summaryrefslogtreecommitdiffstats
path: root/bindings/python
diff options
context:
space:
mode:
Diffstat (limited to 'bindings/python')
-rw-r--r--bindings/python/python.i7
-rw-r--r--bindings/python/tinyWRAP.py1381
-rw-r--r--bindings/python/tinyWRAP_wrap.cxx19464
-rw-r--r--bindings/python/tinyWRAP_wrap.h447
4 files changed, 21299 insertions, 0 deletions
diff --git a/bindings/python/python.i b/bindings/python/python.i
new file mode 100644
index 0000000..bfe7b91
--- /dev/null
+++ b/bindings/python/python.i
@@ -0,0 +1,7 @@
+/* File : python.i */
+
+/* http://www.swig.org/Doc1.3/Library.html#Library_carrays
+* 8.3.2 Passing binary data */
+%apply (char *STRING, int LENGTH) { (const void* buffer, int len) };
+
+%include ../_common/tinyWRAP.i
diff --git a/bindings/python/tinyWRAP.py b/bindings/python/tinyWRAP.py
new file mode 100644
index 0000000..8b4b9c7
--- /dev/null
+++ b/bindings/python/tinyWRAP.py
@@ -0,0 +1,1381 @@
+# This file was automatically generated by SWIG (http://www.swig.org).
+# Version 1.3.39
+#
+# Do not make changes to this file unless you know what you are doing--modify
+# the SWIG interface file instead.
+# This file is compatible with both classic and new-style classes.
+
+from sys import version_info
+if version_info >= (2,6,0):
+ def swig_import_helper():
+ from os.path import dirname
+ import imp
+ try:
+ fp, pathname, description = imp.find_module('_tinyWRAP', [dirname(__file__)])
+ _mod = imp.load_module('_tinyWRAP', fp, pathname, description)
+ finally:
+ if fp is not None: fp.close()
+ return _mod
+ _tinyWRAP = swig_import_helper()
+ del swig_import_helper
+else:
+ import _tinyWRAP
+del version_info
+try:
+ _swig_property = property
+except NameError:
+ pass # Python < 2.2 doesn't have 'property'.
+def _swig_setattr_nondynamic(self,class_type,name,value,static=1):
+ if (name == "thisown"): return self.this.own(value)
+ if (name == "this"):
+ if type(value).__name__ == 'SwigPyObject':
+ self.__dict__[name] = value
+ return
+ method = class_type.__swig_setmethods__.get(name,None)
+ if method: return method(self,value)
+ if (not static) or hasattr(self,name):
+ self.__dict__[name] = value
+ else:
+ raise AttributeError("You cannot add attributes to %s" % self)
+
+def _swig_setattr(self,class_type,name,value):
+ return _swig_setattr_nondynamic(self,class_type,name,value,0)
+
+def _swig_getattr(self,class_type,name):
+ if (name == "thisown"): return self.this.own()
+ method = class_type.__swig_getmethods__.get(name,None)
+ if method: return method(self)
+ raise AttributeError(name)
+
+def _swig_repr(self):
+ try: strthis = "proxy of " + self.this.__repr__()
+ except: strthis = ""
+ return "<%s.%s; %s >" % (self.__class__.__module__, self.__class__.__name__, strthis,)
+
+try:
+ _object = object
+ _newclass = 1
+except AttributeError:
+ class _object : pass
+ _newclass = 0
+
+
+try:
+ import weakref
+ weakref_proxy = weakref.proxy
+except:
+ weakref_proxy = lambda x: x
+
+
+class DDebugCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, DDebugCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, DDebugCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == DDebugCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_DDebugCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_DDebugCallback
+ __del__ = lambda self : None;
+ def OnDebugInfo(self, *args): return _tinyWRAP.DDebugCallback_OnDebugInfo(self, *args)
+ def OnDebugWarn(self, *args): return _tinyWRAP.DDebugCallback_OnDebugWarn(self, *args)
+ def OnDebugError(self, *args): return _tinyWRAP.DDebugCallback_OnDebugError(self, *args)
+ def OnDebugFatal(self, *args): return _tinyWRAP.DDebugCallback_OnDebugFatal(self, *args)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_DDebugCallback(self)
+ return weakref_proxy(self)
+DDebugCallback_swigregister = _tinyWRAP.DDebugCallback_swigregister
+DDebugCallback_swigregister(DDebugCallback)
+
+twrap_media_none = _tinyWRAP.twrap_media_none
+twrap_media_audio = _tinyWRAP.twrap_media_audio
+twrap_media_video = _tinyWRAP.twrap_media_video
+twrap_media_audiovideo = _tinyWRAP.twrap_media_audiovideo
+twrap_media_msrp = _tinyWRAP.twrap_media_msrp
+class ActionConfig(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ActionConfig, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ActionConfig, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_ActionConfig()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_ActionConfig
+ __del__ = lambda self : None;
+ def addHeader(self, *args): return _tinyWRAP.ActionConfig_addHeader(self, *args)
+ def setResponseLine(self, *args): return _tinyWRAP.ActionConfig_setResponseLine(self, *args)
+ def setMediaString(self, *args): return _tinyWRAP.ActionConfig_setMediaString(self, *args)
+ def setMediaInt(self, *args): return _tinyWRAP.ActionConfig_setMediaInt(self, *args)
+ActionConfig_swigregister = _tinyWRAP.ActionConfig_swigregister
+ActionConfig_swigregister(ActionConfig)
+
+class MediaSessionMgr(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MediaSessionMgr, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, MediaSessionMgr, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_MediaSessionMgr
+ __del__ = lambda self : None;
+ def sessionSetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_sessionSetInt32(self, *args)
+ def consumerSetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_consumerSetInt32(self, *args)
+ def consumerSetInt64(self, *args): return _tinyWRAP.MediaSessionMgr_consumerSetInt64(self, *args)
+ def producerSetInt32(self, *args): return _tinyWRAP.MediaSessionMgr_producerSetInt32(self, *args)
+ def producerSetInt64(self, *args): return _tinyWRAP.MediaSessionMgr_producerSetInt64(self, *args)
+ def findProxyPluginConsumer(self, *args): return _tinyWRAP.MediaSessionMgr_findProxyPluginConsumer(self, *args)
+ def findProxyPluginProducer(self, *args): return _tinyWRAP.MediaSessionMgr_findProxyPluginProducer(self, *args)
+MediaSessionMgr_swigregister = _tinyWRAP.MediaSessionMgr_swigregister
+MediaSessionMgr_swigregister(MediaSessionMgr)
+
+class MediaContent(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MediaContent, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, MediaContent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_MediaContent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.MediaContent_getType(self)
+ def getDataLength(self): return _tinyWRAP.MediaContent_getDataLength(self)
+ def getData(self, *args): return _tinyWRAP.MediaContent_getData(self, *args)
+ __swig_getmethods__["parse"] = lambda x: _tinyWRAP.MediaContent_parse
+ if _newclass:parse = staticmethod(_tinyWRAP.MediaContent_parse)
+ def getPayloadLength(self): return _tinyWRAP.MediaContent_getPayloadLength(self)
+ def getPayload(self, *args): return _tinyWRAP.MediaContent_getPayload(self, *args)
+MediaContent_swigregister = _tinyWRAP.MediaContent_swigregister
+MediaContent_swigregister(MediaContent)
+
+def MediaContent_parse(*args):
+ return _tinyWRAP.MediaContent_parse(*args)
+MediaContent_parse = _tinyWRAP.MediaContent_parse
+
+class MediaContentCPIM(MediaContent):
+ __swig_setmethods__ = {}
+ for _s in [MediaContent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MediaContentCPIM, name, value)
+ __swig_getmethods__ = {}
+ for _s in [MediaContent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, MediaContentCPIM, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_MediaContentCPIM
+ __del__ = lambda self : None;
+ def getPayloadLength(self): return _tinyWRAP.MediaContentCPIM_getPayloadLength(self)
+ def getPayload(self, *args): return _tinyWRAP.MediaContentCPIM_getPayload(self, *args)
+ def getHeaderValue(self, *args): return _tinyWRAP.MediaContentCPIM_getHeaderValue(self, *args)
+MediaContentCPIM_swigregister = _tinyWRAP.MediaContentCPIM_swigregister
+MediaContentCPIM_swigregister(MediaContentCPIM)
+
+class SipUri(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SipUri, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SipUri, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_SipUri(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SipUri
+ __del__ = lambda self : None;
+ def isValid(self, *args): return _tinyWRAP.SipUri_isValid(self, *args)
+ def getScheme(self): return _tinyWRAP.SipUri_getScheme(self)
+ def getHost(self): return _tinyWRAP.SipUri_getHost(self)
+ def getPort(self): return _tinyWRAP.SipUri_getPort(self)
+ def getUserName(self): return _tinyWRAP.SipUri_getUserName(self)
+ def getPassword(self): return _tinyWRAP.SipUri_getPassword(self)
+ def getDisplayName(self): return _tinyWRAP.SipUri_getDisplayName(self)
+ def getParamValue(self, *args): return _tinyWRAP.SipUri_getParamValue(self, *args)
+SipUri_swigregister = _tinyWRAP.SipUri_swigregister
+SipUri_swigregister(SipUri)
+
+class SdpMessage(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SdpMessage, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SdpMessage, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_SdpMessage()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SdpMessage
+ __del__ = lambda self : None;
+ def getSdpHeaderValue(self, *args): return _tinyWRAP.SdpMessage_getSdpHeaderValue(self, *args)
+ def getSdpHeaderAValue(self, *args): return _tinyWRAP.SdpMessage_getSdpHeaderAValue(self, *args)
+SdpMessage_swigregister = _tinyWRAP.SdpMessage_swigregister
+SdpMessage_swigregister(SdpMessage)
+
+class SipMessage(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SipMessage, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SipMessage, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_SipMessage()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SipMessage
+ __del__ = lambda self : None;
+ def getSipHeaderValue(self, *args): return _tinyWRAP.SipMessage_getSipHeaderValue(self, *args)
+ def getSipHeaderParamValue(self, *args): return _tinyWRAP.SipMessage_getSipHeaderParamValue(self, *args)
+ def getSipContentLength(self): return _tinyWRAP.SipMessage_getSipContentLength(self)
+ def getSipContent(self, *args): return _tinyWRAP.SipMessage_getSipContent(self, *args)
+ def getSdpMessage(self): return _tinyWRAP.SipMessage_getSdpMessage(self)
+SipMessage_swigregister = _tinyWRAP.SipMessage_swigregister
+SipMessage_swigregister(SipMessage)
+
+class SipEvent(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SipEvent, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SipEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_SipEvent
+ __del__ = lambda self : None;
+ def getCode(self): return _tinyWRAP.SipEvent_getCode(self)
+ def getPhrase(self): return _tinyWRAP.SipEvent_getPhrase(self)
+ def getBaseSession(self): return _tinyWRAP.SipEvent_getBaseSession(self)
+ def getSipMessage(self): return _tinyWRAP.SipEvent_getSipMessage(self)
+SipEvent_swigregister = _tinyWRAP.SipEvent_swigregister
+SipEvent_swigregister(SipEvent)
+
+class DialogEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, DialogEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, DialogEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_DialogEvent
+ __del__ = lambda self : None;
+DialogEvent_swigregister = _tinyWRAP.DialogEvent_swigregister
+DialogEvent_swigregister(DialogEvent)
+
+class StackEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, StackEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, StackEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_StackEvent
+ __del__ = lambda self : None;
+StackEvent_swigregister = _tinyWRAP.StackEvent_swigregister
+StackEvent_swigregister(StackEvent)
+
+class InviteEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, InviteEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, InviteEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_InviteEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.InviteEvent_getType(self)
+ def getMediaType(self): return _tinyWRAP.InviteEvent_getMediaType(self)
+ def getSession(self): return _tinyWRAP.InviteEvent_getSession(self)
+ def takeCallSessionOwnership(self): return _tinyWRAP.InviteEvent_takeCallSessionOwnership(self)
+ def takeMsrpSessionOwnership(self): return _tinyWRAP.InviteEvent_takeMsrpSessionOwnership(self)
+InviteEvent_swigregister = _tinyWRAP.InviteEvent_swigregister
+InviteEvent_swigregister(InviteEvent)
+
+class MessagingEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MessagingEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, MessagingEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_MessagingEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.MessagingEvent_getType(self)
+ def getSession(self): return _tinyWRAP.MessagingEvent_getSession(self)
+ def takeSessionOwnership(self): return _tinyWRAP.MessagingEvent_takeSessionOwnership(self)
+MessagingEvent_swigregister = _tinyWRAP.MessagingEvent_swigregister
+MessagingEvent_swigregister(MessagingEvent)
+
+class OptionsEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, OptionsEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, OptionsEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_OptionsEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.OptionsEvent_getType(self)
+ def getSession(self): return _tinyWRAP.OptionsEvent_getSession(self)
+OptionsEvent_swigregister = _tinyWRAP.OptionsEvent_swigregister
+OptionsEvent_swigregister(OptionsEvent)
+
+class PublicationEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, PublicationEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, PublicationEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_PublicationEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.PublicationEvent_getType(self)
+ def getSession(self): return _tinyWRAP.PublicationEvent_getSession(self)
+PublicationEvent_swigregister = _tinyWRAP.PublicationEvent_swigregister
+PublicationEvent_swigregister(PublicationEvent)
+
+class RegistrationEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, RegistrationEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, RegistrationEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_RegistrationEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.RegistrationEvent_getType(self)
+ def getSession(self): return _tinyWRAP.RegistrationEvent_getSession(self)
+ def takeSessionOwnership(self): return _tinyWRAP.RegistrationEvent_takeSessionOwnership(self)
+RegistrationEvent_swigregister = _tinyWRAP.RegistrationEvent_swigregister
+RegistrationEvent_swigregister(RegistrationEvent)
+
+class SubscriptionEvent(SipEvent):
+ __swig_setmethods__ = {}
+ for _s in [SipEvent]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SubscriptionEvent, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipEvent]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, SubscriptionEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_SubscriptionEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.SubscriptionEvent_getType(self)
+ def getSession(self): return _tinyWRAP.SubscriptionEvent_getSession(self)
+SubscriptionEvent_swigregister = _tinyWRAP.SubscriptionEvent_swigregister
+SubscriptionEvent_swigregister(SubscriptionEvent)
+
+class SipSession(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SipSession, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SipSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_SipSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SipSession
+ __del__ = lambda self : None;
+ def haveOwnership(self): return _tinyWRAP.SipSession_haveOwnership(self)
+ def addHeader(self, *args): return _tinyWRAP.SipSession_addHeader(self, *args)
+ def removeHeader(self, *args): return _tinyWRAP.SipSession_removeHeader(self, *args)
+ def addCaps(self, *args): return _tinyWRAP.SipSession_addCaps(self, *args)
+ def removeCaps(self, *args): return _tinyWRAP.SipSession_removeCaps(self, *args)
+ def setExpires(self, *args): return _tinyWRAP.SipSession_setExpires(self, *args)
+ def setFromUri(self, *args): return _tinyWRAP.SipSession_setFromUri(self, *args)
+ def setToUri(self, *args): return _tinyWRAP.SipSession_setToUri(self, *args)
+ def setSilentHangup(self, *args): return _tinyWRAP.SipSession_setSilentHangup(self, *args)
+ def addSigCompCompartment(self, *args): return _tinyWRAP.SipSession_addSigCompCompartment(self, *args)
+ def removeSigCompCompartment(self): return _tinyWRAP.SipSession_removeSigCompCompartment(self)
+ def getId(self): return _tinyWRAP.SipSession_getId(self)
+SipSession_swigregister = _tinyWRAP.SipSession_swigregister
+SipSession_swigregister(SipSession)
+
+class InviteSession(SipSession):
+ __swig_setmethods__ = {}
+ for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, InviteSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, InviteSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_InviteSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_InviteSession
+ __del__ = lambda self : None;
+ def accept(self, *args): return _tinyWRAP.InviteSession_accept(self, *args)
+ def hangup(self, *args): return _tinyWRAP.InviteSession_hangup(self, *args)
+ def reject(self, *args): return _tinyWRAP.InviteSession_reject(self, *args)
+ def getMediaMgr(self): return _tinyWRAP.InviteSession_getMediaMgr(self)
+InviteSession_swigregister = _tinyWRAP.InviteSession_swigregister
+InviteSession_swigregister(InviteSession)
+
+class CallSession(InviteSession):
+ __swig_setmethods__ = {}
+ for _s in [InviteSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, CallSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [InviteSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, CallSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_CallSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_CallSession
+ __del__ = lambda self : None;
+ def callAudio(self, *args): return _tinyWRAP.CallSession_callAudio(self, *args)
+ def callAudioVideo(self, *args): return _tinyWRAP.CallSession_callAudioVideo(self, *args)
+ def callVideo(self, *args): return _tinyWRAP.CallSession_callVideo(self, *args)
+ def setSessionTimer(self, *args): return _tinyWRAP.CallSession_setSessionTimer(self, *args)
+ def set100rel(self, *args): return _tinyWRAP.CallSession_set100rel(self, *args)
+ def setQoS(self, *args): return _tinyWRAP.CallSession_setQoS(self, *args)
+ def hold(self, *args): return _tinyWRAP.CallSession_hold(self, *args)
+ def resume(self, *args): return _tinyWRAP.CallSession_resume(self, *args)
+ def sendDTMF(self, *args): return _tinyWRAP.CallSession_sendDTMF(self, *args)
+CallSession_swigregister = _tinyWRAP.CallSession_swigregister
+CallSession_swigregister(CallSession)
+
+class MsrpSession(InviteSession):
+ __swig_setmethods__ = {}
+ for _s in [InviteSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [InviteSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, MsrpSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_MsrpSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_MsrpSession
+ __del__ = lambda self : None;
+ def setCallback(self, *args): return _tinyWRAP.MsrpSession_setCallback(self, *args)
+ def callMsrp(self, *args): return _tinyWRAP.MsrpSession_callMsrp(self, *args)
+ def sendMessage(self, *args): return _tinyWRAP.MsrpSession_sendMessage(self, *args)
+ def sendFile(self, *args): return _tinyWRAP.MsrpSession_sendFile(self, *args)
+MsrpSession_swigregister = _tinyWRAP.MsrpSession_swigregister
+MsrpSession_swigregister(MsrpSession)
+
+class MessagingSession(SipSession):
+ __swig_setmethods__ = {}
+ for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MessagingSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, MessagingSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_MessagingSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_MessagingSession
+ __del__ = lambda self : None;
+ def send(self, *args): return _tinyWRAP.MessagingSession_send(self, *args)
+ def accept(self): return _tinyWRAP.MessagingSession_accept(self)
+ def reject(self): return _tinyWRAP.MessagingSession_reject(self)
+MessagingSession_swigregister = _tinyWRAP.MessagingSession_swigregister
+MessagingSession_swigregister(MessagingSession)
+
+class OptionsSession(SipSession):
+ __swig_setmethods__ = {}
+ for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, OptionsSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, OptionsSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_OptionsSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_OptionsSession
+ __del__ = lambda self : None;
+ def send(self): return _tinyWRAP.OptionsSession_send(self)
+OptionsSession_swigregister = _tinyWRAP.OptionsSession_swigregister
+OptionsSession_swigregister(OptionsSession)
+
+class PublicationSession(SipSession):
+ __swig_setmethods__ = {}
+ for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, PublicationSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, PublicationSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_PublicationSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_PublicationSession
+ __del__ = lambda self : None;
+ def publish(self, *args): return _tinyWRAP.PublicationSession_publish(self, *args)
+ def unPublish(self): return _tinyWRAP.PublicationSession_unPublish(self)
+PublicationSession_swigregister = _tinyWRAP.PublicationSession_swigregister
+PublicationSession_swigregister(PublicationSession)
+
+class RegistrationSession(SipSession):
+ __swig_setmethods__ = {}
+ for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, RegistrationSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, RegistrationSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_RegistrationSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_RegistrationSession
+ __del__ = lambda self : None;
+ def register_(self): return _tinyWRAP.RegistrationSession_register_(self)
+ def unRegister(self): return _tinyWRAP.RegistrationSession_unRegister(self)
+ def accept(self, *args): return _tinyWRAP.RegistrationSession_accept(self, *args)
+ def reject(self, *args): return _tinyWRAP.RegistrationSession_reject(self, *args)
+RegistrationSession_swigregister = _tinyWRAP.RegistrationSession_swigregister
+RegistrationSession_swigregister(RegistrationSession)
+
+class SubscriptionSession(SipSession):
+ __swig_setmethods__ = {}
+ for _s in [SipSession]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SubscriptionSession, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SipSession]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, SubscriptionSession, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_SubscriptionSession(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SubscriptionSession
+ __del__ = lambda self : None;
+ def subscribe(self): return _tinyWRAP.SubscriptionSession_subscribe(self)
+ def unSubscribe(self): return _tinyWRAP.SubscriptionSession_unSubscribe(self)
+SubscriptionSession_swigregister = _tinyWRAP.SubscriptionSession_swigregister
+SubscriptionSession_swigregister(SubscriptionSession)
+
+twrap_proxy_plugin_audio_producer = _tinyWRAP.twrap_proxy_plugin_audio_producer
+twrap_proxy_plugin_video_producer = _tinyWRAP.twrap_proxy_plugin_video_producer
+twrap_proxy_plugin_audio_consumer = _tinyWRAP.twrap_proxy_plugin_audio_consumer
+twrap_proxy_plugin_video_consumer = _tinyWRAP.twrap_proxy_plugin_video_consumer
+class ProxyPluginMgr(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyPluginMgr, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyPluginMgr, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyPluginMgr
+ __del__ = lambda self : None;
+ __swig_getmethods__["createInstance"] = lambda x: _tinyWRAP.ProxyPluginMgr_createInstance
+ if _newclass:createInstance = staticmethod(_tinyWRAP.ProxyPluginMgr_createInstance)
+ __swig_getmethods__["getInstance"] = lambda x: _tinyWRAP.ProxyPluginMgr_getInstance
+ if _newclass:getInstance = staticmethod(_tinyWRAP.ProxyPluginMgr_getInstance)
+ def findAudioConsumer(self, *args): return _tinyWRAP.ProxyPluginMgr_findAudioConsumer(self, *args)
+ def findVideoConsumer(self, *args): return _tinyWRAP.ProxyPluginMgr_findVideoConsumer(self, *args)
+ def findAudioProducer(self, *args): return _tinyWRAP.ProxyPluginMgr_findAudioProducer(self, *args)
+ def findVideoProducer(self, *args): return _tinyWRAP.ProxyPluginMgr_findVideoProducer(self, *args)
+ProxyPluginMgr_swigregister = _tinyWRAP.ProxyPluginMgr_swigregister
+ProxyPluginMgr_swigregister(ProxyPluginMgr)
+
+def ProxyPluginMgr_createInstance(*args):
+ return _tinyWRAP.ProxyPluginMgr_createInstance(*args)
+ProxyPluginMgr_createInstance = _tinyWRAP.ProxyPluginMgr_createInstance
+
+def ProxyPluginMgr_getInstance():
+ return _tinyWRAP.ProxyPluginMgr_getInstance()
+ProxyPluginMgr_getInstance = _tinyWRAP.ProxyPluginMgr_getInstance
+
+class ProxyPluginMgrCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyPluginMgrCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyPluginMgrCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == ProxyPluginMgrCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_ProxyPluginMgrCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_ProxyPluginMgrCallback
+ __del__ = lambda self : None;
+ def OnPluginCreated(self, *args): return _tinyWRAP.ProxyPluginMgrCallback_OnPluginCreated(self, *args)
+ def OnPluginDestroyed(self, *args): return _tinyWRAP.ProxyPluginMgrCallback_OnPluginDestroyed(self, *args)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_ProxyPluginMgrCallback(self)
+ return weakref_proxy(self)
+ProxyPluginMgrCallback_swigregister = _tinyWRAP.ProxyPluginMgrCallback_swigregister
+ProxyPluginMgrCallback_swigregister(ProxyPluginMgrCallback)
+
+class ProxyPlugin(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyPlugin, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyPlugin, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyPlugin
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.ProxyPlugin_getType(self)
+ def getId(self): return _tinyWRAP.ProxyPlugin_getId(self)
+ProxyPlugin_swigregister = _tinyWRAP.ProxyPlugin_swigregister
+ProxyPlugin_swigregister(ProxyPlugin)
+
+class ProxyAudioConsumerCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioConsumerCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioConsumerCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == ProxyAudioConsumerCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_ProxyAudioConsumerCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_ProxyAudioConsumerCallback
+ __del__ = lambda self : None;
+ def prepare(self, *args): return _tinyWRAP.ProxyAudioConsumerCallback_prepare(self, *args)
+ def start(self): return _tinyWRAP.ProxyAudioConsumerCallback_start(self)
+ def pause(self): return _tinyWRAP.ProxyAudioConsumerCallback_pause(self)
+ def stop(self): return _tinyWRAP.ProxyAudioConsumerCallback_stop(self)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_ProxyAudioConsumerCallback(self)
+ return weakref_proxy(self)
+ProxyAudioConsumerCallback_swigregister = _tinyWRAP.ProxyAudioConsumerCallback_swigregister
+ProxyAudioConsumerCallback_swigregister(ProxyAudioConsumerCallback)
+
+class ProxyAudioConsumer(ProxyPlugin):
+ __swig_setmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioConsumer, name, value)
+ __swig_getmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioConsumer, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyAudioConsumer
+ __del__ = lambda self : None;
+ def pull(self, *args): return _tinyWRAP.ProxyAudioConsumer_pull(self, *args)
+ def reset(self): return _tinyWRAP.ProxyAudioConsumer_reset(self)
+ def setCallback(self, *args): return _tinyWRAP.ProxyAudioConsumer_setCallback(self, *args)
+ def getMediaSessionId(self): return _tinyWRAP.ProxyAudioConsumer_getMediaSessionId(self)
+ __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyAudioConsumer_registerPlugin
+ if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyAudioConsumer_registerPlugin)
+ProxyAudioConsumer_swigregister = _tinyWRAP.ProxyAudioConsumer_swigregister
+ProxyAudioConsumer_swigregister(ProxyAudioConsumer)
+
+def ProxyAudioConsumer_registerPlugin():
+ return _tinyWRAP.ProxyAudioConsumer_registerPlugin()
+ProxyAudioConsumer_registerPlugin = _tinyWRAP.ProxyAudioConsumer_registerPlugin
+
+class ProxyVideoConsumerCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoConsumerCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoConsumerCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == ProxyVideoConsumerCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_ProxyVideoConsumerCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_ProxyVideoConsumerCallback
+ __del__ = lambda self : None;
+ def prepare(self, *args): return _tinyWRAP.ProxyVideoConsumerCallback_prepare(self, *args)
+ def consume(self, *args): return _tinyWRAP.ProxyVideoConsumerCallback_consume(self, *args)
+ def start(self): return _tinyWRAP.ProxyVideoConsumerCallback_start(self)
+ def pause(self): return _tinyWRAP.ProxyVideoConsumerCallback_pause(self)
+ def stop(self): return _tinyWRAP.ProxyVideoConsumerCallback_stop(self)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_ProxyVideoConsumerCallback(self)
+ return weakref_proxy(self)
+ProxyVideoConsumerCallback_swigregister = _tinyWRAP.ProxyVideoConsumerCallback_swigregister
+ProxyVideoConsumerCallback_swigregister(ProxyVideoConsumerCallback)
+
+class ProxyVideoConsumer(ProxyPlugin):
+ __swig_setmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoConsumer, name, value)
+ __swig_getmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoConsumer, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyVideoConsumer
+ __del__ = lambda self : None;
+ def setDisplaySize(self, *args): return _tinyWRAP.ProxyVideoConsumer_setDisplaySize(self, *args)
+ def setCallback(self, *args): return _tinyWRAP.ProxyVideoConsumer_setCallback(self, *args)
+ def getMediaSessionId(self): return _tinyWRAP.ProxyVideoConsumer_getMediaSessionId(self)
+ __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyVideoConsumer_registerPlugin
+ if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyVideoConsumer_registerPlugin)
+ __swig_getmethods__["setDefaultChroma"] = lambda x: _tinyWRAP.ProxyVideoConsumer_setDefaultChroma
+ if _newclass:setDefaultChroma = staticmethod(_tinyWRAP.ProxyVideoConsumer_setDefaultChroma)
+ProxyVideoConsumer_swigregister = _tinyWRAP.ProxyVideoConsumer_swigregister
+ProxyVideoConsumer_swigregister(ProxyVideoConsumer)
+
+def ProxyVideoConsumer_registerPlugin():
+ return _tinyWRAP.ProxyVideoConsumer_registerPlugin()
+ProxyVideoConsumer_registerPlugin = _tinyWRAP.ProxyVideoConsumer_registerPlugin
+
+def ProxyVideoConsumer_setDefaultChroma(*args):
+ return _tinyWRAP.ProxyVideoConsumer_setDefaultChroma(*args)
+ProxyVideoConsumer_setDefaultChroma = _tinyWRAP.ProxyVideoConsumer_setDefaultChroma
+
+class ProxyVideoFrame(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoFrame, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoFrame, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyVideoFrame
+ __del__ = lambda self : None;
+ def getSize(self): return _tinyWRAP.ProxyVideoFrame_getSize(self)
+ def getContent(self, *args): return _tinyWRAP.ProxyVideoFrame_getContent(self, *args)
+ProxyVideoFrame_swigregister = _tinyWRAP.ProxyVideoFrame_swigregister
+ProxyVideoFrame_swigregister(ProxyVideoFrame)
+
+class ProxyAudioProducerCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioProducerCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioProducerCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == ProxyAudioProducerCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_ProxyAudioProducerCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_ProxyAudioProducerCallback
+ __del__ = lambda self : None;
+ def prepare(self, *args): return _tinyWRAP.ProxyAudioProducerCallback_prepare(self, *args)
+ def start(self): return _tinyWRAP.ProxyAudioProducerCallback_start(self)
+ def pause(self): return _tinyWRAP.ProxyAudioProducerCallback_pause(self)
+ def stop(self): return _tinyWRAP.ProxyAudioProducerCallback_stop(self)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_ProxyAudioProducerCallback(self)
+ return weakref_proxy(self)
+ProxyAudioProducerCallback_swigregister = _tinyWRAP.ProxyAudioProducerCallback_swigregister
+ProxyAudioProducerCallback_swigregister(ProxyAudioProducerCallback)
+
+class ProxyAudioProducer(ProxyPlugin):
+ __swig_setmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyAudioProducer, name, value)
+ __swig_getmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyAudioProducer, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyAudioProducer
+ __del__ = lambda self : None;
+ def push(self, *args): return _tinyWRAP.ProxyAudioProducer_push(self, *args)
+ def setCallback(self, *args): return _tinyWRAP.ProxyAudioProducer_setCallback(self, *args)
+ def getMediaSessionId(self): return _tinyWRAP.ProxyAudioProducer_getMediaSessionId(self)
+ __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyAudioProducer_registerPlugin
+ if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyAudioProducer_registerPlugin)
+ProxyAudioProducer_swigregister = _tinyWRAP.ProxyAudioProducer_swigregister
+ProxyAudioProducer_swigregister(ProxyAudioProducer)
+
+def ProxyAudioProducer_registerPlugin():
+ return _tinyWRAP.ProxyAudioProducer_registerPlugin()
+ProxyAudioProducer_registerPlugin = _tinyWRAP.ProxyAudioProducer_registerPlugin
+
+class ProxyVideoProducerCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoProducerCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoProducerCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == ProxyVideoProducerCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_ProxyVideoProducerCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_ProxyVideoProducerCallback
+ __del__ = lambda self : None;
+ def prepare(self, *args): return _tinyWRAP.ProxyVideoProducerCallback_prepare(self, *args)
+ def start(self): return _tinyWRAP.ProxyVideoProducerCallback_start(self)
+ def pause(self): return _tinyWRAP.ProxyVideoProducerCallback_pause(self)
+ def stop(self): return _tinyWRAP.ProxyVideoProducerCallback_stop(self)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_ProxyVideoProducerCallback(self)
+ return weakref_proxy(self)
+ProxyVideoProducerCallback_swigregister = _tinyWRAP.ProxyVideoProducerCallback_swigregister
+ProxyVideoProducerCallback_swigregister(ProxyVideoProducerCallback)
+
+class ProxyVideoProducer(ProxyPlugin):
+ __swig_setmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, ProxyVideoProducer, name, value)
+ __swig_getmethods__ = {}
+ for _s in [ProxyPlugin]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, ProxyVideoProducer, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_ProxyVideoProducer
+ __del__ = lambda self : None;
+ def getRotation(self): return _tinyWRAP.ProxyVideoProducer_getRotation(self)
+ def setRotation(self, *args): return _tinyWRAP.ProxyVideoProducer_setRotation(self, *args)
+ def push(self, *args): return _tinyWRAP.ProxyVideoProducer_push(self, *args)
+ def send(self, *args): return _tinyWRAP.ProxyVideoProducer_send(self, *args)
+ def setCallback(self, *args): return _tinyWRAP.ProxyVideoProducer_setCallback(self, *args)
+ def getMediaSessionId(self): return _tinyWRAP.ProxyVideoProducer_getMediaSessionId(self)
+ __swig_getmethods__["registerPlugin"] = lambda x: _tinyWRAP.ProxyVideoProducer_registerPlugin
+ if _newclass:registerPlugin = staticmethod(_tinyWRAP.ProxyVideoProducer_registerPlugin)
+ __swig_getmethods__["setDefaultChroma"] = lambda x: _tinyWRAP.ProxyVideoProducer_setDefaultChroma
+ if _newclass:setDefaultChroma = staticmethod(_tinyWRAP.ProxyVideoProducer_setDefaultChroma)
+ProxyVideoProducer_swigregister = _tinyWRAP.ProxyVideoProducer_swigregister
+ProxyVideoProducer_swigregister(ProxyVideoProducer)
+
+def ProxyVideoProducer_registerPlugin():
+ return _tinyWRAP.ProxyVideoProducer_registerPlugin()
+ProxyVideoProducer_registerPlugin = _tinyWRAP.ProxyVideoProducer_registerPlugin
+
+def ProxyVideoProducer_setDefaultChroma(*args):
+ return _tinyWRAP.ProxyVideoProducer_setDefaultChroma(*args)
+ProxyVideoProducer_setDefaultChroma = _tinyWRAP.ProxyVideoProducer_setDefaultChroma
+
+class SipCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SipCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SipCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == SipCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_SipCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SipCallback
+ __del__ = lambda self : None;
+ def OnDialogEvent(self, *args): return _tinyWRAP.SipCallback_OnDialogEvent(self, *args)
+ def OnStackEvent(self, *args): return _tinyWRAP.SipCallback_OnStackEvent(self, *args)
+ def OnInviteEvent(self, *args): return _tinyWRAP.SipCallback_OnInviteEvent(self, *args)
+ def OnMessagingEvent(self, *args): return _tinyWRAP.SipCallback_OnMessagingEvent(self, *args)
+ def OnOptionsEvent(self, *args): return _tinyWRAP.SipCallback_OnOptionsEvent(self, *args)
+ def OnPublicationEvent(self, *args): return _tinyWRAP.SipCallback_OnPublicationEvent(self, *args)
+ def OnRegistrationEvent(self, *args): return _tinyWRAP.SipCallback_OnRegistrationEvent(self, *args)
+ def OnSubscriptionEvent(self, *args): return _tinyWRAP.SipCallback_OnSubscriptionEvent(self, *args)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_SipCallback(self)
+ return weakref_proxy(self)
+SipCallback_swigregister = _tinyWRAP.SipCallback_swigregister
+SipCallback_swigregister(SipCallback)
+
+class SafeObject(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SafeObject, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SafeObject, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_SafeObject()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SafeObject
+ __del__ = lambda self : None;
+ def Lock(self): return _tinyWRAP.SafeObject_Lock(self)
+ def UnLock(self): return _tinyWRAP.SafeObject_UnLock(self)
+SafeObject_swigregister = _tinyWRAP.SafeObject_swigregister
+SafeObject_swigregister(SafeObject)
+
+class SipStack(SafeObject):
+ __swig_setmethods__ = {}
+ for _s in [SafeObject]: __swig_setmethods__.update(getattr(_s,'__swig_setmethods__',{}))
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SipStack, name, value)
+ __swig_getmethods__ = {}
+ for _s in [SafeObject]: __swig_getmethods__.update(getattr(_s,'__swig_getmethods__',{}))
+ __getattr__ = lambda self, name: _swig_getattr(self, SipStack, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_SipStack(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SipStack
+ __del__ = lambda self : None;
+ def start(self): return _tinyWRAP.SipStack_start(self)
+ def setDebugCallback(self, *args): return _tinyWRAP.SipStack_setDebugCallback(self, *args)
+ def setRealm(self, *args): return _tinyWRAP.SipStack_setRealm(self, *args)
+ def setIMPI(self, *args): return _tinyWRAP.SipStack_setIMPI(self, *args)
+ def setIMPU(self, *args): return _tinyWRAP.SipStack_setIMPU(self, *args)
+ def setPassword(self, *args): return _tinyWRAP.SipStack_setPassword(self, *args)
+ def setAMF(self, *args): return _tinyWRAP.SipStack_setAMF(self, *args)
+ def setOperatorId(self, *args): return _tinyWRAP.SipStack_setOperatorId(self, *args)
+ def setProxyCSCF(self, *args): return _tinyWRAP.SipStack_setProxyCSCF(self, *args)
+ def setLocalIP(self, *args): return _tinyWRAP.SipStack_setLocalIP(self, *args)
+ def setLocalPort(self, *args): return _tinyWRAP.SipStack_setLocalPort(self, *args)
+ def setEarlyIMS(self, *args): return _tinyWRAP.SipStack_setEarlyIMS(self, *args)
+ def addHeader(self, *args): return _tinyWRAP.SipStack_addHeader(self, *args)
+ def removeHeader(self, *args): return _tinyWRAP.SipStack_removeHeader(self, *args)
+ def addDnsServer(self, *args): return _tinyWRAP.SipStack_addDnsServer(self, *args)
+ def setDnsDiscovery(self, *args): return _tinyWRAP.SipStack_setDnsDiscovery(self, *args)
+ def setAoR(self, *args): return _tinyWRAP.SipStack_setAoR(self, *args)
+ def setSigCompParams(self, *args): return _tinyWRAP.SipStack_setSigCompParams(self, *args)
+ def addSigCompCompartment(self, *args): return _tinyWRAP.SipStack_addSigCompCompartment(self, *args)
+ def removeSigCompCompartment(self, *args): return _tinyWRAP.SipStack_removeSigCompCompartment(self, *args)
+ def setSTUNServer(self, *args): return _tinyWRAP.SipStack_setSTUNServer(self, *args)
+ def setSTUNCred(self, *args): return _tinyWRAP.SipStack_setSTUNCred(self, *args)
+ def setTLSSecAgree(self, *args): return _tinyWRAP.SipStack_setTLSSecAgree(self, *args)
+ def setSSLCretificates(self, *args): return _tinyWRAP.SipStack_setSSLCretificates(self, *args)
+ def setIPSecSecAgree(self, *args): return _tinyWRAP.SipStack_setIPSecSecAgree(self, *args)
+ def setIPSecParameters(self, *args): return _tinyWRAP.SipStack_setIPSecParameters(self, *args)
+ def dnsENUM(self, *args): return _tinyWRAP.SipStack_dnsENUM(self, *args)
+ def dnsNaptrSrv(self, *args): return _tinyWRAP.SipStack_dnsNaptrSrv(self, *args)
+ def dnsSrv(self, *args): return _tinyWRAP.SipStack_dnsSrv(self, *args)
+ def getLocalIPnPort(self, *args): return _tinyWRAP.SipStack_getLocalIPnPort(self, *args)
+ def getPreferredIdentity(self): return _tinyWRAP.SipStack_getPreferredIdentity(self)
+ def isValid(self): return _tinyWRAP.SipStack_isValid(self)
+ def stop(self): return _tinyWRAP.SipStack_stop(self)
+ __swig_getmethods__["setCodecs"] = lambda x: _tinyWRAP.SipStack_setCodecs
+ if _newclass:setCodecs = staticmethod(_tinyWRAP.SipStack_setCodecs)
+ __swig_getmethods__["setCodecs_2"] = lambda x: _tinyWRAP.SipStack_setCodecs_2
+ if _newclass:setCodecs_2 = staticmethod(_tinyWRAP.SipStack_setCodecs_2)
+ __swig_getmethods__["isCodecSupported"] = lambda x: _tinyWRAP.SipStack_isCodecSupported
+ if _newclass:isCodecSupported = staticmethod(_tinyWRAP.SipStack_isCodecSupported)
+SipStack_swigregister = _tinyWRAP.SipStack_swigregister
+SipStack_swigregister(SipStack)
+
+def SipStack_setCodecs(*args):
+ return _tinyWRAP.SipStack_setCodecs(*args)
+SipStack_setCodecs = _tinyWRAP.SipStack_setCodecs
+
+def SipStack_setCodecs_2(*args):
+ return _tinyWRAP.SipStack_setCodecs_2(*args)
+SipStack_setCodecs_2 = _tinyWRAP.SipStack_setCodecs_2
+
+def SipStack_isCodecSupported(*args):
+ return _tinyWRAP.SipStack_isCodecSupported(*args)
+SipStack_isCodecSupported = _tinyWRAP.SipStack_isCodecSupported
+
+tsip_event_invite = _tinyWRAP.tsip_event_invite
+tsip_event_message = _tinyWRAP.tsip_event_message
+tsip_event_options = _tinyWRAP.tsip_event_options
+tsip_event_publish = _tinyWRAP.tsip_event_publish
+tsip_event_register = _tinyWRAP.tsip_event_register
+tsip_event_subscribe = _tinyWRAP.tsip_event_subscribe
+tsip_event_dialog = _tinyWRAP.tsip_event_dialog
+tsip_event_code_dialog_transport_error = _tinyWRAP.tsip_event_code_dialog_transport_error
+tsip_event_code_dialog_global_error = _tinyWRAP.tsip_event_code_dialog_global_error
+tsip_event_code_dialog_message_error = _tinyWRAP.tsip_event_code_dialog_message_error
+tsip_event_code_dialog_request_incoming = _tinyWRAP.tsip_event_code_dialog_request_incoming
+tsip_event_code_dialog_request_cancelled = _tinyWRAP.tsip_event_code_dialog_request_cancelled
+tsip_event_code_dialog_request_sent = _tinyWRAP.tsip_event_code_dialog_request_sent
+tsip_event_code_dialog_connecting = _tinyWRAP.tsip_event_code_dialog_connecting
+tsip_event_code_dialog_connected = _tinyWRAP.tsip_event_code_dialog_connected
+tsip_event_code_dialog_terminating = _tinyWRAP.tsip_event_code_dialog_terminating
+tsip_event_code_dialog_terminated = _tinyWRAP.tsip_event_code_dialog_terminated
+tsip_event_code_stack_started = _tinyWRAP.tsip_event_code_stack_started
+tsip_event_code_stack_stopped = _tinyWRAP.tsip_event_code_stack_stopped
+tsip_event_code_stack_failed_to_start = _tinyWRAP.tsip_event_code_stack_failed_to_start
+tsip_event_code_stack_failed_to_stop = _tinyWRAP.tsip_event_code_stack_failed_to_stop
+tsip_i_newreg = _tinyWRAP.tsip_i_newreg
+tsip_i_register = _tinyWRAP.tsip_i_register
+tsip_ao_register = _tinyWRAP.tsip_ao_register
+tsip_i_unregister = _tinyWRAP.tsip_i_unregister
+tsip_ao_unregister = _tinyWRAP.tsip_ao_unregister
+tsip_i_subscribe = _tinyWRAP.tsip_i_subscribe
+tsip_ao_subscribe = _tinyWRAP.tsip_ao_subscribe
+tsip_i_unsubscribe = _tinyWRAP.tsip_i_unsubscribe
+tsip_ao_unsubscribe = _tinyWRAP.tsip_ao_unsubscribe
+tsip_i_notify = _tinyWRAP.tsip_i_notify
+tsip_ao_notify = _tinyWRAP.tsip_ao_notify
+tsip_i_publish = _tinyWRAP.tsip_i_publish
+tsip_ao_publish = _tinyWRAP.tsip_ao_publish
+tsip_i_unpublish = _tinyWRAP.tsip_i_unpublish
+tsip_ao_unpublish = _tinyWRAP.tsip_ao_unpublish
+tsip_i_message = _tinyWRAP.tsip_i_message
+tsip_ao_message = _tinyWRAP.tsip_ao_message
+tsip_i_options = _tinyWRAP.tsip_i_options
+tsip_ao_options = _tinyWRAP.tsip_ao_options
+tsip_i_newcall = _tinyWRAP.tsip_i_newcall
+tsip_i_request = _tinyWRAP.tsip_i_request
+tsip_ao_request = _tinyWRAP.tsip_ao_request
+tsip_o_ect_ok = _tinyWRAP.tsip_o_ect_ok
+tsip_o_ect_nok = _tinyWRAP.tsip_o_ect_nok
+tsip_i_ect = _tinyWRAP.tsip_i_ect
+tsip_m_early_media = _tinyWRAP.tsip_m_early_media
+tsip_m_local_hold_ok = _tinyWRAP.tsip_m_local_hold_ok
+tsip_m_local_hold_nok = _tinyWRAP.tsip_m_local_hold_nok
+tsip_m_local_resume_ok = _tinyWRAP.tsip_m_local_resume_ok
+tsip_m_local_resume_nok = _tinyWRAP.tsip_m_local_resume_nok
+tsip_m_remote_hold = _tinyWRAP.tsip_m_remote_hold
+tsip_m_remote_resume = _tinyWRAP.tsip_m_remote_resume
+tmedia_rgb24 = _tinyWRAP.tmedia_rgb24
+tmedia_bgr24 = _tinyWRAP.tmedia_bgr24
+tmedia_rgb32 = _tinyWRAP.tmedia_rgb32
+tmedia_rgb565le = _tinyWRAP.tmedia_rgb565le
+tmedia_rgb565be = _tinyWRAP.tmedia_rgb565be
+tmedia_nv12 = _tinyWRAP.tmedia_nv12
+tmedia_nv21 = _tinyWRAP.tmedia_nv21
+tmedia_yuv422p = _tinyWRAP.tmedia_yuv422p
+tmedia_uyvy422 = _tinyWRAP.tmedia_uyvy422
+tmedia_yuv420p = _tinyWRAP.tmedia_yuv420p
+tmedia_qos_stype_none = _tinyWRAP.tmedia_qos_stype_none
+tmedia_qos_stype_segmented = _tinyWRAP.tmedia_qos_stype_segmented
+tmedia_qos_stype_e2e = _tinyWRAP.tmedia_qos_stype_e2e
+tmedia_qos_strength_none = _tinyWRAP.tmedia_qos_strength_none
+tmedia_qos_strength_failure = _tinyWRAP.tmedia_qos_strength_failure
+tmedia_qos_strength_unknown = _tinyWRAP.tmedia_qos_strength_unknown
+tmedia_qos_strength_optional = _tinyWRAP.tmedia_qos_strength_optional
+tmedia_qos_strength_mandatory = _tinyWRAP.tmedia_qos_strength_mandatory
+tmedia_bl_low = _tinyWRAP.tmedia_bl_low
+tmedia_bl_medium = _tinyWRAP.tmedia_bl_medium
+tmedia_bl_hight = _tinyWRAP.tmedia_bl_hight
+tdav_codec_id_none = _tinyWRAP.tdav_codec_id_none
+tdav_codec_id_amr_nb_oa = _tinyWRAP.tdav_codec_id_amr_nb_oa
+tdav_codec_id_amr_nb_be = _tinyWRAP.tdav_codec_id_amr_nb_be
+tdav_codec_id_amr_wb_oa = _tinyWRAP.tdav_codec_id_amr_wb_oa
+tdav_codec_id_amr_wb_be = _tinyWRAP.tdav_codec_id_amr_wb_be
+tdav_codec_id_gsm = _tinyWRAP.tdav_codec_id_gsm
+tdav_codec_id_pcma = _tinyWRAP.tdav_codec_id_pcma
+tdav_codec_id_pcmu = _tinyWRAP.tdav_codec_id_pcmu
+tdav_codec_id_ilbc = _tinyWRAP.tdav_codec_id_ilbc
+tdav_codec_id_speex_nb = _tinyWRAP.tdav_codec_id_speex_nb
+tdav_codec_id_speex_wb = _tinyWRAP.tdav_codec_id_speex_wb
+tdav_codec_id_speex_uwb = _tinyWRAP.tdav_codec_id_speex_uwb
+tdav_codec_id_bv16 = _tinyWRAP.tdav_codec_id_bv16
+tdav_codec_id_bv32 = _tinyWRAP.tdav_codec_id_bv32
+tdav_codec_id_evrc = _tinyWRAP.tdav_codec_id_evrc
+tdav_codec_id_g729ab = _tinyWRAP.tdav_codec_id_g729ab
+tdav_codec_id_h261 = _tinyWRAP.tdav_codec_id_h261
+tdav_codec_id_h263 = _tinyWRAP.tdav_codec_id_h263
+tdav_codec_id_h263p = _tinyWRAP.tdav_codec_id_h263p
+tdav_codec_id_h263pp = _tinyWRAP.tdav_codec_id_h263pp
+tdav_codec_id_h264_bp10 = _tinyWRAP.tdav_codec_id_h264_bp10
+tdav_codec_id_h264_bp20 = _tinyWRAP.tdav_codec_id_h264_bp20
+tdav_codec_id_h264_bp30 = _tinyWRAP.tdav_codec_id_h264_bp30
+tdav_codec_id_theora = _tinyWRAP.tdav_codec_id_theora
+tdav_codec_id_mp4ves_es = _tinyWRAP.tdav_codec_id_mp4ves_es
+class XcapSelector(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, XcapSelector, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, XcapSelector, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_XcapSelector(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_XcapSelector
+ __del__ = lambda self : None;
+ def setAUID(self, *args): return _tinyWRAP.XcapSelector_setAUID(self, *args)
+ def setName(self, *args): return _tinyWRAP.XcapSelector_setName(self, *args)
+ def setAttribute(self, *args): return _tinyWRAP.XcapSelector_setAttribute(self, *args)
+ def setPos(self, *args): return _tinyWRAP.XcapSelector_setPos(self, *args)
+ def setPosAttribute(self, *args): return _tinyWRAP.XcapSelector_setPosAttribute(self, *args)
+ def setNamespace(self, *args): return _tinyWRAP.XcapSelector_setNamespace(self, *args)
+ def getString(self): return _tinyWRAP.XcapSelector_getString(self)
+ def reset(self): return _tinyWRAP.XcapSelector_reset(self)
+XcapSelector_swigregister = _tinyWRAP.XcapSelector_swigregister
+XcapSelector_swigregister(XcapSelector)
+
+class XcapMessage(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, XcapMessage, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, XcapMessage, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_XcapMessage()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_XcapMessage
+ __del__ = lambda self : None;
+ def getCode(self): return _tinyWRAP.XcapMessage_getCode(self)
+ def getPhrase(self): return _tinyWRAP.XcapMessage_getPhrase(self)
+ def getXcapHeaderValue(self, *args): return _tinyWRAP.XcapMessage_getXcapHeaderValue(self, *args)
+ def getXcapHeaderParamValue(self, *args): return _tinyWRAP.XcapMessage_getXcapHeaderParamValue(self, *args)
+ def getXcapContentLength(self): return _tinyWRAP.XcapMessage_getXcapContentLength(self)
+ def getXcapContent(self, *args): return _tinyWRAP.XcapMessage_getXcapContent(self, *args)
+XcapMessage_swigregister = _tinyWRAP.XcapMessage_swigregister
+XcapMessage_swigregister(XcapMessage)
+
+class XcapEvent(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, XcapEvent, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, XcapEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_XcapEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.XcapEvent_getType(self)
+ def getXcapMessage(self): return _tinyWRAP.XcapEvent_getXcapMessage(self)
+XcapEvent_swigregister = _tinyWRAP.XcapEvent_swigregister
+XcapEvent_swigregister(XcapEvent)
+
+class XcapCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, XcapCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, XcapCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == XcapCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_XcapCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_XcapCallback
+ __del__ = lambda self : None;
+ def onEvent(self, *args): return _tinyWRAP.XcapCallback_onEvent(self, *args)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_XcapCallback(self)
+ return weakref_proxy(self)
+XcapCallback_swigregister = _tinyWRAP.XcapCallback_swigregister
+XcapCallback_swigregister(XcapCallback)
+
+class XcapStack(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, XcapStack, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, XcapStack, name)
+ __repr__ = _swig_repr
+ def __init__(self, *args):
+ this = _tinyWRAP.new_XcapStack(*args)
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_XcapStack
+ __del__ = lambda self : None;
+ def registerAUID(self, *args): return _tinyWRAP.XcapStack_registerAUID(self, *args)
+ def start(self): return _tinyWRAP.XcapStack_start(self)
+ def setCredentials(self, *args): return _tinyWRAP.XcapStack_setCredentials(self, *args)
+ def setXcapRoot(self, *args): return _tinyWRAP.XcapStack_setXcapRoot(self, *args)
+ def setLocalIP(self, *args): return _tinyWRAP.XcapStack_setLocalIP(self, *args)
+ def setLocalPort(self, *args): return _tinyWRAP.XcapStack_setLocalPort(self, *args)
+ def addHeader(self, *args): return _tinyWRAP.XcapStack_addHeader(self, *args)
+ def removeHeader(self, *args): return _tinyWRAP.XcapStack_removeHeader(self, *args)
+ def setTimeout(self, *args): return _tinyWRAP.XcapStack_setTimeout(self, *args)
+ def getDocument(self, *args): return _tinyWRAP.XcapStack_getDocument(self, *args)
+ def getElement(self, *args): return _tinyWRAP.XcapStack_getElement(self, *args)
+ def getAttribute(self, *args): return _tinyWRAP.XcapStack_getAttribute(self, *args)
+ def deleteDocument(self, *args): return _tinyWRAP.XcapStack_deleteDocument(self, *args)
+ def deleteElement(self, *args): return _tinyWRAP.XcapStack_deleteElement(self, *args)
+ def deleteAttribute(self, *args): return _tinyWRAP.XcapStack_deleteAttribute(self, *args)
+ def putDocument(self, *args): return _tinyWRAP.XcapStack_putDocument(self, *args)
+ def putElement(self, *args): return _tinyWRAP.XcapStack_putElement(self, *args)
+ def putAttribute(self, *args): return _tinyWRAP.XcapStack_putAttribute(self, *args)
+ def stop(self): return _tinyWRAP.XcapStack_stop(self)
+XcapStack_swigregister = _tinyWRAP.XcapStack_swigregister
+XcapStack_swigregister(XcapStack)
+
+thttp_event_dialog_started = _tinyWRAP.thttp_event_dialog_started
+thttp_event_message = _tinyWRAP.thttp_event_message
+thttp_event_auth_failed = _tinyWRAP.thttp_event_auth_failed
+thttp_event_closed = _tinyWRAP.thttp_event_closed
+thttp_event_transport_error = _tinyWRAP.thttp_event_transport_error
+thttp_event_dialog_terminated = _tinyWRAP.thttp_event_dialog_terminated
+twrap_rpmessage_type_sms_none = _tinyWRAP.twrap_rpmessage_type_sms_none
+twrap_rpmessage_type_sms_submit = _tinyWRAP.twrap_rpmessage_type_sms_submit
+twrap_rpmessage_type_sms_deliver = _tinyWRAP.twrap_rpmessage_type_sms_deliver
+twrap_rpmessage_type_sms_ack = _tinyWRAP.twrap_rpmessage_type_sms_ack
+twrap_rpmessage_type_sms_error = _tinyWRAP.twrap_rpmessage_type_sms_error
+twrap_sms_type_none = _tinyWRAP.twrap_sms_type_none
+twrap_sms_type_rpdata = _tinyWRAP.twrap_sms_type_rpdata
+twrap_sms_type_smma = _tinyWRAP.twrap_sms_type_smma
+twrap_sms_type_ack = _tinyWRAP.twrap_sms_type_ack
+twrap_sms_type_error = _tinyWRAP.twrap_sms_type_error
+class RPMessage(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, RPMessage, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, RPMessage, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_RPMessage()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_RPMessage
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.RPMessage_getType(self)
+ def getPayloadLength(self): return _tinyWRAP.RPMessage_getPayloadLength(self)
+ def getPayload(self, *args): return _tinyWRAP.RPMessage_getPayload(self, *args)
+RPMessage_swigregister = _tinyWRAP.RPMessage_swigregister
+RPMessage_swigregister(RPMessage)
+
+class SMSData(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SMSData, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SMSData, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_SMSData()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_SMSData
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.SMSData_getType(self)
+ def getMR(self): return _tinyWRAP.SMSData_getMR(self)
+ def getPayloadLength(self): return _tinyWRAP.SMSData_getPayloadLength(self)
+ def getPayload(self, *args): return _tinyWRAP.SMSData_getPayload(self, *args)
+ def getOA(self): return _tinyWRAP.SMSData_getOA(self)
+ def getDA(self): return _tinyWRAP.SMSData_getDA(self)
+SMSData_swigregister = _tinyWRAP.SMSData_swigregister
+SMSData_swigregister(SMSData)
+
+class SMSEncoder(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, SMSEncoder, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, SMSEncoder, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_getmethods__["encodeSubmit"] = lambda x: _tinyWRAP.SMSEncoder_encodeSubmit
+ if _newclass:encodeSubmit = staticmethod(_tinyWRAP.SMSEncoder_encodeSubmit)
+ __swig_getmethods__["encodeDeliver"] = lambda x: _tinyWRAP.SMSEncoder_encodeDeliver
+ if _newclass:encodeDeliver = staticmethod(_tinyWRAP.SMSEncoder_encodeDeliver)
+ __swig_getmethods__["encodeACK"] = lambda x: _tinyWRAP.SMSEncoder_encodeACK
+ if _newclass:encodeACK = staticmethod(_tinyWRAP.SMSEncoder_encodeACK)
+ __swig_getmethods__["encodeError"] = lambda x: _tinyWRAP.SMSEncoder_encodeError
+ if _newclass:encodeError = staticmethod(_tinyWRAP.SMSEncoder_encodeError)
+ __swig_getmethods__["decode"] = lambda x: _tinyWRAP.SMSEncoder_decode
+ if _newclass:decode = staticmethod(_tinyWRAP.SMSEncoder_decode)
+ __swig_destroy__ = _tinyWRAP.delete_SMSEncoder
+ __del__ = lambda self : None;
+SMSEncoder_swigregister = _tinyWRAP.SMSEncoder_swigregister
+SMSEncoder_swigregister(SMSEncoder)
+
+def SMSEncoder_encodeSubmit(*args):
+ return _tinyWRAP.SMSEncoder_encodeSubmit(*args)
+SMSEncoder_encodeSubmit = _tinyWRAP.SMSEncoder_encodeSubmit
+
+def SMSEncoder_encodeDeliver(*args):
+ return _tinyWRAP.SMSEncoder_encodeDeliver(*args)
+SMSEncoder_encodeDeliver = _tinyWRAP.SMSEncoder_encodeDeliver
+
+def SMSEncoder_encodeACK(*args):
+ return _tinyWRAP.SMSEncoder_encodeACK(*args)
+SMSEncoder_encodeACK = _tinyWRAP.SMSEncoder_encodeACK
+
+def SMSEncoder_encodeError(*args):
+ return _tinyWRAP.SMSEncoder_encodeError(*args)
+SMSEncoder_encodeError = _tinyWRAP.SMSEncoder_encodeError
+
+def SMSEncoder_decode(*args):
+ return _tinyWRAP.SMSEncoder_decode(*args)
+SMSEncoder_decode = _tinyWRAP.SMSEncoder_decode
+
+class MsrpMessage(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpMessage, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, MsrpMessage, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ this = _tinyWRAP.new_MsrpMessage()
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_MsrpMessage
+ __del__ = lambda self : None;
+ def isRequest(self): return _tinyWRAP.MsrpMessage_isRequest(self)
+ def getCode(self): return _tinyWRAP.MsrpMessage_getCode(self)
+ def getPhrase(self): return _tinyWRAP.MsrpMessage_getPhrase(self)
+ def getRequestType(self): return _tinyWRAP.MsrpMessage_getRequestType(self)
+ def getByteRange(self): return _tinyWRAP.MsrpMessage_getByteRange(self)
+ def isLastChunck(self): return _tinyWRAP.MsrpMessage_isLastChunck(self)
+ def isFirstChunck(self): return _tinyWRAP.MsrpMessage_isFirstChunck(self)
+ def getMsrpHeaderValue(self, *args): return _tinyWRAP.MsrpMessage_getMsrpHeaderValue(self, *args)
+ def getMsrpHeaderParamValue(self, *args): return _tinyWRAP.MsrpMessage_getMsrpHeaderParamValue(self, *args)
+ def getMsrpContentLength(self): return _tinyWRAP.MsrpMessage_getMsrpContentLength(self)
+ def getMsrpContent(self, *args): return _tinyWRAP.MsrpMessage_getMsrpContent(self, *args)
+MsrpMessage_swigregister = _tinyWRAP.MsrpMessage_swigregister
+MsrpMessage_swigregister(MsrpMessage)
+
+class MsrpEvent(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpEvent, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, MsrpEvent, name)
+ def __init__(self, *args, **kwargs): raise AttributeError("No constructor defined")
+ __repr__ = _swig_repr
+ __swig_destroy__ = _tinyWRAP.delete_MsrpEvent
+ __del__ = lambda self : None;
+ def getType(self): return _tinyWRAP.MsrpEvent_getType(self)
+ def getSipSession(self): return _tinyWRAP.MsrpEvent_getSipSession(self)
+ def getMessage(self): return _tinyWRAP.MsrpEvent_getMessage(self)
+MsrpEvent_swigregister = _tinyWRAP.MsrpEvent_swigregister
+MsrpEvent_swigregister(MsrpEvent)
+
+class MsrpCallback(_object):
+ __swig_setmethods__ = {}
+ __setattr__ = lambda self, name, value: _swig_setattr(self, MsrpCallback, name, value)
+ __swig_getmethods__ = {}
+ __getattr__ = lambda self, name: _swig_getattr(self, MsrpCallback, name)
+ __repr__ = _swig_repr
+ def __init__(self):
+ if self.__class__ == MsrpCallback:
+ _self = None
+ else:
+ _self = self
+ this = _tinyWRAP.new_MsrpCallback(_self, )
+ try: self.this.append(this)
+ except: self.this = this
+ __swig_destroy__ = _tinyWRAP.delete_MsrpCallback
+ __del__ = lambda self : None;
+ def OnEvent(self, *args): return _tinyWRAP.MsrpCallback_OnEvent(self, *args)
+ def __disown__(self):
+ self.this.disown()
+ _tinyWRAP.disown_MsrpCallback(self)
+ return weakref_proxy(self)
+MsrpCallback_swigregister = _tinyWRAP.MsrpCallback_swigregister
+MsrpCallback_swigregister(MsrpCallback)
+
+tmsrp_NONE = _tinyWRAP.tmsrp_NONE
+tmsrp_SEND = _tinyWRAP.tmsrp_SEND
+tmsrp_REPORT = _tinyWRAP.tmsrp_REPORT
+tmsrp_AUTH = _tinyWRAP.tmsrp_AUTH
+tmsrp_event_type_none = _tinyWRAP.tmsrp_event_type_none
+tmsrp_event_type_connected = _tinyWRAP.tmsrp_event_type_connected
+tmsrp_event_type_disconnected = _tinyWRAP.tmsrp_event_type_disconnected
+tmsrp_event_type_message = _tinyWRAP.tmsrp_event_type_message
+
+
diff --git a/bindings/python/tinyWRAP_wrap.cxx b/bindings/python/tinyWRAP_wrap.cxx
new file mode 100644
index 0000000..d309c3d
--- /dev/null
+++ b/bindings/python/tinyWRAP_wrap.cxx
@@ -0,0 +1,19464 @@
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 1.3.39
+ *
+ * This file is not intended to be easily readable and contains a number of
+ * coding conventions designed to improve portability and efficiency. Do not make
+ * changes to this file unless you know what you are doing--modify the SWIG
+ * interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+#define SWIGPYTHON
+#define SWIG_DIRECTORS
+#define SWIG_PYTHON_DIRECTOR_NO_VTABLE
+
+
+#ifdef __cplusplus
+/* SwigValueWrapper is described in swig.swg */
+template<typename T> class SwigValueWrapper {
+ struct SwigMovePointer {
+ T *ptr;
+ SwigMovePointer(T *p) : ptr(p) { }
+ ~SwigMovePointer() { delete ptr; }
+ SwigMovePointer& operator=(SwigMovePointer& rhs) { T* oldptr = ptr; ptr = 0; delete oldptr; ptr = rhs.ptr; rhs.ptr = 0; return *this; }
+ } pointer;
+ SwigValueWrapper& operator=(const SwigValueWrapper<T>& rhs);
+ SwigValueWrapper(const SwigValueWrapper<T>& rhs);
+public:
+ SwigValueWrapper() : pointer(0) { }
+ SwigValueWrapper& operator=(const T& t) { SwigMovePointer tmp(new T(t)); pointer = tmp; return *this; }
+ operator T&() const { return *pointer.ptr; }
+ T *operator&() { return pointer.ptr; }
+};
+
+template <typename T> T SwigValueInit() {
+ return T();
+}
+#endif
+
+/* -----------------------------------------------------------------------------
+ * This section contains generic SWIG labels for method/variable
+ * declarations/attributes, and other compiler dependent labels.
