diff options
author | phil <phil@FreeBSD.org> | 2016-04-12 23:30:56 +0000 |
---|---|---|
committer | phil <phil@FreeBSD.org> | 2016-04-12 23:30:56 +0000 |
commit | 47a6833363ee968ee9043b2fd0cb32a3c167381e (patch) | |
tree | 8b05bbc5cc8ee819294f6b59434398058cbd3ee1 /contrib/libxo/doc | |
parent | 628aed7218740590ae9043da02fdc85cee84dfe3 (diff) | |
parent | dbee4ad2b18e02c7c1efe919b37a0e6b39cab43c (diff) | |
download | FreeBSD-src-47a6833363ee968ee9043b2fd0cb32a3c167381e.zip FreeBSD-src-47a6833363ee968ee9043b2fd0cb32a3c167381e.tar.gz |
Merge libxo 0.4.6
Reviewed by: sjg
Approved by: sjg (mentor)
Diffstat (limited to 'contrib/libxo/doc')
-rw-r--r-- | contrib/libxo/doc/libxo-manual.html | 27134 |
1 files changed, 27134 insertions, 0 deletions
diff --git a/contrib/libxo/doc/libxo-manual.html b/contrib/libxo/doc/libxo-manual.html new file mode 100644 index 0000000..bc4463d --- /dev/null +++ b/contrib/libxo/doc/libxo-manual.html @@ -0,0 +1,27134 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD HTML 4.01//EN"> +<html lang="en"> +<head profile="http://www.w3.org/2006/03/hcard"> +<meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1"> +<title>libxo: The Easy Way to Generate text, XML, JSON, and HTML output</title> +<style type="text/css">/* + * $Id$ + * + * Copyright (c) 2006-2011, Juniper Networks, Inc. + * All rights reserved. + * This SOFTWARE is licensed under the LICENSE provided in the + * ../Copyright file. By downloading, installing, copying, or otherwise + * using the SOFTWARE, you agree to be bound by the terms of that + * LICENSE. + */ + +#media-inspector { + display:none +} +@media screen { + #media-inspector { z-index: 1 } +} +@media print { + #media-inspector { z-index: 2 } +} + +pre { + font-family: Consolas, Menlo, Monaco,Lucida Console, Liberation Mono, + DejaVu Sans Mono, Bitstream Vera Sans Mono, Courier New, + monospace, serif; + margin-bottom: 10px; +} + +@media screen { + hr.noprint { + display: none; + } + + h1, h2, h3, h4, h5 { + font-size: 14pt; + color: black; + margin: 0; + padding: 0; + } + h1 a, h2 a, h3 a, h4 a, h5 a { + font-size: 12pt; + color: black; + } + + div#top { + display: table; + } + + div#top-left { + display: table-cell; + width: 400px; + border: 1px solid black; + border-right: 0px; + } + + div#top-right { + display: table-cell; + width: 100%; + border: 1px solid black; + } + + div.section-number { + display: none; + } + + div.fake-content { + display: block; + background-color: #d0d0f0; + } + + div.fake-active { + display: block; + background-color: #f0d0d0; + } + + div#nav-bar { + display: inline-block; + float: right; + } + + div#nav-bar button#nav-next { + margin-right: 1em; + } + + div#nav-bar button { + border-radius: 4px; + } + + div.content { + display: none; + } + + div.active { + display: block; + } + + a.toc-active { + background-color: #dddddd; + } + + div.self-section-number { + display: none; + } + + div#debug-log { + white-space: pre-wrap; + } + + h1, h2, h3, h4, h5 { + margin: 0; + } + + div#toc { + overflow-y: scroll; + } + + div#toc > ul.toc { + margin-left: 2px; + } + + table.header { + display: none; + } + + p#title span.filename { + display: none; + } + + p#title { + margin-top: 20px; + } + + ul.top-toc { + display: none; + } + + ul.top-toc-open { + display: block; + } + + div.padding { + width: 300px; + } + +} + +@media print { + div.self-section-number, div.section-number { + display: block-inline; + } + + button { + display: none; + } + + h1 { + font-size: 14pt; + /* line-height: 21pt;*/ + page-break-after: avoid; + } + h1.np { + page-break-before: always; + } + h1 a { + color: #333333; + } + h2 { + font-size: 12pt; + /* line-height: 15pt; */ + page-break-after: avoid; + } + h2 a { + color: black; + } + h3 { + font-size: 10pt; + page-break-after: avoid; + } + h3 a { + color: black; + } + h4 { + font-size: 10pt; + page-break-after: avoid; + } + h4 a { + color: black; + } + h5 { + font-size: 10pt; + page-break-after: avoid; + } + h5 a { + color: black; + } +} + +p.section-contents, p.section-contents + ul { + background-color: #f8f8ff; + padding: 1em 0px 1em 3em; + border: 1px dotted #0000c0; +} + +p.section-contents + ul { + margin: 0px 1em 0px 3em; + border-top: 0px; +} + +p.section-contents { + margin: 3em 1em 0px 3em; + font-weight: bold; + border-bottom: 0px; + padding-bottom: 0px; +} +</style> +<style type="text/css" title="Xml2Rfc (sans serif)"> +a { + text-decoration: none; +} +a.smpl { + color: black; +} +a:hover { + text-decoration: underline; +} +a:active { + text-decoration: underline; +} +address { + margin-top: 1em; + margin-left: 2em; + font-style: normal; +} +body { + color: black; + font-family: verdana, helvetica, arial, sans-serif; + font-size: 10pt; +} +cite { + font-style: normal; +} +dd { + margin-right: 2em; +} +dl { + margin-left: 2em; +} + +dl.empty dd { + margin-top: .5em; +} +dl p { + margin-left: 0em; +} +dt { + margin-top: .5em; +} +img { + margin-left: 3em; +} +li { + margin-left: 2em; + margin-right: 2em; +} +ol { + margin-left: 2em; + margin-right: 2em; +} +ol p { + margin-left: 0em; +} +p { + margin-left: 2em; + margin-right: 2em; +} +pre { + margin-left: 3em; + background-color: lightyellow; + padding: .25em; + padding-top: 12px; + margin-right: 1em; + -moz-box-shadow: 0 0 4px #000000; + -webkit-box-shadow: 0 0 4px #000000; + box-shadow: 0 0 4px #000000; +} +pre.text2 { + border-style: dotted; + border-width: 1px; + background-color: #f0f0f0; + width: 69em; +} +pre.inline { + background-color: white; + padding: 0em; +} +pre.text { + border-style: dotted; + border-width: 1px; + background-color: #f8f8f8; + width: 69em; +} +pre.drawing { + border-style: solid; + border-width: 1px; + background-color: #f8f8f8; + padding: 2em; +} +table { + margin-left: 2em; +} +table.tt { + vertical-align: top; +} +table.full { + border-style: outset; + border-width: 1px; + margin-left: 3em; + background-color: lightyellow; + padding: .25em; + -moz-box-shadow: 0 0 4px #000000; + -webkit-box-shadow: 0 0 4px #000000; + box-shadow: 0 0 4px #000000; +} +table.headers { + border-style: outset; + border-width: 1px; +} +table.tt td { + vertical-align: top; +} +table.full td { + border-style: inset; + border-width: 1px; +} +table.tt th { + vertical-align: top; +} +table.full th { + border-style: inset; + border-width: 1px; +} +table.headers th { + border-style: none none inset none; + border-width: 1px; +} +table.header { + width: 95%; + font-size: 10pt; + color: white; +} +td.top { + vertical-align: top; +} +td.topnowrap { + vertical-align: top; + white-space: nowrap; +} +td.header { + background-color: gray; + width: 50%; +} +td.header a { + color: white; +} +td.reference { + vertical-align: top; + white-space: nowrap; + padding-right: 1em; +} +thead { + display:table-header-group; +} +ul.toc { + list-style: none; + margin-left: 1.5em; + margin-right: 0em; + padding-left: 0em; +} +li.tocline0 { + line-height: 150%; + font-weight: bold; + font-size: 10pt; + margin-left: 0em; + margin-right: 0em; +} +li.tocline1 { + line-height: normal; + font-weight: normal; + font-size: 9pt; + margin-left: 0em; + margin-right: 0em; +} +li.tocline2 { + font-size: 0pt; +} +ul p { + margin-left: 0em; +} +ul.ind { + list-style: none; + margin-left: 1.5em; + margin-right: 0em; + padding-left: 0em; +} +li.indline0 { + font-weight: bold; + line-height: 200%; + margin-left: 0em; + margin-right: 0em; +} +li.indline1 { + font-weight: normal; + line-height: 150%; + margin-left: 0em; + margin-right: 0em; +} + +.comment { + background-color: yellow; +} +.center { + text-align: center; +} +.error { + color: red; + font-style: italic; + font-weight: bold; +} +.figure { + font-weight: bold; + text-align: center; + font-size: 9pt; +} +.filename { + color: #333333; + font-weight: bold; + font-size: 12pt; + line-height: 21pt; + text-align: center; +} +.fn { + font-weight: bold; +} +.hidden { + display: none; +} +.left { + text-align: left; +} +.right { + text-align: right; +} +.title { + color: #990000; + font-size: 18pt; + line-height: 18pt; + font-weight: bold; + text-align: center; + margin-top: 36pt; +} +.vcardline { + display: block; +} +.warning { + font-size: 14pt; + background-color: yellow; +} + + +@media print { + .noprint { + display: none; + } + + a { + color: black; + text-decoration: none; + } + + table.header { + width: 90%; + } + + td.header { + width: 50%; + color: black; + background-color: white; + vertical-align: top; + font-size: 12pt; + } + + ul.toc a::after { + content: leader('.') target-counter(attr(href), page); + } + + a.iref { + content: target-counter(attr(href), page); + } + + .print2col { + column-count: 2; + -moz-column-count: 2; + column-fill: auto; + } +} + +@page { + @top-left { + content: ""; + + } + @top-right { + content: "August 2015"; + + } + @top-center { + content: "LIBXO-MANUAL"; + + } + @bottom-left { + content: "Shafer"; + + } + @bottom-center { + content: ""; + + } + @bottom-right { + content: "[Page " counter(page) "]"; + + } +} + +@page:first { + @top-left { + content: normal; + } + @top-right { + content: normal; + } + @top-center { + content: normal; + } +} + +div.tooltip { + border: solid 1px #666666; + padding: 0px; + position: absolute; + z-index: 100; + display: none; + color: #333333; + top: 20px; + left: 90px; + background-color: #ffffcc; + layer-background-color: #ffffcc; +} + +div.fancy-tooltip-empty-header { + text-align: left; + font-weight: bold; + margin: 2px; +} + +div.fancy-tooltip-header { + text-align: left; + font-weight: bold; + margin: 2px 2px 0px 2px; + border-bottom: 1px solid black; +} + +div.fancy-tooltip-body { + font-weight: normal; + margin: 4px; +} + +div.fancy-tooltip-body ul, div.fancy-tooltip-body li { + padding: 1px 4px 1px 4px; + margin: 1px 2px 1px 8px; +} + +span.digress { + background-color: #778899; + font: courier new, courier, monospace; + color: black; + font-weight: bold; + font-size: 10px; + border: 1px solid #aaaaaa; +} + +span.digress-anchor { + margin: 10pt 20pt 10pt 50pt; +} + +a.digress-anchor:link, a.digress-anchor:visited, + a.digress-anchor-hover, a.digress-anchor,active { + text-decoration: none; + color: black; +} + +</style> +<script type="text/javascript">/*! + * jQuery JavaScript Library v1.7 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Nov 3 16:18:21 2011 -0400 + */ +(function( window, undefined ) { + +// Use the correct document accordingly with window argument (sandbox) +var document = window.document, + navigator = window.navigator, + location = window.location; +var jQuery = (function() { + +// Define a local copy of jQuery +var jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$, + + // A central reference to the root jQuery(document) + rootjQuery, + + // A simple way to check for HTML strings or ID strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, + + // Check if a string has a non-whitespace character in it + rnotwhite = /\S/, + + // Used for trimming whitespace + trimLeft = /^\s+/, + trimRight = /\s+$/, + + // Check for digits + rdigit = /\d/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, + + // JSON RegExp + rvalidchars = /^[\],:{}\s]*$/, + rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, + rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, + rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, + + // Useragent RegExp + rwebkit = /(webkit)[ \/]([\w.]+)/, + ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, + rmsie = /(msie) ([\w.]+)/, + rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, + + // Matches dashed string for camelizing + rdashAlpha = /-([a-z]|[0-9])/ig, + rmsPrefix = /^-ms-/, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return ( letter + "" ).toUpperCase(); + }, + + // Keep a UserAgent string for use with jQuery.browser + userAgent = navigator.userAgent, + + // For matching the engine and version of the browser + browserMatch, + + // The deferred used on DOM ready + readyList, + + // The ready event handler + DOMContentLoaded, + + // Save a reference to some core methods + toString = Object.prototype.toString, + hasOwn = Object.prototype.hasOwnProperty, + push = Array.prototype.push, + slice = Array.prototype.slice, + trim = String.prototype.trim, + indexOf = Array.prototype.indexOf, + + // [[Class]] -> type pairs + class2type = {}; + +jQuery.fn = jQuery.prototype = { + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem, ret, doc; + + // Handle $(""), $(null), or $(undefined) + if ( !selector ) { + return this; + } + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + } + + // The body element only exists once, optimize finding it + if ( selector === "body" && !context && document.body ) { + this.context = document; + this[0] = document.body; + this.selector = selector; + this.length = 1; + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = quickExpr.exec( selector ); + } + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + doc = ( context ? context.ownerDocument || context : document ); + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + ret = rsingleTag.exec( selector ); + + if ( ret ) { + if ( jQuery.isPlainObject( context ) ) { + selector = [ document.createElement( ret[1] ) ]; + jQuery.fn.attr.call( selector, context, true ); + + } else { + selector = [ doc.createElement( ret[1] ) ]; + } + + } else { + ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); + selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; + } + + return jQuery.merge( this, selector ); + + // HANDLE: $("#id") + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.7", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return slice.call( this, 0 ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = this.constructor(); + + if ( jQuery.isArray( elems ) ) { + push.apply( ret, elems ); + + } else { + jQuery.merge( ret, elems ); + } + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) { + ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; + } else if ( name ) { + ret.selector = this.selector + "." + name + "(" + selector + ")"; + } + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Attach the listeners + jQuery.bindReady(); + + // Add the callback + readyList.add( fn ); + + return this; + }, + + eq: function( i ) { + return i === -1 ? + this.slice( i ) : + this.slice( i, +i + 1 ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ), + "slice", slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + // Either a released hold or an DOMready/load event and not yet ready + if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( !document.body ) { + return setTimeout( jQuery.ready, 1 ); + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.fireWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger( "ready" ).unbind( "ready" ); + } + } + }, + + bindReady: function() { + if ( readyList ) { + return; + } + + readyList = jQuery.Callbacks( "once memory" ); + + // Catch cases where $(document).ready() is called after the + // browser event has already occurred. + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + return setTimeout( jQuery.ready, 1 ); + } + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent( "onreadystatechange", DOMContentLoaded ); + + // A fallback to window.onload, that will always work + window.attachEvent( "onload", jQuery.ready ); + + // If IE and not a frame + // continually check to see if the document is ready + var toplevel = false; + + try { + toplevel = window.frameElement == null; + } catch(e) {} + + if ( document.documentElement.doScroll && toplevel ) { + doScrollCheck(); + } + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray || function( obj ) { + return jQuery.type(obj) === "array"; + }, + + // A crude way of determining if an object is a window + isWindow: function( obj ) { + return obj && typeof obj === "object" && "setInterval" in obj; + }, + + isNumeric: function( obj ) { + return obj != null && rdigit.test( obj ) && !isNaN( obj ); + }, + + type: function( obj ) { + return obj == null ? + String( obj ) : + class2type[ toString.call(obj) ] || "object"; + }, + + isPlainObject: function( obj ) { + // Must be an Object. + // Because of IE, we also have to check the presence of the constructor property. + // Make sure that DOM nodes and window objects don't pass through, as well + if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + try { + // Not own constructor property must be Object + if ( obj.constructor && + !hasOwn.call(obj, "constructor") && + !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { + return false; + } + } catch ( e ) { + // IE8,9 Will throw exceptions on certain host objects #9897 + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + + var key; + for ( key in obj ) {} + + return key === undefined || hasOwn.call( obj, key ); + }, + + isEmptyObject: function( obj ) { + for ( var name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw msg; + }, + + parseJSON: function( data ) { + if ( typeof data !== "string" || !data ) { + return null; + } + + // Make sure leading/trailing whitespace is removed (IE can't handle it) + data = jQuery.trim( data ); + + // Attempt to parse using the native JSON parser first + if ( window.JSON && window.JSON.parse ) { + return window.JSON.parse( data ); + } + + // Make sure the incoming data is actual JSON + // Logic borrowed from http://json.org/json2.js + if ( rvalidchars.test( data.replace( rvalidescape, "@" ) + .replace( rvalidtokens, "]" ) + .replace( rvalidbraces, "")) ) { + + return ( new Function( "return " + data ) )(); + + } + jQuery.error( "Invalid JSON: " + data ); + }, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + try { + if ( window.DOMParser ) { // Standard + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } else { // IE + xml = new ActiveXObject( "Microsoft.XMLDOM" ); + xml.async = "false"; + xml.loadXML( data ); + } + } catch( e ) { + xml = undefined; + } + if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + // Workarounds based on findings by Jim Driscoll + // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context + globalEval: function( data ) { + if ( data && rnotwhite.test( data ) ) { + // We use execScript on Internet Explorer + // We use an anonymous function so that context is window + // rather than jQuery in Firefox + ( window.execScript || function( data ) { + window[ "eval" ].call( window, data ); + } )( data ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, + length = object.length, + isObj = length === undefined || jQuery.isFunction( object ); + + if ( args ) { + if ( isObj ) { + for ( name in object ) { + if ( callback.apply( object[ name ], args ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.apply( object[ i++ ], args ) === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isObj ) { + for ( name in object ) { + if ( callback.call( object[ name ], name, object[ name ] ) === false ) { + break; + } + } + } else { + for ( ; i < length; ) { + if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { + break; + } + } + } + } + + return object; + }, + + // Use native String.trim function wherever possible + trim: trim ? + function( text ) { + return text == null ? + "" : + trim.call( text ); + } : + + // Otherwise use our own trimming functionality + function( text ) { + return text == null ? + "" : + text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); + }, + + // results is for internal usage only + makeArray: function( array, results ) { + var ret = results || []; + + if ( array != null ) { + // The window, strings (and functions) also have 'length' + // The extra typeof function check is to prevent crashes + // in Safari 2 (See: #3039) + // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 + var type = jQuery.type( array ); + + if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { + push.call( ret, array ); + } else { + jQuery.merge( ret, array ); + } + } + + return ret; + }, + + inArray: function( elem, array, i ) { + var len; + + if ( array ) { + if ( indexOf ) { + return indexOf.call( array, elem, i ); + } + + len = array.length; + i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; + + for ( ; i < len; i++ ) { + // Skip accessing in sparse arrays + if ( i in array && array[ i ] === elem ) { + return i; + } + } + } + + return -1; + }, + + merge: function( first, second ) { + var i = first.length, + j = 0; + + if ( typeof second.length === "number" ) { + for ( var l = second.length; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var ret = [], retVal; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, key, ret = [], + i = 0, + length = elems.length, + // jquery objects are treated as arrays + isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( key in elems ) { + value = callback( elems[ key ], key, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return ret.concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + if ( typeof context === "string" ) { + var tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + var args = slice.call( arguments, 2 ), + proxy = function() { + return fn.apply( context, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; + + return proxy; + }, + + // Mutifunctional method to get and set values to a collection + // The value/s can optionally be executed if it's a function + access: function( elems, key, value, exec, fn, pass ) { + var length = elems.length; + + // Setting many attributes + if ( typeof key === "object" ) { + for ( var k in key ) { + jQuery.access( elems, k, key[k], exec, fn, value ); + } + return elems; + } + + // Setting one attribute + if ( value !== undefined ) { + // Optionally, function values get executed if exec is true + exec = !pass && exec && jQuery.isFunction(value); + + for ( var i = 0; i < length; i++ ) { + fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); + } + + return elems; + } + + // Getting an attribute + return length ? fn( elems[0], key ) : undefined; + }, + + now: function() { + return ( new Date() ).getTime(); + }, + + // Use of jQuery.browser is frowned upon. + // More details: http://docs.jquery.com/Utilities/jQuery.browser + uaMatch: function( ua ) { + ua = ua.toLowerCase(); + + var match = rwebkit.exec( ua ) || + ropera.exec( ua ) || + rmsie.exec( ua ) || + ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || + []; + + return { browser: match[1] || "", version: match[2] || "0" }; + }, + + sub: function() { + function jQuerySub( selector, context ) { + return new jQuerySub.fn.init( selector, context ); + } + jQuery.extend( true, jQuerySub, this ); + jQuerySub.superclass = this; + jQuerySub.fn = jQuerySub.prototype = this(); + jQuerySub.fn.constructor = jQuerySub; + jQuerySub.sub = this.sub; + jQuerySub.fn.init = function init( selector, context ) { + if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { + context = jQuerySub( context ); + } + + return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); + }; + jQuerySub.fn.init.prototype = jQuerySub.fn; + var rootjQuerySub = jQuerySub(document); + return jQuerySub; + }, + + browser: {} +}); + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +browserMatch = jQuery.uaMatch( userAgent ); +if ( browserMatch.browser ) { + jQuery.browser[ browserMatch.browser ] = true; + jQuery.browser.version = browserMatch.version; +} + +// Deprecated, use jQuery.browser.webkit instead +if ( jQuery.browser.webkit ) { + jQuery.browser.safari = true; +} + +// IE doesn't match non-breaking spaces with \s +if ( rnotwhite.test( "\xA0" ) ) { + trimLeft = /^[\s\xA0]+/; + trimRight = /[\s\xA0]+$/; +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); + +// Cleanup functions for the document ready method +if ( document.addEventListener ) { + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +} else if ( document.attachEvent ) { + DOMContentLoaded = function() { + // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", DOMContentLoaded ); + jQuery.ready(); + } + }; +} + +// The DOM ready check for Internet Explorer +function doScrollCheck() { + if ( jQuery.isReady ) { + return; + } + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch(e) { + setTimeout( doScrollCheck, 1 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); +} + +// Expose jQuery as an AMD module, but only for AMD loaders that +// understand the issues with loading multiple versions of jQuery +// in a page that all might call define(). The loader will indicate +// they have special allowances for multiple jQuery versions by +// specifying define.amd.jQuery = true. Register as a named module, +// since jQuery can be concatenated with other files that may use define, +// but not use a proper concatenation script that understands anonymous +// AMD modules. A named AMD is safest and most robust way to register. +// Lowercase jquery is used because AMD module names are derived from +// file names, and jQuery is normally delivered in a lowercase file name. +if ( typeof define === "function" && define.amd && define.amd.jQuery ) { + define( "jquery", [], function () { return jQuery; } ); +} + +return jQuery; + +})(); + + +// String to Object flags format cache +var flagsCache = {}; + +// Convert String-formatted flags into Object-formatted ones and store in cache +function createFlags( flags ) { + var object = flagsCache[ flags ] = {}, + i, length; + flags = flags.split( /\s+/ ); + for ( i = 0, length = flags.length; i < length; i++ ) { + object[ flags[i] ] = true; + } + return object; +} + +/* + * Create a callback list using the following parameters: + * + * flags: an optional list of space-separated flags that will change how + * the callback list behaves + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible flags: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( flags ) { + + // Convert flags from String-formatted to Object-formatted + // (we check in cache first) + flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; + + var // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = [], + // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Add one or several callbacks to the list + add = function( args ) { + var i, + length, + elem, + type, + actual; + for ( i = 0, length = args.length; i < length; i++ ) { + elem = args[ i ]; + type = jQuery.type( elem ); + if ( type === "array" ) { + // Inspect recursively + add( elem ); + } else if ( type === "function" ) { + // Add if not in unique mode and callback is not in + if ( !flags.unique || !self.has( elem ) ) { + list.push( elem ); + } + } + } + }, + // Fire callbacks + fire = function( context, args ) { + args = args || []; + memory = !flags.memory || [ context, args ]; + firing = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { + memory = true; // Mark as halted + break; + } + } + firing = false; + if ( list ) { + if ( !flags.once ) { + if ( stack && stack.length ) { + memory = stack.shift(); + self.fireWith( memory[ 0 ], memory[ 1 ] ); + } + } else if ( memory === true ) { + self.disable(); + } else { + list = []; + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + var length = list.length; + add( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away, unless previous + // firing was halted (stopOnFalse) + } else if ( memory && memory !== true ) { + firingStart = length; + fire( memory[ 0 ], memory[ 1 ] ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + var args = arguments, + argIndex = 0, + argLength = args.length; + for ( ; argIndex < argLength ; argIndex++ ) { + for ( var i = 0; i < list.length; i++ ) { + if ( args[ argIndex ] === list[ i ] ) { + // Handle firingIndex and firingLength + if ( firing ) { + if ( i <= firingLength ) { + firingLength--; + if ( i <= firingIndex ) { + firingIndex--; + } + } + } + // Remove the element + list.splice( i--, 1 ); + // If we have some unicity property then + // we only need to do this once + if ( flags.unique ) { + break; + } + } + } + } + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + if ( list ) { + var i = 0, + length = list.length; + for ( ; i < length; i++ ) { + if ( fn === list[ i ] ) { + return true; + } + } + } + return false; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory || memory === true ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( stack ) { + if ( firing ) { + if ( !flags.once ) { + stack.push( [ context, args ] ); + } + } else if ( !( flags.once && memory ) ) { + fire( context, args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!memory; + } + }; + + return self; +}; + + + + +var // Static reference to slice + sliceDeferred = [].slice; + +jQuery.extend({ + + Deferred: function( func ) { + var doneList = jQuery.Callbacks( "once memory" ), + failList = jQuery.Callbacks( "once memory" ), + progressList = jQuery.Callbacks( "memory" ), + state = "pending", + lists = { + resolve: doneList, + reject: failList, + notify: progressList + }, + promise = { + done: doneList.add, + fail: failList.add, + progress: progressList.add, + + state: function() { + return state; + }, + + // Deprecated + isResolved: doneList.fired, + isRejected: failList.fired, + + then: function( doneCallbacks, failCallbacks, progressCallbacks ) { + deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); + return this; + }, + always: function() { + return deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); + }, + pipe: function( fnDone, fnFail, fnProgress ) { + return jQuery.Deferred(function( newDefer ) { + jQuery.each( { + done: [ fnDone, "resolve" ], + fail: [ fnFail, "reject" ], + progress: [ fnProgress, "notify" ] + }, function( handler, data ) { + var fn = data[ 0 ], + action = data[ 1 ], + returned; + if ( jQuery.isFunction( fn ) ) { + deferred[ handler ](function() { + returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); + } + }); + } else { + deferred[ handler ]( newDefer[ action ] ); + } + }); + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + if ( obj == null ) { + obj = promise; + } else { + for ( var key in promise ) { + obj[ key ] = promise[ key ]; + } + } + return obj; + } + }, + deferred = promise.promise({}), + key; + + for ( key in lists ) { + deferred[ key ] = lists[ key ].fire; + deferred[ key + "With" ] = lists[ key ].fireWith; + } + + // Handle state + deferred.done( function() { + state = "resolved"; + }, failList.disable, progressList.lock ).fail( function() { + state = "rejected"; + }, doneList.disable, progressList.lock ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( firstParam ) { + var args = sliceDeferred.call( arguments, 0 ), + i = 0, + length = args.length, + pValues = new Array( length ), + count = length, + pCount = length, + deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? + firstParam : + jQuery.Deferred(), + promise = deferred.promise(); + function resolveFunc( i ) { + return function( value ) { + args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + if ( !( --count ) ) { + deferred.resolveWith( deferred, args ); + } + }; + } + function progressFunc( i ) { + return function( value ) { + pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; + deferred.notifyWith( promise, pValues ); + }; + } + if ( length > 1 ) { + for ( ; i < length; i++ ) { + if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { + args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); + } else { + --count; + } + } + if ( !count ) { + deferred.resolveWith( deferred, args ); + } + } else if ( deferred !== firstParam ) { + deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); + } + return promise; + } +}); + + + + +jQuery.support = (function() { + + var div = document.createElement( "div" ), + documentElement = document.documentElement, + all, + a, + select, + opt, + input, + marginDiv, + support, + fragment, + body, + testElementParent, + testElement, + testElementStyle, + tds, + events, + eventName, + i, + isSupported; + + // Preliminary tests + div.setAttribute("className", "t"); + div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/><nav></nav>"; + + + all = div.getElementsByTagName( "*" ); + a = div.getElementsByTagName( "a" )[ 0 ]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return {}; + } + + // First batch of supports tests + select = document.createElement( "select" ); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName( "input" )[ 0 ]; + + support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: ( div.firstChild.nodeType === 3 ), + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName( "tbody" ).length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName( "link" ).length, + + // Get the style information from getAttribute + // (IE uses .cssText instead) + style: /top/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: ( a.getAttribute( "href" ) === "/a" ), + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.55/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Make sure unknown elements (like HTML5 elems) are handled appropriately + unknownElems: !!div.getElementsByTagName( "nav" ).length, + + // Make sure that if no value is specified for a checkbox + // that it defaults to "on". + // (WebKit defaults to "" instead) + checkOn: ( input.value === "on" ), + + // Make sure that a selected-by-default option has a working selected property. + // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) + optSelected: opt.selected, + + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // Tests for enctype support on a form(#6743) + enctype: !!document.createElement("form").enctype, + + // Will be defined later + submitBubbles: true, + changeBubbles: true, + focusinBubbles: false, + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Test to see if it's possible to delete an expando from an element + // Fails in Internet Explorer + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { + div.attachEvent( "onclick", function() { + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + support.noCloneEvent = false; + }); + div.cloneNode( true ).fireEvent( "onclick" ); + } + + // Check if a radio maintains its value + // after being appended to the DOM + input = document.createElement("input"); + input.value = "t"; + input.setAttribute("type", "radio"); + support.radioValue = input.value === "t"; + + input.setAttribute("checked", "checked"); + div.appendChild( input ); + fragment = document.createDocumentFragment(); + fragment.appendChild( div.lastChild ); + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + div.innerHTML = ""; + + // Figure out if the W3C box model works as expected + div.style.width = div.style.paddingLeft = "1px"; + + // We don't want to do body-related feature tests on frameset + // documents, which lack a body. So we use + // document.getElementsByTagName("body")[0], which is undefined in + // frameset documents, while document.body isn’t. (7398) + body = document.getElementsByTagName("body")[ 0 ]; + // We use our own, invisible, body unless the body is already present + // in which case we use a div (#9239) + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + jQuery.extend( testElementStyle, { + position: "absolute", + left: "-999px", + top: "-999px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + support.boxModel = div.offsetWidth === 2; + + if ( "zoom" in div.style ) { + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + // (IE < 8 does this) + div.style.display = "inline"; + div.style.zoom = 1; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 2 ); + + // Check if elements with layout shrink-wrap their children + // (IE 6 does this) + div.style.display = ""; + div.innerHTML = "<div style='width:4px;'></div>"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 2 ); + } + + div.innerHTML = "<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>"; + tds = div.getElementsByTagName( "td" ); + + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + // (only IE 8 fails this test) + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Check if empty table cells still have offsetWidth/Height + // (IE < 8 fail this test) + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + div.innerHTML = ""; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. For more + // info see bug #3333 + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + if ( document.defaultView && document.defaultView.getComputedStyle ) { + marginDiv = document.createElement( "div" ); + marginDiv.style.width = "0"; + marginDiv.style.marginRight = "0"; + div.appendChild( marginDiv ); + support.reliableMarginRight = + ( parseInt( ( document.defaultView.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; + } + + // Technique from Juriy Zaytsev + // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ + // We only care about the case where non-standard event systems + // are used, namely in IE. Short-circuiting here helps us to + // avoid an eval call (in setAttribute) which can cause CSP + // to go haywire. See: https://developer.mozilla.org/en/Security/CSP + if ( div.attachEvent ) { + for( i in { + submit: 1, + change: 1, + focusin: 1 + } ) { + eventName = "on" + i; + isSupported = ( eventName in div ); + if ( !isSupported ) { + div.setAttribute( eventName, "return;" ); + isSupported = ( typeof div[ eventName ] === "function" ); + } + support[ i + "Bubbles" ] = isSupported; + } + } + + // Run fixed position tests at doc ready to avoid a crash + // related to the invisible body in IE8 + jQuery(function() { + var container, outer, inner, table, td, offsetSupport, + conMarginTop = 1, + ptlm = "position:absolute;top:0;left:0;width:1px;height:1px;margin:0;", + vb = "visibility:hidden;border:0;", + style = "style='" + ptlm + "border:5px solid #000;padding:0;'", + html = "<div " + style + "><div></div></div>" + + "<table " + style + " cellpadding='0' cellspacing='0'>" + + "<tr><td></td></tr></table>"; + + // Reconstruct a container + body = document.getElementsByTagName("body")[0]; + if ( !body ) { + // Return for frameset docs that don't have a body + // These tests cannot be done + return; + } + + container = document.createElement("div"); + container.style.cssText = vb + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; + body.insertBefore( container, body.firstChild ); + + // Construct a test element + testElement = document.createElement("div"); + testElement.style.cssText = ptlm + vb; + + testElement.innerHTML = html; + container.appendChild( testElement ); + outer = testElement.firstChild; + inner = outer.firstChild; + td = outer.nextSibling.firstChild.firstChild; + + offsetSupport = { + doesNotAddBorder: ( inner.offsetTop !== 5 ), + doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) + }; + + inner.style.position = "fixed"; + inner.style.top = "20px"; + + // safari subtracts parent border width here which is 5px + offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); + inner.style.position = inner.style.top = ""; + + outer.style.overflow = "hidden"; + outer.style.position = "relative"; + + offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); + offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); + + body.removeChild( container ); + testElement = container = null; + + jQuery.extend( support, offsetSupport ); + }); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + // Null connected elements to avoid leaks in IE + testElement = fragment = select = opt = body = marginDiv = div = input = null; + + return support; +})(); + +// Keep track of boxModel +jQuery.boxModel = jQuery.support.boxModel; + + + + +var rbrace = /^(?:\{.*\}|\[.*\])$/, + rmultiDash = /([A-Z])/g; + +jQuery.extend({ + cache: {}, + + // Please use with caution + uuid: 0, + + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), + + // The following elements throw uncatchable exceptions if you + // attempt to add expando properties to them. + noData: { + "embed": true, + // Ban all objects except for Flash (which handle expandos) + "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", + "applet": true + }, + + hasData: function( elem ) { + elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; + return !!elem && !isEmptyDataObject( elem ); + }, + + data: function( elem, name, data, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var privateCache, thisCache, ret, + internalKey = jQuery.expando, + getByName = typeof name === "string", + + // We have to handle DOM nodes and JS objects differently because IE6-7 + // can't GC object references properly across the DOM-JS boundary + isNode = elem.nodeType, + + // Only DOM nodes need the global jQuery cache; JS object data is + // attached directly to the object so GC can occur automatically + cache = isNode ? jQuery.cache : elem, + + // Only defining an ID for JS objects if its cache already exists allows + // the code to shortcut on the same path as a DOM node with no cache + id = isNode ? elem[ jQuery.expando ] : elem[ jQuery.expando ] && jQuery.expando, + isEvents = name === "events"; + + // Avoid doing any more work than we need to when trying to get data on an + // object that has no data at all + if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { + return; + } + + if ( !id ) { + // Only DOM nodes need a new unique ID for each element since their data + // ends up in the global cache + if ( isNode ) { + elem[ jQuery.expando ] = id = ++jQuery.uuid; + } else { + id = jQuery.expando; + } + } + + if ( !cache[ id ] ) { + cache[ id ] = {}; + + // Avoids exposing jQuery metadata on plain JS objects when the object + // is serialized using JSON.stringify + if ( !isNode ) { + cache[ id ].toJSON = jQuery.noop; + } + } + + // An object can be passed to jQuery.data instead of a key/value pair; this gets + // shallow copied over onto the existing cache + if ( typeof name === "object" || typeof name === "function" ) { + if ( pvt ) { + cache[ id ] = jQuery.extend( cache[ id ], name ); + } else { + cache[ id ].data = jQuery.extend( cache[ id ].data, name ); + } + } + + privateCache = thisCache = cache[ id ]; + + // jQuery data() is stored in a separate object inside the object's internal data + // cache in order to avoid key collisions between internal data and user-defined + // data. + if ( !pvt ) { + if ( !thisCache.data ) { + thisCache.data = {}; + } + + thisCache = thisCache.data; + } + + if ( data !== undefined ) { + thisCache[ jQuery.camelCase( name ) ] = data; + } + + // Users should not attempt to inspect the internal events object using jQuery.data, + // it is undocumented and subject to change. But does anyone listen? No. + if ( isEvents && !thisCache[ name ] ) { + return privateCache.events; + } + + // Check for both converted-to-camel and non-converted data property names + // If a data property was specified + if ( getByName ) { + + // First Try to find as-is property data + ret = thisCache[ name ]; + + // Test for null|undefined property data + if ( ret == null ) { + + // Try to find the camelCased property + ret = thisCache[ jQuery.camelCase( name ) ]; + } + } else { + ret = thisCache; + } + + return ret; + }, + + removeData: function( elem, name, pvt /* Internal Use Only */ ) { + if ( !jQuery.acceptData( elem ) ) { + return; + } + + var thisCache, i, l, + + // Reference to internal data cache key + internalKey = jQuery.expando, + + isNode = elem.nodeType, + + // See jQuery.data for more information + cache = isNode ? jQuery.cache : elem, + + // See jQuery.data for more information + id = isNode ? elem[ jQuery.expando ] : jQuery.expando; + + // If there is already no cache entry for this object, there is no + // purpose in continuing + if ( !cache[ id ] ) { + return; + } + + if ( name ) { + + thisCache = pvt ? cache[ id ] : cache[ id ].data; + + if ( thisCache ) { + + // Support space separated names + if ( jQuery.isArray( name ) ) { + name = name; + } else if ( name in thisCache ) { + name = [ name ]; + } else { + + // split the camel cased version by spaces + name = jQuery.camelCase( name ); + if ( name in thisCache ) { + name = [ name ]; + } else { + name = name.split( " " ); + } + } + + for ( i = 0, l = name.length; i < l; i++ ) { + delete thisCache[ name[i] ]; + } + + // If there is no data left in the cache, we want to continue + // and let the cache object itself get destroyed + if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { + return; + } + } + } + + // See jQuery.data for more information + if ( !pvt ) { + delete cache[ id ].data; + + // Don't destroy the parent cache unless the internal data object + // had been the only thing left in it + if ( !isEmptyDataObject(cache[ id ]) ) { + return; + } + } + + // Browsers that fail expando deletion also refuse to delete expandos on + // the window, but it will allow it on all other JS objects; other browsers + // don't care + // Ensure that `cache` is not a window object #10080 + if ( jQuery.support.deleteExpando || !cache.setInterval ) { + delete cache[ id ]; + } else { + cache[ id ] = null; + } + + // We destroyed the cache and need to eliminate the expando on the node to avoid + // false lookups in the cache for entries that no longer exist + if ( isNode ) { + // IE does not allow us to delete expando properties from nodes, + // nor does it have a removeAttribute function on Document nodes; + // we must handle all of these cases + if ( jQuery.support.deleteExpando ) { + delete elem[ jQuery.expando ]; + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } else { + elem[ jQuery.expando ] = null; + } + } + }, + + // For internal use only. + _data: function( elem, name, data ) { + return jQuery.data( elem, name, data, true ); + }, + + // A method for determining if a DOM node can handle the data expando + acceptData: function( elem ) { + if ( elem.nodeName ) { + var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; + + if ( match ) { + return !(match === true || elem.getAttribute("classid") !== match); + } + } + + return true; + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var parts, attr, name, + data = null; + + if ( typeof key === "undefined" ) { + if ( this.length ) { + data = jQuery.data( this[0] ); + + if ( this[0].nodeType === 1 && !jQuery._data( this[0], "parsedAttrs" ) ) { + attr = this[0].attributes; + for ( var i = 0, l = attr.length; i < l; i++ ) { + name = attr[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + + dataAttr( this[0], name, data[ name ] ); + } + } + jQuery._data( this[0], "parsedAttrs", true ); + } + } + + return data; + + } else if ( typeof key === "object" ) { + return this.each(function() { + jQuery.data( this, key ); + }); + } + + parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + // Try to fetch any internally stored data first + if ( data === undefined && this.length ) { + data = jQuery.data( this[0], key ); + data = dataAttr( this[0], key, data ); + } + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + + } else { + return this.each(function() { + var $this = jQuery( this ), + args = [ parts[0], value ]; + + $this.triggerHandler( "setData" + parts[1] + "!", args ); + jQuery.data( this, key, value ); + $this.triggerHandler( "changeData" + parts[1] + "!", args ); + }); + } + }, + + removeData: function( key ) { + return this.each(function() { + jQuery.removeData( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + jQuery.isNumeric( data ) ? parseFloat( data ) : + rbrace.test( data ) ? jQuery.parseJSON( data ) : + data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + jQuery.data( elem, key, data ); + + } else { + data = undefined; + } + } + + return data; +} + +// checks a cache object for emptiness +function isEmptyDataObject( obj ) { + for ( var name in obj ) { + + // if the public data object is empty, the private is still empty + if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { + continue; + } + if ( name !== "toJSON" ) { + return false; + } + } + + return true; +} + + + + +function handleQueueMarkDefer( elem, type, src ) { + var deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + defer = jQuery._data( elem, deferDataKey ); + if ( defer && + ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && + ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { + // Give room for hard-coded callbacks to fire first + // and eventually mark/queue something else on the element + setTimeout( function() { + if ( !jQuery._data( elem, queueDataKey ) && + !jQuery._data( elem, markDataKey ) ) { + jQuery.removeData( elem, deferDataKey, true ); + defer.fire(); + } + }, 0 ); + } +} + +jQuery.extend({ + + _mark: function( elem, type ) { + if ( elem ) { + type = ( type || "fx" ) + "mark"; + jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); + } + }, + + _unmark: function( force, elem, type ) { + if ( force !== true ) { + type = elem; + elem = force; + force = false; + } + if ( elem ) { + type = type || "fx"; + var key = type + "mark", + count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); + if ( count ) { + jQuery._data( elem, key, count ); + } else { + jQuery.removeData( elem, key, true ); + handleQueueMarkDefer( elem, type, "mark" ); + } + } + }, + + queue: function( elem, type, data ) { + var q; + if ( elem ) { + type = ( type || "fx" ) + "queue"; + q = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !q || jQuery.isArray(data) ) { + q = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + q.push( data ); + } + } + return q || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + fn = queue.shift(), + hooks = {}; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + } + + if ( fn ) { + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + jQuery._data( elem, type + ".run", hooks ); + fn.call( elem, function() { + jQuery.dequeue( elem, type ); + }, hooks ); + } + + if ( !queue.length ) { + jQuery.removeData( elem, type + "queue " + type + ".run", true ); + handleQueueMarkDefer( elem, type, "queue" ); + } + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) { + return jQuery.queue( this[0], type ); + } + return this.each(function() { + var queue = jQuery.queue( this, type, data ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, object ) { + if ( typeof type !== "string" ) { + object = type; + type = undefined; + } + type = type || "fx"; + var defer = jQuery.Deferred(), + elements = this, + i = elements.length, + count = 1, + deferDataKey = type + "defer", + queueDataKey = type + "queue", + markDataKey = type + "mark", + tmp; + function resolve() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + } + while( i-- ) { + if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || + ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || + jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && + jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { + count++; + tmp.add( resolve ); + } + } + resolve(); + return defer.promise(); + } +}); + + + + +var rclass = /[\n\t\r]/g, + rspace = /\s+/, + rreturn = /\r/g, + rtype = /^(?:button|input)$/i, + rfocusable = /^(?:button|input|object|select|textarea)$/i, + rclickable = /^a(?:rea)?