to carry the callback ptrs when needed */ + /* -----------------------------------------------------------------------------*/ + + SWIGINTERN void + SWIG_Python_FixMethods(PyMethodDef *methods, + swig_const_info *const_table, + swig_type_info **types, + swig_type_info **types_initial) { + size_t i; + for (i = 0; methods[i].ml_name; ++i) { + const char *c = methods[i].ml_doc; + if (c && (c = strstr(c, "swig_ptr: "))) { + int j; + swig_const_info *ci = 0; + const char *name = c + 10; + for (j = 0; const_table[j].type; ++j) { + if (strncmp(const_table[j].name, name, + strlen(const_table[j].name)) == 0) { + ci = &(const_table[j]); + break; + } + } + if (ci) { + void *ptr = (ci->type == SWIG_PY_POINTER) ? ci->pvalue : 0; + if (ptr) { + size_t shift = (ci->ptype) - types; + swig_type_info *ty = types_initial[shift]; + size_t ldoc = (c - methods[i].ml_doc); + size_t lptr = strlen(ty->name)+2*sizeof(void*)+2; + char *ndoc = (char*)malloc(ldoc + lptr + 10); + if (ndoc) { + char *buff = ndoc; + strncpy(buff, methods[i].ml_doc, ldoc); + buff += ldoc; + strncpy(buff, "swig_ptr: ", 10); + buff += 10; + SWIG_PackVoidPtr(buff, ptr, ty->name, lptr); + methods[i].ml_doc = ndoc; + } + } + } + } + } + } + +#ifdef __cplusplus +} +#endif + +/* -----------------------------------------------------------------------------* + * Partial Init method + * -----------------------------------------------------------------------------*/ + +#ifdef __cplusplus +extern "C" +#endif + +SWIGEXPORT +#if PY_VERSION_HEX >= 0x03000000 +PyObject* +#else +void +#endif +SWIG_init(void) { + PyObject *m, *d, *md; +#if PY_VERSION_HEX >= 0x03000000 + static struct PyModuleDef SWIG_module = { +# if PY_VERSION_HEX >= 0x03020000 + PyModuleDef_HEAD_INIT, +# else + { + PyObject_HEAD_INIT(NULL) + NULL, /* m_init */ + 0, /* m_index */ + NULL, /* m_copy */ + }, +# endif + (char *) SWIG_name, + NULL, + -1, + SwigMethods, + NULL, + NULL, + NULL, + NULL + }; +#endif + +#if defined(SWIGPYTHON_BUILTIN) + static SwigPyClientData SwigPyObject_clientdata = { + 0, 0, 0, 0, 0, 0, 0 + }; + static PyGetSetDef this_getset_def = { + (char *)"this", &SwigPyBuiltin_ThisClosure, NULL, NULL, NULL + }; + static SwigPyGetSet thisown_getset_closure = { + (PyCFunction) SwigPyObject_own, + (PyCFunction) SwigPyObject_own + }; + static PyGetSetDef thisown_getset_def = { + (char *)"thisown", SwigPyBuiltin_GetterClosure, SwigPyBuiltin_SetterClosure, NULL, &thisown_getset_closure + }; + PyObject *metatype_args; + PyTypeObject *builtin_pytype; + int builtin_base_count; + swig_type_info *builtin_basetype; + PyObject *tuple; + PyGetSetDescrObject *static_getset; + PyTypeObject *metatype; + SwigPyClientData *cd; + PyObject *public_interface, *public_symbol; + PyObject *this_descr; + PyObject *thisown_descr; + int i; + + (void)builtin_pytype; + (void)builtin_base_count; + (void)builtin_basetype; + (void)tuple; + (void)static_getset; + + /* metatype is used to implement static member variables. */ + metatype_args = Py_BuildValue("(s(O){})", "SwigPyObjectType", &PyType_Type); + assert(metatype_args); + metatype = (PyTypeObject *) PyType_Type.tp_call((PyObject *) &PyType_Type, metatype_args, NULL); + assert(metatype); + Py_DECREF(metatype_args); + metatype->tp_setattro = (setattrofunc) &SwigPyObjectType_setattro; + assert(PyType_Ready(metatype) >= 0); +#endif + + /* Fix SwigMethods to carry the callback ptrs when needed */ + SWIG_Python_FixMethods(SwigMethods, swig_const_table, swig_types, swig_type_initial); + +#if PY_VERSION_HEX >= 0x03000000 + m = PyModule_Create(&SWIG_module); +#else + m = Py_InitModule((char *) SWIG_name, SwigMethods); +#endif + md = d = PyModule_GetDict(m); + (void)md; + + SWIG_InitializeModule(0); + +#ifdef SWIGPYTHON_BUILTIN + SwigPyObject_stype = SWIG_MangledTypeQuery("_p_SwigPyObject"); + assert(SwigPyObject_stype); + cd = (SwigPyClientData*) SwigPyObject_stype->clientdata; + if (!cd) { + SwigPyObject_stype->clientdata = &SwigPyObject_clientdata; + SwigPyObject_clientdata.pytype = SwigPyObject_TypeOnce(); + } else if (SwigPyObject_TypeOnce()->tp_basicsize != cd->pytype->tp_basicsize) { + PyErr_SetString(PyExc_RuntimeError, "Import error: attempted to load two incompatible swig-generated modules."); +# if PY_VERSION_HEX >= 0x03000000 + return NULL; +# else + return; +# endif + } + + /* All objects have a 'this' attribute */ + this_descr = PyDescr_NewGetSet(SwigPyObject_type(), &this_getset_def); + (void)this_descr; + + /* All objects have a 'thisown' attribute */ + thisown_descr = PyDescr_NewGetSet(SwigPyObject_type(), &thisown_getset_def); + (void)thisown_descr; + + public_interface = PyList_New(0); + public_symbol = 0; + (void)public_symbol; + + PyDict_SetItemString(md, "__all__", public_interface); + Py_DECREF(public_interface); + for (i = 0; SwigMethods[i].ml_name != NULL; ++i) + SwigPyBuiltin_AddPublicSymbol(public_interface, SwigMethods[i].ml_name); + for (i = 0; swig_const_table[i].name != 0; ++i) + SwigPyBuiltin_AddPublicSymbol(public_interface, swig_const_table[i].name); +#endif + + SWIG_InstallConstants(d,swig_const_table); + + SWIG_Python_SetConstant(d, "twrap_media_none",SWIG_From_int(static_cast< int >(twrap_media_none))); + SWIG_Python_SetConstant(d, "twrap_media_audio",SWIG_From_int(static_cast< int >(twrap_media_audio))); + SWIG_Python_SetConstant(d, "twrap_media_video",SWIG_From_int(static_cast< int >(twrap_media_video))); + SWIG_Python_SetConstant(d, "twrap_media_msrp",SWIG_From_int(static_cast< int >(twrap_media_msrp))); + SWIG_Python_SetConstant(d, "twrap_media_t140",SWIG_From_int(static_cast< int >(twrap_media_t140))); + SWIG_Python_SetConstant(d, "twrap_media_bfcp",SWIG_From_int(static_cast< int >(twrap_media_bfcp))); + SWIG_Python_SetConstant(d, "twrap_media_bfcp_audio",SWIG_From_int(static_cast< int >(twrap_media_bfcp_audio))); + SWIG_Python_SetConstant(d, "twrap_media_bfcp_video",SWIG_From_int(static_cast< int >(twrap_media_bfcp_video))); + SWIG_Python_SetConstant(d, "twrap_media_audiovideo",SWIG_From_int(static_cast< int >(twrap_media_audiovideo))); + SWIG_Python_SetConstant(d, "twrap_media_audio_video",SWIG_From_int(static_cast< int >(twrap_media_audio_video))); + SWIG_Python_SetConstant(d, "twrap_proxy_plugin_audio_producer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_audio_producer))); + SWIG_Python_SetConstant(d, "twrap_proxy_plugin_video_producer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_video_producer))); + SWIG_Python_SetConstant(d, "twrap_proxy_plugin_audio_consumer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_audio_consumer))); + SWIG_Python_SetConstant(d, "twrap_proxy_plugin_video_consumer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_video_consumer))); + SWIG_Python_SetConstant(d, "tsip_stack_mode_ua",SWIG_From_int(static_cast< int >(tsip_stack_mode_ua))); + SWIG_Python_SetConstant(d, "tsip_stack_mode_p2p",SWIG_From_int(static_cast< int >(tsip_stack_mode_p2p))); + SWIG_Python_SetConstant(d, "tsip_stack_mode_mediaproxy",SWIG_From_int(static_cast< int >(tsip_stack_mode_mediaproxy))); + SWIG_Python_SetConstant(d, "tsip_stack_mode_mcu",SWIG_From_int(static_cast< int >(tsip_stack_mode_mcu))); + SWIG_Python_SetConstant(d, "tsip_NONE",SWIG_From_int(static_cast< int >(tsip_NONE))); + SWIG_Python_SetConstant(d, "tsip_ACK",SWIG_From_int(static_cast< int >(tsip_ACK))); + SWIG_Python_SetConstant(d, "tsip_BYE",SWIG_From_int(static_cast< int >(tsip_BYE))); + SWIG_Python_SetConstant(d, "tsip_CANCEL",SWIG_From_int(static_cast< int >(tsip_CANCEL))); + SWIG_Python_SetConstant(d, "tsip_INVITE",SWIG_From_int(static_cast< int >(tsip_INVITE))); + SWIG_Python_SetConstant(d, "tsip_OPTIONS",SWIG_From_int(static_cast< int >(tsip_OPTIONS))); + SWIG_Python_SetConstant(d, "tsip_REGISTER",SWIG_From_int(static_cast< int >(tsip_REGISTER))); + SWIG_Python_SetConstant(d, "tsip_SUBSCRIBE",SWIG_From_int(static_cast< int >(tsip_SUBSCRIBE))); + SWIG_Python_SetConstant(d, "tsip_NOTIFY",SWIG_From_int(static_cast< int >(tsip_NOTIFY))); + SWIG_Python_SetConstant(d, "tsip_REFER",SWIG_From_int(static_cast< int >(tsip_REFER))); + SWIG_Python_SetConstant(d, "tsip_INFO",SWIG_From_int(static_cast< int >(tsip_INFO))); + SWIG_Python_SetConstant(d, "tsip_UPDATE",SWIG_From_int(static_cast< int >(tsip_UPDATE))); + SWIG_Python_SetConstant(d, "tsip_MESSAGE",SWIG_From_int(static_cast< int >(tsip_MESSAGE))); + SWIG_Python_SetConstant(d, "tsip_PUBLISH",SWIG_From_int(static_cast< int >(tsip_PUBLISH))); + SWIG_Python_SetConstant(d, "tsip_PRACK",SWIG_From_int(static_cast< int >(tsip_PRACK))); + SWIG_Python_SetConstant(d, "tsip_event_invite",SWIG_From_int(static_cast< int >(tsip_event_invite))); + SWIG_Python_SetConstant(d, "tsip_event_message",SWIG_From_int(static_cast< int >(tsip_event_message))); + SWIG_Python_SetConstant(d, "tsip_event_info",SWIG_From_int(static_cast< int >(tsip_event_info))); + SWIG_Python_SetConstant(d, "tsip_event_options",SWIG_From_int(static_cast< int >(tsip_event_options))); + SWIG_Python_SetConstant(d, "tsip_event_publish",SWIG_From_int(static_cast< int >(tsip_event_publish))); + SWIG_Python_SetConstant(d, "tsip_event_register",SWIG_From_int(static_cast< int >(tsip_event_register))); + SWIG_Python_SetConstant(d, "tsip_event_subscribe",SWIG_From_int(static_cast< int >(tsip_event_subscribe))); + SWIG_Python_SetConstant(d, "tsip_event_dialog",SWIG_From_int(static_cast< int >(tsip_event_dialog))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_transport_error",SWIG_From_int(static_cast< int >(702))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_global_error",SWIG_From_int(static_cast< int >(703))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_message_error",SWIG_From_int(static_cast< int >(704))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_incoming",SWIG_From_int(static_cast< int >(800))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_outgoing",SWIG_From_int(static_cast< int >(802))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_cancelled",SWIG_From_int(static_cast< int >(803))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_sent",SWIG_From_int(static_cast< int >(804))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_connecting",SWIG_From_int(static_cast< int >(900))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_connected",SWIG_From_int(static_cast< int >(901))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_terminating",SWIG_From_int(static_cast< int >(902))); + SWIG_Python_SetConstant(d, "tsip_event_code_dialog_terminated",SWIG_From_int(static_cast< int >(903))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_starting",SWIG_From_int(static_cast< int >(950))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_started",SWIG_From_int(static_cast< int >(951))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_stopping",SWIG_From_int(static_cast< int >(952))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_stopped",SWIG_From_int(static_cast< int >(953))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_failed_to_start",SWIG_From_int(static_cast< int >(954))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_failed_to_stop",SWIG_From_int(static_cast< int >(955))); + SWIG_Python_SetConstant(d, "tsip_event_code_stack_disconnected",SWIG_From_int(static_cast< int >(956))); + SWIG_Python_SetConstant(d, "tsip_i_newreg",SWIG_From_int(static_cast< int >(tsip_i_newreg))); + SWIG_Python_SetConstant(d, "tsip_i_register",SWIG_From_int(static_cast< int >(tsip_i_register))); + SWIG_Python_SetConstant(d, "tsip_ao_register",SWIG_From_int(static_cast< int >(tsip_ao_register))); + SWIG_Python_SetConstant(d, "tsip_i_unregister",SWIG_From_int(static_cast< int >(tsip_i_unregister))); + SWIG_Python_SetConstant(d, "tsip_ao_unregister",SWIG_From_int(static_cast< int >(tsip_ao_unregister))); + SWIG_Python_SetConstant(d, "tsip_i_subscribe",SWIG_From_int(static_cast< int >(tsip_i_subscribe))); + SWIG_Python_SetConstant(d, "tsip_ao_subscribe",SWIG_From_int(static_cast< int >(tsip_ao_subscribe))); + SWIG_Python_SetConstant(d, "tsip_i_unsubscribe",SWIG_From_int(static_cast< int >(tsip_i_unsubscribe))); + SWIG_Python_SetConstant(d, "tsip_ao_unsubscribe",SWIG_From_int(static_cast< int >(tsip_ao_unsubscribe))); + SWIG_Python_SetConstant(d, "tsip_i_notify",SWIG_From_int(static_cast< int >(tsip_i_notify))); + SWIG_Python_SetConstant(d, "tsip_ao_notify",SWIG_From_int(static_cast< int >(tsip_ao_notify))); + SWIG_Python_SetConstant(d, "tsip_i_publish",SWIG_From_int(static_cast< int >(tsip_i_publish))); + SWIG_Python_SetConstant(d, "tsip_ao_publish",SWIG_From_int(static_cast< int >(tsip_ao_publish))); + SWIG_Python_SetConstant(d, "tsip_i_unpublish",SWIG_From_int(static_cast< int >(tsip_i_unpublish))); + SWIG_Python_SetConstant(d, "tsip_ao_unpublish",SWIG_From_int(static_cast< int >(tsip_ao_unpublish))); + SWIG_Python_SetConstant(d, "tsip_i_message",SWIG_From_int(static_cast< int >(tsip_i_message))); + SWIG_Python_SetConstant(d, "tsip_ao_message",SWIG_From_int(static_cast< int >(tsip_ao_message))); + SWIG_Python_SetConstant(d, "tsip_i_info",SWIG_From_int(static_cast< int >(tsip_i_info))); + SWIG_Python_SetConstant(d, "tsip_ao_info",SWIG_From_int(static_cast< int >(tsip_ao_info))); + SWIG_Python_SetConstant(d, "tsip_i_options",SWIG_From_int(static_cast< int >(tsip_i_options))); + SWIG_Python_SetConstant(d, "tsip_ao_options",SWIG_From_int(static_cast< int >(tsip_ao_options))); + SWIG_Python_SetConstant(d, "tsip_i_newcall",SWIG_From_int(static_cast< int >(tsip_i_newcall))); + SWIG_Python_SetConstant(d, "tsip_i_request",SWIG_From_int(static_cast< int >(tsip_i_request))); + SWIG_Python_SetConstant(d, "tsip_ao_request",SWIG_From_int(static_cast< int >(tsip_ao_request))); + SWIG_Python_SetConstant(d, "tsip_o_ect_trying",SWIG_From_int(static_cast< int >(tsip_o_ect_trying))); + SWIG_Python_SetConstant(d, "tsip_o_ect_accepted",SWIG_From_int(static_cast< int >(tsip_o_ect_accepted))); + SWIG_Python_SetConstant(d, "tsip_o_ect_completed",SWIG_From_int(static_cast< int >(tsip_o_ect_completed))); + SWIG_Python_SetConstant(d, "tsip_o_ect_failed",SWIG_From_int(static_cast< int >(tsip_o_ect_failed))); + SWIG_Python_SetConstant(d, "tsip_o_ect_notify",SWIG_From_int(static_cast< int >(tsip_o_ect_notify))); + SWIG_Python_SetConstant(d, "tsip_i_ect_requested",SWIG_From_int(static_cast< int >(tsip_i_ect_requested))); + SWIG_Python_SetConstant(d, "tsip_i_ect_newcall",SWIG_From_int(static_cast< int >(tsip_i_ect_newcall))); + SWIG_Python_SetConstant(d, "tsip_i_ect_completed",SWIG_From_int(static_cast< int >(tsip_i_ect_completed))); + SWIG_Python_SetConstant(d, "tsip_i_ect_failed",SWIG_From_int(static_cast< int >(tsip_i_ect_failed))); + SWIG_Python_SetConstant(d, "tsip_i_ect_notify",SWIG_From_int(static_cast< int >(tsip_i_ect_notify))); + SWIG_Python_SetConstant(d, "tsip_m_early_media",SWIG_From_int(static_cast< int >(tsip_m_early_media))); + SWIG_Python_SetConstant(d, "tsip_m_updating",SWIG_From_int(static_cast< int >(tsip_m_updating))); + SWIG_Python_SetConstant(d, "tsip_m_updated",SWIG_From_int(static_cast< int >(tsip_m_updated))); + SWIG_Python_SetConstant(d, "tsip_m_local_hold_ok",SWIG_From_int(static_cast< int >(tsip_m_local_hold_ok))); + SWIG_Python_SetConstant(d, "tsip_m_local_hold_nok",SWIG_From_int(static_cast< int >(tsip_m_local_hold_nok))); + SWIG_Python_SetConstant(d, "tsip_m_local_resume_ok",SWIG_From_int(static_cast< int >(tsip_m_local_resume_ok))); + SWIG_Python_SetConstant(d, "tsip_m_local_resume_nok",SWIG_From_int(static_cast< int >(tsip_m_local_resume_nok))); + SWIG_Python_SetConstant(d, "tsip_m_remote_hold",SWIG_From_int(static_cast< int >(tsip_m_remote_hold))); + SWIG_Python_SetConstant(d, "tsip_m_remote_resume",SWIG_From_int(static_cast< int >(tsip_m_remote_resume))); + SWIG_Python_SetConstant(d, "tmedia_qos_stype_none",SWIG_From_int(static_cast< int >(tmedia_qos_stype_none))); + SWIG_Python_SetConstant(d, "tmedia_qos_stype_segmented",SWIG_From_int(static_cast< int >(tmedia_qos_stype_segmented))); + SWIG_Python_SetConstant(d, "tmedia_qos_stype_e2e",SWIG_From_int(static_cast< int >(tmedia_qos_stype_e2e))); + SWIG_Python_SetConstant(d, "tmedia_qos_strength_none",SWIG_From_int(static_cast< int >(tmedia_qos_strength_none))); + SWIG_Python_SetConstant(d, "tmedia_qos_strength_failure",SWIG_From_int(static_cast< int >(tmedia_qos_strength_failure))); + SWIG_Python_SetConstant(d, "tmedia_qos_strength_unknown",SWIG_From_int(static_cast< int >(tmedia_qos_strength_unknown))); + SWIG_Python_SetConstant(d, "tmedia_qos_strength_optional",SWIG_From_int(static_cast< int >(tmedia_qos_strength_optional))); + SWIG_Python_SetConstant(d, "tmedia_qos_strength_mandatory",SWIG_From_int(static_cast< int >(tmedia_qos_strength_mandatory))); + SWIG_Python_SetConstant(d, "tmedia_chroma_none",SWIG_From_int(static_cast< int >(tmedia_chroma_none))); + SWIG_Python_SetConstant(d, "tmedia_chroma_rgb24",SWIG_From_int(static_cast< int >(tmedia_chroma_rgb24))); + SWIG_Python_SetConstant(d, "tmedia_chroma_bgr24",SWIG_From_int(static_cast< int >(tmedia_chroma_bgr24))); + SWIG_Python_SetConstant(d, "tmedia_chroma_rgb32",SWIG_From_int(static_cast< int >(tmedia_chroma_rgb32))); + SWIG_Python_SetConstant(d, "tmedia_chroma_rgb565le",SWIG_From_int(static_cast< int >(tmedia_chroma_rgb565le))); + SWIG_Python_SetConstant(d, "tmedia_chroma_rgb565be",SWIG_From_int(static_cast< int >(tmedia_chroma_rgb565be))); + SWIG_Python_SetConstant(d, "tmedia_chroma_nv12",SWIG_From_int(static_cast< int >(tmedia_chroma_nv12))); + SWIG_Python_SetConstant(d, "tmedia_chroma_nv21",SWIG_From_int(static_cast< int >(tmedia_chroma_nv21))); + SWIG_Python_SetConstant(d, "tmedia_chroma_yuv422p",SWIG_From_int(static_cast< int >(tmedia_chroma_yuv422p))); + SWIG_Python_SetConstant(d, "tmedia_chroma_uyvy422",SWIG_From_int(static_cast< int >(tmedia_chroma_uyvy422))); + SWIG_Python_SetConstant(d, "tmedia_chroma_yuv420p",SWIG_From_int(static_cast< int >(tmedia_chroma_yuv420p))); + SWIG_Python_SetConstant(d, "tmedia_chroma_mjpeg",SWIG_From_int(static_cast< int >(tmedia_chroma_mjpeg))); + SWIG_Python_SetConstant(d, "tmedia_chroma_yuyv422",SWIG_From_int(static_cast< int >(tmedia_chroma_yuyv422))); + SWIG_Python_SetConstant(d, "tmedia_mode_none",SWIG_From_int(static_cast< int >(tmedia_mode_none))); + SWIG_Python_SetConstant(d, "tmedia_mode_optional",SWIG_From_int(static_cast< int >(tmedia_mode_optional))); + SWIG_Python_SetConstant(d, "tmedia_mode_mandatory",SWIG_From_int(static_cast< int >(tmedia_mode_mandatory))); + SWIG_Python_SetConstant(d, "tmedia_srtp_mode_none",SWIG_From_int(static_cast< int >(tmedia_srtp_mode_none))); + SWIG_Python_SetConstant(d, "tmedia_srtp_mode_optional",SWIG_From_int(static_cast< int >(tmedia_srtp_mode_optional))); + SWIG_Python_SetConstant(d, "tmedia_srtp_mode_mandatory",SWIG_From_int(static_cast< int >(tmedia_srtp_mode_mandatory))); + SWIG_Python_SetConstant(d, "tmedia_srtp_type_none",SWIG_From_int(static_cast< int >(tmedia_srtp_type_none))); + SWIG_Python_SetConstant(d, "tmedia_srtp_type_sdes",SWIG_From_int(static_cast< int >(tmedia_srtp_type_sdes))); + SWIG_Python_SetConstant(d, "tmedia_srtp_type_dtls",SWIG_From_int(static_cast< int >(tmedia_srtp_type_dtls))); + SWIG_Python_SetConstant(d, "tmedia_srtp_type_sdes_dtls",SWIG_From_int(static_cast< int >(tmedia_srtp_type_sdes_dtls))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_utf8",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_utf8))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_zero_width_no_break_space",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_zero_width_no_break_space))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_backspace",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_backspace))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_esc",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_esc))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_cr",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_cr))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_lf",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_lf))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_cr_lf",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_cr_lf))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_interrupt2",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_interrupt2))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_bell",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_bell))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_sos",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_sos))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_string_term",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_string_term))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_graphic_start",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_graphic_start))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_graphic_end",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_graphic_end))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_loss_char_char",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_loss_char_char))); + SWIG_Python_SetConstant(d, "tmedia_t140_data_type_loss_utf8",SWIG_From_int(static_cast< int >(tmedia_t140_data_type_loss_utf8))); + SWIG_Python_SetConstant(d, "tmedia_profile_default",SWIG_From_int(static_cast< int >(tmedia_profile_default))); + SWIG_Python_SetConstant(d, "tmedia_profile_rtcweb",SWIG_From_int(static_cast< int >(tmedia_profile_rtcweb))); + SWIG_Python_SetConstant(d, "tmedia_bl_low",SWIG_From_int(static_cast< int >(tmedia_bl_low))); + SWIG_Python_SetConstant(d, "tmedia_bl_medium",SWIG_From_int(static_cast< int >(tmedia_bl_medium))); + SWIG_Python_SetConstant(d, "tmedia_bl_hight",SWIG_From_int(static_cast< int >(tmedia_bl_hight))); + SWIG_Python_SetConstant(d, "tmedia_bl_unrestricted",SWIG_From_int(static_cast< int >(tmedia_bl_unrestricted))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_sqcif",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_sqcif))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_qcif",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_qcif))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_qvga",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_qvga))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_cif",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_cif))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_hvga",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_hvga))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_vga",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_vga))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_4cif",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_4cif))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_wvga",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_wvga))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_svga",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_svga))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_480p",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_480p))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_xga",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_xga))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_720p",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_720p))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_16cif",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_16cif))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_1080p",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_1080p))); + SWIG_Python_SetConstant(d, "tmedia_pref_video_size_2160p",SWIG_From_int(static_cast< int >(tmedia_pref_video_size_2160p))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_none",SWIG_From_int(static_cast< int >(tmedia_codec_id_none))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_amr_nb_oa",SWIG_From_int(static_cast< int >(tmedia_codec_id_amr_nb_oa))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_amr_nb_be",SWIG_From_int(static_cast< int >(tmedia_codec_id_amr_nb_be))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_amr_wb_oa",SWIG_From_int(static_cast< int >(tmedia_codec_id_amr_wb_oa))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_amr_wb_be",SWIG_From_int(static_cast< int >(tmedia_codec_id_amr_wb_be))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_gsm",SWIG_From_int(static_cast< int >(tmedia_codec_id_gsm))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_pcma",SWIG_From_int(static_cast< int >(tmedia_codec_id_pcma))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_pcmu",SWIG_From_int(static_cast< int >(tmedia_codec_id_pcmu))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_ilbc",SWIG_From_int(static_cast< int >(tmedia_codec_id_ilbc))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_speex_nb",SWIG_From_int(static_cast< int >(tmedia_codec_id_speex_nb))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_speex_wb",SWIG_From_int(static_cast< int >(tmedia_codec_id_speex_wb))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_speex_uwb",SWIG_From_int(static_cast< int >(tmedia_codec_id_speex_uwb))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_bv16",SWIG_From_int(static_cast< int >(tmedia_codec_id_bv16))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_bv32",SWIG_From_int(static_cast< int >(tmedia_codec_id_bv32))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_opus",SWIG_From_int(static_cast< int >(tmedia_codec_id_opus))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_g729ab",SWIG_From_int(static_cast< int >(tmedia_codec_id_g729ab))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_g722",SWIG_From_int(static_cast< int >(tmedia_codec_id_g722))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h261",SWIG_From_int(static_cast< int >(tmedia_codec_id_h261))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h263",SWIG_From_int(static_cast< int >(tmedia_codec_id_h263))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h263p",SWIG_From_int(static_cast< int >(tmedia_codec_id_h263p))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h263pp",SWIG_From_int(static_cast< int >(tmedia_codec_id_h263pp))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_bp",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_bp))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_mp",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_mp))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_hp",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_hp))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_bp10",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_bp10))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_bp20",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_bp20))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_bp30",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_bp30))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_h264_svc",SWIG_From_int(static_cast< int >(tmedia_codec_id_h264_svc))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_theora",SWIG_From_int(static_cast< int >(tmedia_codec_id_theora))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_mp4ves_es",SWIG_From_int(static_cast< int >(tmedia_codec_id_mp4ves_es))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_vp8",SWIG_From_int(static_cast< int >(tmedia_codec_id_vp8))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_t140",SWIG_From_int(static_cast< int >(tmedia_codec_id_t140))); + SWIG_Python_SetConstant(d, "tmedia_codec_id_red",SWIG_From_int(static_cast< int >(tmedia_codec_id_red))); + SWIG_Python_SetConstant(d, "tdav_codec_id_none",SWIG_From_int(static_cast< int >(tdav_codec_id_none))); + SWIG_Python_SetConstant(d, "tdav_codec_id_amr_nb_oa",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_nb_oa))); + SWIG_Python_SetConstant(d, "tdav_codec_id_amr_nb_be",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_nb_be))); + SWIG_Python_SetConstant(d, "tdav_codec_id_amr_wb_oa",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_wb_oa))); + SWIG_Python_SetConstant(d, "tdav_codec_id_amr_wb_be",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_wb_be))); + SWIG_Python_SetConstant(d, "tdav_codec_id_gsm",SWIG_From_int(static_cast< int >(tdav_codec_id_gsm))); + SWIG_Python_SetConstant(d, "tdav_codec_id_pcma",SWIG_From_int(static_cast< int >(tdav_codec_id_pcma))); + SWIG_Python_SetConstant(d, "tdav_codec_id_pcmu",SWIG_From_int(static_cast< int >(tdav_codec_id_pcmu))); + SWIG_Python_SetConstant(d, "tdav_codec_id_ilbc",SWIG_From_int(static_cast< int >(tdav_codec_id_ilbc))); + SWIG_Python_SetConstant(d, "tdav_codec_id_speex_nb",SWIG_From_int(static_cast< int >(tdav_codec_id_speex_nb))); + SWIG_Python_SetConstant(d, "tdav_codec_id_speex_wb",SWIG_From_int(static_cast< int >(tdav_codec_id_speex_wb))); + SWIG_Python_SetConstant(d, "tdav_codec_id_speex_uwb",SWIG_From_int(static_cast< int >(tdav_codec_id_speex_uwb))); + SWIG_Python_SetConstant(d, "tdav_codec_id_bv16",SWIG_From_int(static_cast< int >(tdav_codec_id_bv16))); + SWIG_Python_SetConstant(d, "tdav_codec_id_bv32",SWIG_From_int(static_cast< int >(tdav_codec_id_bv32))); + SWIG_Python_SetConstant(d, "tdav_codec_id_opus",SWIG_From_int(static_cast< int >(tdav_codec_id_opus))); + SWIG_Python_SetConstant(d, "tdav_codec_id_g729ab",SWIG_From_int(static_cast< int >(tdav_codec_id_g729ab))); + SWIG_Python_SetConstant(d, "tdav_codec_id_g722",SWIG_From_int(static_cast< int >(tdav_codec_id_g722))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h261",SWIG_From_int(static_cast< int >(tdav_codec_id_h261))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h263",SWIG_From_int(static_cast< int >(tdav_codec_id_h263))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h263p",SWIG_From_int(static_cast< int >(tdav_codec_id_h263p))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h263pp",SWIG_From_int(static_cast< int >(tdav_codec_id_h263pp))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_mp",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_mp))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_hp",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_hp))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp10",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp10))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp20",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp20))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp30",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp30))); + SWIG_Python_SetConstant(d, "tdav_codec_id_h264_svc",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_svc))); + SWIG_Python_SetConstant(d, "tdav_codec_id_theora",SWIG_From_int(static_cast< int >(tdav_codec_id_theora))); + SWIG_Python_SetConstant(d, "tdav_codec_id_mp4ves_es",SWIG_From_int(static_cast< int >(tdav_codec_id_mp4ves_es))); + SWIG_Python_SetConstant(d, "tdav_codec_id_vp8",SWIG_From_int(static_cast< int >(tdav_codec_id_vp8))); + SWIG_Python_SetConstant(d, "tdav_codec_id_t140",SWIG_From_int(static_cast< int >(tdav_codec_id_t140))); + SWIG_Python_SetConstant(d, "tdav_codec_id_red",SWIG_From_int(static_cast< int >(tdav_codec_id_red))); + SWIG_Python_SetConstant(d, "thttp_event_dialog_started",SWIG_From_int(static_cast< int >(thttp_event_dialog_started))); + SWIG_Python_SetConstant(d, "thttp_event_message",SWIG_From_int(static_cast< int >(thttp_event_message))); + SWIG_Python_SetConstant(d, "thttp_event_auth_failed",SWIG_From_int(static_cast< int >(thttp_event_auth_failed))); + SWIG_Python_SetConstant(d, "thttp_event_closed",SWIG_From_int(static_cast< int >(thttp_event_closed))); + SWIG_Python_SetConstant(d, "thttp_event_transport_error",SWIG_From_int(static_cast< int >(thttp_event_transport_error))); + SWIG_Python_SetConstant(d, "thttp_event_dialog_terminated",SWIG_From_int(static_cast< int >(thttp_event_dialog_terminated))); + SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_none",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_none))); + SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_submit",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_submit))); + SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_deliver",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_deliver))); + SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_ack",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_ack))); + SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_error",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_error))); + SWIG_Python_SetConstant(d, "twrap_sms_type_none",SWIG_From_int(static_cast< int >(twrap_sms_type_none))); + SWIG_Python_SetConstant(d, "twrap_sms_type_rpdata",SWIG_From_int(static_cast< int >(twrap_sms_type_rpdata))); + SWIG_Python_SetConstant(d, "twrap_sms_type_smma",SWIG_From_int(static_cast< int >(twrap_sms_type_smma))); + SWIG_Python_SetConstant(d, "twrap_sms_type_ack",SWIG_From_int(static_cast< int >(twrap_sms_type_ack))); + SWIG_Python_SetConstant(d, "twrap_sms_type_error",SWIG_From_int(static_cast< int >(twrap_sms_type_error))); + SWIG_Python_SetConstant(d, "tmsrp_NONE",SWIG_From_int(static_cast< int >(tmsrp_NONE))); + SWIG_Python_SetConstant(d, "tmsrp_SEND",SWIG_From_int(static_cast< int >(tmsrp_SEND))); + SWIG_Python_SetConstant(d, "tmsrp_REPORT",SWIG_From_int(static_cast< int >(tmsrp_REPORT))); + SWIG_Python_SetConstant(d, "tmsrp_AUTH",SWIG_From_int(static_cast< int >(tmsrp_AUTH))); + SWIG_Python_SetConstant(d, "tmsrp_event_type_none",SWIG_From_int(static_cast< int >(tmsrp_event_type_none))); + SWIG_Python_SetConstant(d, "tmsrp_event_type_connected",SWIG_From_int(static_cast< int >(tmsrp_event_type_connected))); + SWIG_Python_SetConstant(d, "tmsrp_event_type_disconnected",SWIG_From_int(static_cast< int >(tmsrp_event_type_disconnected))); + SWIG_Python_SetConstant(d, "tmsrp_event_type_message",SWIG_From_int(static_cast< int >(tmsrp_event_type_message))); +#if PY_VERSION_HEX >= 0x03000000 + return m; +#else + return; +#endif +} + diff --git a/bindings/python/tinyWRAP_wrap.h b/bindings/python/tinyWRAP_wrap.h new file mode 100644 index 0000000..4a768eb --- /dev/null +++ b/bindings/python/tinyWRAP_wrap.h @@ -0,0 +1,495 @@ +/* ---------------------------------------------------------------------------- + * This file was automatically generated by SWIG (http://www.swig.org). + * Version 2.0.9 + * + * This file is not intended to be easily readable and contains a number of + * coding conventions designed to improve portability and efficiency. Do not make + * changes to this file unless you know what you are doing--modify the SWIG + * interface file instead. + * ----------------------------------------------------------------------------- */ + +#ifndef SWIG_tinyWRAP_WRAP_H_ +#define SWIG_tinyWRAP_WRAP_H_ + +#include <map> +#include <string> + + +class SwigDirector_DDebugCallback : public DDebugCallback, public Swig::Director { + +public: + SwigDirector_DDebugCallback(PyObject *self); + virtual ~SwigDirector_DDebugCallback(); + virtual int OnDebugInfo(char const *message); + virtual int OnDebugWarn(char const *message); + virtual int OnDebugError(char const *message); + virtual int OnDebugFatal(char const *message); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class DDebugCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[4]; +#endif + +}; + + +class SwigDirector_T140Callback : public T140Callback, public Swig::Director { + +public: + SwigDirector_T140Callback(PyObject *self); + virtual ~SwigDirector_T140Callback(); + virtual int ondata(T140CallbackData const *pData); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class T140Callback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[1]; +#endif + +}; + + +class SwigDirector_ProxyPluginMgrCallback : public ProxyPluginMgrCallback, public Swig::Director { + +public: + SwigDirector_ProxyPluginMgrCallback(PyObject *self); + virtual ~SwigDirector_ProxyPluginMgrCallback(); + virtual int OnPluginCreated(uint64_t id, enum twrap_proxy_plugin_type_e type); + virtual int OnPluginDestroyed(uint64_t id, enum twrap_proxy_plugin_type_e type); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class ProxyPluginMgrCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[2]; +#endif + +}; + + +class SwigDirector_ProxyAudioConsumerCallback : public ProxyAudioConsumerCallback, public Swig::Director { + +public: + SwigDirector_ProxyAudioConsumerCallback(PyObject *self); + virtual ~SwigDirector_ProxyAudioConsumerCallback(); + virtual int prepare(int ptime, int rate, int channels); + virtual int start(); + virtual int pause(); + virtual int stop(); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class ProxyAudioConsumerCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[4]; +#endif + +}; + + +class SwigDirector_ProxyVideoConsumerCallback : public ProxyVideoConsumerCallback, public Swig::Director { + +public: + SwigDirector_ProxyVideoConsumerCallback(PyObject *self); + virtual ~SwigDirector_ProxyVideoConsumerCallback(); + virtual int prepare(int nWidth, int nHeight, int nFps); + virtual int consume(ProxyVideoFrame const *frame); + virtual int bufferCopied(unsigned int nCopiedSize, unsigned int nAvailableSize); + virtual int start(); + virtual int pause(); + virtual int stop(); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class ProxyVideoConsumerCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[6]; +#endif + +}; + + +class SwigDirector_ProxyAudioProducerCallback : public ProxyAudioProducerCallback, public Swig::Director { + +public: + SwigDirector_ProxyAudioProducerCallback(PyObject *self); + virtual ~SwigDirector_ProxyAudioProducerCallback(); + virtual int prepare(int ptime, int rate, int channels); + virtual int start(); + virtual int pause(); + virtual int stop(); + virtual int fillPushBuffer(); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class ProxyAudioProducerCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[5]; +#endif + +}; + + +class SwigDirector_ProxyVideoProducerCallback : public ProxyVideoProducerCallback, public Swig::Director { + +public: + SwigDirector_ProxyVideoProducerCallback(PyObject *self); + virtual ~SwigDirector_ProxyVideoProducerCallback(); + virtual int prepare(int width, int height, int fps); + virtual int start(); + virtual int pause(); + virtual int stop(); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class ProxyVideoProducerCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[4]; +#endif + +}; + + +class SwigDirector_SipCallback : public SipCallback, public Swig::Director { + +public: + SwigDirector_SipCallback(PyObject *self); + virtual ~SwigDirector_SipCallback(); + virtual int OnDialogEvent(DialogEvent const *e); + virtual int OnStackEvent(StackEvent const *e); + virtual int OnInviteEvent(InviteEvent const *e); + virtual int OnMessagingEvent(MessagingEvent const *e); + virtual int OnInfoEvent(InfoEvent const *e); + virtual int OnOptionsEvent(OptionsEvent const *e); + virtual int OnPublicationEvent(PublicationEvent const *e); + virtual int OnRegistrationEvent(RegistrationEvent const *e); + virtual int OnSubscriptionEvent(SubscriptionEvent const *e); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class SipCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[9]; +#endif + +}; + + +class SwigDirector_XcapCallback : public XcapCallback, public Swig::Director { + +public: + SwigDirector_XcapCallback(PyObject *self); + virtual ~SwigDirector_XcapCallback(); + virtual int onEvent(XcapEvent const *e) const; + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class XcapCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[1]; +#endif + +}; + + +class SwigDirector_MsrpCallback : public MsrpCallback, public Swig::Director { + +public: + SwigDirector_MsrpCallback(PyObject *self); + virtual ~SwigDirector_MsrpCallback(); + virtual int OnEvent(MsrpEvent const *e); + + +/* Internal Director utilities */ +public: + bool swig_get_inner(const char* swig_protected_method_name) const { + std::map<std::string, bool>::const_iterator iv = swig_inner.find(swig_protected_method_name); + return (iv != swig_inner.end() ? iv->second : false); + } + + void swig_set_inner(const char* swig_protected_method_name, bool val) const + { swig_inner[swig_protected_method_name] = val;} + +private: + mutable std::map<std::string, bool> swig_inner; + + +#if defined(SWIG_PYTHON_DIRECTOR_VTABLE) +/* VTable implementation */ + PyObject *swig_get_method(size_t method_index, const char *method_name) const { + PyObject *method = vtable[method_index]; + if (!method) { + swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name); + method = PyObject_GetAttr(swig_get_self(), name); + if (!method) { + std::string msg = "Method in class MsrpCallback doesn't exist, undefined "; + msg += method_name; + Swig::DirectorMethodException::raise(msg.c_str()); + } + vtable[method_index] = method; + } + return method; + } +private: + mutable swig::SwigVar_PyObject vtable[1]; +#endif + +}; + + +#endif |