+ * ----------------------------------------------------------------------------- */
+
+/* template workaround for compilers that cannot correctly implement the C++ standard */
+#ifndef SWIGTEMPLATEDISAMBIGUATOR
+# if defined(__SUNPRO_CC) && (__SUNPRO_CC <= 0x560)
+# define SWIGTEMPLATEDISAMBIGUATOR template
+# elif defined(__HP_aCC)
+/* Needed even with `aCC -AA' when `aCC -V' reports HP ANSI C++ B3910B A.03.55 */
+/* If we find a maximum version that requires this, the test would be __HP_aCC <= 35500 for A.03.55 */
+# define SWIGTEMPLATEDISAMBIGUATOR template
+# else
+# define SWIGTEMPLATEDISAMBIGUATOR
+# endif
+#endif
+
+/* inline attribute */
+#ifndef SWIGINLINE
+# if defined(__cplusplus) || (defined(__GNUC__) && !defined(__STRICT_ANSI__))
+# define SWIGINLINE inline
+# else
+# define SWIGINLINE
+# endif
+#endif
+
+/* attribute recognised by some compilers to avoid 'unused' warnings */
+#ifndef SWIGUNUSED
+# if defined(__GNUC__)
+# if !(defined(__cplusplus)) || (__GNUC__ > 3 || (__GNUC__ == 3 && __GNUC_MINOR__ >= 4))
+# define SWIGUNUSED __attribute__ ((__unused__))
+# else
+# define SWIGUNUSED
+# endif
+# elif defined(__ICC)
+# define SWIGUNUSED __attribute__ ((__unused__))
+# else
+# define SWIGUNUSED
+# endif
+#endif
+
+#ifndef SWIG_MSC_UNSUPPRESS_4505
+# if defined(_MSC_VER)
+# pragma warning(disable : 4505) /* unreferenced local function has been removed */
+# endif
+#endif
+
+#ifndef SWIGUNUSEDPARM
+# ifdef __cplusplus
+# define SWIGUNUSEDPARM(p)
+# else
+# define SWIGUNUSEDPARM(p) p SWIGUNUSED
+# endif
+#endif
+
+/* internal SWIG method */
+#ifndef SWIGINTERN
+# define SWIGINTERN static SWIGUNUSED
+#endif
+
+/* internal inline SWIG method */
+#ifndef SWIGINTERNINLINE
+# define SWIGINTERNINLINE SWIGINTERN SWIGINLINE
+#endif
+
+/* exporting methods */
+#if (__GNUC__ >= 4) || (__GNUC__ == 3 && __GNUC_MINOR__ >= 4)
+# ifndef GCC_HASCLASSVISIBILITY
+# define GCC_HASCLASSVISIBILITY
+# endif
+#endif
+
+#ifndef SWIGEXPORT
+# if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
+# if defined(STATIC_LINKED)
+# define SWIGEXPORT
+# else
+# define SWIGEXPORT __declspec(dllexport)
+# endif
+# else
+# if defined(__GNUC__) && defined(GCC_HASCLASSVISIBILITY)
+# define SWIGEXPORT __attribute__ ((visibility("default")))
+# else
+# define SWIGEXPORT
+# endif
+# endif
+#endif
+
+/* calling conventions for Windows */
+#ifndef SWIGSTDCALL
+# if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
+# define SWIGSTDCALL __stdcall
+# else
+# define SWIGSTDCALL
+# endif
+#endif
+
+/* Deal with Microsoft's attempt at deprecating C standard runtime functions */
+#if !defined(SWIG_NO_CRT_SECURE_NO_DEPRECATE) && defined(_MSC_VER) && !defined(_CRT_SECURE_NO_DEPRECATE)
+# define _CRT_SECURE_NO_DEPRECATE
+#endif
+
+/* Deal with Microsoft's attempt at deprecating methods in the standard C++ library */
+#if !defined(SWIG_NO_SCL_SECURE_NO_DEPRECATE) && defined(_MSC_VER) && !defined(_SCL_SECURE_NO_DEPRECATE)
+# define _SCL_SECURE_NO_DEPRECATE
+#endif
+
+
+
+/* Python.h has to appear first */
+#include <Python.h>
+
+/* -----------------------------------------------------------------------------
+ * swigrun.swg
+ *
+ * This file contains generic C API SWIG runtime support for pointer
+ * type checking.
+ * ----------------------------------------------------------------------------- */
+
+/* This should only be incremented when either the layout of swig_type_info changes,
+ or for whatever reason, the runtime changes incompatibly */
+#define SWIG_RUNTIME_VERSION "4"
+
+/* define SWIG_TYPE_TABLE_NAME as "SWIG_TYPE_TABLE" */
+#ifdef SWIG_TYPE_TABLE
+# define SWIG_QUOTE_STRING(x) #x
+# define SWIG_EXPAND_AND_QUOTE_STRING(x) SWIG_QUOTE_STRING(x)
+# define SWIG_TYPE_TABLE_NAME SWIG_EXPAND_AND_QUOTE_STRING(SWIG_TYPE_TABLE)
+#else
+# define SWIG_TYPE_TABLE_NAME
+#endif
+
+/*
+ You can use the SWIGRUNTIME and SWIGRUNTIMEINLINE macros for
+ creating a static or dynamic library from the SWIG runtime code.
+ In 99.9% of the cases, SWIG just needs to declare them as 'static'.
+
+ But only do this if strictly necessary, ie, if you have problems
+ with your compiler or suchlike.
+*/
+
+#ifndef SWIGRUNTIME
+# define SWIGRUNTIME SWIGINTERN
+#endif
+
+#ifndef SWIGRUNTIMEINLINE
+# define SWIGRUNTIMEINLINE SWIGRUNTIME SWIGINLINE
+#endif
+
+/* Generic buffer size */
+#ifndef SWIG_BUFFER_SIZE
+# define SWIG_BUFFER_SIZE 1024
+#endif
+
+/* Flags for pointer conversions */
+#define SWIG_POINTER_DISOWN 0x1
+#define SWIG_CAST_NEW_MEMORY 0x2
+
+/* Flags for new pointer objects */
+#define SWIG_POINTER_OWN 0x1
+
+
+/*
+ Flags/methods for returning states.
+
+ The SWIG conversion methods, as ConvertPtr, return and integer
+ that tells if the conversion was successful or not. And if not,
+ an error code can be returned (see swigerrors.swg for the codes).
+
+ Use the following macros/flags to set or process the returning
+ states.
+
+ In old versions of SWIG, code such as the following was usually written:
+
+ if (SWIG_ConvertPtr(obj,vptr,ty.flags) != -1) {
+ // success code
+ } else {
+ //fail code
+ }
+
+ Now you can be more explicit:
+
+ int res = SWIG_ConvertPtr(obj,vptr,ty.flags);
+ if (SWIG_IsOK(res)) {
+ // success code
+ } else {
+ // fail code
+ }
+
+ which is the same really, but now you can also do
+
+ Type *ptr;
+ int res = SWIG_ConvertPtr(obj,(void **)(&ptr),ty.flags);
+ if (SWIG_IsOK(res)) {
+ // success code
+ if (SWIG_IsNewObj(res) {
+ ...
+ delete *ptr;
+ } else {
+ ...
+ }
+ } else {
+ // fail code
+ }
+
+ I.e., now SWIG_ConvertPtr can return new objects and you can
+ identify the case and take care of the deallocation. Of course that
+ also requires SWIG_ConvertPtr to return new result values, such as
+
+ int SWIG_ConvertPtr(obj, ptr,...) {
+ if (<obj is ok>) {
+ if (<need new object>) {
+ *ptr = <ptr to new allocated object>;
+ return SWIG_NEWOBJ;
+ } else {
+ *ptr = <ptr to old object>;
+ return SWIG_OLDOBJ;
+ }
+ } else {
+ return SWIG_BADOBJ;
+ }
+ }
+
+ Of course, returning the plain '0(success)/-1(fail)' still works, but you can be
+ more explicit by returning SWIG_BADOBJ, SWIG_ERROR or any of the
+ SWIG errors code.
+
+ Finally, if the SWIG_CASTRANK_MODE is enabled, the result code
+ allows to return the 'cast rank', for example, if you have this
+
+ int food(double)
+ int fooi(int);
+
+ and you call
+
+ food(1) // cast rank '1' (1 -> 1.0)
+ fooi(1) // cast rank '0'
+
+ just use the SWIG_AddCast()/SWIG_CheckState()
+*/
+
+#define SWIG_OK (0)
+#define SWIG_ERROR (-1)
+#define SWIG_IsOK(r) (r >= 0)
+#define SWIG_ArgError(r) ((r != SWIG_ERROR) ? r : SWIG_TypeError)
+
+/* The CastRankLimit says how many bits are used for the cast rank */
+#define SWIG_CASTRANKLIMIT (1 << 8)
+/* The NewMask denotes the object was created (using new/malloc) */
+#define SWIG_NEWOBJMASK (SWIG_CASTRANKLIMIT << 1)
+/* The TmpMask is for in/out typemaps that use temporal objects */
+#define SWIG_TMPOBJMASK (SWIG_NEWOBJMASK << 1)
+/* Simple returning values */
+#define SWIG_BADOBJ (SWIG_ERROR)
+#define SWIG_OLDOBJ (SWIG_OK)
+#define SWIG_NEWOBJ (SWIG_OK | SWIG_NEWOBJMASK)
+#define SWIG_TMPOBJ (SWIG_OK | SWIG_TMPOBJMASK)
+/* Check, add and del mask methods */
+#define SWIG_AddNewMask(r) (SWIG_IsOK(r) ? (r | SWIG_NEWOBJMASK) : r)
+#define SWIG_DelNewMask(r) (SWIG_IsOK(r) ? (r & ~SWIG_NEWOBJMASK) : r)
+#define SWIG_IsNewObj(r) (SWIG_IsOK(r) && (r & SWIG_NEWOBJMASK))
+#define SWIG_AddTmpMask(r) (SWIG_IsOK(r) ? (r | SWIG_TMPOBJMASK) : r)
+#define SWIG_DelTmpMask(r) (SWIG_IsOK(r) ? (r & ~SWIG_TMPOBJMASK) : r)
+#define SWIG_IsTmpObj(r) (SWIG_IsOK(r) && (r & SWIG_TMPOBJMASK))
+
+/* Cast-Rank Mode */
+#if defined(SWIG_CASTRANK_MODE)
+# ifndef SWIG_TypeRank
+# define SWIG_TypeRank unsigned long
+# endif
+# ifndef SWIG_MAXCASTRANK /* Default cast allowed */
+# define SWIG_MAXCASTRANK (2)
+# endif
+# define SWIG_CASTRANKMASK ((SWIG_CASTRANKLIMIT) -1)
+# define SWIG_CastRank(r) (r & SWIG_CASTRANKMASK)
+SWIGINTERNINLINE int SWIG_AddCast(int r) {
+ return SWIG_IsOK(r) ? ((SWIG_CastRank(r) < SWIG_MAXCASTRANK) ? (r + 1) : SWIG_ERROR) : r;
+}
+SWIGINTERNINLINE int SWIG_CheckState(int r) {
+ return SWIG_IsOK(r) ? SWIG_CastRank(r) + 1 : 0;
+}
+#else /* no cast-rank mode */
+# define SWIG_AddCast
+# define SWIG_CheckState(r) (SWIG_IsOK(r) ? 1 : 0)
+#endif
+
+
+#include <string.h>
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+typedef void *(*swig_converter_func)(void *, int *);
+typedef struct swig_type_info *(*swig_dycast_func)(void **);
+
+/* Structure to store information on one type */
+typedef struct swig_type_info {
+ const char *name; /* mangled name of this type */
+ const char *str; /* human readable name of this type */
+ swig_dycast_func dcast; /* dynamic cast function down a hierarchy */
+ struct swig_cast_info *cast; /* linked list of types that can cast into this type */
+ void *clientdata; /* language specific type data */
+ int owndata; /* flag if the structure owns the clientdata */
+} swig_type_info;
+
+/* Structure to store a type and conversion function used for casting */
+typedef struct swig_cast_info {
+ swig_type_info *type; /* pointer to type that is equivalent to this type */
+ swig_converter_func converter; /* function to cast the void pointers */
+ struct swig_cast_info *next; /* pointer to next cast in linked list */
+ struct swig_cast_info *prev; /* pointer to the previous cast */
+} swig_cast_info;
+
+/* Structure used to store module information
+ * Each module generates one structure like this, and the runtime collects
+ * all of these structures and stores them in a circularly linked list.*/
+typedef struct swig_module_info {
+ swig_type_info **types; /* Array of pointers to swig_type_info structures that are in this module */
+ size_t size; /* Number of types in this module */
+ struct swig_module_info *next; /* Pointer to next element in circularly linked list */
+ swig_type_info **type_initial; /* Array of initially generated type structures */
+ swig_cast_info **cast_initial; /* Array of initially generated casting structures */
+ void *clientdata; /* Language specific module data */
+} swig_module_info;
+
+/*
+ Compare two type names skipping the space characters, therefore
+ "char*" == "char *" and "Class<int>" == "Class<int >", etc.
+
+ Return 0 when the two name types are equivalent, as in
+ strncmp, but skipping ' '.
+*/
+SWIGRUNTIME int
+SWIG_TypeNameComp(const char *f1, const char *l1,
+ const char *f2, const char *l2) {
+ for (;(f1 != l1) && (f2 != l2); ++f1, ++f2) {
+ while ((*f1 == ' ') && (f1 != l1)) ++f1;
+ while ((*f2 == ' ') && (f2 != l2)) ++f2;
+ if (*f1 != *f2) return (*f1 > *f2) ? 1 : -1;
+ }
+ return (int)((l1 - f1) - (l2 - f2));
+}
+
+/*
+ Check type equivalence in a name list like <name1>|<name2>|...
+ Return 0 if not equal, 1 if equal
+*/
+SWIGRUNTIME int
+SWIG_TypeEquiv(const char *nb, const char *tb) {
+ int equiv = 0;
+ const char* te = tb + strlen(tb);
+ const char* ne = nb;
+ while (!equiv && *ne) {
+ for (nb = ne; *ne; ++ne) {
+ if (*ne == '|') break;
+ }
+ equiv = (SWIG_TypeNameComp(nb, ne, tb, te) == 0) ? 1 : 0;
+ if (*ne) ++ne;
+ }
+ return equiv;
+}
+
+/*
+ Check type equivalence in a name list like <name1>|<name2>|...
+ Return 0 if equal, -1 if nb < tb, 1 if nb > tb
+*/
+SWIGRUNTIME int
+SWIG_TypeCompare(const char *nb, const char *tb) {
+ int equiv = 0;
+ const char* te = tb + strlen(tb);
+ const char* ne = nb;
+ while (!equiv && *ne) {
+ for (nb = ne; *ne; ++ne) {
+ if (*ne == '|') break;
+ }
+ equiv = (SWIG_TypeNameComp(nb, ne, tb, te) == 0) ? 1 : 0;
+ if (*ne) ++ne;
+ }
+ return equiv;
+}
+
+
+/*
+ Check the typename
+*/
+SWIGRUNTIME swig_cast_info *
+SWIG_TypeCheck(const char *c, swig_type_info *ty) {
+ if (ty) {
+ swig_cast_info *iter = ty->cast;
+ while (iter) {
+ if (strcmp(iter->type->name, c) == 0) {
+ if (iter == ty->cast)
+ return iter;
+ /* Move iter to the top of the linked list */
+ iter->prev->next = iter->next;
+ if (iter->next)
+ iter->next->prev = iter->prev;
+ iter->next = ty->cast;
+ iter->prev = 0;
+ if (ty->cast) ty->cast->prev = iter;
+ ty->cast = iter;
+ return iter;
+ }
+ iter = iter->next;
+ }
+ }
+ return 0;
+}
+
+/*
+ Identical to SWIG_TypeCheck, except strcmp is replaced with a pointer comparison
+*/
+SWIGRUNTIME swig_cast_info *
+SWIG_TypeCheckStruct(swig_type_info *from, swig_type_info *ty) {
+ if (ty) {
+ swig_cast_info *iter = ty->cast;
+ while (iter) {
+ if (iter->type == from) {
+ if (iter == ty->cast)
+ return iter;
+ /* Move iter to the top of the linked list */
+ iter->prev->next = iter->next;
+ if (iter->next)
+ iter->next->prev = iter->prev;
+ iter->next = ty->cast;
+ iter->prev = 0;
+ if (ty->cast) ty->cast->prev = iter;
+ ty->cast = iter;
+ return iter;
+ }
+ iter = iter->next;
+ }
+ }
+ return 0;
+}
+
+/*
+ Cast a pointer up an inheritance hierarchy
+*/
+SWIGRUNTIMEINLINE void *
+SWIG_TypeCast(swig_cast_info *ty, void *ptr, int *newmemory) {
+ return ((!ty) || (!ty->converter)) ? ptr : (*ty->converter)(ptr, newmemory);
+}
+
+/*
+ Dynamic pointer casting. Down an inheritance hierarchy
+*/
+SWIGRUNTIME swig_type_info *
+SWIG_TypeDynamicCast(swig_type_info *ty, void **ptr) {
+ swig_type_info *lastty = ty;
+ if (!ty || !ty->dcast) return ty;
+ while (ty && (ty->dcast)) {
+ ty = (*ty->dcast)(ptr);
+ if (ty) lastty = ty;
+ }
+ return lastty;
+}
+
+/*
+ Return the name associated with this type
+*/
+SWIGRUNTIMEINLINE const char *
+SWIG_TypeName(const swig_type_info *ty) {
+ return ty->name;
+}
+
+/*
+ Return the pretty name associated with this type,
+ that is an unmangled type name in a form presentable to the user.
+*/
+SWIGRUNTIME const char *
+SWIG_TypePrettyName(const swig_type_info *type) {
+ /* The "str" field contains the equivalent pretty names of the
+ type, separated by vertical-bar characters. We choose
+ to print the last name, as it is often (?) the most
+ specific. */
+ if (!type) return NULL;
+ if (type->str != NULL) {
+ const char *last_name = type->str;
+ const char *s;
+ for (s = type->str; *s; s++)
+ if (*s == '|') last_name = s+1;
+ return last_name;
+ }
+ else
+ return type->name;
+}
+
+/*
+ Set the clientdata field for a type
+*/
+SWIGRUNTIME void
+SWIG_TypeClientData(swig_type_info *ti, void *clientdata) {
+ swig_cast_info *cast = ti->cast;
+ /* if (ti->clientdata == clientdata) return; */
+ ti->clientdata = clientdata;
+
+ while (cast) {
+ if (!cast->converter) {
+ swig_type_info *tc = cast->type;
+ if (!tc->clientdata) {
+ SWIG_TypeClientData(tc, clientdata);
+ }
+ }
+ cast = cast->next;
+ }
+}
+SWIGRUNTIME void
+SWIG_TypeNewClientData(swig_type_info *ti, void *clientdata) {
+ SWIG_TypeClientData(ti, clientdata);
+ ti->owndata = 1;
+}
+
+/*
+ Search for a swig_type_info structure only by mangled name
+ Search is a O(log #types)
+
+ We start searching at module start, and finish searching when start == end.
+ Note: if start == end at the beginning of the function, we go all the way around
+ the circular list.
+*/
+SWIGRUNTIME swig_type_info *
+SWIG_MangledTypeQueryModule(swig_module_info *start,
+ swig_module_info *end,
+ const char *name) {
+ swig_module_info *iter = start;
+ do {
+ if (iter->size) {
+ register size_t l = 0;
+ register size_t r = iter->size - 1;
+ do {
+ /* since l+r >= 0, we can (>> 1) instead (/ 2) */
+ register size_t i = (l + r) >> 1;
+ const char *iname = iter->types[i]->name;
+ if (iname) {
+ register int compare = strcmp(name, iname);
+ if (compare == 0) {
+ return iter->types[i];
+ } else if (compare < 0) {
+ if (i) {
+ r = i - 1;
+ } else {
+ break;
+ }
+ } else if (compare > 0) {
+ l = i + 1;
+ }
+ } else {
+ break; /* should never happen */
+ }
+ } while (l <= r);
+ }
+ iter = iter->next;
+ } while (iter != end);
+ return 0;
+}
+
+/*
+ Search for a swig_type_info structure for either a mangled name or a human readable name.
+ It first searches the mangled names of the types, which is a O(log #types)
+ If a type is not found it then searches the human readable names, which is O(#types).
+
+ We start searching at module start, and finish searching when start == end.
+ Note: if start == end at the beginning of the function, we go all the way around
+ the circular list.
+*/
+SWIGRUNTIME swig_type_info *
+SWIG_TypeQueryModule(swig_module_info *start,
+ swig_module_info *end,
+ const char *name) {
+ /* STEP 1: Search the name field using binary search */
+ swig_type_info *ret = SWIG_MangledTypeQueryModule(start, end, name);
+ if (ret) {
+ return ret;
+ } else {
+ /* STEP 2: If the type hasn't been found, do a complete search
+ of the str field (the human readable name) */
+ swig_module_info *iter = start;
+ do {
+ register size_t i = 0;
+ for (; i < iter->size; ++i) {
+ if (iter->types[i]->str && (SWIG_TypeEquiv(iter->types[i]->str, name)))
+ return iter->types[i];
+ }
+ iter = iter->next;
+ } while (iter != end);
+ }
+
+ /* neither found a match */
+ return 0;
+}
+
+/*
+ Pack binary data into a string
+*/
+SWIGRUNTIME char *
+SWIG_PackData(char *c, void *ptr, size_t sz) {
+ static const char hex[17] = "0123456789abcdef";
+ register const unsigned char *u = (unsigned char *) ptr;
+ register const unsigned char *eu = u + sz;
+ for (; u != eu; ++u) {
+ register unsigned char uu = *u;
+ *(c++) = hex[(uu & 0xf0) >> 4];
+ *(c++) = hex[uu & 0xf];
+ }
+ return c;
+}
+
+/*
+ Unpack binary data from a string
+*/
+SWIGRUNTIME const char *
+SWIG_UnpackData(const char *c, void *ptr, size_t sz) {
+ register unsigned char *u = (unsigned char *) ptr;
+ register const unsigned char *eu = u + sz;
+ for (; u != eu; ++u) {
+ register char d = *(c++);
+ register unsigned char uu;
+ if ((d >= '0') && (d <= '9'))
+ uu = ((d - '0') << 4);
+ else if ((d >= 'a') && (d <= 'f'))
+ uu = ((d - ('a'-10)) << 4);
+ else
+ return (char *) 0;
+ d = *(c++);
+ if ((d >= '0') && (d <= '9'))
+ uu |= (d - '0');
+ else if ((d >= 'a') && (d <= 'f'))
+ uu |= (d - ('a'-10));
+ else
+ return (char *) 0;
+ *u = uu;
+ }
+ return c;
+}
+
+/*
+ Pack 'void *' into a string buffer.
+*/
+SWIGRUNTIME char *
+SWIG_PackVoidPtr(char *buff, void *ptr, const char *name, size_t bsz) {
+ char *r = buff;
+ if ((2*sizeof(void *) + 2) > bsz) return 0;
+ *(r++) = '_';
+ r = SWIG_PackData(r,&ptr,sizeof(void *));
+ if (strlen(name) + 1 > (bsz - (r - buff))) return 0;
+ strcpy(r,name);
+ return buff;
+}
+
+SWIGRUNTIME const char *
+SWIG_UnpackVoidPtr(const char *c, void **ptr, const char *name) {
+ if (*c != '_') {
+ if (strcmp(c,"NULL") == 0) {
+ *ptr = (void *) 0;
+ return name;
+ } else {
+ return 0;
+ }
+ }
+ return SWIG_UnpackData(++c,ptr,sizeof(void *));
+}
+
+SWIGRUNTIME char *
+SWIG_PackDataName(char *buff, void *ptr, size_t sz, const char *name, size_t bsz) {
+ char *r = buff;
+ size_t lname = (name ? strlen(name) : 0);
+ if ((2*sz + 2 + lname) > bsz) return 0;
+ *(r++) = '_';
+ r = SWIG_PackData(r,ptr,sz);
+ if (lname) {
+ strncpy(r,name,lname+1);
+ } else {
+ *r = 0;
+ }
+ return buff;
+}
+
+SWIGRUNTIME const char *
+SWIG_UnpackDataName(const char *c, void *ptr, size_t sz, const char *name) {
+ if (*c != '_') {
+ if (strcmp(c,"NULL") == 0) {
+ memset(ptr,0,sz);
+ return name;
+ } else {
+ return 0;
+ }
+ }
+ return SWIG_UnpackData(++c,ptr,sz);
+}
+
+#ifdef __cplusplus
+}
+#endif
+
+/* Errors in SWIG */
+#define SWIG_UnknownError -1
+#define SWIG_IOError -2
+#define SWIG_RuntimeError -3
+#define SWIG_IndexError -4
+#define SWIG_TypeError -5
+#define SWIG_DivisionByZero -6
+#define SWIG_OverflowError -7
+#define SWIG_SyntaxError -8
+#define SWIG_ValueError -9
+#define SWIG_SystemError -10
+#define SWIG_AttributeError -11
+#define SWIG_MemoryError -12
+#define SWIG_NullReferenceError -13
+
+
+
+/* Compatibility marcos for Python 3 */
+#if PY_VERSION_HEX >= 0x03000000
+
+#define PyClass_Check(obj) PyObject_IsInstance(obj, (PyObject *)&PyType_Type)
+#define PyInt_Check(x) PyLong_Check(x)
+#define PyInt_AsLong(x) PyLong_AsLong(x)
+#define PyInt_FromLong(x) PyLong_FromLong(x)
+#define PyString_Format(fmt, args) PyUnicode_Format(fmt, args)
+
+#endif
+
+#ifndef Py_TYPE
+# define Py_TYPE(op) ((op)->ob_type)
+#endif
+
+/* SWIG APIs for compatibility of both Python 2 & 3 */
+
+#if PY_VERSION_HEX >= 0x03000000
+# define SWIG_Python_str_FromFormat PyUnicode_FromFormat
+#else
+# define SWIG_Python_str_FromFormat PyString_FromFormat
+#endif
+
+SWIGINTERN char*
+SWIG_Python_str_AsChar(PyObject *str)
+{
+#if PY_VERSION_HEX >= 0x03000000
+ str = PyUnicode_AsUTF8String(str);
+ return PyBytes_AsString(str);
+#else
+ return PyString_AsString(str);
+#endif
+}
+
+SWIGINTERN PyObject*
+SWIG_Python_str_FromChar(const char *c)
+{
+#if PY_VERSION_HEX >= 0x03000000
+ return PyUnicode_FromString(c);
+#else
+ return PyString_FromString(c);
+#endif
+}
+
+/* Add PyOS_snprintf for old Pythons */
+#if PY_VERSION_HEX < 0x02020000
+# if defined(_MSC_VER) || defined(__BORLANDC__) || defined(_WATCOM)
+# define PyOS_snprintf _snprintf
+# else
+# define PyOS_snprintf snprintf
+# endif
+#endif
+
+/* A crude PyString_FromFormat implementation for old Pythons */
+#if PY_VERSION_HEX < 0x02020000
+
+#ifndef SWIG_PYBUFFER_SIZE
+# define SWIG_PYBUFFER_SIZE 1024
+#endif
+
+static PyObject *
+PyString_FromFormat(const char *fmt, ...) {
+ va_list ap;
+ char buf[SWIG_PYBUFFER_SIZE * 2];
+ int res;
+ va_start(ap, fmt);
+ res = vsnprintf(buf, sizeof(buf), fmt, ap);
+ va_end(ap);
+ return (res < 0 || res >= (int)sizeof(buf)) ? 0 : PyString_FromString(buf);
+}
+#endif
+
+/* Add PyObject_Del for old Pythons */
+#if PY_VERSION_HEX < 0x01060000
+# define PyObject_Del(op) PyMem_DEL((op))
+#endif
+#ifndef PyObject_DEL
+# define PyObject_DEL PyObject_Del
+#endif
+
+/* A crude PyExc_StopIteration exception for old Pythons */
+#if PY_VERSION_HEX < 0x02020000
+# ifndef PyExc_StopIteration
+# define PyExc_StopIteration PyExc_RuntimeError
+# endif
+# ifndef PyObject_GenericGetAttr
+# define PyObject_GenericGetAttr 0
+# endif
+#endif
+
+/* Py_NotImplemented is defined in 2.1 and up. */
+#if PY_VERSION_HEX < 0x02010000
+# ifndef Py_NotImplemented
+# define Py_NotImplemented PyExc_RuntimeError
+# endif
+#endif
+
+/* A crude PyString_AsStringAndSize implementation for old Pythons */
+#if PY_VERSION_HEX < 0x02010000
+# ifndef PyString_AsStringAndSize
+# define PyString_AsStringAndSize(obj, s, len) {*s = PyString_AsString(obj); *len = *s ? strlen(*s) : 0;}
+# endif
+#endif
+
+/* PySequence_Size for old Pythons */
+#if PY_VERSION_HEX < 0x02000000
+# ifndef PySequence_Size
+# define PySequence_Size PySequence_Length
+# endif
+#endif
+
+/* PyBool_FromLong for old Pythons */
+#if PY_VERSION_HEX < 0x02030000
+static
+PyObject *PyBool_FromLong(long ok)
+{
+ PyObject *result = ok ? Py_True : Py_False;
+ Py_INCREF(result);
+ return result;
+}
+#endif
+
+/* Py_ssize_t for old Pythons */
+/* This code is as recommended by: */
+/* http://www.python.org/dev/peps/pep-0353/#conversion-guidelines */
+#if PY_VERSION_HEX < 0x02050000 && !defined(PY_SSIZE_T_MIN)
+typedef int Py_ssize_t;
+# define PY_SSIZE_T_MAX INT_MAX
+# define PY_SSIZE_T_MIN INT_MIN
+#endif
+
+/* -----------------------------------------------------------------------------
+ * error manipulation
+ * ----------------------------------------------------------------------------- */
+
+SWIGRUNTIME PyObject*
+SWIG_Python_ErrorType(int code) {
+ PyObject* type = 0;
+ switch(code) {
+ case SWIG_MemoryError:
+ type = PyExc_MemoryError;
+ break;
+ case SWIG_IOError:
+ type = PyExc_IOError;
+ break;
+ case SWIG_RuntimeError:
+ type = PyExc_RuntimeError;
+ break;
+ case SWIG_IndexError:
+ type = PyExc_IndexError;
+ break;
+ case SWIG_TypeError:
+ type = PyExc_TypeError;
+ break;
+ case SWIG_DivisionByZero:
+ type = PyExc_ZeroDivisionError;
+ break;
+ case SWIG_OverflowError:
+ type = PyExc_OverflowError;
+ break;
+ case SWIG_SyntaxError:
+ type = PyExc_SyntaxError;
+ break;
+ case SWIG_ValueError:
+ type = PyExc_ValueError;
+ break;
+ case SWIG_SystemError:
+ type = PyExc_SystemError;
+ break;
+ case SWIG_AttributeError:
+ type = PyExc_AttributeError;
+ break;
+ default:
+ type = PyExc_RuntimeError;
+ }
+ return type;
+}
+
+
+SWIGRUNTIME void
+SWIG_Python_AddErrorMsg(const char* mesg)
+{
+ PyObject *type = 0;
+ PyObject *value = 0;
+ PyObject *traceback = 0;
+
+ if (PyErr_Occurred()) PyErr_Fetch(&type, &value, &traceback);
+ if (value) {
+ PyObject *old_str = PyObject_Str(value);
+ PyErr_Clear();
+ Py_XINCREF(type);
+
+ PyErr_Format(type, "%s %s", SWIG_Python_str_AsChar(old_str), mesg);
+ Py_DECREF(old_str);
+ Py_DECREF(value);
+ } else {
+ PyErr_SetString(PyExc_RuntimeError, mesg);
+ }
+}
+
+#if defined(SWIG_PYTHON_NO_THREADS)
+# if defined(SWIG_PYTHON_THREADS)
+# undef SWIG_PYTHON_THREADS
+# endif
+#endif
+#if defined(SWIG_PYTHON_THREADS) /* Threading support is enabled */
+# if !defined(SWIG_PYTHON_USE_GIL) && !defined(SWIG_PYTHON_NO_USE_GIL)
+# if (PY_VERSION_HEX >= 0x02030000) /* For 2.3 or later, use the PyGILState calls */
+# define SWIG_PYTHON_USE_GIL
+# endif
+# endif
+# if defined(SWIG_PYTHON_USE_GIL) /* Use PyGILState threads calls */
+# ifndef SWIG_PYTHON_INITIALIZE_THREADS
+# define SWIG_PYTHON_INITIALIZE_THREADS PyEval_InitThreads()
+# endif
+# ifdef __cplusplus /* C++ code */
+ class SWIG_Python_Thread_Block {
+ bool status;
+ PyGILState_STATE state;
+ public:
+ void end() { if (status) { PyGILState_Release(state); status = false;} }
+ SWIG_Python_Thread_Block() : status(true), state(PyGILState_Ensure()) {}
+ ~SWIG_Python_Thread_Block() { end(); }
+ };
+ class SWIG_Python_Thread_Allow {
+ bool status;
+ PyThreadState *save;
+ public:
+ void end() { if (status) { PyEval_RestoreThread(save); status = false; }}
+ SWIG_Python_Thread_Allow() : status(true), save(PyEval_SaveThread()) {}
+ ~SWIG_Python_Thread_Allow() { end(); }
+ };
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK SWIG_Python_Thread_Block _swig_thread_block
+# define SWIG_PYTHON_THREAD_END_BLOCK _swig_thread_block.end()
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW SWIG_Python_Thread_Allow _swig_thread_allow
+# define SWIG_PYTHON_THREAD_END_ALLOW _swig_thread_allow.end()
+# else /* C code */
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK PyGILState_STATE _swig_thread_block = PyGILState_Ensure()
+# define SWIG_PYTHON_THREAD_END_BLOCK PyGILState_Release(_swig_thread_block)
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW PyThreadState *_swig_thread_allow = PyEval_SaveThread()
+# define SWIG_PYTHON_THREAD_END_ALLOW PyEval_RestoreThread(_swig_thread_allow)
+# endif
+# else /* Old thread way, not implemented, user must provide it */
+# if !defined(SWIG_PYTHON_INITIALIZE_THREADS)
+# define SWIG_PYTHON_INITIALIZE_THREADS
+# endif
+# if !defined(SWIG_PYTHON_THREAD_BEGIN_BLOCK)
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK
+# endif
+# if !defined(SWIG_PYTHON_THREAD_END_BLOCK)
+# define SWIG_PYTHON_THREAD_END_BLOCK
+# endif
+# if !defined(SWIG_PYTHON_THREAD_BEGIN_ALLOW)
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW
+# endif
+# if !defined(SWIG_PYTHON_THREAD_END_ALLOW)
+# define SWIG_PYTHON_THREAD_END_ALLOW
+# endif
+# endif
+#else /* No thread support */
+# define SWIG_PYTHON_INITIALIZE_THREADS
+# define SWIG_PYTHON_THREAD_BEGIN_BLOCK
+# define SWIG_PYTHON_THREAD_END_BLOCK
+# define SWIG_PYTHON_THREAD_BEGIN_ALLOW
+# define SWIG_PYTHON_THREAD_END_ALLOW
+#endif
+
+/* -----------------------------------------------------------------------------
+ * Python API portion that goes into the runtime
+ * ----------------------------------------------------------------------------- */
+
+#ifdef __cplusplus
+extern "C" {
+#if 0
+} /* cc-mode */
+#endif
+#endif
+
+/* -----------------------------------------------------------------------------
+ * Constant declarations
+ * ----------------------------------------------------------------------------- */
+
+/* Constant Types */
+#define SWIG_PY_POINTER 4
+#define SWIG_PY_BINARY 5
+
+/* Constant information structure */
+typedef struct swig_const_info {
+ int type;
+ char *name;
+ long lvalue;
+ double dvalue;
+ void *pvalue;
+ swig_type_info **ptype;
+} swig_const_info;
+
+
+/* -----------------------------------------------------------------------------
+ * Wrapper of PyInstanceMethod_New() used in Python 3
+ * It is exported to the generated module, used for -fastproxy
+ * ----------------------------------------------------------------------------- */
+SWIGRUNTIME PyObject* SWIG_PyInstanceMethod_New(PyObject *self, PyObject *func)
+{
+#if PY_VERSION_HEX >= 0x03000000
+ return PyInstanceMethod_New(func);
+#else
+ return NULL;
+#endif
+}
+
+#ifdef __cplusplus
+#if 0
+{ /* cc-mode */
+#endif
+}
+#endif
+
+
+/* -----------------------------------------------------------------------------
+ * See the LICENSE file for information on copyright, usage and redistribution
+ * of SWIG, and the README file for authors - http://www.swig.org/release.html.
+ *
+ * pyrun.swg
+ *
+ * This file contains the runtime support for Python modules
+ * and includes code for managing global variables and pointer
+ * type checking.