$/i, + rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, + getSetAttribute = jQuery.support.getSetAttribute, + nodeHook, boolHook, fixSpecified; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.attr ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, name, value, true, jQuery.prop ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classNames, i, l, elem, + setClass, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call(this, j, this.className) ); + }); + } + + if ( value && typeof value === "string" ) { + classNames = value.split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 ) { + if ( !elem.className && classNames.length === 1 ) { + elem.className = value; + + } else { + setClass = " " + elem.className + " "; + + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { + setClass += classNames[ c ] + " "; + } + } + elem.className = jQuery.trim( setClass ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classNames, i, l, elem, className, c, cl; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call(this, j, this.className) ); + }); + } + + if ( (value && typeof value === "string") || value === undefined ) { + classNames = ( value || "" ).split( rspace ); + + for ( i = 0, l = this.length; i < l; i++ ) { + elem = this[ i ]; + + if ( elem.nodeType === 1 && elem.className ) { + if ( value ) { + className = (" " + elem.className + " ").replace( rclass, " " ); + for ( c = 0, cl = classNames.length; c < cl; c++ ) { + className = className.replace(" " + classNames[ c ] + " ", " "); + } + elem.className = jQuery.trim( className ); + + } else { + elem.className = ""; + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.split( rspace ); + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space seperated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // toggle whole className + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.nodeName.toLowerCase() ] || jQuery.valHooks[ elem.type ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return undefined; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var self = jQuery(this), val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.nodeName.toLowerCase() ] || jQuery.valHooks[ this.type ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, i, max, option, + index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type === "select-one"; + + // Nothing was selected + if ( index < 0 ) { + return null; + } + + // Loop through all the selected options + i = one ? index : 0; + max = one ? index + 1 : options.length; + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Don't return options that are disabled or in a disabled optgroup + if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && + (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + // Fixes Bug #2551 -- select.val() broken in IE after form.reset() + if ( one && !values.length && options.length ) { + return jQuery( options[ index ] ).val(); + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attrFn: { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true + }, + + attr: function( elem, name, value, pass ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + if ( pass && name in jQuery.attrFn ) { + return jQuery( elem )[ name ]( value ); + } + + // Fallback to prop when attributes are not supported + if ( !("getAttribute" in elem) ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return undefined; + + } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, "" + value ); + return value; + } + + } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret === null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var propName, attrNames, name, l, + i = 0; + + if ( elem.nodeType === 1 ) { + attrNames = ( value || "" ).split( rspace ); + l = attrNames.length; + + for ( ; i < l; i++ ) { + name = attrNames[ i ].toLowerCase(); + propName = jQuery.propFix[ name ] || name; + + // See #9699 for explanation of this approach (setting first, then removal) + jQuery.attr( elem, name, "" ); + elem.removeAttribute( getSetAttribute ? name : propName ); + + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) && propName in elem ) { + elem[ propName ] = false; + } + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + // We can't allow the type property to be changed (since it causes problems in IE) + if ( rtype.test( elem.nodeName ) && elem.parentNode ) { + jQuery.error( "type property can't be changed" ); + } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to it's default in case type is set after value + // This is for element creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + }, + // Use the value property for back compat + // Use the nodeHook for button elements in IE6/7 (#1954) + value: { + get: function( elem, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.get( elem, name ); + } + return name in elem ? + elem.value : + null; + }, + set: function( elem, value, name ) { + if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { + return nodeHook.set( elem, value, name ); + } + // Does not return so that setAttribute is also used + elem.value = value; + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return undefined; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) +jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + // Align boolean attributes with corresponding properties + // Fall back to attribute presence where some booleans are not supported + var attrNode, + property = jQuery.prop( elem, name ); + return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + var propName; + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + // value is true since we know at this point it's type boolean and not false + // Set boolean attributes to the same name and set the DOM property + propName = jQuery.propFix[ name ] || name; + if ( propName in elem ) { + // Only set the IDL specifically if it already exists on the element + elem[ propName ] = true; + } + + elem.setAttribute( name, name.toLowerCase() ); + } + return name; + } +}; + +// IE6/7 do not support getting/setting some attributes with get/setAttribute +if ( !getSetAttribute ) { + + fixSpecified = { + name: true, + id: true + }; + + // Use this for any attribute in IE6/7 + // This fixes almost every IE6/7 issue + nodeHook = jQuery.valHooks.button = { + get: function( elem, name ) { + var ret; + ret = elem.getAttributeNode( name ); + return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? + ret.nodeValue : + undefined; + }, + set: function( elem, value, name ) { + // Set the existing or create a new attribute node + var ret = elem.getAttributeNode( name ); + if ( !ret ) { + ret = document.createAttribute( name ); + elem.setAttributeNode( ret ); + } + return ( ret.nodeValue = value + "" ); + } + }; + + // Apply the nodeHook to tabindex + jQuery.attrHooks.tabindex.set = nodeHook.set; + + // Set width and height to auto instead of 0 on empty string( Bug #8150 ) + // This is for removals + jQuery.each([ "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + set: function( elem, value ) { + if ( value === "" ) { + elem.setAttribute( name, "auto" ); + return value; + } + } + }); + }); + + // Set contenteditable to false on removals(#10429) + // Setting to empty string throws an error as an invalid value + jQuery.attrHooks.contenteditable = { + get: nodeHook.get, + set: function( elem, value, name ) { + if ( value === "" ) { + value = "false"; + } + nodeHook.set( elem, value, name ); + } + }; +} + + +// Some attributes require a special call on IE +if ( !jQuery.support.hrefNormalized ) { + jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { + jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { + get: function( elem ) { + var ret = elem.getAttribute( name, 2 ); + return ret === null ? undefined : ret; + } + }); + }); +} + +if ( !jQuery.support.style ) { + jQuery.attrHooks.style = { + get: function( elem ) { + // Return undefined in the case of empty string + // Normalize to lowercase since IE uppercases css property names + return elem.style.cssText.toLowerCase() || undefined; + }, + set: function( elem, value ) { + return ( elem.style.cssText = "" + value ); + } + }; +} + +// Safari mis-reports the default selected property of an option +// Accessing the parent's selectedIndex property fixes it +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + + if ( parent ) { + parent.selectedIndex; + + // Make sure that it also works with optgroups, see #5701 + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + return null; + } + }); +} + +// IE6/7 call enctype encoding +if ( !jQuery.support.enctype ) { + jQuery.propFix.enctype = "encoding"; +} + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + + + + +var rnamespaces = /\.(.*)$/, + rformElems = /^(?:textarea|input|select)$/i, + rperiod = /\./g, + rspaces = / /g, + rescape = /[^\w\s.|`]/g, + rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, + rhoverHack = /\bhover(\.\S+)?/, + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, + quickParse = function( selector ) { + var quick = rquickIs.exec( selector ); + if ( quick ) { + // 0 1 2 3 + // [ _, tag, id, class ] + quick[1] = ( quick[1] || "" ).toLowerCase(); + quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); + } + return quick; + }, + quickIs = function( elem, m ) { + return ( + (!m[1] || elem.nodeName.toLowerCase() === m[1]) && + (!m[2] || elem.id === m[2]) && + (!m[3] || m[3].test( elem.className )) + ); + }, + hoverHack = function( events ) { + return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); + }; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + + var elemData, eventHandle, events, + t, tns, type, namespaces, handleObj, + handleObjIn, quick, handlers, special; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + types = hoverHack(types).split( " " ); + for ( t = 0; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + namespace: namespaces.join(".") + }, handleObjIn ); + + // Delegated event; pre-analyze selector so it's processed quickly on event dispatch + if ( selector ) { + handleObj.quick = quickParse( selector ); + if ( !handleObj.quick && jQuery.expr.match.POS.test( selector ) ) { + handleObj.isPositional = true; + } + } + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener/attachEvent if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + // Bind the global event handler to the element + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + + } else if ( elem.attachEvent ) { + elem.attachEvent( "on" + type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector ) { + + var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), + t, tns, type, namespaces, origCount, + j, events, special, handle, eventType, handleObj; + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = hoverHack( types || "" ).split(" "); + for ( t = 0; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + namespaces = namespaces? "." + namespaces : ""; + for ( j in events ) { + jQuery.event.remove( elem, j + namespaces, handler, selector ); + } + return; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + + // Only need to loop for special events or selective removal + if ( handler || namespaces || selector || special.remove ) { + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( !handler || handler.guid === handleObj.guid ) { + if ( !namespaces || namespaces.test( handleObj.namespace ) ) { + if ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + } + } + } else { + // Removing all events + eventType.length = 0; + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + handle = elemData.handle; + if ( handle ) { + handle.elem = null; + } + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery.removeData( elem, [ "events", "handle" ], true ); + } + }, + + // Events that are safe to short-circuit if no handlers are attached. + // Native DOM events should not be added, they may have inline handlers. + customEvent: { + "getData": true, + "setData": true, + "changeData": true + }, + + trigger: function( event, data, elem, onlyHandlers ) { + // Don't do events on text and comment nodes + if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { + return; + } + + // Event object or event type + var type = event.type || event, + namespaces = [], + cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; + + if ( type.indexOf( "!" ) >= 0 ) { + // Exclusive events trigger only for the exact event (no namespaces) + type = type.slice(0, -1); + exclusive = true; + } + + if ( type.indexOf( "." ) >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { + // No jQuery handlers for this event type, and it can't have inline handlers + return; + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.exclusive = exclusive; + event.namespace = namespaces.join( "." ); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; + ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; + + // triggerHandler() and global events don't bubble or run the default action + if ( onlyHandlers || !elem ) { + event.preventDefault(); + } + + // Handle a global trigger + if ( !elem ) { + + // TODO: Stop taunting the data cache; remove global events and always attach to document + cache = jQuery.cache; + for ( i in cache ) { + if ( cache[ i ].events && cache[ i ].events[ type ] ) { + jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); + } + } + return; + } + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + old = null; + for ( cur = elem.parentNode; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old && old === elem.ownerDocument ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length; i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) ) { + handle.apply( cur, data ); + } + + if ( event.isPropagationStopped() ) { + break; + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Can't use an .isFunction() check here because IE6/7 fails that test. + // Don't do default actions on window, that's where global variables be (#6170) + // IE<9 dies on focus/blur to hidden element (#1486) + if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event || window.event ); + + var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = [].slice.call( arguments, 0 ), + run_all = !event.exclusive && !event.namespace, + specialHandle = ( jQuery.event.special[ event.type ] || {} ).handle, + handlerQueue = [], + i, j, cur, ret, selMatch, matched, matches, handleObj, sel, hit, related; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Determine handlers that should run if there are delegated events + // Avoid disabled elements in IE (#6911) and non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !event.target.disabled && !(event.button && event.type === "click") ) { + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + hit = selMatch[ sel ]; + + if ( handleObj.isPositional ) { + // Since .is() does not work for positionals; see http://jsfiddle.net/eJ4yd/3/ + hit = ( hit || (selMatch[ sel ] = jQuery( sel )) ).index( cur ) >= 0; + } else if ( hit === undefined ) { + hit = selMatch[ sel ] = ( handleObj.quick ? quickIs( cur, handleObj.quick ) : jQuery( cur ).is( sel ) ); + } + if ( hit ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) be non-exclusive and have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( specialHandle || handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** + props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement wheelDelta".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button, + fromElement = original.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && fromElement ) { + event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) + if ( !event.target ) { + event.target = originalEvent.srcElement || document; + } + + // Target should not be a text node (#504, Safari) + if ( event.target.nodeType === 3 ) { + event.target = event.target.parentNode; + } + + // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) + if ( event.metaKey === undefined ) { + event.metaKey = event.ctrlKey; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: jQuery.bindReady + }, + + focus: { + delegateType: "focusin", + noBubble: true + }, + blur: { + delegateType: "focusout", + noBubble: true + }, + + beforeunload: { + setup: function( data, namespaces, eventHandle ) { + // We only want to do this special case on windows + if ( jQuery.isWindow( this ) ) { + this.onbeforeunload = eventHandle; + } + }, + + teardown: function( namespaces, eventHandle ) { + if ( this.onbeforeunload === eventHandle ) { + this.onbeforeunload = null; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = document.removeEventListener ? + function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } + } : + function( elem, type, handle ) { + if ( elem.detachEvent ) { + elem.detachEvent( "on" + type, handle ); + } + }; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + + // if preventDefault exists run it on the original event + if ( e.preventDefault ) { + e.preventDefault(); + + // otherwise set the returnValue property of the original event to false (IE) + } else { + e.returnValue = false; + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( !e ) { + return; + } + // if stopPropagation exists run it on the original event + if ( e.stopPropagation ) { + e.stopPropagation(); + } + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = jQuery.event.special[ fix ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var target = this, + related = event.relatedTarget, + handleObj = event.handleObj, + selector = handleObj.selector, + oldType, ret; + + // For a real mouseover/out, always call the handler; for + // mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || handleObj.origType === event.type || (related !== target && !jQuery.contains( target, related )) ) { + oldType = event.type; + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = oldType; + } + return ret; + } + }; +}); + +// IE submit delegation +if ( !jQuery.support.submitBubbles ) { + + jQuery.event.special.submit = { + setup: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Lazy-add a submit handler when a descendant form may potentially be submitted + jQuery.event.add( this, "click._submit keypress._submit", function( e ) { + // Node name check avoids a VML-related crash in IE (#9807) + var elem = e.target, + form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; + if ( form && !form._submit_attached ) { + jQuery.event.add( form, "submit._submit", function( event ) { + // Form was submitted, bubble the event up the tree + if ( this.parentNode ) { + jQuery.event.simulate( "submit", this.parentNode, event, true ); + } + }); + form._submit_attached = true; + } + }); + // return undefined since we don't need an event listener + }, + + teardown: function() { + // Only need this for delegated form submit events + if ( jQuery.nodeName( this, "form" ) ) { + return false; + } + + // Remove delegated handlers; cleanData eventually reaps submit handlers attached above + jQuery.event.remove( this, "._submit" ); + } + }; +} + +// IE change delegation and checkbox/radio fix +if ( !jQuery.support.changeBubbles ) { + + jQuery.event.special.change = { + + setup: function() { + + if ( rformElems.test( this.nodeName ) ) { + // IE doesn't fire change on a check/radio until blur; trigger it on click + // after a propertychange. Eat the blur-change in special.change.handle. + // This still fires onchange a second time for check/radio after blur. + if ( this.type === "checkbox" || this.type === "radio" ) { + jQuery.event.add( this, "propertychange._change", function( event ) { + if ( event.originalEvent.propertyName === "checked" ) { + this._just_changed = true; + } + }); + jQuery.event.add( this, "click._change", function( event ) { + if ( this._just_changed ) { + this._just_changed = false; + jQuery.event.simulate( "change", this, event, true ); + } + }); + } + return false; + } + // Delegated event; lazy-add a change handler on descendant inputs + jQuery.event.add( this, "beforeactivate._change", function( e ) { + var elem = e.target; + + if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { + jQuery.event.add( elem, "change._change", function( event ) { + if ( this.parentNode && !event.isSimulated ) { + jQuery.event.simulate( "change", this.parentNode, event, true ); + } + }); + elem._change_attached = true; + } + }); + }, + + handle: function( event ) { + var elem = event.target; + + // Swallow native change events from checkbox/radio, we already triggered them above + if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { + return event.handleObj.handler.apply( this, arguments ); + } + }, + + teardown: function() { + jQuery.event.remove( this, "._change" ); + + return rformElems.test( this.nodeName ); + } + }; +} + +// Create "bubbling" focus and blur events +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + // ( types-Object, data ) + data = selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on.call( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + var handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace? handleObj.type + "." + handleObj.namespace : handleObj.type, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( var type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + live: function( types, data, fn ) { + jQuery( this.context ).on( types, this.selector, data, fn ); + return this; + }, + die: function( types, fn ) { + jQuery( this.context ).off( types, this.selector || "**", fn ); + return this; + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, + guid = fn.guid || jQuery.guid++, + i = 0, + toggler = function( event ) { + // Figure out which function to execute + var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; + jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ lastToggle ].apply( this, arguments ) || false; + }; + + // link all the functions, so any of them can unbind this click handler + toggler.guid = guid; + while ( i < args.length ) { + args[ i++ ].guid = guid; + } + + return this.click( toggler ); + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + if ( fn == null ) { + fn = data; + data = null; + } + + return arguments.length > 0 ? + this.bind( name, data, fn ) : + this.trigger( name ); + }; + + if ( jQuery.attrFn ) { + jQuery.attrFn[ name ] = true; + } + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); + + + +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, + expando = "sizcache" + (Math.random() + '').replace('.', ''), + done = 0, + toString = Object.prototype.toString, + hasDuplicate = false, + baseHasDuplicate = true, + rBackslash = /\\/g, + rReturn = /\r\n/g, + rNonWord = /\W/; + +// Here we check if the JavaScript engine is using some sort of +// optimization where it does not always call our comparision +// function. If that is the case, discard the hasDuplicate value. +// Thus far that includes Google Chrome. +[0, 0].sort(function() { + baseHasDuplicate = false; + return 0; +}); + +var Sizzle = function( selector, context, results, seed ) { + results = results || []; + context = context || document; + + var origContext = context; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) { + return []; + } + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var m, set, checkSet, extra, ret, cur, pop, i, + prune = true, + contextXML = Sizzle.isXML( context ), + parts = [], + soFar = selector; + + // Reset the position of the chunker regexp (start from head) + do { + chunker.exec( "" ); + m = chunker.exec( soFar ); + + if ( m ) { + soFar = m[3]; + + parts.push( m[1] ); + + if ( m[2] ) { + extra = m[3]; + break; + } + } + } while ( m ); + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context, seed ); + + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) { + selector += parts.shift(); + } + + set = posProcess( selector, set, seed ); + } + } + + } else { + // Take a shortcut and set the context if the root selector is an ID + // (but not if it'll be faster if the inner selector is an ID) + if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && + Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { + + ret = Sizzle.find( parts.shift(), context, contextXML ); + context = ret.expr ? + Sizzle.filter( ret.expr, ret.set )[0] : + ret.set[0]; + } + + if ( context ) { + ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); + + set = ret.expr ? + Sizzle.filter( ret.expr, ret.set ) : + ret.set; + + if ( parts.length > 0 ) { + checkSet = makeArray( set ); + + } else { + prune = false; + } + + while ( parts.length ) { + cur = parts.pop(); + pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, contextXML ); + } + + } else { + checkSet = parts = []; + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + Sizzle.error( cur || selector ); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + + } else if ( context && context.nodeType === 1 ) { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + + } else { + for ( i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, origContext, results, seed ); + Sizzle.uniqueSort( results ); + } + + return results; +}; + +Sizzle.uniqueSort = function( results ) { + if ( sortOrder ) { + hasDuplicate = baseHasDuplicate; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[ i - 1 ] ) { + results.splice( i--, 1 ); + } + } + } + } + + return results; +}; + +Sizzle.matches = function( expr, set ) { + return Sizzle( expr, null, null, set ); +}; + +Sizzle.matchesSelector = function( node, expr ) { + return Sizzle( expr, null, null, [node] ).length > 0; +}; + +Sizzle.find = function( expr, context, isXML ) { + var set, i, len, match, type, left; + + if ( !expr ) { + return []; + } + + for ( i = 0, len = Expr.order.length; i < len; i++ ) { + type = Expr.order[i]; + + if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { + left = match[1]; + match.splice( 1, 1 ); + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace( rBackslash, "" ); + set = Expr.find[ type ]( match, context, isXML ); + + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = typeof context.getElementsByTagName !== "undefined" ? + context.getElementsByTagName( "*" ) : + []; + } + + return { set: set, expr: expr }; +}; + +Sizzle.filter = function( expr, set, inplace, not ) { + var match, anyFound, + type, found, item, filter, left, + i, pass, + old = expr, + result = [], + curLoop = set, + isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); + + while ( expr && set.length ) { + for ( type in Expr.filter ) { + if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { + filter = Expr.filter[ type ]; + left = match[1]; + + anyFound = false; + + match.splice(1,1); + + if ( left.substr( left.length - 1 ) === "\\" ) { + continue; + } + + if ( curLoop === result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + pass = not ^ found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + + } else { + curLoop[i] = false; + } + + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr === old ) { + if ( anyFound == null ) { + Sizzle.error( expr ); + + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +Sizzle.error = function( msg ) { + throw "Syntax error, unrecognized expression: " + msg; +}; + +/** + * Utility function for retreiving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +var getText = Sizzle.getText = function( elem ) { + var i, node, + nodeType = elem.nodeType, + ret = ""; + + if ( nodeType ) { + if ( nodeType === 1 ) { + // Use textContent || innerText for elements + if ( typeof elem.textContent === 'string' ) { + return elem.textContent; + } else if ( typeof elem.innerText === 'string' ) { + // Replace IE's carriage returns + return elem.innerText.replace( rReturn, '' ); + } else { + // Traverse it's children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + } else { + + // If no nodeType, this is expected to be an array + for ( i = 0; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + if ( node.nodeType !== 8 ) { + ret += getText( node ); + } + } + } + return ret; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + + match: { + ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ + }, + + leftMatch: {}, + + attrMap: { + "class": "className", + "for": "htmlFor" + }, + + attrHandle: { + href: function( elem ) { + return elem.getAttribute( "href" ); + }, + type: function( elem ) { + return elem.getAttribute( "type" ); + } + }, + + relative: { + "+": function(checkSet, part){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !rNonWord.test( part ), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag ) { + part = part.toLowerCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + + ">": function( checkSet, part ) { + var elem, + isPartStr = typeof part === "string", + i = 0, + l = checkSet.length; + + if ( isPartStr && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; + } + } + + } else { + for ( ; i < l; i++ ) { + elem = checkSet[i]; + + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + + "": function(checkSet, part, isXML){ + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); + }, + + "~": function( checkSet, part, isXML ) { + var nodeCheck, + doneName = done++, + checkFn = dirCheck; + + if ( typeof part === "string" && !rNonWord.test( part ) ) { + part = part.toLowerCase(); + nodeCheck = part; + checkFn = dirNodeCheck; + } + + checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); + } + }, + + find: { + ID: function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }, + + NAME: function( match, context ) { + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], + results = context.getElementsByName( match[1] ); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + + TAG: function( match, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( match[1] ); + } + } + }, + preFilter: { + CLASS: function( match, curLoop, inplace, result, not, isXML ) { + match = " " + match[1].replace( rBackslash, "" ) + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { + if ( !inplace ) { + result.push( elem ); + } + + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + + ID: function( match ) { + return match[1].replace( rBackslash, "" ); + }, + + TAG: function( match, curLoop ) { + return match[1].replace( rBackslash, "" ).toLowerCase(); + }, + + CHILD: function( match ) { + if ( match[1] === "nth" ) { + if ( !match[2] ) { + Sizzle.error( match[0] ); + } + + match[2] = match[2].replace(/^\+|\s*/g, ''); + + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( + match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + else if ( match[2] ) { + Sizzle.error( match[0] ); + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + + ATTR: function( match, curLoop, inplace, result, not, isXML ) { + var name = match[1] = match[1].replace( rBackslash, "" ); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + // Handle if an un-quoted value was used + match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + + PSEUDO: function( match, curLoop, inplace, result, not ) { + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + + if ( !inplace ) { + result.push.apply( result, ret ); + } + + return false; + } + + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + + POS: function( match ) { + match.unshift( true ); + + return match; + } + }, + + filters: { + enabled: function( elem ) { + return elem.disabled === false && elem.type !== "hidden"; + }, + + disabled: function( elem ) { + return elem.disabled === true; + }, + + checked: function( elem ) { + return elem.checked === true; + }, + + selected: function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + parent: function( elem ) { + return !!elem.firstChild; + }, + + empty: function( elem ) { + return !elem.firstChild; + }, + + has: function( elem, i, match ) { + return !!Sizzle( match[3], elem ).length; + }, + + header: function( elem ) { + return (/h\d/i).test( elem.nodeName ); + }, + + text: function( elem ) { + var attr = elem.getAttribute( "type" ), type = elem.type; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); + }, + + radio: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; + }, + + checkbox: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; + }, + + file: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; + }, + + password: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; + }, + + submit: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "submit" === elem.type; + }, + + image: function( elem ) { + return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; + }, + + reset: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && "reset" === elem.type; + }, + + button: function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && "button" === elem.type || name === "button"; + }, + + input: function( elem ) { + return (/input|select|textarea|button/i).test( elem.nodeName ); + }, + + focus: function( elem ) { + return elem === elem.ownerDocument.activeElement; + } + }, + setFilters: { + first: function( elem, i ) { + return i === 0; + }, + + last: function( elem, i, match, array ) { + return i === array.length - 1; + }, + + even: function( elem, i ) { + return i % 2 === 0; + }, + + odd: function( elem, i ) { + return i % 2 === 1; + }, + + lt: function( elem, i, match ) { + return i < match[3] - 0; + }, + + gt: function( elem, i, match ) { + return i > match[3] - 0; + }, + + nth: function( elem, i, match ) { + return match[3] - 0 === i; + }, + + eq: function( elem, i, match ) { + return match[3] - 0 === i; + } + }, + filter: { + PSEUDO: function( elem, match, i, array ) { + var name = match[1], + filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; + + } else if ( name === "not" ) { + var not = match[3]; + + for ( var j = 0, l = not.length; j < l; j++ ) { + if ( not[j] === elem ) { + return false; + } + } + + return true; + + } else { + Sizzle.error( name ); + } + }, + + CHILD: function( elem, match ) { + var first, last, + doneName, parent, cache, + count, diff, + type = match[1], + node = elem; + + switch ( type ) { + case "only": + case "first": + while ( (node = node.previousSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + if ( type === "first" ) { + return true; + } + + node = elem; + + case "last": + while ( (node = node.nextSibling) ) { + if ( node.nodeType === 1 ) { + return false; + } + } + + return true; + + case "nth": + first = match[2]; + last = match[3]; + + if ( first === 1 && last === 0 ) { + return true; + } + + doneName = match[0]; + parent = elem.parentNode; + + if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { + count = 0; + + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + + parent[ expando ] = doneName; + } + + diff = elem.nodeIndex - last; + + if ( first === 0 ) { + return diff === 0; + + } else { + return ( diff % first === 0 && diff / first >= 0 ); + } + } + }, + + ID: function( elem, match ) { + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + + TAG: function( elem, match ) { + return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; + }, + + CLASS: function( elem, match ) { + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + + ATTR: function( elem, match ) { + var name = match[1], + result = Sizzle.attr ? + Sizzle.attr( elem, name ) : + Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + !type && Sizzle.attr ? + result != null : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value !== check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + + POS: function( elem, match, i, array ) { + var name = match[2], + filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS, + fescape = function(all, num){ + return "\\" + (num - 0 + 1); + }; + +for ( var type in Expr.match ) { + Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); + Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); +} + +var makeArray = function( array, results ) { + array = Array.prototype.slice.call( array, 0 ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +// Also verifies that the returned array holds DOM nodes +// (which is not the case in the Blackberry browser) +try { + Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; + +// Provide a fallback method if it does not work +} catch( e ) { + makeArray = function( array, results ) { + var i = 0, + ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + + } else { + if ( typeof array.length === "number" ) { + for ( var l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + + } else { + for ( ; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder, siblingCheck; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { + return a.compareDocumentPosition ? -1 : 1; + } + + return a.compareDocumentPosition(b) & 4 ? -1 : 1; + }; + +} else { + sortOrder = function( a, b ) { + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return a.sourceIndex - b.sourceIndex; + } + + var al, bl, + ap = [], + bp = [], + aup = a.parentNode, + bup = b.parentNode, + cur = aup; + + // If the nodes are siblings (or identical) we can do a quick check + if ( aup === bup ) { + return siblingCheck( a, b ); + + // If no parents were found then the nodes are disconnected + } else if ( !aup ) { + return -1; + + } else if ( !bup ) { + return 1; + } + + // Otherwise they're somewhere else in the tree so we need + // to build up a full list of the parentNodes for comparison + while ( cur ) { + ap.unshift( cur ); + cur = cur.parentNode; + } + + cur = bup; + + while ( cur ) { + bp.unshift( cur ); + cur = cur.parentNode; + } + + al = ap.length; + bl = bp.length; + + // Start walking down the tree looking for a discrepancy + for ( var i = 0; i < al && i < bl; i++ ) { + if ( ap[i] !== bp[i] ) { + return siblingCheck( ap[i], bp[i] ); + } + } + + // We ended someplace up the tree so do a sibling check + return i === al ? + siblingCheck( a, bp[i], -1 ) : + siblingCheck( ap[i], b, 1 ); + }; + + siblingCheck = function( a, b, ret ) { + if ( a === b ) { + return ret; + } + + var cur = a.nextSibling; + + while ( cur ) { + if ( cur === b ) { + return -1; + } + + cur = cur.nextSibling; + } + + return 1; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("div"), + id = "script" + (new Date()).getTime(), + root = document.documentElement; + + form.innerHTML = "<a name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( document.getElementById( id ) ) { + Expr.find.ID = function( match, context, isXML ) { + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + + return m ? + m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? + [m] : + undefined : + []; + } + }; + + Expr.filter.ID = function( elem, match ) { + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); + + // release memory in IE + root = form = null; +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function( match, context ) { + var results = context.getElementsByTagName( match[1] ); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + + Expr.attrHandle.href = function( elem ) { + return elem.getAttribute( "href", 2 ); + }; + } + + // release memory in IE + div = null; +})(); + +if ( document.querySelectorAll ) { + (function(){ + var oldSizzle = Sizzle, + div = document.createElement("div"), + id = "__sizzle__"; + + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function( query, context, extra, seed ) { + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && !Sizzle.isXML(context) ) { + // See if we find a selector to speed up + var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); + + if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { + // Speed-up: Sizzle("TAG") + if ( match[1] ) { + return makeArray( context.getElementsByTagName( query ), extra ); + + // Speed-up: Sizzle(".CLASS") + } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { + return makeArray( context.getElementsByClassName( match[2] ), extra ); + } + } + + if ( context.nodeType === 9 ) { + // Speed-up: Sizzle("body") + // The body element only exists once, optimize finding it + if ( query === "body" && context.body ) { + return makeArray( [ context.body ], extra ); + + // Speed-up: Sizzle("#ID") + } else if ( match && match[3] ) { + var elem = context.getElementById( match[3] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id === match[3] ) { + return makeArray( [ elem ], extra ); + } + + } else { + return makeArray( [], extra ); + } + } + + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(qsaError) {} + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + var oldContext = context, + old = context.getAttribute( "id" ), + nid = old || id, + hasParent = context.parentNode, + relativeHierarchySelector = /^\s*[+~]/.test( query ); + + if ( !old ) { + context.setAttribute( "id", nid ); + } else { + nid = nid.replace( /'/g, "\\$&" ); + } + if ( relativeHierarchySelector && hasParent ) { + context = context.parentNode; + } + + try { + if ( !relativeHierarchySelector || hasParent ) { + return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); + } + + } catch(pseudoError) { + } finally { + if ( !old ) { + oldContext.removeAttribute( "id" ); + } + } + } + } + + return oldSizzle(query, context, extra, seed); + }; + + for ( var prop in oldSizzle ) { + Sizzle[ prop ] = oldSizzle[ prop ]; + } + + // release memory in IE + div = null; + })(); +} + +(function(){ + var html = document.documentElement, + matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; + + if ( matches ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9 fails this) + var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), + pseudoWorks = false; + + try { + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( document.documentElement, "[test!='']:sizzle" ); + + } catch( pseudoError ) { + pseudoWorks = true; + } + + Sizzle.matchesSelector = function( node, expr ) { + // Make sure that attribute selectors are quoted + expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); + + if ( !Sizzle.isXML( node ) ) { + try { + if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { + var ret = matches.call( node, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || !disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9, so check for that + node.document && node.document.nodeType !== 11 ) { + return ret; + } + } + } catch(e) {} + } + + return Sizzle(expr, null, null, [node]).length > 0; + }; + } +})(); + +(function(){ + var div = document.createElement("div"); + + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + // Also, make sure that getElementsByClassName actually exists + if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { + return; + } + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) { + return; + } + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function( match, context, isXML ) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; + + // release memory in IE + div = null; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( elem.nodeName.toLowerCase() === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + + if ( elem ) { + var match = false; + + elem = elem[dir]; + + while ( elem ) { + if ( elem[ expando ] === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem[ expando ] = doneName; + elem.sizset = i; + } + + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +if ( document.documentElement.contains ) { + Sizzle.contains = function( a, b ) { + return a !== b && (a.contains ? a.contains(b) : true); + }; + +} else if ( document.documentElement.compareDocumentPosition ) { + Sizzle.contains = function( a, b ) { + return !!(a.compareDocumentPosition(b) & 16); + }; + +} else { + Sizzle.contains = function() { + return false; + }; +} + +Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; + + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +var posProcess = function( selector, context, seed ) { + var match, + tmpSet = [], + later = "", + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet, seed ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +Sizzle.selectors.attrMap = {}; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})(); + + +var runtil = /Until$/, + rparentsprev = /^(?:parents|prevUntil|prevAll)/, + // Note: This RegExp should be improved, or likely pulled from Sizzle + rmultiselector = /,/, + isSimple = /^.[^:#\[\.,]*$/, + slice = Array.prototype.slice, + POS = jQuery.expr.match.POS, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self = this, + i, l; + + if ( typeof selector !== "string" ) { + return jQuery( selector ).filter(function() { + for ( i = 0, l = self.length; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }); + } + + var ret = this.pushStack( "", "find", selector ), + length, n, r; + + for ( i = 0, l = this.length; i < l; i++ ) { + length = ret.length; + jQuery.find( selector, this[i], ret ); + + if ( i > 0 ) { + // Make sure that the results are unique + for ( n = length; n < ret.length; n++ ) { + for ( r = 0; r < length; r++ ) { + if ( ret[r] === ret[n] ) { + ret.splice(n--, 1); + break; + } + } + } + } + } + + return ret; + }, + + has: function( target ) { + var targets = jQuery( target ); + return this.filter(function() { + for ( var i = 0, l = targets.length; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false), "not", selector); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true), "filter", selector ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + POS.test( selector ) ? + jQuery( selector, this.context ).index( this[0] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var ret = [], i, l, cur = this[0]; + + // Array (deprecated as of jQuery 1.7) + if ( jQuery.isArray( selectors ) ) { + var level = 1; + + while ( cur && cur.ownerDocument && cur !== context ) { + for ( i = 0; i < selectors.length; i++ ) { + + if ( jQuery( cur ).is( selectors[ i ] ) ) { + ret.push({ selector: selectors[ i ], elem: cur, level: level }); + } + } + + cur = cur.parentNode; + level++; + } + + return ret; + } + + // String + var pos = POS.test( selectors ) || typeof selectors !== "string" ? + jQuery( selectors, context || this.context ) : + 0; + + for ( i = 0, l = this.length; i < l; i++ ) { + cur = this[i]; + + while ( cur ) { + if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { + ret.push( cur ); + break; + + } else { + cur = cur.parentNode; + if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { + break; + } + } + } + } + + ret = ret.length > 1 ? jQuery.unique( ret ) : ret; + + return this.pushStack( ret, "closest", selectors ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return jQuery.inArray( this[0], jQuery( elem ) ); + } + + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[0] : elem, this ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? + all : + jQuery.unique( all ) ); + }, + + andSelf: function() { + return this.add( this.prevObject ); + } +}); + +// A painfully simple check to see if an element is disconnected +// from a document (should be improved, where feasible). +function isDisconnected( node ) { + return !node || !node.parentNode || node.parentNode.nodeType === 11; +} + +jQuery.each({ + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return jQuery.nth( elem, 2, "nextSibling" ); + }, + prev: function( elem ) { + return jQuery.nth( elem, 2, "previousSibling" ); + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( elem.parentNode.firstChild, elem ); + }, + children: function( elem ) { + return jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.makeArray( elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var ret = jQuery.map( this, fn, until ), + // The variable 'args' was introduced in + // https://github.com/jquery/jquery/commit/52a0238 + // to work around a bug in Chrome 10 (Dev) and should be removed when the bug is fixed. + // http://code.google.com/p/v8/issues/detail?id=1050 + args = slice.call(arguments); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + ret = jQuery.filter( selector, ret ); + } + + ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; + + if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { + ret = ret.reverse(); + } + + return this.pushStack( ret, name, args.join(",") ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : + jQuery.find.matches(expr, elems); + }, + + dir: function( elem, dir, until ) { + var matched = [], + cur = elem[ dir ]; + + while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { + if ( cur.nodeType === 1 ) { + matched.push( cur ); + } + cur = cur[dir]; + } + return matched; + }, + + nth: function( cur, result, dir, elem ) { + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) { + if ( cur.nodeType === 1 && ++num === result ) { + break; + } + } + + return cur; + }, + + sibling: function( n, elem ) { + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + r.push( n ); + } + } + + return r; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + + } else if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem, i ) { + return ( elem === qualifier ) === keep; + }); + + } else if ( typeof qualifier === "string" ) { + var filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter(qualifier, filtered, !keep); + } else { + qualifier = jQuery.filter( qualifier, filtered ); + } + } + + return jQuery.grep(elements, function( elem, i ) { + return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; + }); +} + + + + +function createSafeFragment( document ) { + var list = nodeNames.split( " " ), + safeFrag = document.createDocumentFragment(); + + if ( safeFrag.createElement ) { + while ( list.length ) { + safeFrag.createElement( + list.pop() + ); + } + } + return safeFrag; +} + +var nodeNames = "abbr article aside audio canvas datalist details figcaption figure footer " + + "header hgroup mark meter nav output progress section summary time video", + rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, + rleadingWhitespace = /^\s+/, + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, + rtagName = /<([\w:]+)/, + rtbody = /<tbody/i, + rhtml = /<|&#?