summaryrefslogtreecommitdiffstats
path: root/sys/net
Commit message (Expand)AuthorAgeFilesLines
* Don't to forget to unlock the rwlock on trunk before destroying it.yar2006-02-241-2/+3
* Fix build.glebius2006-02-151-2/+2
* - Introduce ifmedia_baudrate(), which returns correct baudrate of theglebius2006-02-142-2/+82
* Bump the MODULE_VERSION for HEAD, as the vlan(4) API is different inemaste2006-02-101-1/+1
* Avoid frobbing IFF_UP at any cost (which is close toyar2006-02-101-2/+0
* Add a MODULE_VERSION so that other modules (perhaps third-party) canemaste2006-02-091-0/+1
* The code in rn_walktree_from() that checks if we backed up too farqingli2006-02-071-1/+9
* Remove two unnecessary type casts, of which both had a typo inqingli2006-02-071-2/+2
* Properly initialize args structure before passing it to ipfw_chk(): havingoleg2006-02-032-0/+2
* In vlan_config() first call vlan_inithash(), then lock mutex, becauseglebius2006-02-021-4/+6
* define lock.h before rwlock.h for DEBUG_LOCKScsjp2006-02-021-0/+1
* Implement SIOCGIFCONF for 32bit binaries.ps2006-02-022-0/+31
* Use PFIL_HOOKED macros in if_bridge and pass the right argument tocsjp2006-02-021-10/+10
* Somewhat re-factor the read/write locking mechanism associated with the packetcsjp2006-02-022-111/+33
* Fix two bugs with the bridgethompsa2006-01-311-3/+17
* Set IFF_BROADCAST and IFF_MULTICAST on vlan interfaces from theyar2006-01-311-2/+5
* Merge the //depot/user/yar/vlan branch into CVS. It contains some collectiveglebius2006-01-306-130/+480
* Add some initial locking to gif(4). It doesn't covers the whole driver,glebius2006-01-302-25/+22
* Make sure buffers in if_bridge are fully initialized before copyingcperciva2006-01-251-0/+3
* Be consistent in checking ifa->ifa_addr for NULL.yar2006-01-231-1/+1
* Fix stack corruptions on amd64.bz2006-01-211-2/+2
* Return mbuf pointer or NULL from ip_fastforward() as the mbuf pointerandre2006-01-187-8/+8
* Add code that clears certain capabilities from the member interface, these arethompsa2006-01-142-10/+51
* Check the right ifnet pointer to see if if_alloc() failed or not inrwatson2006-01-131-1/+3
* When freeing the chain of if_ef devices on an aborted load, userwatson2006-01-131-2/+2
* Get rid of the bogus IFP2FC() macro and use IFP2FWC(). IFP2FC()brooks2006-01-111-7/+5
* Add a new leaf to the net.link.generic.ifdata.%d sysctl to retrieveharti2006-01-042-1/+19
* Correctly check the filter length. I committed the wrong version.jkim2006-01-031-1/+6
* - Explicitly validate an empty filter to match bpf_filter() comment[1].jkim2006-01-031-1/+1
* Fix a brain-o in the last commit, the conditional was always false.thompsa2006-01-021-1/+1
* Reorganise bridge_rtupdate slightly to reduce duplication.thompsa2006-01-021-3/+2
* Reset the route expiry time on each update rather than always letting them getthompsa2006-01-021-4/+3
* It is better to use time_uptime here since it is monotonic.thompsa2006-01-021-5/+5
* Minor whitespace cleanup.thompsa2006-01-022-19/+18
* Read time_second directly rather than calling getmicrotime().thompsa2006-01-021-13/+5
* When pfil(9) is enabled the bridge only considers ETHERTYPE_ARP, ETHERTYPE_IP...thompsa2005-12-291-5/+13
* add a sysctl to turn debug msgs on/off when built with IFMEDIA_DEBUGsam2005-12-251-0/+4
* 1) remove useless check of loop_copy - corresponding code was removed inoleg2005-12-221-5/+5
* Add RFC 3378 EtherIP support. This change makes it possible to add gifthompsa2005-12-213-10/+95
* As of r1.21 all broadcast packets are reprocessed by ether_input as arriving onthompsa2005-12-211-2/+6
* - Fix VLAN_INPUT_TAG() macro, so that it doesn't touch mtag inglebius2005-12-181-6/+7
* Use M_ZERO for the bridge_iflist to ensure there are no unexpected suprises.thompsa2005-12-171-1/+1
* Minor whitespace cleanup.thompsa2005-12-172-31/+31
* Change from a callback in if_ethersubr to using EVENTHANDLER in order to detachthompsa2005-12-173-21/+67
* It is not safe to use m_copypacket() here as the returned mbuf is readonly,thompsa2005-12-151-1/+6
* Add support for creating span ports so that one can snoop bridged trafficthompsa2005-12-142-1/+152
* Do not accept an empty bpf program.jkim2005-12-081-0/+3
* Add BPF Just-In-Time compiler support for ng_bpf(4).jkim2005-12-073-6/+8
* s/M_WAITOK/M_NOWAIT/ while mutex is held.jkim2005-12-061-2/+2
* Add experimental BPF Just-In-Time compiler for amd64 and i386.jkim2005-12-064-3/+222
OpenPOWER on IntegriCloud