+ *
+ * ----------------------------------------------------------------------------- */
+
+/* Common SWIG API */
+
+/* for raw pointers */
+#define SWIG_Python_ConvertPtr(obj, pptr, type, flags) SWIG_Python_ConvertPtrAndOwn(obj, pptr, type, flags, 0)
+#define SWIG_ConvertPtr(obj, pptr, type, flags) SWIG_Python_ConvertPtr(obj, pptr, type, flags)
+#define SWIG_ConvertPtrAndOwn(obj,pptr,type,flags,own) SWIG_Python_ConvertPtrAndOwn(obj, pptr, type, flags, own)
+#define SWIG_NewPointerObj(ptr, type, flags) SWIG_Python_NewPointerObj(ptr, type, flags)
+#define SWIG_CheckImplicit(ty) SWIG_Python_CheckImplicit(ty)
+#define SWIG_AcquirePtr(ptr, src) SWIG_Python_AcquirePtr(ptr, src)
+#define swig_owntype int
+
+/* for raw packed data */
+#define SWIG_ConvertPacked(obj, ptr, sz, ty) SWIG_Python_ConvertPacked(obj, ptr, sz, ty)
+#define SWIG_NewPackedObj(ptr, sz, type) SWIG_Python_NewPackedObj(ptr, sz, type)
+
+/* for class or struct pointers */
+#define SWIG_ConvertInstance(obj, pptr, type, flags) SWIG_ConvertPtr(obj, pptr, type, flags)
+#define SWIG_NewInstanceObj(ptr, type, flags) SWIG_NewPointerObj(ptr, type, flags)
+
+/* for C or C++ function pointers */
+#define SWIG_ConvertFunctionPtr(obj, pptr, type) SWIG_Python_ConvertFunctionPtr(obj, pptr, type)
+#define SWIG_NewFunctionPtrObj(ptr, type) SWIG_Python_NewPointerObj(ptr, type, 0)
+
+/* for C++ member pointers, ie, member methods */
+#define SWIG_ConvertMember(obj, ptr, sz, ty) SWIG_Python_ConvertPacked(obj, ptr, sz, ty)
+#define SWIG_NewMemberObj(ptr, sz, type) SWIG_Python_NewPackedObj(ptr, sz, type)
+
+
+/* Runtime API */
+
+#define SWIG_GetModule(clientdata) SWIG_Python_GetModule()
+#define SWIG_SetModule(clientdata, pointer) SWIG_Python_SetModule(pointer)
+#define SWIG_NewClientData(obj) SwigPyClientData_New(obj)
+
+#define SWIG_SetErrorObj SWIG_Python_SetErrorObj
+#define SWIG_SetErrorMsg SWIG_Python_SetErrorMsg
+#define SWIG_ErrorType(code) SWIG_Python_ErrorType(code)
+#define SWIG_Error(code, msg) SWIG_Python_SetErrorMsg(SWIG_ErrorType(code), msg)
+#define SWIG_fail goto fail
+
+
+/* Runtime API implementation */
+
+/* Error manipulation */
+
+SWIGINTERN void
+SWIG_Python_SetErrorObj(PyObject *errtype, PyObject *obj) {
+ SWIG_PYTHON_THREAD_BEGIN_BLOCK;
+ PyErr_SetObject(errtype, obj);
+ Py_DECREF(obj);
+ SWIG_PYTHON_THREAD_END_BLOCK;
+}
+
+SWIGINTERN void
+SWIG_Python_SetErrorMsg(PyObject *errtype, const char *msg) {
+ SWIG_PYTHON_THREAD_BEGIN_BLOCK;
+ PyErr_SetString(errtype, (char *) msg);
+ SWIG_PYTHON_THREAD_END_BLOCK;
+}
+
+#define SWIG_Python_Raise(obj, type, desc) SWIG_Python_SetErrorObj(SWIG_Python_ExceptionType(desc), obj)
+
+/* Set a constant value */
+
+SWIGINTERN void
+SWIG_Python_SetConstant(PyObject *d, const char *name, PyObject *obj) {
+ PyDict_SetItemString(d, (char*) name, obj);
+ Py_DECREF(obj);
+}
+
+/* Append a value to the result obj */
+
+SWIGINTERN PyObject*
+SWIG_Python_AppendOutput(PyObject* result, PyObject* obj) {
+#if !defined(SWIG_PYTHON_OUTPUT_TUPLE)
+ if (!result) {
+ result = obj;
+ } else if (result == Py_None) {
+ Py_DECREF(result);
+ result = obj;
+ } else {
+ if (!PyList_Check(result)) {
+ PyObject *o2 = result;
+ result = PyList_New(1);
+ PyList_SetItem(result, 0, o2);
+ }
+ PyList_Append(result,obj);
+ Py_DECREF(obj);
+ }
+ return result;
+#else
+ PyObject* o2;
+ PyObject* o3;
+ if (!result) {
+ result = obj;
+ } else if (result == Py_None) {
+ Py_DECREF(result);
+ result = obj;
+ } else {
+ if (!PyTuple_Check(result)) {
+ o2 = result;
+ result = PyTuple_New(1);
+ PyTuple_SET_ITEM(result, 0, o2);
+ }
+ o3 = PyTuple_New(1);
+ PyTuple_SET_ITEM(o3, 0, obj);
+ o2 = result;
+ result = PySequence_Concat(o2, o3);
+ Py_DECREF(o2);
+ Py_DECREF(o3);
+ }
+ return result;
+#endif
+}
+
+/* Unpack the argument tuple */
+
+SWIGINTERN int
+SWIG_Python_UnpackTuple(PyObject *args, const char *name, Py_ssize_t min, Py_ssize_t max, PyObject **objs)
+{
+ if (!args) {
+ if (!min && !max) {
+ return 1;
+ } else {
+ PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got none",
+ name, (min == max ? "" : "at least "), (int)min);
+ return 0;
+ }
+ }
+ if (!PyTuple_Check(args)) {
+ PyErr_SetString(PyExc_SystemError, "UnpackTuple() argument list is not a tuple");
+ return 0;
+ } else {
+ register Py_ssize_t l = PyTuple_GET_SIZE(args);
+ if (l < min) {
+ PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got %d",
+ name, (min == max ? "" : "at least "), (int)min, (int)l);
+ return 0;
+ } else if (l > max) {
+ PyErr_Format(PyExc_TypeError, "%s expected %s%d arguments, got %d",
+ name, (min == max ? "" : "at most "), (int)max, (int)l);
+ return 0;
+ } else {
+ register int i;
+ for (i = 0; i < l; ++i) {
+ objs[i] = PyTuple_GET_ITEM(args, i);
+ }
+ for (; l < max; ++l) {
+ objs[l] = 0;
+ }
+ return i + 1;
+ }
+ }
+}
+
+/* A functor is a function object with one single object argument */
+#if PY_VERSION_HEX >= 0x02020000
+#define SWIG_Python_CallFunctor(functor, obj) PyObject_CallFunctionObjArgs(functor, obj, NULL);
+#else
+#define SWIG_Python_CallFunctor(functor, obj) PyObject_CallFunction(functor, "O", obj);
+#endif
+
+/*
+ Helper for static pointer initialization for both C and C++ code, for example
+ static PyObject *SWIG_STATIC_POINTER(MyVar) = NewSomething(...);
+*/
+#ifdef __cplusplus
+#define SWIG_STATIC_POINTER(var) var
+#else
+#define SWIG_STATIC_POINTER(var) var = 0; if (!var) var
+#endif
+
+/* -----------------------------------------------------------------------------
+ * Pointer declarations
+ * ----------------------------------------------------------------------------- */
+
+/* Flags for new pointer objects */
+#define SWIG_POINTER_NOSHADOW (SWIG_POINTER_OWN << 1)
+#define SWIG_POINTER_NEW (SWIG_POINTER_NOSHADOW | SWIG_POINTER_OWN)
+
+#define SWIG_POINTER_IMPLICIT_CONV (SWIG_POINTER_DISOWN << 1)
+
+#ifdef __cplusplus
+extern "C" {
+#if 0
+} /* cc-mode */
+#endif
+#endif
+
+/* How to access Py_None */
+#if defined(_WIN32) || defined(__WIN32__) || defined(__CYGWIN__)
+# ifndef SWIG_PYTHON_NO_BUILD_NONE
+# ifndef SWIG_PYTHON_BUILD_NONE
+# define SWIG_PYTHON_BUILD_NONE
+# endif
+# endif
+#endif
+
+#ifdef SWIG_PYTHON_BUILD_NONE
+# ifdef Py_None
+# undef Py_None
+# define Py_None SWIG_Py_None()
+# endif
+SWIGRUNTIMEINLINE PyObject *
+_SWIG_Py_None(void)
+{
+ PyObject *none = Py_BuildValue((char*)"");
+ Py_DECREF(none);
+ return none;
+}
+SWIGRUNTIME PyObject *
+SWIG_Py_None(void)
+{
+ static PyObject *SWIG_STATIC_POINTER(none) = _SWIG_Py_None();
+ return none;
+}
+#endif
+
+/* The python void return value */
+
+SWIGRUNTIMEINLINE PyObject *
+SWIG_Py_Void(void)
+{
+ PyObject *none = Py_None;
+ Py_INCREF(none);
+ return none;
+}
+
+/* SwigPyClientData */
+
+typedef struct {
+ PyObject *klass;
+ PyObject *newraw;
+ PyObject *newargs;
+ PyObject *destroy;
+ int delargs;
+ int implicitconv;
+} SwigPyClientData;
+
+SWIGRUNTIMEINLINE int
+SWIG_Python_CheckImplicit(swig_type_info *ty)
+{
+ SwigPyClientData *data = (SwigPyClientData *)ty->clientdata;
+ return data ? data->implicitconv : 0;
+}
+
+SWIGRUNTIMEINLINE PyObject *
+SWIG_Python_ExceptionType(swig_type_info *desc) {
+ SwigPyClientData *data = desc ? (SwigPyClientData *) desc->clientdata : 0;
+ PyObject *klass = data ? data->klass : 0;
+ return (klass ? klass : PyExc_RuntimeError);
+}
+
+
+SWIGRUNTIME SwigPyClientData *
+SwigPyClientData_New(PyObject* obj)
+{
+ if (!obj) {
+ return 0;
+ } else {
+ SwigPyClientData *data = (SwigPyClientData *)malloc(sizeof(SwigPyClientData));
+ /* the klass element */
+ data->klass = obj;
+ Py_INCREF(data->klass);
+ /* the newraw method and newargs arguments used to create a new raw instance */
+ if (PyClass_Check(obj)) {
+ data->newraw = 0;
+ data->newargs = obj;
+ Py_INCREF(obj);
+ } else {
+#if (PY_VERSION_HEX < 0x02020000)
+ data->newraw = 0;
+#else
+ data->newraw = PyObject_GetAttrString(data->klass, (char *)"__new__");
+#endif
+ if (data->newraw) {
+ Py_INCREF(data->newraw);
+ data->newargs = PyTuple_New(1);
+ PyTuple_SetItem(data->newargs, 0, obj);
+ } else {
+ data->newargs = obj;
+ }
+ Py_INCREF(data->newargs);
+ }
+ /* the destroy method, aka as the C++ delete method */
+ data->destroy = PyObject_GetAttrString(data->klass, (char *)"__swig_destroy__");
+ if (PyErr_Occurred()) {
+ PyErr_Clear();
+ data->destroy = 0;
+ }
+ if (data->destroy) {
+ int flags;
+ Py_INCREF(data->destroy);
+ flags = PyCFunction_GET_FLAGS(data->destroy);
+#ifdef METH_O
+ data->delargs = !(flags & (METH_O));
+#else
+ data->delargs = 0;
+#endif
+ } else {
+ data->delargs = 0;
+ }
+ data->implicitconv = 0;
+ return data;
+ }
+}
+
+SWIGRUNTIME void
+SwigPyClientData_Del(SwigPyClientData* data)
+{
+ Py_XDECREF(data->newraw);
+ Py_XDECREF(data->newargs);
+ Py_XDECREF(data->destroy);
+}
+
+/* =============== SwigPyObject =====================*/
+
+typedef struct {
+ PyObject_HEAD
+ void *ptr;
+ swig_type_info *ty;
+ int own;
+ PyObject *next;
+} SwigPyObject;
+
+SWIGRUNTIME PyObject *
+SwigPyObject_long(SwigPyObject *v)
+{
+ return PyLong_FromVoidPtr(v->ptr);
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_format(const char* fmt, SwigPyObject *v)
+{
+ PyObject *res = NULL;
+ PyObject *args = PyTuple_New(1);
+ if (args) {
+ if (PyTuple_SetItem(args, 0, SwigPyObject_long(v)) == 0) {
+ PyObject *ofmt = SWIG_Python_str_FromChar(fmt);
+ if (ofmt) {
+#if PY_VERSION_HEX >= 0x03000000
+ res = PyUnicode_Format(ofmt,args);
+#else
+ res = PyString_Format(ofmt,args);
+#endif
+ Py_DECREF(ofmt);
+ }
+ Py_DECREF(args);
+ }
+ }
+ return res;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_oct(SwigPyObject *v)
+{
+ return SwigPyObject_format("%o",v);
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_hex(SwigPyObject *v)
+{
+ return SwigPyObject_format("%x",v);
+}
+
+SWIGRUNTIME PyObject *
+#ifdef METH_NOARGS
+SwigPyObject_repr(SwigPyObject *v)
+#else
+SwigPyObject_repr(SwigPyObject *v, PyObject *args)
+#endif
+{
+ const char *name = SWIG_TypePrettyName(v->ty);
+ PyObject *hex = SwigPyObject_hex(v);
+ PyObject *repr = SWIG_Python_str_FromFormat("<Swig Object of type '%s' at %p>", name, hex);
+ Py_DECREF(hex);
+ if (v->next) {
+#ifdef METH_NOARGS
+ PyObject *nrep = SwigPyObject_repr((SwigPyObject *)v->next);
+#else
+ PyObject *nrep = SwigPyObject_repr((SwigPyObject *)v->next, args);
+#endif
+#if PY_VERSION_HEX >= 0x03000000
+ PyObject *joined = PyUnicode_Concat(repr, nrep);
+ Py_DecRef(repr);
+ Py_DecRef(nrep);
+ repr = joined;
+#else
+ PyString_ConcatAndDel(&repr,nrep);
+#endif
+ }
+ return repr;
+}
+
+SWIGRUNTIME int
+SwigPyObject_print(SwigPyObject *v, FILE *fp, int SWIGUNUSEDPARM(flags))
+{
+#ifdef METH_NOARGS
+ PyObject *repr = SwigPyObject_repr(v);
+#else
+ PyObject *repr = SwigPyObject_repr(v, NULL);
+#endif
+ if (repr) {
+ fputs(SWIG_Python_str_AsChar(repr), fp);
+ Py_DECREF(repr);
+ return 0;
+ } else {
+ return 1;
+ }
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_str(SwigPyObject *v)
+{
+ char result[SWIG_BUFFER_SIZE];
+ return SWIG_PackVoidPtr(result, v->ptr, v->ty->name, sizeof(result)) ?
+ SWIG_Python_str_FromChar(result) : 0;
+}
+
+SWIGRUNTIME int
+SwigPyObject_compare(SwigPyObject *v, SwigPyObject *w)
+{
+ void *i = v->ptr;
+ void *j = w->ptr;
+ return (i < j) ? -1 : ((i > j) ? 1 : 0);
+}
+
+/* Added for Python 3.x, whould it also useful for Python 2.x? */
+SWIGRUNTIME PyObject*
+SwigPyObject_richcompare(SwigPyObject *v, SwigPyObject *w, int op)
+{
+ PyObject* res;
+ if( op != Py_EQ && op != Py_NE ) {
+ Py_INCREF(Py_NotImplemented);
+ return Py_NotImplemented;
+ }
+ if( (SwigPyObject_compare(v, w)==0) == (op == Py_EQ) )
+ res = Py_True;
+ else
+ res = Py_False;
+ Py_INCREF(res);
+ return res;
+}
+
+
+SWIGRUNTIME PyTypeObject* _PySwigObject_type(void);
+
+SWIGRUNTIME PyTypeObject*
+SwigPyObject_type(void) {
+ static PyTypeObject *SWIG_STATIC_POINTER(type) = _PySwigObject_type();
+ return type;
+}
+
+SWIGRUNTIMEINLINE int
+SwigPyObject_Check(PyObject *op) {
+ return (Py_TYPE(op) == SwigPyObject_type())
+ || (strcmp(Py_TYPE(op)->tp_name,"SwigPyObject") == 0);
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_New(void *ptr, swig_type_info *ty, int own);
+
+SWIGRUNTIME void
+SwigPyObject_dealloc(PyObject *v)
+{
+ SwigPyObject *sobj = (SwigPyObject *) v;
+ PyObject *next = sobj->next;
+ if (sobj->own == SWIG_POINTER_OWN) {
+ swig_type_info *ty = sobj->ty;
+ SwigPyClientData *data = ty ? (SwigPyClientData *) ty->clientdata : 0;
+ PyObject *destroy = data ? data->destroy : 0;
+ if (destroy) {
+ /* destroy is always a VARARGS method */
+ PyObject *res;
+ if (data->delargs) {
+ /* we need to create a temporal object to carry the destroy operation */
+ PyObject *tmp = SwigPyObject_New(sobj->ptr, ty, 0);
+ res = SWIG_Python_CallFunctor(destroy, tmp);
+ Py_DECREF(tmp);
+ } else {
+ PyCFunction meth = PyCFunction_GET_FUNCTION(destroy);
+ PyObject *mself = PyCFunction_GET_SELF(destroy);
+ res = ((*meth)(mself, v));
+ }
+ Py_XDECREF(res);
+ }
+#if !defined(SWIG_PYTHON_SILENT_MEMLEAK)
+ else {
+ const char *name = SWIG_TypePrettyName(ty);
+ printf("swig/python detected a memory leak of type '%s', no destructor found.\n", (name ? name : "unknown"));
+ }
+#endif
+ }
+ Py_XDECREF(next);
+ PyObject_DEL(v);
+}
+
+SWIGRUNTIME PyObject*
+SwigPyObject_append(PyObject* v, PyObject* next)
+{
+ SwigPyObject *sobj = (SwigPyObject *) v;
+#ifndef METH_O
+ PyObject *tmp = 0;
+ if (!PyArg_ParseTuple(next,(char *)"O:append", &tmp)) return NULL;
+ next = tmp;
+#endif
+ if (!SwigPyObject_Check(next)) {
+ return NULL;
+ }
+ sobj->next = next;
+ Py_INCREF(next);
+ return SWIG_Py_Void();
+}
+
+SWIGRUNTIME PyObject*
+#ifdef METH_NOARGS
+SwigPyObject_next(PyObject* v)
+#else
+SwigPyObject_next(PyObject* v, PyObject *SWIGUNUSEDPARM(args))
+#endif
+{
+ SwigPyObject *sobj = (SwigPyObject *) v;
+ if (sobj->next) {
+ Py_INCREF(sobj->next);
+ return sobj->next;
+ } else {
+ return SWIG_Py_Void();
+ }
+}
+
+SWIGINTERN PyObject*
+#ifdef METH_NOARGS
+SwigPyObject_disown(PyObject *v)
+#else
+SwigPyObject_disown(PyObject* v, PyObject *SWIGUNUSEDPARM(args))
+#endif
+{
+ SwigPyObject *sobj = (SwigPyObject *)v;
+ sobj->own = 0;
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject*
+#ifdef METH_NOARGS
+SwigPyObject_acquire(PyObject *v)
+#else
+SwigPyObject_acquire(PyObject* v, PyObject *SWIGUNUSEDPARM(args))
+#endif
+{
+ SwigPyObject *sobj = (SwigPyObject *)v;
+ sobj->own = SWIG_POINTER_OWN;
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject*
+SwigPyObject_own(PyObject *v, PyObject *args)
+{
+ PyObject *val = 0;
+#if (PY_VERSION_HEX < 0x02020000)
+ if (!PyArg_ParseTuple(args,(char *)"|O:own",&val))
+#else
+ if (!PyArg_UnpackTuple(args, (char *)"own", 0, 1, &val))
+#endif
+ {
+ return NULL;
+ }
+ else
+ {
+ SwigPyObject *sobj = (SwigPyObject *)v;
+ PyObject *obj = PyBool_FromLong(sobj->own);
+ if (val) {
+#ifdef METH_NOARGS
+ if (PyObject_IsTrue(val)) {
+ SwigPyObject_acquire(v);
+ } else {
+ SwigPyObject_disown(v);
+ }
+#else
+ if (PyObject_IsTrue(val)) {
+ SwigPyObject_acquire(v,args);
+ } else {
+ SwigPyObject_disown(v,args);
+ }
+#endif
+ }
+ return obj;
+ }
+}
+
+#ifdef METH_O
+static PyMethodDef
+swigobject_methods[] = {
+ {(char *)"disown", (PyCFunction)SwigPyObject_disown, METH_NOARGS, (char *)"releases ownership of the pointer"},
+ {(char *)"acquire", (PyCFunction)SwigPyObject_acquire, METH_NOARGS, (char *)"aquires ownership of the pointer"},
+ {(char *)"own", (PyCFunction)SwigPyObject_own, METH_VARARGS, (char *)"returns/sets ownership of the pointer"},
+ {(char *)"append", (PyCFunction)SwigPyObject_append, METH_O, (char *)"appends another 'this' object"},
+ {(char *)"next", (PyCFunction)SwigPyObject_next, METH_NOARGS, (char *)"returns the next 'this' object"},
+ {(char *)"__repr__",(PyCFunction)SwigPyObject_repr, METH_NOARGS, (char *)"returns object representation"},
+ {0, 0, 0, 0}
+};
+#else
+static PyMethodDef
+swigobject_methods[] = {
+ {(char *)"disown", (PyCFunction)SwigPyObject_disown, METH_VARARGS, (char *)"releases ownership of the pointer"},
+ {(char *)"acquire", (PyCFunction)SwigPyObject_acquire, METH_VARARGS, (char *)"aquires ownership of the pointer"},
+ {(char *)"own", (PyCFunction)SwigPyObject_own, METH_VARARGS, (char *)"returns/sets ownership of the pointer"},
+ {(char *)"append", (PyCFunction)SwigPyObject_append, METH_VARARGS, (char *)"appends another 'this' object"},
+ {(char *)"next", (PyCFunction)SwigPyObject_next, METH_VARARGS, (char *)"returns the next 'this' object"},
+ {(char *)"__repr__",(PyCFunction)SwigPyObject_repr, METH_VARARGS, (char *)"returns object representation"},
+ {0, 0, 0, 0}
+};
+#endif
+
+#if PY_VERSION_HEX < 0x02020000
+SWIGINTERN PyObject *
+SwigPyObject_getattr(SwigPyObject *sobj,char *name)
+{
+ return Py_FindMethod(swigobject_methods, (PyObject *)sobj, name);
+}
+#endif
+
+SWIGRUNTIME PyTypeObject*
+_PySwigObject_type(void) {
+ static char swigobject_doc[] = "Swig object carries a C/C++ instance pointer";
+
+ static PyNumberMethods SwigPyObject_as_number = {
+ (binaryfunc)0, /*nb_add*/
+ (binaryfunc)0, /*nb_subtract*/
+ (binaryfunc)0, /*nb_multiply*/
+ /* nb_divide removed in Python 3 */
+#if PY_VERSION_HEX < 0x03000000
+ (binaryfunc)0, /*nb_divide*/
+#endif
+ (binaryfunc)0, /*nb_remainder*/
+ (binaryfunc)0, /*nb_divmod*/
+ (ternaryfunc)0,/*nb_power*/
+ (unaryfunc)0, /*nb_negative*/
+ (unaryfunc)0, /*nb_positive*/
+ (unaryfunc)0, /*nb_absolute*/
+ (inquiry)0, /*nb_nonzero*/
+ 0, /*nb_invert*/
+ 0, /*nb_lshift*/
+ 0, /*nb_rshift*/
+ 0, /*nb_and*/
+ 0, /*nb_xor*/
+ 0, /*nb_or*/
+#if PY_VERSION_HEX < 0x03000000
+ 0, /*nb_coerce*/
+#endif
+ (unaryfunc)SwigPyObject_long, /*nb_int*/
+ (unaryfunc)SwigPyObject_long, /*nb_long*/
+ (unaryfunc)0, /*nb_float*/
+#if PY_VERSION_HEX < 0x03000000
+ (unaryfunc)SwigPyObject_oct, /*nb_oct*/
+ (unaryfunc)SwigPyObject_hex, /*nb_hex*/
+#endif
+#if PY_VERSION_HEX >= 0x03000000 /* 3.0 */
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_index, nb_inplace_divide removed */
+#elif PY_VERSION_HEX >= 0x02050000 /* 2.5.0 */
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_index */
+#elif PY_VERSION_HEX >= 0x02020000 /* 2.2.0 */
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_inplace_true_divide */
+#elif PY_VERSION_HEX >= 0x02000000 /* 2.0.0 */
+ 0,0,0,0,0,0,0,0,0,0,0 /* nb_inplace_add -> nb_inplace_or */
+#endif
+ };
+
+ static PyTypeObject swigpyobject_type;
+ static int type_init = 0;
+ if (!type_init) {
+ const PyTypeObject tmp
+ = {
+ /* PyOjbect header changed in Python 3 */
+#if PY_VERSION_HEX >= 0x03000000
+ PyVarObject_HEAD_INIT(&PyType_Type, 0)
+#else
+ PyObject_HEAD_INIT(NULL)
+ 0, /* ob_size */
+#endif
+ (char *)"SwigPyObject", /* tp_name */
+ sizeof(SwigPyObject), /* tp_basicsize */
+ 0, /* tp_itemsize */
+ (destructor)SwigPyObject_dealloc, /* tp_dealloc */
+ (printfunc)SwigPyObject_print, /* tp_print */
+#if PY_VERSION_HEX < 0x02020000
+ (getattrfunc)SwigPyObject_getattr, /* tp_getattr */
+#else
+ (getattrfunc)0, /* tp_getattr */
+#endif
+ (setattrfunc)0, /* tp_setattr */
+ (cmpfunc)SwigPyObject_compare, /* tp_compare */
+ (reprfunc)SwigPyObject_repr, /* tp_repr */
+ &SwigPyObject_as_number, /* tp_as_number */
+ 0, /* tp_as_sequence */
+ 0, /* tp_as_mapping */
+ (hashfunc)0, /* tp_hash */
+ (ternaryfunc)0, /* tp_call */
+ (reprfunc)SwigPyObject_str, /* tp_str */
+ PyObject_GenericGetAttr, /* tp_getattro */
+ 0, /* tp_setattro */
+ 0, /* tp_as_buffer */
+ Py_TPFLAGS_DEFAULT, /* tp_flags */
+ swigobject_doc, /* tp_doc */
+ 0, /* tp_traverse */
+ 0, /* tp_clear */
+ (richcmpfunc)SwigPyObject_richcompare, /* tp_richcompare */
+ 0, /* tp_weaklistoffset */
+#if PY_VERSION_HEX >= 0x02020000
+ 0, /* tp_iter */
+ 0, /* tp_iternext */
+ swigobject_methods, /* tp_methods */
+ 0, /* tp_members */
+ 0, /* tp_getset */
+ 0, /* tp_base */
+ 0, /* tp_dict */
+ 0, /* tp_descr_get */
+ 0, /* tp_descr_set */
+ 0, /* tp_dictoffset */
+ 0, /* tp_init */
+ 0, /* tp_alloc */
+ 0, /* tp_new */
+ 0, /* tp_free */
+ 0, /* tp_is_gc */
+ 0, /* tp_bases */
+ 0, /* tp_mro */
+ 0, /* tp_cache */
+ 0, /* tp_subclasses */
+ 0, /* tp_weaklist */
+#endif
+#if PY_VERSION_HEX >= 0x02030000
+ 0, /* tp_del */
+#endif
+#ifdef COUNT_ALLOCS
+ 0,0,0,0 /* tp_alloc -> tp_next */
+#endif
+ };
+ swigpyobject_type = tmp;
+ /* for Python 3 we already assigned the ob_type in PyVarObject_HEAD_INIT() */
+#if PY_VERSION_HEX < 0x03000000
+ swigpyobject_type.ob_type = &PyType_Type;
+#endif
+ type_init = 1;
+ }
+ return &swigpyobject_type;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyObject_New(void *ptr, swig_type_info *ty, int own)
+{
+ SwigPyObject *sobj = PyObject_NEW(SwigPyObject, SwigPyObject_type());
+ if (sobj) {
+ sobj->ptr = ptr;
+ sobj->ty = ty;
+ sobj->own = own;
+ sobj->next = 0;
+ }
+ return (PyObject *)sobj;
+}
+
+/* -----------------------------------------------------------------------------
+ * Implements a simple Swig Packed type, and use it instead of string
+ * ----------------------------------------------------------------------------- */
+
+typedef struct {
+ PyObject_HEAD
+ void *pack;
+ swig_type_info *ty;
+ size_t size;
+} SwigPyPacked;
+
+SWIGRUNTIME int
+SwigPyPacked_print(SwigPyPacked *v, FILE *fp, int SWIGUNUSEDPARM(flags))
+{
+ char result[SWIG_BUFFER_SIZE];
+ fputs("<Swig Packed ", fp);
+ if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))) {
+ fputs("at ", fp);
+ fputs(result, fp);
+ }
+ fputs(v->ty->name,fp);
+ fputs(">", fp);
+ return 0;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyPacked_repr(SwigPyPacked *v)
+{
+ char result[SWIG_BUFFER_SIZE];
+ if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))) {
+ return SWIG_Python_str_FromFormat("<Swig Packed at %s%s>", result, v->ty->name);
+ } else {
+ return SWIG_Python_str_FromFormat("<Swig Packed %s>", v->ty->name);
+ }
+}
+
+SWIGRUNTIME PyObject *
+SwigPyPacked_str(SwigPyPacked *v)
+{
+ char result[SWIG_BUFFER_SIZE];
+ if (SWIG_PackDataName(result, v->pack, v->size, 0, sizeof(result))){
+ return SWIG_Python_str_FromFormat("%s%s", result, v->ty->name);
+ } else {
+ return SWIG_Python_str_FromChar(v->ty->name);
+ }
+}
+
+SWIGRUNTIME int
+SwigPyPacked_compare(SwigPyPacked *v, SwigPyPacked *w)
+{
+ size_t i = v->size;
+ size_t j = w->size;
+ int s = (i < j) ? -1 : ((i > j) ? 1 : 0);
+ return s ? s : strncmp((char *)v->pack, (char *)w->pack, 2*v->size);
+}
+
+SWIGRUNTIME PyTypeObject* _PySwigPacked_type(void);
+
+SWIGRUNTIME PyTypeObject*
+SwigPyPacked_type(void) {
+ static PyTypeObject *SWIG_STATIC_POINTER(type) = _PySwigPacked_type();
+ return type;
+}
+
+SWIGRUNTIMEINLINE int
+SwigPyPacked_Check(PyObject *op) {
+ return ((op)->ob_type == _PySwigPacked_type())
+ || (strcmp((op)->ob_type->tp_name,"SwigPyPacked") == 0);
+}
+
+SWIGRUNTIME void
+SwigPyPacked_dealloc(PyObject *v)
+{
+ if (SwigPyPacked_Check(v)) {
+ SwigPyPacked *sobj = (SwigPyPacked *) v;
+ free(sobj->pack);
+ }
+ PyObject_DEL(v);
+}
+
+SWIGRUNTIME PyTypeObject*
+_PySwigPacked_type(void) {
+ static char swigpacked_doc[] = "Swig object carries a C/C++ instance pointer";
+ static PyTypeObject swigpypacked_type;
+ static int type_init = 0;
+ if (!type_init) {
+ const PyTypeObject tmp
+ = {
+ /* PyObject header changed in Python 3 */
+#if PY_VERSION_HEX>=0x03000000
+ PyVarObject_HEAD_INIT(&PyType_Type, 0)
+#else
+ PyObject_HEAD_INIT(NULL)
+ 0, /* ob_size */
+#endif
+ (char *)"SwigPyPacked", /* tp_name */
+ sizeof(SwigPyPacked), /* tp_basicsize */
+ 0, /* tp_itemsize */
+ (destructor)SwigPyPacked_dealloc, /* tp_dealloc */
+ (printfunc)SwigPyPacked_print, /* tp_print */
+ (getattrfunc)0, /* tp_getattr */
+ (setattrfunc)0, /* tp_setattr */
+ (cmpfunc)SwigPyPacked_compare, /* tp_compare */
+ (reprfunc)SwigPyPacked_repr, /* tp_repr */
+ 0, /* tp_as_number */
+ 0, /* tp_as_sequence */
+ 0, /* tp_as_mapping */
+ (hashfunc)0, /* tp_hash */
+ (ternaryfunc)0, /* tp_call */
+ (reprfunc)SwigPyPacked_str, /* tp_str */
+ PyObject_GenericGetAttr, /* tp_getattro */
+ 0, /* tp_setattro */
+ 0, /* tp_as_buffer */
+ Py_TPFLAGS_DEFAULT, /* tp_flags */
+ swigpacked_doc, /* tp_doc */
+ 0, /* tp_traverse */
+ 0, /* tp_clear */
+ 0, /* tp_richcompare */
+ 0, /* tp_weaklistoffset */
+#if PY_VERSION_HEX >= 0x02020000
+ 0, /* tp_iter */
+ 0, /* tp_iternext */
+ 0, /* tp_methods */
+ 0, /* tp_members */
+ 0, /* tp_getset */
+ 0, /* tp_base */
+ 0, /* tp_dict */
+ 0, /* tp_descr_get */
+ 0, /* tp_descr_set */
+ 0, /* tp_dictoffset */
+ 0, /* tp_init */
+ 0, /* tp_alloc */
+ 0, /* tp_new */
+ 0, /* tp_free */
+ 0, /* tp_is_gc */
+ 0, /* tp_bases */
+ 0, /* tp_mro */
+ 0, /* tp_cache */
+ 0, /* tp_subclasses */
+ 0, /* tp_weaklist */
+#endif
+#if PY_VERSION_HEX >= 0x02030000
+ 0, /* tp_del */
+#endif
+#ifdef COUNT_ALLOCS
+ 0,0,0,0 /* tp_alloc -> tp_next */
+#endif
+ };
+ swigpypacked_type = tmp;
+ /* for Python 3 the ob_type already assigned in PyVarObject_HEAD_INIT() */
+#if PY_VERSION_HEX < 0x03000000
+ swigpypacked_type.ob_type = &PyType_Type;
+#endif
+ type_init = 1;
+ }
+ return &swigpypacked_type;
+}
+
+SWIGRUNTIME PyObject *
+SwigPyPacked_New(void *ptr, size_t size, swig_type_info *ty)
+{
+ SwigPyPacked *sobj = PyObject_NEW(SwigPyPacked, SwigPyPacked_type());
+ if (sobj) {
+ void *pack = malloc(size);
+ if (pack) {
+ memcpy(pack, ptr, size);
+ sobj->pack = pack;
+ sobj->ty = ty;
+ sobj->size = size;
+ } else {
+ PyObject_DEL((PyObject *) sobj);
+ sobj = 0;
+ }
+ }
+ return (PyObject *) sobj;
+}
+
+SWIGRUNTIME swig_type_info *
+SwigPyPacked_UnpackData(PyObject *obj, void *ptr, size_t size)
+{
+ if (SwigPyPacked_Check(obj)) {
+ SwigPyPacked *sobj = (SwigPyPacked *)obj;
+ if (sobj->size != size) return 0;
+ memcpy(ptr, sobj->pack, size);
+ return sobj->ty;
+ } else {
+ return 0;
+ }
+}
+
+/* -----------------------------------------------------------------------------
+ * pointers/data manipulation
+ * ----------------------------------------------------------------------------- */
+
+SWIGRUNTIMEINLINE PyObject *
+_SWIG_This(void)
+{
+ return SWIG_Python_str_FromChar("this");
+}
+
+SWIGRUNTIME PyObject *
+SWIG_This(void)
+{
+ static PyObject *SWIG_STATIC_POINTER(swig_this) = _SWIG_This();
+ return swig_this;
+}
+
+/* #define SWIG_PYTHON_SLOW_GETSET_THIS */
+
+/* TODO: I don't know how to implement the fast getset in Python 3 right now */
+#if PY_VERSION_HEX>=0x03000000
+#define SWIG_PYTHON_SLOW_GETSET_THIS
+#endif
+
+SWIGRUNTIME SwigPyObject *
+SWIG_Python_GetSwigThis(PyObject *pyobj)
+{
+ if (SwigPyObject_Check(pyobj)) {
+ return (SwigPyObject *) pyobj;
+ } else {
+ PyObject *obj = 0;
+#if (!defined(SWIG_PYTHON_SLOW_GETSET_THIS) && (PY_VERSION_HEX >= 0x02030000))
+ if (PyInstance_Check(pyobj)) {
+ obj = _PyInstance_Lookup(pyobj, SWIG_This());
+ } else {
+ PyObject **dictptr = _PyObject_GetDictPtr(pyobj);
+ if (dictptr != NULL) {
+ PyObject *dict = *dictptr;
+ obj = dict ? PyDict_GetItem(dict, SWIG_This()) : 0;
+ } else {
+#ifdef PyWeakref_CheckProxy
+ if (PyWeakref_CheckProxy(pyobj)) {
+ PyObject *wobj = PyWeakref_GET_OBJECT(pyobj);
+ return wobj ? SWIG_Python_GetSwigThis(wobj) : 0;
+ }
+#endif
+ obj = PyObject_GetAttr(pyobj,SWIG_This());
+ if (obj) {
+ Py_DECREF(obj);
+ } else {
+ if (PyErr_Occurred()) PyErr_Clear();
+ return 0;
+ }
+ }
+ }
+#else
+ obj = PyObject_GetAttr(pyobj,SWIG_This());
+ if (obj) {
+ Py_DECREF(obj);
+ } else {
+ if (PyErr_Occurred()) PyErr_Clear();
+ return 0;
+ }
+#endif
+ if (obj && !SwigPyObject_Check(obj)) {
+ /* a PyObject is called 'this', try to get the 'real this'
+ SwigPyObject from it */
+ return SWIG_Python_GetSwigThis(obj);
+ }
+ return (SwigPyObject *)obj;
+ }
+}
+
+/* Acquire a pointer value */
+
+SWIGRUNTIME int
+SWIG_Python_AcquirePtr(PyObject *obj, int own) {
+ if (own == SWIG_POINTER_OWN) {
+ SwigPyObject *sobj = SWIG_Python_GetSwigThis(obj);
+ if (sobj) {
+ int oldown = sobj->own;
+ sobj->own = own;
+ return oldown;
+ }
+ }
+ return 0;
+}
+
+/* Convert a pointer value */
+
+SWIGRUNTIME int
+SWIG_Python_ConvertPtrAndOwn(PyObject *obj, void **ptr, swig_type_info *ty, int flags, int *own) {
+ if (!obj) return SWIG_ERROR;
+ if (obj == Py_None) {
+ if (ptr) *ptr = 0;
+ return SWIG_OK;
+ } else {
+ SwigPyObject *sobj = SWIG_Python_GetSwigThis(obj);
+ if (own)
+ *own = 0;
+ while (sobj) {
+ void *vptr = sobj->ptr;
+ if (ty) {
+ swig_type_info *to = sobj->ty;
+ if (to == ty) {
+ /* no type cast needed */
+ if (ptr) *ptr = vptr;
+ break;
+ } else {
+ swig_cast_info *tc = SWIG_TypeCheck(to->name,ty);
+ if (!tc) {
+ sobj = (SwigPyObject *)sobj->next;
+ } else {
+ if (ptr) {
+ int newmemory = 0;
+ *ptr = SWIG_TypeCast(tc,vptr,&newmemory);
+ if (newmemory == SWIG_CAST_NEW_MEMORY) {
+ assert(own);
+ if (own)
+ *own = *own | SWIG_CAST_NEW_MEMORY;
+ }
+ }
+ break;
+ }
+ }
+ } else {
+ if (ptr) *ptr = vptr;
+ break;
+ }
+ }
+ if (sobj) {
+ if (own)
+ *own = *own | sobj->own;
+ if (flags & SWIG_POINTER_DISOWN) {
+ sobj->own = 0;
+ }
+ return SWIG_OK;
+ } else {
+ int res = SWIG_ERROR;
+ if (flags & SWIG_POINTER_IMPLICIT_CONV) {
+ SwigPyClientData *data = ty ? (SwigPyClientData *) ty->clientdata : 0;
+ if (data && !data->implicitconv) {
+ PyObject *klass = data->klass;
+ if (klass) {
+ PyObject *impconv;
+ data->implicitconv = 1; /* avoid recursion and call 'explicit' constructors*/
+ impconv = SWIG_Python_CallFunctor(klass, obj);
+ data->implicitconv = 0;
+ if (PyErr_Occurred()) {
+ PyErr_Clear();
+ impconv = 0;
+ }
+ if (impconv) {
+ SwigPyObject *iobj = SWIG_Python_GetSwigThis(impconv);
+ if (iobj) {
+ void *vptr;
+ res = SWIG_Python_ConvertPtrAndOwn((PyObject*)iobj, &vptr, ty, 0, 0);
+ if (SWIG_IsOK(res)) {
+ if (ptr) {
+ *ptr = vptr;
+ /* transfer the ownership to 'ptr' */
+ iobj->own = 0;
+ res = SWIG_AddCast(res);
+ res = SWIG_AddNewMask(res);
+ } else {
+ res = SWIG_AddCast(res);
+ }
+ }
+ }
+ Py_DECREF(impconv);
+ }
+ }
+ }
+ }
+ return res;
+ }
+ }
+}
+
+/* Convert a function ptr value */
+
+SWIGRUNTIME int
+SWIG_Python_ConvertFunctionPtr(PyObject *obj, void **ptr, swig_type_info *ty) {
+ if (!PyCFunction_Check(obj)) {
+ return SWIG_ConvertPtr(obj, ptr, ty, 0);
+ } else {
+ void *vptr = 0;
+
+ /* here we get the method pointer for callbacks */
+ const char *doc = (((PyCFunctionObject *)obj) -> m_ml -> ml_doc);
+ const char *desc = doc ? strstr(doc, "swig_ptr: ") : 0;
+ if (desc) {
+ desc = ty ? SWIG_UnpackVoidPtr(desc + 10, &vptr, ty->name) : 0;
+ if (!desc) return SWIG_ERROR;
+ }
+ if (ty) {
+ swig_cast_info *tc = SWIG_TypeCheck(desc,ty);
+ if (tc) {
+ int newmemory = 0;
+ *ptr = SWIG_TypeCast(tc,vptr,&newmemory);
+ assert(!newmemory); /* newmemory handling not yet implemented */
+ } else {
+ return SWIG_ERROR;
+ }
+ } else {
+ *ptr = vptr;
+ }
+ return SWIG_OK;
+ }
+}
+
+/* Convert a packed value value */
+
+SWIGRUNTIME int
+SWIG_Python_ConvertPacked(PyObject *obj, void *ptr, size_t sz, swig_type_info *ty) {
+ swig_type_info *to = SwigPyPacked_UnpackData(obj, ptr, sz);
+ if (!to) return SWIG_ERROR;
+ if (ty) {
+ if (to != ty) {
+ /* check type cast? */
+ swig_cast_info *tc = SWIG_TypeCheck(to->name,ty);
+ if (!tc) return SWIG_ERROR;
+ }
+ }
+ return SWIG_OK;
+}
+
+/* -----------------------------------------------------------------------------
+ * Create a new pointer object
+ * ----------------------------------------------------------------------------- */
+
+/*
+ Create a new instance object, whitout calling __init__, and set the
+ 'this' attribute.
+*/
+
+SWIGRUNTIME PyObject*
+SWIG_Python_NewShadowInstance(SwigPyClientData *data, PyObject *swig_this)
+{
+#if (PY_VERSION_HEX >= 0x02020000)
+ PyObject *inst = 0;
+ PyObject *newraw = data->newraw;
+ if (newraw) {
+ inst = PyObject_Call(newraw, data->newargs, NULL);
+ if (inst) {
+#if !defined(SWIG_PYTHON_SLOW_GETSET_THIS)
+ PyObject **dictptr = _PyObject_GetDictPtr(inst);
+ if (dictptr != NULL) {
+ PyObject *dict = *dictptr;
+ if (dict == NULL) {
+ dict = PyDict_New();
+ *dictptr = dict;
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ }
+ }
+#else
+ PyObject *key = SWIG_This();
+ PyObject_SetAttr(inst, key, swig_this);
+#endif
+ }
+ } else {
+#if PY_VERSION_HEX >= 0x03000000
+ inst = PyBaseObject_Type.tp_new((PyTypeObject*) data->newargs, Py_None, Py_None);
+ Py_INCREF(data->newargs);
+ PyObject_SetAttr(inst, SWIG_This(), swig_this);
+ Py_TYPE(inst)->tp_flags &= ~Py_TPFLAGS_VALID_VERSION_TAG;
+#else
+ PyObject *dict = PyDict_New();
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ inst = PyInstance_NewRaw(data->newargs, dict);
+ Py_DECREF(dict);
+#endif
+ }
+ return inst;
+#else
+#if (PY_VERSION_HEX >= 0x02010000)
+ PyObject *inst;
+ PyObject *dict = PyDict_New();
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ inst = PyInstance_NewRaw(data->newargs, dict);
+ Py_DECREF(dict);
+ return (PyObject *) inst;
+#else
+ PyInstanceObject *inst = PyObject_NEW(PyInstanceObject, &PyInstance_Type);
+ if (inst == NULL) {
+ return NULL;
+ }
+ inst->in_class = (PyClassObject *)data->newargs;
+ Py_INCREF(inst->in_class);
+ inst->in_dict = PyDict_New();
+ if (inst->in_dict == NULL) {
+ Py_DECREF(inst);
+ return NULL;
+ }
+#ifdef Py_TPFLAGS_HAVE_WEAKREFS
+ inst->in_weakreflist = NULL;
+#endif
+#ifdef Py_TPFLAGS_GC
+ PyObject_GC_Init(inst);
+#endif
+ PyDict_SetItem(inst->in_dict, SWIG_This(), swig_this);
+ return (PyObject *) inst;
+#endif
+#endif
+}
+
+SWIGRUNTIME void
+SWIG_Python_SetSwigThis(PyObject *inst, PyObject *swig_this)
+{
+ PyObject *dict;
+#if (PY_VERSION_HEX >= 0x02020000) && !defined(SWIG_PYTHON_SLOW_GETSET_THIS)
+ PyObject **dictptr = _PyObject_GetDictPtr(inst);
+ if (dictptr != NULL) {
+ dict = *dictptr;
+ if (dict == NULL) {
+ dict = PyDict_New();
+ *dictptr = dict;
+ }
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ return;
+ }
+#endif
+ dict = PyObject_GetAttrString(inst, (char*)"__dict__");
+ PyDict_SetItem(dict, SWIG_This(), swig_this);
+ Py_DECREF(dict);
+}
+
+
+SWIGINTERN PyObject *
+SWIG_Python_InitShadowInstance(PyObject *args) {
+ PyObject *obj[2];
+ if (!SWIG_Python_UnpackTuple(args,(char*)"swiginit", 2, 2, obj)) {
+ return NULL;
+ } else {
+ SwigPyObject *sthis = SWIG_Python_GetSwigThis(obj[0]);
+ if (sthis) {
+ SwigPyObject_append((PyObject*) sthis, obj[1]);
+ } else {
+ SWIG_Python_SetSwigThis(obj[0], obj[1]);
+ }
+ return SWIG_Py_Void();
+ }
+}
+
+/* Create a new pointer object */
+
+SWIGRUNTIME PyObject *
+SWIG_Python_NewPointerObj(void *ptr, swig_type_info *type, int flags) {
+ if (!ptr) {
+ return SWIG_Py_Void();
+ } else {
+ int own = (flags & SWIG_POINTER_OWN) ? SWIG_POINTER_OWN : 0;
+ PyObject *robj = SwigPyObject_New(ptr, type, own);
+ SwigPyClientData *clientdata = type ? (SwigPyClientData *)(type->clientdata) : 0;
+ if (clientdata && !(flags & SWIG_POINTER_NOSHADOW)) {
+ PyObject *inst = SWIG_Python_NewShadowInstance(clientdata, robj);
+ if (inst) {
+ Py_DECREF(robj);
+ robj = inst;
+ }
+ }
+ return robj;
+ }
+}
+
+/* Create a new packed object */
+
+SWIGRUNTIMEINLINE PyObject *
+SWIG_Python_NewPackedObj(void *ptr, size_t sz, swig_type_info *type) {
+ return ptr ? SwigPyPacked_New((void *) ptr, sz, type) : SWIG_Py_Void();
+}
+
+/* -----------------------------------------------------------------------------*
+ * Get type list
+ * -----------------------------------------------------------------------------*/
+
+#ifdef SWIG_LINK_RUNTIME
+void *SWIG_ReturnGlobalTypeList(void *);
+#endif
+
+SWIGRUNTIME swig_module_info *
+SWIG_Python_GetModule(void) {
+ static void *type_pointer = (void *)0;
+ /* first check if module already created */
+ if (!type_pointer) {
+#ifdef SWIG_LINK_RUNTIME
+ type_pointer = SWIG_ReturnGlobalTypeList((void *)0);
+#else
+ type_pointer = PyCObject_Import((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION,
+ (char*)"type_pointer" SWIG_TYPE_TABLE_NAME);
+ if (PyErr_Occurred()) {
+ PyErr_Clear();
+ type_pointer = (void *)0;
+ }
+#endif
+ }
+ return (swig_module_info *) type_pointer;
+}
+
+#if PY_MAJOR_VERSION < 2
+/* PyModule_AddObject function was introduced in Python 2.0. The following function
+ is copied out of Python/modsupport.c in python version 2.3.4 */
+SWIGINTERN int
+PyModule_AddObject(PyObject *m, char *name, PyObject *o)
+{
+ PyObject *dict;
+ if (!PyModule_Check(m)) {
+ PyErr_SetString(PyExc_TypeError,
+ "PyModule_AddObject() needs module as first arg");
+ return SWIG_ERROR;
+ }
+ if (!o) {
+ PyErr_SetString(PyExc_TypeError,
+ "PyModule_AddObject() needs non-NULL value");
+ return SWIG_ERROR;
+ }
+
+ dict = PyModule_GetDict(m);
+ if (dict == NULL) {
+ /* Internal error -- modules must have a dict! */
+ PyErr_Format(PyExc_SystemError, "module '%s' has no __dict__",
+ PyModule_GetName(m));
+ return SWIG_ERROR;
+ }
+ if (PyDict_SetItemString(dict, name, o))
+ return SWIG_ERROR;
+ Py_DECREF(o);
+ return SWIG_OK;
+}
+#endif
+
+SWIGRUNTIME void
+SWIG_Python_DestroyModule(void *vptr)
+{
+ swig_module_info *swig_module = (swig_module_info *) vptr;
+ swig_type_info **types = swig_module->types;
+ size_t i;
+ for (i =0; i < swig_module->size; ++i) {
+ swig_type_info *ty = types[i];
+ if (ty->owndata) {
+ SwigPyClientData *data = (SwigPyClientData *) ty->clientdata;
+ if (data) SwigPyClientData_Del(data);
+ }
+ }
+ Py_DECREF(SWIG_This());
+}
+
+SWIGRUNTIME void
+SWIG_Python_SetModule(swig_module_info *swig_module) {
+ static PyMethodDef swig_empty_runtime_method_table[] = { {NULL, NULL, 0, NULL} };/* Sentinel */
+
+#if PY_VERSION_HEX >= 0x03000000
+ /* Add a dummy module object into sys.modules */
+ PyObject *module = PyImport_AddModule((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION);
+#else
+ PyObject *module = Py_InitModule((char*)"swig_runtime_data" SWIG_RUNTIME_VERSION,
+ swig_empty_runtime_method_table);
+#endif
+ PyObject *pointer = PyCObject_FromVoidPtr((void *) swig_module, SWIG_Python_DestroyModule);
+ if (pointer && module) {
+ PyModule_AddObject(module, (char*)"type_pointer" SWIG_TYPE_TABLE_NAME, pointer);
+ } else {
+ Py_XDECREF(pointer);
+ }
+}
+
+/* The python cached type query */
+SWIGRUNTIME PyObject *
+SWIG_Python_TypeCache(void) {
+ static PyObject *SWIG_STATIC_POINTER(cache) = PyDict_New();
+ return cache;
+}
+
+SWIGRUNTIME swig_type_info *
+SWIG_Python_TypeQuery(const char *type)
+{
+ PyObject *cache = SWIG_Python_TypeCache();
+ PyObject *key = SWIG_Python_str_FromChar(type);
+ PyObject *obj = PyDict_GetItem(cache, key);
+ swig_type_info *descriptor;
+ if (obj) {
+ descriptor = (swig_type_info *) PyCObject_AsVoidPtr(obj);
+ } else {
+ swig_module_info *swig_module = SWIG_Python_GetModule();
+ descriptor = SWIG_TypeQueryModule(swig_module, swig_module, type);
+ if (descriptor) {
+ obj = PyCObject_FromVoidPtr(descriptor, NULL);
+ PyDict_SetItem(cache, key, obj);
+ Py_DECREF(obj);
+ }
+ }
+ Py_DECREF(key);
+ return descriptor;
+}
+
+/*
+ For backward compatibility only
+*/
+#define SWIG_POINTER_EXCEPTION 0
+#define SWIG_arg_fail(arg) SWIG_Python_ArgFail(arg)
+#define SWIG_MustGetPtr(p, type, argnum, flags) SWIG_Python_MustGetPtr(p, type, argnum, flags)
+
+SWIGRUNTIME int
+SWIG_Python_AddErrMesg(const char* mesg, int infront)
+{
+ if (PyErr_Occurred()) {
+ PyObject *type = 0;
+ PyObject *value = 0;
+ PyObject *traceback = 0;
+ PyErr_Fetch(&type, &value, &traceback);
+ if (value) {
+ PyObject *old_str = PyObject_Str(value);
+ Py_XINCREF(type);
+ PyErr_Clear();
+ if (infront) {
+ PyErr_Format(type, "%s %s", mesg, SWIG_Python_str_AsChar(old_str));
+ } else {
+ PyErr_Format(type, "%s %s", SWIG_Python_str_AsChar(old_str), mesg);
+ }
+ Py_DECREF(old_str);
+ }
+ return 1;
+ } else {
+ return 0;
+ }
+}
+
+SWIGRUNTIME int
+SWIG_Python_ArgFail(int argnum)
+{
+ if (PyErr_Occurred()) {
+ /* add information about failing argument */
+ char mesg[256];
+ PyOS_snprintf(mesg, sizeof(mesg), "argument number %d:", argnum);
+ return SWIG_Python_AddErrMesg(mesg, 1);
+ } else {
+ return 0;
+ }
+}
+
+SWIGRUNTIMEINLINE const char *
+SwigPyObject_GetDesc(PyObject *self)
+{
+ SwigPyObject *v = (SwigPyObject *)self;
+ swig_type_info *ty = v ? v->ty : 0;
+ return ty ? ty->str : (char*)"";
+}
+
+SWIGRUNTIME void
+SWIG_Python_TypeError(const char *type, PyObject *obj)
+{
+ if (type) {
+#if defined(SWIG_COBJECT_TYPES)
+ if (obj && SwigPyObject_Check(obj)) {
+ const char *otype = (const char *) SwigPyObject_GetDesc(obj);
+ if (otype) {
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected, 'SwigPyObject(%s)' is received",
+ type, otype);
+ return;
+ }
+ } else
+#endif
+ {
+ const char *otype = (obj ? obj->ob_type->tp_name : 0);
+ if (otype) {
+ PyObject *str = PyObject_Str(obj);
+ const char *cstr = str ? SWIG_Python_str_AsChar(str) : 0;
+ if (cstr) {
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected, '%s(%s)' is received",
+ type, otype, cstr);
+ } else {
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected, '%s' is received",
+ type, otype);
+ }
+ Py_XDECREF(str);
+ return;
+ }
+ }
+ PyErr_Format(PyExc_TypeError, "a '%s' is expected", type);
+ } else {
+ PyErr_Format(PyExc_TypeError, "unexpected type is received");
+ }
+}
+
+
+/* Convert a pointer value, signal an exception on a type mismatch */
+SWIGRUNTIME void *
+SWIG_Python_MustGetPtr(PyObject *obj, swig_type_info *ty, int argnum, int flags) {
+ void *result;
+ if (SWIG_Python_ConvertPtr(obj, &result, ty, flags) == -1) {
+ PyErr_Clear();
+ if (flags & SWIG_POINTER_EXCEPTION) {
+ SWIG_Python_TypeError(SWIG_TypePrettyName(ty), obj);
+ SWIG_Python_ArgFail(argnum);
+ }
+ }
+ return result;
+}
+
+
+#ifdef __cplusplus
+#if 0
+{ /* cc-mode */
+#endif
+}
+#endif
+
+
+
+#define SWIG_exception_fail(code, msg) do { SWIG_Error(code, msg); SWIG_fail; } while(0)
+
+#define SWIG_contract_assert(expr, msg) if (!(expr)) { SWIG_Error(SWIG_RuntimeError, msg); SWIG_fail; } else
+
+
+/* -----------------------------------------------------------------------------
+ * See the LICENSE file for information on copyright, usage and redistribution
+ * of SWIG, and the README file for authors - http://www.swig.org/release.html.