\w+;/, + rnoInnerhtml = /<(?:script|style)/i, + rnocache = /<(?:script|object|embed|option|style)/i, + rnoshimcache = new RegExp("<(?:" + nodeNames.replace(" ", "|") + ")", "i"), + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /\/(java|ecma)script/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, + wrapMap = { + option: [ 1, "<select multiple='multiple'>", "</select>" ], + legend: [ 1, "<fieldset>", "</fieldset>" ], + thead: [ 1, "<table>", "</table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], + area: [ 1, "<map>", "</map>" ], + _default: [ 0, "", "" ] + }, + safeFragment = createSafeFragment( document ); + +wrapMap.optgroup = wrapMap.option; +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// IE can't serialize <link> and <script> tags normally +if ( !jQuery.support.htmlSerialize ) { + wrapMap._default = [ 1, "div<div>", "</div>" ]; +} + +jQuery.fn.extend({ + text: function( text ) { + if ( jQuery.isFunction(text) ) { + return this.each(function(i) { + var self = jQuery( this ); + + self.text( text.call(this, i, self.text()) ); + }); + } + + if ( typeof text !== "object" && text !== undefined ) { + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + } + + return jQuery.text( this ); + }, + + wrapAll: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapAll( html.call(this, i) ); + }); + } + + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); + + if ( this[0].parentNode ) { + wrap.insertBefore( this[0] ); + } + + wrap.map(function() { + var elem = this; + + while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { + elem = elem.firstChild; + } + + return elem; + }).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( jQuery.isFunction( html ) ) { + return this.each(function(i) { + jQuery(this).wrapInner( html.call(this, i) ); + }); + } + + return this.each(function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + }); + }, + + wrap: function( html ) { + return this.each(function() { + jQuery( this ).wrapAll( html ); + }); + }, + + unwrap: function() { + return this.parent().each(function() { + if ( !jQuery.nodeName( this, "body" ) ) { + jQuery( this ).replaceWith( this.childNodes ); + } + }).end(); + }, + + append: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.appendChild( elem ); + } + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function( elem ) { + if ( this.nodeType === 1 ) { + this.insertBefore( elem, this.firstChild ); + } + }); + }, + + before: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this ); + }); + } else if ( arguments.length ) { + var set = jQuery(arguments[0]); + set.push.apply( set, this.toArray() ); + return this.pushStack( set, "before", arguments ); + } + }, + + after: function() { + if ( this[0] && this[0].parentNode ) { + return this.domManip(arguments, false, function( elem ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + } else if ( arguments.length ) { + var set = this.pushStack( this, "after", arguments ); + set.push.apply( set, jQuery(arguments[0]).toArray() ); + return set; + } + }, + + // keepData is for internal use only--do not document + remove: function( selector, keepData ) { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { + if ( !keepData && elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + jQuery.cleanData( [ elem ] ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } + } + } + + return this; + }, + + empty: function() { + for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( elem.getElementsByTagName("*") ); + } + + // Remove any remaining nodes + while ( elem.firstChild ) { + elem.removeChild( elem.firstChild ); + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function () { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + }); + }, + + html: function( value ) { + if ( value === undefined ) { + return this[0] && this[0].nodeType === 1 ? + this[0].innerHTML.replace(rinlinejQuery, "") : + null; + + // See if we can take a shortcut and just use innerHTML + } else if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + (jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value )) && + !wrapMap[ (rtagName.exec( value ) || ["", ""])[1].toLowerCase() ] ) { + + value = value.replace(rxhtmlTag, "<$1></$2>"); + + try { + for ( var i = 0, l = this.length; i < l; i++ ) { + // Remove element nodes and prevent memory leaks + if ( this[i].nodeType === 1 ) { + jQuery.cleanData( this[i].getElementsByTagName("*") ); + this[i].innerHTML = value; + } + } + + // If using innerHTML throws an exception, use the fallback method + } catch(e) { + this.empty().append( value ); + } + + } else if ( jQuery.isFunction( value ) ) { + this.each(function(i){ + var self = jQuery( this ); + + self.html( value.call(this, i, self.html()) ); + }); + + } else { + this.empty().append( value ); + } + + return this; + }, + + replaceWith: function( value ) { + if ( this[0] && this[0].parentNode ) { + // Make sure that the elements are removed from the DOM before they are inserted + // this can help fix replacing a parent with child elements + if ( jQuery.isFunction( value ) ) { + return this.each(function(i) { + var self = jQuery(this), old = self.html(); + self.replaceWith( value.call( this, i, old ) ); + }); + } + + if ( typeof value !== "string" ) { + value = jQuery( value ).detach(); + } + + return this.each(function() { + var next = this.nextSibling, + parent = this.parentNode; + + jQuery( this ).remove(); + + if ( next ) { + jQuery(next).before( value ); + } else { + jQuery(parent).append( value ); + } + }); + } else { + return this.length ? + this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : + this; + } + }, + + detach: function( selector ) { + return this.remove( selector, true ); + }, + + domManip: function( args, table, callback ) { + var results, first, fragment, parent, + value = args[0], + scripts = []; + + // We can't cloneNode fragments that contain checked, in WebKit + if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { + return this.each(function() { + jQuery(this).domManip( args, table, callback, true ); + }); + } + + if ( jQuery.isFunction(value) ) { + return this.each(function(i) { + var self = jQuery(this); + args[0] = value.call(this, i, table ? self.html() : undefined); + self.domManip( args, table, callback ); + }); + } + + if ( this[0] ) { + parent = value && value.parentNode; + + // If we're in a fragment, just use that instead of building a new one + if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { + results = { fragment: parent }; + + } else { + results = jQuery.buildFragment( args, this, scripts ); + } + + fragment = results.fragment; + + if ( fragment.childNodes.length === 1 ) { + first = fragment = fragment.firstChild; + } else { + first = fragment.firstChild; + } + + if ( first ) { + table = table && jQuery.nodeName( first, "tr" ); + + for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { + callback.call( + table ? + root(this[i], first) : + this[i], + // Make sure that we do not leak memory by inadvertently discarding + // the original fragment (which might have attached data) instead of + // using it; in addition, use the original fragment object for the last + // item instead of first because it can end up being emptied incorrectly + // in certain situations (Bug #8070). + // Fragments from the fragment cache must always be cloned and never used + // in place. + results.cacheable || ( l > 1 && i < lastIndex ) ? + jQuery.clone( fragment, true, true ) : + fragment + ); + } + } + + if ( scripts.length ) { + jQuery.each( scripts, evalScript ); + } + } + + return this; + } +}); + +function root( elem, cur ) { + return jQuery.nodeName(elem, "table") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; +} + +function cloneCopyEvent( src, dest ) { + + if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { + return; + } + + var type, i, l, + oldData = jQuery._data( src ), + curData = jQuery._data( dest, oldData ), + events = oldData.events; + + if ( events ) { + delete curData.handle; + curData.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type + ( events[ type ][ i ].namespace ? "." : "" ) + events[ type ][ i ].namespace, events[ type ][ i ], events[ type ][ i ].data ); + } + } + } + + // make the cloned public data object a copy from the original + if ( curData.data ) { + curData.data = jQuery.extend( {}, curData.data ); + } +} + +function cloneFixAttributes( src, dest ) { + var nodeName; + + // We do not need to do anything for non-Elements + if ( dest.nodeType !== 1 ) { + return; + } + + // clearAttributes removes the attributes, which we don't want, + // but also removes the attachEvent events, which we *do* want + if ( dest.clearAttributes ) { + dest.clearAttributes(); + } + + // mergeAttributes, in contrast, only merges back on the + // original attributes, not the events + if ( dest.mergeAttributes ) { + dest.mergeAttributes( src ); + } + + nodeName = dest.nodeName.toLowerCase(); + + // IE6-8 fail to clone children inside object elements that use + // the proprietary classid attribute value (rather than the type + // attribute) to identify the type of content to display + if ( nodeName === "object" ) { + dest.outerHTML = src.outerHTML; + + } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { + // IE6-8 fails to persist the checked state of a cloned checkbox + // or radio button. Worse, IE6-7 fail to give the cloned element + // a checked appearance if the defaultChecked value isn't also set + if ( src.checked ) { + dest.defaultChecked = dest.checked = src.checked; + } + + // IE6-7 get confused and end up setting the value of a cloned + // checkbox/radio button to an empty string instead of "on" + if ( dest.value !== src.value ) { + dest.value = src.value; + } + + // IE6-8 fails to return the selected option to the default selected + // state when cloning options + } else if ( nodeName === "option" ) { + dest.selected = src.defaultSelected; + + // IE6-8 fails to set the defaultValue to the correct value when + // cloning other types of input fields + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } + + // Event data gets referenced instead of copied if the expando + // gets copied too + dest.removeAttribute( jQuery.expando ); +} + +jQuery.buildFragment = function( args, nodes, scripts ) { + var fragment, cacheable, cacheresults, doc, + first = args[ 0 ]; + + // nodes may contain either an explicit document object, + // a jQuery collection or context object. + // If nodes[0] contains a valid object to assign to doc + if ( nodes && nodes[0] ) { + doc = nodes[0].ownerDocument || nodes[0]; + } + + // Ensure that an attr object doesn't incorrectly stand in as a document object + // Chrome and Firefox seem to allow this to occur and will throw exception + // Fixes #8950 + if ( !doc.createDocumentFragment ) { + doc = document; + } + + // Only cache "small" (1/2 KB) HTML strings that are associated with the main document + // Cloning options loses the selected state, so don't cache them + // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment + // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache + // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 + if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document && + first.charAt(0) === "<" && !rnocache.test( first ) && + (jQuery.support.checkClone || !rchecked.test( first )) && + (!jQuery.support.unknownElems && rnoshimcache.test( first )) ) { + + cacheable = true; + + cacheresults = jQuery.fragments[ first ]; + if ( cacheresults && cacheresults !== 1 ) { + fragment = cacheresults; + } + } + + if ( !fragment ) { + fragment = doc.createDocumentFragment(); + jQuery.clean( args, doc, fragment, scripts ); + } + + if ( cacheable ) { + jQuery.fragments[ first ] = cacheresults ? fragment : 1; + } + + return { fragment: fragment, cacheable: cacheable }; +}; + +jQuery.fragments = {}; + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var ret = [], + insert = jQuery( selector ), + parent = this.length === 1 && this[0].parentNode; + + if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { + insert[ original ]( this[0] ); + return this; + + } else { + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = ( i > 0 ? this.clone(true) : this ).get(); + jQuery( insert[i] )[ original ]( elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, insert.selector ); + } + }; +}); + +function getAll( elem ) { + if ( typeof elem.getElementsByTagName !== "undefined" ) { + return elem.getElementsByTagName( "*" ); + + } else if ( typeof elem.querySelectorAll !== "undefined" ) { + return elem.querySelectorAll( "*" ); + + } else { + return []; + } +} + +// Used in clean, fixes the defaultChecked property +function fixDefaultChecked( elem ) { + if ( elem.type === "checkbox" || elem.type === "radio" ) { + elem.defaultChecked = elem.checked; + } +} +// Finds all inputs and passes them to fixDefaultChecked +function findInputs( elem ) { + var nodeName = ( elem.nodeName || "" ).toLowerCase(); + if ( nodeName === "input" ) { + fixDefaultChecked( elem ); + // Skip scripts, get other children + } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) { + jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); + } +} + +jQuery.extend({ + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var clone = elem.cloneNode(true), + srcElements, + destElements, + i; + + if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && + (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { + // IE copies events bound via attachEvent when using cloneNode. + // Calling detachEvent on the clone will also remove the events + // from the original. In order to get around this, we use some + // proprietary methods to clear the events. Thanks to MooTools + // guys for this hotness. + + cloneFixAttributes( elem, clone ); + + // Using Sizzle here is crazy slow, so we use getElementsByTagName + // instead + srcElements = getAll( elem ); + destElements = getAll( clone ); + + // Weird iteration because IE will replace the length property + // with an element if you are cloning the body and one of the + // elements on the page has a name or id of "length" + for ( i = 0; srcElements[i]; ++i ) { + // Ensure that the destination node is not null; Fixes #9587 + if ( destElements[i] ) { + cloneFixAttributes( srcElements[i], destElements[i] ); + } + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + cloneCopyEvent( elem, clone ); + + if ( deepDataAndEvents ) { + srcElements = getAll( elem ); + destElements = getAll( clone ); + + for ( i = 0; srcElements[i]; ++i ) { + cloneCopyEvent( srcElements[i], destElements[i] ); + } + } + } + + srcElements = destElements = null; + + // Return the cloned set + return clone; + }, + + clean: function( elems, context, fragment, scripts ) { + var checkScriptType; + + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) { + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + } + + var ret = [], j; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( typeof elem === "number" ) { + elem += ""; + } + + if ( !elem ) { + continue; + } + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + if ( !rhtml.test( elem ) ) { + elem = context.createTextNode( elem ); + } else { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(rxhtmlTag, "<$1></$2>"); + + // Trim whitespace, otherwise indexOf won't work as expected + var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(), + wrap = wrapMap[ tag ] || wrapMap._default, + depth = wrap[0], + div = context.createElement("div"); + + // Append wrapper element to unknown element safe doc fragment + if ( context === document ) { + // Use the fragment we've already created for this document + safeFragment.appendChild( div ); + } else { + // Use a fragment created with the owner document + createSafeFragment( context ).appendChild( div ); + } + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( depth-- ) { + div = div.lastChild; + } + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = rtbody.test(elem), + tbody = tag === "table" && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] === "<table>" && !hasBody ? + div.childNodes : + []; + + for ( j = tbody.length - 1; j >= 0 ; --j ) { + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + } + } + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { + div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); + } + + elem = div.childNodes; + } + } + + // Resets defaultChecked for any radios and checkboxes + // about to be appended to the DOM in IE 6/7 (#8060) + var len; + if ( !jQuery.support.appendChecked ) { + if ( elem[0] && typeof (len = elem.length) === "number" ) { + for ( j = 0; j < len; j++ ) { + findInputs( elem[j] ); + } + } else { + findInputs( elem ); + } + } + + if ( elem.nodeType ) { + ret.push( elem ); + } else { + ret = jQuery.merge( ret, elem ); + } + } + + if ( fragment ) { + checkScriptType = function( elem ) { + return !elem.type || rscriptType.test( elem.type ); + }; + for ( i = 0; ret[i]; i++ ) { + if ( scripts && jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + + } else { + if ( ret[i].nodeType === 1 ) { + var jsTags = jQuery.grep( ret[i].getElementsByTagName( "script" ), checkScriptType ); + + ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); + } + fragment.appendChild( ret[i] ); + } + } + } + + return ret; + }, + + cleanData: function( elems ) { + var data, id, + cache = jQuery.cache, + special = jQuery.event.special, + deleteExpando = jQuery.support.deleteExpando; + + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { + continue; + } + + id = elem[ jQuery.expando ]; + + if ( id ) { + data = cache[ id ]; + + if ( data && data.events ) { + for ( var type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + + // Null the DOM reference to avoid IE6/7/8 leak (#7054) + if ( data.handle ) { + data.handle.elem = null; + } + } + + if ( deleteExpando ) { + delete elem[ jQuery.expando ]; + + } else if ( elem.removeAttribute ) { + elem.removeAttribute( jQuery.expando ); + } + + delete cache[ id ]; + } + } + } +}); + +function evalScript( i, elem ) { + if ( elem.src ) { + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + } else { + jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); + } + + if ( elem.parentNode ) { + elem.parentNode.removeChild( elem ); + } +} + + + + +var ralpha = /alpha\([^)]*\)/i, + ropacity = /opacity=([^)]*)/, + // fixed for IE9, see #8346 + rupper = /([A-Z]|^ms)/g, + rnumpx = /^-?\d+(?:px)?$/i, + rnum = /^-?\d/, + rrelNum = /^([\-+])=([\-+.\de]+)/, + + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssWidth = [ "Left", "Right" ], + cssHeight = [ "Top", "Bottom" ], + curCSS, + + getComputedStyle, + currentStyle; + +jQuery.fn.css = function( name, value ) { + // Setting 'undefined' is a no-op + if ( arguments.length === 2 && value === undefined ) { + return this; + } + + return jQuery.access( this, name, value, true, function( elem, name, value ) { + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }); +}; + +jQuery.extend({ + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity", "opacity" ); + return ret === "" ? "1" : ret; + + } else { + return elem.style.opacity; + } + } + } + }, + + // Exclude the following css properties to add px + cssNumber: { + "fillOpacity": true, + "fontWeight": true, + "lineHeight": true, + "opacity": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: { + // normalize float css property + "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" + }, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, origName = jQuery.camelCase( name ), + style = elem.style, hooks = jQuery.cssHooks[ origName ]; + + name = jQuery.cssProps[ origName ] || origName; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // convert relative number strings (+= or -=) to relative numbers. #7345 + if ( type === "string" && (ret = rrelNum.exec( value )) ) { + value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); + // Fixes bug #9237 + type = "number"; + } + + // Make sure that NaN and null values aren't set. See: #7116 + if ( value == null || type === "number" && isNaN( value ) ) { + return; + } + + // If a number was passed in, add 'px' to the (except for certain CSS properties) + if ( type === "number" && !jQuery.cssNumber[ origName ] ) { + value += "px"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { + // Wrapped to prevent IE from throwing errors when 'invalid' values are provided + // Fixes bug #5509 + try { + style[ name ] = value; + } catch(e) {} + } + + } else { + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra ) { + var ret, hooks; + + // Make sure that we're working with the right name + name = jQuery.camelCase( name ); + hooks = jQuery.cssHooks[ name ]; + name = jQuery.cssProps[ name ] || name; + + // cssFloat needs a special treatment + if ( name === "cssFloat" ) { + name = "float"; + } + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { + return ret; + + // Otherwise, if a way to get the computed value exists, use that + } else if ( curCSS ) { + return curCSS( elem, name ); + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + } +}); + +// DEPRECATED, Use jQuery.css() instead +jQuery.curCSS = jQuery.css; + +jQuery.each(["height", "width"], function( i, name ) { + jQuery.cssHooks[ name ] = { + get: function( elem, computed, extra ) { + var val; + + if ( computed ) { + if ( elem.offsetWidth !== 0 ) { + return getWH( elem, name, extra ); + } else { + jQuery.swap( elem, cssShow, function() { + val = getWH( elem, name, extra ); + }); + } + + return val; + } + }, + + set: function( elem, value ) { + if ( rnumpx.test( value ) ) { + // ignore negative width and height values #1599 + value = parseFloat( value ); + + if ( value >= 0 ) { + return value + "px"; + } + + } else { + return value; + } + } + }; +}); + +if ( !jQuery.support.opacity ) { + jQuery.cssHooks.opacity = { + get: function( elem, computed ) { + // IE uses filters for opacity + return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? + ( parseFloat( RegExp.$1 ) / 100 ) + "" : + computed ? "1" : ""; + }, + + set: function( elem, value ) { + var style = elem.style, + currentStyle = elem.currentStyle, + opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", + filter = currentStyle && currentStyle.filter || style.filter || ""; + + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + style.zoom = 1; + + // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 + if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { + + // Setting style.filter to null, "" & " " still leave "filter:" in the cssText + // if "filter:" is present at all, clearType is disabled, we want to avoid this + // style.removeAttribute is IE Only, but so apparently is this code path... + style.removeAttribute( "filter" ); + + // if there there is no filter style applied in a css rule, we are done + if ( currentStyle && !currentStyle.filter ) { + return; + } + } + + // otherwise, set new filter values + style.filter = ralpha.test( filter ) ? + filter.replace( ralpha, opacity ) : + filter + " " + opacity; + } + }; +} + +jQuery(function() { + // This hook cannot be added until DOM ready because the support test + // for it is not run until after DOM ready + if ( !jQuery.support.reliableMarginRight ) { + jQuery.cssHooks.marginRight = { + get: function( elem, computed ) { + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + // Work around by temporarily setting element display to inline-block + var ret; + jQuery.swap( elem, { "display": "inline-block" }, function() { + if ( computed ) { + ret = curCSS( elem, "margin-right", "marginRight" ); + } else { + ret = elem.style.marginRight; + } + }); + return ret; + } + }; + } +}); + +if ( document.defaultView && document.defaultView.getComputedStyle ) { + getComputedStyle = function( elem, name ) { + var ret, defaultView, computedStyle; + + name = name.replace( rupper, "-$1" ).toLowerCase(); + + if ( !(defaultView = elem.ownerDocument.defaultView) ) { + return undefined; + } + + if ( (computedStyle = defaultView.getComputedStyle( elem, null )) ) { + ret = computedStyle.getPropertyValue( name ); + if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { + ret = jQuery.style( elem, name ); + } + } + + return ret; + }; +} + +if ( document.documentElement.currentStyle ) { + currentStyle = function( elem, name ) { + var left, rsLeft, uncomputed, + ret = elem.currentStyle && elem.currentStyle[ name ], + style = elem.style; + + // Avoid setting ret to empty string here + // so we don't default to auto + if ( ret === null && style && (uncomputed = style[ name ]) ) { + ret = uncomputed; + } + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !rnumpx.test( ret ) && rnum.test( ret ) ) { + + // Remember the original values + left = style.left; + rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + if ( rsLeft ) { + elem.runtimeStyle.left = elem.currentStyle.left; + } + style.left = name === "fontSize" ? "1em" : ( ret || 0 ); + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + if ( rsLeft ) { + elem.runtimeStyle.left = rsLeft; + } + } + + return ret === "" ? "auto" : ret; + }; +} + +curCSS = getComputedStyle || currentStyle; + +function getWH( elem, name, extra ) { + + // Start with offset property + var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, + which = name === "width" ? cssWidth : cssHeight; + + if ( val > 0 ) { + if ( extra !== "border" ) { + jQuery.each( which, function() { + if ( !extra ) { + val -= parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } else { + val -= parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + }); + } + + return val + "px"; + } + + // Fall back to computed then uncomputed css if necessary + val = curCSS( elem, name, name ); + if ( val < 0 || val == null ) { + val = elem.style[ name ] || 0; + } + // Normalize "", auto, and prepare for extra + val = parseFloat( val ) || 0; + + // Add padding, border, margin + if ( extra ) { + jQuery.each( which, function() { + val += parseFloat( jQuery.css( elem, "padding" + this ) ) || 0; + if ( extra !== "padding" ) { + val += parseFloat( jQuery.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( extra === "margin" ) { + val += parseFloat( jQuery.css( elem, extra + this ) ) || 0; + } + }); + } + + return val + "px"; +} + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.hidden = function( elem ) { + var width = elem.offsetWidth, + height = elem.offsetHeight; + + return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none"); + }; + + jQuery.expr.filters.visible = function( elem ) { + return !jQuery.expr.filters.hidden( elem ); + }; +} + + + + +var r20 = /%20/g, + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rhash = /#.*$/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL + rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + rquery = /\?/, + rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, + rselectTextarea = /^(?:select|textarea)/i, + rspacesAjax = /\s+/, + rts = /([?&])_=[^&]*/, + rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, + + // Keep a copy of the old load method + _load = jQuery.fn.load, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Document location + ajaxLocation, + + // Document location segments + ajaxLocParts, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = ["*/"] + ["*"]; + +// #8138, IE may throw an exception when accessing +// a field from window.location if document.domain has been set +try { + ajaxLocation = location.href; +} catch( e ) { + // Use the href attribute of an A element + // since IE will modify it given document.location + ajaxLocation = document.createElement( "a" ); + ajaxLocation.href = ""; + ajaxLocation = ajaxLocation.href; +} + +// Segment location into parts +ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + if ( jQuery.isFunction( func ) ) { + var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), + i = 0, + length = dataTypes.length, + dataType, + list, + placeBefore; + + // For each dataType in the dataTypeExpression + for ( ; i < length; i++ ) { + dataType = dataTypes[ i ]; + // We control if we're asked to add before + // any existing element + placeBefore = /^\+/.test( dataType ); + if ( placeBefore ) { + dataType = dataType.substr( 1 ) || "*"; + } + list = structure[ dataType ] = structure[ dataType ] || []; + // then we add to the structure accordingly + list[ placeBefore ? "unshift" : "push" ]( func ); + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, + dataType /* internal */, inspected /* internal */ ) { + + dataType = dataType || options.dataTypes[ 0 ]; + inspected = inspected || {}; + + inspected[ dataType ] = true; + + var list = structure[ dataType ], + i = 0, + length = list ? list.length : 0, + executeOnly = ( structure === prefilters ), + selection; + + for ( ; i < length && ( executeOnly || !selection ); i++ ) { + selection = list[ i ]( options, originalOptions, jqXHR ); + // If we got redirected to another dataType + // we try there if executing only and not done already + if ( typeof selection === "string" ) { + if ( !executeOnly || inspected[ selection ] ) { + selection = undefined; + } else { + options.dataTypes.unshift( selection ); + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, selection, inspected ); + } + } + } + // If we're only executing or nothing was selected + // we try the catchall dataType if not done already + if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { + selection = inspectPrefiltersOrTransports( + structure, options, originalOptions, jqXHR, "*", inspected ); + } + // unnecessary when only executing (prefilters) + // but it'll be ignored by the caller in that case + return selection; +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } +} + +jQuery.fn.extend({ + load: function( url, params, callback ) { + if ( typeof url !== "string" && _load ) { + return _load.apply( this, arguments ); + + // Don't do a request if no elements are being requested + } else if ( !this.length ) { + return this; + } + + var off = url.indexOf( " " ); + if ( off >= 0 ) { + var selector = url.slice( off, url.length ); + url = url.slice( 0, off ); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) { + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( typeof params === "object" ) { + params = jQuery.param( params, jQuery.ajaxSettings.traditional ); + type = "POST"; + } + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + // Complete callback (responseText is used internally) + complete: function( jqXHR, status, responseText ) { + // Store the response as specified by the jqXHR object + responseText = jqXHR.responseText; + // If successful, inject the HTML into all the matched elements + if ( jqXHR.isResolved() ) { + // #4825: Get the actual response in case + // a dataFilter is present in ajaxSettings + jqXHR.done(function( r ) { + responseText = r; + }); + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(responseText.replace(rscript, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + responseText ); + } + + if ( callback ) { + self.each( callback, [ responseText, status, jqXHR ] ); + } + } + }); + + return this; + }, + + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray( this.elements ) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + ( this.checked || rselectTextarea.test( this.nodeName ) || + rinput.test( this.type ) ); + }) + .map(function( i, elem ){ + var val = jQuery( this ).val(); + + return val == null ? + null : + jQuery.isArray( val ) ? + jQuery.map( val, function( val, i ){ + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }) : + { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ + jQuery.fn[ o ] = function( f ){ + return this.bind( o, f ); + }; +}); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + // shift arguments if data argument was omitted + if ( jQuery.isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + return jQuery.ajax({ + type: method, + url: url, + data: data, + success: callback, + dataType: type + }); + }; +}); + +jQuery.extend({ + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + if ( settings ) { + // Building a settings object + ajaxExtend( target, jQuery.ajaxSettings ); + } else { + // Extending ajaxSettings + settings = target; + target = jQuery.ajaxSettings; + } + ajaxExtend( target, settings ); + return target; + }, + + ajaxSettings: { + url: ajaxLocation, + isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + traditional: false, + headers: {}, + */ + + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + text: "text/plain", + json: "application/json, text/javascript", + "*": allTypes + }, + + contents: { + xml: /xml/, + html: /html/, + json: /json/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText" + }, + + // List of data converters + // 1) key format is "source_type destination_type" (a single space in-between) + // 2) the catchall symbol "*" can be used for source_type + converters: { + + // Convert anything to text + "* text": window.String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": jQuery.parseJSON, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + context: true, + url: true + } + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + // Callbacks context + callbackContext = s.context || s, + // Context for global events + // It's the callbackContext if one was provided in the options + // and if it's a DOM node or a jQuery collection + globalEventContext = callbackContext !== s && + ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? + jQuery( callbackContext ) : jQuery.event, + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + // Status-dependent callbacks + statusCode = s.statusCode || {}, + // ifModified key + ifModifiedKey, + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + // Response headers + responseHeadersString, + responseHeaders, + // transport + transport, + // timeout handle + timeoutTimer, + // Cross-domain detection vars + parts, + // The jqXHR state + state = 0, + // To know if global events are to be dispatched + fireGlobals, + // Loop variable + i, + // Fake xhr + jqXHR = { + + readyState: 0, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( !state ) { + var lname = name.toLowerCase(); + name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Raw string + getAllResponseHeaders: function() { + return state === 2 ? responseHeadersString : null; + }, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( state === 2 ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; + } + } + match = responseHeaders[ key.toLowerCase() ]; + } + return match === undefined ? null : match; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( !state ) { + s.mimeType = type; + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + statusText = statusText || "abort"; + if ( transport ) { + transport.abort( statusText ); + } + done( 0, statusText ); + return this; + } + }; + + // Callback for when everything is done + // It is defined here because jslint complains if it is declared + // at the end of the function (which would be more logical and readable) + function done( status, nativeStatusText, responses, headers ) { + + // Called once + if ( state === 2 ) { + return; + } + + // State is "done" now + state = 2; + + // Clear timeout if it exists + if ( timeoutTimer ) { + clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + var isSuccess, + success, + error, + statusText = nativeStatusText, + response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, + lastModified, + etag; + + // If successful, handle type chaining + if ( status >= 200 && status < 300 || status === 304 ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + + if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { + jQuery.lastModified[ ifModifiedKey ] = lastModified; + } + if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { + jQuery.etag[ ifModifiedKey ] = etag; + } + } + + // If not modified + if ( status === 304 ) { + + statusText = "notmodified"; + isSuccess = true; + + // If we have data + } else { + + try { + success = ajaxConvert( s, response ); + statusText = "success"; + isSuccess = true; + } catch(e) { + // We have a parsererror + statusText = "parsererror"; + error = e; + } + } + } else { + // We extract error from statusText + // then normalize statusText and status for non-aborts + error = statusText; + if ( !statusText || status ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = "" + ( nativeStatusText || statusText ); + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + // Attach deferreds + deferred.promise( jqXHR ); + jqXHR.success = jqXHR.done; + jqXHR.error = jqXHR.fail; + jqXHR.complete = completeDeferred.add; + + // Status-dependent callbacks + jqXHR.statusCode = function( map ) { + if ( map ) { + var tmp; + if ( state < 2 ) { + for ( tmp in map ) { + statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; + } + } else { + tmp = map[ jqXHR.status ]; + jqXHR.then( tmp, tmp ); + } + } + return this; + }; + + // Remove hash character (#7531: and string promotion) + // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) + // We also use the url parameter if available + s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); + + // Extract dataTypes list + s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); + + // Determine if a cross-domain request is in order + if ( s.crossDomain == null ) { + parts = rurl.exec( s.url.toLowerCase() ); + s.crossDomain = !!( parts && + ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || + ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != + ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) + ); + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefiler, stop there + if ( state === 2 ) { + return false; + } + + // We can fire global events as of now if asked to + fireGlobals = s.global; + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // If data is available, append data to url + if ( s.data ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Get ifModifiedKey before adding the anti-cache parameter + ifModifiedKey = s.url; + + // Add anti-cache in url if needed + if ( s.cache === false ) { + + var ts = jQuery.now(), + // try replacing _= if it is there + ret = s.url.replace( rts, "$1_=" + ts ); + + // if nothing was replaced, add timestamp to the end + s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + ifModifiedKey = ifModifiedKey || s.url; + if ( jQuery.lastModified[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); + } + if ( jQuery.etag[ ifModifiedKey ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); + } + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? + s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { + // Abort if not done already + jqXHR.abort(); + return false; + + } + + // Install callbacks on deferreds + for ( i in { success: 1, error: 1, complete: 1 } ) { + jqXHR[ i ]( s[ i ] ); + } + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = setTimeout( function(){ + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + state = 1; + transport.send( requestHeaders, done ); + } catch (e) { + // Propagate exception as error if not done + if ( state < 2 ) { + done( -1, e ); + // Simply rethrow otherwise + } else { + jQuery.error( e ); + } + } + } + + return jqXHR; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a, traditional ) { + var s = [], + add = function( key, value ) { + // If value is a function, invoke it and return its value + value = jQuery.isFunction( value ) ? value() : value; + s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); + }; + + // Set traditional to true for jQuery <= 1.3.2 behavior. + if ( traditional === undefined ) { + traditional = jQuery.ajaxSettings.traditional; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + }); + + } else { + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( var prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ).replace( r20, "+" ); + } +}); + +function buildParams( prefix, obj, traditional, add ) { + if ( jQuery.isArray( obj ) ) { + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + // If array item is non-scalar (array or object), encode its + // numeric index to resolve deserialization ambiguity issues. + // Note that rack (as of 1.0.0) can't currently deserialize + // nested arrays properly, and attempting to do so may cause + // a server error. Possible fixes are to modify rack's + // deserialization algorithm or to provide an option or flag + // to force array serialization to be shallow. + buildParams( prefix + "[" + ( typeof v === "object" || jQuery.isArray(v) ? i : "" ) + "]", v, traditional, add ); + } + }); + + } else if ( !traditional && obj != null && typeof obj === "object" ) { + // Serialize object item. + for ( var name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + // Serialize scalar item. + add( prefix, obj ); + } +} + +// This is still on the jQuery object... for now +// Want to move this to jQuery.ajax some day +jQuery.extend({ + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {} + +}); + +/* Handles responses to an ajax request: + * - sets all responseXXX fields accordingly + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var contents = s.contents, + dataTypes = s.dataTypes, + responseFields = s.responseFields, + ct, + type, + finalDataType, + firstDataType; + + // Fill responseXXX fields + for ( type in responseFields ) { + if ( type in responses ) { + jqXHR[ responseFields[type] ] = responses[ type ]; + } + } + + // Remove auto dataType and get content-type in the process + while( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +// Chain conversions given the request and the original response +function ajaxConvert( s, response ) { + + // Apply the dataFilter if provided + if ( s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + var dataTypes = s.dataTypes, + converters = {}, + i, + key, + length = dataTypes.length, + tmp, + // Current and previous dataTypes + current = dataTypes[ 0 ], + prev, + // Conversion expression + conversion, + // Conversion function + conv, + // Conversion functions (transitive conversion) + conv1, + conv2; + + // For each dataType in the chain + for ( i = 1; i < length; i++ ) { + + // Create converters map + // with lowercased keys + if ( i === 1 ) { + for ( key in s.converters ) { + if ( typeof key === "string" ) { + converters[ key.toLowerCase() ] = s.converters[ key ]; + } + } + } + + // Get the dataTypes + prev = current; + current = dataTypes[ i ]; + + // If current is auto dataType, update it to prev + if ( current === "*" ) { + current = prev; + // If no auto and dataTypes are actually different + } else if ( prev !== "*" && prev !== current ) { + + // Get the converter + conversion = prev + " " + current; + conv = converters[ conversion ] || converters[ "* " + current ]; + + // If there is no direct converter, search transitively + if ( !conv ) { + conv2 = undefined; + for ( conv1 in converters ) { + tmp = conv1.split( " " ); + if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { + conv2 = converters[ tmp[1] + " " + current ]; + if ( conv2 ) { + conv1 = converters[ conv1 ]; + if ( conv1 === true ) { + conv = conv2; + } else if ( conv2 === true ) { + conv = conv1; + } + break; + } + } + } + } + // If we found no converter, dispatch an error + if ( !( conv || conv2 ) ) { + jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); + } + // If found converter is not an equivalence + if ( conv !== true ) { + // Convert with 1 or 2 converters accordingly + response = conv ? conv( response ) : conv2( conv1(response) ); + } + } + } + return response; +} + + + + +var jsc = jQuery.now(), + jsre = /(\=)\?(&|$)|\?\?/i; + +// Default jsonp settings +jQuery.ajaxSetup({ + jsonp: "callback", + jsonpCallback: function() { + return jQuery.expando + "_" + ( jsc++ ); + } +}); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var inspectData = s.contentType === "application/x-www-form-urlencoded" && + ( typeof s.data === "string" ); + + if ( s.dataTypes[ 0 ] === "jsonp" || + s.jsonp !== false && ( jsre.test( s.url ) || + inspectData && jsre.test( s.data ) ) ) { + + var responseContainer, + jsonpCallback = s.jsonpCallback = + jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, + previous = window[ jsonpCallback ], + url = s.url, + data = s.data, + replace = "$1" + jsonpCallback + "$2"; + + if ( s.jsonp !== false ) { + url = url.replace( jsre, replace ); + if ( s.url === url ) { + if ( inspectData ) { + data = data.replace( jsre, replace ); + } + if ( s.data === data ) { + // Add callback manually + url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; + } + } + } + + s.url = url; + s.data = data; + + // Install callback + window[ jsonpCallback ] = function( response ) { + responseContainer = [ response ]; + }; + + // Clean-up function + jqXHR.always(function() { + // Set callback back to previous value + window[ jsonpCallback ] = previous; + // Call if it was a function and we have a response + if ( responseContainer && jQuery.isFunction( previous ) ) { + window[ jsonpCallback ]( responseContainer[ 0 ] ); + } + }); + + // Use data converter to retrieve json after script execution + s.converters["script json"] = function() { + if ( !responseContainer ) { + jQuery.error( jsonpCallback + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // force json dataType + s.dataTypes[ 0 ] = "json"; + + // Delegate to script + return "script"; + } +}); + + + + +// Install script dataType +jQuery.ajaxSetup({ + accepts: { + script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /javascript|ecmascript/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +}); + +// Handle cache's special case and global +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + s.global = false; + } +}); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function(s) { + + // This transport only deals with cross domain requests + if ( s.crossDomain ) { + + var script, + head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; + + return { + + send: function( _, callback ) { + + script = document.createElement( "script" ); + + script.async = "async"; + + if ( s.scriptCharset ) { + script.charset = s.scriptCharset; + } + + script.src = s.url; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function( _, isAbort ) { + + if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + + // Remove the script + if ( head && script.parentNode ) { + head.removeChild( script ); + } + + // Dereference the script + script = undefined; + + // Callback if not abort + if ( !isAbort ) { + callback( 200, "success" ); + } + } + }; + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709 and #4378). + head.insertBefore( script, head.firstChild ); + }, + + abort: function() { + if ( script ) { + script.onload( 0, 1 ); + } + } + }; + } +}); + + + + +var // #5280: Internet Explorer will keep connections alive if we don't abort on unload + xhrOnUnloadAbort = window.ActiveXObject ? function() { + // Abort all pending requests + for ( var key in xhrCallbacks ) { + xhrCallbacks[ key ]( 0, 1 ); + } + } : false, + xhrId = 0, + xhrCallbacks; + +// Functions to create xhrs +function createStandardXHR() { + try { + return new window.XMLHttpRequest(); + } catch( e ) {} +} + +function createActiveXHR() { + try { + return new window.ActiveXObject( "Microsoft.XMLHTTP" ); + } catch( e ) {} +} + +// Create the request object +// (This is still attached to ajaxSettings for backward compatibility) +jQuery.ajaxSettings.xhr = window.ActiveXObject ? + /* Microsoft failed to properly + * implement the XMLHttpRequest in IE7 (can't request local files), + * so we use the ActiveXObject when it is available + * Additionally XMLHttpRequest can be disabled in IE7/IE8 so + * we need a fallback. + */ + function() { + return !this.isLocal && createStandardXHR() || createActiveXHR(); + } : + // For all other browsers, use the standard XMLHttpRequest object + createStandardXHR; + +// Determine support properties +(function( xhr ) { + jQuery.extend( jQuery.support, { + ajax: !!xhr, + cors: !!xhr && ( "withCredentials" in xhr ) + }); +})( jQuery.ajaxSettings.xhr() ); + +// Create transport if the browser can provide an xhr +if ( jQuery.support.ajax ) { + + jQuery.ajaxTransport(function( s ) { + // Cross domain only allowed if supported through XMLHttpRequest + if ( !s.crossDomain || jQuery.support.cors ) { + + var callback; + + return { + send: function( headers, complete ) { + + // Get a new xhr + var xhr = s.xhr(), + handle, + i; + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if ( s.username ) { + xhr.open( s.type, s.url, s.async, s.username, s.password ); + } else { + xhr.open( s.type, s.url, s.async ); + } + + // Apply custom fields if provided + if ( s.xhrFields ) { + for ( i in s.xhrFields ) { + xhr[ i ] = s.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( s.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( s.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !s.crossDomain && !headers["X-Requested-With"] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + } catch( _ ) {} + + // Do send the request + // This may raise an exception which is actually + // handled in jQuery.ajax (so no try/catch here) + xhr.send( ( s.hasContent && s.data ) || null ); + + // Listener + callback = function( _, isAbort ) { + + var status, + statusText, + responseHeaders, + responses, + xml; + + // Firefox throws exceptions when accessing properties + // of an xhr when a network error occured + // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) + try { + + // Was never called and is aborted or complete + if ( callback && ( isAbort || xhr.readyState === 4 ) ) { + + // Only called once + callback = undefined; + + // Do not keep as active anymore + if ( handle ) { + xhr.onreadystatechange = jQuery.noop; + if ( xhrOnUnloadAbort ) { + delete xhrCallbacks[ handle ]; + } + } + + // If it's an abort + if ( isAbort ) { + // Abort it manually if needed + if ( xhr.readyState !== 4 ) { + xhr.abort(); + } + } else { + status = xhr.status; + responseHeaders = xhr.getAllResponseHeaders(); + responses = {}; + xml = xhr.responseXML; + + // Construct response list + if ( xml && xml.documentElement /* #4958 */ ) { + responses.xml = xml; + } + responses.text = xhr.responseText; + + // Firefox throws an exception when accessing + // statusText for faulty cross-domain requests + try { + statusText = xhr.statusText; + } catch( e ) { + // We normalize with Webkit giving an empty statusText + statusText = ""; + } + + // Filter status for non standard behaviors + + // If the request is local and we have data: assume a success + // (success with no data won't get notified, that's the best we + // can do given current implementations) + if ( !status && s.isLocal && !s.crossDomain ) { + status = responses.text ? 