summaryrefslogtreecommitdiffstats
path: root/share
Commit message (Expand)AuthorAgeFilesLines
* s/MYRI10GE/MXGE/ and a typo fixed.brueffer2006-06-131-2/+2
* - Complete the myri10ge -> mxge name change by doing a mechanicalgallatin2006-06-132-11/+12
* o vinum.8 -> gvinum.8 as the former was replaced by the latter.maxim2006-06-111-16/+16
* The monetary decimal point (mon_decimal_point) for pt_PT.ISO8859-1simon2006-06-111-2/+2
* Cross-reference src.conf(5).jkoshy2006-06-111-0/+1
* Be explicit about which chips support jumbo frames.brueffer2006-06-101-1/+2
* Move the reset beep tunable/sysctl to debug.acpi.resume_beep. This makesnjl2006-06-101-2/+10
* o Catch up v_flag split and replace VSYSTEM by VV_SYSTEM.maxim2006-06-081-1/+1
* Catch up with the rename of symbol VDOOMED to VI_DOOMED in revisionjkoshy2006-06-071-3/+1
* Add section describing how ARP load balancing works and itsglebius2006-06-071-8/+34
* Reflect latest changes in rc.subr wrt prefix/etcdir variables being setflz2006-06-071-11/+37
* Cleanups for mailwrapper(8):delphij2006-06-061-19/+64
* Some mdoc and wording improvements.brueffer2006-06-051-6/+7
* o Add missed comma.maxim2006-06-051-1/+1
* Just a very quick update to get *close* to reality.mjacob2006-06-051-8/+43
* my(4) provides support now as well.brueffer2006-06-051-1/+2
* Fix minor typos.joel2006-06-051-3/+3
* - Document that padlock(4) pretends to accelerate HMAC algorithms.pjd2006-06-051-2/+6
* Break out description of the audit pipe facility from audit.4 into a newrwatson2006-06-053-32/+257
* Document more bits.pjd2006-06-031-6/+29
* Strengthen wording; the KTR_ENTRIES value *must* be a power of two sincekris2006-06-031-1/+1
* doc fix: option MFS is obsolete. use MD_ROOT instead.motoyuki2006-06-021-1/+1
* Add rc.d/bridge which is invoked when a new interface arrives and canthompsa2006-06-011-0/+18
* Add jail_<jname>_exec_afterstart<N> rc.conf variable, where <N> ismatteo2006-05-301-1/+17
* Remove mention of minor number construction.phk2006-05-271-9/+0
* s/2005/2006/ for FreeBSD 6.1 and 5.5.maxim2006-05-261-2/+2
* o FreeBSD 5.5 added.maxim2006-05-251-20/+23
* Clarify that G_F_DISKIOCTL is unused, and remove G_T_DETAILS altogether,ceri2006-05-251-4/+2
* Clean up the grammar in here some.ceri2006-05-241-31/+32
* The (British) Crown Dependencies now have their own codes.wollman2006-05-231-1/+8
* Add a stub man page for device_get_sysctl{_ctx,tree}. Needs someimp2006-05-232-0/+61
* Document missing CRYPTO_F_ flags.pjd2006-05-231-1/+15
* Remove stale altq instructions. They don't belong to the driver manpagemlaier2006-05-201-43/+1
* ALTQ-ify nve(4).mlaier2006-05-201-1/+2
* Fix a formatting issue.brueffer2006-05-201-0/+1
* Make this example more real world usable: When the manpage first appearedbrueffer2006-05-201-1/+1
* Convert to use a SYNPOSIS section that mentions kernel modules.brueffer2006-05-2017-40/+232
* o Sort .Xrs, touch .Dd.maxim2006-05-201-4/+4
* Minimal manpage for the acpi_dock driver. This needs to be fleshed outbrueffer2006-05-202-0/+64
* Add description how to use caching.ume2006-05-201-7/+42
* We don't have d_maj field in cdevsw structure anymore.sobomax2006-05-191-8/+1
* Remove reference to mount_procfs, which is no longer used by mount(8).rodrigc2006-05-191-1/+7
* Remove reference to mount_linprocfs, which is no longer used by mount(8).rodrigc2006-05-191-1/+8
* Add two new scripts (mdconfig/mdconfig2) to replace old ramdisk{,-own}flz2006-05-181-1/+88
* Remove reference to mount_devfs(8), since mount(8) no longerrodrigc2006-05-181-5/+10
* Add a man page for ext2fs.rodrigc2006-05-172-0/+84
* Update HMAC algorithms.pjd2006-05-171-1/+3
* Update manual page: cri_rnd field is gone, cri_mlen field was added.pjd2006-05-171-5/+5
* Fix typo in device hint variablecsjp2006-05-171-1/+1
* o Replace alpha-specific DESTDIR to a sparc64 one.maxim2006-05-171-1/+1
OpenPOWER on IntegriCloud