+ *
+ * director.swg
+ *
+ * This file contains support for director classes that proxy
+ * method calls from C++ to Python extensions.
+ * ----------------------------------------------------------------------------- */
+
+#ifndef SWIG_DIRECTOR_PYTHON_HEADER_
+#define SWIG_DIRECTOR_PYTHON_HEADER_
+
+#ifdef __cplusplus
+
+#include <string>
+#include <iostream>
+#include <exception>
+#include <vector>
+#include <map>
+
+
+/*
+ Use -DSWIG_PYTHON_DIRECTOR_NO_VTABLE if you don't want to generate a 'virtual
+ table', and avoid multiple GetAttr calls to retrieve the python
+ methods.
+*/
+
+#ifndef SWIG_PYTHON_DIRECTOR_NO_VTABLE
+#ifndef SWIG_PYTHON_DIRECTOR_VTABLE
+#define SWIG_PYTHON_DIRECTOR_VTABLE
+#endif
+#endif
+
+
+
+/*
+ Use -DSWIG_DIRECTOR_NO_UEH if you prefer to avoid the use of the
+ Undefined Exception Handler provided by swift
+*/
+#ifndef SWIG_DIRECTOR_NO_UEH
+#ifndef SWIG_DIRECTOR_UEH
+#define SWIG_DIRECTOR_UEH
+#endif
+#endif
+
+
+/*
+ Use -DSWIG_DIRECTOR_STATIC if you prefer to avoid the use of the
+ 'Swig' namespace. This could be usefull for multi-modules projects.
+*/
+#ifdef SWIG_DIRECTOR_STATIC
+/* Force anonymous (static) namespace */
+#define Swig
+#endif
+
+
+/*
+ Use -DSWIG_DIRECTOR_NORTTI if you prefer to avoid the use of the
+ native C++ RTTI and dynamic_cast<>. But be aware that directors
+ could stop working when using this option.
+*/
+#ifdef SWIG_DIRECTOR_NORTTI
+/*
+ When we don't use the native C++ RTTI, we implement a minimal one
+ only for Directors.
+*/
+# ifndef SWIG_DIRECTOR_RTDIR
+# define SWIG_DIRECTOR_RTDIR
+#include <map>
+
+namespace Swig {
+ class Director;
+ SWIGINTERN std::map<void*,Director*>& get_rtdir_map() {
+ static std::map<void*,Director*> rtdir_map;
+ return rtdir_map;
+ }
+
+ SWIGINTERNINLINE void set_rtdir(void *vptr, Director *rtdir) {
+ get_rtdir_map()[vptr] = rtdir;
+ }
+
+ SWIGINTERNINLINE Director *get_rtdir(void *vptr) {
+ std::map<void*,Director*>::const_iterator pos = get_rtdir_map().find(vptr);
+ Director *rtdir = (pos != get_rtdir_map().end()) ? pos->second : 0;
+ return rtdir;
+ }
+}
+# endif /* SWIG_DIRECTOR_RTDIR */
+
+# define SWIG_DIRECTOR_CAST(Arg) Swig::get_rtdir(static_cast<void*>(Arg))
+# define SWIG_DIRECTOR_RGTR(Arg1, Arg2) Swig::set_rtdir(static_cast<void*>(Arg1), Arg2)
+
+#else
+
+# define SWIG_DIRECTOR_CAST(Arg) dynamic_cast<Swig::Director*>(Arg)
+# define SWIG_DIRECTOR_RGTR(Arg1, Arg2)
+
+#endif /* SWIG_DIRECTOR_NORTTI */
+
+extern "C" {
+ struct swig_type_info;
+}
+
+namespace Swig {
+
+ /* memory handler */
+ struct GCItem
+ {
+ virtual ~GCItem() {}
+
+ virtual int get_own() const
+ {
+ return 0;
+ }
+ };
+
+ struct GCItem_var
+ {
+ GCItem_var(GCItem *item = 0) : _item(item)
+ {
+ }
+
+ GCItem_var& operator=(GCItem *item)
+ {
+ GCItem *tmp = _item;
+ _item = item;
+ delete tmp;
+ return *this;
+ }
+
+ ~GCItem_var()
+ {
+ delete _item;
+ }
+
+ GCItem * operator->() const
+ {
+ return _item;
+ }
+
+ private:
+ GCItem *_item;
+ };
+
+ struct GCItem_Object : GCItem
+ {
+ GCItem_Object(int own) : _own(own)
+ {
+ }
+
+ virtual ~GCItem_Object()
+ {
+ }
+
+ int get_own() const
+ {
+ return _own;
+ }
+
+ private:
+ int _own;
+ };
+
+ template <typename Type>
+ struct GCItem_T : GCItem
+ {
+ GCItem_T(Type *ptr) : _ptr(ptr)
+ {
+ }
+
+ virtual ~GCItem_T()
+ {
+ delete _ptr;
+ }
+
+ private:
+ Type *_ptr;
+ };
+
+ template <typename Type>
+ struct GCArray_T : GCItem
+ {
+ GCArray_T(Type *ptr) : _ptr(ptr)
+ {
+ }
+
+ virtual ~GCArray_T()
+ {
+ delete[] _ptr;
+ }
+
+ private:
+ Type *_ptr;
+ };
+
+ /* base class for director exceptions */
+ class DirectorException {
+ protected:
+ std::string swig_msg;
+ public:
+ DirectorException(PyObject *error, const char* hdr ="", const char* msg ="")
+ : swig_msg(hdr)
+ {
+ SWIG_PYTHON_THREAD_BEGIN_BLOCK;
+ if (strlen(msg)) {
+ swig_msg += " ";
+ swig_msg += msg;
+ }
+ if (!PyErr_Occurred()) {
+ PyErr_SetString(error, getMessage());
+ }
+ SWIG_PYTHON_THREAD_END_BLOCK;
+ }
+
+ const char *getMessage() const
+ {
+ return swig_msg.c_str();
+ }
+
+ static void raise(PyObject *error, const char *msg)
+ {
+ throw DirectorException(error, msg);
+ }
+
+ static void raise(const char *msg)
+ {
+ raise(PyExc_RuntimeError, msg);
+ }
+ };
+
+ /* unknown exception handler */
+ class UnknownExceptionHandler
+ {
+#ifdef SWIG_DIRECTOR_UEH
+ static void handler() {
+ try {
+ throw;
+ } catch (DirectorException& e) {
+ std::cerr << "Swig Director exception caught:" << std::endl
+ << e.getMessage() << std::endl;
+ } catch (std::exception& e) {
+ std::cerr << "std::exception caught: "<< e.what() << std::endl;
+ } catch (...) {
+ std::cerr << "Unknown exception caught." << std::endl;
+ }
+
+ std::cerr << std::endl
+ << "Python interpreter traceback:" << std::endl;
+ PyErr_Print();
+ std::cerr << std::endl;
+
+ std::cerr << "This exception was caught by the SWIG unexpected exception handler." << std::endl
+ << "Try using %feature(\"director:except\") to avoid reaching this point." << std::endl
+ << std::endl
+ << "Exception is being re-thrown, program will like abort/terminate." << std::endl;
+ throw;
+ }
+
+ public:
+
+ std::unexpected_handler old;
+ UnknownExceptionHandler(std::unexpected_handler nh = handler)
+ {
+ old = std::set_unexpected(nh);
+ }
+
+ ~UnknownExceptionHandler()
+ {
+ std::set_unexpected(old);
+ }
+#endif
+ };
+
+ /* type mismatch in the return value from a python method call */
+ class DirectorTypeMismatchException : public Swig::DirectorException {
+ public:
+ DirectorTypeMismatchException(PyObject *error, const char* msg="")
+ : Swig::DirectorException(error, "Swig director type mismatch", msg)
+ {
+ }
+
+ DirectorTypeMismatchException(const char* msg="")
+ : Swig::DirectorException(PyExc_TypeError, "Swig director type mismatch", msg)
+ {
+ }
+
+ static void raise(PyObject *error, const char *msg)
+ {
+ throw DirectorTypeMismatchException(error, msg);
+ }
+
+ static void raise(const char *msg)
+ {
+ throw DirectorTypeMismatchException(msg);
+ }
+ };
+
+ /* any python exception that occurs during a director method call */
+ class DirectorMethodException : public Swig::DirectorException {
+ public:
+ DirectorMethodException(const char* msg = "")
+ : DirectorException(PyExc_RuntimeError, "Swig director method error.", msg)
+ {
+ }
+
+ static void raise(const char *msg)
+ {
+ throw DirectorMethodException(msg);
+ }
+ };
+
+ /* attempt to call a pure virtual method via a director method */
+ class DirectorPureVirtualException : public Swig::DirectorException
+ {
+ public:
+ DirectorPureVirtualException(const char* msg = "")
+ : DirectorException(PyExc_RuntimeError, "Swig director pure virtual method called", msg)
+ {
+ }
+
+ static void raise(const char *msg)
+ {
+ throw DirectorPureVirtualException(msg);
+ }
+ };
+
+
+#if defined(SWIG_PYTHON_THREADS)
+/* __THREAD__ is the old macro to activate some thread support */
+# if !defined(__THREAD__)
+# define __THREAD__ 1
+# endif
+#endif
+
+#ifdef __THREAD__
+# include "pythread.h"
+ class Guard
+ {
+ PyThread_type_lock & mutex_;
+
+ public:
+ Guard(PyThread_type_lock & mutex) : mutex_(mutex)
+ {
+ PyThread_acquire_lock(mutex_, WAIT_LOCK);
+ }
+
+ ~Guard()
+ {
+ PyThread_release_lock(mutex_);
+ }
+ };
+# define SWIG_GUARD(mutex) Guard _guard(mutex)
+#else
+# define SWIG_GUARD(mutex)
+#endif
+
+ /* director base class */
+ class Director {
+ private:
+ /* pointer to the wrapped python object */
+ PyObject* swig_self;
+ /* flag indicating whether the object is owned by python or c++ */
+ mutable bool swig_disown_flag;
+
+ /* decrement the reference count of the wrapped python object */
+ void swig_decref() const {
+ if (swig_disown_flag) {
+ SWIG_PYTHON_THREAD_BEGIN_BLOCK;
+ Py_DECREF(swig_self);
+ SWIG_PYTHON_THREAD_END_BLOCK;
+ }
+ }
+
+ public:
+ /* wrap a python object, optionally taking ownership */
+ Director(PyObject* self) : swig_self(self), swig_disown_flag(false) {
+ swig_incref();
+ }
+
+
+ /* discard our reference at destruction */
+ virtual ~Director() {
+ swig_decref();
+ }
+
+
+ /* return a pointer to the wrapped python object */
+ PyObject *swig_get_self() const {
+ return swig_self;
+ }
+
+ /* acquire ownership of the wrapped python object (the sense of "disown"
+ * is from python) */
+ void swig_disown() const {
+ if (!swig_disown_flag) {
+ swig_disown_flag=true;
+ swig_incref();
+ }
+ }
+
+ /* increase the reference count of the wrapped python object */
+ void swig_incref() const {
+ if (swig_disown_flag) {
+ Py_INCREF(swig_self);
+ }
+ }
+
+ /* methods to implement pseudo protected director members */
+ virtual bool swig_get_inner(const char* /* name */) const {
+ return true;
+ }
+
+ virtual void swig_set_inner(const char* /* name */, bool /* val */) const {
+ }
+
+ /* ownership management */
+ private:
+ typedef std::map<void*, GCItem_var> ownership_map;
+ mutable ownership_map owner;
+#ifdef __THREAD__
+ static PyThread_type_lock swig_mutex_own;
+#endif
+
+ public:
+ template <typename Type>
+ void swig_acquire_ownership_array(Type *vptr) const
+ {
+ if (vptr) {
+ SWIG_GUARD(swig_mutex_own);
+ owner[vptr] = new GCArray_T<Type>(vptr);
+ }
+ }
+
+ template <typename Type>
+ void swig_acquire_ownership(Type *vptr) const
+ {
+ if (vptr) {
+ SWIG_GUARD(swig_mutex_own);
+ owner[vptr] = new GCItem_T<Type>(vptr);
+ }
+ }
+
+ void swig_acquire_ownership_obj(void *vptr, int own) const
+ {
+ if (vptr && own) {
+ SWIG_GUARD(swig_mutex_own);
+ owner[vptr] = new GCItem_Object(own);
+ }
+ }
+
+ int swig_release_ownership(void *vptr) const
+ {
+ int own = 0;
+ if (vptr) {
+ SWIG_GUARD(swig_mutex_own);
+ ownership_map::iterator iter = owner.find(vptr);
+ if (iter != owner.end()) {
+ own = iter->second->get_own();
+ owner.erase(iter);
+ }
+ }
+ return own;
+ }
+ };
+
+#ifdef __THREAD__
+ PyThread_type_lock Director::swig_mutex_own = PyThread_allocate_lock();
+#endif
+}
+
+#endif /* __cplusplus */
+
+
+#endif
+
+/* -------- TYPES TABLE (BEGIN) -------- */
+
+#define SWIGTYPE_p_ActionConfig swig_types[0]
+#define SWIGTYPE_p_CallSession swig_types[1]
+#define SWIGTYPE_p_DDebugCallback swig_types[2]
+#define SWIGTYPE_p_DialogEvent swig_types[3]
+#define SWIGTYPE_p_InviteEvent swig_types[4]
+#define SWIGTYPE_p_InviteSession swig_types[5]
+#define SWIGTYPE_p_MediaContent swig_types[6]
+#define SWIGTYPE_p_MediaContentCPIM swig_types[7]
+#define SWIGTYPE_p_MediaSessionMgr swig_types[8]
+#define SWIGTYPE_p_MessagingEvent swig_types[9]
+#define SWIGTYPE_p_MessagingSession swig_types[10]
+#define SWIGTYPE_p_MsrpCallback swig_types[11]
+#define SWIGTYPE_p_MsrpEvent swig_types[12]
+#define SWIGTYPE_p_MsrpMessage swig_types[13]
+#define SWIGTYPE_p_MsrpSession swig_types[14]
+#define SWIGTYPE_p_OptionsEvent swig_types[15]
+#define SWIGTYPE_p_OptionsSession swig_types[16]
+#define SWIGTYPE_p_ProxyAudioConsumer swig_types[17]
+#define SWIGTYPE_p_ProxyAudioConsumerCallback swig_types[18]
+#define SWIGTYPE_p_ProxyAudioProducer swig_types[19]
+#define SWIGTYPE_p_ProxyAudioProducerCallback swig_types[20]
+#define SWIGTYPE_p_ProxyPlugin swig_types[21]
+#define SWIGTYPE_p_ProxyPluginMgr swig_types[22]
+#define SWIGTYPE_p_ProxyPluginMgrCallback swig_types[23]
+#define SWIGTYPE_p_ProxyVideoConsumer swig_types[24]
+#define SWIGTYPE_p_ProxyVideoConsumerCallback swig_types[25]
+#define SWIGTYPE_p_ProxyVideoFrame swig_types[26]
+#define SWIGTYPE_p_ProxyVideoProducer swig_types[27]
+#define SWIGTYPE_p_ProxyVideoProducerCallback swig_types[28]
+#define SWIGTYPE_p_PublicationEvent swig_types[29]
+#define SWIGTYPE_p_PublicationSession swig_types[30]
+#define SWIGTYPE_p_RPMessage swig_types[31]
+#define SWIGTYPE_p_RegistrationEvent swig_types[32]
+#define SWIGTYPE_p_RegistrationSession swig_types[33]
+#define SWIGTYPE_p_SMSData swig_types[34]
+#define SWIGTYPE_p_SMSEncoder swig_types[35]
+#define SWIGTYPE_p_SafeObject swig_types[36]
+#define SWIGTYPE_p_SdpMessage swig_types[37]
+#define SWIGTYPE_p_SipCallback swig_types[38]
+#define SWIGTYPE_p_SipEvent swig_types[39]
+#define SWIGTYPE_p_SipMessage swig_types[40]
+#define SWIGTYPE_p_SipSession swig_types[41]
+#define SWIGTYPE_p_SipStack swig_types[42]
+#define SWIGTYPE_p_SipUri swig_types[43]
+#define SWIGTYPE_p_StackEvent swig_types[44]
+#define SWIGTYPE_p_SubscriptionEvent swig_types[45]
+#define SWIGTYPE_p_SubscriptionSession swig_types[46]
+#define SWIGTYPE_p_XcapCallback swig_types[47]
+#define SWIGTYPE_p_XcapEvent swig_types[48]
+#define SWIGTYPE_p_XcapMessage swig_types[49]
+#define SWIGTYPE_p_XcapSelector swig_types[50]
+#define SWIGTYPE_p_XcapStack swig_types[51]
+#define SWIGTYPE_p_char swig_types[52]
+#define SWIGTYPE_p_int swig_types[53]
+#define SWIGTYPE_p_long_long swig_types[54]
+#define SWIGTYPE_p_short swig_types[55]
+#define SWIGTYPE_p_signed_char swig_types[56]
+#define SWIGTYPE_p_tdav_codec_id_e swig_types[57]
+#define SWIGTYPE_p_thttp_event_type_e swig_types[58]
+#define SWIGTYPE_p_tmedia_bandwidth_level_e swig_types[59]
+#define SWIGTYPE_p_tmedia_chroma_e swig_types[60]
+#define SWIGTYPE_p_tmedia_qos_strength_e swig_types[61]
+#define SWIGTYPE_p_tmedia_qos_stype_e swig_types[62]
+#define SWIGTYPE_p_tmsrp_event_type_e swig_types[63]
+#define SWIGTYPE_p_tmsrp_request_type_e swig_types[64]
+#define SWIGTYPE_p_tsip_event_type_e swig_types[65]
+#define SWIGTYPE_p_tsip_invite_event_type_e swig_types[66]
+#define SWIGTYPE_p_tsip_message_event_type_e swig_types[67]
+#define SWIGTYPE_p_tsip_options_event_type_e swig_types[68]
+#define SWIGTYPE_p_tsip_publish_event_type_e swig_types[69]
+#define SWIGTYPE_p_tsip_register_event_type_e swig_types[70]
+#define SWIGTYPE_p_tsip_subscribe_event_type_e swig_types[71]
+#define SWIGTYPE_p_tsk_list_t swig_types[72]
+#define SWIGTYPE_p_twrap_media_type_e swig_types[73]
+#define SWIGTYPE_p_twrap_proxy_plugin_type_e swig_types[74]
+#define SWIGTYPE_p_twrap_rpmessage_type_e swig_types[75]
+#define SWIGTYPE_p_twrap_sms_type_e swig_types[76]
+#define SWIGTYPE_p_unsigned_char swig_types[77]
+#define SWIGTYPE_p_unsigned_int swig_types[78]
+#define SWIGTYPE_p_unsigned_long_long swig_types[79]
+#define SWIGTYPE_p_unsigned_short swig_types[80]
+static swig_type_info *swig_types[82];
+static swig_module_info swig_module = {swig_types, 81, 0, 0, 0, 0};
+#define SWIG_TypeQuery(name) SWIG_TypeQueryModule(&swig_module, &swig_module, name)
+#define SWIG_MangledTypeQuery(name) SWIG_MangledTypeQueryModule(&swig_module, &swig_module, name)
+
+/* -------- TYPES TABLE (END) -------- */
+
+#if (PY_VERSION_HEX <= 0x02000000)
+# if !defined(SWIG_PYTHON_CLASSIC)
+# error "This python version requires swig to be run with the '-classic' option"
+# endif
+#endif
+
+/*-----------------------------------------------
+ @(target):= _tinyWRAP.so
+ ------------------------------------------------*/
+#if PY_VERSION_HEX >= 0x03000000
+# define SWIG_init PyInit__tinyWRAP
+
+#else
+# define SWIG_init init_tinyWRAP
+
+#endif
+#define SWIG_name "_tinyWRAP"
+
+#define SWIGVERSION 0x010339
+#define SWIG_VERSION SWIGVERSION
+
+
+#define SWIG_as_voidptr(a) const_cast< void * >(static_cast< const void * >(a))
+#define SWIG_as_voidptrptr(a) ((void)SWIG_as_voidptr(*a),reinterpret_cast< void** >(a))
+
+
+#include <stdexcept>
+
+
+namespace swig {
+ class SwigPtr_PyObject {
+ protected:
+ PyObject *_obj;
+
+ public:
+ SwigPtr_PyObject() :_obj(0)
+ {
+ }
+
+ SwigPtr_PyObject(const SwigPtr_PyObject& item) : _obj(item._obj)
+ {
+ Py_XINCREF(_obj);
+ }
+
+ SwigPtr_PyObject(PyObject *obj, bool initial_ref = true) :_obj(obj)
+ {
+ if (initial_ref) {
+ Py_XINCREF(_obj);
+ }
+ }
+
+ SwigPtr_PyObject & operator=(const SwigPtr_PyObject& item)
+ {
+ Py_XINCREF(item._obj);
+ Py_XDECREF(_obj);
+ _obj = item._obj;
+ return *this;
+ }
+
+ ~SwigPtr_PyObject()
+ {
+ Py_XDECREF(_obj);
+ }
+
+ operator PyObject *() const
+ {
+ return _obj;
+ }
+
+ PyObject *operator->() const
+ {
+ return _obj;
+ }
+ };
+}
+
+
+namespace swig {
+ struct SwigVar_PyObject : SwigPtr_PyObject {
+ SwigVar_PyObject(PyObject* obj = 0) : SwigPtr_PyObject(obj, false) { }
+
+ SwigVar_PyObject & operator = (PyObject* obj)
+ {
+ Py_XDECREF(_obj);
+ _obj = obj;
+ return *this;
+ }
+ };
+}
+
+
+#include <stdint.h> // Use the C99 official header
+
+
+#include "DDebug.h"
+
+
+SWIGINTERN swig_type_info*
+SWIG_pchar_descriptor(void)
+{
+ static int init = 0;
+ static swig_type_info* info = 0;
+ if (!init) {
+ info = SWIG_TypeQuery("_p_char");
+ init = 1;
+ }
+ return info;
+}
+
+
+SWIGINTERN int
+SWIG_AsCharPtrAndSize(PyObject *obj, char** cptr, size_t* psize, int *alloc)
+{
+#if PY_VERSION_HEX>=0x03000000
+ if (PyUnicode_Check(obj))
+#else
+ if (PyString_Check(obj))
+#endif
+ {
+ char *cstr; Py_ssize_t len;
+#if PY_VERSION_HEX>=0x03000000
+ obj = PyUnicode_AsUTF8String(obj);
+ PyBytes_AsStringAndSize(obj, &cstr, &len);
+#else
+ PyString_AsStringAndSize(obj, &cstr, &len);
+#endif
+ if (cptr) {
+ if (alloc) {
+ /*
+ In python the user should not be able to modify the inner
+ string representation. To warranty that, if you define
+ SWIG_PYTHON_SAFE_CSTRINGS, a new/copy of the python string
+ buffer is always returned.
+
+ The default behavior is just to return the pointer value,
+ so, be careful.
+ */
+#if defined(SWIG_PYTHON_SAFE_CSTRINGS)
+ if (*alloc != SWIG_OLDOBJ)
+#else
+ if (*alloc == SWIG_NEWOBJ)
+#endif
+ {
+ *cptr = reinterpret_cast< char* >(memcpy((new char[len + 1]), cstr, sizeof(char)*(len + 1)));
+ *alloc = SWIG_NEWOBJ;
+ }
+ else {
+ *cptr = cstr;
+ *alloc = SWIG_OLDOBJ;
+ }
+ } else {
+ *cptr = SWIG_Python_str_AsChar(obj);
+ }
+ }
+ if (psize) *psize = len + 1;
+ return SWIG_OK;
+ } else {
+ swig_type_info* pchar_descriptor = SWIG_pchar_descriptor();
+ if (pchar_descriptor) {
+ void* vptr = 0;
+ if (SWIG_ConvertPtr(obj, &vptr, pchar_descriptor, 0) == SWIG_OK) {
+ if (cptr) *cptr = (char *) vptr;
+ if (psize) *psize = vptr ? (strlen((char *)vptr) + 1) : 0;
+ if (alloc) *alloc = SWIG_OLDOBJ;
+ return SWIG_OK;
+ }
+ }
+ }
+ return SWIG_TypeError;
+}
+
+
+
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_FromCharPtrAndSize(const char* carray, size_t size)
+{
+ if (carray) {
+ if (size > INT_MAX) {
+ swig_type_info* pchar_descriptor = SWIG_pchar_descriptor();
+ return pchar_descriptor ?
+ SWIG_NewPointerObj(const_cast< char * >(carray), pchar_descriptor, 0) : SWIG_Py_Void();
+ } else {
+#if PY_VERSION_HEX >= 0x03000000
+ return PyUnicode_FromStringAndSize(carray, static_cast< int >(size));
+#else
+ return PyString_FromStringAndSize(carray, static_cast< int >(size));
+#endif
+ }
+ } else {
+ return SWIG_Py_Void();
+ }
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_FromCharPtr(const char *cptr)
+{
+ return SWIG_FromCharPtrAndSize(cptr, (cptr ? strlen(cptr) : 0));
+}
+
+
+#include <limits.h>
+#if !defined(SWIG_NO_LLONG_MAX)
+# if !defined(LLONG_MAX) && defined(__GNUC__) && defined (__LONG_LONG_MAX__)
+# define LLONG_MAX __LONG_LONG_MAX__
+# define LLONG_MIN (-LLONG_MAX - 1LL)
+# define ULLONG_MAX (LLONG_MAX * 2ULL + 1ULL)
+# endif
+#endif
+
+
+SWIGINTERN int
+SWIG_AsVal_double (PyObject *obj, double *val)
+{
+ int res = SWIG_TypeError;
+ if (PyFloat_Check(obj)) {
+ if (val) *val = PyFloat_AsDouble(obj);
+ return SWIG_OK;
+ } else if (PyInt_Check(obj)) {
+ if (val) *val = PyInt_AsLong(obj);
+ return SWIG_OK;
+ } else if (PyLong_Check(obj)) {
+ double v = PyLong_AsDouble(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ int dispatch = 0;
+ double d = PyFloat_AsDouble(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = d;
+ return SWIG_AddCast(SWIG_OK);
+ } else {
+ PyErr_Clear();
+ }
+ if (!dispatch) {
+ long v = PyLong_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_AddCast(SWIG_AddCast(SWIG_OK));
+ } else {
+ PyErr_Clear();
+ }
+ }
+ }
+#endif
+ return res;
+}
+
+
+#include <float.h>
+
+
+#include <math.h>
+
+
+SWIGINTERNINLINE int
+SWIG_CanCastAsInteger(double *d, double min, double max) {
+ double x = *d;
+ if ((min <= x && x <= max)) {
+ double fx = floor(x);
+ double cx = ceil(x);
+ double rd = ((x - fx) < 0.5) ? fx : cx; /* simple rint */
+ if ((errno == EDOM) || (errno == ERANGE)) {
+ errno = 0;
+ } else {
+ double summ, reps, diff;
+ if (rd < x) {
+ diff = x - rd;
+ } else if (rd > x) {
+ diff = rd - x;
+ } else {
+ return 1;
+ }
+ summ = rd + x;
+ reps = diff/summ;
+ if (reps < 8*DBL_EPSILON) {
+ *d = rd;
+ return 1;
+ }
+ }
+ }
+ return 0;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_long (PyObject *obj, long* val)
+{
+ if (PyInt_Check(obj)) {
+ if (val) *val = PyInt_AsLong(obj);
+ return SWIG_OK;
+ } else if (PyLong_Check(obj)) {
+ long v = PyLong_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ int dispatch = 0;
+ long v = PyInt_AsLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_AddCast(SWIG_OK);
+ } else {
+ PyErr_Clear();
+ }
+ if (!dispatch) {
+ double d;
+ int res = SWIG_AddCast(SWIG_AsVal_double (obj,&d));
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, LONG_MIN, LONG_MAX)) {
+ if (val) *val = (long)(d);
+ return res;
+ }
+ }
+ }
+#endif
+ return SWIG_TypeError;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_int (PyObject * obj, int *val)
+{
+ long v;
+ int res = SWIG_AsVal_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v < INT_MIN || v > INT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = static_cast< int >(v);
+ }
+ }
+ return res;
+}
+
+
+ #define SWIG_From_long PyInt_FromLong
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_int (int value)
+{
+ return SWIG_From_long (value);
+}
+
+
+#include "ActionConfig.h"
+#include "MediaSessionMgr.h"
+#include "MediaContent.h"
+#include "SipUri.h"
+#include "SipMessage.h"
+#include "SipEvent.h"
+#include "SipSession.h"
+
+#include "ProxyPluginMgr.h"
+#include "ProxyConsumer.h"
+#include "ProxyProducer.h"
+
+#include "SipCallback.h"
+#include "SafeObject.h"
+#include "SipStack.h"
+
+
+SWIGINTERNINLINE PyObject*
+ SWIG_From_bool (bool value)
+{
+ return PyBool_FromLong(value ? 1 : 0);
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_short (PyObject * obj, short *val)
+{
+ long v;
+ int res = SWIG_AsVal_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v < SHRT_MIN || v > SHRT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = static_cast< short >(v);
+ }
+ }
+ return res;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_long_SS_long (PyObject *obj, long long *val)
+{
+ int res = SWIG_TypeError;
+ if (PyLong_Check(obj)) {
+ long long v = PyLong_AsLongLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ } else {
+ long v;
+ res = SWIG_AsVal_long (obj,&v);
+ if (SWIG_IsOK(res)) {
+ if (val) *val = v;
+ return res;
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ const double mant_max = 1LL << DBL_MANT_DIG;
+ const double mant_min = -mant_max;
+ double d;
+ res = SWIG_AsVal_double (obj,&d);
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, mant_min, mant_max)) {
+ if (val) *val = (long long)(d);
+ return SWIG_AddCast(res);
+ }
+ res = SWIG_TypeError;
+ }
+#endif
+ return res;
+}
+
+
+SWIGINTERNINLINE PyObject*
+SWIG_From_unsigned_SS_long (unsigned long value)
+{
+ return (value > LONG_MAX) ?
+ PyLong_FromUnsignedLong(value) : PyInt_FromLong(static_cast< long >(value));
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_unsigned_SS_int (unsigned int value)
+{
+ return SWIG_From_unsigned_SS_long (value);
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_long (PyObject *obj, unsigned long *val)
+{
+ if (PyInt_Check(obj)) {
+ long v = PyInt_AsLong(obj);
+ if (v >= 0) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ return SWIG_OverflowError;
+ }
+ } else if (PyLong_Check(obj)) {
+ unsigned long v = PyLong_AsUnsignedLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ int dispatch = 0;
+ unsigned long v = PyLong_AsUnsignedLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_AddCast(SWIG_OK);
+ } else {
+ PyErr_Clear();
+ }
+ if (!dispatch) {
+ double d;
+ int res = SWIG_AddCast(SWIG_AsVal_double (obj,&d));
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, 0, ULONG_MAX)) {
+ if (val) *val = (unsigned long)(d);
+ return res;
+ }
+ }
+ }
+#endif
+ return SWIG_TypeError;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_int (PyObject * obj, unsigned int *val)
+{
+ unsigned long v;
+ int res = SWIG_AsVal_unsigned_SS_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v > UINT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = static_cast< unsigned int >(v);
+ }
+ }
+ return res;
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_unsigned_SS_short (unsigned short value)
+{
+ return SWIG_From_unsigned_SS_long (value);
+}
+
+
+SWIGINTERN int
+SWIG_AsCharArray(PyObject * obj, char *val, size_t size)
+{
+ char* cptr = 0; size_t csize = 0; int alloc = SWIG_OLDOBJ;
+ int res = SWIG_AsCharPtrAndSize(obj, &cptr, &csize, &alloc);
+ if (SWIG_IsOK(res)) {
+ if ((csize == size + 1) && cptr && !(cptr[csize-1])) --csize;
+ if (csize <= size) {
+ if (val) {
+ if (csize) memcpy(val, cptr, csize*sizeof(char));
+ if (csize < size) memset(val + csize, 0, (size - csize)*sizeof(char));
+ }
+ if (alloc == SWIG_NEWOBJ) {
+ delete[] cptr;
+ res = SWIG_DelNewMask(res);
+ }
+ return res;
+ }
+ if (alloc == SWIG_NEWOBJ) delete[] cptr;
+ }
+ return SWIG_TypeError;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_char (PyObject * obj, char *val)
+{
+ int res = SWIG_AsCharArray(obj, val, 1);
+ if (!SWIG_IsOK(res)) {
+ long v;
+ res = SWIG_AddCast(SWIG_AsVal_long (obj, &v));
+ if (SWIG_IsOK(res)) {
+ if ((CHAR_MIN <= v) && (v <= CHAR_MAX)) {
+ if (val) *val = static_cast< char >(v);
+ } else {
+ res = SWIG_OverflowError;
+ }
+ }
+ }
+ return res;
+}
+
+
+SWIGINTERNINLINE PyObject *
+SWIG_From_short (short value)
+{
+ return SWIG_From_long (value);
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_bool (PyObject *obj, bool *val)
+{
+ int r = PyObject_IsTrue(obj);
+ if (r == -1)
+ return SWIG_ERROR;
+ if (val) *val = r ? true : false;
+ return SWIG_OK;
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_long_SS_long (PyObject *obj, unsigned long long *val)
+{
+ int res = SWIG_TypeError;
+ if (PyLong_Check(obj)) {
+ unsigned long long v = PyLong_AsUnsignedLongLong(obj);
+ if (!PyErr_Occurred()) {
+ if (val) *val = v;
+ return SWIG_OK;
+ } else {
+ PyErr_Clear();
+ }
+ } else {
+ unsigned long v;
+ res = SWIG_AsVal_unsigned_SS_long (obj,&v);
+ if (SWIG_IsOK(res)) {
+ if (val) *val = v;
+ return res;
+ }
+ }
+#ifdef SWIG_PYTHON_CAST_MODE
+ {
+ const double mant_max = 1LL << DBL_MANT_DIG;
+ double d;
+ res = SWIG_AsVal_double (obj,&d);
+ if (SWIG_IsOK(res) && SWIG_CanCastAsInteger(&d, 0, mant_max)) {
+ if (val) *val = (unsigned long long)(d);
+ return SWIG_AddCast(res);
+ }
+ res = SWIG_TypeError;
+ }
+#endif
+ return res;
+}
+
+
+SWIGINTERNINLINE PyObject*
+SWIG_From_long_SS_long (long long value)
+{
+ return ((value < LONG_MIN) || (value > LONG_MAX)) ?
+ PyLong_FromLongLong(value) : PyInt_FromLong(static_cast< long >(value));
+}
+
+
+SWIGINTERNINLINE PyObject*
+SWIG_From_unsigned_SS_long_SS_long (unsigned long long value)
+{
+ return (value > LONG_MAX) ?
+ PyLong_FromUnsignedLongLong(value) : PyInt_FromLong(static_cast< long >(value));
+}
+
+
+SWIGINTERN int
+SWIG_AsVal_unsigned_SS_short (PyObject * obj, unsigned short *val)
+{
+ unsigned long v;
+ int res = SWIG_AsVal_unsigned_SS_long (obj, &v);
+ if (SWIG_IsOK(res)) {
+ if ((v > USHRT_MAX)) {
+ return SWIG_OverflowError;
+ } else {
+ if (val) *val = static_cast< unsigned short >(v);
+ }
+ }
+ return res;
+}
+
+
+#include "Xcap.h"
+
+
+#include "SMSEncoder.h"
+
+
+#include "Msrp.h"
+
+
+
+/* ---------------------------------------------------
+ * C++ director class methods
+ * --------------------------------------------------- */
+
+#include "tinyWRAP_wrap.h"
+
+SwigDirector_DDebugCallback::SwigDirector_DDebugCallback(PyObject *self): DDebugCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((DDebugCallback *)this, this);
+}
+
+
+
+
+SwigDirector_DDebugCallback::~SwigDirector_DDebugCallback() {
+}
+
+int SwigDirector_DDebugCallback::OnDebugInfo(char const *message) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_FromCharPtr((const char *)message);
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "OnDebugInfo";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugInfo", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugInfo'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_DDebugCallback::OnDebugWarn(char const *message) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_FromCharPtr((const char *)message);
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "OnDebugWarn";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugWarn", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugWarn'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_DDebugCallback::OnDebugError(char const *message) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_FromCharPtr((const char *)message);
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 2;
+ const char * const swig_method_name = "OnDebugError";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugError", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugError'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_DDebugCallback::OnDebugFatal(char const *message) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_FromCharPtr((const char *)message);
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call DDebugCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 3;
+ const char * const swig_method_name = "OnDebugFatal";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDebugFatal", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'DDebugCallback.OnDebugFatal'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_ProxyPluginMgrCallback::SwigDirector_ProxyPluginMgrCallback(PyObject *self): ProxyPluginMgrCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((ProxyPluginMgrCallback *)this, this);
+}
+
+
+
+
+SwigDirector_ProxyPluginMgrCallback::~SwigDirector_ProxyPluginMgrCallback() {
+}
+
+int SwigDirector_ProxyPluginMgrCallback::OnPluginCreated(uint64_t id, enum twrap_proxy_plugin_type_e type) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(id));
+ swig::SwigVar_PyObject obj1;
+ obj1 = SWIG_From_int(static_cast< int >(type));
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyPluginMgrCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "OnPluginCreated";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnPluginCreated", (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyPluginMgrCallback.OnPluginCreated'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyPluginMgrCallback::OnPluginDestroyed(uint64_t id, enum twrap_proxy_plugin_type_e type) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(id));
+ swig::SwigVar_PyObject obj1;
+ obj1 = SWIG_From_int(static_cast< int >(type));
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyPluginMgrCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "OnPluginDestroyed";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnPluginDestroyed", (char *)"(OO)" ,(PyObject *)obj0,(PyObject *)obj1);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyPluginMgrCallback.OnPluginDestroyed'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_ProxyAudioConsumerCallback::SwigDirector_ProxyAudioConsumerCallback(PyObject *self): ProxyAudioConsumerCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((ProxyAudioConsumerCallback *)this, this);
+}
+
+
+
+
+SwigDirector_ProxyAudioConsumerCallback::~SwigDirector_ProxyAudioConsumerCallback() {
+}
+
+int SwigDirector_ProxyAudioConsumerCallback::prepare(int ptime, int rate, int channels) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_From_int(static_cast< int >(ptime));
+ swig::SwigVar_PyObject obj1;
+ obj1 = SWIG_From_int(static_cast< int >(rate));
+ swig::SwigVar_PyObject obj2;
+ obj2 = SWIG_From_int(static_cast< int >(channels));
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "prepare";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.prepare'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyAudioConsumerCallback::start() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "start";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.start'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyAudioConsumerCallback::pause() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 2;
+ const char * const swig_method_name = "pause";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.pause'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyAudioConsumerCallback::stop() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 3;
+ const char * const swig_method_name = "stop";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioConsumerCallback.stop'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_ProxyVideoConsumerCallback::SwigDirector_ProxyVideoConsumerCallback(PyObject *self): ProxyVideoConsumerCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((ProxyVideoConsumerCallback *)this, this);
+}
+
+
+
+
+SwigDirector_ProxyVideoConsumerCallback::~SwigDirector_ProxyVideoConsumerCallback() {
+}
+
+int SwigDirector_ProxyVideoConsumerCallback::prepare(int width, int height, int fps) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_From_int(static_cast< int >(width));
+ swig::SwigVar_PyObject obj1;
+ obj1 = SWIG_From_int(static_cast< int >(height));
+ swig::SwigVar_PyObject obj2;
+ obj2 = SWIG_From_int(static_cast< int >(fps));
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "prepare";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.prepare'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoConsumerCallback::consume(ProxyVideoFrame const *frame) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(frame), SWIGTYPE_p_ProxyVideoFrame, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "consume";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"consume", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.consume'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoConsumerCallback::start() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 2;
+ const char * const swig_method_name = "start";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.start'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoConsumerCallback::pause() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 3;
+ const char * const swig_method_name = "pause";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.pause'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoConsumerCallback::stop() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoConsumerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 4;
+ const char * const swig_method_name = "stop";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoConsumerCallback.stop'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_ProxyAudioProducerCallback::SwigDirector_ProxyAudioProducerCallback(PyObject *self): ProxyAudioProducerCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((ProxyAudioProducerCallback *)this, this);
+}
+
+
+
+
+SwigDirector_ProxyAudioProducerCallback::~SwigDirector_ProxyAudioProducerCallback() {
+}
+
+int SwigDirector_ProxyAudioProducerCallback::prepare(int ptime, int rate, int channels) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_From_int(static_cast< int >(ptime));
+ swig::SwigVar_PyObject obj1;
+ obj1 = SWIG_From_int(static_cast< int >(rate));
+ swig::SwigVar_PyObject obj2;
+ obj2 = SWIG_From_int(static_cast< int >(channels));
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "prepare";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.prepare'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyAudioProducerCallback::start() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "start";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.start'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyAudioProducerCallback::pause() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 2;
+ const char * const swig_method_name = "pause";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.pause'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyAudioProducerCallback::stop() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyAudioProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 3;
+ const char * const swig_method_name = "stop";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyAudioProducerCallback.stop'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_ProxyVideoProducerCallback::SwigDirector_ProxyVideoProducerCallback(PyObject *self): ProxyVideoProducerCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((ProxyVideoProducerCallback *)this, this);
+}
+
+
+
+
+SwigDirector_ProxyVideoProducerCallback::~SwigDirector_ProxyVideoProducerCallback() {
+}
+
+int SwigDirector_ProxyVideoProducerCallback::prepare(int width, int height, int fps) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_From_int(static_cast< int >(width));
+ swig::SwigVar_PyObject obj1;
+ obj1 = SWIG_From_int(static_cast< int >(height));
+ swig::SwigVar_PyObject obj2;
+ obj2 = SWIG_From_int(static_cast< int >(fps));
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "prepare";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"prepare", (char *)"(OOO)" ,(PyObject *)obj0,(PyObject *)obj1,(PyObject *)obj2);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.prepare'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoProducerCallback::start() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "start";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "start", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.start'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoProducerCallback::pause() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 2;
+ const char * const swig_method_name = "pause";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "pause", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.pause'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_ProxyVideoProducerCallback::stop() {
+ int c_result;
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call ProxyVideoProducerCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 3;
+ const char * const swig_method_name = "stop";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, NULL, NULL);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *) "stop", NULL);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'ProxyVideoProducerCallback.stop'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_SipCallback::SwigDirector_SipCallback(PyObject *self): SipCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((SipCallback *)this, this);
+}
+
+
+
+
+SwigDirector_SipCallback::~SwigDirector_SipCallback() {
+}
+
+int SwigDirector_SipCallback::OnDialogEvent(DialogEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_DialogEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "OnDialogEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnDialogEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnDialogEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnStackEvent(StackEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_StackEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 1;
+ const char * const swig_method_name = "OnStackEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnStackEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnStackEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnInviteEvent(InviteEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_InviteEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 2;
+ const char * const swig_method_name = "OnInviteEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnInviteEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnInviteEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnMessagingEvent(MessagingEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_MessagingEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 3;
+ const char * const swig_method_name = "OnMessagingEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnMessagingEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnMessagingEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnOptionsEvent(OptionsEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_OptionsEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 4;
+ const char * const swig_method_name = "OnOptionsEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnOptionsEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnOptionsEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnPublicationEvent(PublicationEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_PublicationEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 5;
+ const char * const swig_method_name = "OnPublicationEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnPublicationEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnPublicationEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnRegistrationEvent(RegistrationEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_RegistrationEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 6;
+ const char * const swig_method_name = "OnRegistrationEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnRegistrationEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnRegistrationEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+int SwigDirector_SipCallback::OnSubscriptionEvent(SubscriptionEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_SubscriptionEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call SipCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 7;
+ const char * const swig_method_name = "OnSubscriptionEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnSubscriptionEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'SipCallback.OnSubscriptionEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_XcapCallback::SwigDirector_XcapCallback(PyObject *self): XcapCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((XcapCallback *)this, this);
+}
+
+
+
+
+SwigDirector_XcapCallback::~SwigDirector_XcapCallback() {
+}
+
+int SwigDirector_XcapCallback::onEvent(XcapEvent const *e) const {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_XcapEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call XcapCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "onEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"onEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'XcapCallback.onEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+SwigDirector_MsrpCallback::SwigDirector_MsrpCallback(PyObject *self): MsrpCallback(), Swig::Director(self) {
+ SWIG_DIRECTOR_RGTR((MsrpCallback *)this, this);
+}
+
+
+
+
+SwigDirector_MsrpCallback::~SwigDirector_MsrpCallback() {
+}
+
+int SwigDirector_MsrpCallback::OnEvent(MsrpEvent const *e) {
+ int c_result;
+ swig::SwigVar_PyObject obj0;
+ obj0 = SWIG_NewPointerObj(SWIG_as_voidptr(e), SWIGTYPE_p_MsrpEvent, 0 );
+ if (!swig_get_self()) {
+ Swig::DirectorException::raise("'self' uninitialized, maybe you forgot to call MsrpCallback.__init__.");
+ }
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+ const size_t swig_method_index = 0;
+ const char * const swig_method_name = "OnEvent";
+ PyObject* method = swig_get_method(swig_method_index, swig_method_name);
+ swig::SwigVar_PyObject result = PyObject_CallFunction(method, (char *)"(O)" ,(PyObject *)obj0);
+#else
+ swig::SwigVar_PyObject result = PyObject_CallMethod(swig_get_self(), (char *)"OnEvent", (char *)"(O)" ,(PyObject *)obj0);
+#endif
+ if (result == NULL) {
+ PyObject *error = PyErr_Occurred();
+ if (error != NULL) {
+ Swig::DirectorMethodException::raise("Error detected when calling 'MsrpCallback.OnEvent'");
+ }
+ }
+ int swig_val;
+ int swig_res = SWIG_AsVal_int(result, &swig_val);
+ if (!SWIG_IsOK(swig_res)) {
+ Swig::DirectorTypeMismatchException::raise(SWIG_ErrorType(SWIG_ArgError(swig_res)), "in output value of type '""int""'");
+ }
+ c_result = static_cast< int >(swig_val);
+ return (int) c_result;
+}
+
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+SWIGINTERN PyObject *_wrap_new_DDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ DDebugCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_DDebugCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (DDebugCallback *)new SwigDirector_DDebugCallback(arg1);
+ } else {
+ result = (DDebugCallback *)new DDebugCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_DDebugCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_DDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DDebugCallback *arg1 = (DDebugCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_DDebugCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_DDebugCallback" "', argument " "1"" of type '" "DDebugCallback *""'");
+ }
+ arg1 = reinterpret_cast< DDebugCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugInfo(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DDebugCallback *arg1 = (DDebugCallback *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugInfo",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugInfo" "', argument " "1"" of type '" "DDebugCallback *""'");
+ }
+ arg1 = reinterpret_cast< DDebugCallback * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugInfo" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->DDebugCallback::OnDebugInfo((char const *)arg2);
+ } else {
+ result = (int)(arg1)->OnDebugInfo((char const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugWarn(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DDebugCallback *arg1 = (DDebugCallback *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugWarn",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugWarn" "', argument " "1"" of type '" "DDebugCallback *""'");
+ }
+ arg1 = reinterpret_cast< DDebugCallback * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugWarn" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->DDebugCallback::OnDebugWarn((char const *)arg2);
+ } else {
+ result = (int)(arg1)->OnDebugWarn((char const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugError(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DDebugCallback *arg1 = (DDebugCallback *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugError",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugError" "', argument " "1"" of type '" "DDebugCallback *""'");
+ }
+ arg1 = reinterpret_cast< DDebugCallback * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugError" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->DDebugCallback::OnDebugError((char const *)arg2);
+ } else {
+ result = (int)(arg1)->OnDebugError((char const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_DDebugCallback_OnDebugFatal(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DDebugCallback *arg1 = (DDebugCallback *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:DDebugCallback_OnDebugFatal",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "DDebugCallback_OnDebugFatal" "', argument " "1"" of type '" "DDebugCallback *""'");
+ }
+ arg1 = reinterpret_cast< DDebugCallback * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "DDebugCallback_OnDebugFatal" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->DDebugCallback::OnDebugFatal((char const *)arg2);
+ } else {
+ result = (int)(arg1)->OnDebugFatal((char const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_DDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DDebugCallback *arg1 = (DDebugCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_DDebugCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DDebugCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_DDebugCallback" "', argument " "1"" of type '" "DDebugCallback *""'");
+ }
+ arg1 = reinterpret_cast< DDebugCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *DDebugCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_DDebugCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_ActionConfig(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ActionConfig *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_ActionConfig")) SWIG_fail;
+ result = (ActionConfig *)new ActionConfig();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_ActionConfig(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ActionConfig *arg1 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ActionConfig",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ActionConfig" "', argument " "1"" of type '" "ActionConfig *""'");
+ }
+ arg1 = reinterpret_cast< ActionConfig * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ActionConfig_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ActionConfig *arg1 = (ActionConfig *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ActionConfig_addHeader",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_addHeader" "', argument " "1"" of type '" "ActionConfig *""'");
+ }
+ arg1 = reinterpret_cast< ActionConfig * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ActionConfig_addHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_addHeader" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ActionConfig_setResponseLine(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ActionConfig *arg1 = (ActionConfig *) 0 ;
+ short arg2 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ short val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ ActionConfig *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ActionConfig_setResponseLine",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setResponseLine" "', argument " "1"" of type '" "ActionConfig *""'");
+ }
+ arg1 = reinterpret_cast< ActionConfig * >(argp1);
+ ecode2 = SWIG_AsVal_short(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setResponseLine" "', argument " "2"" of type '" "short""'");
+ }
+ arg2 = static_cast< short >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_setResponseLine" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (ActionConfig *)(arg1)->setResponseLine(arg2,(char const *)arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ActionConfig_setMediaString(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ActionConfig *arg1 = (ActionConfig *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ ActionConfig *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:ActionConfig_setMediaString",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setMediaString" "', argument " "1"" of type '" "ActionConfig *""'");
+ }
+ arg1 = reinterpret_cast< ActionConfig * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setMediaString" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_setMediaString" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "ActionConfig_setMediaString" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (ActionConfig *)(arg1)->setMediaString(arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ActionConfig_setMediaInt(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ActionConfig *arg1 = (ActionConfig *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ ActionConfig *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:ActionConfig_setMediaInt",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ActionConfig_setMediaInt" "', argument " "1"" of type '" "ActionConfig *""'");
+ }
+ arg1 = reinterpret_cast< ActionConfig * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ActionConfig_setMediaInt" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "ActionConfig_setMediaInt" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ActionConfig_setMediaInt" "', argument " "4"" of type '" "int""'");
+ }
+ arg4 = static_cast< int >(val4);
+ result = (ActionConfig *)(arg1)->setMediaInt(arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ActionConfig_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ActionConfig, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_MediaSessionMgr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MediaSessionMgr",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MediaSessionMgr" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_sessionSetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ int32_t arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_sessionSetInt32",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_sessionSetInt32" "', argument " "4"" of type '" "int32_t""'");
+ }
+ arg4 = static_cast< int32_t >(val4);
+ result = (bool)(arg1)->sessionSetInt32(arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_consumerSetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ int32_t arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_consumerSetInt32",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_consumerSetInt32" "', argument " "4"" of type '" "int32_t""'");
+ }
+ arg4 = static_cast< int32_t >(val4);
+ result = (bool)(arg1)->consumerSetInt32(arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_consumerSetInt64(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ int64_t arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ long long val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_consumerSetInt64",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_long_SS_long(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_consumerSetInt64" "', argument " "4"" of type '" "int64_t""'");
+ }
+ arg4 = static_cast< int64_t >(val4);
+ result = (bool)(arg1)->consumerSetInt64(arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_producerSetInt32(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ int32_t arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_producerSetInt32",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_producerSetInt32" "', argument " "4"" of type '" "int32_t""'");
+ }
+ arg4 = static_cast< int32_t >(val4);
+ result = (bool)(arg1)->producerSetInt32(arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_producerSetInt64(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ char *arg3 = (char *) 0 ;
+ int64_t arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ long long val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:MediaSessionMgr_producerSetInt64",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_long_SS_long(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "MediaSessionMgr_producerSetInt64" "', argument " "4"" of type '" "int64_t""'");
+ }
+ arg4 = static_cast< int64_t >(val4);
+ result = (bool)(arg1)->producerSetInt64(arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_findProxyPluginConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ ProxyPlugin *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_findProxyPluginConsumer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_findProxyPluginConsumer" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_findProxyPluginConsumer" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ result = (ProxyPlugin *)(arg1)->findProxyPluginConsumer(arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPlugin, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaSessionMgr_findProxyPluginProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaSessionMgr *arg1 = (MediaSessionMgr *) 0 ;
+ twrap_media_type_t arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ ProxyPlugin *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MediaSessionMgr_findProxyPluginProducer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaSessionMgr_findProxyPluginProducer" "', argument " "1"" of type '" "MediaSessionMgr *""'");
+ }
+ arg1 = reinterpret_cast< MediaSessionMgr * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaSessionMgr_findProxyPluginProducer" "', argument " "2"" of type '" "twrap_media_type_t""'");
+ }
+ arg2 = static_cast< twrap_media_type_t >(val2);
+ result = (ProxyPlugin *)(arg1)->findProxyPluginProducer(arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPlugin, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MediaSessionMgr_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MediaSessionMgr, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_MediaContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContent *arg1 = (MediaContent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MediaContent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MediaContent" "', argument " "1"" of type '" "MediaContent *""'");
+ }
+ arg1 = reinterpret_cast< MediaContent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContent *arg1 = (MediaContent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MediaContent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getType" "', argument " "1"" of type '" "MediaContent *""'");
+ }
+ arg1 = reinterpret_cast< MediaContent * >(argp1);
+ result = (char *)(arg1)->getType();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_getDataLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContent *arg1 = (MediaContent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MediaContent_getDataLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getDataLength" "', argument " "1"" of type '" "MediaContent *""'");
+ }
+ arg1 = reinterpret_cast< MediaContent * >(argp1);
+ result = (unsigned int)(arg1)->getDataLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_getData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContent *arg1 = (MediaContent *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContent_getData",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getData" "', argument " "1"" of type '" "MediaContent *""'");
+ }
+ arg1 = reinterpret_cast< MediaContent * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContent_getData" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MediaContent_getData" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getData(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_parse__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ unsigned int arg2 ;
+ char *arg3 = (char *) 0 ;
+ int res1 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ MediaContent *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContent_parse",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_parse" "', argument " "1"" of type '" "void const *""'");
+ }
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaContent_parse" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MediaContent_parse" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (MediaContent *)MediaContent::parse((void const *)arg1,arg2,(char const *)arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MediaContent, SWIG_POINTER_OWN | 0 );
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_parse__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ unsigned int arg2 ;
+ int res1 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ MediaContentCPIM *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MediaContent_parse",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_parse" "', argument " "1"" of type '" "void const *""'");
+ }
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "MediaContent_parse" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ result = (MediaContentCPIM *)MediaContent::parse((void const *)arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MediaContentCPIM, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_parse(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *ptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &ptr, 0, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[1], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_MediaContent_parse__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *ptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &ptr, 0, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[1], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_MediaContent_parse__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'MediaContent_parse'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " parse(void const *,unsigned int,char const *)\n"
+ " MediaContent::parse(void const *,unsigned int)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContent *arg1 = (MediaContent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MediaContent_getPayloadLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getPayloadLength" "', argument " "1"" of type '" "MediaContent *""'");
+ }
+ arg1 = reinterpret_cast< MediaContent * >(argp1);
+ result = (unsigned int)(arg1)->getPayloadLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContent_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContent *arg1 = (MediaContent *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContent_getPayload",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContent_getPayload" "', argument " "1"" of type '" "MediaContent *""'");
+ }
+ arg1 = reinterpret_cast< MediaContent * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContent_getPayload" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MediaContent_getPayload" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getPayload(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MediaContent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MediaContent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_MediaContentCPIM(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MediaContentCPIM",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MediaContentCPIM" "', argument " "1"" of type '" "MediaContentCPIM *""'");
+ }
+ arg1 = reinterpret_cast< MediaContentCPIM * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContentCPIM_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MediaContentCPIM_getPayloadLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContentCPIM_getPayloadLength" "', argument " "1"" of type '" "MediaContentCPIM *""'");
+ }
+ arg1 = reinterpret_cast< MediaContentCPIM * >(argp1);
+ result = (unsigned int)(arg1)->getPayloadLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContentCPIM_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MediaContentCPIM_getPayload",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContentCPIM_getPayload" "', argument " "1"" of type '" "MediaContentCPIM *""'");
+ }
+ arg1 = reinterpret_cast< MediaContentCPIM * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContentCPIM_getPayload" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MediaContentCPIM_getPayload" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getPayload(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MediaContentCPIM_getHeaderValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MediaContentCPIM *arg1 = (MediaContentCPIM *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MediaContentCPIM_getHeaderValue",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MediaContentCPIM, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MediaContentCPIM_getHeaderValue" "', argument " "1"" of type '" "MediaContentCPIM *""'");
+ }
+ arg1 = reinterpret_cast< MediaContentCPIM * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MediaContentCPIM_getHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->getHeaderValue((char const *)arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MediaContentCPIM_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MediaContentCPIM, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SipUri(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ char *arg1 = (char *) 0 ;
+ int res1 ;
+ char *buf1 = 0 ;
+ int alloc1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SipUri *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_SipUri",&obj0)) SWIG_fail;
+ res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipUri" "', argument " "1"" of type '" "char const *""'");
+ }
+ arg1 = reinterpret_cast< char * >(buf1);
+ result = (SipUri *)new SipUri((char const *)arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipUri, SWIG_POINTER_NEW | 0 );
+ if (alloc1 == SWIG_NEWOBJ) delete[] buf1;
+ return resultobj;
+fail:
+ if (alloc1 == SWIG_NEWOBJ) delete[] buf1;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SipUri(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SipUri",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipUri" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_isValid__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ char *arg1 = (char *) 0 ;
+ int res1 ;
+ char *buf1 = 0 ;
+ int alloc1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_isValid",&obj0)) SWIG_fail;
+ res1 = SWIG_AsCharPtrAndSize(obj0, &buf1, NULL, &alloc1);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_isValid" "', argument " "1"" of type '" "char const *""'");
+ }
+ arg1 = reinterpret_cast< char * >(buf1);
+ result = (bool)SipUri::isValid((char const *)arg1);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc1 == SWIG_NEWOBJ) delete[] buf1;
+ return resultobj;
+fail:
+ if (alloc1 == SWIG_NEWOBJ) delete[] buf1;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_isValid__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_isValid",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_isValid" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (bool)(arg1)->isValid();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_isValid(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[2];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 1); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipUri, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_SipUri_isValid__SWIG_1(self, args);
+ }
+ }
+ if (argc == 1) {
+ int _v;
+ int res = SWIG_AsCharPtrAndSize(argv[0], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_SipUri_isValid__SWIG_0(self, args);
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'SipUri_isValid'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " isValid(char const *)\n"
+ " isValid(SipUri *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getScheme(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getScheme",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getScheme" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (char *)(arg1)->getScheme();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getHost(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getHost",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getHost" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (char *)(arg1)->getHost();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned short result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getPort",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getPort" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (unsigned short)(arg1)->getPort();
+ resultobj = SWIG_From_unsigned_SS_short(static_cast< unsigned short >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getUserName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getUserName",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getUserName" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (char *)(arg1)->getUserName();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getPassword(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getPassword",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getPassword" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (char *)(arg1)->getPassword();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getDisplayName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipUri_getDisplayName",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getDisplayName" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ result = (char *)(arg1)->getDisplayName();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipUri_getParamValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipUri *arg1 = (SipUri *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipUri_getParamValue",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipUri, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipUri_getParamValue" "', argument " "1"" of type '" "SipUri *""'");
+ }
+ arg1 = reinterpret_cast< SipUri * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipUri_getParamValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->getParamValue((char const *)arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SipUri_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SipUri, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SdpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SdpMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_SdpMessage")) SWIG_fail;
+ result = (SdpMessage *)new SdpMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SdpMessage, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SdpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SdpMessage *arg1 = (SdpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SdpMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SdpMessage" "', argument " "1"" of type '" "SdpMessage *""'");
+ }
+ arg1 = reinterpret_cast< SdpMessage * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SdpMessage *arg1 = (SdpMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char arg3 ;
+ unsigned int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ char val3 ;
+ int ecode3 = 0 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SdpMessage_getSdpHeaderValue",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "1"" of type '" "SdpMessage *""'");
+ }
+ arg1 = reinterpret_cast< SdpMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_char(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "3"" of type '" "char""'");
+ }
+ arg3 = static_cast< char >(val3);
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ result = (char *)(arg1)->getSdpHeaderValue((char const *)arg2,arg3,arg4);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SdpMessage *arg1 = (SdpMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ char val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SdpMessage_getSdpHeaderValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "1"" of type '" "SdpMessage *""'");
+ }
+ arg1 = reinterpret_cast< SdpMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_char(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SdpMessage_getSdpHeaderValue" "', argument " "3"" of type '" "char""'");
+ }
+ arg3 = static_cast< char >(val3);
+ result = (char *)(arg1)->getSdpHeaderValue((char const *)arg2,arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderValue(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[5];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 4); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SdpMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_char(argv[2], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_SdpMessage_getSdpHeaderValue__SWIG_1(self, args);
+ }
+ }
+ }
+ }
+ if (argc == 4) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SdpMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_char(argv[2], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_SdpMessage_getSdpHeaderValue__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'SdpMessage_getSdpHeaderValue'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " getSdpHeaderValue(SdpMessage *,char const *,char,unsigned int)\n"
+ " getSdpHeaderValue(SdpMessage *,char const *,char)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SdpMessage_getSdpHeaderAValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SdpMessage *arg1 = (SdpMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SdpMessage_getSdpHeaderAValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SdpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SdpMessage_getSdpHeaderAValue" "', argument " "1"" of type '" "SdpMessage *""'");
+ }
+ arg1 = reinterpret_cast< SdpMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SdpMessage_getSdpHeaderAValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SdpMessage_getSdpHeaderAValue" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (char *)(arg1)->getSdpHeaderAValue((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SdpMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SdpMessage, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SipMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_SipMessage")) SWIG_fail;
+ result = (SipMessage *)new SipMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipMessage, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SipMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SipMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipMessage" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipMessage_getSipHeaderValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderValue" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipMessage_getSipHeaderValue" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (char *)(arg1)->getSipHeaderValue((char const *)arg2,arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipMessage_getSipHeaderValue",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderValue" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->getSipHeaderValue((char const *)arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderValue(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_SipMessage_getSipHeaderValue__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_SipMessage_getSipHeaderValue__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'SipMessage_getSipHeaderValue'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " getSipHeaderValue(SipMessage *,char const *,unsigned int)\n"
+ " getSipHeaderValue(SipMessage *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderParamValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ unsigned int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SipMessage_getSipHeaderParamValue",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ result = (char *)(arg1)->getSipHeaderParamValue((char const *)arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderParamValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipMessage_getSipHeaderParamValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipMessage_getSipHeaderParamValue" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (char *)(arg1)->getSipHeaderParamValue((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipHeaderParamValue(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[5];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 4); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_SipMessage_getSipHeaderParamValue__SWIG_1(self, args);
+ }
+ }
+ }
+ }
+ if (argc == 4) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_SipMessage_getSipHeaderParamValue__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'SipMessage_getSipHeaderParamValue'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " getSipHeaderParamValue(SipMessage *,char const *,char const *,unsigned int)\n"
+ " getSipHeaderParamValue(SipMessage *,char const *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipContentLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getSipContentLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipContentLength" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ result = (unsigned int)(arg1)->getSipContentLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSipContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipMessage_getSipContent",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSipContent" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipMessage_getSipContent" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipMessage_getSipContent" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getSipContent(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipMessage_getSdpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipMessage *arg1 = (SipMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SdpMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipMessage_getSdpMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipMessage_getSdpMessage" "', argument " "1"" of type '" "SipMessage *""'");
+ }
+ arg1 = reinterpret_cast< SipMessage * >(argp1);
+ result = (SdpMessage *)(arg1)->getSdpMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SdpMessage, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SipMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SipMessage, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_SipEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipEvent *arg1 = (SipEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SipEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipEvent" "', argument " "1"" of type '" "SipEvent *""'");
+ }