200 : 404; + // IE - #1450: sometimes returns 1223 when it should be 204 + } else if ( status === 1223 ) { + status = 204; + } + } + } + } catch( firefoxAccessException ) { + if ( !isAbort ) { + complete( -1, firefoxAccessException ); + } + } + + // Call complete if needed + if ( responses ) { + complete( status, statusText, responses, responseHeaders ); + } + }; + + // if we're in sync mode or it's in cache + // and has been retrieved directly (IE6 & IE7) + // we need to manually fire the callback + if ( !s.async || xhr.readyState === 4 ) { + callback(); + } else { + handle = ++xhrId; + if ( xhrOnUnloadAbort ) { + // Create the active xhrs callbacks list if needed + // and attach the unload handler + if ( !xhrCallbacks ) { + xhrCallbacks = {}; + jQuery( window ).unload( xhrOnUnloadAbort ); + } + // Add to list of active xhrs callbacks + xhrCallbacks[ handle ] = callback; + } + xhr.onreadystatechange = callback; + } + }, + + abort: function() { + if ( callback ) { + callback(0,1); + } + } + }; + } + }); +} + + + + +var elemdisplay = {}, + iframe, iframeDoc, + rfxtypes = /^(?:toggle|show|hide)$/, + rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ], + fxNow; + +jQuery.fn.extend({ + show: function( speed, easing, callback ) { + var elem, display; + + if ( speed || speed === 0 ) { + return this.animate( genFx("show", 3), speed, easing, callback ); + + } else { + for ( var i = 0, j = this.length; i < j; i++ ) { + elem = this[ i ]; + + if ( elem.style ) { + display = elem.style.display; + + // Reset the inline display of this element to learn if it is + // being hidden by cascaded rules or not + if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { + display = elem.style.display = ""; + } + + // Set elements which have been overridden with display: none + // in a stylesheet to whatever the default browser style is + // for such an element + if ( display === "" && jQuery.css(elem, "display") === "none" ) { + jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) ); + } + } + } + + // Set the display of most of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + elem = this[ i ]; + + if ( elem.style ) { + display = elem.style.display; + + if ( display === "" || display === "none" ) { + elem.style.display = jQuery._data( elem, "olddisplay" ) || ""; + } + } + } + + return this; + } + }, + + hide: function( speed, easing, callback ) { + if ( speed || speed === 0 ) { + return this.animate( genFx("hide", 3), speed, easing, callback); + + } else { + var elem, display, + i = 0, + j = this.length; + + for ( ; i < j; i++ ) { + elem = this[i]; + if ( elem.style ) { + display = jQuery.css( elem, "display" ); + + if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) { + jQuery._data( elem, "olddisplay", display ); + } + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( i = 0; i < j; i++ ) { + if ( this[i].style ) { + this[i].style.display = "none"; + } + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2, callback ) { + var bool = typeof fn === "boolean"; + + if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { + this._toggle.apply( this, arguments ); + + } else if ( fn == null || bool ) { + this.each(function() { + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }); + + } else { + this.animate(genFx("toggle", 3), fn, fn2, callback); + } + + return this; + }, + + fadeTo: function( speed, to, easing, callback ) { + return this.filter(":hidden").css("opacity", 0).show().end() + .animate({opacity: to}, speed, easing, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed( speed, easing, callback ); + + if ( jQuery.isEmptyObject( prop ) ) { + return this.each( optall.complete, [ false ] ); + } + + // Do not change referenced properties as per-property easing will be lost + prop = jQuery.extend( {}, prop ); + + function doAnimation() { + // XXX 'this' does not always have a nodeName when running the + // test suite + + if ( optall.queue === false ) { + jQuery._mark( this ); + } + + var opt = jQuery.extend( {}, optall ), + isElement = this.nodeType === 1, + hidden = isElement && jQuery(this).is(":hidden"), + name, val, p, e, + parts, start, end, unit, + method; + + // will store per property easing and be used to determine when an animation is complete + opt.animatedProperties = {}; + + for ( p in prop ) { + + // property name normalization + name = jQuery.camelCase( p ); + if ( p !== name ) { + prop[ name ] = prop[ p ]; + delete prop[ p ]; + } + + val = prop[ name ]; + + // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) + if ( jQuery.isArray( val ) ) { + opt.animatedProperties[ name ] = val[ 1 ]; + val = prop[ name ] = val[ 0 ]; + } else { + opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; + } + + if ( val === "hide" && hidden || val === "show" && !hidden ) { + return opt.complete.call( this ); + } + + if ( isElement && ( name === "height" || name === "width" ) ) { + // Make sure that nothing sneaks out + // Record all 3 overflow attributes because IE does not + // change the overflow attribute when overflowX and + // overflowY are set to the same value + opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; + + // Set display property to inline-block for height/width + // animations on inline elements that are having width/height animated + if ( jQuery.css( this, "display" ) === "inline" && + jQuery.css( this, "float" ) === "none" ) { + + // inline-level elements accept inline-block; + // block-level elements need to be inline with layout + if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) { + this.style.display = "inline-block"; + + } else { + this.style.zoom = 1; + } + } + } + } + + if ( opt.overflow != null ) { + this.style.overflow = "hidden"; + } + + for ( p in prop ) { + e = new jQuery.fx( this, opt, p ); + val = prop[ p ]; + + if ( rfxtypes.test( val ) ) { + + // Tracks whether to show or hide based on private + // data attached to the element + method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 ); + if ( method ) { + jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" ); + e[ method ](); + } else { + e[ val ](); + } + + } else { + parts = rfxnum.exec( val ); + start = e.cur(); + + if ( parts ) { + end = parseFloat( parts[2] ); + unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); + + // We need to compute starting value + if ( unit !== "px" ) { + jQuery.style( this, p, (end || 1) + unit); + start = ( (end || 1) / e.cur() ) * start; + jQuery.style( this, p, start + unit); + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) { + end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; + } + + e.custom( start, end, unit ); + + } else { + e.custom( start, val, "" ); + } + } + } + + // For JS strict compliance + return true; + } + + return optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + + stop: function( type, clearQueue, gotoEnd ) { + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each(function() { + var i, + hadTimers = false, + timers = jQuery.timers, + data = jQuery._data( this ); + + // clear marker counters if we know they won't be + if ( !gotoEnd ) { + jQuery._unmark( true, this ); + } + + function stopQueue( elem, data, i ) { + var hooks = data[ i ]; + jQuery.removeData( elem, i, true ); + hooks.stop( gotoEnd ); + } + + if ( type == null ) { + for ( i in data ) { + if ( data[ i ].stop && i.indexOf(".run") === i.length - 4 ) { + stopQueue( this, data, i ); + } + } + } else if ( data[ i = type + ".run" ] && data[ i ].stop ){ + stopQueue( this, data, i ); + } + + for ( i = timers.length; i--; ) { + if ( timers[ i ].elem === this && (type == null || timers[ i ].queue === type) ) { + if ( gotoEnd ) { + + // force the next step to be the last + timers[ i ]( true ); + } else { + timers[ i ].saveState(); + } + hadTimers = true; + timers.splice( i, 1 ); + } + } + + // start the next in the queue if the last step wasn't forced + // timers currently will call their complete callbacks, which will dequeue + // but only if they were gotoEnd + if ( !( gotoEnd && hadTimers ) ) { + jQuery.dequeue( this, type ); + } + }); + } + +}); + +// Animations created synchronously will run synchronously +function createFxNow() { + setTimeout( clearFxNow, 0 ); + return ( fxNow = jQuery.now() ); +} + +function clearFxNow() { + fxNow = undefined; +} + +// Generate parameters to create a standard animation +function genFx( type, num ) { + var obj = {}; + + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() { + obj[ this ] = type; + }); + + return obj; +} + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx( "show", 1 ), + slideUp: genFx( "hide", 1 ), + slideToggle: genFx( "toggle", 1 ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +}); + +jQuery.extend({ + speed: function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; + + // normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function( noUnmark ) { + if ( jQuery.isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } else if ( noUnmark !== false ) { + jQuery._unmark( this ); + } + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ( ( -Math.cos( p*Math.PI ) / 2 ) + 0.5 ) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ) { + this.options = options; + this.elem = elem; + this.prop = prop; + + options.orig = options.orig || {}; + } + +}); + +jQuery.fx.prototype = { + // Simple function for setting a style value + update: function() { + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this ); + }, + + // Get the current size + cur: function() { + if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) { + return this.elem[ this.prop ]; + } + + var parsed, + r = jQuery.css( this.elem, this.prop ); + // Empty strings, null, undefined and "auto" are converted to 0, + // complex values such as "rotate(1rad)" are returned as is, + // simple values such as "10px" are parsed to Float. + return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; + }, + + // Start an animation from one number to another + custom: function( from, to, unit ) { + var self = this, + fx = jQuery.fx; + + this.startTime = fxNow || createFxNow(); + this.end = to; + this.now = this.start = from; + this.pos = this.state = 0; + this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); + + function t( gotoEnd ) { + return self.step( gotoEnd ); + } + + t.queue = this.options.queue; + t.elem = this.elem; + t.saveState = function() { + if ( self.options.hide && jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) { + jQuery._data( self.elem, "fxshow" + self.prop, self.start ); + } + }; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval( fx.tick, fx.interval ); + } + }, + + // Simple 'show' function + show: function() { + var dataShow = jQuery._data( this.elem, "fxshow" + this.prop ); + + // Remember where we started, so that we can go back to it later + this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any flash of content + if ( dataShow !== undefined ) { + // This show is picking up where a previous hide or show left off + this.custom( this.cur(), dataShow ); + } else { + this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() ); + } + + // Start by showing the element + jQuery( this.elem ).show(); + }, + + // Simple 'hide' function + hide: function() { + // Remember where we started, so that we can go back to it later + this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom( this.cur(), 0 ); + }, + + // Each step of an animation + step: function( gotoEnd ) { + var p, n, complete, + t = fxNow || createFxNow(), + done = true, + elem = this.elem, + options = this.options; + + if ( gotoEnd || t >= options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + options.animatedProperties[ this.prop ] = true; + + for ( p in options.animatedProperties ) { + if ( options.animatedProperties[ p ] !== true ) { + done = false; + } + } + + if ( done ) { + // Reset the overflow + if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { + + jQuery.each( [ "", "X", "Y" ], function( index, value ) { + elem.style[ "overflow" + value ] = options.overflow[ index ]; + }); + } + + // Hide the element if the "hide" operation was done + if ( options.hide ) { + jQuery( elem ).hide(); + } + + // Reset the properties, if the item has been hidden or shown + if ( options.hide || options.show ) { + for ( p in options.animatedProperties ) { + jQuery.style( elem, p, options.orig[ p ] ); + jQuery.removeData( elem, "fxshow" + p, true ); + // Toggle data is no longer needed + jQuery.removeData( elem, "toggle" + p, true ); + } + } + + // Execute the complete function + // in the event that the complete function throws an exception + // we must ensure it won't be called twice. #5684 + + complete = options.complete; + if ( complete ) { + + options.complete = false; + complete.call( elem ); + } + } + + return false; + + } else { + // classical easing cannot be used with an Infinity duration + if ( options.duration == Infinity ) { + this.now = t; + } else { + n = t - this.startTime; + this.state = n / options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration ); + this.now = this.start + ( (this.end - this.start) * this.pos ); + } + // Perform the next step of the animation + this.update(); + } + + return true; + } +}; + +jQuery.extend( jQuery.fx, { + tick: function() { + var timer, + timers = jQuery.timers, + i = 0; + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + // Checks the timer has not already been removed + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + }, + + interval: 13, + + stop: function() { + clearInterval( timerId ); + timerId = null; + }, + + speeds: { + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + + step: { + opacity: function( fx ) { + jQuery.style( fx.elem, "opacity", fx.now ); + }, + + _default: function( fx ) { + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { + fx.elem.style[ fx.prop ] = fx.now + fx.unit; + } else { + fx.elem[ fx.prop ] = fx.now; + } + } + } +}); + +// Adds width/height step functions +// Do not set anything below 0 +jQuery.each([ "width", "height" ], function( i, prop ) { + jQuery.fx.step[ prop ] = function( fx ) { + jQuery.style( fx.elem, prop, Math.max(0, fx.now) ); + }; +}); + +if ( jQuery.expr && jQuery.expr.filters ) { + jQuery.expr.filters.animated = function( elem ) { + return jQuery.grep(jQuery.timers, function( fn ) { + return elem === fn.elem; + }).length; + }; +} + +// Try to restore the default display value of an element +function defaultDisplay( nodeName ) { + + if ( !elemdisplay[ nodeName ] ) { + + var body = document.body, + elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), + display = elem.css( "display" ); + elem.remove(); + + // If the simple way fails, + // get element's real default display by attaching it to a temp iframe + if ( display === "none" || display === "" ) { + // No iframe to use yet, so create it + if ( !iframe ) { + iframe = document.createElement( "iframe" ); + iframe.frameBorder = iframe.width = iframe.height = 0; + } + + body.appendChild( iframe ); + + // Create a cacheable copy of the iframe document on first call. + // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML + // document to it; WebKit & Firefox won't allow reusing the iframe document. + if ( !iframeDoc || !iframe.createElement ) { + iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; + iframeDoc.write( ( document.compatMode === "CSS1Compat" ? "<!doctype html>" : "" ) + "<html><body>" ); + iframeDoc.close(); + } + + elem = iframeDoc.createElement( nodeName ); + + iframeDoc.body.appendChild( elem ); + + display = jQuery.css( elem, "display" ); + body.removeChild( iframe ); + } + + // Store the correct default display + elemdisplay[ nodeName ] = display; + } + + return elemdisplay[ nodeName ]; +} + + + + +var rtable = /^t(?:able|d|h)$/i, + rroot = /^(?:body|html)$/i; + +if ( "getBoundingClientRect" in document.documentElement ) { + jQuery.fn.offset = function( options ) { + var elem = this[0], box; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + try { + box = elem.getBoundingClientRect(); + } catch(e) {} + + var doc = elem.ownerDocument, + docElem = doc.documentElement; + + // Make sure we're not dealing with a disconnected DOM node + if ( !box || !jQuery.contains( docElem, elem ) ) { + return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; + } + + var body = doc.body, + win = getWindow(doc), + clientTop = docElem.clientTop || body.clientTop || 0, + clientLeft = docElem.clientLeft || body.clientLeft || 0, + scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, + scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, + top = box.top + scrollTop - clientTop, + left = box.left + scrollLeft - clientLeft; + + return { top: top, left: left }; + }; + +} else { + jQuery.fn.offset = function( options ) { + var elem = this[0]; + + if ( options ) { + return this.each(function( i ) { + jQuery.offset.setOffset( this, options, i ); + }); + } + + if ( !elem || !elem.ownerDocument ) { + return null; + } + + if ( elem === elem.ownerDocument.body ) { + return jQuery.offset.bodyOffset( elem ); + } + + var computedStyle, + offsetParent = elem.offsetParent, + prevOffsetParent = elem, + doc = elem.ownerDocument, + docElem = doc.documentElement, + body = doc.body, + defaultView = doc.defaultView, + prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, + top = elem.offsetTop, + left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { + break; + } + + computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; + top -= elem.scrollTop; + left -= elem.scrollLeft; + + if ( elem === offsetParent ) { + top += elem.offsetTop; + left += elem.offsetLeft; + + if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevOffsetParent = offsetParent; + offsetParent = elem.offsetParent; + } + + if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { + top += parseFloat( computedStyle.borderTopWidth ) || 0; + left += parseFloat( computedStyle.borderLeftWidth ) || 0; + } + + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { + top += body.offsetTop; + left += body.offsetLeft; + } + + if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { + top += Math.max( docElem.scrollTop, body.scrollTop ); + left += Math.max( docElem.scrollLeft, body.scrollLeft ); + } + + return { top: top, left: left }; + }; +} + +jQuery.offset = { + + bodyOffset: function( body ) { + var top = body.offsetTop, + left = body.offsetLeft; + + if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { + top += parseFloat( jQuery.css(body, "marginTop") ) || 0; + left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; + } + + return { top: top, left: left }; + }, + + setOffset: function( elem, options, i ) { + var position = jQuery.css( elem, "position" ); + + // set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + var curElem = jQuery( elem ), + curOffset = curElem.offset(), + curCSSTop = jQuery.css( elem, "top" ), + curCSSLeft = jQuery.css( elem, "left" ), + calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, + props = {}, curPosition = {}, curTop, curLeft; + + // need to be able to calculate position if either top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( jQuery.isFunction( options ) ) { + options = options.call( elem, i, curOffset ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + } +}; + + +jQuery.fn.extend({ + + position: function() { + if ( !this[0] ) { + return null; + } + + var elem = this[0], + + // Get *real* offsetParent + offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; + offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; + + // Add offsetParent borders + parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; + parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; + + // Subtract the two offsets + return { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + }, + + offsetParent: function() { + return this.map(function() { + var offsetParent = this.offsetParent || document.body; + while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { + offsetParent = offsetParent.offsetParent; + } + return offsetParent; + }); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ["Left", "Top"], function( i, name ) { + var method = "scroll" + name; + + jQuery.fn[ method ] = function( val ) { + var elem, win; + + if ( val === undefined ) { + elem = this[ 0 ]; + + if ( !elem ) { + return null; + } + + win = getWindow( elem ); + + // Return the scroll offset + return win ? ("pageXOffset" in win) ? win[ i ? "pageYOffset" : "pageXOffset" ] : + jQuery.support.boxModel && win.document.documentElement[ method ] || + win.document.body[ method ] : + elem[ method ]; + } + + // Set the scroll offset + return this.each(function() { + win = getWindow( this ); + + if ( win ) { + win.scrollTo( + !i ? val : jQuery( win ).scrollLeft(), + i ? val : jQuery( win ).scrollTop() + ); + + } else { + this[ method ] = val; + } + }); + }; +}); + +function getWindow( elem ) { + return jQuery.isWindow( elem ) ? + elem : + elem.nodeType === 9 ? + elem.defaultView || elem.parentWindow : + false; +} + + + + +// Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function( i, name ) { + + var type = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn[ "inner" + name ] = function() { + var elem = this[0]; + return elem ? + elem.style ? + parseFloat( jQuery.css( elem, type, "padding" ) ) : + this[ type ]() : + null; + }; + + // outerHeight and outerWidth + jQuery.fn[ "outer" + name ] = function( margin ) { + var elem = this[0]; + return elem ? + elem.style ? + parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : + this[ type ]() : + null; + }; + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + var elem = this[0]; + if ( !elem ) { + return size == null ? null : this; + } + + if ( jQuery.isFunction( size ) ) { + return this.each(function( i ) { + var self = jQuery( this ); + self[ type ]( size.call( this, i, self[ type ]() ) ); + }); + } + + if ( jQuery.isWindow( elem ) ) { + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat + var docElemProp = elem.document.documentElement[ "client" + name ], + body = elem.document.body; + return elem.document.compatMode === "CSS1Compat" && docElemProp || + body && body[ "client" + name ] || docElemProp; + + // Get document width or height + } else if ( elem.nodeType === 9 ) { + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + return Math.max( + elem.documentElement["client" + name], + elem.body["scroll" + name], elem.documentElement["scroll" + name], + elem.body["offset" + name], elem.documentElement["offset" + name] + ); + + // Get or set width or height on the element + } else if ( size === undefined ) { + var orig = jQuery.css( elem, type ), + ret = parseFloat( orig ); + + return jQuery.isNumeric( ret ) ? ret : orig; + + // Set the width or height on the element (default to pixels if value is unitless) + } else { + return this.css( type, typeof size === "string" ? size : size + "px" ); + } + }; + +}); + + +// Expose jQuery to the global object +window.jQuery = window.$ = jQuery; +})( window ); +</script><script type="text/javascript">/*! + * jQuery UI 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function( $, undefined ) { + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.8.16", + + keyCode: { + ALT: 18, + BACKSPACE: 8, + CAPS_LOCK: 20, + COMMA: 188, + COMMAND: 91, + COMMAND_LEFT: 91, // COMMAND + COMMAND_RIGHT: 93, + CONTROL: 17, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + INSERT: 45, + LEFT: 37, + MENU: 93, // COMMAND_RIGHT + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SHIFT: 16, + SPACE: 32, + TAB: 9, + UP: 38, + WINDOWS: 91 // COMMAND + } +}); + +// plugins +$.fn.extend({ + propAttr: $.fn.prop || $.fn.attr, + + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); + }).eq(0); + } + + return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; + if ( border ) { + size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + var map = element.parentNode, + mapName = map.name, + img; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) + ? !element.disabled + : "a" == nodeName + ? element.href || isTabIndexNotNaN + : isTabIndexNotNaN) + // the element and all of its ancestors must be visible + && visible( element ); +} + +function visible( element ) { + return !$( element ).parents().andSelf().filter(function() { + return $.curCSS( this, "visibility" ) === "hidden" || + $.expr.filters.hidden( this ); + }).length; +} + +$.extend( $.expr[ ":" ], { + data: function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support +$(function() { + var body = document.body, + div = body.appendChild( div = document.createElement( "div" ) ); + + $.extend( div.style, { + minHeight: "100px", + height: "auto", + padding: 0, + borderWidth: 0 + }); + + $.support.minHeight = div.offsetHeight === 100; + $.support.selectstart = "onselectstart" in div; + + // set display to none to avoid a layout bug in IE + // http://dev.jquery.com/ticket/4014 + body.removeChild( div ).style.display = "none"; +}); + + + + + +// deprecated +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var proto = $.ui[ module ].prototype; + for ( var i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode ) { + return; + } + + for ( var i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() + contains: function( a, b ) { + return document.compareDocumentPosition ? + a.compareDocumentPosition( b ) & 16 : + a !== b && a.contains( b ); + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + }, + + // these are odd functions, fix the API or move into individual plugins + isOverAxis: function( x, reference, size ) { + //Determines when x coordinate is over "b" element axis + return ( x > reference ) && ( x < ( reference + size ) ); + }, + isOver: function( y, x, top, left, height, width ) { + //Determines when x, y coordinates is over "b" element + return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); + } +}); + +})( jQuery ); +/*! + * jQuery UI Widget 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var callback = this.options[ type ]; + + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + data = data || {}; + + // copy original event properties over to the new event + // this would happen if we could call $.event.fix instead of $.Event + // but we don't have a way to force an event to be fixed multiple times + if ( event.originalEvent ) { + for ( var i = $.event.props.length, prop; i; ) { + prop = $.event.props[ --i ]; + event[ prop ] = event.originalEvent[ prop ]; + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); +/*! + * jQuery UI Mouse 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); +/* + * jQuery UI Draggable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue if helper is set to "original" + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.16" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); +/* + * jQuery UI Droppable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.16" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = dropped || this._drop.call(this, event); + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); +/* + * jQuery UI Resizable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.16" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); +/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if (event.metaKey && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.16" +}); + +})(jQuery); +/* + * jQuery UI Sortable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled") + .removeData("sortable") + .unbind(".sortable"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData("sortable-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, 'sortable-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(sortable-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], 'sortable'); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data('sortable-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.16" +}); + +})(jQuery); +/* + * jQuery UI Effects 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +;jQuery.effects || (function($, undefined) { + +$.effects = {}; + + + +/******************************************************************************/ +/****************************** COLOR ANIMATIONS ******************************/ +/******************************************************************************/ + +// override the animation for color styles +$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', + 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], +function(i, attr) { + $.fx.step[attr] = function(fx) { + if (!fx.colorInit) { + fx.start = getColor(fx.elem, attr); + fx.end = getRGB(fx.end); + fx.colorInit = true; + } + + fx.elem.style[attr] = 'rgb(' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + + Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; + }; +}); + +// Color Conversion functions from highlightFade +// By Blair Mitchelmore +// http://jquery.offput.ca/highlightFade/ + +// Parse strings looking for color tuples [255,255,255] +function getRGB(color) { + var result; + + // Check if we're already dealing with an array of colors + if ( color && color.constructor == Array && color.length == 3 ) + return color; + + // Look for rgb(num,num,num) + if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) + return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; + + // Look for rgb(num%,num%,num%) + if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) + return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; + + // Look for #a0b1c2 + if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) + return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; + + // Look for #fff + if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) + return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; + + // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 + if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) + return colors['transparent']; + + // Otherwise, we're most likely dealing with a named color + return colors[$.trim(color).toLowerCase()]; +} + +function getColor(elem, attr) { + var color; + + do { + color = $.curCSS(elem, attr); + + // Keep going until we find an element that has color, or we hit the body + if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) + break; + + attr = "backgroundColor"; + } while ( elem = elem.parentNode ); + + return getRGB(color); +}; + +// Some named colors to work with +// From Interface by Stefan Petre +// http://interface.eyecon.ro/ + +var colors = { + aqua:[0,255,255], + azure:[240,255,255], + beige:[245,245,220], + black:[0,0,0], + blue:[0,0,255], + brown:[165,42,42], + cyan:[0,255,255], + darkblue:[0,0,139], + darkcyan:[0,139,139], + darkgrey:[169,169,169], + darkgreen:[0,100,0], + darkkhaki:[189,183,107], + darkmagenta:[139,0,139], + darkolivegreen:[85,107,47], + darkorange:[255,140,0], + darkorchid:[153,50,204], + darkred:[139,0,0], + darksalmon:[233,150,122], + darkviolet:[148,0,211], + fuchsia:[255,0,255], + gold:[255,215,0], + green:[0,128,0], + indigo:[75,0,130], + khaki:[240,230,140], + lightblue:[173,216,230], + lightcyan:[224,255,255], + lightgreen:[144,238,144], + lightgrey:[211,211,211], + lightpink:[255,182,193], + lightyellow:[255,255,224], + lime:[0,255,0], + magenta:[255,0,255], + maroon:[128,0,0], + navy:[0,0,128], + olive:[128,128,0], + orange:[255,165,0], + pink:[255,192,203], + purple:[128,0,128], + violet:[128,0,128], + red:[255,0,0], + silver:[192,192,192], + white:[255,255,255], + yellow:[255,255,0], + transparent: [255,255,255] +}; + + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ + +var classAnimationActions = ['add', 'remove', 'toggle'], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +function getElementStyles() { + var style = document.defaultView + ? document.defaultView.getComputedStyle(this, null) + : this.currentStyle, + newStyle = {}, + key, + camelCase; + + // webkit enumerates style porperties + if (style && style.length && style[0] && style[style[0]]) { + var len = style.length; + while (len--) { + key = style[len]; + if (typeof style[key] == 'string') { + camelCase = key.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + newStyle[camelCase] = style[key]; + } + } + } else { + for (key in style) { + if (typeof style[key] === 'string') { + newStyle[key] = style[key]; + } + } + } + + return newStyle; +} + +function filterStyles(styles) { + var name, value; + for (name in styles) { + value = styles[name]; + if ( + // ignore null and undefined values + value == null || + // ignore functions (when does this occur?) + $.isFunction(value) || + // shorthand styles that need to be expanded + name in shorthandStyles || + // ignore scrollbars (break in IE) + (/scrollbar/).test(name) || + + // only colors or values that can be converted to numbers + (!(/color/i).test(name) && isNaN(parseFloat(value))) + ) { + delete styles[name]; + } + } + + return styles; +} + +function styleDifference(oldStyle, newStyle) { + var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 + name; + + for (name in newStyle) { + if (oldStyle[name] != newStyle[name]) { + diff[name] = newStyle[name]; + } + } + + return diff; +} + +$.effects.animateClass = function(value, duration, easing, callback) { + if ($.isFunction(easing)) { + callback = easing; + easing = null; + } + + return this.queue(function() { + var that = $(this), + originalStyleAttr = that.attr('style') || ' ', + originalStyle = filterStyles(getElementStyles.call(this)), + newStyle, + className = that.attr('class'); + + $.each(classAnimationActions, function(i, action) { + if (value[action]) { + that[action + 'Class'](value[action]); + } + }); + newStyle = filterStyles(getElementStyles.call(this)); + that.attr('class', className); + + that.animate(styleDifference(originalStyle, newStyle), { + queue: false, + duration: duration, + easing: easing, + complete: function() { + $.each(classAnimationActions, function(i, action) { + if (value[action]) { that[action + 'Class'](value[action]); } + }); + // work around bug in IE by clearing the cssText before setting it + if (typeof that.attr('style') == 'object') { + that.attr('style').cssText = ''; + that.attr('style').cssText = originalStyleAttr; + } else { + that.attr('style', originalStyleAttr); + } + if (callback) { callback.apply(this, arguments); } + $.dequeue( this ); + } + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function(classNames, speed, easing, callback) { + return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); + }, + + _removeClass: $.fn.removeClass, + removeClass: function(classNames,speed,easing,callback) { + return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function(classNames, force, speed, easing, callback) { + if ( typeof force == "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter; + return this._toggleClass(classNames, force); + } else { + return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); + } + } else { + // without switch parameter; + return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); + } + }, + + switchClass: function(remove,add,speed,easing,callback) { + return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); + } +}); + + + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +$.extend($.effects, { + version: "1.8.16", + + // Saves a set of properties in a data storage + save: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function(element, set) { + for(var i=0; i < set.length; i++) { + if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); + } + }, + + setMode: function(el, mode) { + if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle + return mode; + }, + + getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + var y, x; + switch (origin[0]) { + case 'top': y = 0; break; + case 'middle': y = 0.5; break; + case 'bottom': y = 1; break; + default: y = origin[0] / original.height; + }; + switch (origin[1]) { + case 'left': x = 0; break; + case 'center': x = 0.5; break; + case 'right': x = 1; break; + default: x = origin[1] / original.width; + }; + return {x: x, y: y}; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function(element) { + + // if the element is already wrapped, return it + if (element.parent().is('.ui-effects-wrapper')) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + 'float': element.css('float') + }, + wrapper = $('<div></div>') + .addClass('ui-effects-wrapper') + .css({ + fontSize: '100%', + background: 'transparent', + border: 'none', + margin: 0, + padding: 0 + }), + active = document.activeElement; + + element.wrap(wrapper); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if (element.css('position') == 'static') { + wrapper.css({ position: 'relative' }); + element.css({ position: 'relative' }); + } else { + $.extend(props, { + position: element.css('position'), + zIndex: element.css('z-index') + }); + $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { + props[pos] = element.css(pos); + if (isNaN(parseInt(props[pos], 10))) { + props[pos] = 'auto'; + } + }); + element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); + } + + return wrapper.css(props).show(); + }, + + removeWrapper: function(element) { + var parent, + active = document.activeElement; + + if (element.parent().is('.ui-effects-wrapper')) { + parent = element.parent().replaceWith(element); + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + return parent; + } + + return element; + }, + + setTransition: function(element, list, factor, value) { + value = value || {}; + $.each(list, function(i, x){ + unit = element.cssUnit(x); + if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; + }); + return value; + } +}); + + +function _normalizeArguments(effect, options, speed, callback) { + // shift params for method overloading + if (typeof effect == 'object') { + callback = options; + speed = null; + options = effect; + effect = options.effect; + } + if ($.isFunction(options)) { + callback = options; + speed = null; + options = {}; + } + if (typeof options == 'number' || $.fx.speeds[options]) { + callback = speed; + speed = options; + options = {}; + } + if ($.isFunction(speed)) { + callback = speed; + speed = null; + } + + options = options || {}; + + speed = speed || options.duration; + speed = $.fx.off ? 0 : typeof speed == 'number' + ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; + + callback = callback || options.complete; + + return [effect, options, speed, callback]; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + if ( typeof speed === "string" && !$.effects[ speed ] ) { + return true; + } + + return false; +} + +$.fn.extend({ + effect: function(effect, options, speed, callback) { + var args = _normalizeArguments.apply(this, arguments), + // TODO: make effects take actual parameters instead of a hash + args2 = { + options: args[1], + duration: args[2], + callback: args[3] + }, + mode = args2.options.mode, + effectMethod = $.effects[effect]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args2.duration, args2.callback ); + } else { + return this.each(function() { + if ( args2.callback ) { + args2.callback.call( this ); + } + }); + } + } + + return effectMethod.call(this, args2); + }, + + _show: $.fn.show, + show: function(speed) { + if ( standardSpeed( speed ) ) { + return this._show.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'show'; + return this.effect.apply(this, args); + } + }, + + _hide: $.fn.hide, + hide: function(speed) { + if ( standardSpeed( speed ) ) { + return this._hide.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'hide'; + return this.effect.apply(this, args); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function(speed) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply(this, arguments); + } else { + var args = _normalizeArguments.apply(this, arguments); + args[1].mode = 'toggle'; + return this.effect.apply(this, args); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css(key), val = []; + $.each( ['em','px','%','pt'], function(i, unit){ + if(style.indexOf(unit) > 0) + val = [parseFloat(style), unit]; + }); + return val; + } +}); + + + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +/* + * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ + * + * Uses the built in easing capabilities added In jQuery 1.1 + * to offer multiple easing options + * + * TERMS OF USE - jQuery Easing + * + * Open source under the BSD License. + * + * Copyright 2008 George McGinley Smith + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * +*/ + +// t: current time, b: begInnIng value, c: change In value, d: duration +$.easing.jswing = $.easing.swing; + +$.extend($.easing, +{ + def: 'easeOutQuad', + swing: function (x, t, b, c, d) { + //alert($.easing.default); + return $.easing[$.easing.def](x, t, b, c, d); + }, + easeInQuad: function (x, t, b, c, d) { + return c*(t/=d)*t + b; + }, + easeOutQuad: function (x, t, b, c, d) { + return -c *(t/=d)*(t-2) + b; + }, + easeInOutQuad: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return -c/2 * ((--t)*(t-2) - 1) + b; + }, + easeInCubic: function (x, t, b, c, d) { + return c*(t/=d)*t*t + b; + }, + easeOutCubic: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t + 1) + b; + }, + easeInOutCubic: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t + b; + return c/2*((t-=2)*t*t + 2) + b; + }, + easeInQuart: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t + b; + }, + easeOutQuart: function (x, t, b, c, d) { + return -c * ((t=t/d-1)*t*t*t - 1) + b; + }, + easeInOutQuart: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t + b; + return -c/2 * ((t-=2)*t*t*t - 2) + b; + }, + easeInQuint: function (x, t, b, c, d) { + return c*(t/=d)*t*t*t*t + b; + }, + easeOutQuint: function (x, t, b, c, d) { + return c*((t=t/d-1)*t*t*t*t + 1) + b; + }, + easeInOutQuint: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; + return c/2*((t-=2)*t*t*t*t + 2) + b; + }, + easeInSine: function (x, t, b, c, d) { + return -c * Math.cos(t/d * (Math.PI/2)) + c + b; + }, + easeOutSine: function (x, t, b, c, d) { + return c * Math.sin(t/d * (Math.PI/2)) + b; + }, + easeInOutSine: function (x, t, b, c, d) { + return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; + }, + easeInExpo: function (x, t, b, c, d) { + return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; + }, + easeOutExpo: function (x, t, b, c, d) { + return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; + }, + easeInOutExpo: function (x, t, b, c, d) { + if (t==0) return b; + if (t==d) return b+c; + if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; + return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; + }, + easeInCirc: function (x, t, b, c, d) { + return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; + }, + easeOutCirc: function (x, t, b, c, d) { + return c * Math.sqrt(1 - (t=t/d-1)*t) + b; + }, + easeInOutCirc: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; + return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; + }, + easeInElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + }, + easeOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; + }, + easeInOutElastic: function (x, t, b, c, d) { + var s=1.70158;var p=0;var a=c; + if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); + if (a < Math.abs(c)) { a=c; var s=p/4; } + else var s = p/(2*Math.PI) * Math.asin (c/a); + if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; + return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; + }, + easeInBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*(t/=d)*t*((s+1)*t - s) + b; + }, + easeOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; + }, + easeInOutBack: function (x, t, b, c, d, s) { + if (s == undefined) s = 1.70158; + if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; + return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; + }, + easeInBounce: function (x, t, b, c, d) { + return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; + }, + easeOutBounce: function (x, t, b, c, d) { + if ((t/=d) < (1/2.75)) { + return c*(7.5625*t*t) + b; + } else if (t < (2/2.75)) { + return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; + } else if (t < (2.5/2.75)) { + return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; + } else { + return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; + } + }, + easeInOutBounce: function (x, t, b, c, d) { + if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; + return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; + } +}); + +/* + * + * TERMS OF USE - EASING EQUATIONS + * + * Open source under the BSD License. + * + * Copyright 2001 Robert Penner + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without modification, + * are permitted provided that the following conditions are met: + * + * Redistributions of source code must retain the above copyright notice, this list of + * conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, this list + * of conditions and the following disclaimer in the documentation and/or other materials + * provided with the distribution. + * + * Neither the name of the author nor the names of contributors may be used to endorse + * or promote products derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY + * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE + * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, + * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE + * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED + * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING + * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED + * OF THE POSSIBILITY OF SUCH DAMAGE. + * + */ + +})(jQuery); +/* + * jQuery UI Effects Blind 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.blind = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'vertical') ? 'height' : 'width'; + var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); + if(mode == 'show') wrapper.css(ref, 0); // Shift + + // Animation + var animation = {}; + animation[ref] = mode == 'show' ? distance : 0; + + // Animate + wrapper.animate(animation, o.duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Bounce 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.bounce = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'up'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 5; // Default # of times + var speed = o.duration || 250; // Default speed per bounce + if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + if (mode == 'hide') distance = distance / (times * 2); + if (mode != 'hide') times--; + + // Animate + if (mode == 'show') { // Show Bounce + var animation = {opacity: 1}; + animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation, speed / 2, o.options.easing); + distance = distance / 2; + times--; + }; + for (var i = 0; i < times; i++) { // Bounces + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); + distance = (mode == 'hide') ? distance * 2 : distance / 2; + }; + if (mode == 'hide') { // Last Bounce + var animation = {opacity: 0}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + el.animate(animation, speed / 2, o.options.easing, function(){ + el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + } else { + var animation1 = {}, animation2 = {}; + animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; + el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + }; + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Clip 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.clip = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','height','width']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'vertical'; // Default direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var animate = el[0].tagName == 'IMG' ? wrapper : el; + var ref = { + size: (direction == 'vertical') ? 'height' : 'width', + position: (direction == 'vertical') ? 'top' : 'left' + }; + var distance = (direction == 'vertical') ? animate.height() : animate.width(); + if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift + + // Animation + var animation = {}; + animation[ref.size] = mode == 'show' ? distance : 0; + animation[ref.position] = mode == 'show' ? 0 : distance / 2; + + // Animate + animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Drop 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.drop = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','opacity']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2); + if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift + + // Animation + var animation = {opacity: mode == 'show' ? 1 : 0}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Explode 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.explode = function(o) { + + return this.queue(function() { + + var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; + + o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; + var el = $(this).show().css('visibility', 'hidden'); + var offset = el.offset(); + + //Substract the margins - not fixing the problem yet. + offset.top -= parseInt(el.css("marginTop"),10) || 0; + offset.left -= parseInt(el.css("marginLeft"),10) || 0; + + var width = el.outerWidth(true); + var height = el.outerHeight(true); + + for(var i=0;i<rows;i++) { // = + for(var j=0;j<cells;j++) { // || + el + .clone() + .appendTo('body') + .wrap('<div></div>') + .css({ + position: 'absolute', + visibility: 'visible', + left: -j*(width/cells), + top: -i*(height/rows) + }) + .parent() + .addClass('ui-effects-explode') + .css({ + position: 'absolute', + overflow: 'hidden', + width: width/cells, + height: height/rows, + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), + opacity: o.options.mode == 'show' ? 0 : 1 + }).animate({ + left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), + top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), + opacity: o.options.mode == 'show' ? 