summaryrefslogtreecommitdiffstats
path: root/sys/kern/sys_procdesc.c
Commit message (Expand)AuthorAgeFilesLines
* MFC r303382:kib2016-08-261-1/+2
* Introduce the PD_CLOEXEC for pdfork(2).oshogbo2016-06-081-0/+16
* The si_status field of the siginfo_t, provided by the waitid(2) andkib2015-07-181-1/+1
* Add a new fo_fill_kinfo fileops method to add type-specific information tojhb2014-09-221-0/+14
* Fix various issues with invalid file operations:jhb2014-09-121-59/+6
* Implement kqueue(2) for procdesc(4).ed2014-04-071-1/+65
* Fix a typo. The function name is pdfork; not pfork.ed2014-04-061-1/+1
* Nit: fix locking of p->p_state in procdesc_close().ed2014-04-061-31/+33
* Update kernel inclusions of capability.h to use capsicum.h instead; somerwatson2014-03-161-1/+1
* Make process descriptors standard part of the kernel. rwhod(8) alreadypjd2013-11-301-15/+0
* Change the cap_rights_t type from uint64_t to a structure that we can extendpjd2013-09-051-5/+7
* Restore the previous sendfile(2) behaviour on the block devices.kib2013-08-161-0/+1
* Add the wait6(2) system call. It takes POSIX waitid()-like processkib2012-11-131-1/+1
* Fix panic in procdesc that can be triggered in the following scenario:pjd2012-09-011-2/+10
* Check proper flag (PDF_DAEMON, not PD_DAEMON) when deciding if the processpjd2012-06-191-2/+2
* In order to maximize the re-usability of kernel code in user space thiskmacy2011-09-161-3/+3
* Add experimental support for process descriptorsjonathan2011-08-181-0/+524
OpenPOWER on IntegriCloud