+ arg1 = reinterpret_cast< SipEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipEvent_getCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipEvent *arg1 = (SipEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ short result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getCode",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getCode" "', argument " "1"" of type '" "SipEvent const *""'");
+ }
+ arg1 = reinterpret_cast< SipEvent * >(argp1);
+ result = (short)((SipEvent const *)arg1)->getCode();
+ resultobj = SWIG_From_short(static_cast< short >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipEvent_getPhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipEvent *arg1 = (SipEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getPhrase",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getPhrase" "', argument " "1"" of type '" "SipEvent const *""'");
+ }
+ arg1 = reinterpret_cast< SipEvent * >(argp1);
+ result = (char *)((SipEvent const *)arg1)->getPhrase();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipEvent_getBaseSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipEvent *arg1 = (SipEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SipSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getBaseSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getBaseSession" "', argument " "1"" of type '" "SipEvent const *""'");
+ }
+ arg1 = reinterpret_cast< SipEvent * >(argp1);
+ result = (SipSession *)((SipEvent const *)arg1)->getBaseSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipEvent_getSipMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipEvent *arg1 = (SipEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SipMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipEvent_getSipMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipEvent_getSipMessage" "', argument " "1"" of type '" "SipEvent const *""'");
+ }
+ arg1 = reinterpret_cast< SipEvent * >(argp1);
+ result = (SipMessage *)((SipEvent const *)arg1)->getSipMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipMessage, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SipEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SipEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_DialogEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ DialogEvent *arg1 = (DialogEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_DialogEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_DialogEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_DialogEvent" "', argument " "1"" of type '" "DialogEvent *""'");
+ }
+ arg1 = reinterpret_cast< DialogEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *DialogEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_DialogEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_StackEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ StackEvent *arg1 = (StackEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_StackEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_StackEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_StackEvent" "', argument " "1"" of type '" "StackEvent *""'");
+ }
+ arg1 = reinterpret_cast< StackEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *StackEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_StackEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_InviteEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteEvent *arg1 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_InviteEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_InviteEvent" "', argument " "1"" of type '" "InviteEvent *""'");
+ }
+ arg1 = reinterpret_cast< InviteEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteEvent *arg1 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tsip_invite_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_getType" "', argument " "1"" of type '" "InviteEvent const *""'");
+ }
+ arg1 = reinterpret_cast< InviteEvent * >(argp1);
+ result = (tsip_invite_event_type_t)((InviteEvent const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteEvent_getMediaType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteEvent *arg1 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ twrap_media_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_getMediaType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_getMediaType" "', argument " "1"" of type '" "InviteEvent *""'");
+ }
+ arg1 = reinterpret_cast< InviteEvent * >(argp1);
+ result = (twrap_media_type_t)(arg1)->getMediaType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteEvent *arg1 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ InviteSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_getSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_getSession" "', argument " "1"" of type '" "InviteEvent const *""'");
+ }
+ arg1 = reinterpret_cast< InviteEvent * >(argp1);
+ result = (InviteSession *)((InviteEvent const *)arg1)->getSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InviteSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteEvent_takeCallSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteEvent *arg1 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ CallSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_takeCallSessionOwnership",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_takeCallSessionOwnership" "', argument " "1"" of type '" "InviteEvent const *""'");
+ }
+ arg1 = reinterpret_cast< InviteEvent * >(argp1);
+ result = (CallSession *)((InviteEvent const *)arg1)->takeCallSessionOwnership();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_CallSession, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteEvent_takeMsrpSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteEvent *arg1 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MsrpSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteEvent_takeMsrpSessionOwnership",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteEvent_takeMsrpSessionOwnership" "', argument " "1"" of type '" "InviteEvent const *""'");
+ }
+ arg1 = reinterpret_cast< InviteEvent * >(argp1);
+ result = (MsrpSession *)((InviteEvent const *)arg1)->takeMsrpSessionOwnership();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpSession, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *InviteEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_InviteEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_MessagingEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingEvent *arg1 = (MessagingEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MessagingEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MessagingEvent" "', argument " "1"" of type '" "MessagingEvent *""'");
+ }
+ arg1 = reinterpret_cast< MessagingEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MessagingEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingEvent *arg1 = (MessagingEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tsip_message_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MessagingEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingEvent_getType" "', argument " "1"" of type '" "MessagingEvent const *""'");
+ }
+ arg1 = reinterpret_cast< MessagingEvent * >(argp1);
+ result = (tsip_message_event_type_t)((MessagingEvent const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MessagingEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingEvent *arg1 = (MessagingEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MessagingSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MessagingEvent_getSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingEvent_getSession" "', argument " "1"" of type '" "MessagingEvent const *""'");
+ }
+ arg1 = reinterpret_cast< MessagingEvent * >(argp1);
+ result = (MessagingSession *)((MessagingEvent const *)arg1)->getSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MessagingSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MessagingEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingEvent *arg1 = (MessagingEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MessagingSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MessagingEvent_takeSessionOwnership",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingEvent_takeSessionOwnership" "', argument " "1"" of type '" "MessagingEvent const *""'");
+ }
+ arg1 = reinterpret_cast< MessagingEvent * >(argp1);
+ result = (MessagingSession *)((MessagingEvent const *)arg1)->takeSessionOwnership();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MessagingSession, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MessagingEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MessagingEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_OptionsEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ OptionsEvent *arg1 = (OptionsEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_OptionsEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_OptionsEvent" "', argument " "1"" of type '" "OptionsEvent *""'");
+ }
+ arg1 = reinterpret_cast< OptionsEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_OptionsEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ OptionsEvent *arg1 = (OptionsEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tsip_options_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:OptionsEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsEvent_getType" "', argument " "1"" of type '" "OptionsEvent const *""'");
+ }
+ arg1 = reinterpret_cast< OptionsEvent * >(argp1);
+ result = (tsip_options_event_type_t)((OptionsEvent const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_OptionsEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ OptionsEvent *arg1 = (OptionsEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ OptionsSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:OptionsEvent_getSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsEvent_getSession" "', argument " "1"" of type '" "OptionsEvent const *""'");
+ }
+ arg1 = reinterpret_cast< OptionsEvent * >(argp1);
+ result = (OptionsSession *)((OptionsEvent const *)arg1)->getSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_OptionsSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *OptionsEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_OptionsEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_PublicationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PublicationEvent *arg1 = (PublicationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_PublicationEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_PublicationEvent" "', argument " "1"" of type '" "PublicationEvent *""'");
+ }
+ arg1 = reinterpret_cast< PublicationEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_PublicationEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PublicationEvent *arg1 = (PublicationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tsip_publish_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:PublicationEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationEvent_getType" "', argument " "1"" of type '" "PublicationEvent const *""'");
+ }
+ arg1 = reinterpret_cast< PublicationEvent * >(argp1);
+ result = (tsip_publish_event_type_t)((PublicationEvent const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_PublicationEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PublicationEvent *arg1 = (PublicationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ PublicationSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:PublicationEvent_getSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationEvent_getSession" "', argument " "1"" of type '" "PublicationEvent const *""'");
+ }
+ arg1 = reinterpret_cast< PublicationEvent * >(argp1);
+ result = (PublicationSession *)((PublicationEvent const *)arg1)->getSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_PublicationSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *PublicationEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_PublicationEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_RegistrationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationEvent *arg1 = (RegistrationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_RegistrationEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_RegistrationEvent" "', argument " "1"" of type '" "RegistrationEvent *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationEvent *arg1 = (RegistrationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tsip_register_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationEvent_getType" "', argument " "1"" of type '" "RegistrationEvent const *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationEvent * >(argp1);
+ result = (tsip_register_event_type_t)((RegistrationEvent const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationEvent *arg1 = (RegistrationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ RegistrationSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationEvent_getSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationEvent_getSession" "', argument " "1"" of type '" "RegistrationEvent const *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationEvent * >(argp1);
+ result = (RegistrationSession *)((RegistrationEvent const *)arg1)->getSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationEvent_takeSessionOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationEvent *arg1 = (RegistrationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ RegistrationSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationEvent_takeSessionOwnership",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationEvent_takeSessionOwnership" "', argument " "1"" of type '" "RegistrationEvent const *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationEvent * >(argp1);
+ result = (RegistrationSession *)((RegistrationEvent const *)arg1)->takeSessionOwnership();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RegistrationSession, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *RegistrationEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_RegistrationEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_SubscriptionEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SubscriptionEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SubscriptionEvent" "', argument " "1"" of type '" "SubscriptionEvent *""'");
+ }
+ arg1 = reinterpret_cast< SubscriptionEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SubscriptionEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tsip_subscribe_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionEvent_getType" "', argument " "1"" of type '" "SubscriptionEvent const *""'");
+ }
+ arg1 = reinterpret_cast< SubscriptionEvent * >(argp1);
+ result = (tsip_subscribe_event_type_t)((SubscriptionEvent const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SubscriptionEvent_getSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SubscriptionEvent *arg1 = (SubscriptionEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SubscriptionSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionEvent_getSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionEvent_getSession" "', argument " "1"" of type '" "SubscriptionEvent const *""'");
+ }
+ arg1 = reinterpret_cast< SubscriptionEvent * >(argp1);
+ result = (SubscriptionSession *)((SubscriptionEvent const *)arg1)->getSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SubscriptionSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SubscriptionEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SubscriptionEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SipSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SipSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_SipSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (SipSession *)new SipSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SipSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SipSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipSession" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_haveOwnership(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipSession_haveOwnership",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_haveOwnership" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ result = (bool)(arg1)->haveOwnership();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipSession_addHeader",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addHeader" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipSession_addHeader" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_removeHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_removeHeader",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_removeHeader" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_removeHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->removeHeader((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_addCaps__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipSession_addCaps",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addCaps" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addCaps" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipSession_addCaps" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->addCaps((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_addCaps__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_addCaps",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addCaps" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addCaps" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->addCaps((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_addCaps(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_SipSession_addCaps__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_SipSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_SipSession_addCaps__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'SipSession_addCaps'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " addCaps(SipSession *,char const *,char const *)\n"
+ " addCaps(SipSession *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_removeCaps(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_removeCaps",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_removeCaps" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_removeCaps" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->removeCaps((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_setExpires(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ unsigned int arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setExpires",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setExpires" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipSession_setExpires" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ result = (bool)(arg1)->setExpires(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_setFromUri(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setFromUri",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setFromUri" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_setFromUri" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setFromUri((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_setToUri(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setToUri",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setToUri" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_setToUri" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setToUri((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_setSilentHangup(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ bool arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ bool val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_setSilentHangup",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_setSilentHangup" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ ecode2 = SWIG_AsVal_bool(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipSession_setSilentHangup" "', argument " "2"" of type '" "bool""'");
+ }
+ arg2 = static_cast< bool >(val2);
+ result = (bool)(arg1)->setSilentHangup(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_addSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipSession_addSigCompCompartment",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_addSigCompCompartment" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipSession_addSigCompCompartment" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->addSigCompCompartment((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_removeSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipSession_removeSigCompCompartment",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_removeSigCompCompartment" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ result = (bool)(arg1)->removeSigCompCompartment();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipSession_getId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipSession *arg1 = (SipSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipSession_getId",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipSession_getId" "', argument " "1"" of type '" "SipSession *""'");
+ }
+ arg1 = reinterpret_cast< SipSession * >(argp1);
+ result = (unsigned int)(arg1)->getId();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SipSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SipSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_InviteSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ InviteSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_InviteSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_InviteSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (InviteSession *)new InviteSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_InviteSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_InviteSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_InviteSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_InviteSession" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:InviteSession_accept",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_accept" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_accept" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->accept(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_accept",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_accept" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ result = (bool)(arg1)->accept();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_accept(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_InviteSession_accept__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_InviteSession_accept__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'InviteSession_accept'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " accept(InviteSession *,ActionConfig *)\n"
+ " accept(InviteSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_hangup__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:InviteSession_hangup",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_hangup" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_hangup" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->hangup(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_hangup__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_hangup",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_hangup" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ result = (bool)(arg1)->hangup();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_hangup(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_InviteSession_hangup__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_InviteSession_hangup__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'InviteSession_hangup'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " hangup(InviteSession *,ActionConfig *)\n"
+ " hangup(InviteSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:InviteSession_reject",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_reject" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "InviteSession_reject" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->reject(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_reject",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_reject" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ result = (bool)(arg1)->reject();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_reject(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_InviteSession_reject__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_InviteSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_InviteSession_reject__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'InviteSession_reject'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " reject(InviteSession *,ActionConfig *)\n"
+ " reject(InviteSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_InviteSession_getMediaMgr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ InviteSession *arg1 = (InviteSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MediaSessionMgr *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:InviteSession_getMediaMgr",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_InviteSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "InviteSession_getMediaMgr" "', argument " "1"" of type '" "InviteSession *""'");
+ }
+ arg1 = reinterpret_cast< InviteSession * >(argp1);
+ result = (MediaSessionMgr *)(arg1)->getMediaMgr();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MediaSessionMgr, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *InviteSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_InviteSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_CallSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ CallSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_CallSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_CallSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (CallSession *)new CallSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_CallSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_CallSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_CallSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_CallSession" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callAudio__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ ActionConfig *arg3 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ void *argp3 = 0 ;
+ int res3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callAudio",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudio" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudio" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callAudio" "', argument " "3"" of type '" "ActionConfig *""'");
+ }
+ arg3 = reinterpret_cast< ActionConfig * >(argp3);
+ result = (bool)(arg1)->callAudio((char const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callAudio__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callAudio",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudio" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudio" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->callAudio((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callAudio(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_callAudio__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_callAudio__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'CallSession_callAudio'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " callAudio(CallSession *,char const *,ActionConfig *)\n"
+ " callAudio(CallSession *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ ActionConfig *arg3 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ void *argp3 = 0 ;
+ int res3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callAudioVideo",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudioVideo" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudioVideo" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callAudioVideo" "', argument " "3"" of type '" "ActionConfig *""'");
+ }
+ arg3 = reinterpret_cast< ActionConfig * >(argp3);
+ result = (bool)(arg1)->callAudioVideo((char const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callAudioVideo",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callAudioVideo" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callAudioVideo" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->callAudioVideo((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callAudioVideo(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_callAudioVideo__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_callAudioVideo__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'CallSession_callAudioVideo'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " callAudioVideo(CallSession *,char const *,ActionConfig *)\n"
+ " callAudioVideo(CallSession *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callVideo__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ ActionConfig *arg3 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ void *argp3 = 0 ;
+ int res3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_callVideo",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callVideo" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callVideo" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_callVideo" "', argument " "3"" of type '" "ActionConfig *""'");
+ }
+ arg3 = reinterpret_cast< ActionConfig * >(argp3);
+ result = (bool)(arg1)->callVideo((char const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callVideo__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_callVideo",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_callVideo" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_callVideo" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->callVideo((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_callVideo(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_callVideo__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_callVideo__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'CallSession_callVideo'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " callVideo(CallSession *,char const *,ActionConfig *)\n"
+ " callVideo(CallSession *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_setSessionTimer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ unsigned int arg2 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_setSessionTimer",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setSessionTimer" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setSessionTimer" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "CallSession_setSessionTimer" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->setSessionTimer(arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_set100rel(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ bool arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ bool val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_set100rel",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_set100rel" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ ecode2 = SWIG_AsVal_bool(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_set100rel" "', argument " "2"" of type '" "bool""'");
+ }
+ arg2 = static_cast< bool >(val2);
+ result = (bool)(arg1)->set100rel(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_setQoS(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ tmedia_qos_stype_t arg2 ;
+ tmedia_qos_strength_t arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:CallSession_setQoS",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_setQoS" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_setQoS" "', argument " "2"" of type '" "tmedia_qos_stype_t""'");
+ }
+ arg2 = static_cast< tmedia_qos_stype_t >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "CallSession_setQoS" "', argument " "3"" of type '" "tmedia_qos_strength_t""'");
+ }
+ arg3 = static_cast< tmedia_qos_strength_t >(val3);
+ result = (bool)(arg1)->setQoS(arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_hold__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_hold",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_hold" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_hold" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->hold(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_hold__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:CallSession_hold",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_hold" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ result = (bool)(arg1)->hold();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_hold(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_hold__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_hold__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'CallSession_hold'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " hold(CallSession *,ActionConfig *)\n"
+ " hold(CallSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_resume__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_resume",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_resume" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "CallSession_resume" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->resume(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_resume__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:CallSession_resume",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_resume" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ result = (bool)(arg1)->resume();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_resume(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_resume__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_CallSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_CallSession_resume__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'CallSession_resume'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " resume(CallSession *,ActionConfig *)\n"
+ " resume(CallSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_CallSession_sendDTMF(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ CallSession *arg1 = (CallSession *) 0 ;
+ int arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:CallSession_sendDTMF",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_CallSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "CallSession_sendDTMF" "', argument " "1"" of type '" "CallSession *""'");
+ }
+ arg1 = reinterpret_cast< CallSession * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "CallSession_sendDTMF" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ result = (bool)(arg1)->sendDTMF(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *CallSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_CallSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_MsrpSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ MsrpCallback *arg2 = (MsrpCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ MsrpSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:new_MsrpSession",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_MsrpSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MsrpCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_MsrpSession" "', argument " "2"" of type '" "MsrpCallback *""'");
+ }
+ arg2 = reinterpret_cast< MsrpCallback * >(argp2);
+ result = (MsrpSession *)new MsrpSession(arg1,arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_MsrpSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpSession" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ MsrpCallback *arg2 = (MsrpCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_setCallback",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_setCallback" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MsrpCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_setCallback" "', argument " "2"" of type '" "MsrpCallback *""'");
+ }
+ arg2 = reinterpret_cast< MsrpCallback * >(argp2);
+ result = (bool)(arg1)->setCallback(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ ActionConfig *arg3 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ void *argp3 = 0 ;
+ int res3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpSession_callMsrp",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_callMsrp" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_callMsrp" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2, &argp3,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MsrpSession_callMsrp" "', argument " "3"" of type '" "ActionConfig *""'");
+ }
+ arg3 = reinterpret_cast< ActionConfig * >(argp3);
+ result = (bool)(arg1)->callMsrp((char const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_callMsrp",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_callMsrp" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_callMsrp" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->callMsrp((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_callMsrp(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_MsrpSession_callMsrp__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[2], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_MsrpSession_callMsrp__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'MsrpSession_callMsrp'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " callMsrp(MsrpSession *,char const *,ActionConfig *)\n"
+ " callMsrp(MsrpSession *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_sendMessage__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ ActionConfig *arg4 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ void *argp4 = 0 ;
+ int res4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:MsrpSession_sendMessage",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendMessage" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_sendMessage" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MsrpSession_sendMessage" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ res4 = SWIG_ConvertPtr(obj3, &argp4,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "MsrpSession_sendMessage" "', argument " "4"" of type '" "ActionConfig *""'");
+ }
+ arg4 = reinterpret_cast< ActionConfig * >(argp4);
+ result = (bool)(arg1)->sendMessage((void const *)arg2,arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_sendMessage__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpSession_sendMessage",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendMessage" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_sendMessage" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MsrpSession_sendMessage" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (bool)(arg1)->sendMessage((void const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_sendMessage(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[5];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 4); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *ptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_MsrpSession_sendMessage__SWIG_1(self, args);
+ }
+ }
+ }
+ }
+ if (argc == 4) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *ptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &ptr, 0, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[3], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_MsrpSession_sendMessage__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'MsrpSession_sendMessage'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " sendMessage(MsrpSession *,void const *,unsigned int,ActionConfig *)\n"
+ " sendMessage(MsrpSession *,void const *,unsigned int)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_sendFile__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MsrpSession_sendFile",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendFile" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpSession_sendFile" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->sendFile(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_sendFile__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpSession *arg1 = (MsrpSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpSession_sendFile",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpSession_sendFile" "', argument " "1"" of type '" "MsrpSession *""'");
+ }
+ arg1 = reinterpret_cast< MsrpSession * >(argp1);
+ result = (bool)(arg1)->sendFile();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpSession_sendFile(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_MsrpSession_sendFile__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_MsrpSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_MsrpSession_sendFile__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'MsrpSession_sendFile'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " sendFile(MsrpSession *,ActionConfig *)\n"
+ " sendFile(MsrpSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MsrpSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MsrpSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_MessagingSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MessagingSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_MessagingSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_MessagingSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (MessagingSession *)new MessagingSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MessagingSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_MessagingSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingSession *arg1 = (MessagingSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MessagingSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MessagingSession" "', argument " "1"" of type '" "MessagingSession *""'");
+ }
+ arg1 = reinterpret_cast< MessagingSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MessagingSession_send(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingSession *arg1 = (MessagingSession *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MessagingSession_send",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_send" "', argument " "1"" of type '" "MessagingSession *""'");
+ }
+ arg1 = reinterpret_cast< MessagingSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MessagingSession_send" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MessagingSession_send" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (bool)(arg1)->send((void const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MessagingSession_accept(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingSession *arg1 = (MessagingSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MessagingSession_accept",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_accept" "', argument " "1"" of type '" "MessagingSession *""'");
+ }
+ arg1 = reinterpret_cast< MessagingSession * >(argp1);
+ result = (bool)(arg1)->accept();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MessagingSession_reject(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MessagingSession *arg1 = (MessagingSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MessagingSession_reject",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MessagingSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MessagingSession_reject" "', argument " "1"" of type '" "MessagingSession *""'");
+ }
+ arg1 = reinterpret_cast< MessagingSession * >(argp1);
+ result = (bool)(arg1)->reject();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MessagingSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MessagingSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_OptionsSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ OptionsSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_OptionsSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_OptionsSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (OptionsSession *)new OptionsSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_OptionsSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_OptionsSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ OptionsSession *arg1 = (OptionsSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_OptionsSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_OptionsSession" "', argument " "1"" of type '" "OptionsSession *""'");
+ }
+ arg1 = reinterpret_cast< OptionsSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_OptionsSession_send(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ OptionsSession *arg1 = (OptionsSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:OptionsSession_send",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_OptionsSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "OptionsSession_send" "', argument " "1"" of type '" "OptionsSession *""'");
+ }
+ arg1 = reinterpret_cast< OptionsSession * >(argp1);
+ result = (bool)(arg1)->send();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *OptionsSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_OptionsSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_PublicationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ PublicationSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_PublicationSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_PublicationSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (PublicationSession *)new PublicationSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_PublicationSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_PublicationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PublicationSession *arg1 = (PublicationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_PublicationSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_PublicationSession" "', argument " "1"" of type '" "PublicationSession *""'");
+ }
+ arg1 = reinterpret_cast< PublicationSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_PublicationSession_publish(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PublicationSession *arg1 = (PublicationSession *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:PublicationSession_publish",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationSession_publish" "', argument " "1"" of type '" "PublicationSession *""'");
+ }
+ arg1 = reinterpret_cast< PublicationSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "PublicationSession_publish" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "PublicationSession_publish" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (bool)(arg1)->publish((void const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_PublicationSession_unPublish(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PublicationSession *arg1 = (PublicationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:PublicationSession_unPublish",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_PublicationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "PublicationSession_unPublish" "', argument " "1"" of type '" "PublicationSession *""'");
+ }
+ arg1 = reinterpret_cast< PublicationSession * >(argp1);
+ result = (bool)(arg1)->unPublish();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *PublicationSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_PublicationSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_RegistrationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ RegistrationSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_RegistrationSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_RegistrationSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (RegistrationSession *)new RegistrationSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RegistrationSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_RegistrationSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_RegistrationSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_RegistrationSession" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_register_(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_register_",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_register_" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ result = (bool)(arg1)->register_();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_unRegister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_unRegister",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_unRegister" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ result = (bool)(arg1)->unRegister();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_accept__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:RegistrationSession_accept",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_accept" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RegistrationSession_accept" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->accept(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_accept__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_accept",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_accept" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ result = (bool)(arg1)->accept();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_accept(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_RegistrationSession_accept__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_RegistrationSession_accept__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'RegistrationSession_accept'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " accept(RegistrationSession *,ActionConfig *)\n"
+ " accept(RegistrationSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_reject__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ ActionConfig *arg2 = (ActionConfig *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:RegistrationSession_reject",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_reject" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ActionConfig, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RegistrationSession_reject" "', argument " "2"" of type '" "ActionConfig *""'");
+ }
+ arg2 = reinterpret_cast< ActionConfig * >(argp2);
+ result = (bool)(arg1)->reject(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_reject__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RegistrationSession *arg1 = (RegistrationSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RegistrationSession_reject",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RegistrationSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RegistrationSession_reject" "', argument " "1"" of type '" "RegistrationSession *""'");
+ }
+ arg1 = reinterpret_cast< RegistrationSession * >(argp1);
+ result = (bool)(arg1)->reject();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RegistrationSession_reject(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[3];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 2); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 1) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_RegistrationSession_reject__SWIG_1(self, args);
+ }
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_RegistrationSession, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[1], &vptr, SWIGTYPE_p_ActionConfig, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_RegistrationSession_reject__SWIG_0(self, args);
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'RegistrationSession_reject'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " reject(RegistrationSession *,ActionConfig *)\n"
+ " reject(RegistrationSession *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *RegistrationSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_RegistrationSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SubscriptionSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ SubscriptionSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_SubscriptionSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SubscriptionSession" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (SubscriptionSession *)new SubscriptionSession(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SubscriptionSession, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SubscriptionSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SubscriptionSession *arg1 = (SubscriptionSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SubscriptionSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionSession, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SubscriptionSession" "', argument " "1"" of type '" "SubscriptionSession *""'");
+ }
+ arg1 = reinterpret_cast< SubscriptionSession * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SubscriptionSession_subscribe(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SubscriptionSession *arg1 = (SubscriptionSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionSession_subscribe",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionSession_subscribe" "', argument " "1"" of type '" "SubscriptionSession *""'");
+ }
+ arg1 = reinterpret_cast< SubscriptionSession * >(argp1);
+ result = (bool)(arg1)->subscribe();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SubscriptionSession_unSubscribe(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SubscriptionSession *arg1 = (SubscriptionSession *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SubscriptionSession_unSubscribe",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SubscriptionSession, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SubscriptionSession_unSubscribe" "', argument " "1"" of type '" "SubscriptionSession *""'");
+ }
+ arg1 = reinterpret_cast< SubscriptionSession * >(argp1);
+ result = (bool)(arg1)->unSubscribe();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SubscriptionSession_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SubscriptionSession, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyPluginMgr(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyPluginMgr",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyPluginMgr" "', argument " "1"" of type '" "ProxyPluginMgr *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgr_createInstance(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ ProxyPluginMgr *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyPluginMgr_createInstance",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_createInstance" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1);
+ result = (ProxyPluginMgr *)ProxyPluginMgr::createInstance(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPluginMgr, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgr_getInstance(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgr *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":ProxyPluginMgr_getInstance")) SWIG_fail;
+ result = (ProxyPluginMgr *)ProxyPluginMgr::getInstance();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPluginMgr, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findAudioConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ;
+ uint64_t arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ ProxyAudioConsumer *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findAudioConsumer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findAudioConsumer" "', argument " "1"" of type '" "ProxyPluginMgr *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findAudioConsumer" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = static_cast< uint64_t >(val2);
+ result = (ProxyAudioConsumer *)(arg1)->findAudioConsumer(arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findVideoConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ;
+ uint64_t arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ ProxyVideoConsumer *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findVideoConsumer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findVideoConsumer" "', argument " "1"" of type '" "ProxyPluginMgr *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findVideoConsumer" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = static_cast< uint64_t >(val2);
+ result = (ProxyVideoConsumer *)(arg1)->findVideoConsumer(arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findAudioProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ;
+ uint64_t arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ ProxyAudioProducer *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findAudioProducer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findAudioProducer" "', argument " "1"" of type '" "ProxyPluginMgr *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findAudioProducer" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = static_cast< uint64_t >(val2);
+ result = (ProxyAudioProducer *)(arg1)->findAudioProducer(arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioProducer, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgr_findVideoProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgr *arg1 = (ProxyPluginMgr *) 0 ;
+ uint64_t arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ ProxyVideoProducer *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyPluginMgr_findVideoProducer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgr, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgr_findVideoProducer" "', argument " "1"" of type '" "ProxyPluginMgr *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgr * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgr_findVideoProducer" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = static_cast< uint64_t >(val2);
+ result = (ProxyVideoProducer *)(arg1)->findVideoProducer(arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyPluginMgr_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyPluginMgr, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_ProxyPluginMgrCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ ProxyPluginMgrCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyPluginMgrCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (ProxyPluginMgrCallback *)new SwigDirector_ProxyPluginMgrCallback(arg1);
+ } else {
+ result = (ProxyPluginMgrCallback *)new ProxyPluginMgrCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyPluginMgrCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_ProxyPluginMgrCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyPluginMgrCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyPluginMgrCallback" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgrCallback_OnPluginCreated(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ;
+ uint64_t arg2 ;
+ enum twrap_proxy_plugin_type_e arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyPluginMgrCallback_OnPluginCreated",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgrCallback_OnPluginCreated" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgrCallback_OnPluginCreated" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = static_cast< uint64_t >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyPluginMgrCallback_OnPluginCreated" "', argument " "3"" of type '" "enum twrap_proxy_plugin_type_e""'");
+ }
+ arg3 = static_cast< enum twrap_proxy_plugin_type_e >(val3);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyPluginMgrCallback::OnPluginCreated(arg2,arg3);
+ } else {
+ result = (int)(arg1)->OnPluginCreated(arg2,arg3);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPluginMgrCallback_OnPluginDestroyed(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ;
+ uint64_t arg2 ;
+ enum twrap_proxy_plugin_type_e arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned long long val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyPluginMgrCallback_OnPluginDestroyed",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPluginMgrCallback_OnPluginDestroyed" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_long_SS_long(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyPluginMgrCallback_OnPluginDestroyed" "', argument " "2"" of type '" "uint64_t""'");
+ }
+ arg2 = static_cast< uint64_t >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyPluginMgrCallback_OnPluginDestroyed" "', argument " "3"" of type '" "enum twrap_proxy_plugin_type_e""'");
+ }
+ arg3 = static_cast< enum twrap_proxy_plugin_type_e >(val3);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyPluginMgrCallback::OnPluginDestroyed(arg2,arg3);
+ } else {
+ result = (int)(arg1)->OnPluginDestroyed(arg2,arg3);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_ProxyPluginMgrCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPluginMgrCallback *arg1 = (ProxyPluginMgrCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyPluginMgrCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPluginMgrCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyPluginMgrCallback" "', argument " "1"" of type '" "ProxyPluginMgrCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPluginMgrCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyPluginMgrCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyPluginMgrCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPlugin *arg1 = (ProxyPlugin *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyPlugin",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPlugin, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyPlugin" "', argument " "1"" of type '" "ProxyPlugin *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPlugin * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPlugin_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPlugin *arg1 = (ProxyPlugin *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ twrap_proxy_plugin_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyPlugin_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPlugin, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPlugin_getType" "', argument " "1"" of type '" "ProxyPlugin const *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPlugin * >(argp1);
+ result = (twrap_proxy_plugin_type_t)((ProxyPlugin const *)arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyPlugin_getId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyPlugin *arg1 = (ProxyPlugin *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyPlugin_getId",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyPlugin, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyPlugin_getId" "', argument " "1"" of type '" "ProxyPlugin const *""'");
+ }
+ arg1 = reinterpret_cast< ProxyPlugin * >(argp1);
+ result = (uint64_t)((ProxyPlugin const *)arg1)->getId();
+ resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyPlugin_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyPlugin, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_ProxyAudioConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ ProxyAudioConsumerCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyAudioConsumerCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (ProxyAudioConsumerCallback *)new SwigDirector_ProxyAudioConsumerCallback(arg1);
+ } else {
+ result = (ProxyAudioConsumerCallback *)new ProxyAudioConsumerCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioConsumerCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_ProxyAudioConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioConsumerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioConsumerCallback" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ;
+ int arg2 ;
+ int arg3 ;
+ int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioConsumerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = static_cast< int >(val3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioConsumerCallback_prepare" "', argument " "4"" of type '" "int""'");
+ }
+ arg4 = static_cast< int >(val4);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioConsumerCallback::prepare(arg2,arg3,arg4);
+ } else {
+ result = (int)(arg1)->prepare(arg2,arg3,arg4);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumerCallback_start",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_start" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioConsumerCallback::start();
+ } else {
+ result = (int)(arg1)->start();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumerCallback_pause",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_pause" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioConsumerCallback::pause();
+ } else {
+ result = (int)(arg1)->pause();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumerCallback_stop",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumerCallback_stop" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioConsumerCallback::stop();
+ } else {
+ result = (int)(arg1)->stop();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_ProxyAudioConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumerCallback *arg1 = (ProxyAudioConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyAudioConsumerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyAudioConsumerCallback" "', argument " "1"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyAudioConsumerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioConsumerCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyAudioConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioConsumer",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioConsumer" "', argument " "1"" of type '" "ProxyAudioConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_pull(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyAudioConsumer_pull",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_pull" "', argument " "1"" of type '" "ProxyAudioConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioConsumer_pull" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioConsumer_pull" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->pull(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_reset(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumer_reset",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_reset" "', argument " "1"" of type '" "ProxyAudioConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1);
+ result = (bool)(arg1)->reset();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ;
+ ProxyAudioConsumerCallback *arg2 = (ProxyAudioConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioConsumer_setCallback",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_setCallback" "', argument " "1"" of type '" "ProxyAudioConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyAudioConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioConsumer_setCallback" "', argument " "2"" of type '" "ProxyAudioConsumerCallback *""'");
+ }
+ arg2 = reinterpret_cast< ProxyAudioConsumerCallback * >(argp2);
+ (arg1)->setCallback(arg2);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioConsumer *arg1 = (ProxyAudioConsumer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioConsumer_getMediaSessionId",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioConsumer_getMediaSessionId" "', argument " "1"" of type '" "ProxyAudioConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioConsumer * >(argp1);
+ result = (uint64_t)(arg1)->getMediaSessionId();
+ resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioConsumer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)":ProxyAudioConsumer_registerPlugin")) SWIG_fail;
+ result = (bool)ProxyAudioConsumer::registerPlugin();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyAudioConsumer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioConsumer, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_ProxyVideoConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ ProxyVideoConsumerCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyVideoConsumerCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (ProxyVideoConsumerCallback *)new SwigDirector_ProxyVideoConsumerCallback(arg1);
+ } else {
+ result = (ProxyVideoConsumerCallback *)new ProxyVideoConsumerCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoConsumerCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_ProxyVideoConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoConsumerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoConsumerCallback" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ int arg2 ;
+ int arg3 ;
+ int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyVideoConsumerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = static_cast< int >(val3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyVideoConsumerCallback_prepare" "', argument " "4"" of type '" "int""'");
+ }
+ arg4 = static_cast< int >(val4);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoConsumerCallback::prepare(arg2,arg3,arg4);
+ } else {
+ result = (int)(arg1)->prepare(arg2,arg3,arg4);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_consume(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ ProxyVideoFrame *arg2 = (ProxyVideoFrame *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoConsumerCallback_consume",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_consume" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoConsumerCallback_consume" "', argument " "2"" of type '" "ProxyVideoFrame const *""'");
+ }
+ arg2 = reinterpret_cast< ProxyVideoFrame * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoConsumerCallback::consume((ProxyVideoFrame const *)arg2);
+ } else {
+ result = (int)(arg1)->consume((ProxyVideoFrame const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumerCallback_start",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_start" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoConsumerCallback::start();
+ } else {
+ result = (int)(arg1)->start();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumerCallback_pause",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_pause" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoConsumerCallback::pause();
+ } else {
+ result = (int)(arg1)->pause();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumerCallback_stop",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumerCallback_stop" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoConsumerCallback::stop();
+ } else {
+ result = (int)(arg1)->stop();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_ProxyVideoConsumerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumerCallback *arg1 = (ProxyVideoConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyVideoConsumerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyVideoConsumerCallback" "', argument " "1"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyVideoConsumerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoConsumerCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyVideoConsumer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoConsumer",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoConsumer" "', argument " "1"" of type '" "ProxyVideoConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setDisplaySize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ;
+ int arg2 ;
+ int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoConsumer_setDisplaySize",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_setDisplaySize" "', argument " "1"" of type '" "ProxyVideoConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoConsumer_setDisplaySize" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoConsumer_setDisplaySize" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = static_cast< int >(val3);
+ result = (bool)(arg1)->setDisplaySize(arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ;
+ ProxyVideoConsumerCallback *arg2 = (ProxyVideoConsumerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoConsumer_setCallback",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_setCallback" "', argument " "1"" of type '" "ProxyVideoConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyVideoConsumerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoConsumer_setCallback" "', argument " "2"" of type '" "ProxyVideoConsumerCallback *""'");
+ }
+ arg2 = reinterpret_cast< ProxyVideoConsumerCallback * >(argp2);
+ (arg1)->setCallback(arg2);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoConsumer *arg1 = (ProxyVideoConsumer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_getMediaSessionId",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoConsumer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoConsumer_getMediaSessionId" "', argument " "1"" of type '" "ProxyVideoConsumer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoConsumer * >(argp1);
+ result = (uint64_t)(arg1)->getMediaSessionId();
+ resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)":ProxyVideoConsumer_registerPlugin")) SWIG_fail;
+ result = (bool)ProxyVideoConsumer::registerPlugin();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoConsumer_setDefaultChroma(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ tmedia_chroma_t arg1 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoConsumer_setDefaultChroma",&obj0)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "ProxyVideoConsumer_setDefaultChroma" "', argument " "1"" of type '" "tmedia_chroma_t""'");
+ }
+ arg1 = static_cast< tmedia_chroma_t >(val1);
+ ProxyVideoConsumer::setDefaultChroma(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyVideoConsumer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoConsumer, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyVideoFrame(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoFrame",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoFrame" "', argument " "1"" of type '" "ProxyVideoFrame *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoFrame_getSize(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoFrame_getSize",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoFrame_getSize" "', argument " "1"" of type '" "ProxyVideoFrame *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1);
+ result = (unsigned int)(arg1)->getSize();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoFrame_getContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoFrame *arg1 = (ProxyVideoFrame *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoFrame_getContent",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoFrame, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoFrame_getContent" "', argument " "1"" of type '" "ProxyVideoFrame *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoFrame * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoFrame_getContent" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoFrame_getContent" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getContent(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyVideoFrame_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoFrame, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_ProxyAudioProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ ProxyAudioProducerCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyAudioProducerCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (ProxyAudioProducerCallback *)new SwigDirector_ProxyAudioProducerCallback(arg1);
+ } else {
+ result = (ProxyAudioProducerCallback *)new ProxyAudioProducerCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyAudioProducerCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_ProxyAudioProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioProducerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioProducerCallback" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ;
+ int arg2 ;
+ int arg3 ;
+ int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyAudioProducerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = static_cast< int >(val3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyAudioProducerCallback_prepare" "', argument " "4"" of type '" "int""'");
+ }
+ arg4 = static_cast< int >(val4);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioProducerCallback::prepare(arg2,arg3,arg4);
+ } else {
+ result = (int)(arg1)->prepare(arg2,arg3,arg4);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_start",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_start" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioProducerCallback::start();
+ } else {
+ result = (int)(arg1)->start();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_pause",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_pause" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioProducerCallback::pause();
+ } else {
+ result = (int)(arg1)->pause();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducerCallback_stop",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducerCallback_stop" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyAudioProducerCallback::stop();
+ } else {