1 : 0 + }, o.duration || 500); + } + } + + // Set a timeout, to call the callback approx. when the other animations have finished + setTimeout(function() { + + o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); + if(o.callback) o.callback.apply(el[0]); // Callback + el.dequeue(); + + $('div.ui-effects-explode').remove(); + + }, o.duration || 500); + + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fade = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'); + + elem.animate({ opacity: mode }, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.fold = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode + var size = o.options.size || 15; // Default fold size + var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value + var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var widthFirst = ((mode == 'show') != horizFirst); + var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; + var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; + var percent = /([0-9]+)%/.exec(size); + if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; + if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift + + // Animation + var animation1 = {}, animation2 = {}; + animation1[ref[0]] = mode == 'show' ? distance[0] : size; + animation2[ref[1]] = mode == 'show' ? distance[1] : 0; + + // Animate + wrapper.animate(animation1, duration, o.options.easing) + .animate(animation2, duration, o.options.easing, function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(el[0], arguments); // Callback + el.dequeue(); + }); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.highlight = function(o) { + return this.queue(function() { + var elem = $(this), + props = ['backgroundImage', 'backgroundColor', 'opacity'], + mode = $.effects.setMode(elem, o.options.mode || 'show'), + animation = { + backgroundColor: elem.css('backgroundColor') + }; + + if (mode == 'hide') { + animation.opacity = 0; + } + + $.effects.save(elem, props); + elem + .show() + .css({ + backgroundImage: 'none', + backgroundColor: o.options.color || '#ffff99' + }) + .animate(animation, { + queue: false, + duration: o.duration, + easing: o.options.easing, + complete: function() { + (mode == 'hide' && elem.hide()); + $.effects.restore(elem, props); + (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); + (o.callback && o.callback.apply(this, arguments)); + elem.dequeue(); + } + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.pulsate = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'show'); + times = ((o.options.times || 5) * 2) - 1; + duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, + isVisible = elem.is(':visible'), + animateTo = 0; + + if (!isVisible) { + elem.css('opacity', 0).show(); + animateTo = 1; + } + + if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { + times--; + } + + for (var i = 0; i < times; i++) { + elem.animate({ opacity: animateTo }, duration, o.options.easing); + animateTo = (animateTo + 1) % 2; + } + + elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { + if (animateTo == 0) { + elem.hide(); + } + (o.callback && o.callback.apply(this, arguments)); + }); + + elem + .queue('fx', function() { elem.dequeue(); }) + .dequeue(); + }); +}; + +})(jQuery); +/* + * jQuery UI Effects Scale 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.puff = function(o) { + return this.queue(function() { + var elem = $(this), + mode = $.effects.setMode(elem, o.options.mode || 'hide'), + percent = parseInt(o.options.percent, 10) || 150, + factor = percent / 100, + original = { height: elem.height(), width: elem.width() }; + + $.extend(o.options, { + fade: true, + mode: mode, + percent: mode == 'hide' ? percent : 100, + from: mode == 'hide' + ? original + : { + height: original.height * factor, + width: original.width * factor + } + }); + + elem.effect('scale', o.options, o.duration, o.callback); + elem.dequeue(); + }); +}; + +$.effects.scale = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this); + + // Set options + var options = $.extend(true, {}, o.options); + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent + var direction = o.options.direction || 'both'; // Set default axis + var origin = o.options.origin; // The origin of the scaling + if (mode != 'effect') { // Set default origin and restore for show/hide + options.origin = origin || ['middle','center']; + options.restore = true; + } + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state + + // Adjust + var factor = { // Set scaling factor + y: direction != 'horizontal' ? (percent / 100) : 1, + x: direction != 'vertical' ? (percent / 100) : 1 + }; + el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state + + if (o.options.fade) { // Fade option to support puff + if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; + if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; + }; + + // Animation + options.from = el.from; options.to = el.to; options.mode = mode; + + // Animate + el.effect('size', options, o.duration, o.callback); + el.dequeue(); + }); + +}; + +$.effects.size = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; + var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore + var props2 = ['width','height','overflow']; // Copy for children + var cProps = ['fontSize']; + var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; + var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var restore = o.options.restore || false; // Default restore + var scale = o.options.scale || 'both'; // Default scale mode + var origin = o.options.origin; // The origin of the sizing + var original = {height: el.height(), width: el.width()}; // Save original + el.from = o.options.from || original; // Default from state + el.to = o.options.to || original; // Default to state + // Adjust + if (origin) { // Calculate baseline shifts + var baseline = $.effects.getBaseline(origin, original); + el.from.top = (original.height - el.from.height) * baseline.y; + el.from.left = (original.width - el.from.width) * baseline.x; + el.to.top = (original.height - el.to.height) * baseline.y; + el.to.left = (original.width - el.to.width) * baseline.x; + }; + var factor = { // Set scaling factor + from: {y: el.from.height / original.height, x: el.from.width / original.width}, + to: {y: el.to.height / original.height, x: el.to.width / original.width} + }; + if (scale == 'box' || scale == 'both') { // Scale the css box + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(vProps); + el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + props = props.concat(hProps); + el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); + el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); + }; + }; + if (scale == 'content' || scale == 'both') { // Scale the content + if (factor.from.y != factor.to.y) { // Vertical props scaling + props = props.concat(cProps); + el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); + el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); + }; + }; + $.effects.save(el, restore ? props : props1); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + el.css('overflow','hidden').css(el.from); // Shift + + // Animate + if (scale == 'content' || scale == 'both') { // Scale the children + vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size + hProps = hProps.concat(['marginLeft','marginRight']); // Add margins + props2 = props.concat(vProps).concat(hProps); // Concat + el.find("*[width]").each(function(){ + child = $(this); + if (restore) $.effects.save(child, props2); + var c_original = {height: child.height(), width: child.width()}; // Save original + child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; + child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; + if (factor.from.y != factor.to.y) { // Vertical props scaling + child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); + child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); + }; + if (factor.from.x != factor.to.x) { // Horizontal props scaling + child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); + child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); + }; + child.css(child.from); // Shift children + child.animate(child.to, o.duration, o.options.easing, function(){ + if (restore) $.effects.restore(child, props2); // Restore children + }); // Animate children + }); + }; + + // Animate + el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if (el.to.opacity === 0) { + el.css('opacity', el.from.opacity); + } + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Shake 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.shake = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode + var direction = o.options.direction || 'left'; // Default direction + var distance = o.options.distance || 20; // Default distance + var times = o.options.times || 3; // Default # of times + var speed = o.duration || o.options.duration || 140; // Default speed per shake + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + + // Animation + var animation = {}, animation1 = {}, animation2 = {}; + animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; + animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; + animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; + + // Animate + el.animate(animation, speed, o.options.easing); + for (var i = 1; i < times; i++) { // Shakes + el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); + }; + el.animate(animation1, speed, o.options.easing). + animate(animation, speed / 2, o.options.easing, function(){ // Last shake + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + }); + el.queue('fx', function() { el.dequeue(); }); + el.dequeue(); + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Slide 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.slide = function(o) { + + return this.queue(function() { + + // Create element + var el = $(this), props = ['position','top','bottom','left','right']; + + // Set options + var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode + var direction = o.options.direction || 'left'; // Default Direction + + // Adjust + $.effects.save(el, props); el.show(); // Save & Show + $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper + var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; + var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; + var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true})); + if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift + + // Animation + var animation = {}; + animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; + + // Animate + el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { + if(mode == 'hide') el.hide(); // Hide + $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore + if(o.callback) o.callback.apply(this, arguments); // Callback + el.dequeue(); + }}); + + }); + +}; + +})(jQuery); +/* + * jQuery UI Effects Transfer 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function( $, undefined ) { + +$.effects.transfer = function(o) { + return this.queue(function() { + var elem = $(this), + target = $(o.options.to), + endPosition = target.offset(), + animation = { + top: endPosition.top, + left: endPosition.left, + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $('<div class="ui-effects-transfer"></div>') + .appendTo(document.body) + .addClass(o.options.className) + .css({ + top: startPosition.top, + left: startPosition.left, + height: elem.innerHeight(), + width: elem.innerWidth(), + position: 'absolute' + }) + .animate(animation, o.duration, o.options.easing, function() { + transfer.remove(); + (o.callback && o.callback.apply(elem[0], arguments)); + elem.dequeue(); + }); + }); +}; + +})(jQuery); +/* + * jQuery UI Accordion 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.accordion", { + options: { + active: 0, + animated: "slide", + autoHeight: true, + clearStyle: false, + collapsible: false, + event: "click", + fillSpace: false, + header: "> li > :first-child,> :not(li):even", + icons: { + header: "ui-icon-triangle-1-e", + headerSelected: "ui-icon-triangle-1-s" + }, + navigation: false, + navigationFilter: function() { + return this.href.toLowerCase() === location.href.toLowerCase(); + } + }, + + _create: function() { + var self = this, + options = self.options; + + self.running = 0; + + self.element + .addClass( "ui-accordion ui-widget ui-helper-reset" ) + // in lack of child-selectors in CSS + // we need to mark top-LIs in a UL-accordion for some IE-fix + .children( "li" ) + .addClass( "ui-accordion-li-fix" ); + + self.headers = self.element.find( options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) + .bind( "mouseenter.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + }) + .bind( "mouseleave.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-hover" ); + }) + .bind( "focus.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-focus" ); + }) + .bind( "blur.accordion", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( "ui-state-focus" ); + }); + + self.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); + + if ( options.navigation ) { + var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); + if ( current.length ) { + var header = current.closest( ".ui-accordion-header" ); + if ( header.length ) { + // anchor within header + self.active = header; + } else { + // anchor within content + self.active = current.closest( ".ui-accordion-content" ).prev(); + } + } + } + + self.active = self._findActive( self.active || options.active ) + .addClass( "ui-state-default ui-state-active" ) + .toggleClass( "ui-corner-all" ) + .toggleClass( "ui-corner-top" ); + self.active.next().addClass( "ui-accordion-content-active" ); + + self._createIcons(); + self.resize(); + + // ARIA + self.element.attr( "role", "tablist" ); + + self.headers + .attr( "role", "tab" ) + .bind( "keydown.accordion", function( event ) { + return self._keydown( event ); + }) + .next() + .attr( "role", "tabpanel" ); + + self.headers + .not( self.active || "" ) + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .hide(); + + // make sure at least one header is in the tab order + if ( !self.active.length ) { + self.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + self.active + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }); + } + + // only need links in tab order for Safari + if ( !$.browser.safari ) { + self.headers.find( "a" ).attr( "tabIndex", -1 ); + } + + if ( options.event ) { + self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { + self._clickHandler.call( self, event, this ); + event.preventDefault(); + }); + } + }, + + _createIcons: function() { + var options = this.options; + if ( options.icons ) { + $( "<span></span>" ) + .addClass( "ui-icon " + options.icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-icon" ) + .toggleClass(options.icons.header) + .toggleClass(options.icons.headerSelected); + this.element.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers.children( ".ui-icon" ).remove(); + this.element.removeClass( "ui-accordion-icons" ); + }, + + destroy: function() { + var options = this.options; + + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + this.headers + .unbind( ".accordion" ) + .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-selected" ) + .removeAttr( "tabIndex" ); + + this.headers.find( "a" ).removeAttr( "tabIndex" ); + this._destroyIcons(); + var contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); + if ( options.autoHeight || options.fillHeight ) { + contents.css( "height", "" ); + } + + return $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + + if ( key == "active" ) { + this.activate( value ); + } + if ( key == "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key == "disabled" ) { + this.headers.add(this.headers.next()) + [ value ? "addClass" : "removeClass" ]( + "ui-accordion-disabled ui-state-disabled" ); + } + }, + + _keydown: function( event ) { + if ( this.options.disabled || event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._clickHandler( { target: event.target }, event.target ); + event.preventDefault(); + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + return false; + } + + return true; + }, + + resize: function() { + var options = this.options, + maxHeight; + + if ( options.fillSpace ) { + if ( $.browser.msie ) { + var defOverflow = this.element.parent().css( "overflow" ); + this.element.parent().css( "overflow", "hidden"); + } + maxHeight = this.element.parent().height(); + if ($.browser.msie) { + this.element.parent().css( "overflow", defOverflow ); + } + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( options.autoHeight ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }) + .height( maxHeight ); + } + + return this; + }, + + activate: function( index ) { + // TODO this gets called on init, changing the option without an explicit call for that + this.options.active = index; + // call clickHandler with custom event + var active = this._findActive( index )[ 0 ]; + this._clickHandler( { target: active }, active ); + + return this; + }, + + _findActive: function( selector ) { + return selector + ? typeof selector === "number" + ? this.headers.filter( ":eq(" + selector + ")" ) + : this.headers.not( this.headers.not( selector ) ) + : selector === false + ? $( [] ) + : this.headers.filter( ":eq(0)" ); + }, + + // TODO isn't event.target enough? why the separate target argument? + _clickHandler: function( event, target ) { + var options = this.options; + if ( options.disabled ) { + return; + } + + // called only when using activate(false) to close all parts programmatically + if ( !event.target ) { + if ( !options.collapsible ) { + return; + } + this.active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + this.active.next().addClass( "ui-accordion-content-active" ); + var toHide = this.active.next(), + data = { + options: options, + newHeader: $( [] ), + oldHeader: options.active, + newContent: $( [] ), + oldContent: toHide + }, + toShow = ( this.active = $( [] ) ); + this._toggle( toShow, toHide, data ); + return; + } + + // get the click target + var clicked = $( event.currentTarget || target ), + clickedIsActive = clicked[0] === this.active[0]; + + // TODO the option is changed, is that correct? + // TODO if it is correct, shouldn't that happen after determining that the click is valid? + options.active = options.collapsible && clickedIsActive ? + false : + this.headers.index( clicked ); + + // if animations are still active, or the active header is the target, ignore click + if ( this.running || ( !options.collapsible && clickedIsActive ) ) { + return; + } + + // find elements to show and hide + var active = this.active, + toShow = clicked.next(), + toHide = this.active.next(), + data = { + options: options, + newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, + oldHeader: this.active, + newContent: clickedIsActive && options.collapsible ? $([]) : toShow, + oldContent: toHide + }, + down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $([]) : clicked; + this._toggle( toShow, toHide, data, clickedIsActive, down ); + + // switch classes + active + .removeClass( "ui-state-active ui-corner-top" ) + .addClass( "ui-state-default ui-corner-all" ) + .children( ".ui-icon" ) + .removeClass( options.icons.headerSelected ) + .addClass( options.icons.header ); + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-state-default ui-corner-all" ) + .addClass( "ui-state-active ui-corner-top" ) + .children( ".ui-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.headerSelected ); + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + + return; + }, + + _toggle: function( toShow, toHide, data, clickedIsActive, down ) { + var self = this, + options = self.options; + + self.toShow = toShow; + self.toHide = toHide; + self.data = data; + + var complete = function() { + if ( !self ) { + return; + } + return self._completed.apply( self, arguments ); + }; + + // trigger changestart event + self._trigger( "changestart", null, self.data ); + + // count elements to animate + self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); + + if ( options.animated ) { + var animOptions = {}; + + if ( options.collapsible && clickedIsActive ) { + animOptions = { + toShow: $( [] ), + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } else { + animOptions = { + toShow: toShow, + toHide: toHide, + complete: complete, + down: down, + autoHeight: options.autoHeight || options.fillSpace + }; + } + + if ( !options.proxied ) { + options.proxied = options.animated; + } + + if ( !options.proxiedDuration ) { + options.proxiedDuration = options.duration; + } + + options.animated = $.isFunction( options.proxied ) ? + options.proxied( animOptions ) : + options.proxied; + + options.duration = $.isFunction( options.proxiedDuration ) ? + options.proxiedDuration( animOptions ) : + options.proxiedDuration; + + var animations = $.ui.accordion.animations, + duration = options.duration, + easing = options.animated; + + if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { + easing = "slide"; + } + if ( !animations[ easing ] ) { + animations[ easing ] = function( options ) { + this.slide( options, { + easing: easing, + duration: duration || 700 + }); + }; + } + + animations[ easing ]( animOptions ); + } else { + if ( options.collapsible && clickedIsActive ) { + toShow.toggle(); + } else { + toHide.hide(); + toShow.show(); + } + + complete( true ); + } + + // TODO assert that the blur and focus triggers are really necessary, remove otherwise + toHide.prev() + .attr({ + "aria-expanded": "false", + "aria-selected": "false", + tabIndex: -1 + }) + .blur(); + toShow.prev() + .attr({ + "aria-expanded": "true", + "aria-selected": "true", + tabIndex: 0 + }) + .focus(); + }, + + _completed: function( cancel ) { + this.running = cancel ? 0 : --this.running; + if ( this.running ) { + return; + } + + if ( this.options.clearStyle ) { + this.toShow.add( this.toHide ).css({ + height: "", + overflow: "" + }); + } + + // other classes are removed before the animation; this one needs to stay until completed + this.toHide.removeClass( "ui-accordion-content-active" ); + // Work around for rendering bug in IE (#5421) + if ( this.toHide.length ) { + this.toHide.parent()[0].className = this.toHide.parent()[0].className; + } + + this._trigger( "change", null, this.data ); + } +}); + +$.extend( $.ui.accordion, { + version: "1.8.16", + animations: { + slide: function( options, additions ) { + options = $.extend({ + easing: "swing", + duration: 300 + }, options, additions ); + if ( !options.toHide.size() ) { + options.toShow.animate({ + height: "show", + paddingTop: "show", + paddingBottom: "show" + }, options ); + return; + } + if ( !options.toShow.size() ) { + options.toHide.animate({ + height: "hide", + paddingTop: "hide", + paddingBottom: "hide" + }, options ); + return; + } + var overflow = options.toShow.css( "overflow" ), + percentDone = 0, + showProps = {}, + hideProps = {}, + fxAttrs = [ "height", "paddingTop", "paddingBottom" ], + originalWidth; + // fix width before calculating height of hidden element + var s = options.toShow; + originalWidth = s[0].style.width; + s.width( parseInt( s.parent().width(), 10 ) + - parseInt( s.css( "paddingLeft" ), 10 ) + - parseInt( s.css( "paddingRight" ), 10 ) + - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 ) + - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) ); + + $.each( fxAttrs, function( i, prop ) { + hideProps[ prop ] = "hide"; + + var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); + showProps[ prop ] = { + value: parts[ 1 ], + unit: parts[ 2 ] || "px" + }; + }); + options.toShow.css({ height: 0, overflow: "hidden" }).show(); + options.toHide + .filter( ":hidden" ) + .each( options.complete ) + .end() + .filter( ":visible" ) + .animate( hideProps, { + step: function( now, settings ) { + // only calculate the percent when animating height + // IE gets very inconsistent results when animating elements + // with small values, which is common for padding + if ( settings.prop == "height" ) { + percentDone = ( settings.end - settings.start === 0 ) ? 0 : + ( settings.now - settings.start ) / ( settings.end - settings.start ); + } + + options.toShow[ 0 ].style[ settings.prop ] = + ( percentDone * showProps[ settings.prop ].value ) + + showProps[ settings.prop ].unit; + }, + duration: options.duration, + easing: options.easing, + complete: function() { + if ( !options.autoHeight ) { + options.toShow.css( "height", "" ); + } + options.toShow.css({ + width: originalWidth, + overflow: overflow + }); + options.complete(); + } + }); + }, + bounceslide: function( options ) { + this.slide( options, { + easing: options.down ? "easeOutBounce" : "swing", + duration: options.down ? 1000 : 200 + }); + } + } +}); + +})( jQuery ); +/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + options: { + appendTo: "body", + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null + }, + + pending: 0, + + _create: function() { + var self = this, + doc = this.element[ 0 ].ownerDocument, + suppressKeyPress; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ) + // TODO verify these actually work as intended + .attr({ + role: "textbox", + "aria-autocomplete": "list", + "aria-haspopup": "true" + }) + .bind( "keydown.autocomplete", function( event ) { + if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { + return; + } + + suppressKeyPress = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + self._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + self._move( "nextPage", event ); + break; + case keyCode.UP: + self._move( "previous", event ); + // prevent moving cursor to beginning of text field in some browsers + event.preventDefault(); + break; + case keyCode.DOWN: + self._move( "next", event ); + // prevent moving cursor to end of text field in some browsers + event.preventDefault(); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( self.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + } + //passthrough - ENTER and TAB both select the current element + case keyCode.TAB: + if ( !self.menu.active ) { + return; + } + self.menu.select( event ); + break; + case keyCode.ESCAPE: + self.element.val( self.term ); + self.close( event ); + break; + default: + // keypress is triggered before the input value is changed + clearTimeout( self.searching ); + self.searching = setTimeout(function() { + // only search if the value has changed + if ( self.term != self.element.val() ) { + self.selectedItem = null; + self.search( null, event ); + } + }, self.options.delay ); + break; + } + }) + .bind( "keypress.autocomplete", function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + } + }) + .bind( "focus.autocomplete", function() { + if ( self.options.disabled ) { + return; + } + + self.selectedItem = null; + self.previous = self.element.val(); + }) + .bind( "blur.autocomplete", function( event ) { + if ( self.options.disabled ) { + return; + } + + clearTimeout( self.searching ); + // clicks on the menu (or a button to trigger a search) will cause a blur event + self.closing = setTimeout(function() { + self.close( event ); + self._change( event ); + }, 150 ); + }); + this._initSource(); + this.response = function() { + return self._response.apply( self, arguments ); + }; + this.menu = $( "<ul></ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( $( this.options.appendTo || "body", doc )[0] ) + // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) + .mousedown(function( event ) { + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = self.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + setTimeout(function() { + $( document ).one( 'mousedown', function( event ) { + if ( event.target !== self.element[ 0 ] && + event.target !== menuElement && + !$.ui.contains( menuElement, event.target ) ) { + self.close(); + } + }); + }, 1 ); + } + + // use another timeout to make sure the blur-event-handler on the input was already triggered + setTimeout(function() { + clearTimeout( self.closing ); + }, 13); + }) + .menu({ + focus: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ); + if ( false !== self._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( /^key/.test(event.originalEvent.type) ) { + self.element.val( item.value ); + } + } + }, + selected: function( event, ui ) { + var item = ui.item.data( "item.autocomplete" ), + previous = self.previous; + + // only trigger when focus was lost (click on menu) + if ( self.element[0] !== doc.activeElement ) { + self.element.focus(); + self.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + setTimeout(function() { + self.previous = previous; + self.selectedItem = item; + }, 1); + } + + if ( false !== self._trigger( "select", event, { item: item } ) ) { + self.element.val( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + self.term = self.element.val(); + + self.close( event ); + self.selectedItem = item; + }, + blur: function( event, ui ) { + // don't set the value of the text field if it's already correct + // this prevents moving the cursor unnecessarily + if ( self.menu.element.is(":visible") && + ( self.element.val() !== self.term ) ) { + self.element.val( self.term ); + } + } + }) + .zIndex( this.element.zIndex() + 1 ) + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .hide() + .data( "menu" ); + if ( $.fn.bgiframe ) { + this.menu.element.bgiframe(); + } + }, + + destroy: function() { + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-autocomplete" ) + .removeAttr( "aria-haspopup" ); + this.menu.element.remove(); + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _initSource: function() { + var self = this, + array, + url; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter(array, request.term) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( self.xhr ) { + self.xhr.abort(); + } + self.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + autocompleteRequest: ++requestIndex, + success: function( data, status ) { + if ( this.autocompleteRequest === requestIndex ) { + response( data ); + } + }, + error: function() { + if ( this.autocompleteRequest === requestIndex ) { + response( [] ); + } + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + search: function( value, event ) { + value = value != null ? value : this.element.val(); + + // always save the actual value, not the one passed as an argument + this.term = this.element.val(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + clearTimeout( this.closing ); + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + + this.source( { term: value }, this.response ); + }, + + _response: function( content ) { + if ( !this.options.disabled && content && content.length ) { + content = this._normalize( content ); + this._suggest( content ); + this._trigger( "open" ); + } else { + this.close(); + } + this.pending--; + if ( !this.pending ) { + this.element.removeClass( "ui-autocomplete-loading" ); + } + }, + + close: function( event ) { + clearTimeout( this.closing ); + if ( this.menu.element.is(":visible") ) { + this.menu.element.hide(); + this.menu.deactivate(); + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function(item) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate + this.menu.deactivate(); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next( new $.Event("mouseover") ); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + ul.width( "" ).outerWidth(), + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var self = this; + $.each( items, function( index, item ) { + self._renderItem( ul, item ); + }); + }, + + _renderItem: function( ul, item) { + return $( "<li></li>" ) + .data( "item.autocomplete", item ) + .append( $( "<a></a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is(":visible") ) { + this.search( null, event ); + return; + } + if ( this.menu.first() && /^previous/.test(direction) || + this.menu.last() && /^next/.test(direction) ) { + this.element.val( this.term ); + this.menu.deactivate(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + +}( jQuery )); + +/* + * jQuery UI Menu (not officially released) + * + * This widget isn't yet finished and the API is subject to change. We plan to finish + * it for the next release. You're welcome to give it a try anyway and give us feedback, + * as long as you're okay with migrating your code later on. We can help with that, too. + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function($) { + +$.widget("ui.menu", { + _create: function() { + var self = this; + this.element + .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") + .attr({ + role: "listbox", + "aria-activedescendant": "ui-active-menuitem" + }) + .click(function( event ) { + if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { + return; + } + // temporary + event.preventDefault(); + self.select( event ); + }); + this.refresh(); + }, + + refresh: function() { + var self = this; + + // don't refresh list items that are already adapted + var items = this.element.children("li:not(.ui-menu-item):has(a)") + .addClass("ui-menu-item") + .attr("role", "menuitem"); + + items.children("a") + .addClass("ui-corner-all") + .attr("tabindex", -1) + // mouseenter doesn't work with event delegation + .mouseenter(function( event ) { + self.activate( event, $(this).parent() ); + }) + .mouseleave(function() { + self.deactivate(); + }); + }, + + activate: function( event, item ) { + this.deactivate(); + if (this.hasScroll()) { + var offset = item.offset().top - this.element.offset().top, + scroll = this.element.scrollTop(), + elementHeight = this.element.height(); + if (offset < 0) { + this.element.scrollTop( scroll + offset); + } else if (offset >= elementHeight) { + this.element.scrollTop( scroll + offset - elementHeight + item.height()); + } + } + this.active = item.eq(0) + .children("a") + .addClass("ui-state-hover") + .attr("id", "ui-active-menuitem") + .end(); + this._trigger("focus", event, { item: item }); + }, + + deactivate: function() { + if (!this.active) { return; } + + this.active.children("a") + .removeClass("ui-state-hover") + .removeAttr("id"); + this._trigger("blur"); + this.active = null; + }, + + next: function(event) { + this.move("next", ".ui-menu-item:first", event); + }, + + previous: function(event) { + this.move("prev", ".ui-menu-item:last", event); + }, + + first: function() { + return this.active && !this.active.prevAll(".ui-menu-item").length; + }, + + last: function() { + return this.active && !this.active.nextAll(".ui-menu-item").length; + }, + + move: function(direction, edge, event) { + if (!this.active) { + this.activate(event, this.element.children(edge)); + return; + } + var next = this.active[direction + "All"](".ui-menu-item").eq(0); + if (next.length) { + this.activate(event, next); + } else { + this.activate(event, this.element.children(edge)); + } + }, + + // TODO merge with previousPage + nextPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.last()) { + this.activate(event, this.element.children(".ui-menu-item:first")); + return; + } + var base = this.active.offset().top, + height = this.element.height(), + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base - height + $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:last"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.last() ? ":first" : ":last")); + } + }, + + // TODO merge with nextPage + previousPage: function(event) { + if (this.hasScroll()) { + // TODO merge with no-scroll-else + if (!this.active || this.first()) { + this.activate(event, this.element.children(".ui-menu-item:last")); + return; + } + + var base = this.active.offset().top, + height = this.element.height(); + result = this.element.children(".ui-menu-item").filter(function() { + var close = $(this).offset().top - base + height - $(this).height(); + // TODO improve approximation + return close < 10 && close > -10; + }); + + // TODO try to catch this earlier when scrollTop indicates the last page anyway + if (!result.length) { + result = this.element.children(".ui-menu-item:first"); + } + this.activate(event, result); + } else { + this.activate(event, this.element.children(".ui-menu-item") + .filter(!this.active || this.first() ? ":last" : ":first")); + } + }, + + hasScroll: function() { + return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); + }, + + select: function( event ) { + this._trigger("selected", event, { item: this.active }); + } +}); + +}(jQuery)); +/* + * jQuery UI Button 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset.button" ) + .bind( "reset.button", formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = this.element.propAttr( "disabled" ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var self = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = this.buttonElement.html(); + } + + if ( this.element.is( ":disabled" ) ) { + options.disabled = true; + } + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter.button", function() { + if ( options.disabled ) { + return; + } + $( this ).addClass( "ui-state-hover" ); + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave.button", function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( hoverClass ); + }) + .bind( "click.button", function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus.button", function() { + // no need to check disabled, focus won't be triggered anyway + self.buttonElement.addClass( focusClass ); + }) + .bind( "blur.button", function() { + self.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change.button", function() { + if ( clickDragged ) { + return; + } + self.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown.button", function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup.button", function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).toggleClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", self.element[0].checked ); + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click.button", function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + self.buttonElement.attr( "aria-pressed", "true" ); + + var radio = self.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + $( document ).one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup.button", function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown.button", function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "keyup.button", function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + + if ( this.element.is(":checkbox") ) { + this.type = "checkbox"; + } else if ( this.element.is(":radio") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + var ancestor = this.element.parents().filter(":last"), + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + var checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.attr( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + + $.Widget.prototype.destroy.call( this ); + }, + + _setOption: function( key, value ) { + $.Widget.prototype._setOption.apply( this, arguments ); + if ( key === "disabled" ) { + if ( value ) { + this.element.propAttr( "disabled", true ); + } else { + this.element.propAttr( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + var isDisabled = this.element.is( ":disabled" ); + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>" ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", buttonText ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + options: { + items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + refresh: function() { + var ltr = this.element.css( "direction" ) === "ltr"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( ltr ? "ui-corner-left" : "ui-corner-right" ) + .end() + .filter( ":last" ) + .addClass( ltr ? "ui-corner-right" : "ui-corner-left" ) + .end() + .end(); + }, + + destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + + $.Widget.prototype.destroy.call( this ); + } +}); + +}( jQuery ) ); +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.8.16" } }); + +var PROP_NAME = 'datepicker'; +var dpuuid = new Date().getTime(); +var instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this.debug = false; // Change this to true to start debugging + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division + this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class + this._appendClass = 'ui-datepicker-append'; // The name of the append marker class + this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class + this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class + this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class + this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class + this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class + this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[''] = { // Default regional settings + closeText: 'Done', // Display text for close link + prevText: 'Prev', // Display text for previous month link + nextText: 'Next', // Display text for next month link + currentText: 'Today', // Display text for current month link + monthNames: ['January','February','March','April','May','June', + 'July','August','September','October','November','December'], // Names of months for drop-down and formatting + monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting + dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting + dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting + dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday + weekHeader: 'Wk', // Column header for week of the year + dateFormat: 'mm/dd/yy', // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: '' // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: 'focus', // 'focus' for popup on focus, + // 'button' for trigger button, or 'both' for either + showAnim: 'fadeIn', // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: '', // Display text following the input box, e.g. showing the format + buttonText: '...', // Text for trigger button + buttonImage: '', // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: 'c-10:c+10', // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: '+10', // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with '+' for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: 'fast', // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: '', // Selector for an alternate field to store selected dates into + altFormat: '', // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional['']); + this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: 'hasDatepicker', + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + /* Debug logging (if enabled). */ + log: function () { + if (this.debug) + console.log.apply('', arguments); + }, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + @param settings object - the new settings to use as defaults (anonymous object) + @return the manager object */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + @param target element - the target input field or division or span + @param settings object - the new settings to use for this date picker instance (anonymous) */ + _attachDatepicker: function(target, settings) { + // check for settings on the control itself - in namespace 'date:' + var inlineSettings = null; + for (var attrName in this._defaults) { + var attrValue = target.getAttribute('date:' + attrName); + if (attrValue) { + inlineSettings = inlineSettings || {}; + try { + inlineSettings[attrName] = eval(attrValue); + } catch (err) { + inlineSettings[attrName] = attrValue; + } + } + } + var nodeName = target.nodeName.toLowerCase(); + var inline = (nodeName == 'div' || nodeName == 'span'); + if (!target.id) { + this.uuid += 1; + target.id = 'dp' + this.uuid; + } + var inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}, inlineSettings || {}); + if (nodeName == 'input') { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) + return; + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp). + bind("setData.datepicker", function(event, key, value) { + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key) { + return this._get(inst, key); + }); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var appendText = this._get(inst, 'appendText'); + var isRTL = this._get(inst, 'isRTL'); + if (inst.append) + inst.append.remove(); + if (appendText) { + inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); + input[isRTL ? 'before' : 'after'](inst.append); + } + input.unbind('focus', this._showDatepicker); + if (inst.trigger) + inst.trigger.remove(); + var showOn = this._get(inst, 'showOn'); + if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked + var buttonText = this._get(inst, 'buttonText'); + var buttonImage = this._get(inst, 'buttonImage'); + inst.trigger = $(this._get(inst, 'buttonImageOnly') ? + $('<img/>').addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $('<button type="button"></button>').addClass(this._triggerClass). + html(buttonImage == '' ? buttonText : $('<img/>').attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? 'before' : 'after'](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) + $.datepicker._hideDatepicker(); + else + $.datepicker._showDatepicker(input[0]); + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, 'autoSize') && !inst.inline) { + var date = new Date(2009, 12 - 1, 20); // Ensure double digits + var dateFormat = this._get(inst, 'dateFormat'); + if (dateFormat.match(/[DM]/)) { + var findMax = function(names) { + var max = 0; + var maxI = 0; + for (var i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + 'monthNames' : 'monthNamesShort')))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); + } + inst.input.attr('size', this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) + return; + divSpan.addClass(this.markerClassName).append(inst.dpDiv). + bind("setData.datepicker", function(event, key, value){ + inst.settings[key] = value; + }).bind("getData.datepicker", function(event, key){ + return this._get(inst, key); + }); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + @param input element - ignored + @param date string or Date - the initial date to display + @param onSelect function - the function to call when a date is selected + @param settings object - update the dialog date picker instance's settings (anonymous object) + @param pos int[2] - coordinates for the dialog's position within the screen or + event - with x/y coordinates or + leave empty for default (screen centre) + @return the manager object */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var inst = this._dialogInst; // internal instance + if (!inst) { + this.uuid += 1; + var id = 'dp' + this.uuid; + this._dialogInput = $('<input type="text" id="' + id + + '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (event) { + $.datepicker.log(event); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + if ( $.datepicker._datepickerShowing ) { + $.datepicker._triggerOnClose($.datepicker._curInst); + } + $.datepicker._curInst.dpDiv.stop(true, true); + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft(); + var viewHeight = document.documentElement.clientHeight + $(document).scrollTop(); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Trigger custom callback of onClose. */ + _triggerOnClose: function(inst) { + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + this._curInst = null; + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + $.datepicker._triggerOnClose(inst); + this._datepickerShowing = false; + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + var $target = $(event.target); + if ($target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.hasClass($.datepicker._triggerClass) && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI)) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' + + ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' + + ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : + (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : ''); + var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid + + '.datepicker._gotoToday(\'#' + inst.id + '\');"' + + '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '<div class="ui-datepicker-group'; + if (numMonths[1] > 1) + switch (col) { + case 0: calender += ' ui-datepicker-group-first'; + cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; + case numMonths[1]-1: calender += ' ui-datepicker-group-last'; + cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; + default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; + } + calender += '">'; + } + calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '</div><table class="ui-datepicker-calendar"><thead>' + + '<tr>'; + var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; + } + calender += thead + '</tr></thead><tbody>'; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += '<tr>'; + var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + + this._get(inst, 'calculateWeek')(printDate) + '</td>'); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += '<td class="' + + ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends + (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months + ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + ' ' + this._dayOverClass : '') + // highlight selected day + (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days + (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates + (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day + (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title + (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' + + inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + + (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + + (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day + (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months + '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + '</tr>'; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '</tbody></table>' + (isMultiMonth ? '</div>' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '<div class="ui-datepicker-title">'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += '<select class="ui-datepicker-month" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' + + '>'; + for (var month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && + (!inMaxYear || month <= maxDate.getMonth())) + monthHtml += '<option value="' + month + '"' + + (month == drawMonth ? ' selected="selected"' : '') + + '>' + monthNamesShort[month] + '</option>'; + } + monthHtml += '</select>'; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += '<select class="ui-datepicker-year" ' + + 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' + + '>'; + for (; year <= endYear; year++) { + inst.yearshtml += '<option value="' + year + '"' + + (year == drawYear ? ' selected="selected"' : '') + + '>' + year + '</option>'; + } + inst.yearshtml += '</select>'; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '</div>'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.16"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); +/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('<div></div>')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('<a href="#"></a>') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('<span></span>') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if (options.modal) { + uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode !== $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('<div></div>') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "<div></div>" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('<button type="button"></button>') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.16", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); +/* + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions (see #5280) + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +}( jQuery )); +/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.16" +}); + +})( jQuery ); +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.16" +}); + +}(jQuery)); +/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "<div></div>", + remove: null, + select: null, + show: null, + spinner: "<em>Loading…</em>", + tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on <li> + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.16" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); +</script><script type="text/javascript">/* + * $Id$ + * + * Copyright 2011, Juniper Network Inc, All rights reserved + * See ../Copyright for more information. + */ + +jQuery(function ($) { + /* + * dbgpr() is our old-and-trusted debug print function + */ + $.dbgpr = function () { + /* The actual work is pretty trivial */ + $('#debug-log').prepend(Array.prototype.slice + .call(arguments).join(" ") + "\n"); + } +}); +</script><script type="text/javascript">/* + * $Id$ + * + * Copyright (c) 2006-2011, Juniper Networks, Inc. + * All rights reserved. + * This SOFTWARE is licensed under the LICENSE provided in the + * ../Copyright file. By downloading, installing, copying, or otherwise + * using the SOFTWARE, you agree to be bound by the terms of that + * LICENSE. + */ + +function popClick(event, objectId) { + var sc = window["stickyClick"]; + if (sc && sc[objectId]) { + popDown(event, objectId); + sc[objectId] = false; + } else { + popUp(event, objectId); + if (!sc) { + window["stickyClick"] = sc = []; + } + sc[objectId] = true; + } + return false; +} + +function popUp(event, objectId) { + var sc = window["stickyClick"]; + if (sc && sc[objectId]) { + return; + } + + if (document.getElementById == null) + return; + var ie = document.all ? 1 : 0; /* Is this Internet Explorer? */ + var dm = document.getElementById(objectId); + if (dm == null) + return; + + var ds = dm.style; + var widthPage = window.innerWidth ? window.innerWidth + : document.body.clientWidth; + + var elementWidth = dm.offsetWidth; + var top; + var left; + + if (event.pageY) { + top = event.pageY + 10; + left = event.pageX + 10; + } else if (event.clientY) { + top = event.clientY + 10; + left = event.clientX + 10; + } else { + return; + } + + if (left + elementWidth > widthPage) + left = widthPage - elementWidth - 25; + + if (ie) { + ds.width = "1200px"; + ds.display = "block"; + var cw = dm.firstChild.clientWidth; + if (cw > widthPage - left - 10) { + cw = widthPage - left - 10; + } + ds.width = cw + "px"; + } + + ds.left = "10px"; + ds.top = top + "px"; + ds.width = widthPage / 2 + "px"; + ds.display = "block"; + + var tm = document.getElementById("table-" + objectId); + if (tm == null) + return; + + elementWidth = tm.offsetWidth; + if (left + elementWidth > widthPage) + left = widthPage - elementWidth - 25; + + ds.left = left + "px"; +} + +function popDown(event, objectId) { + var sc = window["stickyClick"]; + if (sc && sc[objectId]) { + return; + } + + if (document.getElementById == null) + return; + var dm = document.getElementById(objectId); + if (dm) { + dm.style.display = "none"; + } +} +</script><script type="text/javascript">/* + * $Id$ + * + * Copyright (c) 2006-2011, Juniper Networks, Inc. + * All rights reserved. + * This SOFTWARE is licensed under the LICENSE provided in the + * ../Copyright file. By downloading, installing, copying, or otherwise + * using the SOFTWARE, you agree to be bound by the terms of that + * LICENSE. + */ + +jQuery(function ($) { + var $body = $("body"); + var $newp = $("<div id='top'><div id='top-left'/>" + + "<div id='top-right'/></div"); + var $left = $("div#top-left", $newp); + var $right = $("div#top-right", $newp); + + $right.append($("<div id='nav-bar'><button id='nav-prev'/>" + + "<button id='nav-next'/></div>")); + + $body.append($newp); + $left.append($("div#toc")); + + $("div.content, div.index, div.note", $body).each(function (i, elt) { + $(elt).appendTo($right); + }); + + $("body > ul.toc").remove(); + $("#rfc.toc").remove(); + $("div.note").remove(); + $("h1", $left).remove(); + + /* $body.append($("<div id='debug-log'/>")); */ + $left.append($("<div class='padding'/>")); + + var active; + var tocactive; + + { + var $active = $($right.children("div.content").get(0)); + if (this.URL) { + var last = this.URL.lastIndexOf("#"); + if (last) { + var $found = $(this.URL.substring(last)); + if ($found.length > 0) + $active = $found.parent(); + if (!$active.hasClass("content")) + $active = $active.parent(); + } + } + setActive($active); + } + + function setActive ($elt, toggle) { + if ($elt && $elt.length > 0 && $elt.hasClass("content")) { + /* Mark a new element "active" */ + if (active) + active.removeClass("active"); + active = $elt; + active.addClass("active"); + + /* Now we want to find the matching TOC entry and mark it */ + if (tocactive) + tocactive.removeClass("toc-active"); + + var id = $elt.get(0).children[0].id + $.dbgpr("sa:", id); + if (id) { + id = "#toc_" + id; + tocactive = $("a", $(id).parent()); + $.dbgpr("ta:", tocactive.length, id); + if (tocactive.length) { + tocactive = $(tocactive[0]); + tocactive.addClass("toc-active"); + + var $tt = tocactive.parents("li.tocline0"); + $.dbgpr("tt:", $tt.length); + if (toggle) + $("ul.top-toc", $tt).toggleClass("top-toc-open"); + else + $("ul.top-toc", $tt).addClass("top-toc-open"); + } + } + + var szr = $("div#top-right div.active").innerHeight(); + var sz = $("p#title").innerHeight(); + sz = window.innerHeight - sz; + sz -= 66; + if (sz < 200) + sz = 300; + if (sz < szr) + sz = szr; + $("div#toc > ul.toc").innerHeight(sz); + + } + } + + function findParent ($elt, className) { + while ($elt) { + if ($elt.hasClass(className)) + return $elt; + $elt = $elt.parent(); + } + return null; + } + + $("a", $left).click(function (event) { + event.preventDefault(); + var $this = $(this); + var id = this.href.split("#"); + id = id[id.length - 1]; + + var toggle = $(this).parent().hasClass("tocline0"); + + var $target = $(document.getElementById(id)); + $.dbgpr("id: ", id, " + ", $target, " + ", $target.length); + + var $parent = findParent($target, "content"); + $.dbgpr("pr: ", $parent); + setActive($parent, toggle); + $.dbgpr("done"); + + $("html").animate({ scrollTop: 0 }, 500); + }); + + + $("a", $right).each(function (idx, elt) { + /* Put the @title as the link value */ + var $elt = $(elt); + var href = $elt.attr("href"); + var proto; + + if (href) { + var len = href.indexOf(":"); + if (len > 0) { + proto = href.substr(0, len); + } + } + if (proto != "http" && proto != "https") { + var t = $elt.attr("title"); + if (t !== undefined && href !== undefined) + $elt.text(t); + $elt.click(function (event) { + event.preventDefault(); + var id = this.href.split("#"); + id = id[id.length - 1]; + + var $target = $(document.getElementById(id)); + setActive($target.parents("div.content")); + + $("html").animate({ scrollTop: 0 }, 500); + }); + } + }); + + $("button#nav-prev").button({ + label: "<< Previous", + }).click(function (event) { + setActive(active.prev()); + }); + + $("button#nav-next").button({ + label: "Next >>", + }).click(function (event) { + setActive(active.next()); + }); + + $("p", $right).each(function (idx, elt) { + var $elt = $(elt); + var val = $elt.get(0); + if (val && val.textContent && val.textContent.startsWith("Section Contents")) { + $elt.addClass("section-contents"); + } + }); + + + function getMedia () { + var mediaInspector = document.getElementById('media-inspector'); + var zIndex; + + if (mediaInspector === null) + return -1; + + if (mediaInspector.currentStyle) { + zIndex = mediaInspector.currentStyle['zIndex']; + } else if (window.getComputedStyle) { + zIndex = window.getComputedStyle(mediaInspector, '') + .getPropertyValue("z-index"); + } + return zIndex; + } +}); +</script><link rel="Contents" href="#doc.toc"> +<link rel="Author" href="#doc.authors"> +<link rel="Chapter" title="1 Overview" href="#doc_section_1"> +<link rel="Chapter" title="2 Formatting with libxo" href="#doc_section_2"> +<link rel="Chapter" title="3 The libxo API" href="#doc_section_3"> +<link rel="Chapter" title='4 The "xo" Utility' href="#doc_section_4"> +<link rel="Chapter" title="5 xolint" href="#doc_section_5"> +<link rel="Chapter" title="6 xohtml" href="#doc_section_6"> +<link rel="Chapter" title="7 xopo" href="#doc_section_7"> +<link rel="Chapter" title="8 FAQs" href="#doc_section_8"> +<link rel="Chapter" title="9 Howtos: Focused Directions" href="#doc_section_9"> +<link rel="Chapter" title="10 Examples" href="#doc_section_10"> +<meta name="generator" content="http://greenbytes.de/tech/webdav/rfc2629.xslt, Revision 1.389, 2008-08-20 14:21:35, XSLT vendor: libxslt http://xmlsoft.org/XSLT/"> +<link rel="schema.DC" href="http://purl.org/dc/elements/1.1/"> +<meta name="DC.Creator" content="Shafer, P."> +</head> +<body style="font-size: 80%"> +<div id="media-inspector"></div> +<div id="header"><table summary="header information" class="header" border="0" cellpadding="1" cellspacing="1"> +<tr> +<td class="header left">The libxo Project</td> +<td class="header right">P. Shafer</td> +</tr> +<tr> +<td class="header left"></td> +<td class="header right">Juniper Networks</td> +</tr> +<tr> +<td class="header left"></td> +<td class="header right">August 24, 2015</td> +</tr> +</table></div> +<p id="title" class="title">libxo: The Easy Way to Generate text, XML, JSON, and HTML output<br><span class="filename">libxo-manual</span></p> +<div id="toc"> +<h1 class="np" id="doc.toc"><a href="#doc.toc">Table of Contents</a></h1> +<ul class="toc"> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_1">1 </div> +<a href="#overview">Overview</a><ul class="toc top-toc"><li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1">1.1 </div> +<a href="#getting-libxo">Getting libxo</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_1">1.1.1 </div> +<a href="#downloading-libxo-source-code">Downloading libxo Source Code</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_2">1.1.2 </div> +<a href="#building-libxo">Building libxo</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_2_1">1.1.2.1 </div> +<a href="#setting-up-the-build">Setting up the build</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_2_2">1.1.2.2 </div> +<a href="#running-the-configure-script">Running the "configure" Script</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_2_3">1.1.2.3 </div> +<a href="#running-the-make-command">Running the "make" command</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_2_4">1.1.2.4 </div> +<a href="#running-the-regression-tests">Running the Regression Tests</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_1_1_2_5">1.1.2.5 </div> +<a href="#installing-libxo">Installing libxo</a> +</li> +</ul> +</li> +</ul> +</li></ul> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_2">2 </div> +<a href="#formatting-with-libxo">Formatting with libxo</a><ul class="toc top-toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_1">2.1 </div> +<a href="#encoding-styles">Encoding Styles</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_1_1">2.1.1 </div> +<a href="#text-output">Text Output</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_1_2">2.1.2 </div> +<a href="#xml-output">XML Output</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_1_3">2.1.3 </div> +<a href="#json-output">JSON Output</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_1_4">2.1.4 </div> +<a href="#html-output">HTML Output</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2">2.2 </div> +<a href="#format-strings">Format Strings</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1">2.2.1 </div> +<a href="#field-roles">Field Roles</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_1">2.2.1.1 </div> +<a href="#color-role">The Color Role ({C:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_2">2.2.1.2 </div> +<a href="#the-decoration-role-d">The Decoration Role ({D:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_3">2.2.1.3 </div> +<a href="#gettext-role">The Gettext Role ({G:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_4">2.2.1.4 </div> +<a href="#the-label-role-l">The Label Role ({L:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_5">2.2.1.5 </div> +<a href="#the-note-role-n">The Note Role ({N:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_6">2.2.1.6 </div> +<a href="#padding-role">The Padding Role ({P:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_7">2.2.1.7 </div> +<a href="#the-title-role-t">The Title Role ({T:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_8">2.2.1.8 </div> +<a href="#the-units-role-u">The Units Role ({U:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_9">2.2.1.9 </div> +<a href="#the-value-role-v-and-">The Value Role ({V:} and {:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_1_10">2.2.1.10 </div> +<a href="#anchor-role">The Anchor Roles ({[:} and {]:})</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2">2.2.2 </div> +<a href="#field-modifiers">Field Modifiers</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_1">2.2.2.1 </div> +<a href="#the-colon-modifier-c">The Colon Modifier ({c:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_2">2.2.2.2 </div> +<a href="#the-display-modifier-d">The Display Modifier ({d:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_3">2.2.2.3 </div> +<a href="#e-modifier">The Encoding Modifier ({e:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_4">2.2.2.4 </div> +<a href="#gettext-modifier">The Gettext Modifier ({g:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_5">2.2.2.5 </div> +<a href="#the-humanize-modifier-h">The Humanize Modifier ({h:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_6">2.2.2.6 </div> +<a href="#the-key-modifier-k">The Key Modifier ({k:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_7">2.2.2.7 </div> +<a href="#the-leaf-list-modifier-l">The Leaf-List Modifier ({l:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_8">2.2.2.8 </div> +<a href="#the-no-quotes-modifier-n">The No-Quotes Modifier ({n:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_9">2.2.2.9 </div> +<a href="#plural-modifier">The Plural Modifier ({p:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_10">2.2.2.10 </div> +<a href="#the-quotes-modifier-q">The Quotes Modifier ({q:})</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_2_11">2.2.2.11 </div> +<a href="#the-white-space-modifier-w">The White Space Modifier ({w:})</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_3">2.2.3 </div> +<a href="#field-formatting">Field Formatting</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_4">2.2.4 </div> +<a href="#utf-8-and-locale-strings">UTF-8 and Locale Strings</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_5">2.2.5 </div> +<a href="#characters-outside-of-field-definitions">Characters Outside of Field Definitions</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_6">2.2.6 </div> +<a href="#m-is-supported">"%m" Is Supported</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_7">2.2.7 </div> +<a href="#n-is-not-supported">"%n" Is Not Supported</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_8">2.2.8 </div> +<a href="#the-encoding-format-eformat">The Encoding Format (eformat)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_9">2.2.9 </div> +<a href="#content-strings">Content Strings</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_10">2.2.10 </div> +<a href="#printf-like">Argument Validation</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_2_11">2.2.11 </div> +<a href="#example">Example</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_3">2.3 </div> +<a href="#command-line-arguments">Command-line Arguments</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_4">2.4 </div> +<a href="#representing-hierarchy">Representing Hierarchy</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_4_1">2.4.1 </div> +<a href="#containers">Containers</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_4_2">2.4.2 </div> +<a href="#lists-and-instances">Lists and Instances</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_4_3">2.4.3 </div> +<a href="#dtrt-mode">DTRT Mode</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_4_4">2.4.4 </div> +<a href="#markers">Markers</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_5">2.5 </div> +<a href="#handles">Handles</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_2_6">2.6 </div> +<a href="#utf-8">UTF-8</a> +</li> +</ul> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_3">3 </div> +<a href="#the-libxo-api">The libxo API</a><ul class="toc top-toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1">3.1 </div> +<a href="#handles-2">Handles</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_1">3.1.1 </div> +<a href="#xo_create">xo_create</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_2">3.1.2 </div> +<a href="#xo_create_to_file">xo_create_to_file</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_3">3.1.3 </div> +<a href="#xo_set_writer">xo_set_writer</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_4">3.1.4 </div> +<a href="#xo_set_style">xo_set_style</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_4_1">3.1.4.1 </div> +<a href="#styles">Output Styles (XO_STYLE_*)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_4_2">3.1.4.2 </div> +<a href="#xo_set_style_name">xo_set_style_name</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_5">3.1.5 </div> +<a href="#xo_set_flags">xo_set_flags</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_5_1">3.1.5.1 </div> +<a href="#flags">Flags (XOF_*)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_5_2">3.1.5.2 </div> +<a href="#xo_clear_flags">xo_clear_flags</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_5_3">3.1.5.3 </div> +<a href="#xo_set_options">xo_set_options</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_1_6">3.1.6 </div> +<a href="#xo_destroy">xo_destroy</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_2">3.2 </div> +<a href="#emitting-content-xo_emit">Emitting Content (xo_emit)</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_2_1">3.2.1 </div> +<a href="#xo_attr">Attributes (xo_attr)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_2_2">3.2.2 </div> +<a href="#flushing-output-xo_flush">Flushing Output (xo_flush)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_2_3">3.2.3 </div> +<a href="#finishing-output-xo_finish">Finishing Output (xo_finish)</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_3">3.3 </div> +<a href="#emitting-hierarchy">Emitting Hierarchy</a><ul class="toc"><li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_3_1">3.3.1 </div> +<a href="#lists-and-instances-2">Lists and Instances</a> +</li></ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4">3.4 </div> +<a href="#support-functions">Support Functions</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_1">3.4.1 </div> +<a href="#xo_parse_args">Parsing Command-line Arguments (xo_parse_args)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_2">3.4.2 </div> +<a href="#xo_set_program">xo_set_program</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_3">3.4.3 </div> +<a href="#xo_set_version">xo_set_version</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_4">3.4.4 </div> +<a href="#info">Field Information (xo_info_t)</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_5">3.4.5 </div> +<a href="#memory-allocation">Memory Allocation</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_6">3.4.6 </div> +<a href="#LIBXO_OPTIONS">LIBXO_OPTIONS</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_7">3.4.7 </div> +<a href="#errors-warnings-and-messages">Errors, Warnings, and Messages</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_8">3.4.8 </div> +<a href="#xo_error">xo_error</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_4_9">3.4.9 </div> +<a href="#xo_no_setlocale">xo_no_setlocale</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5">3.5 </div> +<a href="#emitting-syslog-messages">Emitting syslog Messages</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_1">3.5.1 </div> +<a href="#priority">Priority, Facility, and Flags</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_2">3.5.2 </div> +<a href="#xo_syslog">xo_syslog</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_3">3.5.3 </div> +<a href="#support-functions-2">Support functions</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_3_1">3.5.3.1 </div> +<a href="#xo_vsyslog">xo_vsyslog</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_3_2">3.5.3.2 </div> +<a href="#xo_open_log">xo_open_log</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_3_3">3.5.3.3 </div> +<a href="#xo_close_log">xo_close_log</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_3_4">3.5.3.4 </div> +<a href="#xo_set_logmask">xo_set_logmask</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_5_3_5">3.5.3.5 </div> +<a href="#xo_set_syslog_enterprise_id">xo_set_syslog_enterprise_id</a> +</li> +</ul> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_6">3.6 </div> +<a href="#creating-custom-encoders">Creating Custom Encoders</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_6_1">3.6.1 </div> +<a href="#loading-encoders">Loading Encoders</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_6_2">3.6.2 </div> +<a href="#encoder-initialization">Encoder Initialization</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_3_6_3">3.6.3 </div> +<a href="#operations">Operations</a> +</li> +</ul> +</li> +</ul> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_4">4 </div> +<a href="#the-xo-utility">The "xo" Utility</a><ul class="toc top-toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_4_1">4.1 </div> +<a href="#command-line-options">Command Line Options</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_4_2">4.2 </div> +<a href="#example-2">Example</a> +</li> +</ul> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_5">5 </div> +<a href="#xolint">xolint</a> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_6">6 </div> +<a href="#xohtml">xohtml</a> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_7">7 </div> +<a href="#xopo">xopo</a> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_8">8 </div> +<a href="#faqs">FAQs</a><ul class="toc top-toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_1">8.1 </div> +<a href="#general">General</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_1_1">8.1.1 </div> +<a href="#can-you-share-the-history-of-libxo">Can you share the history of libxo?</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_1_2">8.1.2 </div> +<a href="#did-the-complex-semantics-of-format-strings-evolve-over-time">Did the complex semantics of format strings evolve over time?</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_1_3">8.1.3 </div> +<a href="#good-field-names">What makes a good field name?</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2">8.2 </div> +<a href="#what-does-this-message-mean">What does this message mean?</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_1">8.2.1 </div> +<a href="#a-percent-sign-appearing-in-text-is-a-literal">'A percent sign appearing in text is a literal'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_2">8.2.2 </div> +<a href="#unknown-long-name-for-rolemodifier">'Unknown long name for role/modifier'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_3">8.2.3 </div> +<a href="#last-character-before-field-definition-is-a-field-type">'Last character before field definition is a field type'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_4">8.2.4 </div> +<a href="#encoding-format-uses-different-number-of-arguments">'Encoding format uses different number of arguments'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_5">8.2.5 </div> +<a href="#only-one-field-role-can-be-used">'Only one field role can be used'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_6">8.2.6 </div> +<a href="#potential-missing-slash-after-c-d-n-l-or-t-with-format">'Potential missing slash after C, D, N, L, or T with format'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_7">8.2.7 </div> +<a href="#an-encoding-format-cannot-be-given-roles-dnlt">'An encoding format cannot be given (roles: DNLT)'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_8">8.2.8 </div> +<a href="#format-cannot-be-given-when-content-is-present-roles-cdln">'Format cannot be given when content is present (roles: CDLN)'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_9">8.2.9 </div> +<a href="#field-has-color-without-fg--or-bg--role-c">'Field has color without fg- or bg- (role: C)'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_10">8.2.10 </div> +<a href="#field-has-invalid-color-or-effect-role-c">'Field has invalid color or effect (role: C)'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_11">8.2.11 </div> +<a href="#field-has-humanize-modifier-but-no-format-string">'Field has humanize modifier but no format string'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_12">8.2.12 </div> +<a href="#field-has-hn--modifier-but-not-h-modifier">'Field has hn-* modifier but not 'h' modifier'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_13">8.2.13 </div> +<a href="#value-field-must-have-a-name-as-content">'Value field must have a name (as content)")'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_14">8.2.14 </div> +<a href="#use-hyphens-not-underscores-for-value-field-name">'Use hyphens, not underscores, for value field name'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_15">8.2.15 </div> +<a href="#value-field-name-cannot-start-with-digit">'Value field name cannot start with digit'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_16">8.2.16 </div> +<a href="#value-field-name-should-be-lower-case">'Value field name should be lower case'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_17">8.2.17 </div> +<a href="#value-field-name-should-be-longer-than-two-characters">'Value field name should be longer than two characters'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_18">8.2.18 </div> +<a href="#value-field-name-contains-invalid-character">'Value field name contains invalid character'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_19">8.2.19 </div> +<a href="#decoration-field-contains-invalid-character">'decoration field contains invalid character'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_20">8.2.20 </div> +<a href="#anchor-content-should-be-decimal-width">'Anchor content should be decimal width'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_21">8.2.21 </div> +<a href="#anchor-format-should-be-d">'Anchor format should be "%d"'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_22">8.2.22 </div> +<a href="#anchor-cannot-have-both-format-and-encoding-format">'Anchor cannot have both format and encoding format")'</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_8_2_23">8.2.23 </div> +<a href="#max-width-only-valid-for-strings">'Max width only valid for strings'</a> +</li> +</ul> +</li> +</ul> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_9">9 </div> +<a href="#howtos-focused-directions">Howtos: Focused Directions</a><ul class="toc top-toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_1">9.1 </div> +<a href="#howto-report-bugs">Howto: Report bugs</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_2">9.2 </div> +<a href="#howto-install-libxo">Howto: Install libxo</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_3">9.3 </div> +<a href="#howto-convert-command-line-applications">Howto: Convert command line applications</a><ul class="toc"> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_3_1">9.3.1 </div> +<a href="#setting-up-the-context">Setting up the context</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_3_2">9.3.2 </div> +<a href="#converting-printf-calls">Converting printf Calls</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_3_3">9.3.3 </div> +<a href="#creating-hierarchy">Creating Hierarchy</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_3_4">9.3.4 </div> +<a href="#converting-error-functions">Converting Error Functions</a> +</li> +</ul> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_4">9.4 </div> +<a href="#howto-use-xo-in-shell-scripts">Howto: Use "xo" in Shell Scripts</a> +</li> +<li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_5">9.5 </div> +<a href="#howto-i18n">Howto: Internationalization (i18n)</a><ul class="toc"><li class="tocline1"> +<div class="section-number" id="toc_doc_section_9_5_1">9.5.1 </div> +<a href="#i18n-and-xo_emit">i18n and xo_emit</a> +</li></ul> +</li> +</ul> +</li> +<li class="tocline0"> +<div class="section-number" id="toc_doc_section_10">10 </div> +<a href="#examples">Examples</a><ul class="toc top-toc"><li class="tocline1"> +<div class="section-number" id="toc_doc_section_10_1">10.1 </div> +<a href="#unit-test">Unit Test</a> +</li></ul> +</li> +<li class="tocline0"><a href="#doc.authors">Author's Address</a></li> +</ul> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_1" class="np"> +<div class="self-section-number"> +<a href="#doc_section_1">1_</a> </div> +<a id="overview" href="#overview">Overview</a> +</h1> +<p id="doc_section_1_p_1">libxo - A Library for Generating Text, XML, JSON, and HTML Output</p> +<p id="doc_section_1_p_2">You want to prepare for the future, but you need to live in the present. You'd love a flying car, but need to get to work today. You want to support features like XML, JSON, and HTML rendering to allow integration with NETCONF, REST, and web browsers, but you need to make text output for command line users. And you don't want multiple code paths that can't help but get out of sync. None of this "if (xml) {... } else {...}" logic. And ifdefs are right out. But you'd really, really like all the fancy features that modern encoding formats can provide. libxo can help.</p> +<p id="doc_section_1_p_3">The libxo library allows an application to generate text, XML, JSON, and HTML output using a common set of function calls. The application decides at run time which output style should be produced. The application calls a function "xo_emit" to product output that is described in a format string. A "field descriptor" tells libxo what the field is and what it means. Each field descriptor is placed in braces with a printf-like format string (<a href="#format-strings" title="Format Strings">Section 2.2</a>):</p> +<div id="doc_figure_u.1"></div> <pre> + xo_emit(" {:lines/%7ju} {:words/%7ju} " + "{:characters/%7ju} {d:filename/%s}\n", + linect, wordct, charct, file); + </pre> <p id="doc_section_1_p_5">Each field can have a role, with the 'value' role being the default, and the role tells libxo how and when to render that field. Output can then be generated in various style, using the "‑‑libxo" option:</p> +<div id="doc_figure_u.2"></div> <pre> + % wc /etc/motd + 25 165 1140 /etc/motd + % wc --libxo xml,pretty,warn /etc/motd + <wc> + <file> + <lines>25</lines> + <words>165</words> + <characters>1140</characters> + <filename>/etc/motd</filename> + </file> + </wc> + % wc --libxo json,pretty,warn /etc/motd + { + "wc": { + "file": [ + { + "lines": 25, + "words": 165, + "characters": 1140, + "filename": "/etc/motd" + } + ] + } + } + % wc --libxo html,pretty,warn /etc/motd + <div class="line"> + <div class="text"> </div> + <div class="data" data-tag="lines"> 25</div> + <div class="text"> </div> + <div class="data" data-tag="words"> 165</div> + <div class="text"> </div> + <div class="data" data-tag="characters"> 1140</div> + <div class="text"> </div> + <div class="data" data-tag="filename">/etc/motd</div> + </div> + </pre> <p id="doc_section_1_p_7">Section Contents: </p> +<ul><li><a href="#getting-libxo" title="Getting libxo">Section 1.1</a></li></ul> +<div class="content"> +<h2 id="doc_section_1_1"> +<div class="self-section-number"> +<a href="#doc_section_1_1">1.1</a> </div> +<a id="getting-libxo" href="#getting-libxo">Getting libxo</a> +</h2> +<p id="doc_section_1_1_p_1">libxo lives on github as:</p> +<p id="doc_section_1_1_p_2"> <a href="https://github.com/Juniper/libxo">https://github.com/Juniper/libxo</a></p> +<p id="doc_section_1_1_p_3">The latest release of libxo is available at:</p> +<p id="doc_section_1_1_p_4"> <a href="https://github.com/Juniper/libxo/releases">https://github.com/Juniper/libxo/releases</a></p> +<p id="doc_section_1_1_p_5">We are following the branching scheme from <a href="http://nvie.com/posts/a-successful-git-branching-model/">http://nvie.com/posts/a-successful-git-branching-model/</a> which means we will do development under the "develop" branch, and release from the "master" branch. To clone a developer tree, run the following command:</p> +<div id="doc_figure_u.3"></div> <pre> + git clone https://github.com/Juniper/libxo.git -b develop + </pre> <p id="doc_section_1_1_p_7">We're using semantic release numbering, as defined in <a href="http://semver.org/spec/v2.0.0.html">http://semver.org/spec/v2.0.0.html</a>.</p> +<p id="doc_section_1_1_p_8">libxo is open source, distributed under the BSD license. It shipped as part of the FreeBSD operating system starting with release 11.0.</p> +<p id="doc_section_1_1_p_9">Issues, problems, and bugs should be directly to the issues page on our github site.</p> +<p id="doc_section_1_1_p_10">Section Contents: </p> +<ul> +<li><a href="#downloading-libxo-source-code" title="Downloading libxo Source Code">Section 1.1.1</a></li> +<li><a href="#building-libxo" title="Building libxo">Section 1.1.2</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_1_1_1"> +<div class="self-section-number"> +<a href="#doc_section_1_1_1">1.1.1</a> </div> +<a id="downloading-libxo-source-code" href="#downloading-libxo-source-code">Downloading libxo Source Code</a> +</h3> +<p id="doc_section_1_1_1_p_1">You can retrieve the source for libxo in two ways:</p> +<p id="doc_section_1_1_1_p_2">A) Use a "distfile" for a specific release. We use github to maintain our releases. Visit github release page (<a href="https://github.com/Juniper/libxo/releases">https://github.com/Juniper/libxo/releases</a>) to see the list of releases. To download the latest, look for the release with the green "Latest release" button and the green "libxo‑RELEASE.tar.gz" button under that section.</p> +<p id="doc_section_1_1_1_p_3">After downloading that release's distfile, untar it as follows:</p> +<div id="doc_figure_u.4"></div> <pre> + tar -zxf libxo-RELEASE.tar.gz + cd libxo-RELEASE + </pre> <p id="doc_section_1_1_1_p_5">[Note: for Solaris users, your "tar" command lacks the "‑z" flag, so you'll need to substitute "gzip -dc "file" | tar xf -" instead of "tar -zxf "file"".]</p> +<p id="doc_section_1_1_1_p_6">B) Use the current build from github. This gives you the most recent source code, which might be less stable than a specific release. To build libxo from the git repo:</p> +<div id="doc_figure_u.5"></div> <pre> + git clone https://github.com/Juniper/libxo.git + cd libxo + </pre> <p id="doc_section_1_1_1_p_8">_BE AWARE_: The github repository does _not_ contain the files generated by "autoreconf", with the notable exception of the "m4" directory. Since these files (depcomp, configure, missing, install-sh, etc) are generated files, we keep them out of the source code repository.</p> +<p id="doc_section_1_1_1_p_9">This means that if you download the a release distfile, these files will be ready and you'll just need to run "configure", but if you download the source code from svn, then you'll need to run "autoreconf" by hand. This step is done for you by the "setup.sh" script, described in the next section.</p> +</div> +<div class="content"> +<h3 id="doc_section_1_1_2"> +<div class="self-section-number"> +<a href="#doc_section_1_1_2">1.1.2</a> </div> +<a id="building-libxo" href="#building-libxo">Building libxo</a> +</h3> +<p id="doc_section_1_1_2_p_1">To build libxo, you'll need to set up the build, run the "configure" script, run the "make" command, and run the regression tests.</p> +<p id="doc_section_1_1_2_p_2">The following is a summary of the commands needed. These commands are explained in detail in the rest of this section.</p> +<div id="doc_figure_u.6"></div> <pre> + sh bin/setup.sh + cd build + ../configure + make + make test + sudo make install + </pre> <p id="doc_section_1_1_2_p_4">The following sections will walk thru each of these steps with additional details and options, but the above directions should be all that's needed.</p> +<p id="doc_section_1_1_2_p_5">Section Contents: </p> +<ul> +<li><a href="#setting-up-the-build" title="Setting up the build">Section 1.1.2.1</a></li> +<li><a href="#running-the-configure-script" title='Running the "configure" Script'>Section 1.1.2.2</a></li> +<li><a href="#running-the-make-command" title='Running the "make" command'>Section 1.1.2.3</a></li> +<li><a href="#running-the-regression-tests" title="Running the Regression Tests">Section 1.1.2.4</a></li> +<li><a href="#installing-libxo" title="Installing libxo">Section 1.1.2.5</a></li> +</ul> +<div class="content"> +<h4 id="doc_section_1_1_2_1"> +<div class="self-section-number"> +<a href="#doc_section_1_1_2_1">1.1.2.1</a> </div> +<a id="setting-up-the-build" href="#setting-up-the-build">Setting up the build</a> +</h4> +<p id="doc_section_1_1_2_1_p_1">[If you downloaded a distfile, you can skip this step.]</p> +<p id="doc_section_1_1_2_1_p_2">Run the "setup.sh" script to set up the build. This script runs the "autoreconf" command to generate the "configure" script and other generated files.</p> +<div id="doc_figure_u.7"></div> <pre> + sh bin/setup.sh + </pre> <p id="doc_section_1_1_2_1_p_4">Note: We're are currently using autoreconf version 2.69.</p> +</div> +<div class="content"> +<h4 id="doc_section_1_1_2_2"> +<div class="self-section-number"> +<a href="#doc_section_1_1_2_2">1.1.2.2</a> </div> +<a id="running-the-configure-script" href="#running-the-configure-script">Running the "configure" Script</a> +</h4> +<p id="doc_section_1_1_2_2_p_1">Configure (and autoconf in general) provides a means of building software in diverse environments. Our configure script supports a set of options that can be used to adjust to your operating environment. Use "configure --help" to view these options.</p> +<p id="doc_section_1_1_2_2_p_2">We use the "build" directory to keep object files and generated files away from the source tree.</p> +<p id="doc_section_1_1_2_2_p_3">To run the configure script, change into the "build" directory, and run the "configure" script. Add any required options to the "../configure" command line.</p> +<div id="doc_figure_u.8"></div> <pre> + cd build + ../configure + </pre> <p id="doc_section_1_1_2_2_p_5">Expect to see the "configure" script generate the following error:</p> +<div id="doc_figure_u.9"></div> <pre> + /usr/bin/rm: cannot remove `libtoolT': No such file or directory + </pre> <p id="doc_section_1_1_2_2_p_7">This error is harmless and can be safely ignored.</p> +<p id="doc_section_1_1_2_2_p_8">By default, libxo installs architecture-independent files, including extension library files, in the /usr/local directories. To specify an installation prefix other than /usr/local for all installation files, include the --prefix=prefix option and specify an alternate location. To install just the extension library files in a different, user-defined location, include the --with-extensions-dir=dir option and specify the location where the extension libraries will live.</p> +<div id="doc_figure_u.10"></div> <pre> + cd build + ../configure [OPTION]... [VAR=VALUE]... + </pre> </div> +<div class="content"> +<h4 id="doc_section_1_1_2_3"> +<div class="self-section-number"> +<a href="#doc_section_1_1_2_3">1.1.2.3</a> </div> +<a id="running-the-make-command" href="#running-the-make-command">Running the "make" command</a> +</h4> +<p id="doc_section_1_1_2_3_p_1">Once the "configure" script is run, build the images using the "make" command:</p> +<div id="doc_figure_u.11"></div> <pre> + make + </pre> </div> +<div class="content"> +<h4 id="doc_section_1_1_2_4"> +<div class="self-section-number"> +<a href="#doc_section_1_1_2_4">1.1.2.4</a> </div> +<a id="running-the-regression-tests" href="#running-the-regression-tests">Running the Regression Tests</a> +</h4> +<p id="doc_section_1_1_2_4_p_1">libxo includes a set of regression tests that can be run to ensure the software is working properly. These test are optional, but will help determine if there are any issues running libxo on your machine. To run the regression tests:</p> +<div id="doc_figure_u.12"></div> <pre> + make test + </pre> </div> +<div class="content"> +<h4 id="doc_section_1_1_2_5"> +<div class="self-section-number"> +<a href="#doc_section_1_1_2_5">1.1.2.5</a> </div> +<a id="installing-libxo" href="#installing-libxo">Installing libxo</a> +</h4> +<p id="doc_section_1_1_2_5_p_1">Once the software is built, you'll need to install libxo using the "make install" command. If you are the root user, or the owner of the installation directory, simply issue the command:</p> +<div id="doc_figure_u.13"></div> <pre> + make install + </pre> <p id="doc_section_1_1_2_5_p_3">If you are not the "root" user and are using the "sudo" package, use:</p> +<div id="doc_figure_u.14"></div> <pre> + sudo make install + </pre> <p id="doc_section_1_1_2_5_p_5">Verify the installation by viewing the output of "xo --version":</p> +<div id="doc_figure_u.15"></div> <pre> + % xo --version + libxo version 0.3.5-git-develop + xo version 0.3.5-git-develop + </pre> </div> +</div> +</div> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_2" class="np"> +<div class="self-section-number"> +<a href="#doc_section_2">2_</a> </div> +<a id="formatting-with-libxo" href="#formatting-with-libxo">Formatting with libxo</a> +</h1> +<p id="doc_section_2_p_1">Most unix commands emit text output aimed at humans. It is designed to be parsed and understood by a user. Humans are gifted at extracting details and pattern matching in such output. Often programmers need to extract information from this human-oriented output. Programmers use tools like grep, awk, and regular expressions to ferret out the pieces of information they need. Such solutions are fragile and require maintenance when output contents change or evolve, along with testing and validation.</p> +<p id="doc_section_2_p_2">Modern tool developers favor encoding schemes like XML and JSON, which allow trivial parsing and extraction of data. Such formats are simple, well understood, hierarchical, easily parsed, and often integrate easier with common tools and environments. Changes to content can be done in ways that do not break existing users of the data, which can reduce maintenance costs and increase feature velocity.</p> +<p id="doc_section_2_p_3">In addition, modern reality means that more output ends up in web browsers than in terminals, making HTML output valuable.</p> +<p id="doc_section_2_p_4">libxo allows a single set of function calls in source code to generate traditional text output, as well as XML and JSON formatted data. HTML can also be generated; "<div>" elements surround the traditional text output, with attributes that detail how to render the data.</p> +<p id="doc_section_2_p_5">A single libxo function call in source code is all that's required:</p> +<div id="doc_figure_u.16"></div> <pre> + xo_emit("Connecting to {:host}.{:domain}...\n", host, domain); + + TEXT: + Connecting to my-box.example.com... + XML: + <host>my-box</host> + <domain>example.com</domain> + JSON: + "host": "my-box", + "domain": "example.com" + HTML: + <div class="line"> + <div class="text">Connecting to </div> + <div class="data" data-tag="host" + data-xpath="/top/host">my-box</div> + <div class="text">.</div> + <div class="data" data-tag="domain" + data-xpath="/top/domain">example.com</div> + <div class="text">...</div> + </div> + </pre> <p id="doc_section_2_p_7">Section Contents: </p> +<ul> +<li><a href="#encoding-styles" title="Encoding Styles">Section 2.1</a></li> +<li><a href="#format-strings" title="Format Strings">Section 2.2</a></li> +<li><a href="#command-line-arguments" title="Command-line Arguments">Section 2.3</a></li> +<li><a href="#representing-hierarchy" title="Representing Hierarchy">Section 2.4</a></li> +<li><a href="#handles" title="Handles">Section 2.5</a></li> +<li><a href="#utf-8" title="UTF-8">Section 2.6</a></li> +</ul> +<div class="content"> +<h2 id="doc_section_2_1"> +<div class="self-section-number"> +<a href="#doc_section_2_1">2.1</a> </div> +<a id="encoding-styles" href="#encoding-styles">Encoding Styles</a> +</h2> +<p id="doc_section_2_1_p_1">There are four encoding styles supported by libxo:</p> +<p id="doc_section_2_1_p_2"> </p> +<ul> +<li>TEXT output can be display on a terminal session, allowing compatibility with traditional command line usage.</li> +<li>XML output is suitable for tools like XPath and protocols like NETCONF.</li> +<li>JSON output can be used for RESTful APIs and integration with languages like Javascript and Python.</li> +<li>HTML can be matched with a small CSS file to permit rendering in any HTML5 browser.</li> +</ul> +<p id="doc_section_2_1_p_3">In general, XML and JSON are suitable for encoding data, while TEXT is suited for terminal output and HTML is suited for display in a web browser (see <a href="#xohtml" title="xohtml">Section 6</a>).</p> +<p id="doc_section_2_1_p_4">Section Contents: </p> +<ul> +<li><a href="#text-output" title="Text Output">Section 2.1.1</a></li> +<li><a href="#xml-output" title="XML Output">Section 2.1.2</a></li> +<li><a href="#json-output" title="JSON Output">Section 2.1.3</a></li> +<li><a href="#html-output" title="HTML Output">Section 2.1.4</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_2_1_1"> +<div class="self-section-number"> +<a href="#doc_section_2_1_1">2.1.1</a> </div> +<a id="text-output" href="#text-output">Text Output</a> +</h3> +<p id="doc_section_2_1_1_p_1">Most traditional programs generate text output on standard output, with contents like:</p> +<div id="doc_figure_u.17"></div> <pre> + 36 ./src + 40 ./bin + 90 . + </pre> <p id="doc_section_2_1_1_p_3">In this example (taken from du source code), the code to generate this data might look like:</p> +<div id="doc_figure_u.18"></div> <pre> + printf("%d\t%s\n", num_blocks, path); + </pre> <p id="doc_section_2_1_1_p_5">Simple, direct, obvious. But it's only making text output. Imagine using a single code path to make TEXT, XML, JSON or HTML, deciding at run time which to generate.</p> +<p id="doc_section_2_1_1_p_6">libxo expands on the idea of printf format strings to make a single format containing instructions for creating multiple output styles:</p> +<div id="doc_figure_u.19"></div> <pre> + xo_emit("{:blocks/%d}\t{:path/%s}\n", num_blocks, path); + </pre> <p id="doc_section_2_1_1_p_8">This line will generate the same text output as the earlier printf call, but also has enough information to generate XML, JSON, and HTML.</p> +<p id="doc_section_2_1_1_p_9">The following sections introduce the other formats.</p> +</div> +<div class="content"> +<h3 id="doc_section_2_1_2"> +<div class="self-section-number"> +<a href="#doc_section_2_1_2">2.1.2</a> </div> +<a id="xml-output" href="#xml-output">XML Output</a> +</h3> +<p id="doc_section_2_1_2_p_1">XML output consists of a hierarchical set of elements, each encoded with a start tag and an end tag. The element should be named for data value that it is encoding:</p> +<div id="doc_figure_u.20"></div> <pre> + <item> + <blocks>36</blocks> + <path>./src</path> + </item> + <item> + <blocks>40</blocks> + <path>./bin</path> + </item> + <item> + <blocks>90</blocks> + <path>.</path> + </item> + </pre> <p id="doc_section_2_1_2_p_3">XML is a W3C standard for encoding data. See w3c.org/TR/xml for additional information.</p> +</div> +<div class="content"> +<h3 id="doc_section_2_1_3"> +<div class="self-section-number"> +<a href="#doc_section_2_1_3">2.1.3</a> </div> +<a id="json-output" href="#json-output">JSON Output</a> +</h3> +<p id="doc_section_2_1_3_p_1">JSON output consists of a hierarchical set of objects and lists, each encoded with a quoted name, a colon, and a value. If the value is a string, it must be quoted, but numbers are not quoted. Objects are encoded using braces; lists are encoded using square brackets. Data inside objects and lists is separated using commas:</p> +<div id="doc_figure_u.21"></div> <pre> + items: [ + { "blocks": 36, "path" : "./src" }, + { "blocks": 40, "path" : "./bin" }, + { "blocks": 90, "path" : "./" } + ] + </pre> </div> +<div class="content"> +<h3 id="doc_section_2_1_4"> +<div class="self-section-number"> +<a href="#doc_section_2_1_4">2.1.4</a> </div> +<a id="html-output" href="#html-output">HTML Output</a> +</h3> +<p id="doc_section_2_1_4_p_1">HTML output is designed to allow the output to be rendered in a web browser with minimal effort. Each piece of output data is rendered inside a <div> element, with a class name related to the role of the data. By using a small set of class attribute values, a CSS stylesheet can render the HTML into rich text that mirrors the traditional text content.</p> +<p id="doc_section_2_1_4_p_2">Additional attributes can be enabled to provide more details about the data, including data type, description, and an XPath location.