+ result = (int)(arg1)->stop();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_ProxyAudioProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducerCallback *arg1 = (ProxyAudioProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyAudioProducerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyAudioProducerCallback" "', argument " "1"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducerCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyAudioProducerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioProducerCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyAudioProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyAudioProducer",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyAudioProducer" "', argument " "1"" of type '" "ProxyAudioProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducer_push(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyAudioProducer_push",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_push" "', argument " "1"" of type '" "ProxyAudioProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_push" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyAudioProducer_push" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (int)(arg1)->push((void const *)arg2,arg3);
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ;
+ ProxyAudioProducerCallback *arg2 = (ProxyAudioProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyAudioProducer_setCallback",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_setCallback" "', argument " "1"" of type '" "ProxyAudioProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyAudioProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyAudioProducer_setCallback" "', argument " "2"" of type '" "ProxyAudioProducerCallback *""'");
+ }
+ arg2 = reinterpret_cast< ProxyAudioProducerCallback * >(argp2);
+ (arg1)->setCallback(arg2);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyAudioProducer *arg1 = (ProxyAudioProducer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyAudioProducer_getMediaSessionId",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyAudioProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyAudioProducer_getMediaSessionId" "', argument " "1"" of type '" "ProxyAudioProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyAudioProducer * >(argp1);
+ result = (uint64_t)(arg1)->getMediaSessionId();
+ resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyAudioProducer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)":ProxyAudioProducer_registerPlugin")) SWIG_fail;
+ result = (bool)ProxyAudioProducer::registerPlugin();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyAudioProducer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyAudioProducer, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_ProxyVideoProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ ProxyVideoProducerCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_ProxyVideoProducerCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (ProxyVideoProducerCallback *)new SwigDirector_ProxyVideoProducerCallback(arg1);
+ } else {
+ result = (ProxyVideoProducerCallback *)new ProxyVideoProducerCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_ProxyVideoProducerCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_ProxyVideoProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoProducerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoProducerCallback" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_prepare(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ;
+ int arg2 ;
+ int arg3 ;
+ int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:ProxyVideoProducerCallback_prepare",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = static_cast< int >(val3);
+ ecode4 = SWIG_AsVal_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyVideoProducerCallback_prepare" "', argument " "4"" of type '" "int""'");
+ }
+ arg4 = static_cast< int >(val4);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoProducerCallback::prepare(arg2,arg3,arg4);
+ } else {
+ result = (int)(arg1)->prepare(arg2,arg3,arg4);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducerCallback_start",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_start" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoProducerCallback::start();
+ } else {
+ result = (int)(arg1)->start();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_pause(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducerCallback_pause",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_pause" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoProducerCallback::pause();
+ } else {
+ result = (int)(arg1)->pause();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducerCallback_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducerCallback_stop",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducerCallback_stop" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->ProxyVideoProducerCallback::stop();
+ } else {
+ result = (int)(arg1)->stop();
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_ProxyVideoProducerCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducerCallback *arg1 = (ProxyVideoProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_ProxyVideoProducerCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_ProxyVideoProducerCallback" "', argument " "1"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducerCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyVideoProducerCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoProducerCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_ProxyVideoProducer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_ProxyVideoProducer",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_ProxyVideoProducer" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_getRotation(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_getRotation",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_getRotation" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ result = (int)(arg1)->getRotation();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setRotation(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ int arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoProducer_setRotation",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_setRotation" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ ecode2 = SWIG_AsVal_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "ProxyVideoProducer_setRotation" "', argument " "2"" of type '" "int""'");
+ }
+ arg2 = static_cast< int >(val2);
+ (arg1)->setRotation(arg2);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_push(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:ProxyVideoProducer_push",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_push" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoProducer_push" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoProducer_push" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (int)(arg1)->push((void const *)arg2,arg3);
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_send(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ unsigned int arg4 ;
+ bool arg5 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ bool val5 ;
+ int ecode5 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOO:ProxyVideoProducer_send",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_send" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoProducer_send" "', argument " "2"" of type '" "void const *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "ProxyVideoProducer_send" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "ProxyVideoProducer_send" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ ecode5 = SWIG_AsVal_bool(obj4, &val5);
+ if (!SWIG_IsOK(ecode5)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "ProxyVideoProducer_send" "', argument " "5"" of type '" "bool""'");
+ }
+ arg5 = static_cast< bool >(val5);
+ result = (int)(arg1)->send((void const *)arg2,arg3,arg4,arg5);
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ ProxyVideoProducerCallback *arg2 = (ProxyVideoProducerCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:ProxyVideoProducer_setCallback",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_setCallback" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_ProxyVideoProducerCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "ProxyVideoProducer_setCallback" "', argument " "2"" of type '" "ProxyVideoProducerCallback *""'");
+ }
+ arg2 = reinterpret_cast< ProxyVideoProducerCallback * >(argp2);
+ (arg1)->setCallback(arg2);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_getMediaSessionId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ ProxyVideoProducer *arg1 = (ProxyVideoProducer *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ uint64_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_getMediaSessionId",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_ProxyVideoProducer, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "ProxyVideoProducer_getMediaSessionId" "', argument " "1"" of type '" "ProxyVideoProducer *""'");
+ }
+ arg1 = reinterpret_cast< ProxyVideoProducer * >(argp1);
+ result = (uint64_t)(arg1)->getMediaSessionId();
+ resultobj = SWIG_From_unsigned_SS_long_SS_long(static_cast< unsigned long long >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_registerPlugin(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)":ProxyVideoProducer_registerPlugin")) SWIG_fail;
+ result = (bool)ProxyVideoProducer::registerPlugin();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_ProxyVideoProducer_setDefaultChroma(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ tmedia_chroma_t arg1 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:ProxyVideoProducer_setDefaultChroma",&obj0)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "ProxyVideoProducer_setDefaultChroma" "', argument " "1"" of type '" "tmedia_chroma_t""'");
+ }
+ arg1 = static_cast< tmedia_chroma_t >(val1);
+ ProxyVideoProducer::setDefaultChroma(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *ProxyVideoProducer_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_ProxyVideoProducer, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SipCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ SipCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_SipCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (SipCallback *)new SwigDirector_SipCallback(arg1);
+ } else {
+ result = (SipCallback *)new SipCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SipCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SipCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipCallback" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnDialogEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ DialogEvent *arg2 = (DialogEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnDialogEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnDialogEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_DialogEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnDialogEvent" "', argument " "2"" of type '" "DialogEvent const *""'");
+ }
+ arg2 = reinterpret_cast< DialogEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnDialogEvent((DialogEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnDialogEvent((DialogEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnStackEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ StackEvent *arg2 = (StackEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnStackEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnStackEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_StackEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnStackEvent" "', argument " "2"" of type '" "StackEvent const *""'");
+ }
+ arg2 = reinterpret_cast< StackEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnStackEvent((StackEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnStackEvent((StackEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnInviteEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ InviteEvent *arg2 = (InviteEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnInviteEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnInviteEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_InviteEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnInviteEvent" "', argument " "2"" of type '" "InviteEvent const *""'");
+ }
+ arg2 = reinterpret_cast< InviteEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnInviteEvent((InviteEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnInviteEvent((InviteEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnMessagingEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ MessagingEvent *arg2 = (MessagingEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnMessagingEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnMessagingEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MessagingEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnMessagingEvent" "', argument " "2"" of type '" "MessagingEvent const *""'");
+ }
+ arg2 = reinterpret_cast< MessagingEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnMessagingEvent((MessagingEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnMessagingEvent((MessagingEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnOptionsEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ OptionsEvent *arg2 = (OptionsEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnOptionsEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnOptionsEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_OptionsEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnOptionsEvent" "', argument " "2"" of type '" "OptionsEvent const *""'");
+ }
+ arg2 = reinterpret_cast< OptionsEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnOptionsEvent((OptionsEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnOptionsEvent((OptionsEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnPublicationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ PublicationEvent *arg2 = (PublicationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnPublicationEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnPublicationEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_PublicationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnPublicationEvent" "', argument " "2"" of type '" "PublicationEvent const *""'");
+ }
+ arg2 = reinterpret_cast< PublicationEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnPublicationEvent((PublicationEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnPublicationEvent((PublicationEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnRegistrationEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ RegistrationEvent *arg2 = (RegistrationEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnRegistrationEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnRegistrationEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_RegistrationEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnRegistrationEvent" "', argument " "2"" of type '" "RegistrationEvent const *""'");
+ }
+ arg2 = reinterpret_cast< RegistrationEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnRegistrationEvent((RegistrationEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnRegistrationEvent((RegistrationEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipCallback_OnSubscriptionEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ SubscriptionEvent *arg2 = (SubscriptionEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipCallback_OnSubscriptionEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipCallback_OnSubscriptionEvent" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_SubscriptionEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipCallback_OnSubscriptionEvent" "', argument " "2"" of type '" "SubscriptionEvent const *""'");
+ }
+ arg2 = reinterpret_cast< SubscriptionEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->SipCallback::OnSubscriptionEvent((SubscriptionEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnSubscriptionEvent((SubscriptionEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_SipCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_SipCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_SipCallback" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SipCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SipCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SafeObject(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SafeObject *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_SafeObject")) SWIG_fail;
+ result = (SafeObject *)new SafeObject();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SafeObject, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SafeObject(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SafeObject *arg1 = (SafeObject *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SafeObject",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SafeObject, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SafeObject" "', argument " "1"" of type '" "SafeObject *""'");
+ }
+ arg1 = reinterpret_cast< SafeObject * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SafeObject_Lock(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SafeObject *arg1 = (SafeObject *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SafeObject_Lock",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SafeObject, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SafeObject_Lock" "', argument " "1"" of type '" "SafeObject const *""'");
+ }
+ arg1 = reinterpret_cast< SafeObject * >(argp1);
+ result = (int)((SafeObject const *)arg1)->Lock();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SafeObject_UnLock(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SafeObject *arg1 = (SafeObject *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SafeObject_UnLock",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SafeObject, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SafeObject_UnLock" "', argument " "1"" of type '" "SafeObject const *""'");
+ }
+ arg1 = reinterpret_cast< SafeObject * >(argp1);
+ result = (int)((SafeObject const *)arg1)->UnLock();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SafeObject_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SafeObject, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SipStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipCallback *arg1 = (SipCallback *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ SipStack *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:new_SipStack",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_SipStack" "', argument " "1"" of type '" "SipCallback *""'");
+ }
+ arg1 = reinterpret_cast< SipCallback * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_SipStack" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_SipStack" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "new_SipStack" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (SipStack *)new SipStack(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SipStack, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SipStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SipStack",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SipStack" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_start",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_start" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (bool)(arg1)->start();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setDebugCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ DDebugCallback *arg2 = (DDebugCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setDebugCallback",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setDebugCallback" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_DDebugCallback, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setDebugCallback" "', argument " "2"" of type '" "DDebugCallback *""'");
+ }
+ arg2 = reinterpret_cast< DDebugCallback * >(argp2);
+ result = (bool)(arg1)->setDebugCallback(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setRealm(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setRealm",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setRealm" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setRealm" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setRealm((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setIMPI(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setIMPI",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIMPI" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setIMPI" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setIMPI((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setIMPU(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setIMPU",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIMPU" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setIMPU" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setIMPU((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setPassword(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setPassword",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setPassword" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setPassword" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setPassword((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setAMF(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setAMF",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setAMF" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setAMF" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setAMF((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setOperatorId(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setOperatorId",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setOperatorId" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setOperatorId" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setOperatorId((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setProxyCSCF(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned short arg3 ;
+ char *arg4 = (char *) 0 ;
+ char *arg5 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned short val3 ;
+ int ecode3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ int res5 ;
+ char *buf5 = 0 ;
+ int alloc5 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setProxyCSCF",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setProxyCSCF" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setProxyCSCF" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setProxyCSCF" "', argument " "3"" of type '" "unsigned short""'");
+ }
+ arg3 = static_cast< unsigned short >(val3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setProxyCSCF" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5);
+ if (!SWIG_IsOK(res5)) {
+ SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "SipStack_setProxyCSCF" "', argument " "5"" of type '" "char const *""'");
+ }
+ arg5 = reinterpret_cast< char * >(buf5);
+ result = (bool)(arg1)->setProxyCSCF((char const *)arg2,arg3,(char const *)arg4,(char const *)arg5);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setLocalIP(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setLocalIP",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setLocalIP" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setLocalIP" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setLocalIP((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setLocalPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ unsigned short arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned short val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setLocalPort",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setLocalPort" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_short(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setLocalPort" "', argument " "2"" of type '" "unsigned short""'");
+ }
+ arg2 = static_cast< unsigned short >(val2);
+ result = (bool)(arg1)->setLocalPort(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setEarlyIMS(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ bool arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ bool val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setEarlyIMS",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setEarlyIMS" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ ecode2 = SWIG_AsVal_bool(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setEarlyIMS" "', argument " "2"" of type '" "bool""'");
+ }
+ arg2 = static_cast< bool >(val2);
+ result = (bool)(arg1)->setEarlyIMS(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_addHeader",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_addHeader" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_addHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_addHeader" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_removeHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_removeHeader",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_removeHeader" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_removeHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->removeHeader((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_addDnsServer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_addDnsServer",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_addDnsServer" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_addDnsServer" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->addDnsServer((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setDnsDiscovery(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ bool arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ bool val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setDnsDiscovery",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setDnsDiscovery" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ ecode2 = SWIG_AsVal_bool(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setDnsDiscovery" "', argument " "2"" of type '" "bool""'");
+ }
+ arg2 = static_cast< bool >(val2);
+ result = (bool)(arg1)->setDnsDiscovery(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setAoR(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setAoR",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setAoR" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setAoR" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setAoR" "', argument " "3"" of type '" "int""'");
+ }
+ arg3 = static_cast< int >(val3);
+ result = (bool)(arg1)->setAoR((char const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setSigCompParams(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ unsigned int arg2 ;
+ unsigned int arg3 ;
+ unsigned int arg4 ;
+ bool arg5 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ bool val5 ;
+ int ecode5 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setSigCompParams",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSigCompParams" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setSigCompParams" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setSigCompParams" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SipStack_setSigCompParams" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ ecode5 = SWIG_AsVal_bool(obj4, &val5);
+ if (!SWIG_IsOK(ecode5)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode5), "in method '" "SipStack_setSigCompParams" "', argument " "5"" of type '" "bool""'");
+ }
+ arg5 = static_cast< bool >(val5);
+ result = (bool)(arg1)->setSigCompParams(arg2,arg3,arg4,arg5);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_addSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_addSigCompCompartment",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_addSigCompCompartment" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_addSigCompCompartment" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->addSigCompCompartment((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_removeSigCompCompartment(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_removeSigCompCompartment",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_removeSigCompCompartment" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_removeSigCompCompartment" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->removeSigCompCompartment((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setSTUNServer(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned short arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned short val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setSTUNServer",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSTUNServer" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSTUNServer" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_unsigned_SS_short(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SipStack_setSTUNServer" "', argument " "3"" of type '" "unsigned short""'");
+ }
+ arg3 = static_cast< unsigned short >(val3);
+ result = (bool)(arg1)->setSTUNServer((char const *)arg2,arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setSTUNCred(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_setSTUNCred",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSTUNCred" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSTUNCred" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSTUNCred" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->setSTUNCred((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setTLSSecAgree(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ bool arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ bool val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setTLSSecAgree",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setTLSSecAgree" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ ecode2 = SWIG_AsVal_bool(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setTLSSecAgree" "', argument " "2"" of type '" "bool""'");
+ }
+ arg2 = static_cast< bool >(val2);
+ result = (bool)(arg1)->setTLSSecAgree(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setSSLCretificates(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SipStack_setSSLCretificates",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setSSLCretificates" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setSSLCretificates" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setSSLCretificates" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setSSLCretificates" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (bool)(arg1)->setSSLCretificates((char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setIPSecSecAgree(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ bool arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ bool val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_setIPSecSecAgree",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIPSecSecAgree" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ ecode2 = SWIG_AsVal_bool(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SipStack_setIPSecSecAgree" "', argument " "2"" of type '" "bool""'");
+ }
+ arg2 = static_cast< bool >(val2);
+ result = (bool)(arg1)->setIPSecSecAgree(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setIPSecParameters(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ char *arg5 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ int res5 ;
+ char *buf5 = 0 ;
+ int alloc5 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOO:SipStack_setIPSecParameters",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_setIPSecParameters" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_setIPSecParameters" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_setIPSecParameters" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_setIPSecParameters" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5);
+ if (!SWIG_IsOK(res5)) {
+ SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "SipStack_setIPSecParameters" "', argument " "5"" of type '" "char const *""'");
+ }
+ arg5 = reinterpret_cast< char * >(buf5);
+ result = (bool)(arg1)->setIPSecParameters((char const *)arg2,(char const *)arg3,(char const *)arg4,(char const *)arg5);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_dnsENUM(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SipStack_dnsENUM",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_dnsENUM" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_dnsENUM" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_dnsENUM" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SipStack_dnsENUM" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (char *)(arg1)->dnsENUM((char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_dnsNaptrSrv(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ unsigned short *arg4 = (unsigned short *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ unsigned short temp4 ;
+ int res4 = SWIG_TMPOBJ ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ arg4 = &temp4;
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SipStack_dnsNaptrSrv",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_dnsNaptrSrv" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_dnsNaptrSrv" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SipStack_dnsNaptrSrv" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (char *)(arg1)->dnsNaptrSrv((char const *)arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (SWIG_IsTmpObj(res4)) {
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_unsigned_SS_short((*arg4)));
+ } else {
+ int new_flags = SWIG_IsNewObj(res4) ? (SWIG_POINTER_OWN | 0 ) : 0 ;
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg4), SWIGTYPE_p_unsigned_short, new_flags));
+ }
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_dnsSrv(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned short *arg3 = (unsigned short *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned short temp3 ;
+ int res3 = SWIG_TMPOBJ ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ arg3 = &temp3;
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_dnsSrv",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_dnsSrv" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_dnsSrv" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->dnsSrv((char const *)arg2,arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (SWIG_IsTmpObj(res3)) {
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_unsigned_SS_short((*arg3)));
+ } else {
+ int new_flags = SWIG_IsNewObj(res3) ? (SWIG_POINTER_OWN | 0 ) : 0 ;
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg3), SWIGTYPE_p_unsigned_short, new_flags));
+ }
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_getLocalIPnPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned short *arg3 = (unsigned short *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned short temp3 ;
+ int res3 = SWIG_TMPOBJ ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ arg3 = &temp3;
+ if (!PyArg_ParseTuple(args,(char *)"OO:SipStack_getLocalIPnPort",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_getLocalIPnPort" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SipStack_getLocalIPnPort" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->getLocalIPnPort((char const *)arg2,arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (SWIG_IsTmpObj(res3)) {
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_unsigned_SS_short((*arg3)));
+ } else {
+ int new_flags = SWIG_IsNewObj(res3) ? (SWIG_POINTER_OWN | 0 ) : 0 ;
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg3), SWIGTYPE_p_unsigned_short, new_flags));
+ }
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_getPreferredIdentity(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_getPreferredIdentity",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_getPreferredIdentity" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (char *)(arg1)->getPreferredIdentity();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ delete[] result;
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_isValid(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_isValid",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_isValid" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (bool)(arg1)->isValid();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SipStack *arg1 = (SipStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_stop",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SipStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SipStack_stop" "', argument " "1"" of type '" "SipStack *""'");
+ }
+ arg1 = reinterpret_cast< SipStack * >(argp1);
+ result = (bool)(arg1)->stop();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setCodecs(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ tdav_codec_id_t arg1 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_setCodecs",&obj0)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_setCodecs" "', argument " "1"" of type '" "tdav_codec_id_t""'");
+ }
+ arg1 = static_cast< tdav_codec_id_t >(val1);
+ SipStack::setCodecs(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_setCodecs_2(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ int arg1 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_setCodecs_2",&obj0)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_setCodecs_2" "', argument " "1"" of type '" "int""'");
+ }
+ arg1 = static_cast< int >(val1);
+ SipStack::setCodecs_2(arg1);
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SipStack_isCodecSupported(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ tdav_codec_id_t arg1 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SipStack_isCodecSupported",&obj0)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SipStack_isCodecSupported" "', argument " "1"" of type '" "tdav_codec_id_t""'");
+ }
+ arg1 = static_cast< tdav_codec_id_t >(val1);
+ result = (bool)SipStack::isCodecSupported(arg1);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SipStack_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SipStack, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_XcapSelector(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_XcapSelector",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_XcapSelector" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ result = (XcapSelector *)new XcapSelector(arg1);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_XcapSelector(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapSelector",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapSelector" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_setAUID(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapSelector_setAUID",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setAUID" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setAUID" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (XcapSelector *)(arg1)->setAUID((char const *)arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_setName(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapSelector_setName",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setName" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setName" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (XcapSelector *)(arg1)->setName((char const *)arg2);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_setAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapSelector_setAttribute",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setAttribute" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setAttribute" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapSelector_setAttribute" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "XcapSelector_setAttribute" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (XcapSelector *)(arg1)->setAttribute((char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_setPos(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapSelector_setPos",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setPos" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setPos" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapSelector_setPos" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (XcapSelector *)(arg1)->setPos((char const *)arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_setPosAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned int arg3 ;
+ char *arg4 = (char *) 0 ;
+ char *arg5 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ int res5 ;
+ char *buf5 = 0 ;
+ int alloc5 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOO:XcapSelector_setPosAttribute",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setPosAttribute" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setPosAttribute" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapSelector_setPosAttribute" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "XcapSelector_setPosAttribute" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5);
+ if (!SWIG_IsOK(res5)) {
+ SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "XcapSelector_setPosAttribute" "', argument " "5"" of type '" "char const *""'");
+ }
+ arg5 = reinterpret_cast< char * >(buf5);
+ result = (XcapSelector *)(arg1)->setPosAttribute((char const *)arg2,arg3,(char const *)arg4,(char const *)arg5);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_setNamespace(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ XcapSelector *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapSelector_setNamespace",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_setNamespace" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapSelector_setNamespace" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapSelector_setNamespace" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (XcapSelector *)(arg1)->setNamespace((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_getString(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapSelector_getString",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_getString" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ result = (char *)(arg1)->getString();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ delete[] result;
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapSelector_reset(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapSelector *arg1 = (XcapSelector *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapSelector_reset",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapSelector, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapSelector_reset" "', argument " "1"" of type '" "XcapSelector *""'");
+ }
+ arg1 = reinterpret_cast< XcapSelector * >(argp1);
+ (arg1)->reset();
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *XcapSelector_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_XcapSelector, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_XcapMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_XcapMessage")) SWIG_fail;
+ result = (XcapMessage *)new XcapMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapMessage, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_XcapMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapMessage" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ short result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapMessage_getCode",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getCode" "', argument " "1"" of type '" "XcapMessage const *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ result = (short)((XcapMessage const *)arg1)->getCode();
+ resultobj = SWIG_From_short(static_cast< short >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getPhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapMessage_getPhrase",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getPhrase" "', argument " "1"" of type '" "XcapMessage const *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ result = (char *)((XcapMessage const *)arg1)->getPhrase();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapMessage_getXcapHeaderValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (char *)(arg1)->getXcapHeaderValue((char const *)arg2,arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapMessage_getXcapHeaderValue",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->getXcapHeaderValue((char const *)arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderValue(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[4];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 3); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 2) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_XcapMessage_getXcapHeaderValue__SWIG_1(self, args);
+ }
+ }
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[2], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_XcapMessage_getXcapHeaderValue__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'XcapMessage_getXcapHeaderValue'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " getXcapHeaderValue(XcapMessage *,char const *,unsigned int)\n"
+ " getXcapHeaderValue(XcapMessage *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderParamValue__SWIG_0(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ unsigned int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapMessage_getXcapHeaderParamValue",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ result = (char *)(arg1)->getXcapHeaderParamValue((char const *)arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderParamValue__SWIG_1(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapMessage_getXcapHeaderParamValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapMessage_getXcapHeaderParamValue" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (char *)(arg1)->getXcapHeaderParamValue((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapHeaderParamValue(PyObject *self, PyObject *args) {
+ int argc;
+ PyObject *argv[5];
+ int ii;
+
+ if (!PyTuple_Check(args)) SWIG_fail;
+ argc = (int)PyObject_Length(args);
+ for (ii = 0; (ii < argc) && (ii < 4); ii++) {
+ argv[ii] = PyTuple_GET_ITEM(args,ii);
+ }
+ if (argc == 3) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ return _wrap_XcapMessage_getXcapHeaderParamValue__SWIG_1(self, args);
+ }
+ }
+ }
+ }
+ if (argc == 4) {
+ int _v;
+ void *vptr = 0;
+ int res = SWIG_ConvertPtr(argv[0], &vptr, SWIGTYPE_p_XcapMessage, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[1], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ int res = SWIG_AsCharPtrAndSize(argv[2], 0, NULL, 0);
+ _v = SWIG_CheckState(res);
+ if (_v) {
+ {
+ int res = SWIG_AsVal_unsigned_SS_int(argv[3], NULL);
+ _v = SWIG_CheckState(res);
+ }
+ if (_v) {
+ return _wrap_XcapMessage_getXcapHeaderParamValue__SWIG_0(self, args);
+ }
+ }
+ }
+ }
+ }
+
+fail:
+ SWIG_SetErrorMsg(PyExc_NotImplementedError,"Wrong number of arguments for overloaded function 'XcapMessage_getXcapHeaderParamValue'.\n"
+ " Possible C/C++ prototypes are:\n"
+ " getXcapHeaderParamValue(XcapMessage *,char const *,char const *,unsigned int)\n"
+ " getXcapHeaderParamValue(XcapMessage *,char const *,char const *)\n");
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapContentLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapMessage_getXcapContentLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapContentLength" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ result = (unsigned int)(arg1)->getXcapContentLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapMessage_getXcapContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapMessage *arg1 = (XcapMessage *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapMessage_getXcapContent",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapMessage_getXcapContent" "', argument " "1"" of type '" "XcapMessage *""'");
+ }
+ arg1 = reinterpret_cast< XcapMessage * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapMessage_getXcapContent" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "XcapMessage_getXcapContent" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getXcapContent(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *XcapMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_XcapMessage, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_XcapEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapEvent *arg1 = (XcapEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapEvent" "', argument " "1"" of type '" "XcapEvent *""'");
+ }
+ arg1 = reinterpret_cast< XcapEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapEvent *arg1 = (XcapEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ thttp_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapEvent_getType" "', argument " "1"" of type '" "XcapEvent *""'");
+ }
+ arg1 = reinterpret_cast< XcapEvent * >(argp1);
+ result = (thttp_event_type_t)(arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapEvent_getXcapMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapEvent *arg1 = (XcapEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ XcapMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapEvent_getXcapMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapEvent_getXcapMessage" "', argument " "1"" of type '" "XcapEvent const *""'");
+ }
+ arg1 = reinterpret_cast< XcapEvent * >(argp1);
+ result = (XcapMessage *)((XcapEvent const *)arg1)->getXcapMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapMessage, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *XcapEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_XcapEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_XcapCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ XcapCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_XcapCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (XcapCallback *)new SwigDirector_XcapCallback(arg1);
+ } else {
+ result = (XcapCallback *)new XcapCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_XcapCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapCallback *arg1 = (XcapCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapCallback" "', argument " "1"" of type '" "XcapCallback *""'");
+ }
+ arg1 = reinterpret_cast< XcapCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapCallback_onEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapCallback *arg1 = (XcapCallback *) 0 ;
+ XcapEvent *arg2 = (XcapEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapCallback_onEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapCallback_onEvent" "', argument " "1"" of type '" "XcapCallback const *""'");
+ }
+ arg1 = reinterpret_cast< XcapCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_XcapEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapCallback_onEvent" "', argument " "2"" of type '" "XcapEvent const *""'");
+ }
+ arg2 = reinterpret_cast< XcapEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)((XcapCallback const *)arg1)->XcapCallback::onEvent((XcapEvent const *)arg2);
+ } else {
+ result = (int)((XcapCallback const *)arg1)->onEvent((XcapEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_XcapCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapCallback *arg1 = (XcapCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_XcapCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_XcapCallback" "', argument " "1"" of type '" "XcapCallback *""'");
+ }
+ arg1 = reinterpret_cast< XcapCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *XcapCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_XcapCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_XcapStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapCallback *arg1 = (XcapCallback *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ XcapStack *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:new_XcapStack",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "new_XcapStack" "', argument " "1"" of type '" "XcapCallback *""'");
+ }
+ arg1 = reinterpret_cast< XcapCallback * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "new_XcapStack" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "new_XcapStack" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "new_XcapStack" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (XcapStack *)new XcapStack(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_XcapStack, SWIG_POINTER_NEW | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_XcapStack(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_XcapStack",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_XcapStack" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_registerAUID(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ char *arg5 = (char *) 0 ;
+ bool arg6 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ int res5 ;
+ char *buf5 = 0 ;
+ int alloc5 = 0 ;
+ bool val6 ;
+ int ecode6 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ PyObject * obj5 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOOO:XcapStack_registerAUID",&obj0,&obj1,&obj2,&obj3,&obj4,&obj5)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_registerAUID" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_registerAUID" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_registerAUID" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "XcapStack_registerAUID" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5);
+ if (!SWIG_IsOK(res5)) {
+ SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "XcapStack_registerAUID" "', argument " "5"" of type '" "char const *""'");
+ }
+ arg5 = reinterpret_cast< char * >(buf5);
+ ecode6 = SWIG_AsVal_bool(obj5, &val6);
+ if (!SWIG_IsOK(ecode6)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode6), "in method '" "XcapStack_registerAUID" "', argument " "6"" of type '" "bool""'");
+ }
+ arg6 = static_cast< bool >(val6);
+ result = (bool)(arg1)->registerAUID((char const *)arg2,(char const *)arg3,(char const *)arg4,(char const *)arg5,arg6);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_start(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapStack_start",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_start" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ result = (bool)(arg1)->start();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_setCredentials(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapStack_setCredentials",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setCredentials" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_setCredentials" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_setCredentials" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->setCredentials((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_setXcapRoot(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setXcapRoot",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setXcapRoot" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_setXcapRoot" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setXcapRoot((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_setLocalIP(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setLocalIP",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setLocalIP" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_setLocalIP" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->setLocalIP((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_setLocalPort(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ unsigned int arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setLocalPort",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setLocalPort" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "XcapStack_setLocalPort" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ result = (bool)(arg1)->setLocalPort(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_addHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:XcapStack_addHeader",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_addHeader" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_addHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_addHeader" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (bool)(arg1)->addHeader((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_removeHeader(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_removeHeader",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_removeHeader" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_removeHeader" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->removeHeader((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_setTimeout(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ unsigned int arg2 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_setTimeout",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_setTimeout" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "XcapStack_setTimeout" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ result = (bool)(arg1)->setTimeout(arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_getDocument(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_getDocument",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_getDocument" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_getDocument" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->getDocument((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_getElement(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_getElement",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_getElement" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_getElement" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->getElement((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_getAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_getAttribute",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_getAttribute" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_getAttribute" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->getAttribute((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_deleteDocument(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_deleteDocument",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_deleteDocument" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_deleteDocument" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->deleteDocument((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_deleteElement(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_deleteElement",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_deleteElement" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_deleteElement" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->deleteElement((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_deleteAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:XcapStack_deleteAttribute",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_deleteAttribute" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_deleteAttribute" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (bool)(arg1)->deleteAttribute((char const *)arg2);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_putDocument(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *arg3 = (void *) 0 ;
+ unsigned int arg4 ;
+ char *arg5 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ int res5 ;
+ char *buf5 = 0 ;
+ int alloc5 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ PyObject * obj4 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOOO:XcapStack_putDocument",&obj0,&obj1,&obj2,&obj3,&obj4)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_putDocument" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_putDocument" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_putDocument" "', argument " "3"" of type '" "void const *""'");
+ }
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapStack_putDocument" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ res5 = SWIG_AsCharPtrAndSize(obj4, &buf5, NULL, &alloc5);
+ if (!SWIG_IsOK(res5)) {
+ SWIG_exception_fail(SWIG_ArgError(res5), "in method '" "XcapStack_putDocument" "', argument " "5"" of type '" "char const *""'");
+ }
+ arg5 = reinterpret_cast< char * >(buf5);
+ result = (bool)(arg1)->putDocument((char const *)arg2,(void const *)arg3,arg4,(char const *)arg5);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc5 == SWIG_NEWOBJ) delete[] buf5;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_putElement(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *arg3 = (void *) 0 ;
+ unsigned int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapStack_putElement",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_putElement" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_putElement" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_putElement" "', argument " "3"" of type '" "void const *""'");
+ }
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapStack_putElement" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ result = (bool)(arg1)->putElement((char const *)arg2,(void const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_putAttribute(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *arg3 = (void *) 0 ;
+ unsigned int arg4 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ unsigned int val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:XcapStack_putAttribute",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_putAttribute" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "XcapStack_putAttribute" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_ConvertPtr(obj2,SWIG_as_voidptrptr(&arg3), 0, 0);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "XcapStack_putAttribute" "', argument " "3"" of type '" "void const *""'");
+ }
+ ecode4 = SWIG_AsVal_unsigned_SS_int(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "XcapStack_putAttribute" "', argument " "4"" of type '" "unsigned int""'");
+ }
+ arg4 = static_cast< unsigned int >(val4);
+ result = (bool)(arg1)->putAttribute((char const *)arg2,(void const *)arg3,arg4);
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_XcapStack_stop(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ XcapStack *arg1 = (XcapStack *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:XcapStack_stop",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_XcapStack, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "XcapStack_stop" "', argument " "1"" of type '" "XcapStack *""'");
+ }
+ arg1 = reinterpret_cast< XcapStack * >(argp1);
+ result = (bool)(arg1)->stop();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *XcapStack_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_XcapStack, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_RPMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RPMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_RPMessage")) SWIG_fail;
+ result = (RPMessage *)new RPMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_RPMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RPMessage *arg1 = (RPMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_RPMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_RPMessage" "', argument " "1"" of type '" "RPMessage *""'");
+ }
+ arg1 = reinterpret_cast< RPMessage * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RPMessage_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RPMessage *arg1 = (RPMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ twrap_rpmessage_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RPMessage_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RPMessage_getType" "', argument " "1"" of type '" "RPMessage *""'");
+ }
+ arg1 = reinterpret_cast< RPMessage * >(argp1);
+ result = (twrap_rpmessage_type_t)(arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RPMessage_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RPMessage *arg1 = (RPMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:RPMessage_getPayloadLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RPMessage_getPayloadLength" "', argument " "1"" of type '" "RPMessage *""'");
+ }
+ arg1 = reinterpret_cast< RPMessage * >(argp1);
+ result = (unsigned int)(arg1)->getPayloadLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_RPMessage_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ RPMessage *arg1 = (RPMessage *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:RPMessage_getPayload",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_RPMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "RPMessage_getPayload" "', argument " "1"" of type '" "RPMessage *""'");
+ }
+ arg1 = reinterpret_cast< RPMessage * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "RPMessage_getPayload" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "RPMessage_getPayload" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getPayload(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *RPMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_RPMessage, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_SMSData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_SMSData")) SWIG_fail;
+ result = (SMSData *)new SMSData();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SMSData, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SMSData(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SMSData",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SMSData" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSData_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ twrap_sms_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getType" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ result = (twrap_sms_type_t)(arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSData_getMR(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getMR",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getMR" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ result = (int)(arg1)->getMR();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSData_getPayloadLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getPayloadLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getPayloadLength" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ result = (unsigned int)(arg1)->getPayloadLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSData_getPayload(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SMSData_getPayload",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getPayload" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSData_getPayload" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SMSData_getPayload" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getPayload(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSData_getOA(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getOA",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getOA" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ result = (char *)(arg1)->getOA();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSData_getDA(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSData *arg1 = (SMSData *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:SMSData_getDA",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSData, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSData_getDA" "', argument " "1"" of type '" "SMSData *""'");
+ }
+ arg1 = reinterpret_cast< SMSData * >(argp1);
+ result = (char *)(arg1)->getDA();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SMSData_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SMSData, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_SMSEncoder_encodeSubmit(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ int arg1 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ RPMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeSubmit",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeSubmit" "', argument " "1"" of type '" "int""'");
+ }
+ arg1 = static_cast< int >(val1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeSubmit" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeSubmit" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SMSEncoder_encodeSubmit" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (RPMessage *)SMSEncoder::encodeSubmit(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSEncoder_encodeDeliver(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ int arg1 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ char *arg4 = (char *) 0 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ int res4 ;
+ char *buf4 = 0 ;
+ int alloc4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ RPMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeDeliver",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeDeliver" "', argument " "1"" of type '" "int""'");
+ }
+ arg1 = static_cast< int >(val1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeDeliver" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeDeliver" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ res4 = SWIG_AsCharPtrAndSize(obj3, &buf4, NULL, &alloc4);
+ if (!SWIG_IsOK(res4)) {
+ SWIG_exception_fail(SWIG_ArgError(res4), "in method '" "SMSEncoder_encodeDeliver" "', argument " "4"" of type '" "char const *""'");
+ }
+ arg4 = reinterpret_cast< char * >(buf4);
+ result = (RPMessage *)SMSEncoder::encodeDeliver(arg1,(char const *)arg2,(char const *)arg3,(char const *)arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ if (alloc4 == SWIG_NEWOBJ) delete[] buf4;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSEncoder_encodeACK(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ int arg1 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ bool arg4 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ bool val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ RPMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeACK",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeACK" "', argument " "1"" of type '" "int""'");
+ }
+ arg1 = static_cast< int >(val1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeACK" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeACK" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_bool(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SMSEncoder_encodeACK" "', argument " "4"" of type '" "bool""'");
+ }
+ arg4 = static_cast< bool >(val4);
+ result = (RPMessage *)SMSEncoder::encodeACK(arg1,(char const *)arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSEncoder_encodeError(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ int arg1 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ bool arg4 ;
+ int val1 ;
+ int ecode1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ bool val4 ;
+ int ecode4 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ PyObject * obj3 = 0 ;
+ RPMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOOO:SMSEncoder_encodeError",&obj0,&obj1,&obj2,&obj3)) SWIG_fail;
+ ecode1 = SWIG_AsVal_int(obj0, &val1);
+ if (!SWIG_IsOK(ecode1)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode1), "in method '" "SMSEncoder_encodeError" "', argument " "1"" of type '" "int""'");
+ }
+ arg1 = static_cast< int >(val1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "SMSEncoder_encodeError" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "SMSEncoder_encodeError" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ ecode4 = SWIG_AsVal_bool(obj3, &val4);
+ if (!SWIG_IsOK(ecode4)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode4), "in method '" "SMSEncoder_encodeError" "', argument " "4"" of type '" "bool""'");
+ }
+ arg4 = static_cast< bool >(val4);
+ result = (RPMessage *)SMSEncoder::encodeError(arg1,(char const *)arg2,(char const *)arg3,arg4);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_RPMessage, SWIG_POINTER_OWN | 0 );
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_SMSEncoder_decode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ void *arg1 = (void *) 0 ;
+ unsigned int arg2 ;
+ bool arg3 ;
+ int res1 ;
+ unsigned int val2 ;
+ int ecode2 = 0 ;
+ bool val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ SMSData *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:SMSEncoder_decode",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0,SWIG_as_voidptrptr(&arg1), 0, 0);
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "SMSEncoder_decode" "', argument " "1"" of type '" "void const *""'");
+ }
+ ecode2 = SWIG_AsVal_unsigned_SS_int(obj1, &val2);
+ if (!SWIG_IsOK(ecode2)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode2), "in method '" "SMSEncoder_decode" "', argument " "2"" of type '" "unsigned int""'");
+ }
+ arg2 = static_cast< unsigned int >(val2);
+ ecode3 = SWIG_AsVal_bool(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "SMSEncoder_decode" "', argument " "3"" of type '" "bool""'");
+ }
+ arg3 = static_cast< bool >(val3);
+ result = (SMSData *)SMSEncoder::decode((void const *)arg1,arg2,arg3);
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_SMSData, SWIG_POINTER_OWN | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_SMSEncoder(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ SMSEncoder *arg1 = (SMSEncoder *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_SMSEncoder",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_SMSEncoder, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_SMSEncoder" "', argument " "1"" of type '" "SMSEncoder *""'");
+ }
+ arg1 = reinterpret_cast< SMSEncoder * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *SMSEncoder_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_SMSEncoder, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_MsrpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)":new_MsrpMessage")) SWIG_fail;
+ result = (MsrpMessage *)new MsrpMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpMessage, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_MsrpMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpMessage" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_isRequest(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isRequest",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isRequest" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (bool)(arg1)->isRequest();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getCode(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ short result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getCode",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getCode" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (short)(arg1)->getCode();
+ resultobj = SWIG_From_short(static_cast< short >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getPhrase(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getPhrase",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getPhrase" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (char *)(arg1)->getPhrase();
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getRequestType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tmsrp_request_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getRequestType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getRequestType" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (tmsrp_request_type_t)(arg1)->getRequestType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getByteRange(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ int64_t *arg2 = (int64_t *) 0 ;
+ int64_t *arg3 = (int64_t *) 0 ;
+ int64_t *arg4 = (int64_t *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int64_t temp2 ;
+ int res2 = SWIG_TMPOBJ ;
+ int64_t temp3 ;
+ int res3 = SWIG_TMPOBJ ;
+ int64_t temp4 ;
+ int res4 = SWIG_TMPOBJ ;
+ PyObject * obj0 = 0 ;
+
+ arg2 = &temp2;
+ arg3 = &temp3;
+ arg4 = &temp4;
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getByteRange",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getByteRange" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ (arg1)->getByteRange(arg2,arg3,arg4);
+ resultobj = SWIG_Py_Void();
+ if (SWIG_IsTmpObj(res2)) {
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_long_SS_long((*arg2)));
+ } else {
+ int new_flags = SWIG_IsNewObj(res2) ? (SWIG_POINTER_OWN | 0 ) : 0 ;
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg2), SWIGTYPE_p_long_long, new_flags));
+ }
+ if (SWIG_IsTmpObj(res3)) {
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_long_SS_long((*arg3)));
+ } else {
+ int new_flags = SWIG_IsNewObj(res3) ? (SWIG_POINTER_OWN | 0 ) : 0 ;
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg3), SWIGTYPE_p_long_long, new_flags));
+ }
+ if (SWIG_IsTmpObj(res4)) {