</p> +<div id="doc_figure_u.22"></div> <pre> + <div class="line"> + <div class="data" data-tag="blocks">36</div> + <div class="padding"> </div> + <div class="data" data-tag="path">./src</div> + </div> + <div class="line"> + <div class="data" data-tag="blocks">40</div> + <div class="padding"> </div> + <div class="data" data-tag="path">./bin</div> + </div> + <div class="line"> + <div class="data" data-tag="blocks">90</div> + <div class="padding"> </div> + <div class="data" data-tag="path">./</div> + </div> + </pre> </div> +</div> +<div class="content"> +<h2 id="doc_section_2_2"> +<div class="self-section-number"> +<a href="#doc_section_2_2">2.2</a> </div> +<a id="format-strings" href="#format-strings">Format Strings</a> +</h2> +<p id="doc_section_2_2_p_1">libxo uses format strings to control the rendering of data into the various output styles. Each format string contains a set of zero or more field descriptions, which describe independent data fields. Each field description contains a set of modifiers, a content string, and zero, one, or two format descriptors. The modifiers tell libxo what the field is and how to treat it, while the format descriptors are formatting instructions using printf-style format strings, telling libxo how to format the field. The field description is placed inside a set of braces, with a colon (":") after the modifiers and a slash ("/") before each format descriptors. Text may be intermixed with field descriptions within the format string.</p> +<p id="doc_section_2_2_p_2">The field description is given as follows:</p> +<div id="doc_figure_u.23"></div> <pre> + '{' [ role | modifier ]* [',' long-names ]* ':' [ content ] + [ '/' field-format [ '/' encoding-format ]] '}' + </pre> <p id="doc_section_2_2_p_4">The role describes the function of the field, while the modifiers enable optional behaviors. The contents, field-format, and encoding-format are used in varying ways, based on the role. These are described in the following sections.</p> +<p id="doc_section_2_2_p_5">In the following example, three field descriptors appear. The first is a padding field containing three spaces of padding, the second is a label ("In stock"), and the third is a value field ("in‑stock"). The in-stock field has a "%u" format that will parse the next argument passed to the xo_emit function as an unsigned integer.</p> +<div id="doc_figure_u.24"></div> <pre> + xo_emit("{P: }{Lwc:In stock}{:in-stock/%u}\n", 65); + </pre> <p id="doc_section_2_2_p_7">This single line of code can generate text (" In stock: 65\n"), XML ("<in‑stock>65</in‑stock>"), JSON ('"in‑stock": 6'), or HTML (too lengthy to be listed here).</p> +<p id="doc_section_2_2_p_8">While roles and modifiers typically use single character for brevity, there are alternative names for each which allow more verbose formatting strings. These names must be preceded by a comma, and may follow any single-character values:</p> +<div id="doc_figure_u.25"></div> <pre> + xo_emit("{L,white,colon:In stock}{,key:in-stock/%u}\n", 65); + </pre> <p id="doc_section_2_2_p_10">Section Contents: </p> +<ul> +<li><a href="#field-roles" title="Field Roles">Section 2.2.1</a></li> +<li><a href="#field-modifiers" title="Field Modifiers">Section 2.2.2</a></li> +<li><a href="#field-formatting" title="Field Formatting">Section 2.2.3</a></li> +<li><a href="#utf-8-and-locale-strings" title="UTF-8 and Locale Strings">Section 2.2.4</a></li> +<li><a href="#characters-outside-of-field-definitions" title="Characters Outside of Field Definitions">Section 2.2.5</a></li> +<li><a href="#m-is-supported" title='"%m" Is Supported'>Section 2.2.6</a></li> +<li><a href="#n-is-not-supported" title='"%n" Is Not Supported'>Section 2.2.7</a></li> +<li><a href="#the-encoding-format-eformat" title="The Encoding Format (eformat)">Section 2.2.8</a></li> +<li><a href="#content-strings" title="Content Strings">Section 2.2.9</a></li> +<li><a href="#printf-like" title="Argument Validation">Section 2.2.10</a></li> +<li><a href="#example" title="Example">Section 2.2.11</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_2_2_1"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1">2.2.1</a> </div> +<a id="field-roles" href="#field-roles">Field Roles</a> +</h3> +<p id="doc_section_2_2_1_p_1">Field roles are optional, and indicate the role and formatting of the content. The roles are listed below; only one role is permitted:</p> +<div id="doc_table_u.1"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">R</th> +<th class="left">Name</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>C</td> +<td>color</td> +<td>Field has color and effect controls</td> +</tr> +<tr> +<td>D</td> +<td>decoration</td> +<td>Field is non-text (e.g., colon, comma)</td> +</tr> +<tr> +<td>E</td> +<td>error</td> +<td>Field is an error message</td> +</tr> +<tr> +<td>G</td> +<td>gettext</td> +<td>Call gettext(3) on the format string</td> +</tr> +<tr> +<td>L</td> +<td>label</td> +<td>Field is text that prefixes a value</td> +</tr> +<tr> +<td>N</td> +<td>note</td> +<td>Field is text that follows a value</td> +</tr> +<tr> +<td>P</td> +<td>padding</td> +<td>Field is spaces needed for vertical alignment</td> +</tr> +<tr> +<td>T</td> +<td>title</td> +<td>Field is a title value for headings</td> +</tr> +<tr> +<td>U</td> +<td>units</td> +<td>Field is the units for the previous value field</td> +</tr> +<tr> +<td>V</td> +<td>value</td> +<td>Field is the name of field (the default)</td> +</tr> +<tr> +<td>W</td> +<td>warning</td> +<td>Field is a warning message</td> +</tr> +<tr> +<td>[</td> +<td>start-anchor</td> +<td>Begin a section of anchored variable-width text</td> +</tr> +<tr> +<td>]</td> +<td>stop-anchor</td> +<td>End a section of anchored variable-width text</td> +</tr> +</tbody> +</table></div> +<div id="doc_figure_u.26"></div> <pre> + EXAMPLE: + xo_emit("{L:Free}{D::}{P: }{:free/%u} {U:Blocks}\n", + free_blocks); + </pre> <p id="doc_section_2_2_1_p_3">When a role is not provided, the "value" role is used as the default.</p> +<p id="doc_section_2_2_1_p_4">Roles and modifiers can also use more verbose names, when preceeded by a comma:</p> +<div id="doc_figure_u.27"></div> <pre> + EXAMPLE: + xo_emit("{,label:Free}{,decoration::}{,padding: }" + "{,value:free/%u} {,units:Blocks}\n", + free_blocks); + </pre> <p id="doc_section_2_2_1_p_6">Section Contents: </p> +<ul> +<li><a href="#color-role" title="The Color Role ({C:})">Section 2.2.1.1</a></li> +<li><a href="#the-decoration-role-d" title="The Decoration Role ({D:})">Section 2.2.1.2</a></li> +<li><a href="#gettext-role" title="The Gettext Role ({G:})">Section 2.2.1.3</a></li> +<li><a href="#the-label-role-l" title="The Label Role ({L:})">Section 2.2.1.4</a></li> +<li><a href="#the-note-role-n" title="The Note Role ({N:})">Section 2.2.1.5</a></li> +<li><a href="#padding-role" title="The Padding Role ({P:})">Section 2.2.1.6</a></li> +<li><a href="#the-title-role-t" title="The Title Role ({T:})">Section 2.2.1.7</a></li> +<li><a href="#the-units-role-u" title="The Units Role ({U:})">Section 2.2.1.8</a></li> +<li><a href="#the-value-role-v-and-" title="The Value Role ({V:} and {:})">Section 2.2.1.9</a></li> +<li><a href="#anchor-role" title="The Anchor Roles ({[:} and {]:})">Section 2.2.1.10</a></li> +</ul> +<div class="content"> +<h4 id="doc_section_2_2_1_1"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_1">2.2.1.1</a> </div> +<a id="color-role" href="#color-role">The Color Role ({C:})</a> +</h4> +<p id="doc_section_2_2_1_1_p_1">Colors and effects control how text values are displayed; they are used for display styles (TEXT and HTML).</p> +<div id="doc_figure_u.28"></div> <pre> + xo_emit("{C:bold}{:value}{C:no-bold}\n", value); + </pre> <p id="doc_section_2_2_1_1_p_3">Colors and effects remain in effect until modified by other "C"-role fields.</p> +<div id="doc_figure_u.29"></div> <pre> + xo_emit("{C:bold}{C:inverse}both{C:no-bold}only inverse\n"); + </pre> <p id="doc_section_2_2_1_1_p_5">If the content is empty, the "reset" action is performed.</p> +<div id="doc_figure_u.30"></div> <pre> + xo_emit("{C:both,underline}{:value}{C:}\n", value); + </pre> <p id="doc_section_2_2_1_1_p_7">The content should be a comma-separated list of zero or more colors or display effects.</p> +<div id="doc_figure_u.31"></div> <pre> + xo_emit("{C:bold,inverse}Ugly{C:no-bold,no-inverse}\n"); + </pre> <p id="doc_section_2_2_1_1_p_9">The color content can be either static, when placed directly within the field descriptor, or a printf-style format descriptor can be used, if preceded by a slash ("/"):</p> +<div id="doc_figure_u.32"></div> <pre> + xo_emit("{C:/%s%s}{:value}{C:}", need_bold ? "bold" : "", + need_underline ? "underline" : "", value); + </pre> <p id="doc_section_2_2_1_1_p_11">Color names are prefixed with either "fg‑" or "bg‑" to change the foreground and background colors, respectively.</p> +<div id="doc_figure_u.33"></div> <pre> + xo_emit("{C:/fg-%s,bg-%s}{Lwc:Cost}{:cost/%u}{C:reset}\n", + fg_color, bg_color, cost); + </pre> <p id="doc_section_2_2_1_1_p_13">The following table lists the supported effects:</p> +<div id="doc_table_u.2"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Name</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>bg-XXXXX</td> +<td>Change background color</td> +</tr> +<tr> +<td>bold</td> +<td>Start bold text effect</td> +</tr> +<tr> +<td>fg-XXXXX</td> +<td>Change foreground color</td> +</tr> +<tr> +<td>inverse</td> +<td>Start inverse (aka reverse) text effect</td> +</tr> +<tr> +<td>no-bold</td> +<td>Stop bold text effect</td> +</tr> +<tr> +<td>no-inverse</td> +<td>Stop inverse (aka reverse) text effect</td> +</tr> +<tr> +<td>no-underline</td> +<td>Stop underline text effect</td> +</tr> +<tr> +<td>normal</td> +<td>Reset effects (only)</td> +</tr> +<tr> +<td>reset</td> +<td>Reset colors and effects (restore defaults)</td> +</tr> +<tr> +<td>underline</td> +<td>Start underline text effect</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_2_2_1_1_p_14">The following color names are supported:</p> +<div id="doc_table_u.3"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Name</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>black</td> +<td></td> +</tr> +<tr> +<td>blue</td> +<td></td> +</tr> +<tr> +<td>cyan</td> +<td></td> +</tr> +<tr> +<td>default</td> +<td>Default color for foreground or background</td> +</tr> +<tr> +<td>green</td> +<td></td> +</tr> +<tr> +<td>magenta</td> +<td></td> +</tr> +<tr> +<td>red</td> +<td></td> +</tr> +<tr> +<td>white</td> +<td></td> +</tr> +<tr> +<td>yellow</td> +<td></td> +</tr> +</tbody> +</table></div> +</div> +<div class="content"> +<h4 id="doc_section_2_2_1_2"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_2">2.2.1.2</a> </div> +<a id="the-decoration-role-d" href="#the-decoration-role-d">The Decoration Role ({D:})</a> +</h4> +<p id="doc_section_2_2_1_2_p_1">Decorations are typically punctuation marks such as colons, semi-colons, and commas used to decorate the text and make it simpler for human readers. By marking these distinctly, HTML usage scenarios can use CSS to direct their display parameters.</p> +<div id="doc_figure_u.34"></div> <pre> + xo_emit("{D:((}{:name}{D:))}\n", name); + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_1_3"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_3">2.2.1.3</a> </div> +<a id="gettext-role" href="#gettext-role">The Gettext Role ({G:})</a> +</h4> +<p id="doc_section_2_2_1_3_p_1">libxo supports internationalization (i18n) through its use of gettext(3). Use the "{G:}" role to request that the remaining part of the format string, following the "{G:}" field, be handled using gettext().</p> +<p id="doc_section_2_2_1_3_p_2">Since gettext() uses the string as the key into the message catalog, libxo uses a simplified version of the format string that removes unimportant field formatting and modifiers, stopping minor formatting changes from impacting the expensive translation process. A developer change such as changing "/%06d" to "/%08d" should not force hand inspection of all .po files.</p> +<p id="doc_section_2_2_1_3_p_3">The simplified version can be generated for a single message using the "xopo -s <text>" command, or an entire .pot can be translated using the "xopo -f <input> -o <output>" command.</p> +<div id="doc_figure_u.35"></div> <pre> + xo_emit("{G:}Invalid token\n"); + </pre> <p id="doc_section_2_2_1_3_p_5">The {G:} role allows a domain name to be set. gettext calls will continue to use that domain name until the current format string processing is complete, enabling a library function to emit strings using it's own catalog. The domain name can be either static as the content of the field, or a format can be used to get the domain name from the arguments.</p> +<div id="doc_figure_u.36"></div> <pre> + xo_emit("{G:libc}Service unavailable in restricted mode\n"); + </pre> <p id="doc_section_2_2_1_3_p_7">See <a href="#howto-i18n" title="Howto: Internationalization (i18n)">Section 9.5</a> for additional details.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_1_4"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_4">2.2.1.4</a> </div> +<a id="the-label-role-l" href="#the-label-role-l">The Label Role ({L:})</a> +</h4> +<p id="doc_section_2_2_1_4_p_1">Labels are text that appears before a value.</p> +<div id="doc_figure_u.37"></div> <pre> + xo_emit("{Lwc:Cost}{:cost/%u}\n", cost); + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_1_5"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_5">2.2.1.5</a> </div> +<a id="the-note-role-n" href="#the-note-role-n">The Note Role ({N:})</a> +</h4> +<p id="doc_section_2_2_1_5_p_1">Notes are text that appears after a value.</p> +<div id="doc_figure_u.38"></div> <pre> + xo_emit("{:cost/%u} {N:per year}\n", cost); + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_1_6"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_6">2.2.1.6</a> </div> +<a id="padding-role" href="#padding-role">The Padding Role ({P:})</a> +</h4> +<p id="doc_section_2_2_1_6_p_1">Padding represents whitespace used before and between fields.</p> +<p id="doc_section_2_2_1_6_p_2">The padding content can be either static, when placed directly within the field descriptor, or a printf-style format descriptor can be used, if preceded by a slash ("/"):</p> +<div id="doc_figure_u.39"></div> <pre> + xo_emit("{P: }{Lwc:Cost}{:cost/%u}\n", cost); + xo_emit("{P:/%30s}{Lwc:Cost}{:cost/%u}\n", "", cost); + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_1_7"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_7">2.2.1.7</a> </div> +<a id="the-title-role-t" href="#the-title-role-t">The Title Role ({T:})</a> +</h4> +<p id="doc_section_2_2_1_7_p_1">Title are heading or column headers that are meant to be displayed to the user. The title can be either static, when placed directly within the field descriptor, or a printf-style format descriptor can be used, if preceded by a slash ("/"):</p> +<div id="doc_figure_u.40"></div> <pre> + xo_emit("{T:Interface Statistics}\n"); + xo_emit("{T:/%20.20s}{T:/%6.6s}\n", "Item Name", "Cost"); + </pre> <p id="doc_section_2_2_1_7_p_3">Title fields have an extra convenience feature; if both content and format are specified, instead of looking to the argument list for a value, the content is used, allowing a mixture of format and content within the field descriptor:</p> +<div id="doc_figure_u.41"></div> <pre> + xo_emit("{T:Name/%20s}{T:Count/%6s}\n"); + </pre> <p id="doc_section_2_2_1_7_p_5">Since the incoming argument is a string, the format must be "%s" or something suitable.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_1_8"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_8">2.2.1.8</a> </div> +<a id="the-units-role-u" href="#the-units-role-u">The Units Role ({U:})</a> +</h4> +<p id="doc_section_2_2_1_8_p_1">Units are the dimension by which values are measured, such as degrees, miles, bytes, and decibels. The units field carries this information for the previous value field.</p> +<div id="doc_figure_u.42"></div> <pre> + xo_emit("{Lwc:Distance}{:distance/%u}{Uw:miles}\n", miles); + </pre> <p id="doc_section_2_2_1_8_p_3">Note that the sense of the 'w' modifier is reversed for units; a blank is added before the contents, rather than after it.</p> +<p id="doc_section_2_2_1_8_p_4">When the XOF_UNITS flag is set, units are rendered in XML as the "units" attribute:</p> +<div id="doc_figure_u.43"></div> <pre> + <distance units="miles">50</distance> + </pre> <p id="doc_section_2_2_1_8_p_6">Units can also be rendered in HTML as the "data‑units" attribute:</p> +<div id="doc_figure_u.44"></div> <pre> + <div class="data" data-tag="distance" data-units="miles" + data-xpath="/top/data/distance">50</div> + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_1_9"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_9">2.2.1.9</a> </div> +<a id="the-value-role-v-and-" href="#the-value-role-v-and-">The Value Role ({V:} and {:})</a> +</h4> +<p id="doc_section_2_2_1_9_p_1">The value role is used to represent the a data value that is interesting for the non-display output styles (XML and JSON). Value is the default role; if no other role designation is given, the field is a value. The field name must appear within the field descriptor, followed by one or two format descriptors. The first format descriptor is used for display styles (TEXT and HTML), while the second one is used for encoding styles (XML and JSON). If no second format is given, the encoding format defaults to the first format, with any minimum width removed. If no first format is given, both format descriptors default to "%s".</p> +<div id="doc_figure_u.45"></div> <pre> + xo_emit("{:length/%02u}x{:width/%02u}x{:height/%02u}\n", + length, width, height); + xo_emit("{:author} wrote \"{:poem}\" in {:year/%4d}\n, + author, poem, year); + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_1_10"> +<div class="self-section-number"> +<a href="#doc_section_2_2_1_10">2.2.1.10</a> </div> +<a id="anchor-role" href="#anchor-role">The Anchor Roles ({[:} and {]:})</a> +</h4> +<p id="doc_section_2_2_1_10_p_1">The anchor roles allow a set of strings by be padded as a group, but still be visible to xo_emit as distinct fields. Either the start or stop anchor can give a field width and it can be either directly in the descriptor or passed as an argument. Any fields between the start and stop anchor are padded to meet the minimum width given.</p> +<p id="doc_section_2_2_1_10_p_2">To give a width directly, encode it as the content of the anchor tag:</p> +<div id="doc_figure_u.46"></div> <pre> + xo_emit("({[:10}{:min/%d}/{:max/%d}{]:})\n", min, max); + </pre> <p id="doc_section_2_2_1_10_p_4">To pass a width as an argument, use "%d" as the format, which must appear after the "/". Note that only "%d" is supported for widths. Using any other value could ruin your day.</p> +<div id="doc_figure_u.47"></div> <pre> + xo_emit("({[:/%d}{:min/%d}/{:max/%d}{]:})\n", width, min, max); + </pre> <p id="doc_section_2_2_1_10_p_6">If the width is negative, padding will be added on the right, suitable for left justification. Otherwise the padding will be added to the left of the fields between the start and stop anchors, suitable for right justification. If the width is zero, nothing happens. If the number of columns of output between the start and stop anchors is less than the absolute value of the given width, nothing happens.</p> +<p id="doc_section_2_2_1_10_p_7">Widths over 8k are considered probable errors and not supported. If XOF_WARN is set, a warning will be generated.</p> +</div> +</div> +<div class="content"> +<h3 id="doc_section_2_2_2"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2">2.2.2</a> </div> +<a id="field-modifiers" href="#field-modifiers">Field Modifiers</a> +</h3> +<p id="doc_section_2_2_2_p_1">Field modifiers are flags which modify the way content emitted for particular output styles:</p> +<div id="doc_table_u.4"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">M</th> +<th class="left">Name</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>c</td> +<td>colon</td> +<td>A colon (":") is appended after the label</td> +</tr> +<tr> +<td>d</td> +<td>display</td> +<td>Only emit field for display styles (text/HTML)</td> +</tr> +<tr> +<td>e</td> +<td>encoding</td> +<td>Only emit for encoding styles (XML/JSON)</td> +</tr> +<tr> +<td>g</td> +<td>gettext</td> +<td>Call gettext on field's render content</td> +</tr> +<tr> +<td>h</td> +<td>humanize (hn)</td> +<td>Format large numbers in human-readable style</td> +</tr> +<tr> +<td></td> +<td>hn-space</td> +<td>Humanize: Place space between numeric and unit</td> +</tr> +<tr> +<td></td> +<td>hn-decimal</td> +<td>Humanize: Add a decimal digit, if number < 10</td> +</tr> +<tr> +<td></td> +<td>hn-1000</td> +<td>Humanize: Use 1000 as divisor instead of 1024</td> +</tr> +<tr> +<td>k</td> +<td>key</td> +<td>Field is a key, suitable for XPath predicates</td> +</tr> +<tr> +<td>l</td> +<td>leaf-list</td> +<td>Field is a leaf-list</td> +</tr> +<tr> +<td>n</td> +<td>no-quotes</td> +<td>Do not quote the field when using JSON style</td> +</tr> +<tr> +<td>p</td> +<td>plural</td> +<td>Gettext: Use comma-separated plural form</td> +</tr> +<tr> +<td>q</td> +<td>quotes</td> +<td>Quote the field when using JSON style</td> +</tr> +<tr> +<td>t</td> +<td>trim</td> +<td>Trim leading and trailing whitespace</td> +</tr> +<tr> +<td>w</td> +<td>white</td> +<td>A blank (" ") is appended after the label</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_2_2_2_p_2">Roles and modifiers can also use more verbose names, when preceeded by a comma. For example, the modifier string "Lwc" (or "L,white,colon") means the field has a label role (text that describes the next field) and should be followed by a colon ('c') and a space ('w'). The modifier string "Vkq" (or ":key,quote") means the field has a value role (the default role), that it is a key for the current instance, and that the value should be quoted when encoded for JSON.</p> +<p id="doc_section_2_2_2_p_3">Section Contents: </p> +<ul> +<li><a href="#the-colon-modifier-c" title="The Colon Modifier ({c:})">Section 2.2.2.1</a></li> +<li><a href="#the-display-modifier-d" title="The Display Modifier ({d:})">Section 2.2.2.2</a></li> +<li><a href="#e-modifier" title="The Encoding Modifier ({e:})">Section 2.2.2.3</a></li> +<li><a href="#gettext-modifier" title="The Gettext Modifier ({g:})">Section 2.2.2.4</a></li> +<li><a href="#the-humanize-modifier-h" title="The Humanize Modifier ({h:})">Section 2.2.2.5</a></li> +<li><a href="#the-key-modifier-k" title="The Key Modifier ({k:})">Section 2.2.2.6</a></li> +<li><a href="#the-leaf-list-modifier-l" title="The Leaf-List Modifier ({l:})">Section 2.2.2.7</a></li> +<li><a href="#the-no-quotes-modifier-n" title="The No-Quotes Modifier ({n:})">Section 2.2.2.8</a></li> +<li><a href="#plural-modifier" title="The Plural Modifier ({p:})">Section 2.2.2.9</a></li> +<li><a href="#the-quotes-modifier-q" title="The Quotes Modifier ({q:})">Section 2.2.2.10</a></li> +<li><a href="#the-white-space-modifier-w" title="The White Space Modifier ({w:})">Section 2.2.2.11</a></li> +</ul> +<div class="content"> +<h4 id="doc_section_2_2_2_1"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_1">2.2.2.1</a> </div> +<a id="the-colon-modifier-c" href="#the-colon-modifier-c">The Colon Modifier ({c:})</a> +</h4> +<p id="doc_section_2_2_2_1_p_1">The colon modifier appends a single colon to the data value:</p> +<div id="doc_figure_u.48"></div> <pre> + EXAMPLE: + xo_emit("{Lc:Name}{:name}\n", "phil"); + TEXT: + Name:phil + </pre> <p id="doc_section_2_2_2_1_p_3">The colon modifier is only used for the TEXT and HTML output styles. It is commonly combined with the space modifier ('{w:}'). It is purely a convenience feature.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_2"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_2">2.2.2.2</a> </div> +<a id="the-display-modifier-d" href="#the-display-modifier-d">The Display Modifier ({d:})</a> +</h4> +<p id="doc_section_2_2_2_2_p_1">The display modifier indicated the field should only be generated for the display output styles, TEXT and HTML.</p> +<div id="doc_figure_u.49"></div> <pre> + EXAMPLE: + xo_emit("{Lcw:Name}{d:name} {:id/%d}\n", "phil", 1); + TEXT: + Name: phil 1 + XML: + <id>1</id> + </pre> <p id="doc_section_2_2_2_2_p_3">The display modifier is the opposite of the encoding modifier, and they are often used to give to distinct views of the underlying data.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_3"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_3">2.2.2.3</a> </div> +<a id="e-modifier" href="#e-modifier">The Encoding Modifier ({e:})</a> +</h4> +<p id="doc_section_2_2_2_3_p_1">The display modifier indicated the field should only be generated for the display output styles, TEXT and HTML.</p> +<div id="doc_figure_u.50"></div> <pre> + EXAMPLE: + xo_emit("{Lcw:Name}{:name} {e:id/%d}\n", "phil", 1); + TEXT: + Name: phil + XML: + <name>phil</name><id>1</id> + </pre> <p id="doc_section_2_2_2_3_p_3">The encoding modifier is the opposite of the display modifier, and they are often used to give to distinct views of the underlying data.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_4"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_4">2.2.2.4</a> </div> +<a id="gettext-modifier" href="#gettext-modifier">The Gettext Modifier ({g:})</a> +</h4> +<p id="doc_section_2_2_2_4_p_1">The gettext modifier is used to translate individual fields using the gettext domain (typically set using the "{G:}" role) and current language settings. Once libxo renders the field value, it is passed to gettext(3), where it is used as a key to find the native language translation.</p> +<p id="doc_section_2_2_2_4_p_2">In the following example, the strings "State" and "full" are passed to gettext() to find locale-based translated strings.</p> +<div id="doc_figure_u.51"></div> <pre> + xo_emit("{Lgwc:State}{g:state}\n", "full"); + </pre> <p id="doc_section_2_2_2_4_p_4">See <a href="#gettext-role" title="The Gettext Role ({G:})">Section 2.2.1.3</a>, <a href="#plural-modifier" title="The Plural Modifier ({p:})">Section 2.2.2.9</a>, and <a href="#howto-i18n" title="Howto: Internationalization (i18n)">Section 9.5</a> for additional details.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_5"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_5">2.2.2.5</a> </div> +<a id="the-humanize-modifier-h" href="#the-humanize-modifier-h">The Humanize Modifier ({h:})</a> +</h4> +<p id="doc_section_2_2_2_5_p_1">The humanize modifier is used to render large numbers as in a human-readable format. While numbers like "44470272" are completely readable to computers and savants, humans will generally find "44M" more meaningful.</p> +<p id="doc_section_2_2_2_5_p_2">"hn" can be used as an alias for "humanize".</p> +<p id="doc_section_2_2_2_5_p_3">The humanize modifier only affects display styles (TEXT and HMTL). The "no‑humanize" option (See <a href="#LIBXO_OPTIONS" title="LIBXO_OPTIONS">Section 3.4.6</a>) will block the function of the humanize modifier.</p> +<p id="doc_section_2_2_2_5_p_4">There are a number of modifiers that affect details of humanization. These are only available in as full names, not single characters. The "hn‑space" modifier places a space between the number and any multiplier symbol, such as "M" or "K" (ex: "44 K"). The "hn‑decimal" modifier will add a decimal point and a single tenths digit when the number is less than 10 (ex: "4.4K"). The "hn‑1000" modifier will use 1000 as divisor instead of 1024, following the JEDEC-standard instead of the more natural binary powers-of-two tradition.</p> +<div id="doc_figure_u.52"></div> <pre> + EXAMPLE: + xo_emit("{h:input/%u}, {h,hn-space:output/%u}, " + "{h,hn-decimal:errors/%u}, {h,hn-1000:capacity/%u}, " + "{h,hn-decimal:remaining/%u}\n", + input, output, errors, capacity, remaining); + TEXT: + 21, 57 K, 96M, 44M, 1.2G + </pre> <p id="doc_section_2_2_2_5_p_6">In the HTML style, the original numeric value is rendered in the "data‑number" attribute on the <div> element:</p> +<div id="doc_figure_u.53"></div> <pre> + <div class="data" data-tag="errors" + data-number="100663296">96M</div> + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_2_6"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_6">2.2.2.6</a> </div> +<a id="the-key-modifier-k" href="#the-key-modifier-k">The Key Modifier ({k:})</a> +</h4> +<p id="doc_section_2_2_2_6_p_1">The key modifier is used to indicate that a particular field helps uniquely identify an instance of list data.</p> +<div id="doc_figure_u.54"></div> <pre> + EXAMPLE: + xo_open_list("user"); + for (i = 0; i < num_users; i++) { + xo_open_instance("user"); + xo_emit("User {k:name} has {:count} tickets\n", + user[i].u_name, user[i].u_tickets); + xo_close_instance("user"); + } + xo_close_list("user"); + </pre> <p id="doc_section_2_2_2_6_p_3">Currently the key modifier is only used when generating XPath value for the HTML output style when XOF_XPATH is set, but other uses are likely in the near future.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_7"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_7">2.2.2.7</a> </div> +<a id="the-leaf-list-modifier-l" href="#the-leaf-list-modifier-l">The Leaf-List Modifier ({l:})</a> +</h4> +<p id="doc_section_2_2_2_7_p_1">The leaf-list modifier is used to distinguish lists where each instance consists of only a single value. In XML, these are rendered as single elements, where JSON renders them as arrays.</p> +<div id="doc_figure_u.55"></div> <pre> + EXAMPLE: + for (i = 0; i < num_users; i++) { + xo_emit("Member {l:user}\n", user[i].u_name); + } + XML: + <user>phil</user> + <user>pallavi</user> + JSON: + "user": [ "phil", "pallavi" ] + </pre> <p id="doc_section_2_2_2_7_p_3">The name of the field must match the name of the leaf list.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_8"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_8">2.2.2.8</a> </div> +<a id="the-no-quotes-modifier-n" href="#the-no-quotes-modifier-n">The No-Quotes Modifier ({n:})</a> +</h4> +<p id="doc_section_2_2_2_8_p_1">The no-quotes modifier (and its twin, the 'quotes' modifier) affect the quoting of values in the JSON output style. JSON uses quotes for string value, but no quotes for numeric, boolean, and null data. xo_emit applies a simple heuristic to determine whether quotes are needed, but often this needs to be controlled by the caller.</p> +<div id="doc_figure_u.56"></div> <pre> + EXAMPLE: + const char *bool = is_true ? "true" : "false"; + xo_emit("{n:fancy/%s}", bool); + JSON: + "fancy": true + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_2_9"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_9">2.2.2.9</a> </div> +<a id="plural-modifier" href="#plural-modifier">The Plural Modifier ({p:})</a> +</h4> +<p id="doc_section_2_2_2_9_p_1">The plural modifier selects the appropriate plural form of an expression based on the most recent number emitted and the current language settings. The contents of the field should be the singular and plural English values, separated by a comma:</p> +<div id="doc_figure_u.57"></div> <pre> + xo_emit("{:bytes} {Ngp:byte,bytes}\n", bytes); + </pre> <p id="doc_section_2_2_2_9_p_3">The plural modifier is meant to work with the gettext modifier ({g:}) but can work independently. See <a href="#gettext-modifier" title="The Gettext Modifier ({g:})">Section 2.2.2.4</a>.</p> +<p id="doc_section_2_2_2_9_p_4">When used without the gettext modifier or when the message does not appear in the message catalog, the first token is chosen when the last numeric value is equal to 1; otherwise the second value is used, mimicking the simple pluralization rules of English.</p> +<p id="doc_section_2_2_2_9_p_5">When used with the gettext modifier, the ngettext(3) function is called to handle the heavy lifting, using the message catalog to convert the singular and plural forms into the native language.</p> +</div> +<div class="content"> +<h4 id="doc_section_2_2_2_10"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_10">2.2.2.10</a> </div> +<a id="the-quotes-modifier-q" href="#the-quotes-modifier-q">The Quotes Modifier ({q:})</a> +</h4> +<p id="doc_section_2_2_2_10_p_1">The quotes modifier (and its twin, the 'no‑quotes' modifier) affect the quoting of values in the JSON output style. JSON uses quotes for string value, but no quotes for numeric, boolean, and null data. xo_emit applies a simple heuristic to determine whether quotes are needed, but often this needs to be controlled by the caller.</p> +<div id="doc_figure_u.58"></div> <pre> + EXAMPLE: + xo_emit("{q:time/%d}", 2014); + JSON: + "year": "2014" + </pre> </div> +<div class="content"> +<h4 id="doc_section_2_2_2_11"> +<div class="self-section-number"> +<a href="#doc_section_2_2_2_11">2.2.2.11</a> </div> +<a id="the-white-space-modifier-w" href="#the-white-space-modifier-w">The White Space Modifier ({w:})</a> +</h4> +<p id="doc_section_2_2_2_11_p_1">The white space modifier appends a single space to the data value:</p> +<div id="doc_figure_u.59"></div> <pre> + EXAMPLE: + xo_emit("{Lw:Name}{:name}\n", "phil"); + TEXT: + Name phil + </pre> <p id="doc_section_2_2_2_11_p_3">The white space modifier is only used for the TEXT and HTML output styles. It is commonly combined with the colon modifier ('{c:}'). It is purely a convenience feature.</p> +<p id="doc_section_2_2_2_11_p_4">Note that the sense of the 'w' modifier is reversed for the units role ({Uw:}); a blank is added before the contents, rather than after it.</p> +</div> +</div> +<div class="content"> +<h3 id="doc_section_2_2_3"> +<div class="self-section-number"> +<a href="#doc_section_2_2_3">2.2.3</a> </div> +<a id="field-formatting" href="#field-formatting">Field Formatting</a> +</h3> +<p id="doc_section_2_2_3_p_1">The field format is similar to the format string for printf(3). Its use varies based on the role of the field, but generally is used to format the field's contents.</p> +<p id="doc_section_2_2_3_p_2">If the format string is not provided for a value field, it defaults to "%s".</p> +<p id="doc_section_2_2_3_p_3">Note a field definition can contain zero or more printf-style 'directives', which are sequences that start with a '%' and end with one of following characters: "diouxXDOUeEfFgGaAcCsSp". Each directive is matched by one of more arguments to the xo_emit function.</p> +<p id="doc_section_2_2_3_p_4">The format string has the form:</p> +<div id="doc_figure_u.60"></div> <pre> + '%' format-modifier * format-character + </pre> <p id="doc_section_2_2_3_p_6">The format- modifier can be:</p> +<p id="doc_section_2_2_3_p_7"> </p> +<ul> +<li>a '#' character, indicating the output value should be prefixed with '0x', typically to indicate a base 16 (hex) value.</li> +<li>a minus sign ('‑'), indicating the output value should be padded on the right instead of the left.</li> +<li>a leading zero ('0') indicating the output value should be padded on the left with zeroes instead of spaces (' ').</li> +<li>one or more digits ('0' - '9') indicating the minimum width of the argument. If the width in columns of the output value is less that the minumum width, the value will be padded to reach the minimum.</li> +<li>a period followed by one or more digits indicating the maximum number of bytes which will be examined for a string argument, or the maximum width for a non-string argument. When handling ASCII strings this functions as the field width but for multi-byte characters, a single character may be composed of multiple bytes. xo_emit will never dereference memory beyond the given number of bytes.</li> +<li>a second period followed by one or more digits indicating the maximum width for a string argument. This modifier cannot be given for non-string arguments.</li> +<li>one or more 'h' characters, indicating shorter input data.</li> +<li>one or more 'l' characters, indicating longer input data.</li> +<li>a 'z' character, indicating a 'size_t' argument.</li> +<li>a 't' character, indicating a 'ptrdiff_t' argument.</li> +<li>a ' ' character, indicating a space should be emitted before positive numbers.</li> +<li>a '+' character, indicating sign should emitted before any number.</li> +</ul> +<p id="doc_section_2_2_3_p_8">Note that 'q', 'D', 'O', and 'U' are considered deprecated and will be removed eventually.</p> +<p id="doc_section_2_2_3_p_9">The format character is described in the following table:</p> +<div id="doc_table_u.5"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Ltr</th> +<th class="left">Argument Type</th> +<th class="left">Format</th> +</tr></thead> +<tbody> +<tr> +<td>d</td> +<td>int</td> +<td>base 10 (decimal)</td> +</tr> +<tr> +<td>i</td> +<td>int</td> +<td>base 10 (decimal)</td> +</tr> +<tr> +<td>o</td> +<td>int</td> +<td>base 8 (octal)</td> +</tr> +<tr> +<td>u</td> +<td>unsigned</td> +<td>base 10 (decimal)</td> +</tr> +<tr> +<td>x</td> +<td>unsigned</td> +<td>base 16 (hex)</td> +</tr> +<tr> +<td>X</td> +<td>unsigned long</td> +<td>base 16 (hex)</td> +</tr> +<tr> +<td>D</td> +<td>long</td> +<td>base 10 (decimal)</td> +</tr> +<tr> +<td>O</td> +<td>unsigned long</td> +<td>base 8 (octal)</td> +</tr> +<tr> +<td>U</td> +<td>unsigned long</td> +<td>base 10 (decimal)</td> +</tr> +<tr> +<td>e</td> +<td>double</td> +<td>[-]d.ddde+-dd</td> +</tr> +<tr> +<td>E</td> +<td>double</td> +<td>[-]d.dddE+-dd</td> +</tr> +<tr> +<td>f</td> +<td>double</td> +<td>[-]ddd.ddd</td> +</tr> +<tr> +<td>F</td> +<td>double</td> +<td>[-]ddd.ddd</td> +</tr> +<tr> +<td>g</td> +<td>double</td> +<td>as 'e' or 'f'</td> +</tr> +<tr> +<td>G</td> +<td>double</td> +<td>as 'E' or 'F'</td> +</tr> +<tr> +<td>a</td> +<td>double</td> +<td>[-]0xh.hhhp[+-]d</td> +</tr> +<tr> +<td>A</td> +<td>double</td> +<td>[-]0Xh.hhhp[+-]d</td> +</tr> +<tr> +<td>c</td> +<td>unsigned char</td> +<td>a character</td> +</tr> +<tr> +<td>C</td> +<td>wint_t</td> +<td>a character</td> +</tr> +<tr> +<td>s</td> +<td>char *</td> +<td>a UTF-8 string</td> +</tr> +<tr> +<td>S</td> +<td>wchar_t *</td> +<td>a unicode/WCS string</td> +</tr> +<tr> +<td>p</td> +<td>void *</td> +<td>'%#lx'</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_2_2_3_p_10">The 'h' and 'l' modifiers affect the size and treatment of the argument:</p> +<div id="doc_table_u.6"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Mod</th> +<th class="left">d, i</th> +<th class="left">o, u, x, X</th> +</tr></thead> +<tbody> +<tr> +<td>hh</td> +<td>signed char</td> +<td>unsigned char</td> +</tr> +<tr> +<td>h</td> +<td>short</td> +<td>unsigned short</td> +</tr> +<tr> +<td>l</td> +<td>long</td> +<td>unsigned long</td> +</tr> +<tr> +<td>ll</td> +<td>long long</td> +<td>unsigned long long</td> +</tr> +<tr> +<td>j</td> +<td>intmax_t</td> +<td>uintmax_t</td> +</tr> +<tr> +<td>t</td> +<td>ptrdiff_t</td> +<td>ptrdiff_t</td> +</tr> +<tr> +<td>z</td> +<td>size_t</td> +<td>size_t</td> +</tr> +<tr> +<td>q</td> +<td>quad_t</td> +<td>u_quad_t</td> +</tr> +</tbody> +</table></div> +</div> +<div class="content"> +<h3 id="doc_section_2_2_4"> +<div class="self-section-number"> +<a href="#doc_section_2_2_4">2.2.4</a> </div> +<a id="utf-8-and-locale-strings" href="#utf-8-and-locale-strings">UTF-8 and Locale Strings</a> +</h3> +<p id="doc_section_2_2_4_p_1">For strings, the 'h' and 'l' modifiers affect the interpretation of the bytes pointed to argument. The default '%s' string is a 'char *' pointer to a string encoded as UTF-8. Since UTF-8 is compatible with ASCII data, a normal 7-bit ASCII string can be used. '%ls' expects a 'wchar_t *' pointer to a wide-character string, encoded as a 32-bit Unicode values. '%hs' expects a 'char *' pointer to a multi-byte string encoded with the current locale, as given by the LC_CTYPE, LANG, or LC_ALL environment varibles. The first of this list of variables is used and if none of the variables are set, the locale defaults to "UTF‑8".</p> +<p id="doc_section_2_2_4_p_2">For example, a function is passed a locale-base name, a hat size, and a time value. The hat size is formatted in a UTF-8 (ASCII) string, and the time value is formatted into a wchar_t string.</p> +<div id="doc_figure_u.61"></div> <pre> + void print_order (const char *name, int size, + struct tm *timep) { + char buf[32]; + const char *size_val = "unknown"; + + if (size > 0) + snprintf(buf, sizeof(buf), "%d", size); + size_val = buf; + } + + wchar_t when[32]; + wcsftime(when, sizeof(when), L"%d%b%y", timep); + + xo_emit("The hat for {:name/%hs} is {:size/%s}.\n", + name, size_val); + xo_emit("It was ordered on {:order-time/%ls}.\n", + when); + } + </pre> <p id="doc_section_2_2_4_p_4">It is important to note that xo_emit will perform the conversion required to make appropriate output. Text style output uses the current locale (as described above), while XML, JSON, and HTML use UTF-8.</p> +<p id="doc_section_2_2_4_p_5">UTF-8 and locale-encoded strings can use multiple bytes to encode one column of data. The traditional "precision'" (aka "max‑width") value for "%s" printf formatting becomes overloaded since it specifies both the number of bytes that can be safely referenced and the maximum number of columns to emit. xo_emit uses the precision as the former, and adds a third value for specifying the maximum number of columns.</p> +<p id="doc_section_2_2_4_p_6">In this example, the name field is printed with a minimum of 3 columns and a maximum of 6. Up to ten bytes of data at the location given by 'name' are in used in filling those columns.</p> +<div id="doc_figure_u.62"></div> <pre> + xo_emit("{:name/%3.10.6s}", name); + </pre> </div> +<div class="content"> +<h3 id="doc_section_2_2_5"> +<div class="self-section-number"> +<a href="#doc_section_2_2_5">2.2.5</a> </div> +<a id="characters-outside-of-field-definitions" href="#characters-outside-of-field-definitions">Characters Outside of Field Definitions</a> +</h3> +<p id="doc_section_2_2_5_p_1">Characters in the format string that are not part of a field definition are copied to the output for the TEXT style, and are ignored for the JSON and XML styles. For HTML, these characters are placed in a <div> with class "text".</p> +<div id="doc_figure_u.63"></div> <pre> + EXAMPLE: + xo_emit("The hat is {:size/%s}.\n", size_val); + TEXT: + The hat is extra small. + XML: + <size>extra small</size> + JSON: + "size": "extra small" + HTML: + <div class="text">The hat is </div> + <div class="data" data-tag="size">extra small</div> + <div class="text">.</div> + </pre> </div> +<div class="content"> +<h3 id="doc_section_2_2_6"> +<div class="self-section-number"> +<a href="#doc_section_2_2_6">2.2.6</a> </div> +<a id="m-is-supported" href="#m-is-supported">"%m" Is Supported</a> +</h3> +<p id="doc_section_2_2_6_p_1">libxo supports the '%m' directive, which formats the error message associated with the current value of "errno". It is the equivalent of "%s" with the argument strerror(errno).</p> +<div id="doc_figure_u.64"></div> <pre> + xo_emit("{:filename} cannot be opened: {:error/%m}", filename); + xo_emit("{:filename} cannot be opened: {:error/%s}", + filename, strerror(errno)); + </pre> </div> +<div class="content"> +<h3 id="doc_section_2_2_7"> +<div class="self-section-number"> +<a href="#doc_section_2_2_7">2.2.7</a> </div> +<a id="n-is-not-supported" href="#n-is-not-supported">"%n" Is Not Supported</a> +</h3> +<p id="doc_section_2_2_7_p_1">libxo does not support the '%n' directive. It's a bad idea and we just don't do it.</p> +</div> +<div class="content"> +<h3 id="doc_section_2_2_8"> +<div class="self-section-number"> +<a href="#doc_section_2_2_8">2.2.8</a> </div> +<a id="the-encoding-format-eformat" href="#the-encoding-format-eformat">The Encoding Format (eformat)</a> +</h3> +<p id="doc_section_2_2_8_p_1">The "eformat" string is the format string used when encoding the field for JSON and XML. If not provided, it defaults to the primary format with any minimum width removed. If the primary is not given, both default to "%s".</p> +</div> +<div class="content"> +<h3 id="doc_section_2_2_9"> +<div class="self-section-number"> +<a href="#doc_section_2_2_9">2.2.9</a> </div> +<a id="content-strings" href="#content-strings">Content Strings</a> +</h3> +<p id="doc_section_2_2_9_p_1">For padding and labels, the content string is considered the content, unless a format is given.</p> +</div> +<div class="content"> +<h3 id="doc_section_2_2_10"> +<div class="self-section-number"> +<a href="#doc_section_2_2_10">2.2.10</a> </div> +<a id="printf-like" href="#printf-like">Argument Validation</a> +</h3> +<p id="doc_section_2_2_10_p_1">Many compilers and tool chains support validation of printf-like arguments. When the format string fails to match the argument list, a warning is generated. This is a valuable feature and while the formatting strings for libxo differ considerably from printf, many of these checks can still provide build-time protection against bugs.</p> +<p id="doc_section_2_2_10_p_2">libxo provide variants of functions that provide this ability, if the "‑‑enable‑printflike" option is passed to the "configure" script. These functions use the "_p" suffix, like "xo_emit_p()", xo_emit_hp()", etc.</p> +<p id="doc_section_2_2_10_p_3">The following are features of libxo formatting strings that are incompatible with printf-like testing:</p> +<p id="doc_section_2_2_10_p_4"> </p> +<ul> +<li>implicit formats, where "{:tag}" has an implicit "%s";</li> +<li>the "max" parameter for strings, where "{:tag/%4.10.6s}" means up to ten bytes of data can be inspected to fill a minimum of 4 columns and a maximum of 6;</li> +<li>percent signs in strings, where "{:filled}%" makes a single, trailing percent sign;</li> +<li>the "l" and "h" modifiers for strings, where "{:tag/%hs}" means locale-based string and "{:tag/%ls}" means a wide character string;</li> +<li>distinct encoding formats, where "{:tag/#%s/%s}" means the display styles (text and HTML) will use "#%s" where other styles use "%s";</li> +</ul> +<p id="doc_section_2_2_10_p_5">If none of these features are in use by your code, then using the "_p" variants might be wise.</p> +<div id="doc_table_u.7"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Function</th> +<th class="left">printf-like Equivalent</th> +</tr></thead> +<tbody> +<tr> +<td>xo_emit_hv</td> +<td>xo_emit_hvp</td> +</tr> +<tr> +<td>xo_emit_h</td> +<td>xo_emit_hp</td> +</tr> +<tr> +<td>xo_emit</td> +<td>xo_emit_p</td> +</tr> +<tr> +<td>xo_emit_warn_hcv</td> +<td>xo_emit_warn_hcvp</td> +</tr> +<tr> +<td>xo_emit_warn_hc</td> +<td>xo_emit_warn_hcp</td> +</tr> +<tr> +<td>xo_emit_warn_c</td> +<td>xo_emit_warn_cp</td> +</tr> +<tr> +<td>xo_emit_warn</td> +<td>xo_emit_warn_p</td> +</tr> +<tr> +<td>xo_emit_warnx_</td> +<td>xo_emit_warnx_p</td> +</tr> +<tr> +<td>xo_emit_err</td> +<td>xo_emit_err_p</td> +</tr> +<tr> +<td>xo_emit_errx</td> +<td>xo_emit_errx_p</td> +</tr> +<tr> +<td>xo_emit_errc</td> +<td>xo_emit_errc_p</td> +</tr> +</tbody> +</table></div> +</div> +<div class="content"> +<h3 id="doc_section_2_2_11"> +<div class="self-section-number"> +<a href="#doc_section_2_2_11">2.2.11</a> </div> +<a id="example" href="#example">Example</a> +</h3> +<p id="doc_section_2_2_11_p_1">In this example, the value for the number of items in stock is emitted:</p> +<div id="doc_figure_u.65"></div> <pre> + xo_emit("{P: }{Lwc:In stock}{:in-stock/%u}\n", + instock); + </pre> <p id="doc_section_2_2_11_p_3">This call will generate the following output:</p> +<div id="doc_figure_u.66"></div> <pre> + TEXT: + In stock: 144 + XML: + <in-stock>144</in-stock> + JSON: + "in-stock": 144, + HTML: + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">144</div> + </div> + </pre> <p id="doc_section_2_2_11_p_5">Clearly HTML wins the verbosity award, and this output does not include XOF_XPATH or XOF_INFO data, which would expand the penultimate line to:</p> +<div id="doc_figure_u.67"></div> <pre> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" + data-type="number" + data-help="Number of items in stock">144</div> + </pre> </div> +</div> +<div class="content"> +<h2 id="doc_section_2_3"> +<div class="self-section-number"> +<a href="#doc_section_2_3">2.3</a> </div> +<a id="command-line-arguments" href="#command-line-arguments">Command-line Arguments</a> +</h2> +<p id="doc_section_2_3_p_1">libxo uses command line options to trigger rendering behavior. The following options are recognised:</p> +<p id="doc_section_2_3_p_2"> </p> +<ul> +<li>--libxo <options></li> +<li>--libxo=<options></li> +<li>--libxo:<brief‑options></li> +</ul> +<p id="doc_section_2_3_p_3">Options is a comma-separated list of tokens that correspond to output styles, flags, or features:</p> +<div id="doc_table_u.8"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Token</th> +<th class="left">Action</th> +</tr></thead> +<tbody> +<tr> +<td>color</td> +<td>Enable colors/effects for display styles (TEXT, HTML)</td> +</tr> +<tr> +<td>dtrt</td> +<td>Enable "Do The Right Thing" mode</td> +</tr> +<tr> +<td>html</td> +<td>Emit HTML output</td> +</tr> +<tr> +<td>indent=xx</td> +<td>Set the indentation level</td> +</tr> +<tr> +<td>info</td> +<td>Add info attributes (HTML)</td> +</tr> +<tr> +<td>json</td> +<td>Emit JSON output</td> +</tr> +<tr> +<td>keys</td> +<td>Emit the key attribute for keys (XML)</td> +</tr> +<tr> +<td>log-gettext</td> +<td>Log (via stderr) each gettext(3) string lookup</td> +</tr> +<tr> +<td>log-syslog</td> +<td>Log (via stderr) each syslog message (via xo_syslog)</td> +</tr> +<tr> +<td>no-humanize</td> +<td>Ignore the {h:} modifier (TEXT, HTML)</td> +</tr> +<tr> +<td>no-locale</td> +<td>Do not initialize the locale setting</td> +</tr> +<tr> +<td>no-top</td> +<td>Do not emit a top set of braces (JSON)</td> +</tr> +<tr> +<td>not-first</td> +<td>Pretend the 1st output item was not 1st (JSON)</td> +</tr> +<tr> +<td>pretty</td> +<td>Emit pretty-printed output</td> +</tr> +<tr> +<td>text</td> +<td>Emit TEXT output</td> +</tr> +<tr> +<td>underscores</td> +<td>Replace XML-friendly "-"s with JSON friendly "_"s e</td> +</tr> +<tr> +<td>units</td> +<td>Add the 'units' (XML) or 'data-units (HTML) attribute</td> +</tr> +<tr> +<td>warn</td> +<td>Emit warnings when libxo detects bad calls</td> +</tr> +<tr> +<td>warn-xml</td> +<td>Emit warnings in XML</td> +</tr> +<tr> +<td>xml</td> +<td>Emit XML output</td> +</tr> +<tr> +<td>xpath</td> +<td>Add XPath expressions (HTML)</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_2_3_p_4">The brief options are detailed in <a href="#LIBXO_OPTIONS" title="LIBXO_OPTIONS">Section 3.4.6</a>.</p> +</div> +<div class="content"> +<h2 id="doc_section_2_4"> +<div class="self-section-number"> +<a href="#doc_section_2_4">2.4</a> </div> +<a id="representing-hierarchy" href="#representing-hierarchy">Representing Hierarchy</a> +</h2> +<p id="doc_section_2_4_p_1">For XML and JSON, individual fields appear inside hierarchies which provide context and meaning to the fields. Unfortunately, these encoding have a basic disconnect between how lists is similar objects are represented.