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_From_long_SS_long((*arg4)));
+ } else {
+ int new_flags = SWIG_IsNewObj(res4) ? (SWIG_POINTER_OWN | 0 ) : 0 ;
+ resultobj = SWIG_Python_AppendOutput(resultobj, SWIG_NewPointerObj((void*)(arg4), SWIGTYPE_p_long_long, new_flags));
+ }
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_isLastChunck(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isLastChunck",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isLastChunck" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (bool)(arg1)->isLastChunck();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_isFirstChunck(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ bool result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_isFirstChunck",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_isFirstChunck" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (bool)(arg1)->isFirstChunck();
+ resultobj = SWIG_From_bool(static_cast< bool >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpHeaderValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MsrpMessage_getMsrpHeaderValue",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpHeaderValue" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpMessage_getMsrpHeaderValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ result = (char *)(arg1)->getMsrpHeaderValue((char const *)arg2);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpHeaderParamValue(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ char *arg2 = (char *) 0 ;
+ char *arg3 = (char *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ char *buf2 = 0 ;
+ int alloc2 = 0 ;
+ int res3 ;
+ char *buf3 = 0 ;
+ int alloc3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ char *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpMessage_getMsrpHeaderParamValue",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpHeaderParamValue" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ res2 = SWIG_AsCharPtrAndSize(obj1, &buf2, NULL, &alloc2);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpMessage_getMsrpHeaderParamValue" "', argument " "2"" of type '" "char const *""'");
+ }
+ arg2 = reinterpret_cast< char * >(buf2);
+ res3 = SWIG_AsCharPtrAndSize(obj2, &buf3, NULL, &alloc3);
+ if (!SWIG_IsOK(res3)) {
+ SWIG_exception_fail(SWIG_ArgError(res3), "in method '" "MsrpMessage_getMsrpHeaderParamValue" "', argument " "3"" of type '" "char const *""'");
+ }
+ arg3 = reinterpret_cast< char * >(buf3);
+ result = (char *)(arg1)->getMsrpHeaderParamValue((char const *)arg2,(char const *)arg3);
+ resultobj = SWIG_FromCharPtr((const char *)result);
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ delete[] result;
+ return resultobj;
+fail:
+ if (alloc2 == SWIG_NEWOBJ) delete[] buf2;
+ if (alloc3 == SWIG_NEWOBJ) delete[] buf3;
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpContentLength(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpMessage_getMsrpContentLength",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpContentLength" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ result = (unsigned int)(arg1)->getMsrpContentLength();
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpMessage_getMsrpContent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpMessage *arg1 = (MsrpMessage *) 0 ;
+ void *arg2 = (void *) 0 ;
+ unsigned int arg3 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ int res2 ;
+ unsigned int val3 ;
+ int ecode3 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ PyObject * obj2 = 0 ;
+ unsigned int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OOO:MsrpMessage_getMsrpContent",&obj0,&obj1,&obj2)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpMessage_getMsrpContent" "', argument " "1"" of type '" "MsrpMessage *""'");
+ }
+ arg1 = reinterpret_cast< MsrpMessage * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1,SWIG_as_voidptrptr(&arg2), 0, 0);
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpMessage_getMsrpContent" "', argument " "2"" of type '" "void *""'");
+ }
+ ecode3 = SWIG_AsVal_unsigned_SS_int(obj2, &val3);
+ if (!SWIG_IsOK(ecode3)) {
+ SWIG_exception_fail(SWIG_ArgError(ecode3), "in method '" "MsrpMessage_getMsrpContent" "', argument " "3"" of type '" "unsigned int""'");
+ }
+ arg3 = static_cast< unsigned int >(val3);
+ result = (unsigned int)(arg1)->getMsrpContent(arg2,arg3);
+ resultobj = SWIG_From_unsigned_SS_int(static_cast< unsigned int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MsrpMessage_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MsrpMessage, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_delete_MsrpEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpEvent *arg1 = (MsrpEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpEvent",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpEvent" "', argument " "1"" of type '" "MsrpEvent *""'");
+ }
+ arg1 = reinterpret_cast< MsrpEvent * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpEvent_getType(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpEvent *arg1 = (MsrpEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ tmsrp_event_type_t result;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpEvent_getType",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpEvent_getType" "', argument " "1"" of type '" "MsrpEvent *""'");
+ }
+ arg1 = reinterpret_cast< MsrpEvent * >(argp1);
+ result = (tmsrp_event_type_t)(arg1)->getType();
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpEvent_getSipSession(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpEvent *arg1 = (MsrpEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MsrpSession *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpEvent_getSipSession",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpEvent_getSipSession" "', argument " "1"" of type '" "MsrpEvent *""'");
+ }
+ arg1 = reinterpret_cast< MsrpEvent * >(argp1);
+ result = (MsrpSession *)(arg1)->getSipSession();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpSession, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpEvent_getMessage(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpEvent *arg1 = (MsrpEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+ MsrpMessage *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:MsrpEvent_getMessage",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpEvent, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpEvent_getMessage" "', argument " "1"" of type '" "MsrpEvent const *""'");
+ }
+ arg1 = reinterpret_cast< MsrpEvent * >(argp1);
+ result = (MsrpMessage *)((MsrpEvent const *)arg1)->getMessage();
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpMessage, 0 | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MsrpEvent_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MsrpEvent, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+SWIGINTERN PyObject *_wrap_new_MsrpCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ PyObject *arg1 = (PyObject *) 0 ;
+ PyObject * obj0 = 0 ;
+ MsrpCallback *result = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:new_MsrpCallback",&obj0)) SWIG_fail;
+ arg1 = obj0;
+ if ( arg1 != Py_None ) {
+ /* subclassed */
+ result = (MsrpCallback *)new SwigDirector_MsrpCallback(arg1);
+ } else {
+ result = (MsrpCallback *)new MsrpCallback();
+ }
+
+ resultobj = SWIG_NewPointerObj(SWIG_as_voidptr(result), SWIGTYPE_p_MsrpCallback, SWIG_POINTER_NEW | 0 );
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_delete_MsrpCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpCallback *arg1 = (MsrpCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:delete_MsrpCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpCallback, SWIG_POINTER_DISOWN | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "delete_MsrpCallback" "', argument " "1"" of type '" "MsrpCallback *""'");
+ }
+ arg1 = reinterpret_cast< MsrpCallback * >(argp1);
+ delete arg1;
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_MsrpCallback_OnEvent(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpCallback *arg1 = (MsrpCallback *) 0 ;
+ MsrpEvent *arg2 = (MsrpEvent *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ void *argp2 = 0 ;
+ int res2 = 0 ;
+ PyObject * obj0 = 0 ;
+ PyObject * obj1 = 0 ;
+ Swig::Director *director = 0;
+ bool upcall = false;
+ int result;
+
+ if (!PyArg_ParseTuple(args,(char *)"OO:MsrpCallback_OnEvent",&obj0,&obj1)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "MsrpCallback_OnEvent" "', argument " "1"" of type '" "MsrpCallback *""'");
+ }
+ arg1 = reinterpret_cast< MsrpCallback * >(argp1);
+ res2 = SWIG_ConvertPtr(obj1, &argp2,SWIGTYPE_p_MsrpEvent, 0 | 0 );
+ if (!SWIG_IsOK(res2)) {
+ SWIG_exception_fail(SWIG_ArgError(res2), "in method '" "MsrpCallback_OnEvent" "', argument " "2"" of type '" "MsrpEvent const *""'");
+ }
+ arg2 = reinterpret_cast< MsrpEvent * >(argp2);
+ director = SWIG_DIRECTOR_CAST(arg1);
+ upcall = (director && (director->swig_get_self()==obj0));
+ try {
+ if (upcall) {
+ result = (int)(arg1)->MsrpCallback::OnEvent((MsrpEvent const *)arg2);
+ } else {
+ result = (int)(arg1)->OnEvent((MsrpEvent const *)arg2);
+ }
+ } catch (Swig::DirectorException&) {
+ SWIG_fail;
+ }
+ resultobj = SWIG_From_int(static_cast< int >(result));
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *_wrap_disown_MsrpCallback(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *resultobj = 0;
+ MsrpCallback *arg1 = (MsrpCallback *) 0 ;
+ void *argp1 = 0 ;
+ int res1 = 0 ;
+ PyObject * obj0 = 0 ;
+
+ if (!PyArg_ParseTuple(args,(char *)"O:disown_MsrpCallback",&obj0)) SWIG_fail;
+ res1 = SWIG_ConvertPtr(obj0, &argp1,SWIGTYPE_p_MsrpCallback, 0 | 0 );
+ if (!SWIG_IsOK(res1)) {
+ SWIG_exception_fail(SWIG_ArgError(res1), "in method '" "disown_MsrpCallback" "', argument " "1"" of type '" "MsrpCallback *""'");
+ }
+ arg1 = reinterpret_cast< MsrpCallback * >(argp1);
+ {
+ Swig::Director *director = SWIG_DIRECTOR_CAST(arg1);
+ if (director) director->swig_disown();
+ }
+
+ resultobj = SWIG_Py_Void();
+ return resultobj;
+fail:
+ return NULL;
+}
+
+
+SWIGINTERN PyObject *MsrpCallback_swigregister(PyObject *SWIGUNUSEDPARM(self), PyObject *args) {
+ PyObject *obj;
+ if (!PyArg_ParseTuple(args,(char*)"O:swigregister", &obj)) return NULL;
+ SWIG_TypeNewClientData(SWIGTYPE_p_MsrpCallback, SWIG_NewClientData(obj));
+ return SWIG_Py_Void();
+}
+
+static PyMethodDef SwigMethods[] = {
+ { (char *)"SWIG_PyInstanceMethod_New", (PyCFunction)SWIG_PyInstanceMethod_New, METH_O, NULL},
+ { (char *)"new_DDebugCallback", _wrap_new_DDebugCallback, METH_VARARGS, NULL},
+ { (char *)"delete_DDebugCallback", _wrap_delete_DDebugCallback, METH_VARARGS, NULL},
+ { (char *)"DDebugCallback_OnDebugInfo", _wrap_DDebugCallback_OnDebugInfo, METH_VARARGS, NULL},
+ { (char *)"DDebugCallback_OnDebugWarn", _wrap_DDebugCallback_OnDebugWarn, METH_VARARGS, NULL},
+ { (char *)"DDebugCallback_OnDebugError", _wrap_DDebugCallback_OnDebugError, METH_VARARGS, NULL},
+ { (char *)"DDebugCallback_OnDebugFatal", _wrap_DDebugCallback_OnDebugFatal, METH_VARARGS, NULL},
+ { (char *)"disown_DDebugCallback", _wrap_disown_DDebugCallback, METH_VARARGS, NULL},
+ { (char *)"DDebugCallback_swigregister", DDebugCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_ActionConfig", _wrap_new_ActionConfig, METH_VARARGS, NULL},
+ { (char *)"delete_ActionConfig", _wrap_delete_ActionConfig, METH_VARARGS, NULL},
+ { (char *)"ActionConfig_addHeader", _wrap_ActionConfig_addHeader, METH_VARARGS, NULL},
+ { (char *)"ActionConfig_setResponseLine", _wrap_ActionConfig_setResponseLine, METH_VARARGS, NULL},
+ { (char *)"ActionConfig_setMediaString", _wrap_ActionConfig_setMediaString, METH_VARARGS, NULL},
+ { (char *)"ActionConfig_setMediaInt", _wrap_ActionConfig_setMediaInt, METH_VARARGS, NULL},
+ { (char *)"ActionConfig_swigregister", ActionConfig_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_MediaSessionMgr", _wrap_delete_MediaSessionMgr, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_sessionSetInt32", _wrap_MediaSessionMgr_sessionSetInt32, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_consumerSetInt32", _wrap_MediaSessionMgr_consumerSetInt32, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_consumerSetInt64", _wrap_MediaSessionMgr_consumerSetInt64, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_producerSetInt32", _wrap_MediaSessionMgr_producerSetInt32, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_producerSetInt64", _wrap_MediaSessionMgr_producerSetInt64, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_findProxyPluginConsumer", _wrap_MediaSessionMgr_findProxyPluginConsumer, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_findProxyPluginProducer", _wrap_MediaSessionMgr_findProxyPluginProducer, METH_VARARGS, NULL},
+ { (char *)"MediaSessionMgr_swigregister", MediaSessionMgr_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_MediaContent", _wrap_delete_MediaContent, METH_VARARGS, NULL},
+ { (char *)"MediaContent_getType", _wrap_MediaContent_getType, METH_VARARGS, NULL},
+ { (char *)"MediaContent_getDataLength", _wrap_MediaContent_getDataLength, METH_VARARGS, NULL},
+ { (char *)"MediaContent_getData", _wrap_MediaContent_getData, METH_VARARGS, NULL},
+ { (char *)"MediaContent_parse", _wrap_MediaContent_parse, METH_VARARGS, NULL},
+ { (char *)"MediaContent_getPayloadLength", _wrap_MediaContent_getPayloadLength, METH_VARARGS, NULL},
+ { (char *)"MediaContent_getPayload", _wrap_MediaContent_getPayload, METH_VARARGS, NULL},
+ { (char *)"MediaContent_swigregister", MediaContent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_MediaContentCPIM", _wrap_delete_MediaContentCPIM, METH_VARARGS, NULL},
+ { (char *)"MediaContentCPIM_getPayloadLength", _wrap_MediaContentCPIM_getPayloadLength, METH_VARARGS, NULL},
+ { (char *)"MediaContentCPIM_getPayload", _wrap_MediaContentCPIM_getPayload, METH_VARARGS, NULL},
+ { (char *)"MediaContentCPIM_getHeaderValue", _wrap_MediaContentCPIM_getHeaderValue, METH_VARARGS, NULL},
+ { (char *)"MediaContentCPIM_swigregister", MediaContentCPIM_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SipUri", _wrap_new_SipUri, METH_VARARGS, NULL},
+ { (char *)"delete_SipUri", _wrap_delete_SipUri, METH_VARARGS, NULL},
+ { (char *)"SipUri_isValid", _wrap_SipUri_isValid, METH_VARARGS, NULL},
+ { (char *)"SipUri_getScheme", _wrap_SipUri_getScheme, METH_VARARGS, NULL},
+ { (char *)"SipUri_getHost", _wrap_SipUri_getHost, METH_VARARGS, NULL},
+ { (char *)"SipUri_getPort", _wrap_SipUri_getPort, METH_VARARGS, NULL},
+ { (char *)"SipUri_getUserName", _wrap_SipUri_getUserName, METH_VARARGS, NULL},
+ { (char *)"SipUri_getPassword", _wrap_SipUri_getPassword, METH_VARARGS, NULL},
+ { (char *)"SipUri_getDisplayName", _wrap_SipUri_getDisplayName, METH_VARARGS, NULL},
+ { (char *)"SipUri_getParamValue", _wrap_SipUri_getParamValue, METH_VARARGS, NULL},
+ { (char *)"SipUri_swigregister", SipUri_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SdpMessage", _wrap_new_SdpMessage, METH_VARARGS, NULL},
+ { (char *)"delete_SdpMessage", _wrap_delete_SdpMessage, METH_VARARGS, NULL},
+ { (char *)"SdpMessage_getSdpHeaderValue", _wrap_SdpMessage_getSdpHeaderValue, METH_VARARGS, NULL},
+ { (char *)"SdpMessage_getSdpHeaderAValue", _wrap_SdpMessage_getSdpHeaderAValue, METH_VARARGS, NULL},
+ { (char *)"SdpMessage_swigregister", SdpMessage_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SipMessage", _wrap_new_SipMessage, METH_VARARGS, NULL},
+ { (char *)"delete_SipMessage", _wrap_delete_SipMessage, METH_VARARGS, NULL},
+ { (char *)"SipMessage_getSipHeaderValue", _wrap_SipMessage_getSipHeaderValue, METH_VARARGS, NULL},
+ { (char *)"SipMessage_getSipHeaderParamValue", _wrap_SipMessage_getSipHeaderParamValue, METH_VARARGS, NULL},
+ { (char *)"SipMessage_getSipContentLength", _wrap_SipMessage_getSipContentLength, METH_VARARGS, NULL},
+ { (char *)"SipMessage_getSipContent", _wrap_SipMessage_getSipContent, METH_VARARGS, NULL},
+ { (char *)"SipMessage_getSdpMessage", _wrap_SipMessage_getSdpMessage, METH_VARARGS, NULL},
+ { (char *)"SipMessage_swigregister", SipMessage_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_SipEvent", _wrap_delete_SipEvent, METH_VARARGS, NULL},
+ { (char *)"SipEvent_getCode", _wrap_SipEvent_getCode, METH_VARARGS, NULL},
+ { (char *)"SipEvent_getPhrase", _wrap_SipEvent_getPhrase, METH_VARARGS, NULL},
+ { (char *)"SipEvent_getBaseSession", _wrap_SipEvent_getBaseSession, METH_VARARGS, NULL},
+ { (char *)"SipEvent_getSipMessage", _wrap_SipEvent_getSipMessage, METH_VARARGS, NULL},
+ { (char *)"SipEvent_swigregister", SipEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_DialogEvent", _wrap_delete_DialogEvent, METH_VARARGS, NULL},
+ { (char *)"DialogEvent_swigregister", DialogEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_StackEvent", _wrap_delete_StackEvent, METH_VARARGS, NULL},
+ { (char *)"StackEvent_swigregister", StackEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_InviteEvent", _wrap_delete_InviteEvent, METH_VARARGS, NULL},
+ { (char *)"InviteEvent_getType", _wrap_InviteEvent_getType, METH_VARARGS, NULL},
+ { (char *)"InviteEvent_getMediaType", _wrap_InviteEvent_getMediaType, METH_VARARGS, NULL},
+ { (char *)"InviteEvent_getSession", _wrap_InviteEvent_getSession, METH_VARARGS, NULL},
+ { (char *)"InviteEvent_takeCallSessionOwnership", _wrap_InviteEvent_takeCallSessionOwnership, METH_VARARGS, NULL},
+ { (char *)"InviteEvent_takeMsrpSessionOwnership", _wrap_InviteEvent_takeMsrpSessionOwnership, METH_VARARGS, NULL},
+ { (char *)"InviteEvent_swigregister", InviteEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_MessagingEvent", _wrap_delete_MessagingEvent, METH_VARARGS, NULL},
+ { (char *)"MessagingEvent_getType", _wrap_MessagingEvent_getType, METH_VARARGS, NULL},
+ { (char *)"MessagingEvent_getSession", _wrap_MessagingEvent_getSession, METH_VARARGS, NULL},
+ { (char *)"MessagingEvent_takeSessionOwnership", _wrap_MessagingEvent_takeSessionOwnership, METH_VARARGS, NULL},
+ { (char *)"MessagingEvent_swigregister", MessagingEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_OptionsEvent", _wrap_delete_OptionsEvent, METH_VARARGS, NULL},
+ { (char *)"OptionsEvent_getType", _wrap_OptionsEvent_getType, METH_VARARGS, NULL},
+ { (char *)"OptionsEvent_getSession", _wrap_OptionsEvent_getSession, METH_VARARGS, NULL},
+ { (char *)"OptionsEvent_swigregister", OptionsEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_PublicationEvent", _wrap_delete_PublicationEvent, METH_VARARGS, NULL},
+ { (char *)"PublicationEvent_getType", _wrap_PublicationEvent_getType, METH_VARARGS, NULL},
+ { (char *)"PublicationEvent_getSession", _wrap_PublicationEvent_getSession, METH_VARARGS, NULL},
+ { (char *)"PublicationEvent_swigregister", PublicationEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_RegistrationEvent", _wrap_delete_RegistrationEvent, METH_VARARGS, NULL},
+ { (char *)"RegistrationEvent_getType", _wrap_RegistrationEvent_getType, METH_VARARGS, NULL},
+ { (char *)"RegistrationEvent_getSession", _wrap_RegistrationEvent_getSession, METH_VARARGS, NULL},
+ { (char *)"RegistrationEvent_takeSessionOwnership", _wrap_RegistrationEvent_takeSessionOwnership, METH_VARARGS, NULL},
+ { (char *)"RegistrationEvent_swigregister", RegistrationEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_SubscriptionEvent", _wrap_delete_SubscriptionEvent, METH_VARARGS, NULL},
+ { (char *)"SubscriptionEvent_getType", _wrap_SubscriptionEvent_getType, METH_VARARGS, NULL},
+ { (char *)"SubscriptionEvent_getSession", _wrap_SubscriptionEvent_getSession, METH_VARARGS, NULL},
+ { (char *)"SubscriptionEvent_swigregister", SubscriptionEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SipSession", _wrap_new_SipSession, METH_VARARGS, NULL},
+ { (char *)"delete_SipSession", _wrap_delete_SipSession, METH_VARARGS, NULL},
+ { (char *)"SipSession_haveOwnership", _wrap_SipSession_haveOwnership, METH_VARARGS, NULL},
+ { (char *)"SipSession_addHeader", _wrap_SipSession_addHeader, METH_VARARGS, NULL},
+ { (char *)"SipSession_removeHeader", _wrap_SipSession_removeHeader, METH_VARARGS, NULL},
+ { (char *)"SipSession_addCaps", _wrap_SipSession_addCaps, METH_VARARGS, NULL},
+ { (char *)"SipSession_removeCaps", _wrap_SipSession_removeCaps, METH_VARARGS, NULL},
+ { (char *)"SipSession_setExpires", _wrap_SipSession_setExpires, METH_VARARGS, NULL},
+ { (char *)"SipSession_setFromUri", _wrap_SipSession_setFromUri, METH_VARARGS, NULL},
+ { (char *)"SipSession_setToUri", _wrap_SipSession_setToUri, METH_VARARGS, NULL},
+ { (char *)"SipSession_setSilentHangup", _wrap_SipSession_setSilentHangup, METH_VARARGS, NULL},
+ { (char *)"SipSession_addSigCompCompartment", _wrap_SipSession_addSigCompCompartment, METH_VARARGS, NULL},
+ { (char *)"SipSession_removeSigCompCompartment", _wrap_SipSession_removeSigCompCompartment, METH_VARARGS, NULL},
+ { (char *)"SipSession_getId", _wrap_SipSession_getId, METH_VARARGS, NULL},
+ { (char *)"SipSession_swigregister", SipSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_InviteSession", _wrap_new_InviteSession, METH_VARARGS, NULL},
+ { (char *)"delete_InviteSession", _wrap_delete_InviteSession, METH_VARARGS, NULL},
+ { (char *)"InviteSession_accept", _wrap_InviteSession_accept, METH_VARARGS, NULL},
+ { (char *)"InviteSession_hangup", _wrap_InviteSession_hangup, METH_VARARGS, NULL},
+ { (char *)"InviteSession_reject", _wrap_InviteSession_reject, METH_VARARGS, NULL},
+ { (char *)"InviteSession_getMediaMgr", _wrap_InviteSession_getMediaMgr, METH_VARARGS, NULL},
+ { (char *)"InviteSession_swigregister", InviteSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_CallSession", _wrap_new_CallSession, METH_VARARGS, NULL},
+ { (char *)"delete_CallSession", _wrap_delete_CallSession, METH_VARARGS, NULL},
+ { (char *)"CallSession_callAudio", _wrap_CallSession_callAudio, METH_VARARGS, NULL},
+ { (char *)"CallSession_callAudioVideo", _wrap_CallSession_callAudioVideo, METH_VARARGS, NULL},
+ { (char *)"CallSession_callVideo", _wrap_CallSession_callVideo, METH_VARARGS, NULL},
+ { (char *)"CallSession_setSessionTimer", _wrap_CallSession_setSessionTimer, METH_VARARGS, NULL},
+ { (char *)"CallSession_set100rel", _wrap_CallSession_set100rel, METH_VARARGS, NULL},
+ { (char *)"CallSession_setQoS", _wrap_CallSession_setQoS, METH_VARARGS, NULL},
+ { (char *)"CallSession_hold", _wrap_CallSession_hold, METH_VARARGS, NULL},
+ { (char *)"CallSession_resume", _wrap_CallSession_resume, METH_VARARGS, NULL},
+ { (char *)"CallSession_sendDTMF", _wrap_CallSession_sendDTMF, METH_VARARGS, NULL},
+ { (char *)"CallSession_swigregister", CallSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_MsrpSession", _wrap_new_MsrpSession, METH_VARARGS, NULL},
+ { (char *)"delete_MsrpSession", _wrap_delete_MsrpSession, METH_VARARGS, NULL},
+ { (char *)"MsrpSession_setCallback", _wrap_MsrpSession_setCallback, METH_VARARGS, NULL},
+ { (char *)"MsrpSession_callMsrp", _wrap_MsrpSession_callMsrp, METH_VARARGS, NULL},
+ { (char *)"MsrpSession_sendMessage", _wrap_MsrpSession_sendMessage, METH_VARARGS, NULL},
+ { (char *)"MsrpSession_sendFile", _wrap_MsrpSession_sendFile, METH_VARARGS, NULL},
+ { (char *)"MsrpSession_swigregister", MsrpSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_MessagingSession", _wrap_new_MessagingSession, METH_VARARGS, NULL},
+ { (char *)"delete_MessagingSession", _wrap_delete_MessagingSession, METH_VARARGS, NULL},
+ { (char *)"MessagingSession_send", _wrap_MessagingSession_send, METH_VARARGS, NULL},
+ { (char *)"MessagingSession_accept", _wrap_MessagingSession_accept, METH_VARARGS, NULL},
+ { (char *)"MessagingSession_reject", _wrap_MessagingSession_reject, METH_VARARGS, NULL},
+ { (char *)"MessagingSession_swigregister", MessagingSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_OptionsSession", _wrap_new_OptionsSession, METH_VARARGS, NULL},
+ { (char *)"delete_OptionsSession", _wrap_delete_OptionsSession, METH_VARARGS, NULL},
+ { (char *)"OptionsSession_send", _wrap_OptionsSession_send, METH_VARARGS, NULL},
+ { (char *)"OptionsSession_swigregister", OptionsSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_PublicationSession", _wrap_new_PublicationSession, METH_VARARGS, NULL},
+ { (char *)"delete_PublicationSession", _wrap_delete_PublicationSession, METH_VARARGS, NULL},
+ { (char *)"PublicationSession_publish", _wrap_PublicationSession_publish, METH_VARARGS, NULL},
+ { (char *)"PublicationSession_unPublish", _wrap_PublicationSession_unPublish, METH_VARARGS, NULL},
+ { (char *)"PublicationSession_swigregister", PublicationSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_RegistrationSession", _wrap_new_RegistrationSession, METH_VARARGS, NULL},
+ { (char *)"delete_RegistrationSession", _wrap_delete_RegistrationSession, METH_VARARGS, NULL},
+ { (char *)"RegistrationSession_register_", _wrap_RegistrationSession_register_, METH_VARARGS, NULL},
+ { (char *)"RegistrationSession_unRegister", _wrap_RegistrationSession_unRegister, METH_VARARGS, NULL},
+ { (char *)"RegistrationSession_accept", _wrap_RegistrationSession_accept, METH_VARARGS, NULL},
+ { (char *)"RegistrationSession_reject", _wrap_RegistrationSession_reject, METH_VARARGS, NULL},
+ { (char *)"RegistrationSession_swigregister", RegistrationSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SubscriptionSession", _wrap_new_SubscriptionSession, METH_VARARGS, NULL},
+ { (char *)"delete_SubscriptionSession", _wrap_delete_SubscriptionSession, METH_VARARGS, NULL},
+ { (char *)"SubscriptionSession_subscribe", _wrap_SubscriptionSession_subscribe, METH_VARARGS, NULL},
+ { (char *)"SubscriptionSession_unSubscribe", _wrap_SubscriptionSession_unSubscribe, METH_VARARGS, NULL},
+ { (char *)"SubscriptionSession_swigregister", SubscriptionSession_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyPluginMgr", _wrap_delete_ProxyPluginMgr, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_createInstance", _wrap_ProxyPluginMgr_createInstance, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_getInstance", _wrap_ProxyPluginMgr_getInstance, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_findAudioConsumer", _wrap_ProxyPluginMgr_findAudioConsumer, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_findVideoConsumer", _wrap_ProxyPluginMgr_findVideoConsumer, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_findAudioProducer", _wrap_ProxyPluginMgr_findAudioProducer, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_findVideoProducer", _wrap_ProxyPluginMgr_findVideoProducer, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgr_swigregister", ProxyPluginMgr_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_ProxyPluginMgrCallback", _wrap_new_ProxyPluginMgrCallback, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyPluginMgrCallback", _wrap_delete_ProxyPluginMgrCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgrCallback_OnPluginCreated", _wrap_ProxyPluginMgrCallback_OnPluginCreated, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgrCallback_OnPluginDestroyed", _wrap_ProxyPluginMgrCallback_OnPluginDestroyed, METH_VARARGS, NULL},
+ { (char *)"disown_ProxyPluginMgrCallback", _wrap_disown_ProxyPluginMgrCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyPluginMgrCallback_swigregister", ProxyPluginMgrCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyPlugin", _wrap_delete_ProxyPlugin, METH_VARARGS, NULL},
+ { (char *)"ProxyPlugin_getType", _wrap_ProxyPlugin_getType, METH_VARARGS, NULL},
+ { (char *)"ProxyPlugin_getId", _wrap_ProxyPlugin_getId, METH_VARARGS, NULL},
+ { (char *)"ProxyPlugin_swigregister", ProxyPlugin_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_ProxyAudioConsumerCallback", _wrap_new_ProxyAudioConsumerCallback, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyAudioConsumerCallback", _wrap_delete_ProxyAudioConsumerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumerCallback_prepare", _wrap_ProxyAudioConsumerCallback_prepare, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumerCallback_start", _wrap_ProxyAudioConsumerCallback_start, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumerCallback_pause", _wrap_ProxyAudioConsumerCallback_pause, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumerCallback_stop", _wrap_ProxyAudioConsumerCallback_stop, METH_VARARGS, NULL},
+ { (char *)"disown_ProxyAudioConsumerCallback", _wrap_disown_ProxyAudioConsumerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumerCallback_swigregister", ProxyAudioConsumerCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyAudioConsumer", _wrap_delete_ProxyAudioConsumer, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumer_pull", _wrap_ProxyAudioConsumer_pull, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumer_reset", _wrap_ProxyAudioConsumer_reset, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumer_setCallback", _wrap_ProxyAudioConsumer_setCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumer_getMediaSessionId", _wrap_ProxyAudioConsumer_getMediaSessionId, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumer_registerPlugin", _wrap_ProxyAudioConsumer_registerPlugin, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioConsumer_swigregister", ProxyAudioConsumer_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_ProxyVideoConsumerCallback", _wrap_new_ProxyVideoConsumerCallback, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyVideoConsumerCallback", _wrap_delete_ProxyVideoConsumerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumerCallback_prepare", _wrap_ProxyVideoConsumerCallback_prepare, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumerCallback_consume", _wrap_ProxyVideoConsumerCallback_consume, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumerCallback_start", _wrap_ProxyVideoConsumerCallback_start, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumerCallback_pause", _wrap_ProxyVideoConsumerCallback_pause, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumerCallback_stop", _wrap_ProxyVideoConsumerCallback_stop, METH_VARARGS, NULL},
+ { (char *)"disown_ProxyVideoConsumerCallback", _wrap_disown_ProxyVideoConsumerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumerCallback_swigregister", ProxyVideoConsumerCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyVideoConsumer", _wrap_delete_ProxyVideoConsumer, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumer_setDisplaySize", _wrap_ProxyVideoConsumer_setDisplaySize, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumer_setCallback", _wrap_ProxyVideoConsumer_setCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumer_getMediaSessionId", _wrap_ProxyVideoConsumer_getMediaSessionId, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumer_registerPlugin", _wrap_ProxyVideoConsumer_registerPlugin, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumer_setDefaultChroma", _wrap_ProxyVideoConsumer_setDefaultChroma, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoConsumer_swigregister", ProxyVideoConsumer_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyVideoFrame", _wrap_delete_ProxyVideoFrame, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoFrame_getSize", _wrap_ProxyVideoFrame_getSize, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoFrame_getContent", _wrap_ProxyVideoFrame_getContent, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoFrame_swigregister", ProxyVideoFrame_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_ProxyAudioProducerCallback", _wrap_new_ProxyAudioProducerCallback, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyAudioProducerCallback", _wrap_delete_ProxyAudioProducerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducerCallback_prepare", _wrap_ProxyAudioProducerCallback_prepare, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducerCallback_start", _wrap_ProxyAudioProducerCallback_start, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducerCallback_pause", _wrap_ProxyAudioProducerCallback_pause, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducerCallback_stop", _wrap_ProxyAudioProducerCallback_stop, METH_VARARGS, NULL},
+ { (char *)"disown_ProxyAudioProducerCallback", _wrap_disown_ProxyAudioProducerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducerCallback_swigregister", ProxyAudioProducerCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyAudioProducer", _wrap_delete_ProxyAudioProducer, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducer_push", _wrap_ProxyAudioProducer_push, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducer_setCallback", _wrap_ProxyAudioProducer_setCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducer_getMediaSessionId", _wrap_ProxyAudioProducer_getMediaSessionId, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducer_registerPlugin", _wrap_ProxyAudioProducer_registerPlugin, METH_VARARGS, NULL},
+ { (char *)"ProxyAudioProducer_swigregister", ProxyAudioProducer_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_ProxyVideoProducerCallback", _wrap_new_ProxyVideoProducerCallback, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyVideoProducerCallback", _wrap_delete_ProxyVideoProducerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducerCallback_prepare", _wrap_ProxyVideoProducerCallback_prepare, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducerCallback_start", _wrap_ProxyVideoProducerCallback_start, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducerCallback_pause", _wrap_ProxyVideoProducerCallback_pause, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducerCallback_stop", _wrap_ProxyVideoProducerCallback_stop, METH_VARARGS, NULL},
+ { (char *)"disown_ProxyVideoProducerCallback", _wrap_disown_ProxyVideoProducerCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducerCallback_swigregister", ProxyVideoProducerCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_ProxyVideoProducer", _wrap_delete_ProxyVideoProducer, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_getRotation", _wrap_ProxyVideoProducer_getRotation, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_setRotation", _wrap_ProxyVideoProducer_setRotation, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_push", _wrap_ProxyVideoProducer_push, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_send", _wrap_ProxyVideoProducer_send, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_setCallback", _wrap_ProxyVideoProducer_setCallback, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_getMediaSessionId", _wrap_ProxyVideoProducer_getMediaSessionId, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_registerPlugin", _wrap_ProxyVideoProducer_registerPlugin, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_setDefaultChroma", _wrap_ProxyVideoProducer_setDefaultChroma, METH_VARARGS, NULL},
+ { (char *)"ProxyVideoProducer_swigregister", ProxyVideoProducer_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SipCallback", _wrap_new_SipCallback, METH_VARARGS, NULL},
+ { (char *)"delete_SipCallback", _wrap_delete_SipCallback, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnDialogEvent", _wrap_SipCallback_OnDialogEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnStackEvent", _wrap_SipCallback_OnStackEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnInviteEvent", _wrap_SipCallback_OnInviteEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnMessagingEvent", _wrap_SipCallback_OnMessagingEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnOptionsEvent", _wrap_SipCallback_OnOptionsEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnPublicationEvent", _wrap_SipCallback_OnPublicationEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnRegistrationEvent", _wrap_SipCallback_OnRegistrationEvent, METH_VARARGS, NULL},
+ { (char *)"SipCallback_OnSubscriptionEvent", _wrap_SipCallback_OnSubscriptionEvent, METH_VARARGS, NULL},
+ { (char *)"disown_SipCallback", _wrap_disown_SipCallback, METH_VARARGS, NULL},
+ { (char *)"SipCallback_swigregister", SipCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SafeObject", _wrap_new_SafeObject, METH_VARARGS, NULL},
+ { (char *)"delete_SafeObject", _wrap_delete_SafeObject, METH_VARARGS, NULL},
+ { (char *)"SafeObject_Lock", _wrap_SafeObject_Lock, METH_VARARGS, NULL},
+ { (char *)"SafeObject_UnLock", _wrap_SafeObject_UnLock, METH_VARARGS, NULL},
+ { (char *)"SafeObject_swigregister", SafeObject_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SipStack", _wrap_new_SipStack, METH_VARARGS, NULL},
+ { (char *)"delete_SipStack", _wrap_delete_SipStack, METH_VARARGS, NULL},
+ { (char *)"SipStack_start", _wrap_SipStack_start, METH_VARARGS, NULL},
+ { (char *)"SipStack_setDebugCallback", _wrap_SipStack_setDebugCallback, METH_VARARGS, NULL},
+ { (char *)"SipStack_setRealm", _wrap_SipStack_setRealm, METH_VARARGS, NULL},
+ { (char *)"SipStack_setIMPI", _wrap_SipStack_setIMPI, METH_VARARGS, NULL},
+ { (char *)"SipStack_setIMPU", _wrap_SipStack_setIMPU, METH_VARARGS, NULL},
+ { (char *)"SipStack_setPassword", _wrap_SipStack_setPassword, METH_VARARGS, NULL},
+ { (char *)"SipStack_setAMF", _wrap_SipStack_setAMF, METH_VARARGS, NULL},
+ { (char *)"SipStack_setOperatorId", _wrap_SipStack_setOperatorId, METH_VARARGS, NULL},
+ { (char *)"SipStack_setProxyCSCF", _wrap_SipStack_setProxyCSCF, METH_VARARGS, NULL},
+ { (char *)"SipStack_setLocalIP", _wrap_SipStack_setLocalIP, METH_VARARGS, NULL},
+ { (char *)"SipStack_setLocalPort", _wrap_SipStack_setLocalPort, METH_VARARGS, NULL},
+ { (char *)"SipStack_setEarlyIMS", _wrap_SipStack_setEarlyIMS, METH_VARARGS, NULL},
+ { (char *)"SipStack_addHeader", _wrap_SipStack_addHeader, METH_VARARGS, NULL},
+ { (char *)"SipStack_removeHeader", _wrap_SipStack_removeHeader, METH_VARARGS, NULL},
+ { (char *)"SipStack_addDnsServer", _wrap_SipStack_addDnsServer, METH_VARARGS, NULL},
+ { (char *)"SipStack_setDnsDiscovery", _wrap_SipStack_setDnsDiscovery, METH_VARARGS, NULL},
+ { (char *)"SipStack_setAoR", _wrap_SipStack_setAoR, METH_VARARGS, NULL},
+ { (char *)"SipStack_setSigCompParams", _wrap_SipStack_setSigCompParams, METH_VARARGS, NULL},
+ { (char *)"SipStack_addSigCompCompartment", _wrap_SipStack_addSigCompCompartment, METH_VARARGS, NULL},
+ { (char *)"SipStack_removeSigCompCompartment", _wrap_SipStack_removeSigCompCompartment, METH_VARARGS, NULL},
+ { (char *)"SipStack_setSTUNServer", _wrap_SipStack_setSTUNServer, METH_VARARGS, NULL},
+ { (char *)"SipStack_setSTUNCred", _wrap_SipStack_setSTUNCred, METH_VARARGS, NULL},
+ { (char *)"SipStack_setTLSSecAgree", _wrap_SipStack_setTLSSecAgree, METH_VARARGS, NULL},
+ { (char *)"SipStack_setSSLCretificates", _wrap_SipStack_setSSLCretificates, METH_VARARGS, NULL},
+ { (char *)"SipStack_setIPSecSecAgree", _wrap_SipStack_setIPSecSecAgree, METH_VARARGS, NULL},
+ { (char *)"SipStack_setIPSecParameters", _wrap_SipStack_setIPSecParameters, METH_VARARGS, NULL},
+ { (char *)"SipStack_dnsENUM", _wrap_SipStack_dnsENUM, METH_VARARGS, NULL},
+ { (char *)"SipStack_dnsNaptrSrv", _wrap_SipStack_dnsNaptrSrv, METH_VARARGS, NULL},
+ { (char *)"SipStack_dnsSrv", _wrap_SipStack_dnsSrv, METH_VARARGS, NULL},
+ { (char *)"SipStack_getLocalIPnPort", _wrap_SipStack_getLocalIPnPort, METH_VARARGS, NULL},
+ { (char *)"SipStack_getPreferredIdentity", _wrap_SipStack_getPreferredIdentity, METH_VARARGS, NULL},
+ { (char *)"SipStack_isValid", _wrap_SipStack_isValid, METH_VARARGS, NULL},
+ { (char *)"SipStack_stop", _wrap_SipStack_stop, METH_VARARGS, NULL},
+ { (char *)"SipStack_setCodecs", _wrap_SipStack_setCodecs, METH_VARARGS, NULL},
+ { (char *)"SipStack_setCodecs_2", _wrap_SipStack_setCodecs_2, METH_VARARGS, NULL},
+ { (char *)"SipStack_isCodecSupported", _wrap_SipStack_isCodecSupported, METH_VARARGS, NULL},
+ { (char *)"SipStack_swigregister", SipStack_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_XcapSelector", _wrap_new_XcapSelector, METH_VARARGS, NULL},
+ { (char *)"delete_XcapSelector", _wrap_delete_XcapSelector, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_setAUID", _wrap_XcapSelector_setAUID, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_setName", _wrap_XcapSelector_setName, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_setAttribute", _wrap_XcapSelector_setAttribute, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_setPos", _wrap_XcapSelector_setPos, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_setPosAttribute", _wrap_XcapSelector_setPosAttribute, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_setNamespace", _wrap_XcapSelector_setNamespace, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_getString", _wrap_XcapSelector_getString, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_reset", _wrap_XcapSelector_reset, METH_VARARGS, NULL},
+ { (char *)"XcapSelector_swigregister", XcapSelector_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_XcapMessage", _wrap_new_XcapMessage, METH_VARARGS, NULL},
+ { (char *)"delete_XcapMessage", _wrap_delete_XcapMessage, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_getCode", _wrap_XcapMessage_getCode, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_getPhrase", _wrap_XcapMessage_getPhrase, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_getXcapHeaderValue", _wrap_XcapMessage_getXcapHeaderValue, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_getXcapHeaderParamValue", _wrap_XcapMessage_getXcapHeaderParamValue, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_getXcapContentLength", _wrap_XcapMessage_getXcapContentLength, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_getXcapContent", _wrap_XcapMessage_getXcapContent, METH_VARARGS, NULL},
+ { (char *)"XcapMessage_swigregister", XcapMessage_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_XcapEvent", _wrap_delete_XcapEvent, METH_VARARGS, NULL},
+ { (char *)"XcapEvent_getType", _wrap_XcapEvent_getType, METH_VARARGS, NULL},
+ { (char *)"XcapEvent_getXcapMessage", _wrap_XcapEvent_getXcapMessage, METH_VARARGS, NULL},
+ { (char *)"XcapEvent_swigregister", XcapEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_XcapCallback", _wrap_new_XcapCallback, METH_VARARGS, NULL},
+ { (char *)"delete_XcapCallback", _wrap_delete_XcapCallback, METH_VARARGS, NULL},
+ { (char *)"XcapCallback_onEvent", _wrap_XcapCallback_onEvent, METH_VARARGS, NULL},
+ { (char *)"disown_XcapCallback", _wrap_disown_XcapCallback, METH_VARARGS, NULL},
+ { (char *)"XcapCallback_swigregister", XcapCallback_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_XcapStack", _wrap_new_XcapStack, METH_VARARGS, NULL},
+ { (char *)"delete_XcapStack", _wrap_delete_XcapStack, METH_VARARGS, NULL},
+ { (char *)"XcapStack_registerAUID", _wrap_XcapStack_registerAUID, METH_VARARGS, NULL},
+ { (char *)"XcapStack_start", _wrap_XcapStack_start, METH_VARARGS, NULL},
+ { (char *)"XcapStack_setCredentials", _wrap_XcapStack_setCredentials, METH_VARARGS, NULL},
+ { (char *)"XcapStack_setXcapRoot", _wrap_XcapStack_setXcapRoot, METH_VARARGS, NULL},
+ { (char *)"XcapStack_setLocalIP", _wrap_XcapStack_setLocalIP, METH_VARARGS, NULL},
+ { (char *)"XcapStack_setLocalPort", _wrap_XcapStack_setLocalPort, METH_VARARGS, NULL},
+ { (char *)"XcapStack_addHeader", _wrap_XcapStack_addHeader, METH_VARARGS, NULL},
+ { (char *)"XcapStack_removeHeader", _wrap_XcapStack_removeHeader, METH_VARARGS, NULL},
+ { (char *)"XcapStack_setTimeout", _wrap_XcapStack_setTimeout, METH_VARARGS, NULL},
+ { (char *)"XcapStack_getDocument", _wrap_XcapStack_getDocument, METH_VARARGS, NULL},
+ { (char *)"XcapStack_getElement", _wrap_XcapStack_getElement, METH_VARARGS, NULL},
+ { (char *)"XcapStack_getAttribute", _wrap_XcapStack_getAttribute, METH_VARARGS, NULL},
+ { (char *)"XcapStack_deleteDocument", _wrap_XcapStack_deleteDocument, METH_VARARGS, NULL},
+ { (char *)"XcapStack_deleteElement", _wrap_XcapStack_deleteElement, METH_VARARGS, NULL},
+ { (char *)"XcapStack_deleteAttribute", _wrap_XcapStack_deleteAttribute, METH_VARARGS, NULL},
+ { (char *)"XcapStack_putDocument", _wrap_XcapStack_putDocument, METH_VARARGS, NULL},
+ { (char *)"XcapStack_putElement", _wrap_XcapStack_putElement, METH_VARARGS, NULL},
+ { (char *)"XcapStack_putAttribute", _wrap_XcapStack_putAttribute, METH_VARARGS, NULL},
+ { (char *)"XcapStack_stop", _wrap_XcapStack_stop, METH_VARARGS, NULL},
+ { (char *)"XcapStack_swigregister", XcapStack_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_RPMessage", _wrap_new_RPMessage, METH_VARARGS, NULL},
+ { (char *)"delete_RPMessage", _wrap_delete_RPMessage, METH_VARARGS, NULL},
+ { (char *)"RPMessage_getType", _wrap_RPMessage_getType, METH_VARARGS, NULL},
+ { (char *)"RPMessage_getPayloadLength", _wrap_RPMessage_getPayloadLength, METH_VARARGS, NULL},
+ { (char *)"RPMessage_getPayload", _wrap_RPMessage_getPayload, METH_VARARGS, NULL},
+ { (char *)"RPMessage_swigregister", RPMessage_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_SMSData", _wrap_new_SMSData, METH_VARARGS, NULL},
+ { (char *)"delete_SMSData", _wrap_delete_SMSData, METH_VARARGS, NULL},
+ { (char *)"SMSData_getType", _wrap_SMSData_getType, METH_VARARGS, NULL},
+ { (char *)"SMSData_getMR", _wrap_SMSData_getMR, METH_VARARGS, NULL},
+ { (char *)"SMSData_getPayloadLength", _wrap_SMSData_getPayloadLength, METH_VARARGS, NULL},
+ { (char *)"SMSData_getPayload", _wrap_SMSData_getPayload, METH_VARARGS, NULL},
+ { (char *)"SMSData_getOA", _wrap_SMSData_getOA, METH_VARARGS, NULL},
+ { (char *)"SMSData_getDA", _wrap_SMSData_getDA, METH_VARARGS, NULL},
+ { (char *)"SMSData_swigregister", SMSData_swigregister, METH_VARARGS, NULL},
+ { (char *)"SMSEncoder_encodeSubmit", _wrap_SMSEncoder_encodeSubmit, METH_VARARGS, NULL},
+ { (char *)"SMSEncoder_encodeDeliver", _wrap_SMSEncoder_encodeDeliver, METH_VARARGS, NULL},
+ { (char *)"SMSEncoder_encodeACK", _wrap_SMSEncoder_encodeACK, METH_VARARGS, NULL},
+ { (char *)"SMSEncoder_encodeError", _wrap_SMSEncoder_encodeError, METH_VARARGS, NULL},
+ { (char *)"SMSEncoder_decode", _wrap_SMSEncoder_decode, METH_VARARGS, NULL},
+ { (char *)"delete_SMSEncoder", _wrap_delete_SMSEncoder, METH_VARARGS, NULL},
+ { (char *)"SMSEncoder_swigregister", SMSEncoder_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_MsrpMessage", _wrap_new_MsrpMessage, METH_VARARGS, NULL},
+ { (char *)"delete_MsrpMessage", _wrap_delete_MsrpMessage, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_isRequest", _wrap_MsrpMessage_isRequest, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getCode", _wrap_MsrpMessage_getCode, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getPhrase", _wrap_MsrpMessage_getPhrase, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getRequestType", _wrap_MsrpMessage_getRequestType, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getByteRange", _wrap_MsrpMessage_getByteRange, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_isLastChunck", _wrap_MsrpMessage_isLastChunck, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_isFirstChunck", _wrap_MsrpMessage_isFirstChunck, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getMsrpHeaderValue", _wrap_MsrpMessage_getMsrpHeaderValue, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getMsrpHeaderParamValue", _wrap_MsrpMessage_getMsrpHeaderParamValue, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getMsrpContentLength", _wrap_MsrpMessage_getMsrpContentLength, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_getMsrpContent", _wrap_MsrpMessage_getMsrpContent, METH_VARARGS, NULL},
+ { (char *)"MsrpMessage_swigregister", MsrpMessage_swigregister, METH_VARARGS, NULL},
+ { (char *)"delete_MsrpEvent", _wrap_delete_MsrpEvent, METH_VARARGS, NULL},
+ { (char *)"MsrpEvent_getType", _wrap_MsrpEvent_getType, METH_VARARGS, NULL},
+ { (char *)"MsrpEvent_getSipSession", _wrap_MsrpEvent_getSipSession, METH_VARARGS, NULL},
+ { (char *)"MsrpEvent_getMessage", _wrap_MsrpEvent_getMessage, METH_VARARGS, NULL},
+ { (char *)"MsrpEvent_swigregister", MsrpEvent_swigregister, METH_VARARGS, NULL},
+ { (char *)"new_MsrpCallback", _wrap_new_MsrpCallback, METH_VARARGS, NULL},
+ { (char *)"delete_MsrpCallback", _wrap_delete_MsrpCallback, METH_VARARGS, NULL},
+ { (char *)"MsrpCallback_OnEvent", _wrap_MsrpCallback_OnEvent, METH_VARARGS, NULL},
+ { (char *)"disown_MsrpCallback", _wrap_disown_MsrpCallback, METH_VARARGS, NULL},
+ { (char *)"MsrpCallback_swigregister", MsrpCallback_swigregister, METH_VARARGS, NULL},
+ { NULL, NULL, 0, NULL }
+};
+
+
+/* -------- TYPE CONVERSION AND EQUIVALENCE RULES (BEGIN) -------- */
+
+static void *_p_ProxyAudioConsumerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((ProxyPlugin *) ((ProxyAudioConsumer *) x));
+}
+static void *_p_ProxyVideoConsumerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((ProxyPlugin *) ((ProxyVideoConsumer *) x));
+}
+static void *_p_ProxyAudioProducerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((ProxyPlugin *) ((ProxyAudioProducer *) x));
+}
+static void *_p_ProxyVideoProducerTo_p_ProxyPlugin(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((ProxyPlugin *) ((ProxyVideoProducer *) x));
+}
+static void *_p_SipStackTo_p_SafeObject(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SafeObject *) ((SipStack *) x));
+}
+static void *_p_MediaContentCPIMTo_p_MediaContent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((MediaContent *) ((MediaContentCPIM *) x));
+}
+static void *_p_CallSessionTo_p_InviteSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((InviteSession *) ((CallSession *) x));
+}
+static void *_p_MsrpSessionTo_p_InviteSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((InviteSession *) ((MsrpSession *) x));
+}
+static void *_p_InviteSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) ((InviteSession *) x));
+}
+static void *_p_CallSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) (InviteSession *) ((CallSession *) x));
+}
+static void *_p_MsrpSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) (InviteSession *) ((MsrpSession *) x));
+}
+static void *_p_MessagingSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) ((MessagingSession *) x));
+}
+static void *_p_OptionsSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) ((OptionsSession *) x));
+}
+static void *_p_PublicationSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) ((PublicationSession *) x));
+}
+static void *_p_RegistrationSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) ((RegistrationSession *) x));
+}
+static void *_p_SubscriptionSessionTo_p_SipSession(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipSession *) ((SubscriptionSession *) x));
+}
+static void *_p_InviteEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((InviteEvent *) x));
+}
+static void *_p_OptionsEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((OptionsEvent *) x));
+}
+static void *_p_DialogEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((DialogEvent *) x));
+}
+static void *_p_PublicationEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((PublicationEvent *) x));
+}
+static void *_p_RegistrationEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((RegistrationEvent *) x));
+}
+static void *_p_SubscriptionEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((SubscriptionEvent *) x));
+}
+static void *_p_StackEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((StackEvent *) x));
+}
+static void *_p_MessagingEventTo_p_SipEvent(void *x, int *SWIGUNUSEDPARM(newmemory)) {
+ return (void *)((SipEvent *) ((MessagingEvent *) x));
+}
+static swig_type_info _swigt__p_ActionConfig = {"_p_ActionConfig", "ActionConfig *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_CallSession = {"_p_CallSession", "CallSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_DDebugCallback = {"_p_DDebugCallback", "DDebugCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_DialogEvent = {"_p_DialogEvent", "DialogEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_InviteEvent = {"_p_InviteEvent", "InviteEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_InviteSession = {"_p_InviteSession", "InviteSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MediaContent = {"_p_MediaContent", "MediaContent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MediaContentCPIM = {"_p_MediaContentCPIM", "MediaContentCPIM *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MediaSessionMgr = {"_p_MediaSessionMgr", "MediaSessionMgr *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MessagingEvent = {"_p_MessagingEvent", "MessagingEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MessagingSession = {"_p_MessagingSession", "MessagingSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MsrpCallback = {"_p_MsrpCallback", "MsrpCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MsrpEvent = {"_p_MsrpEvent", "MsrpEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MsrpMessage = {"_p_MsrpMessage", "MsrpMessage *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_MsrpSession = {"_p_MsrpSession", "MsrpSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_OptionsEvent = {"_p_OptionsEvent", "OptionsEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_OptionsSession = {"_p_OptionsSession", "OptionsSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyAudioConsumer = {"_p_ProxyAudioConsumer", "ProxyAudioConsumer *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyAudioConsumerCallback = {"_p_ProxyAudioConsumerCallback", "ProxyAudioConsumerCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyAudioProducer = {"_p_ProxyAudioProducer", "ProxyAudioProducer *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyAudioProducerCallback = {"_p_ProxyAudioProducerCallback", "ProxyAudioProducerCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyPlugin = {"_p_ProxyPlugin", "ProxyPlugin *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyPluginMgr = {"_p_ProxyPluginMgr", "ProxyPluginMgr *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyPluginMgrCallback = {"_p_ProxyPluginMgrCallback", "ProxyPluginMgrCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyVideoConsumer = {"_p_ProxyVideoConsumer", "ProxyVideoConsumer *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyVideoConsumerCallback = {"_p_ProxyVideoConsumerCallback", "ProxyVideoConsumerCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyVideoFrame = {"_p_ProxyVideoFrame", "ProxyVideoFrame *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyVideoProducer = {"_p_ProxyVideoProducer", "ProxyVideoProducer *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_ProxyVideoProducerCallback = {"_p_ProxyVideoProducerCallback", "ProxyVideoProducerCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_PublicationEvent = {"_p_PublicationEvent", "PublicationEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_PublicationSession = {"_p_PublicationSession", "PublicationSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_RPMessage = {"_p_RPMessage", "RPMessage *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_RegistrationEvent = {"_p_RegistrationEvent", "RegistrationEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_RegistrationSession = {"_p_RegistrationSession", "RegistrationSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SMSData = {"_p_SMSData", "SMSData *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SMSEncoder = {"_p_SMSEncoder", "SMSEncoder *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SafeObject = {"_p_SafeObject", "SafeObject *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SdpMessage = {"_p_SdpMessage", "SdpMessage *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SipCallback = {"_p_SipCallback", "SipCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SipEvent = {"_p_SipEvent", "SipEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SipMessage = {"_p_SipMessage", "SipMessage *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SipSession = {"_p_SipSession", "SipSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SipStack = {"_p_SipStack", "SipStack *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SipUri = {"_p_SipUri", "SipUri *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_StackEvent = {"_p_StackEvent", "StackEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SubscriptionEvent = {"_p_SubscriptionEvent", "SubscriptionEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_SubscriptionSession = {"_p_SubscriptionSession", "SubscriptionSession *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_XcapCallback = {"_p_XcapCallback", "XcapCallback *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_XcapEvent = {"_p_XcapEvent", "XcapEvent *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_XcapMessage = {"_p_XcapMessage", "XcapMessage *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_XcapSelector = {"_p_XcapSelector", "XcapSelector *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_XcapStack = {"_p_XcapStack", "XcapStack *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_char = {"_p_char", "char *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_int = {"_p_int", "intptr_t *|int *|int_least32_t *|int_fast32_t *|int32_t *|int_fast16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_long_long = {"_p_long_long", "int_least64_t *|int_fast64_t *|int64_t *|long long *|intmax_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_short = {"_p_short", "short *|int_least16_t *|int16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_signed_char = {"_p_signed_char", "signed char *|int_least8_t *|int_fast8_t *|int8_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tdav_codec_id_e = {"_p_tdav_codec_id_e", "enum tdav_codec_id_e *|tdav_codec_id_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_thttp_event_type_e = {"_p_thttp_event_type_e", "enum thttp_event_type_e *|thttp_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tmedia_bandwidth_level_e = {"_p_tmedia_bandwidth_level_e", "enum tmedia_bandwidth_level_e *|tmedia_bandwidth_level_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tmedia_chroma_e = {"_p_tmedia_chroma_e", "tmedia_chroma_t *|enum tmedia_chroma_e *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tmedia_qos_strength_e = {"_p_tmedia_qos_strength_e", "tmedia_qos_strength_t *|enum tmedia_qos_strength_e *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tmedia_qos_stype_e = {"_p_tmedia_qos_stype_e", "enum tmedia_qos_stype_e *|tmedia_qos_stype_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tmsrp_event_type_e = {"_p_tmsrp_event_type_e", "enum tmsrp_event_type_e *|tmsrp_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tmsrp_request_type_e = {"_p_tmsrp_request_type_e", "enum tmsrp_request_type_e *|tmsrp_request_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_event_type_e = {"_p_tsip_event_type_e", "enum tsip_event_type_e *|tsip_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_invite_event_type_e = {"_p_tsip_invite_event_type_e", "enum tsip_invite_event_type_e *|tsip_invite_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_message_event_type_e = {"_p_tsip_message_event_type_e", "enum tsip_message_event_type_e *|tsip_message_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_options_event_type_e = {"_p_tsip_options_event_type_e", "enum tsip_options_event_type_e *|tsip_options_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_publish_event_type_e = {"_p_tsip_publish_event_type_e", "enum tsip_publish_event_type_e *|tsip_publish_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_register_event_type_e = {"_p_tsip_register_event_type_e", "enum tsip_register_event_type_e *|tsip_register_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsip_subscribe_event_type_e = {"_p_tsip_subscribe_event_type_e", "enum tsip_subscribe_event_type_e *|tsip_subscribe_event_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_tsk_list_t = {"_p_tsk_list_t", "twrap_xcap_steps_L_t *|twrap_proxy_plungins_L_t *|tsk_list_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_twrap_media_type_e = {"_p_twrap_media_type_e", "enum twrap_media_type_e *|twrap_media_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_twrap_proxy_plugin_type_e = {"_p_twrap_proxy_plugin_type_e", "enum twrap_proxy_plugin_type_e *|twrap_proxy_plugin_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_twrap_rpmessage_type_e = {"_p_twrap_rpmessage_type_e", "enum twrap_rpmessage_type_e *|twrap_rpmessage_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_twrap_sms_type_e = {"_p_twrap_sms_type_e", "enum twrap_sms_type_e *|twrap_sms_type_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_char = {"_p_unsigned_char", "unsigned char *|uint_least8_t *|uint_fast8_t *|uint8_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_int = {"_p_unsigned_int", "uintptr_t *|uint_least32_t *|uint_fast32_t *|uint32_t *|unsigned int *|uint_fast16_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_long_long = {"_p_unsigned_long_long", "uint_least64_t *|uint_fast64_t *|uint64_t *|unsigned long long *|uintmax_t *", 0, 0, (void*)0, 0};
+static swig_type_info _swigt__p_unsigned_short = {"_p_unsigned_short", "unsigned short *|uint_least16_t *|uint16_t *", 0, 0, (void*)0, 0};
+
+static swig_type_info *swig_type_initial[] = {
+ &_swigt__p_ActionConfig,
+ &_swigt__p_CallSession,
+ &_swigt__p_DDebugCallback,
+ &_swigt__p_DialogEvent,
+ &_swigt__p_InviteEvent,
+ &_swigt__p_InviteSession,
+ &_swigt__p_MediaContent,
+ &_swigt__p_MediaContentCPIM,
+ &_swigt__p_MediaSessionMgr,
+ &_swigt__p_MessagingEvent,
+ &_swigt__p_MessagingSession,
+ &_swigt__p_MsrpCallback,
+ &_swigt__p_MsrpEvent,
+ &_swigt__p_MsrpMessage,
+ &_swigt__p_MsrpSession,
+ &_swigt__p_OptionsEvent,
+ &_swigt__p_OptionsSession,
+ &_swigt__p_ProxyAudioConsumer,
+ &_swigt__p_ProxyAudioConsumerCallback,
+ &_swigt__p_ProxyAudioProducer,
+ &_swigt__p_ProxyAudioProducerCallback,
+ &_swigt__p_ProxyPlugin,
+ &_swigt__p_ProxyPluginMgr,
+ &_swigt__p_ProxyPluginMgrCallback,
+ &_swigt__p_ProxyVideoConsumer,
+ &_swigt__p_ProxyVideoConsumerCallback,
+ &_swigt__p_ProxyVideoFrame,
+ &_swigt__p_ProxyVideoProducer,
+ &_swigt__p_ProxyVideoProducerCallback,
+ &_swigt__p_PublicationEvent,
+ &_swigt__p_PublicationSession,
+ &_swigt__p_RPMessage,
+ &_swigt__p_RegistrationEvent,
+ &_swigt__p_RegistrationSession,
+ &_swigt__p_SMSData,
+ &_swigt__p_SMSEncoder,
+ &_swigt__p_SafeObject,
+ &_swigt__p_SdpMessage,
+ &_swigt__p_SipCallback,
+ &_swigt__p_SipEvent,
+ &_swigt__p_SipMessage,
+ &_swigt__p_SipSession,
+ &_swigt__p_SipStack,
+ &_swigt__p_SipUri,
+ &_swigt__p_StackEvent,
+ &_swigt__p_SubscriptionEvent,
+ &_swigt__p_SubscriptionSession,
+ &_swigt__p_XcapCallback,
+ &_swigt__p_XcapEvent,
+ &_swigt__p_XcapMessage,
+ &_swigt__p_XcapSelector,
+ &_swigt__p_XcapStack,
+ &_swigt__p_char,
+ &_swigt__p_int,
+ &_swigt__p_long_long,
+ &_swigt__p_short,
+ &_swigt__p_signed_char,
+ &_swigt__p_tdav_codec_id_e,
+ &_swigt__p_thttp_event_type_e,
+ &_swigt__p_tmedia_bandwidth_level_e,
+ &_swigt__p_tmedia_chroma_e,
+ &_swigt__p_tmedia_qos_strength_e,
+ &_swigt__p_tmedia_qos_stype_e,
+ &_swigt__p_tmsrp_event_type_e,
+ &_swigt__p_tmsrp_request_type_e,
+ &_swigt__p_tsip_event_type_e,
+ &_swigt__p_tsip_invite_event_type_e,
+ &_swigt__p_tsip_message_event_type_e,
+ &_swigt__p_tsip_options_event_type_e,
+ &_swigt__p_tsip_publish_event_type_e,
+ &_swigt__p_tsip_register_event_type_e,
+ &_swigt__p_tsip_subscribe_event_type_e,
+ &_swigt__p_tsk_list_t,
+ &_swigt__p_twrap_media_type_e,
+ &_swigt__p_twrap_proxy_plugin_type_e,
+ &_swigt__p_twrap_rpmessage_type_e,
+ &_swigt__p_twrap_sms_type_e,
+ &_swigt__p_unsigned_char,
+ &_swigt__p_unsigned_int,
+ &_swigt__p_unsigned_long_long,
+ &_swigt__p_unsigned_short,
+};
+
+static swig_cast_info _swigc__p_ActionConfig[] = { {&_swigt__p_ActionConfig, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_CallSession[] = { {&_swigt__p_CallSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_DDebugCallback[] = { {&_swigt__p_DDebugCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_DialogEvent[] = { {&_swigt__p_DialogEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_InviteEvent[] = { {&_swigt__p_InviteEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_InviteSession[] = { {&_swigt__p_InviteSession, 0, 0, 0}, {&_swigt__p_CallSession, _p_CallSessionTo_p_InviteSession, 0, 0}, {&_swigt__p_MsrpSession, _p_MsrpSessionTo_p_InviteSession, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MediaContent[] = { {&_swigt__p_MediaContent, 0, 0, 0}, {&_swigt__p_MediaContentCPIM, _p_MediaContentCPIMTo_p_MediaContent, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MediaContentCPIM[] = { {&_swigt__p_MediaContentCPIM, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MediaSessionMgr[] = { {&_swigt__p_MediaSessionMgr, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MessagingEvent[] = { {&_swigt__p_MessagingEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MessagingSession[] = { {&_swigt__p_MessagingSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MsrpCallback[] = { {&_swigt__p_MsrpCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MsrpEvent[] = { {&_swigt__p_MsrpEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MsrpMessage[] = { {&_swigt__p_MsrpMessage, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_MsrpSession[] = { {&_swigt__p_MsrpSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_OptionsEvent[] = { {&_swigt__p_OptionsEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_OptionsSession[] = { {&_swigt__p_OptionsSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyAudioConsumer[] = { {&_swigt__p_ProxyAudioConsumer, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyAudioConsumerCallback[] = { {&_swigt__p_ProxyAudioConsumerCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyAudioProducer[] = { {&_swigt__p_ProxyAudioProducer, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyAudioProducerCallback[] = { {&_swigt__p_ProxyAudioProducerCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyPlugin[] = { {&_swigt__p_ProxyPlugin, 0, 0, 0}, {&_swigt__p_ProxyAudioConsumer, _p_ProxyAudioConsumerTo_p_ProxyPlugin, 0, 0}, {&_swigt__p_ProxyVideoConsumer, _p_ProxyVideoConsumerTo_p_ProxyPlugin, 0, 0}, {&_swigt__p_ProxyAudioProducer, _p_ProxyAudioProducerTo_p_ProxyPlugin, 0, 0}, {&_swigt__p_ProxyVideoProducer, _p_ProxyVideoProducerTo_p_ProxyPlugin, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyPluginMgr[] = { {&_swigt__p_ProxyPluginMgr, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyPluginMgrCallback[] = { {&_swigt__p_ProxyPluginMgrCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyVideoConsumer[] = { {&_swigt__p_ProxyVideoConsumer, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyVideoConsumerCallback[] = { {&_swigt__p_ProxyVideoConsumerCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyVideoFrame[] = { {&_swigt__p_ProxyVideoFrame, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyVideoProducer[] = { {&_swigt__p_ProxyVideoProducer, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_ProxyVideoProducerCallback[] = { {&_swigt__p_ProxyVideoProducerCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_PublicationEvent[] = { {&_swigt__p_PublicationEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_PublicationSession[] = { {&_swigt__p_PublicationSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_RPMessage[] = { {&_swigt__p_RPMessage, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_RegistrationEvent[] = { {&_swigt__p_RegistrationEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_RegistrationSession[] = { {&_swigt__p_RegistrationSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SMSData[] = { {&_swigt__p_SMSData, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SMSEncoder[] = { {&_swigt__p_SMSEncoder, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SafeObject[] = { {&_swigt__p_SipStack, _p_SipStackTo_p_SafeObject, 0, 0}, {&_swigt__p_SafeObject, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SdpMessage[] = { {&_swigt__p_SdpMessage, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SipCallback[] = { {&_swigt__p_SipCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SipEvent[] = { {&_swigt__p_SipEvent, 0, 0, 0}, {&_swigt__p_InviteEvent, _p_InviteEventTo_p_SipEvent, 0, 0}, {&_swigt__p_OptionsEvent, _p_OptionsEventTo_p_SipEvent, 0, 0}, {&_swigt__p_DialogEvent, _p_DialogEventTo_p_SipEvent, 0, 0}, {&_swigt__p_PublicationEvent, _p_PublicationEventTo_p_SipEvent, 0, 0}, {&_swigt__p_RegistrationEvent, _p_RegistrationEventTo_p_SipEvent, 0, 0}, {&_swigt__p_SubscriptionEvent, _p_SubscriptionEventTo_p_SipEvent, 0, 0}, {&_swigt__p_StackEvent, _p_StackEventTo_p_SipEvent, 0, 0}, {&_swigt__p_MessagingEvent, _p_MessagingEventTo_p_SipEvent, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SipMessage[] = { {&_swigt__p_SipMessage, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SipSession[] = { {&_swigt__p_SipSession, 0, 0, 0}, {&_swigt__p_InviteSession, _p_InviteSessionTo_p_SipSession, 0, 0}, {&_swigt__p_CallSession, _p_CallSessionTo_p_SipSession, 0, 0}, {&_swigt__p_MsrpSession, _p_MsrpSessionTo_p_SipSession, 0, 0}, {&_swigt__p_MessagingSession, _p_MessagingSessionTo_p_SipSession, 0, 0}, {&_swigt__p_OptionsSession, _p_OptionsSessionTo_p_SipSession, 0, 0}, {&_swigt__p_PublicationSession, _p_PublicationSessionTo_p_SipSession, 0, 0}, {&_swigt__p_RegistrationSession, _p_RegistrationSessionTo_p_SipSession, 0, 0}, {&_swigt__p_SubscriptionSession, _p_SubscriptionSessionTo_p_SipSession, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SipStack[] = { {&_swigt__p_SipStack, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SipUri[] = { {&_swigt__p_SipUri, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_StackEvent[] = { {&_swigt__p_StackEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SubscriptionEvent[] = { {&_swigt__p_SubscriptionEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_SubscriptionSession[] = { {&_swigt__p_SubscriptionSession, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_XcapCallback[] = { {&_swigt__p_XcapCallback, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_XcapEvent[] = { {&_swigt__p_XcapEvent, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_XcapMessage[] = { {&_swigt__p_XcapMessage, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_XcapSelector[] = { {&_swigt__p_XcapSelector, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_XcapStack[] = { {&_swigt__p_XcapStack, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_char[] = { {&_swigt__p_char, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_int[] = { {&_swigt__p_int, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_long_long[] = { {&_swigt__p_long_long, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_short[] = { {&_swigt__p_short, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_signed_char[] = { {&_swigt__p_signed_char, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tdav_codec_id_e[] = { {&_swigt__p_tdav_codec_id_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_thttp_event_type_e[] = { {&_swigt__p_thttp_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tmedia_bandwidth_level_e[] = { {&_swigt__p_tmedia_bandwidth_level_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tmedia_chroma_e[] = { {&_swigt__p_tmedia_chroma_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tmedia_qos_strength_e[] = { {&_swigt__p_tmedia_qos_strength_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tmedia_qos_stype_e[] = { {&_swigt__p_tmedia_qos_stype_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tmsrp_event_type_e[] = { {&_swigt__p_tmsrp_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tmsrp_request_type_e[] = { {&_swigt__p_tmsrp_request_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_event_type_e[] = { {&_swigt__p_tsip_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_invite_event_type_e[] = { {&_swigt__p_tsip_invite_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_message_event_type_e[] = { {&_swigt__p_tsip_message_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_options_event_type_e[] = { {&_swigt__p_tsip_options_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_publish_event_type_e[] = { {&_swigt__p_tsip_publish_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_register_event_type_e[] = { {&_swigt__p_tsip_register_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsip_subscribe_event_type_e[] = { {&_swigt__p_tsip_subscribe_event_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_tsk_list_t[] = { {&_swigt__p_tsk_list_t, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_twrap_media_type_e[] = { {&_swigt__p_twrap_media_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_twrap_proxy_plugin_type_e[] = { {&_swigt__p_twrap_proxy_plugin_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_twrap_rpmessage_type_e[] = { {&_swigt__p_twrap_rpmessage_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_twrap_sms_type_e[] = { {&_swigt__p_twrap_sms_type_e, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_char[] = { {&_swigt__p_unsigned_char, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_int[] = { {&_swigt__p_unsigned_int, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_long_long[] = { {&_swigt__p_unsigned_long_long, 0, 0, 0},{0, 0, 0, 0}};
+static swig_cast_info _swigc__p_unsigned_short[] = { {&_swigt__p_unsigned_short, 0, 0, 0},{0, 0, 0, 0}};
+
+static swig_cast_info *swig_cast_initial[] = {
+ _swigc__p_ActionConfig,
+ _swigc__p_CallSession,
+ _swigc__p_DDebugCallback,
+ _swigc__p_DialogEvent,
+ _swigc__p_InviteEvent,
+ _swigc__p_InviteSession,
+ _swigc__p_MediaContent,
+ _swigc__p_MediaContentCPIM,
+ _swigc__p_MediaSessionMgr,
+ _swigc__p_MessagingEvent,
+ _swigc__p_MessagingSession,
+ _swigc__p_MsrpCallback,
+ _swigc__p_MsrpEvent,
+ _swigc__p_MsrpMessage,
+ _swigc__p_MsrpSession,
+ _swigc__p_OptionsEvent,
+ _swigc__p_OptionsSession,
+ _swigc__p_ProxyAudioConsumer,
+ _swigc__p_ProxyAudioConsumerCallback,
+ _swigc__p_ProxyAudioProducer,
+ _swigc__p_ProxyAudioProducerCallback,
+ _swigc__p_ProxyPlugin,
+ _swigc__p_ProxyPluginMgr,
+ _swigc__p_ProxyPluginMgrCallback,
+ _swigc__p_ProxyVideoConsumer,
+ _swigc__p_ProxyVideoConsumerCallback,
+ _swigc__p_ProxyVideoFrame,
+ _swigc__p_ProxyVideoProducer,
+ _swigc__p_ProxyVideoProducerCallback,
+ _swigc__p_PublicationEvent,
+ _swigc__p_PublicationSession,
+ _swigc__p_RPMessage,
+ _swigc__p_RegistrationEvent,
+ _swigc__p_RegistrationSession,
+ _swigc__p_SMSData,
+ _swigc__p_SMSEncoder,
+ _swigc__p_SafeObject,
+ _swigc__p_SdpMessage,
+ _swigc__p_SipCallback,
+ _swigc__p_SipEvent,
+ _swigc__p_SipMessage,
+ _swigc__p_SipSession,
+ _swigc__p_SipStack,
+ _swigc__p_SipUri,
+ _swigc__p_StackEvent,
+ _swigc__p_SubscriptionEvent,
+ _swigc__p_SubscriptionSession,
+ _swigc__p_XcapCallback,
+ _swigc__p_XcapEvent,
+ _swigc__p_XcapMessage,
+ _swigc__p_XcapSelector,
+ _swigc__p_XcapStack,
+ _swigc__p_char,
+ _swigc__p_int,
+ _swigc__p_long_long,
+ _swigc__p_short,
+ _swigc__p_signed_char,
+ _swigc__p_tdav_codec_id_e,
+ _swigc__p_thttp_event_type_e,
+ _swigc__p_tmedia_bandwidth_level_e,
+ _swigc__p_tmedia_chroma_e,
+ _swigc__p_tmedia_qos_strength_e,
+ _swigc__p_tmedia_qos_stype_e,
+ _swigc__p_tmsrp_event_type_e,
+ _swigc__p_tmsrp_request_type_e,
+ _swigc__p_tsip_event_type_e,
+ _swigc__p_tsip_invite_event_type_e,
+ _swigc__p_tsip_message_event_type_e,
+ _swigc__p_tsip_options_event_type_e,
+ _swigc__p_tsip_publish_event_type_e,
+ _swigc__p_tsip_register_event_type_e,
+ _swigc__p_tsip_subscribe_event_type_e,
+ _swigc__p_tsk_list_t,
+ _swigc__p_twrap_media_type_e,
+ _swigc__p_twrap_proxy_plugin_type_e,
+ _swigc__p_twrap_rpmessage_type_e,
+ _swigc__p_twrap_sms_type_e,
+ _swigc__p_unsigned_char,
+ _swigc__p_unsigned_int,
+ _swigc__p_unsigned_long_long,
+ _swigc__p_unsigned_short,
+};
+
+
+/* -------- TYPE CONVERSION AND EQUIVALENCE RULES (END) -------- */
+
+static swig_const_info swig_const_table[] = {
+{0, 0, 0, 0.0, 0, 0}};
+
+#ifdef __cplusplus
+}
+#endif
+/* -----------------------------------------------------------------------------
+ * Type initialization:
+ * This problem is tough by the requirement that no dynamic
+ * memory is used. Also, since swig_type_info structures store pointers to
+ * swig_cast_info structures and swig_cast_info structures store pointers back
+ * to swig_type_info structures, we need some lookup code at initialization.
+ * The idea is that swig generates all the structures that are needed.
+ * The runtime then collects these partially filled structures.
+ * The SWIG_InitializeModule function takes these initial arrays out of
+ * swig_module, and does all the lookup, filling in the swig_module.types
+ * array with the correct data and linking the correct swig_cast_info
+ * structures together.
+ *
+ * The generated swig_type_info structures are assigned staticly to an initial
+ * array. We just loop through that array, and handle each type individually.
+ * First we lookup if this type has been already loaded, and if so, use the
+ * loaded structure instead of the generated one. Then we have to fill in the
+ * cast linked list. The cast data is initially stored in something like a
+ * two-dimensional array. Each row corresponds to a type (there are the same
+ * number of rows as there are in the swig_type_initial array). Each entry in
+ * a column is one of the swig_cast_info structures for that type.
+ * The cast_initial array is actually an array of arrays, because each row has
+ * a variable number of columns. So to actually build the cast linked list,
+ * we find the array of casts associated with the type, and loop through it
+ * adding the casts to the list. The one last trick we need to do is making
+ * sure the type pointer in the swig_cast_info struct is correct.
+ *
+ * First off, we lookup the cast->type name to see if it is already loaded.
+ * There are three cases to handle:
+ * 1) If the cast->type has already been loaded AND the type we are adding
+ * casting info to has not been loaded (it is in this module), THEN we
+ * replace the cast->type pointer with the type pointer that has already
+ * been loaded.
+ * 2) If BOTH types (the one we are adding casting info to, and the
+ * cast->type) are loaded, THEN the cast info has already been loaded by
+ * the previous module so we just ignore it.
+ * 3) Finally, if cast->type has not already been loaded, then we add that
+ * swig_cast_info to the linked list (because the cast->type) pointer will
+ * be correct.
+ * ----------------------------------------------------------------------------- */
+
+#ifdef __cplusplus
+extern "C" {
+#if 0
+} /* c-mode */
+#endif
+#endif
+
+#if 0
+#define SWIGRUNTIME_DEBUG
+#endif
+
+
+SWIGRUNTIME void
+SWIG_InitializeModule(void *clientdata) {
+ size_t i;
+ swig_module_info *module_head, *iter;
+ int found, init;
+
+ clientdata = clientdata;
+
+ /* check to see if the circular list has been setup, if not, set it up */
+ if (swig_module.next==0) {
+ /* Initialize the swig_module */
+ swig_module.type_initial = swig_type_initial;
+ swig_module.cast_initial = swig_cast_initial;
+ swig_module.next = &swig_module;
+ init = 1;
+ } else {
+ init = 0;
+ }
+
+ /* Try and load any already created modules */
+ module_head = SWIG_GetModule(clientdata);
+ if (!module_head) {
+ /* This is the first module loaded for this interpreter */
+ /* so set the swig module into the interpreter */
+ SWIG_SetModule(clientdata, &swig_module);
+ module_head = &swig_module;
+ } else {
+ /* the interpreter has loaded a SWIG module, but has it loaded this one? */
+ found=0;
+ iter=module_head;
+ do {
+ if (iter==&swig_module) {
+ found=1;
+ break;
+ }
+ iter=iter->next;
+ } while (iter!= module_head);
+
+ /* if the is found in the list, then all is done and we may leave */
+ if (found) return;
+ /* otherwise we must add out module into the list */
+ swig_module.next = module_head->next;
+ module_head->next = &swig_module;
+ }
+
+ /* When multiple interpeters are used, a module could have already been initialized in
+ a different interpreter, but not yet have a pointer in this interpreter.
+ In this case, we do not want to continue adding types... everything should be
+ set up already */
+ if (init == 0) return;
+
+ /* Now work on filling in swig_module.types */
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: size %d\n", swig_module.size);
+#endif
+ for (i = 0; i < swig_module.size; ++i) {
+ swig_type_info *type = 0;
+ swig_type_info *ret;
+ swig_cast_info *cast;
+
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: type %d %s\n", i, swig_module.type_initial[i]->name);
+#endif
+
+ /* if there is another module already loaded */
+ if (swig_module.next != &swig_module) {
+ type = SWIG_MangledTypeQueryModule(swig_module.next, &swig_module, swig_module.type_initial[i]->name);
+ }
+ if (type) {
+ /* Overwrite clientdata field */
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: found type %s\n", type->name);
+#endif
+ if (swig_module.type_initial[i]->clientdata) {
+ type->clientdata = swig_module.type_initial[i]->clientdata;
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: found and overwrite type %s \n", type->name);
+#endif
+ }
+ } else {
+ type = swig_module.type_initial[i];
+ }
+
+ /* Insert casting types */
+ cast = swig_module.cast_initial[i];
+ while (cast->type) {
+ /* Don't need to add information already in the list */
+ ret = 0;
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: look cast %s\n", cast->type->name);
+#endif
+ if (swig_module.next != &swig_module) {
+ ret = SWIG_MangledTypeQueryModule(swig_module.next, &swig_module, cast->type->name);
+#ifdef SWIGRUNTIME_DEBUG
+ if (ret) printf("SWIG_InitializeModule: found cast %s\n", ret->name);
+#endif
+ }
+ if (ret) {
+ if (type == swig_module.type_initial[i]) {
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: skip old type %s\n", ret->name);
+#endif
+ cast->type = ret;
+ ret = 0;
+ } else {
+ /* Check for casting already in the list */
+ swig_cast_info *ocast = SWIG_TypeCheck(ret->name, type);
+#ifdef SWIGRUNTIME_DEBUG
+ if (ocast) printf("SWIG_InitializeModule: skip old cast %s\n", ret->name);
+#endif
+ if (!ocast) ret = 0;
+ }
+ }
+
+ if (!ret) {
+#ifdef SWIGRUNTIME_DEBUG
+ printf("SWIG_InitializeModule: adding cast %s\n", cast->type->name);
+#endif
+ if (type->cast) {
+ type->cast->prev = cast;
+ cast->next = type->cast;
+ }
+ type->cast = cast;
+ }
+ cast++;
+ }
+ /* Set entry in modules->types array equal to the type */
+ swig_module.types[i] = type;
+ }
+ swig_module.types[i] = 0;
+
+#ifdef SWIGRUNTIME_DEBUG
+ printf("**** SWIG_InitializeModule: Cast List ******\n");
+ for (i = 0; i < swig_module.size; ++i) {
+ int j = 0;
+ swig_cast_info *cast = swig_module.cast_initial[i];
+ printf("SWIG_InitializeModule: type %d %s\n", i, swig_module.type_initial[i]->name);
+ while (cast->type) {
+ printf("SWIG_InitializeModule: cast type %s\n", cast->type->name);
+ cast++;
+ ++j;
+ }
+ printf("---- Total casts: %d\n",j);
+ }
+ printf("**** SWIG_InitializeModule: Cast List ******\n");
+#endif
+}
+
+/* This function will propagate the clientdata field of type to
+* any new swig_type_info structures that have been added into the list
+* of equivalent types. It is like calling
+* SWIG_TypeClientData(type, clientdata) a second time.
+*/
+SWIGRUNTIME void
+SWIG_PropagateClientData(void) {
+ size_t i;
+ swig_cast_info *equiv;
+ static int init_run = 0;
+
+ if (init_run) return;
+ init_run = 1;
+
+ for (i = 0; i < swig_module.size; i++) {
+ if (swig_module.types[i]->clientdata) {
+ equiv = swig_module.types[i]->cast;
+ while (equiv) {
+ if (!equiv->converter) {
+ if (equiv->type && !equiv->type->clientdata)
+ SWIG_TypeClientData(equiv->type, swig_module.types[i]->clientdata);
+ }
+ equiv = equiv->next;
+ }
+ }
+ }
+}
+
+#ifdef __cplusplus
+#if 0
+{
+ /* c-mode */
+#endif
+}
+#endif
+
+
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+ /* Python-specific SWIG API */
+#define SWIG_newvarlink() SWIG_Python_newvarlink()
+#define SWIG_addvarlink(p, name, get_attr, set_attr) SWIG_Python_addvarlink(p, name, get_attr, set_attr)
+#define SWIG_InstallConstants(d, constants) SWIG_Python_InstallConstants(d, constants)
+
+ /* -----------------------------------------------------------------------------
+ * global variable support code.
+ * ----------------------------------------------------------------------------- */
+
+ typedef struct swig_globalvar {
+ char *name; /* Name of global variable */
+ PyObject *(*get_attr)(void); /* Return the current value */
+ int (*set_attr)(PyObject *); /* Set the value */
+ struct swig_globalvar *next;
+ } swig_globalvar;
+
+ typedef struct swig_varlinkobject {
+ PyObject_HEAD
+ swig_globalvar *vars;
+ } swig_varlinkobject;
+
+ SWIGINTERN PyObject *
+ swig_varlink_repr(swig_varlinkobject *SWIGUNUSEDPARM(v)) {
+#if PY_VERSION_HEX >= 0x03000000
+ return PyUnicode_InternFromString("<Swig global variables>");
+#else
+ return PyString_FromString("<Swig global variables>");
+#endif
+ }
+
+ SWIGINTERN PyObject *
+ swig_varlink_str(swig_varlinkobject *v) {
+#if PY_VERSION_HEX >= 0x03000000
+ PyObject *str = PyUnicode_InternFromString("(");
+ PyObject *tail;
+ PyObject *joined;
+ swig_globalvar *var;
+ for (var = v->vars; var; var=var->next) {
+ tail = PyUnicode_FromString(var->name);
+ joined = PyUnicode_Concat(str, tail);
+ Py_DecRef(str);
+ Py_DecRef(tail);
+ str = joined;
+ if (var->next) {
+ tail = PyUnicode_InternFromString(", ");
+ joined = PyUnicode_Concat(str, tail);
+ Py_DecRef(str);
+ Py_DecRef(tail);
+ str = joined;
+ }
+ }
+ tail = PyUnicode_InternFromString(")");
+ joined = PyUnicode_Concat(str, tail);
+ Py_DecRef(str);
+ Py_DecRef(tail);
+ str = joined;
+#else
+ PyObject *str = PyString_FromString("(");
+ swig_globalvar *var;
+ for (var = v->vars; var; var=var->next) {
+ PyString_ConcatAndDel(&str,PyString_FromString(var->name));
+ if (var->next) PyString_ConcatAndDel(&str,PyString_FromString(", "));
+ }
+ PyString_ConcatAndDel(&str,PyString_FromString(")"));
+#endif
+ return str;
+ }
+
+ SWIGINTERN int
+ swig_varlink_print(swig_varlinkobject *v, FILE *fp, int SWIGUNUSEDPARM(flags)) {
+ PyObject *str = swig_varlink_str(v);
+ fprintf(fp,"Swig global variables ");
+ fprintf(fp,"%s\n", SWIG_Python_str_AsChar(str));
+ Py_DECREF(str);
+ return 0;
+ }
+
+ SWIGINTERN void
+ swig_varlink_dealloc(swig_varlinkobject *v) {
+ swig_globalvar *var = v->vars;
+ while (var) {
+ swig_globalvar *n = var->next;
+ free(var->name);
+ free(var);
+ var = n;
+ }
+ }
+
+ SWIGINTERN PyObject *
+ swig_varlink_getattr(swig_varlinkobject *v, char *n) {
+ PyObject *res = NULL;
+ swig_globalvar *var = v->vars;
+ while (var) {
+ if (strcmp(var->name,n) == 0) {
+ res = (*var->get_attr)();
+ break;
+ }
+ var = var->next;
+ }
+ if (res == NULL && !PyErr_Occurred()) {
+ PyErr_SetString(PyExc_NameError,"Unknown C global variable");
+ }
+ return res;
+ }
+
+ SWIGINTERN int
+ swig_varlink_setattr(swig_varlinkobject *v, char *n, PyObject *p) {
+ int res = 1;
+ swig_globalvar *var = v->vars;
+ while (var) {
+ if (strcmp(var->name,n) == 0) {
+ res = (*var->set_attr)(p);
+ break;
+ }
+ var = var->next;
+ }
+ if (res == 1 && !PyErr_Occurred()) {
+ PyErr_SetString(PyExc_NameError,"Unknown C global variable");
+ }
+ return res;
+ }
+
+ SWIGINTERN PyTypeObject*
+ swig_varlink_type(void) {
+ static char varlink__doc__[] = "Swig var link object";
+ static PyTypeObject varlink_type;
+ static int type_init = 0;
+ if (!type_init) {
+ const PyTypeObject tmp
+ = {
+ /* PyObject header changed in Python 3 */
+#if PY_VERSION_HEX >= 0x03000000
+ PyVarObject_HEAD_INIT(&PyType_Type, 0)
+#else
+ PyObject_HEAD_INIT(NULL)
+ 0, /* Number of items in variable part (ob_size) */
+#endif
+ (char *)"swigvarlink", /* Type name (tp_name) */
+ sizeof(swig_varlinkobject), /* Basic size (tp_basicsize) */
+ 0, /* Itemsize (tp_itemsize) */
+ (destructor) swig_varlink_dealloc, /* Deallocator (tp_dealloc) */
+ (printfunc) swig_varlink_print, /* Print (tp_print) */
+ (getattrfunc) swig_varlink_getattr, /* get attr (tp_getattr) */
+ (setattrfunc) swig_varlink_setattr, /* Set attr (tp_setattr) */
+ 0, /* tp_compare */
+ (reprfunc) swig_varlink_repr, /* tp_repr */
+ 0, /* tp_as_number */
+ 0, /* tp_as_sequence */
+ 0, /* tp_as_mapping */
+ 0, /* tp_hash */
+ 0, /* tp_call */
+ (reprfunc)swig_varlink_str, /* tp_str */
+ 0, /* tp_getattro */
+ 0, /* tp_setattro */
+ 0, /* tp_as_buffer */
+ 0, /* tp_flags */
+ varlink__doc__, /* tp_doc */
+ 0, /* tp_traverse */
+ 0, /* tp_clear */
+ 0, /* tp_richcompare */
+ 0, /* tp_weaklistoffset */
+#if PY_VERSION_HEX >= 0x02020000
+ 0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0, /* tp_iter -> tp_weaklist */
+#endif
+#if PY_VERSION_HEX >= 0x02030000
+ 0, /* tp_del */
+#endif
+#ifdef COUNT_ALLOCS
+ 0,0,0,0 /* tp_alloc -> tp_next */
+#endif
+ };
+ varlink_type = tmp;
+ /* for Python 3 we already assigned the ob_type in PyVarObject_HEAD_INIT() */
+#if PY_VERSION_HEX < 0x03000000
+ varlink_type.ob_type = &PyType_Type;
+#endif
+ type_init = 1;
+ }
+ return &varlink_type;
+ }
+
+ /* Create a variable linking object for use later */
+ SWIGINTERN PyObject *
+ SWIG_Python_newvarlink(void) {
+ swig_varlinkobject *result = PyObject_NEW(swig_varlinkobject, swig_varlink_type());
+ if (result) {
+ result->vars = 0;
+ }
+ return ((PyObject*) result);
+ }
+
+ SWIGINTERN void
+ SWIG_Python_addvarlink(PyObject *p, char *name, PyObject *(*get_attr)(void), int (*set_attr)(PyObject *p)) {
+ swig_varlinkobject *v = (swig_varlinkobject *) p;
+ swig_globalvar *gv = (swig_globalvar *) malloc(sizeof(swig_globalvar));
+ if (gv) {
+ size_t size = strlen(name)+1;
+ gv->name = (char *)malloc(size);
+ if (gv->name) {
+ strncpy(gv->name,name,size);
+ gv->get_attr = get_attr;
+ gv->set_attr = set_attr;
+ gv->next = v->vars;
+ }
+ }
+ v->vars = gv;
+ }
+
+ SWIGINTERN PyObject *
+ SWIG_globals(void) {
+ static PyObject *_SWIG_globals = 0;
+ if (!_SWIG_globals) _SWIG_globals = SWIG_newvarlink();
+ return _SWIG_globals;
+ }
+
+ /* -----------------------------------------------------------------------------
+ * constants/methods manipulation
+ * ----------------------------------------------------------------------------- */
+
+ /* Install Constants */
+ SWIGINTERN void
+ SWIG_Python_InstallConstants(PyObject *d, swig_const_info constants[]) {
+ PyObject *obj = 0;
+ size_t i;
+ for (i = 0; constants[i].type; ++i) {
+ switch(constants[i].type) {
+ case SWIG_PY_POINTER:
+ obj = SWIG_NewPointerObj(constants[i].pvalue, *(constants[i]).ptype,0);
+ break;
+ case SWIG_PY_BINARY:
+ obj = SWIG_NewPackedObj(constants[i].pvalue, constants[i].lvalue, *(constants[i].ptype));
+ break;
+ default:
+ obj = 0;
+ break;
+ }
+ if (obj) {
+ PyDict_SetItemString(d, constants[i].name, obj);
+ Py_DECREF(obj);
+ }
+ }
+ }
+
+ /* -----------------------------------------------------------------------------*/
+ /* Fix SwigMethods to carry the callback ptrs when needed */
+ /* -----------------------------------------------------------------------------*/
+
+ SWIGINTERN void
+ SWIG_Python_FixMethods(PyMethodDef *methods,
+ swig_const_info *const_table,
+ swig_type_info **types,
+ swig_type_info **types_initial) {
+ size_t i;
+ for (i = 0; methods[i].ml_name; ++i) {
+ const char *c = methods[i].ml_doc;
+ if (c && (c = strstr(c, "swig_ptr: "))) {
+ int j;
+ swig_const_info *ci = 0;
+ const char *name = c + 10;
+ for (j = 0; const_table[j].type; ++j) {
+ if (strncmp(const_table[j].name, name,
+ strlen(const_table[j].name)) == 0) {
+ ci = &(const_table[j]);
+ break;
+ }
+ }
+ if (ci) {
+ size_t shift = (ci->ptype) - types;
+ swig_type_info *ty = types_initial[shift];
+ size_t ldoc = (c - methods[i].ml_doc);
+ size_t lptr = strlen(ty->name)+2*sizeof(void*)+2;
+ char *ndoc = (char*)malloc(ldoc + lptr + 10);
+ if (ndoc) {
+ char *buff = ndoc;
+ void *ptr = (ci->type == SWIG_PY_POINTER) ? ci->pvalue : 0;
+ if (ptr) {
+ strncpy(buff, methods[i].ml_doc, ldoc);
+ buff += ldoc;
+ strncpy(buff, "swig_ptr: ", 10);
+ buff += 10;
+ SWIG_PackVoidPtr(buff, ptr, ty->name, lptr);
+ methods[i].ml_doc = ndoc;
+ }
+ }
+ }
+ }
+ }
+ }
+
+#ifdef __cplusplus
+}
+#endif
+
+/* -----------------------------------------------------------------------------*
+ * Partial Init method
+ * -----------------------------------------------------------------------------*/
+
+#ifdef __cplusplus
+extern "C"
+#endif
+
+SWIGEXPORT
+#if PY_VERSION_HEX >= 0x03000000
+PyObject*
+#else
+void
+#endif
+SWIG_init(void) {
+ PyObject *m, *d;
+
+ /* Fix SwigMethods to carry the callback ptrs when needed */
+ SWIG_Python_FixMethods(SwigMethods, swig_const_table, swig_types, swig_type_initial);
+#if PY_VERSION_HEX >= 0x03000000
+ static struct PyModuleDef SWIG_module = {
+ PyModuleDef_HEAD_INIT,
+ (char *) SWIG_name,
+ NULL,
+ -1,
+ SwigMethods,
+ NULL,
+ NULL,
+ NULL,
+ NULL
+ };
+
+ m = PyModule_Create(&SWIG_module);
+#else
+ m = Py_InitModule((char *) SWIG_name, SwigMethods);
+#endif
+ d = PyModule_GetDict(m);
+
+ SWIG_InitializeModule(0);
+ SWIG_InstallConstants(d,swig_const_table);
+
+
+ SWIG_Python_SetConstant(d, "twrap_media_none",SWIG_From_int(static_cast< int >(twrap_media_none)));
+ SWIG_Python_SetConstant(d, "twrap_media_audio",SWIG_From_int(static_cast< int >(twrap_media_audio)));
+ SWIG_Python_SetConstant(d, "twrap_media_video",SWIG_From_int(static_cast< int >(twrap_media_video)));
+ SWIG_Python_SetConstant(d, "twrap_media_audiovideo",SWIG_From_int(static_cast< int >(twrap_media_audiovideo)));
+ SWIG_Python_SetConstant(d, "twrap_media_msrp",SWIG_From_int(static_cast< int >(twrap_media_msrp)));
+ SWIG_Python_SetConstant(d, "twrap_proxy_plugin_audio_producer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_audio_producer)));
+ SWIG_Python_SetConstant(d, "twrap_proxy_plugin_video_producer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_video_producer)));
+ SWIG_Python_SetConstant(d, "twrap_proxy_plugin_audio_consumer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_audio_consumer)));
+ SWIG_Python_SetConstant(d, "twrap_proxy_plugin_video_consumer",SWIG_From_int(static_cast< int >(twrap_proxy_plugin_video_consumer)));
+ SWIG_Python_SetConstant(d, "tsip_event_invite",SWIG_From_int(static_cast< int >(tsip_event_invite)));
+ SWIG_Python_SetConstant(d, "tsip_event_message",SWIG_From_int(static_cast< int >(tsip_event_message)));
+ SWIG_Python_SetConstant(d, "tsip_event_options",SWIG_From_int(static_cast< int >(tsip_event_options)));
+ SWIG_Python_SetConstant(d, "tsip_event_publish",SWIG_From_int(static_cast< int >(tsip_event_publish)));
+ SWIG_Python_SetConstant(d, "tsip_event_register",SWIG_From_int(static_cast< int >(tsip_event_register)));
+ SWIG_Python_SetConstant(d, "tsip_event_subscribe",SWIG_From_int(static_cast< int >(tsip_event_subscribe)));
+ SWIG_Python_SetConstant(d, "tsip_event_dialog",SWIG_From_int(static_cast< int >(tsip_event_dialog)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_transport_error",SWIG_From_int(static_cast< int >(702)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_global_error",SWIG_From_int(static_cast< int >(703)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_message_error",SWIG_From_int(static_cast< int >(704)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_incoming",SWIG_From_int(static_cast< int >(800)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_cancelled",SWIG_From_int(static_cast< int >(801)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_request_sent",SWIG_From_int(static_cast< int >(802)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_connecting",SWIG_From_int(static_cast< int >(900)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_connected",SWIG_From_int(static_cast< int >(901)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_terminating",SWIG_From_int(static_cast< int >(902)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_dialog_terminated",SWIG_From_int(static_cast< int >(903)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_stack_started",SWIG_From_int(static_cast< int >(950)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_stack_stopped",SWIG_From_int(static_cast< int >(951)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_stack_failed_to_start",SWIG_From_int(static_cast< int >(952)));
+ SWIG_Python_SetConstant(d, "tsip_event_code_stack_failed_to_stop",SWIG_From_int(static_cast< int >(953)));
+ SWIG_Python_SetConstant(d, "tsip_i_newreg",SWIG_From_int(static_cast< int >(tsip_i_newreg)));
+ SWIG_Python_SetConstant(d, "tsip_i_register",SWIG_From_int(static_cast< int >(tsip_i_register)));
+ SWIG_Python_SetConstant(d, "tsip_ao_register",SWIG_From_int(static_cast< int >(tsip_ao_register)));
+ SWIG_Python_SetConstant(d, "tsip_i_unregister",SWIG_From_int(static_cast< int >(tsip_i_unregister)));
+ SWIG_Python_SetConstant(d, "tsip_ao_unregister",SWIG_From_int(static_cast< int >(tsip_ao_unregister)));
+ SWIG_Python_SetConstant(d, "tsip_i_subscribe",SWIG_From_int(static_cast< int >(tsip_i_subscribe)));
+ SWIG_Python_SetConstant(d, "tsip_ao_subscribe",SWIG_From_int(static_cast< int >(tsip_ao_subscribe)));
+ SWIG_Python_SetConstant(d, "tsip_i_unsubscribe",SWIG_From_int(static_cast< int >(tsip_i_unsubscribe)));
+ SWIG_Python_SetConstant(d, "tsip_ao_unsubscribe",SWIG_From_int(static_cast< int >(tsip_ao_unsubscribe)));
+ SWIG_Python_SetConstant(d, "tsip_i_notify",SWIG_From_int(static_cast< int >(tsip_i_notify)));
+ SWIG_Python_SetConstant(d, "tsip_ao_notify",SWIG_From_int(static_cast< int >(tsip_ao_notify)));
+ SWIG_Python_SetConstant(d, "tsip_i_publish",SWIG_From_int(static_cast< int >(tsip_i_publish)));
+ SWIG_Python_SetConstant(d, "tsip_ao_publish",SWIG_From_int(static_cast< int >(tsip_ao_publish)));
+ SWIG_Python_SetConstant(d, "tsip_i_unpublish",SWIG_From_int(static_cast< int >(tsip_i_unpublish)));
+ SWIG_Python_SetConstant(d, "tsip_ao_unpublish",SWIG_From_int(static_cast< int >(tsip_ao_unpublish)));
+ SWIG_Python_SetConstant(d, "tsip_i_message",SWIG_From_int(static_cast< int >(tsip_i_message)));
+ SWIG_Python_SetConstant(d, "tsip_ao_message",SWIG_From_int(static_cast< int >(tsip_ao_message)));
+ SWIG_Python_SetConstant(d, "tsip_i_options",SWIG_From_int(static_cast< int >(tsip_i_options)));
+ SWIG_Python_SetConstant(d, "tsip_ao_options",SWIG_From_int(static_cast< int >(tsip_ao_options)));
+ SWIG_Python_SetConstant(d, "tsip_i_newcall",SWIG_From_int(static_cast< int >(tsip_i_newcall)));
+ SWIG_Python_SetConstant(d, "tsip_i_request",SWIG_From_int(static_cast< int >(tsip_i_request)));
+ SWIG_Python_SetConstant(d, "tsip_ao_request",SWIG_From_int(static_cast< int >(tsip_ao_request)));
+ SWIG_Python_SetConstant(d, "tsip_o_ect_ok",SWIG_From_int(static_cast< int >(tsip_o_ect_ok)));
+ SWIG_Python_SetConstant(d, "tsip_o_ect_nok",SWIG_From_int(static_cast< int >(tsip_o_ect_nok)));
+ SWIG_Python_SetConstant(d, "tsip_i_ect",SWIG_From_int(static_cast< int >(tsip_i_ect)));
+ SWIG_Python_SetConstant(d, "tsip_m_early_media",SWIG_From_int(static_cast< int >(tsip_m_early_media)));
+ SWIG_Python_SetConstant(d, "tsip_m_local_hold_ok",SWIG_From_int(static_cast< int >(tsip_m_local_hold_ok)));
+ SWIG_Python_SetConstant(d, "tsip_m_local_hold_nok",SWIG_From_int(static_cast< int >(tsip_m_local_hold_nok)));
+ SWIG_Python_SetConstant(d, "tsip_m_local_resume_ok",SWIG_From_int(static_cast< int >(tsip_m_local_resume_ok)));
+ SWIG_Python_SetConstant(d, "tsip_m_local_resume_nok",SWIG_From_int(static_cast< int >(tsip_m_local_resume_nok)));
+ SWIG_Python_SetConstant(d, "tsip_m_remote_hold",SWIG_From_int(static_cast< int >(tsip_m_remote_hold)));
+ SWIG_Python_SetConstant(d, "tsip_m_remote_resume",SWIG_From_int(static_cast< int >(tsip_m_remote_resume)));
+ SWIG_Python_SetConstant(d, "tmedia_rgb24",SWIG_From_int(static_cast< int >(tmedia_rgb24)));
+ SWIG_Python_SetConstant(d, "tmedia_bgr24",SWIG_From_int(static_cast< int >(tmedia_bgr24)));
+ SWIG_Python_SetConstant(d, "tmedia_rgb32",SWIG_From_int(static_cast< int >(tmedia_rgb32)));
+ SWIG_Python_SetConstant(d, "tmedia_rgb565le",SWIG_From_int(static_cast< int >(tmedia_rgb565le)));
+ SWIG_Python_SetConstant(d, "tmedia_rgb565be",SWIG_From_int(static_cast< int >(tmedia_rgb565be)));
+ SWIG_Python_SetConstant(d, "tmedia_nv12",SWIG_From_int(static_cast< int >(tmedia_nv12)));
+ SWIG_Python_SetConstant(d, "tmedia_nv21",SWIG_From_int(static_cast< int >(tmedia_nv21)));
+ SWIG_Python_SetConstant(d, "tmedia_yuv422p",SWIG_From_int(static_cast< int >(tmedia_yuv422p)));
+ SWIG_Python_SetConstant(d, "tmedia_uyvy422",SWIG_From_int(static_cast< int >(tmedia_uyvy422)));
+ SWIG_Python_SetConstant(d, "tmedia_yuv420p",SWIG_From_int(static_cast< int >(tmedia_yuv420p)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_stype_none",SWIG_From_int(static_cast< int >(tmedia_qos_stype_none)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_stype_segmented",SWIG_From_int(static_cast< int >(tmedia_qos_stype_segmented)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_stype_e2e",SWIG_From_int(static_cast< int >(tmedia_qos_stype_e2e)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_strength_none",SWIG_From_int(static_cast< int >(tmedia_qos_strength_none)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_strength_failure",SWIG_From_int(static_cast< int >(tmedia_qos_strength_failure)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_strength_unknown",SWIG_From_int(static_cast< int >(tmedia_qos_strength_unknown)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_strength_optional",SWIG_From_int(static_cast< int >(tmedia_qos_strength_optional)));
+ SWIG_Python_SetConstant(d, "tmedia_qos_strength_mandatory",SWIG_From_int(static_cast< int >(tmedia_qos_strength_mandatory)));
+ SWIG_Python_SetConstant(d, "tmedia_bl_low",SWIG_From_int(static_cast< int >(tmedia_bl_low)));
+ SWIG_Python_SetConstant(d, "tmedia_bl_medium",SWIG_From_int(static_cast< int >(tmedia_bl_medium)));
+ SWIG_Python_SetConstant(d, "tmedia_bl_hight",SWIG_From_int(static_cast< int >(tmedia_bl_hight)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_none",SWIG_From_int(static_cast< int >(tdav_codec_id_none)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_amr_nb_oa",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_nb_oa)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_amr_nb_be",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_nb_be)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_amr_wb_oa",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_wb_oa)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_amr_wb_be",SWIG_From_int(static_cast< int >(tdav_codec_id_amr_wb_be)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_gsm",SWIG_From_int(static_cast< int >(tdav_codec_id_gsm)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_pcma",SWIG_From_int(static_cast< int >(tdav_codec_id_pcma)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_pcmu",SWIG_From_int(static_cast< int >(tdav_codec_id_pcmu)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_ilbc",SWIG_From_int(static_cast< int >(tdav_codec_id_ilbc)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_speex_nb",SWIG_From_int(static_cast< int >(tdav_codec_id_speex_nb)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_speex_wb",SWIG_From_int(static_cast< int >(tdav_codec_id_speex_wb)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_speex_uwb",SWIG_From_int(static_cast< int >(tdav_codec_id_speex_uwb)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_bv16",SWIG_From_int(static_cast< int >(tdav_codec_id_bv16)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_bv32",SWIG_From_int(static_cast< int >(tdav_codec_id_bv32)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_evrc",SWIG_From_int(static_cast< int >(tdav_codec_id_evrc)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_g729ab",SWIG_From_int(static_cast< int >(tdav_codec_id_g729ab)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h261",SWIG_From_int(static_cast< int >(tdav_codec_id_h261)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h263",SWIG_From_int(static_cast< int >(tdav_codec_id_h263)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h263p",SWIG_From_int(static_cast< int >(tdav_codec_id_h263p)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h263pp",SWIG_From_int(static_cast< int >(tdav_codec_id_h263pp)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp10",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp10)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp20",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp20)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_h264_bp30",SWIG_From_int(static_cast< int >(tdav_codec_id_h264_bp30)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_theora",SWIG_From_int(static_cast< int >(tdav_codec_id_theora)));
+ SWIG_Python_SetConstant(d, "tdav_codec_id_mp4ves_es",SWIG_From_int(static_cast< int >(tdav_codec_id_mp4ves_es)));
+ SWIG_Python_SetConstant(d, "thttp_event_dialog_started",SWIG_From_int(static_cast< int >(thttp_event_dialog_started)));
+ SWIG_Python_SetConstant(d, "thttp_event_message",SWIG_From_int(static_cast< int >(thttp_event_message)));
+ SWIG_Python_SetConstant(d, "thttp_event_auth_failed",SWIG_From_int(static_cast< int >(thttp_event_auth_failed)));
+ SWIG_Python_SetConstant(d, "thttp_event_closed",SWIG_From_int(static_cast< int >(thttp_event_closed)));
+ SWIG_Python_SetConstant(d, "thttp_event_transport_error",SWIG_From_int(static_cast< int >(thttp_event_transport_error)));
+ SWIG_Python_SetConstant(d, "thttp_event_dialog_terminated",SWIG_From_int(static_cast< int >(thttp_event_dialog_terminated)));
+ SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_none",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_none)));
+ SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_submit",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_submit)));
+ SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_deliver",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_deliver)));
+ SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_ack",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_ack)));
+ SWIG_Python_SetConstant(d, "twrap_rpmessage_type_sms_error",SWIG_From_int(static_cast< int >(twrap_rpmessage_type_sms_error)));
+ SWIG_Python_SetConstant(d, "twrap_sms_type_none",SWIG_From_int(static_cast< int >(twrap_sms_type_none)));
+ SWIG_Python_SetConstant(d, "twrap_sms_type_rpdata",SWIG_From_int(static_cast< int >(twrap_sms_type_rpdata)));
+ SWIG_Python_SetConstant(d, "twrap_sms_type_smma",SWIG_From_int(static_cast< int >(twrap_sms_type_smma)));
+ SWIG_Python_SetConstant(d, "twrap_sms_type_ack",SWIG_From_int(static_cast< int >(twrap_sms_type_ack)));
+ SWIG_Python_SetConstant(d, "twrap_sms_type_error",SWIG_From_int(static_cast< int >(twrap_sms_type_error)));
+ SWIG_Python_SetConstant(d, "tmsrp_NONE",SWIG_From_int(static_cast< int >(tmsrp_NONE)));
+ SWIG_Python_SetConstant(d, "tmsrp_SEND",SWIG_From_int(static_cast< int >(tmsrp_SEND)));
+ SWIG_Python_SetConstant(d, "tmsrp_REPORT",SWIG_From_int(static_cast< int >(tmsrp_REPORT)));
+ SWIG_Python_SetConstant(d, "tmsrp_AUTH",SWIG_From_int(static_cast< int >(tmsrp_AUTH)));
+ SWIG_Python_SetConstant(d, "tmsrp_event_type_none",SWIG_From_int(static_cast< int >(tmsrp_event_type_none)));
+ SWIG_Python_SetConstant(d, "tmsrp_event_type_connected",SWIG_From_int(static_cast< int >(tmsrp_event_type_connected)));
+ SWIG_Python_SetConstant(d, "tmsrp_event_type_disconnected",SWIG_From_int(static_cast< int >(tmsrp_event_type_disconnected)));
+ SWIG_Python_SetConstant(d, "tmsrp_event_type_message",SWIG_From_int(static_cast< int >(tmsrp_event_type_message)));
+#if PY_VERSION_HEX >= 0x03000000
+ return m;
+#else
+ return;
+#endif
+}
+
diff --git a/bindings/python/tinyWRAP_wrap.h b/bindings/python/tinyWRAP_wrap.h
new file mode 100644
index 0000000..ceef2e3
--- /dev/null
+++ b/bindings/python/tinyWRAP_wrap.h
@@ -0,0 +1,447 @@
+/* ----------------------------------------------------------------------------
+ * This file was automatically generated by SWIG (http://www.swig.org).
+ * Version 1.3.39
+ *
+ * This file is not intended to be easily readable and contains a number of
+ * coding conventions designed to improve portability and efficiency. Do not make
+ * changes to this file unless you know what you are doing--modify the SWIG
+ * interface file instead.
+ * ----------------------------------------------------------------------------- */
+
+#ifndef SWIG_tinyWRAP_WRAP_H_
+#define SWIG_tinyWRAP_WRAP_H_
+
+#include <map>
+#include <string>
+
+
+class SwigDirector_DDebugCallback : public DDebugCallback, public Swig::Director {
+
+public:
+ SwigDirector_DDebugCallback(PyObject *self);
+ virtual ~SwigDirector_DDebugCallback();
+ virtual int OnDebugInfo(char const *message);
+ virtual int OnDebugWarn(char const *message);
+ virtual int OnDebugError(char const *message);
+ virtual int OnDebugFatal(char const *message);
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class DDebugCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[4];
+#endif
+
+};
+
+
+class SwigDirector_ProxyPluginMgrCallback : public ProxyPluginMgrCallback, public Swig::Director {
+
+public:
+ SwigDirector_ProxyPluginMgrCallback(PyObject *self);
+ virtual ~SwigDirector_ProxyPluginMgrCallback();
+ virtual int OnPluginCreated(uint64_t id, enum twrap_proxy_plugin_type_e type);
+ virtual int OnPluginDestroyed(uint64_t id, enum twrap_proxy_plugin_type_e type);
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class ProxyPluginMgrCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[2];
+#endif
+
+};
+
+
+class SwigDirector_ProxyAudioConsumerCallback : public ProxyAudioConsumerCallback, public Swig::Director {
+
+public:
+ SwigDirector_ProxyAudioConsumerCallback(PyObject *self);
+ virtual ~SwigDirector_ProxyAudioConsumerCallback();
+ virtual int prepare(int ptime, int rate, int channels);
+ virtual int start();
+ virtual int pause();
+ virtual int stop();
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class ProxyAudioConsumerCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[4];
+#endif
+
+};
+
+
+class SwigDirector_ProxyVideoConsumerCallback : public ProxyVideoConsumerCallback, public Swig::Director {
+
+public:
+ SwigDirector_ProxyVideoConsumerCallback(PyObject *self);
+ virtual ~SwigDirector_ProxyVideoConsumerCallback();
+ virtual int prepare(int width, int height, int fps);
+ virtual int consume(ProxyVideoFrame const *frame);
+ virtual int start();
+ virtual int pause();
+ virtual int stop();
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class ProxyVideoConsumerCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[5];
+#endif
+
+};
+
+
+class SwigDirector_ProxyAudioProducerCallback : public ProxyAudioProducerCallback, public Swig::Director {
+
+public:
+ SwigDirector_ProxyAudioProducerCallback(PyObject *self);
+ virtual ~SwigDirector_ProxyAudioProducerCallback();
+ virtual int prepare(int ptime, int rate, int channels);
+ virtual int start();
+ virtual int pause();
+ virtual int stop();
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class ProxyAudioProducerCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[4];
+#endif
+
+};
+
+
+class SwigDirector_ProxyVideoProducerCallback : public ProxyVideoProducerCallback, public Swig::Director {
+
+public:
+ SwigDirector_ProxyVideoProducerCallback(PyObject *self);
+ virtual ~SwigDirector_ProxyVideoProducerCallback();
+ virtual int prepare(int width, int height, int fps);
+ virtual int start();
+ virtual int pause();
+ virtual int stop();
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class ProxyVideoProducerCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[4];
+#endif
+
+};
+
+
+class SwigDirector_SipCallback : public SipCallback, public Swig::Director {
+
+public:
+ SwigDirector_SipCallback(PyObject *self);
+ virtual ~SwigDirector_SipCallback();
+ virtual int OnDialogEvent(DialogEvent const *e);
+ virtual int OnStackEvent(StackEvent const *e);
+ virtual int OnInviteEvent(InviteEvent const *e);
+ virtual int OnMessagingEvent(MessagingEvent const *e);
+ virtual int OnOptionsEvent(OptionsEvent const *e);
+ virtual int OnPublicationEvent(PublicationEvent const *e);
+ virtual int OnRegistrationEvent(RegistrationEvent const *e);
+ virtual int OnSubscriptionEvent(SubscriptionEvent const *e);
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class SipCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[8];
+#endif
+
+};
+
+
+class SwigDirector_XcapCallback : public XcapCallback, public Swig::Director {
+
+public:
+ SwigDirector_XcapCallback(PyObject *self);
+ virtual ~SwigDirector_XcapCallback();
+ virtual int onEvent(XcapEvent const *e) const;
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class XcapCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[1];
+#endif
+
+};
+
+
+class SwigDirector_MsrpCallback : public MsrpCallback, public Swig::Director {
+
+public:
+ SwigDirector_MsrpCallback(PyObject *self);
+ virtual ~SwigDirector_MsrpCallback();
+ virtual int OnEvent(MsrpEvent const *e);
+
+
+/* Internal Director utilities */
+public:
+ bool swig_get_inner(const char* name) const {
+ std::map<std::string, bool>::const_iterator iv = inner.find(name);
+ return (iv != inner.end() ? iv->second : false);
+ }
+
+ void swig_set_inner(const char* name, bool val) const
+ { inner[name] = val;}
+
+private:
+ mutable std::map<std::string, bool> inner;
+
+
+#if defined(SWIG_PYTHON_DIRECTOR_VTABLE)
+/* VTable implementation */
+ PyObject *swig_get_method(size_t method_index, const char *method_name) const {
+ PyObject *method = vtable[method_index];
+ if (!method) {
+ swig::SwigVar_PyObject name = SWIG_Python_str_FromChar(method_name);
+ method = PyObject_GetAttr(swig_get_self(), name);
+ if (method == NULL) {
+ std::string msg = "Method in class MsrpCallback doesn't exist, undefined ";
+ msg += method_name;
+ Swig::DirectorMethodException::raise(msg.c_str());
+ }
+ vtable[method_index] = method;
+ };
+ return method;
+ }
+private:
+ mutable swig::SwigVar_PyObject vtable[1];
+#endif
+
+};
+
+
+#endif
OpenPOWER on IntegriCloud