</p> +<p id="doc_section_2_4_p_2">XML encodes lists as set of sequential elements:</p> +<div id="doc_figure_u.68"></div> <pre> + <user>phil</user> + <user>pallavi</user> + <user>sjg</user> + </pre> <p id="doc_section_2_4_p_4">JSON encodes lists using a single name and square brackets:</p> +<div id="doc_figure_u.69"></div> <pre> + "user": [ "phil", "pallavi", "sjg" ] + </pre> <p id="doc_section_2_4_p_6">This means libxo needs three distinct indications of hierarchy: one for containers of hierarchy appear only once for any specific parent, one for lists, and one for each item in a list.</p> +<p id="doc_section_2_4_p_7">Section Contents: </p> +<ul> +<li><a href="#containers" title="Containers">Section 2.4.1</a></li> +<li><a href="#lists-and-instances" title="Lists and Instances">Section 2.4.2</a></li> +<li><a href="#dtrt-mode" title="DTRT Mode">Section 2.4.3</a></li> +<li><a href="#markers" title="Markers">Section 2.4.4</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_2_4_1"> +<div class="self-section-number"> +<a href="#doc_section_2_4_1">2.4.1</a> </div> +<a id="containers" href="#containers">Containers</a> +</h3> +<p id="doc_section_2_4_1_p_1">A "container" is an element of a hierarchy that appears only once under any specific parent. The container has no value, but serves to contain other nodes.</p> +<p id="doc_section_2_4_1_p_2">To open a container, call xo_open_container() or xo_open_container_h(). The former uses the default handle and the latter accepts a specific handle.</p> +<div id="doc_figure_u.70"></div> <pre> + int xo_open_container_h (xo_handle_t *xop, const char *name); + int xo_open_container (const char *name); + </pre> <p id="doc_section_2_4_1_p_4">To close a level, use the xo_close_container() or xo_close_container_h() functions:</p> +<div id="doc_figure_u.71"></div> <pre> + int xo_close_container_h (xo_handle_t *xop, const char *name); + int xo_close_container (const char *name); + </pre> <p id="doc_section_2_4_1_p_6">Each open call must have a matching close call. If the XOF_WARN flag is set and the name given does not match the name of the currently open container, a warning will be generated.</p> +<div id="doc_figure_u.72"></div> <pre> + Example: + + xo_open_container("top"); + xo_open_container("system"); + xo_emit("{:host-name/%s%s%s", hostname, + domainname ? "." : "", domainname ?: ""); + xo_close_container("system"); + xo_close_container("top"); + + Sample Output: + Text: + my-host.example.org + XML: + <top> + <system> + <host-name>my-host.example.org</host-name> + </system> + </top> + JSON: + "top" : { + "system" : { + "host-name": "my-host.example.org" + } + } + HTML: + <div class="data" + data-tag="host-name">my-host.example.org</div> + </pre> </div> +<div class="content"> +<h3 id="doc_section_2_4_2"> +<div class="self-section-number"> +<a href="#doc_section_2_4_2">2.4.2</a> </div> +<a id="lists-and-instances" href="#lists-and-instances">Lists and Instances</a> +</h3> +<p id="doc_section_2_4_2_p_1">A list is set of one or more instances that appear under the same parent. The instances contain details about a specific object. One can think of instances as objects or records. A call is needed to open and close the list, while a distinct call is needed to open and close each instance of the list:</p> +<div id="doc_figure_u.73"></div> <pre> + xo_open_list("item"); + + for (ip = list; ip->i_title; ip++) { + xo_open_instance("item"); + xo_emit("{L:Item} '{:name/%s}':\n", ip->i_title); + xo_close_instance("item"); + } + + xo_close_list("item"); + </pre> <p id="doc_section_2_4_2_p_3">Getting the list and instance calls correct is critical to the proper generation of XML and JSON data.</p> +</div> +<div class="content"> +<h3 id="doc_section_2_4_3"> +<div class="self-section-number"> +<a href="#doc_section_2_4_3">2.4.3</a> </div> +<a id="dtrt-mode" href="#dtrt-mode">DTRT Mode</a> +</h3> +<p id="doc_section_2_4_3_p_1">Some users may find tracking the names of open containers, lists, and instances inconvenient. libxo offers a "Do The Right Thing" mode, where libxo will track the names of open containers, lists, and instances so the close function can be called without a name. To enable DTRT mode, turn on the XOF_DTRT flag prior to making any other libxo output.</p> +<div id="doc_figure_u.74"></div> <pre> + xo_set_flags(NULL, XOF_DTRT); + </pre> <p id="doc_section_2_4_3_p_3">Each open and close function has a version with the suffix "_d", which will close the open container, list, or instance:</p> +<div id="doc_figure_u.75"></div> <pre> + xo_open_container("top"); + ... + xo_close_container_d(); + </pre> <p id="doc_section_2_4_3_p_5">This also works for lists and instances:</p> +<div id="doc_figure_u.76"></div> <pre> + xo_open_list("item"); + for (...) { + xo_open_instance("item"); + xo_emit(...); + xo_close_instance_d(); + } + xo_close_list_d(); + </pre> <p id="doc_section_2_4_3_p_7">Note that the XOF_WARN flag will also cause libxo to track open containers, lists, and instances. A warning is generated when the name given to the close function and the name recorded do not match.</p> +</div> +<div class="content"> +<h3 id="doc_section_2_4_4"> +<div class="self-section-number"> +<a href="#doc_section_2_4_4">2.4.4</a> </div> +<a id="markers" href="#markers">Markers</a> +</h3> +<p id="doc_section_2_4_4_p_1">Markers are used to protect and restore the state of open constructs. While a marker is open, no other open constructs can be closed. When a marker is closed, all constructs open since the marker was opened will be closed.</p> +<p id="doc_section_2_4_4_p_2">Markers use names which are not user-visible, allowing the caller to choose appropriate internal names.</p> +<p id="doc_section_2_4_4_p_3">In this example, the code whiffles through a list of fish, calling a function to emit details about each fish. The marker "fish‑guts" is used to ensure that any constructs opened by the function are closed properly.</p> +<div id="doc_figure_u.77"></div> <pre> + for (i = 0; fish[i]; i++) { + xo_open_instance("fish"); + xo_open_marker("fish-guts"); + dump_fish_details(i); + xo_close_marker("fish-guts"); + } + </pre> </div> +</div> +<div class="content"> +<h2 id="doc_section_2_5"> +<div class="self-section-number"> +<a href="#doc_section_2_5">2.5</a> </div> +<a id="handles" href="#handles">Handles</a> +</h2> +<p id="doc_section_2_5_p_1">libxo uses "handles" to control its rendering functionality. The handle contains state and buffered data, as well as callback functions to process data.</p> +<p id="doc_section_2_5_p_2">A default handle is used when a NULL is passed to functions accepting a handle. This handle is initialized to write its data to stdout using the default style of text (XO_STYLE_TEXT).</p> +<p id="doc_section_2_5_p_3">For the convenience of callers, the libxo library includes handle-less functions that implicitly use the default handle. Any function that takes a handle will use the default handle is a value of NULL is passed in place of a valid handle.</p> +<p id="doc_section_2_5_p_4">For example, the following are equivalent:</p> +<div id="doc_figure_u.78"></div> <pre> + xo_emit("test"); + xo_emit_h(NULL, "test"); + </pre> <p id="doc_section_2_5_p_6">Handles are created using xo_create() and destroy using xo_destroy().</p> +</div> +<div class="content"> +<h2 id="doc_section_2_6"> +<div class="self-section-number"> +<a href="#doc_section_2_6">2.6</a> </div> +<a id="utf-8" href="#utf-8">UTF-8</a> +</h2> +<p id="doc_section_2_6_p_1">All strings for libxo must be UTF-8. libxo will handle turning them into locale-based strings for display to the user.</p> +<p id="doc_section_2_6_p_2">The only exception is argument formatted using the "%ls" format, which require a wide character string (wchar_t *) as input. libxo will convert these arguments as needed to either UTF-8 (for XML, JSON, and HTML styles) or locale-based strings for display in text style.</p> +<div id="doc_figure_u.79"></div> <pre> + xo_emit("Alll strings are utf-8 content {:tag/%ls}", + L"except for wide strings"); + </pre> <p id="doc_section_2_6_p_4">"%S" is equivalent to "%ls".</p> +</div> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_3" class="np"> +<div class="self-section-number"> +<a href="#doc_section_3">3_</a> </div> +<a id="the-libxo-api" href="#the-libxo-api">The libxo API</a> +</h1> +<p id="doc_section_3_p_1">This section gives details about the functions in libxo, how to call them, and the actions they perform.</p> +<p id="doc_section_3_p_2">Section Contents: </p> +<ul> +<li><a href="#handles-2" title="Handles">Section 3.1</a></li> +<li><a href="#emitting-content-xo_emit" title="Emitting Content (xo_emit)">Section 3.2</a></li> +<li><a href="#emitting-hierarchy" title="Emitting Hierarchy">Section 3.3</a></li> +<li><a href="#support-functions" title="Support Functions">Section 3.4</a></li> +<li><a href="#emitting-syslog-messages" title="Emitting syslog Messages">Section 3.5</a></li> +<li><a href="#creating-custom-encoders" title="Creating Custom Encoders">Section 3.6</a></li> +</ul> +<div class="content"> +<h2 id="doc_section_3_1"> +<div class="self-section-number"> +<a href="#doc_section_3_1">3.1</a> </div> +<a id="handles-2" href="#handles-2">Handles</a> +</h2> +<p id="doc_section_3_1_p_1">Handles give an abstraction for libxo that encapsulates the state of a stream of output. Handles have the data type "xo_handle_t" and are opaque to the caller.</p> +<p id="doc_section_3_1_p_2">The library has a default handle that is automatically initialized. By default, this handle will send text style output to standard output. The xo_set_style and xo_set_flags functions can be used to change this behavior.</p> +<p id="doc_section_3_1_p_3">Many libxo functions take a handle as their first parameter; most that do not use the default handle. Any function taking a handle can be passed NULL to access the default handle.</p> +<p id="doc_section_3_1_p_4">For the typical command that is generating output on standard output, there is no need to create an explicit handle, but they are available when needed, e.g., for daemons that generate multiple streams of output.</p> +<p id="doc_section_3_1_p_5">Section Contents: </p> +<ul> +<li><a href="#xo_create" title="xo_create">Section 3.1.1</a></li> +<li><a href="#xo_create_to_file" title="xo_create_to_file">Section 3.1.2</a></li> +<li><a href="#xo_set_writer" title="xo_set_writer">Section 3.1.3</a></li> +<li><a href="#xo_set_style" title="xo_set_style">Section 3.1.4</a></li> +<li><a href="#xo_set_flags" title="xo_set_flags">Section 3.1.5</a></li> +<li><a href="#xo_destroy" title="xo_destroy">Section 3.1.6</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_3_1_1"> +<div class="self-section-number"> +<a href="#doc_section_3_1_1">3.1.1</a> </div> +<a id="xo_create" href="#xo_create">xo_create</a> +</h3> +<p id="doc_section_3_1_1_p_1">A handle can be allocated using the xo_create() function:</p> +<div id="doc_figure_u.80"></div> <pre> + xo_handle_t *xo_create (unsigned style, unsigned flags); + + Example: + xo_handle_t *xop = xo_create(XO_STYLE_JSON, XOF_WARN); + .... + xo_emit_h(xop, "testing\n"); + </pre> <p id="doc_section_3_1_1_p_3">See also <a href="#styles" title="Output Styles (XO_STYLE_*)">Section 3.1.4.1</a> and <a href="#flags" title="Flags (XOF_*)">Section 3.1.5.1</a>.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_1_2"> +<div class="self-section-number"> +<a href="#doc_section_3_1_2">3.1.2</a> </div> +<a id="xo_create_to_file" href="#xo_create_to_file">xo_create_to_file</a> +</h3> +<p id="doc_section_3_1_2_p_1">By default, libxo writes output to standard output. A convenience function is provided for situations when output should be written to a different file:</p> +<div id="doc_figure_u.81"></div> <pre> + xo_handle_t *xo_create_to_file (FILE *fp, unsigned style, + unsigned flags); + </pre> <p id="doc_section_3_1_2_p_3">Use the XOF_CLOSE_FP flag to trigger a call to fclose() for the FILE pointer when the handle is destroyed.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_1_3"> +<div class="self-section-number"> +<a href="#doc_section_3_1_3">3.1.3</a> </div> +<a id="xo_set_writer" href="#xo_set_writer">xo_set_writer</a> +</h3> +<p id="doc_section_3_1_3_p_1">The xo_set_writer function allows custom 'write' functions which can tailor how libxo writes data. An opaque argument is recorded and passed back to the write function, allowing the function to acquire context information. The 'close' function can release this opaque data and any other resources as needed. The flush function can flush buffered data associated with the opaque object.</p> +<div id="doc_figure_u.82"></div> <pre> + void xo_set_writer (xo_handle_t *xop, void *opaque, + xo_write_func_t write_func, + xo_close_func_t close_func); + xo_flush_func_t flush_func); + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_1_4"> +<div class="self-section-number"> +<a href="#doc_section_3_1_4">3.1.4</a> </div> +<a id="xo_set_style" href="#xo_set_style">xo_set_style</a> +</h3> +<p id="doc_section_3_1_4_p_1">To set the style, use the xo_set_style() function:</p> +<div id="doc_figure_u.83"></div> <pre> + void xo_set_style(xo_handle_t *xop, unsigned style); + </pre> <p id="doc_section_3_1_4_p_3">To use the default handle, pass a NULL handle:</p> +<div id="doc_figure_u.84"></div> <pre> + xo_set_style(NULL, XO_STYLE_XML); + </pre> <p id="doc_section_3_1_4_p_5">Section Contents: </p> +<ul> +<li><a href="#styles" title="Output Styles (XO_STYLE_*)">Section 3.1.4.1</a></li> +<li><a href="#xo_set_style_name" title="xo_set_style_name">Section 3.1.4.2</a></li> +</ul> +<div class="content"> +<h4 id="doc_section_3_1_4_1"> +<div class="self-section-number"> +<a href="#doc_section_3_1_4_1">3.1.4.1</a> </div> +<a id="styles" href="#styles">Output Styles (XO_STYLE_*)</a> +</h4> +<p id="doc_section_3_1_4_1_p_1">The libxo functions accept a set of output styles:</p> +<div id="doc_table_u.9"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Flag</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>XO_STYLE_TEXT</td> +<td>Traditional text output</td> +</tr> +<tr> +<td>XO_STYLE_XML</td> +<td>XML encoded data</td> +</tr> +<tr> +<td>XO_STYLE_JSON</td> +<td>JSON encoded data</td> +</tr> +<tr> +<td>XO_STYLE_HTML</td> +<td>HTML encoded data</td> +</tr> +</tbody> +</table></div> +</div> +<div class="content"> +<h4 id="doc_section_3_1_4_2"> +<div class="self-section-number"> +<a href="#doc_section_3_1_4_2">3.1.4.2</a> </div> +<a id="xo_set_style_name" href="#xo_set_style_name">xo_set_style_name</a> +</h4> +<p id="doc_section_3_1_4_2_p_1">The xo_set_style_name() can be used to set the style based on a name encoded as a string:</p> +<div id="doc_figure_u.85"></div> <pre> + int xo_set_style_name (xo_handle_t *xop, const char *style); + </pre> <p id="doc_section_3_1_4_2_p_3">The name can be any of the styles: "text", "xml", "json", or "html".</p> +<div id="doc_figure_u.86"></div> <pre> + EXAMPLE: + xo_set_style_name(NULL, "html"); + </pre> </div> +</div> +<div class="content"> +<h3 id="doc_section_3_1_5"> +<div class="self-section-number"> +<a href="#doc_section_3_1_5">3.1.5</a> </div> +<a id="xo_set_flags" href="#xo_set_flags">xo_set_flags</a> +</h3> +<p id="doc_section_3_1_5_p_1">To set the flags, use the xo_set_flags() function:</p> +<div id="doc_figure_u.87"></div> <pre> + void xo_set_flags(xo_handle_t *xop, unsigned flags); + </pre> <p id="doc_section_3_1_5_p_3">To use the default handle, pass a NULL handle:</p> +<div id="doc_figure_u.88"></div> <pre> + xo_set_style(NULL, XO_STYLE_XML); + </pre> <p id="doc_section_3_1_5_p_5">Section Contents: </p> +<ul> +<li><a href="#flags" title="Flags (XOF_*)">Section 3.1.5.1</a></li> +<li><a href="#xo_clear_flags" title="xo_clear_flags">Section 3.1.5.2</a></li> +<li><a href="#xo_set_options" title="xo_set_options">Section 3.1.5.3</a></li> +</ul> +<div class="content"> +<h4 id="doc_section_3_1_5_1"> +<div class="self-section-number"> +<a href="#doc_section_3_1_5_1">3.1.5.1</a> </div> +<a id="flags" href="#flags">Flags (XOF_*)</a> +</h4> +<p id="doc_section_3_1_5_1_p_1">The set of valid flags include:</p> +<div id="doc_table_u.10"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Flag</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>XOF_CLOSE_FP</td> +<td>Close file pointer on xo_destroy()</td> +</tr> +<tr> +<td>XOF_COLOR</td> +<td>Enable color and effects in output</td> +</tr> +<tr> +<td>XOF_COLOR_ALLOWED</td> +<td>Allow color/effect for terminal output</td> +</tr> +<tr> +<td>XOF_DTRT</td> +<td>Enable "do the right thing" mode</td> +</tr> +<tr> +<td>XOF_INFO</td> +<td>Display info data attributes (HTML)</td> +</tr> +<tr> +<td>XOF_KEYS</td> +<td>Emit the key attribute (XML)</td> +</tr> +<tr> +<td>XOF_NO_ENV</td> +<td>Do not use the LIBXO_OPTIONS env var</td> +</tr> +<tr> +<td>XOF_NO_HUMANIZE</td> +<td>Display humanization (TEXT, HTML)</td> +</tr> +<tr> +<td>XOF_PRETTY</td> +<td>Make 'pretty printed' output</td> +</tr> +<tr> +<td>XOF_UNDERSCORES</td> +<td>Replaces hyphens with underscores</td> +</tr> +<tr> +<td>XOF_UNITS</td> +<td>Display units (XML, HMTL)</td> +</tr> +<tr> +<td>XOF_WARN</td> +<td>Generate warnings for broken calls</td> +</tr> +<tr> +<td>XOF_WARN_XML</td> +<td>Generate warnings in XML on stdout</td> +</tr> +<tr> +<td>XOF_XPATH</td> +<td>Emit XPath expressions (HTML)</td> +</tr> +<tr> +<td>XOF_COLUMNS</td> +<td>Force xo_emit to return columns used</td> +</tr> +<tr> +<td>XOF_FLUSH</td> +<td>Flush output after each xo_emit call</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_3_1_5_1_p_2">The XOF_CLOSE_FP flag will trigger the call of the close_func (provided via xo_set_writer()) when the handle is destroyed.</p> +<p id="doc_section_3_1_5_1_p_3">The XOF_COLOR flag enables color and effects in output regardless of output device, while the XOF_COLOR_ALLOWED flag allows color and effects only if the output device is a terminal.</p> +<p id="doc_section_3_1_5_1_p_4">The XOF_PRETTY flag requests 'pretty printing', which will trigger the addition of indentation and newlines to enhance the readability of XML, JSON, and HTML output. Text output is not affected.</p> +<p id="doc_section_3_1_5_1_p_5">The XOF_WARN flag requests that warnings will trigger diagnostic output (on standard error) when the library notices errors during operations, or with arguments to functions. Without warnings enabled, such conditions are ignored.</p> +<p id="doc_section_3_1_5_1_p_6">Warnings allow developers to debug their interaction with libxo. The function "xo_failure" can used as a breakpoint for a debugger, regardless of whether warnings are enabled.</p> +<p id="doc_section_3_1_5_1_p_7">If the style is XO_STYLE_HTML, the following additional flags can be used:</p> +<div id="doc_table_u.11"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Flag</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>XOF_XPATH</td> +<td>Emit "data-xpath" attributes</td> +</tr> +<tr> +<td>XOF_INFO</td> +<td>Emit additional info fields</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_3_1_5_1_p_8">The XOF_XPATH flag enables the emission of XPath expressions detailing the hierarchy of XML elements used to encode the data field, if the XPATH style of output were requested.</p> +<p id="doc_section_3_1_5_1_p_9">The XOF_INFO flag encodes additional informational fields for HTML output. See <a href="#info" title="Field Information (xo_info_t)">Section 3.4.4</a> for details.</p> +<p id="doc_section_3_1_5_1_p_10">If the style is XO_STYLE_XML, the following additional flags can be used:</p> +<div id="doc_table_u.12"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Flag</th> +<th class="left">Description</th> +</tr></thead> +<tbody><tr> +<td>XOF_KEYS</td> +<td>Flag 'key' fields for xml</td> +</tr></tbody> +</table></div> +<p id="doc_section_3_1_5_1_p_11">The XOF_KEYS flag adds 'key' attribute to the XML encoding for field definitions that use the 'k' modifier. The key attribute has the value "key":</p> +<div id="doc_figure_u.89"></div> <pre> + xo_emit("{k:name}", item); + + XML: + <name key="key">truck</name> + </pre> </div> +<div class="content"> +<h4 id="doc_section_3_1_5_2"> +<div class="self-section-number"> +<a href="#doc_section_3_1_5_2">3.1.5.2</a> </div> +<a id="xo_clear_flags" href="#xo_clear_flags">xo_clear_flags</a> +</h4> +<p id="doc_section_3_1_5_2_p_1">The xo_clear_flags() function turns off the given flags in a specific handle.</p> +<div id="doc_figure_u.90"></div> <pre> + void xo_clear_flags (xo_handle_t *xop, xo_xof_flags_t flags); + </pre> </div> +<div class="content"> +<h4 id="doc_section_3_1_5_3"> +<div class="self-section-number"> +<a href="#doc_section_3_1_5_3">3.1.5.3</a> </div> +<a id="xo_set_options" href="#xo_set_options">xo_set_options</a> +</h4> +<p id="doc_section_3_1_5_3_p_1">The xo_set_options() function accepts a comma-separated list of styles and flags and enables them for a specific handle.</p> +<div id="doc_figure_u.91"></div> <pre> + int xo_set_options (xo_handle_t *xop, const char *input); + </pre> <p id="doc_section_3_1_5_3_p_3">The options are identical to those listed in <a href="#command-line-arguments" title="Command-line Arguments">Section 2.3</a>.</p> +</div> +</div> +<div class="content"> +<h3 id="doc_section_3_1_6"> +<div class="self-section-number"> +<a href="#doc_section_3_1_6">3.1.6</a> </div> +<a id="xo_destroy" href="#xo_destroy">xo_destroy</a> +</h3> +<p id="doc_section_3_1_6_p_1">The xo_destroy function releases a handle and any resources it is using. Calling xo_destroy with a NULL handle will release any resources associated with the default handle.</p> +<div id="doc_figure_u.92"></div> <pre> + void xo_destroy(xo_handle_t *xop); + </pre> </div> +</div> +<div class="content"> +<h2 id="doc_section_3_2"> +<div class="self-section-number"> +<a href="#doc_section_3_2">3.2</a> </div> +<a id="emitting-content-xo_emit" href="#emitting-content-xo_emit">Emitting Content (xo_emit)</a> +</h2> +<p id="doc_section_3_2_p_1">The following functions are used to emit output:</p> +<div id="doc_figure_u.93"></div> <pre> + int xo_emit (const char *fmt, ...); + int xo_emit_h (xo_handle_t *xop, const char *fmt, ...); + int xo_emit_hv (xo_handle_t *xop, const char *fmt, va_list vap); + </pre> <p id="doc_section_3_2_p_3">The "fmt" argument is a string containing field descriptors as specified in <a href="#format-strings" title="Format Strings">Section 2.2</a>. The use of a handle is optional and NULL can be passed to access the internal 'default' handle. See <a href="#handles" title="Handles">Section 2.5</a>.</p> +<p id="doc_section_3_2_p_4">The remaining arguments to xo_emit() and xo_emit_h() are a set of arguments corresponding to the fields in the format string. Care must be taken to ensure the argument types match the fields in the format string, since an inappropriate cast can ruin your day. The vap argument to xo_emit_hv() points to a variable argument list that can be used to retrieve arguments via va_arg().</p> +<p id="doc_section_3_2_p_5">Section Contents: </p> +<ul> +<li><a href="#xo_attr" title="Attributes (xo_attr)">Section 3.2.1</a></li> +<li><a href="#flushing-output-xo_flush" title="Flushing Output (xo_flush)">Section 3.2.2</a></li> +<li><a href="#finishing-output-xo_finish" title="Finishing Output (xo_finish)">Section 3.2.3</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_3_2_1"> +<div class="self-section-number"> +<a href="#doc_section_3_2_1">3.2.1</a> </div> +<a id="xo_attr" href="#xo_attr">Attributes (xo_attr)</a> +</h3> +<p id="doc_section_3_2_1_p_1">The xo_attr() function emits attributes for the XML output style.</p> +<div id="doc_figure_u.94"></div> <pre> + int xo_attr (const char *name, const char *fmt, ...); + int xo_attr_h (xo_handle_t *xop, const char *name, + const char *fmt, ...); + int xo_attr_hv (xo_handle_t *xop, const char *name, + const char *fmt, va_list vap); + </pre> <p id="doc_section_3_2_1_p_3">The name parameter give the name of the attribute to be encoded. The fmt parameter gives a printf-style format string used to format the value of the attribute using any remaining arguments, or the vap parameter passed to xo_attr_hv().</p> +<div id="doc_figure_u.95"></div> <pre> + EXAMPLE: + xo_attr("seconds", "%ld", (unsigned long) login_time); + struct tm *tmp = localtime(login_time); + strftime(buf, sizeof(buf), "%R", tmp); + xo_emit("Logged in at {:login-time}\n", buf); + XML: + <login-time seconds="1408336270">00:14</login-time> + </pre> <p id="doc_section_3_2_1_p_5">xo_attr is placed on the next container, instance, leaf, or leaf list that is emitted.</p> +<p id="doc_section_3_2_1_p_6">Since attributes are only emitted in XML, their use should be limited to meta-data and additional or redundant representations of data already emitted in other form.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_2_2"> +<div class="self-section-number"> +<a href="#doc_section_3_2_2">3.2.2</a> </div> +<a id="flushing-output-xo_flush" href="#flushing-output-xo_flush">Flushing Output (xo_flush)</a> +</h3> +<p id="doc_section_3_2_2_p_1">libxo buffers data, both for performance and consistency, but also to allow some advanced features to work properly. At various times, the caller may wish to flush any data buffered within the library. The xo_flush() call is used for this:</p> +<div id="doc_figure_u.96"></div> <pre> + void xo_flush (void); + void xo_flush_h (xo_handle_t *xop); + </pre> <p id="doc_section_3_2_2_p_3">Calling xo_flush also triggers the flush function associated with the handle. For the default handle, this is equivalent to "fflush(stdio);".</p> +</div> +<div class="content"> +<h3 id="doc_section_3_2_3"> +<div class="self-section-number"> +<a href="#doc_section_3_2_3">3.2.3</a> </div> +<a id="finishing-output-xo_finish" href="#finishing-output-xo_finish">Finishing Output (xo_finish)</a> +</h3> +<p id="doc_section_3_2_3_p_1">When the program is ready to exit or close a handle, a call to xo_finish() is required. This flushes any buffered data, closes open libxo constructs, and completes any pending operations.</p> +<div id="doc_figure_u.97"></div> <pre> + int xo_finish (void); + int xo_finish_h (xo_handle_t *xop); + void xo_finish_atexit (void); + </pre> <p id="doc_section_3_2_3_p_3">Calling this function is vital to the proper operation of libxo, especially for the non-TEXT output styles.</p> +<p id="doc_section_3_2_3_p_4">xo_finish_atexit is suitable for use with atexit(3).</p> +</div> +</div> +<div class="content"> +<h2 id="doc_section_3_3"> +<div class="self-section-number"> +<a href="#doc_section_3_3">3.3</a> </div> +<a id="emitting-hierarchy" href="#emitting-hierarchy">Emitting Hierarchy</a> +</h2> +<p id="doc_section_3_3_p_1">libxo represents to types of hierarchy: containers and lists. A container appears once under a given parent where a list contains instances that can appear multiple times. A container is used to hold related fields and to give the data organization and scope.</p> +<p id="doc_section_3_3_p_2">To create a container, use the xo_open_container and xo_close_container functions:</p> +<div id="doc_figure_u.98"></div> <pre> + int xo_open_container (const char *name); + int xo_open_container_h (xo_handle_t *xop, const char *name); + int xo_open_container_hd (xo_handle_t *xop, const char *name); + int xo_open_container_d (const char *name); + + int xo_close_container (const char *name); + int xo_close_container_h (xo_handle_t *xop, const char *name); + int xo_close_container_hd (xo_handle_t *xop); + int xo_close_container_d (void); + </pre> <p id="doc_section_3_3_p_4">The name parameter gives the name of the container, encoded in UTF-8. Since ASCII is a proper subset of UTF-8, traditional C strings can be used directly.</p> +<p id="doc_section_3_3_p_5">The close functions with the "_d" suffix are used in "Do The Right Thing" mode, where the name of the open containers, lists, and instances are maintained internally by libxo to allow the caller to avoid keeping track of the open container name.</p> +<p id="doc_section_3_3_p_6">Use the XOF_WARN flag to generate a warning if the name given on the close does not match the current open container.</p> +<p id="doc_section_3_3_p_7">For TEXT and HTML output, containers are not rendered into output text, though for HTML they are used when the XOF_XPATH flag is set.</p> +<div id="doc_figure_u.99"></div> <pre> + EXAMPLE: + xo_open_container("system"); + xo_emit("The host name is {:host-name}\n", hn); + xo_close_container("system"); + XML: + <system><host-name>foo</host-name></system> + </pre> <p id="doc_section_3_3_p_9">Section Contents: </p> +<ul><li><a href="#lists-and-instances-2" title="Lists and Instances">Section 3.3.1</a></li></ul> +<div class="content"> +<h3 id="doc_section_3_3_1"> +<div class="self-section-number"> +<a href="#doc_section_3_3_1">3.3.1</a> </div> +<a id="lists-and-instances-2" href="#lists-and-instances-2">Lists and Instances</a> +</h3> +<p id="doc_section_3_3_1_p_1">Lists are sequences of instances of homogeneous data objects. Two distinct levels of calls are needed to represent them in our output styles. Calls must be made to open and close a list, and for each instance of data in that list, calls must be make to open and close that instance.</p> +<p id="doc_section_3_3_1_p_2">The name given to all calls must be identical, and it is strongly suggested that the name be singular, not plural, as a matter of style and usage expectations.</p> +<div id="doc_figure_u.100"></div> <pre> + EXAMPLE: + xo_open_list("user"); + for (i = 0; i < num_users; i++) { + xo_open_instance("user"); + xo_emit("{k:name}:{:uid/%u}:{:gid/%u}:{:home}\n", + pw[i].pw_name, pw[i].pw_uid, + pw[i].pw_gid, pw[i].pw_dir); + xo_close_instance("user"); + } + xo_close_list("user"); + TEXT: + phil:1001:1001:/home/phil + pallavi:1002:1002:/home/pallavi + XML: + <user> + <name>phil</name> + <uid>1001</uid> + <gid>1001</gid> + <home>/home/phil</home> + </user> + <user> + <name>pallavi</name> + <uid>1002</uid> + <gid>1002</gid> + <home>/home/pallavi</home> + </user> + JSON: + user: [ + { + "name": "phil", + "uid": 1001, + "gid": 1001, + "home": "/home/phil", + }, + { + "name": "pallavi", + "uid": 1002, + "gid": 1002, + "home": "/home/pallavi", + } + ] + </pre> </div> +</div> +<div class="content"> +<h2 id="doc_section_3_4"> +<div class="self-section-number"> +<a href="#doc_section_3_4">3.4</a> </div> +<a id="support-functions" href="#support-functions">Support Functions</a> +</h2> +<p id="doc_section_3_4_p_1">Section Contents: </p> +<ul> +<li><a href="#xo_parse_args" title="Parsing Command-line Arguments (xo_parse_args)">Section 3.4.1</a></li> +<li><a href="#xo_set_program" title="xo_set_program">Section 3.4.2</a></li> +<li><a href="#xo_set_version" title="xo_set_version">Section 3.4.3</a></li> +<li><a href="#info" title="Field Information (xo_info_t)">Section 3.4.4</a></li> +<li><a href="#memory-allocation" title="Memory Allocation">Section 3.4.5</a></li> +<li><a href="#LIBXO_OPTIONS" title="LIBXO_OPTIONS">Section 3.4.6</a></li> +<li><a href="#errors-warnings-and-messages" title="Errors, Warnings, and Messages">Section 3.4.7</a></li> +<li><a href="#xo_error" title="xo_error">Section 3.4.8</a></li> +<li><a href="#xo_no_setlocale" title="xo_no_setlocale">Section 3.4.9</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_3_4_1"> +<div class="self-section-number"> +<a href="#doc_section_3_4_1">3.4.1</a> </div> +<a id="xo_parse_args" href="#xo_parse_args">Parsing Command-line Arguments (xo_parse_args)</a> +</h3> +<p id="doc_section_3_4_1_p_1">The xo_parse_args() function is used to process a program's arguments. libxo-specific options are processed and removed from the argument list so the calling application does not need to process them. If successful, a new value for argc is returned. On failure, a message it emitted and -1 is returned.</p> +<div id="doc_figure_u.101"></div> <pre> + argc = xo_parse_args(argc, argv); + if (argc < 0) + exit(EXIT_FAILURE); + </pre> <p id="doc_section_3_4_1_p_3">Following the call to xo_parse_args, the application can process the remaining arguments in a normal manner. See <a href="#command-line-arguments" title="Command-line Arguments">Section 2.3</a> for a description of valid arguments.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_4_2"> +<div class="self-section-number"> +<a href="#doc_section_3_4_2">3.4.2</a> </div> +<a id="xo_set_program" href="#xo_set_program">xo_set_program</a> +</h3> +<p id="doc_section_3_4_2_p_1">The xo_set_program function sets name of the program as reported by functions like xo_failure, xo_warn, xo_err, etc. The program name is initialized by xo_parse_args, but subsequent calls to xo_set_program can override this value.</p> +<div id="doc_figure_u.102"></div> <pre> + xo_set_program(argv[0]); + </pre> <p id="doc_section_3_4_2_p_3">Note that the value is not copied, so the memory passed to xo_set_program (and xo_parse_args) must be maintained by the caller.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_4_3"> +<div class="self-section-number"> +<a href="#doc_section_3_4_3">3.4.3</a> </div> +<a id="xo_set_version" href="#xo_set_version">xo_set_version</a> +</h3> +<p id="doc_section_3_4_3_p_1">The xo_set_version function records a version number to be emitted as part of the data for encoding styles (XML and JSON). This version number is suitable for tracking changes in the content, allowing a user of the data to discern which version of the data model is in use.</p> +<div id="doc_figure_u.103"></div> <pre> + void xo_set_version (const char *version); + void xo_set_version_h (xo_handle_t *xop, const char *version); + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_4_4"> +<div class="self-section-number"> +<a href="#doc_section_3_4_4">3.4.4</a> </div> +<a id="info" href="#info">Field Information (xo_info_t)</a> +</h3> +<p id="doc_section_3_4_4_p_1">HTML data can include additional information in attributes that begin with "data‑". To enable this, three things must occur:</p> +<p id="doc_section_3_4_4_p_2">First the application must build an array of xo_info_t structures, one per tag. The array must be sorted by name, since libxo uses a binary search to find the entry that matches names from format instructions.</p> +<p id="doc_section_3_4_4_p_3">Second, the application must inform libxo about this information using the xo_set_info() call:</p> +<div id="doc_figure_u.104"></div> <pre> + typedef struct xo_info_s { + const char *xi_name; /* Name of the element */ + const char *xi_type; /* Type of field */ + const char *xi_help; /* Description of field */ + } xo_info_t; + + void xo_set_info (xo_handle_t *xop, xo_info_t *infop, int count); + </pre> <p id="doc_section_3_4_4_p_5">Like other libxo calls, passing NULL for the handle tells libxo to use the default handle.</p> +<p id="doc_section_3_4_4_p_6">If the count is -1, libxo will count the elements of infop, but there must be an empty element at the end. More typically, the number is known to the application:</p> +<div id="doc_figure_u.105"></div> <pre> + xo_info_t info[] = { + { "in-stock", "number", "Number of items in stock" }, + { "name", "string", "Name of the item" }, + { "on-order", "number", "Number of items on order" }, + { "sku", "string", "Stock Keeping Unit" }, + { "sold", "number", "Number of items sold" }, + }; + int info_count = (sizeof(info) / sizeof(info[0])); + ... + xo_set_info(NULL, info, info_count); + </pre> <p id="doc_section_3_4_4_p_8">Third, the emission of info must be triggered with the XOF_INFO flag using either the xo_set_flags() function or the "‑‑libxo=info" command line argument.</p> +<p id="doc_section_3_4_4_p_9">The type and help values, if present, are emitted as the "data‑type" and "data‑help" attributes:</p> +<div id="doc_figure_u.106"></div> <pre> + <div class="data" data-tag="sku" data-type="string" + data-help="Stock Keeping Unit">GRO-000-533</div> + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_4_5"> +<div class="self-section-number"> +<a href="#doc_section_3_4_5">3.4.5</a> </div> +<a id="memory-allocation" href="#memory-allocation">Memory Allocation</a> +</h3> +<p id="doc_section_3_4_5_p_1">The xo_set_allocator function allows libxo to be used in environments where the standard realloc() and free() functions are not available.</p> +<div id="doc_figure_u.107"></div> <pre> + void xo_set_allocator (xo_realloc_func_t realloc_func, + xo_free_func_t free_func); + </pre> <p id="doc_section_3_4_5_p_3">realloc_func should expect the same arguments as realloc(3) and return a pointer to memory following the same convention. free_func will receive the same argument as free(3) and should release it, as appropriate for the environment.</p> +<p id="doc_section_3_4_5_p_4">By default, the standard realloc() and free() functions are used.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_4_6"> +<div class="self-section-number"> +<a href="#doc_section_3_4_6">3.4.6</a> </div> +<a id="LIBXO_OPTIONS" href="#LIBXO_OPTIONS">LIBXO_OPTIONS</a> +</h3> +<p id="doc_section_3_4_6_p_1">The environment variable "LIBXO_OPTIONS" can be set to a string of options:</p> +<div id="doc_table_u.13"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Option</th> +<th class="left">Action</th> +</tr></thead> +<tbody> +<tr> +<td>c</td> +<td>Enable color/effects for TEXT/HTML</td> +</tr> +<tr> +<td>F</td> +<td>Force line-buffered flushing</td> +</tr> +<tr> +<td>H</td> +<td>Enable HTML output (XO_STYLE_HTML)</td> +</tr> +<tr> +<td>I</td> +<td>Enable info output (XOF_INFO)</td> +</tr> +<tr> +<td>i<num></td> +<td>Indent by <number></td> +</tr> +<tr> +<td>J</td> +<td>Enable JSON output (XO_STYLE_JSON)</td> +</tr> +<tr> +<td>k</td> +<td>Add keys to XPATH expressions in HTML</td> +</tr> +<tr> +<td>n</td> +<td>Disable humanization (TEXT, HTML)</td> +</tr> +<tr> +<td>P</td> +<td>Enable pretty-printed output (XOF_PRETTY)</td> +</tr> +<tr> +<td>T</td> +<td>Enable text output (XO_STYLE_TEXT)</td> +</tr> +<tr> +<td>U</td> +<td>Add units to HTML output</td> +</tr> +<tr> +<td>u</td> +<td>Change "-"s to "_"s in element names (JSON)</td> +</tr> +<tr> +<td>W</td> +<td>Enable warnings (XOF_WARN)</td> +</tr> +<tr> +<td>X</td> +<td>Enable XML output (XO_STYLE_XML)</td> +</tr> +<tr> +<td>x</td> +<td>Enable XPath data (XOF_XPATH)</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_3_4_6_p_2">For example, warnings can be enabled by:</p> +<div id="doc_figure_u.108"></div> <pre> + % env LIBXO_OPTIONS=W my-app + </pre> <p id="doc_section_3_4_6_p_4">Complete HTML output can be generated with:</p> +<div id="doc_figure_u.109"></div> <pre> + % env LIBXO_OPTIONS=HXI my-app + </pre> <p id="doc_section_3_4_6_p_6">Since environment variables are inherited, child processes will have the same options, which may be undesirable, making the use of the "‑‑libxo" option is preferable in most situations.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_4_7"> +<div class="self-section-number"> +<a href="#doc_section_3_4_7">3.4.7</a> </div> +<a id="errors-warnings-and-messages" href="#errors-warnings-and-messages">Errors, Warnings, and Messages</a> +</h3> +<p id="doc_section_3_4_7_p_1">Many programs make use of the standard library functions err() and warn() to generate errors and warnings for the user. libxo wants to pass that information via the current output style, and provides compatible functions to allow this:</p> +<div id="doc_figure_u.110"></div> <pre> + void xo_warn (const char *fmt, ...); + void xo_warnx (const char *fmt, ...); + void xo_warn_c (int code, const char *fmt, ...); + void xo_warn_hc (xo_handle_t *xop, int code, + const char *fmt, ...); + void xo_err (int eval, const char *fmt, ...); + void xo_errc (int eval, int code, const char *fmt, ...); + void xo_errx (int eval, const char *fmt, ...); + void xo_message (const char *fmt, ...); + void xo_message_c (int code, const char *fmt, ...); + void xo_message_hc (xo_handle_t *xop, int code, + const char *fmt, ...); + void xo_message_hcv (xo_handle_t *xop, int code, + const char *fmt, va_list vap); + </pre> <p id="doc_section_3_4_7_p_3">These functions display the program name, a colon, a formatted message based on the arguments, and then optionally a colon and an error message associated with either "errno" or the "code" parameter.</p> +<div id="doc_figure_u.111"></div> <pre> + EXAMPLE: + if (open(filename, O_RDONLY) < 0) + xo_err(1, "cannot open file '%s'", filename); + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_4_8"> +<div class="self-section-number"> +<a href="#doc_section_3_4_8">3.4.8</a> </div> +<a id="xo_error" href="#xo_error">xo_error</a> +</h3> +<p id="doc_section_3_4_8_p_1">The xo_error function can be used for generic errors that should be reported over the handle, rather than to stderr. The xo_error function behaves like xo_err for TEXT and HTML output styles, but puts the error into XML or JSON elements:</p> +<div id="doc_figure_u.112"></div> <pre> + EXAMPLE:: + xo_error("Does not %s", "compute"); + XML:: + <error><message>Does not compute</message></error> + JSON:: + "error": { "message": "Does not compute" } + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_4_9"> +<div class="self-section-number"> +<a href="#doc_section_3_4_9">3.4.9</a> </div> +<a id="xo_no_setlocale" href="#xo_no_setlocale">xo_no_setlocale</a> +</h3> +<p id="doc_section_3_4_9_p_1">libxo automatically initializes the locale based on setting of the environment variables LC_CTYPE, LANG, and LC_ALL. The first of this list of variables is used and if none of the variables, the locale defaults to "UTF‑8". The caller may wish to avoid this behavior, and can do so by calling the xo_no_setlocale() function.</p> +<div id="doc_figure_u.113"></div> <pre> + void xo_no_setlocale (void); + </pre> </div> +</div> +<div class="content"> +<h2 id="doc_section_3_5"> +<div class="self-section-number"> +<a href="#doc_section_3_5">3.5</a> </div> +<a id="emitting-syslog-messages" href="#emitting-syslog-messages">Emitting syslog Messages</a> +</h2> +<p id="doc_section_3_5_p_1">syslog is the system logging facility used throughout the unix world. Messages are sent from commands, applications, and daemons to a hierarchy of servers, where they are filtered, saved, and forwarded based on configuration behaviors.</p> +<p id="doc_section_3_5_p_2">syslog is an older protocol, originally documented only in source code. By the time RFC 3164 published, variation and mutation left the leading "<pri>" string as only common content. RFC 5424 defines a new version (version 1) of syslog and introduces structured data into the messages. Structured data is a set of name/value pairs transmitted distinctly alongside the traditional text message, allowing filtering on precise values instead of regular expressions.</p> +<p id="doc_section_3_5_p_3">These name/value pairs are scoped by a two-part identifier; an enterprise identifier names the party responsible for the message catalog and a name identifying that message. Enterprise IDs are defined by IANA, the Internet Assigned Numbers Authority:</p> +<p id="doc_section_3_5_p_4">https://www.iana.org/assignments/enterprise-numbers/enterprise-numbers</p> +<p id="doc_section_3_5_p_5">Use the <a href="#xo_set_syslog_enterprise_id" title="xo_set_syslog_enterprise_id">Section 3.5.3.5</a>() function to set the Enterprise ID, as needed.</p> +<p id="doc_section_3_5_p_6">The message name should follow the conventions in <a href="#good-field-names" title="What makes a good field name?">Section 8.1.3</a>, as should the fields within the message.</p> +<div id="doc_figure_u.114"></div> <pre> + /* Both of these calls are optional */ + xo_set_syslog_enterprise_id(32473); + xo_open_log("my-program", 0, LOG_DAEMON); + + /* Generate a syslog message */ + xo_syslog(LOG_ERR, "upload-failed", + "error <%d> uploading file '{:filename}' " + "as '{:target/%s:%s}'", + code, filename, protocol, remote); + + xo_syslog(LOG_INFO, "poofd-invalid-state", + "state {:current/%u} is invalid {:connection/%u}", + state, conn); + </pre> <p id="doc_section_3_5_p_8">The developer should be aware that the message name may be used in the future to allow access to further information, including documentation. Care should be taken to choose quality, descriptive names.</p> +<p id="doc_section_3_5_p_9">Section Contents: </p> +<ul> +<li><a href="#priority" title="Priority, Facility, and Flags">Section 3.5.1</a></li> +<li><a href="#xo_syslog" title="xo_syslog">Section 3.5.2</a></li> +<li><a href="#support-functions-2" title="Support functions">Section 3.5.3</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_3_5_1"> +<div class="self-section-number"> +<a href="#doc_section_3_5_1">3.5.1</a> </div> +<a id="priority" href="#priority">Priority, Facility, and Flags</a> +</h3> +<p id="doc_section_3_5_1_p_1">The xo_syslog, xo_vsyslog, and xo_open_log functions accept a set of flags which provide the priority of the message, the source facility, and some additional features. These values are OR'd together to create a single integer argument:</p> +<div id="doc_figure_u.115"></div> <pre> + xo_syslog(LOG_ERR | LOG_AUTH, "login-failed", + "Login failed; user '{:user}' from host '{:address}'", + user, addr); + </pre> <p id="doc_section_3_5_1_p_3">These values are defined in <syslog.h>.</p> +<p id="doc_section_3_5_1_p_4">The priority value indicates the importance and potential impact of each message.</p> +<div id="doc_table_u.14"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Priority</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>LOG_EMERG</td> +<td>A panic condition, normally broadcast to all users</td> +</tr> +<tr> +<td>LOG_ALERT</td> +<td>A condition that should be corrected immediately</td> +</tr> +<tr> +<td>LOG_CRIT</td> +<td>Critical conditions</td> +</tr> +<tr> +<td>LOG_ERR</td> +<td>Generic errors</td> +</tr> +<tr> +<td>LOG_WARNING</td> +<td>Warning messages</td> +</tr> +<tr> +<td>LOG_NOTICE</td> +<td>Non-error conditions that might need special handling</td> +</tr> +<tr> +<td>LOG_INFO</td> +<td>Informational messages</td> +</tr> +<tr> +<td>LOG_DEBUG</td> +<td>Developer-oriented messages</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_3_5_1_p_5">The facility value indicates the source of message, in fairly generic terms.</p> +<div id="doc_table_u.15"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Facility</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>LOG_AUTH</td> +<td>The authorization system (e.g. login(1))</td> +</tr> +<tr> +<td>LOG_AUTHPRIV</td> +<td>As LOG_AUTH, but logged to a privileged file</td> +</tr> +<tr> +<td>LOG_CRON</td> +<td>The cron daemon: cron(8)</td> +</tr> +<tr> +<td>LOG_DAEMON</td> +<td>System daemons, not otherwise explicitly listed</td> +</tr> +<tr> +<td>LOG_FTP</td> +<td>The file transfer protocol daemons</td> +</tr> +<tr> +<td>LOG_KERN</td> +<td>Messages generated by the kernel</td> +</tr> +<tr> +<td>LOG_LPR</td> +<td>The line printer spooling system</td> +</tr> +<tr> +<td>LOG_MAIL</td> +<td>The mail system</td> +</tr> +<tr> +<td>LOG_NEWS</td> +<td>The network news system</td> +</tr> +<tr> +<td>LOG_SECURITY</td> +<td>Security subsystems, such as ipfw(4)</td> +</tr> +<tr> +<td>LOG_SYSLOG</td> +<td>Messages generated internally by syslogd(8)</td> +</tr> +<tr> +<td>LOG_USER</td> +<td>Messages generated by user processes (default)</td> +</tr> +<tr> +<td>LOG_UUCP</td> +<td>The uucp system</td> +</tr> +<tr> +<td>LOG_LOCAL0..7</td> +<td>Reserved for local use</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_3_5_1_p_6">In addition to the values listed above, xo_open_log accepts a set of addition flags requesting specific behaviors.</p> +<div id="doc_table_u.16"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Flag</th> +<th class="left">Description</th> +</tr></thead> +<tbody> +<tr> +<td>LOG_CONS</td> +<td>If syslogd fails, attempt to write to /dev/console</td> +</tr> +<tr> +<td>LOG_NDELAY</td> +<td>Open the connection to syslogd(8) immediately</td> +</tr> +<tr> +<td>LOG_PERROR</td> +<td>Write the message also to standard error output</td> +</tr> +<tr> +<td>LOG_PID</td> +<td>Log the process id with each message</td> +</tr> +</tbody> +</table></div> +</div> +<div class="content"> +<h3 id="doc_section_3_5_2"> +<div class="self-section-number"> +<a href="#doc_section_3_5_2">3.5.2</a> </div> +<a id="xo_syslog" href="#xo_syslog">xo_syslog</a> +</h3> +<p id="doc_section_3_5_2_p_1">Use the xo_syslog function to generate syslog messages by calling it with a log priority and facility, a message name, a format string, and a set of arguments. The priority/facility argument are discussed above, as is the message name.</p> +<p id="doc_section_3_5_2_p_2">The format string follows the same conventions as xo_emit's format string, with each field being rendered as an SD-PARAM pair.</p> +<div id="doc_figure_u.116"></div> <pre> + xo_syslog(LOG_ERR, "poofd-missing-file", + "'{:filename}' not found: {:error/%m}", filename); + + ... [poofd-missing-file@32473 filename="/etc/poofd.conf" + error="Permission denied"] '/etc/poofd.conf' not + found: Permission denied + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_5_3"> +<div class="self-section-number"> +<a href="#doc_section_3_5_3">3.5.3</a> </div> +<a id="support-functions-2" href="#support-functions-2">Support functions</a> +</h3> +<p id="doc_section_3_5_3_p_1">Section Contents: </p> +<ul> +<li><a href="#xo_vsyslog" title="xo_vsyslog">Section 3.5.3.1</a></li> +<li><a href="#xo_open_log" title="xo_open_log">Section 3.5.3.2</a></li> +<li><a href="#xo_close_log" title="xo_close_log">Section 3.5.3.3</a></li> +<li><a href="#xo_set_logmask" title="xo_set_logmask">Section 3.5.3.4</a></li> +<li><a href="#xo_set_syslog_enterprise_id" title="xo_set_syslog_enterprise_id">Section 3.5.3.5</a></li> +</ul> +<div class="content"> +<h4 id="doc_section_3_5_3_1"> +<div class="self-section-number"> +<a href="#doc_section_3_5_3_1">3.5.3.1</a> </div> +<a id="xo_vsyslog" href="#xo_vsyslog">xo_vsyslog</a> +</h4> +<p id="doc_section_3_5_3_1_p_1">xo_vsyslog is identical in function to xo_syslog, but takes the set of arguments using a va_list.</p> +<div id="doc_figure_u.117"></div> <pre> + void my_log (const char *name, const char *fmt, ...) + { + va_list vap; + va_start(vap, fmt); + xo_vsyslog(LOG_ERR, name, fmt, vap); + va_end(vap); + } + </pre> </div> +<div class="content"> +<h4 id="doc_section_3_5_3_2"> +<div class="self-section-number"> +<a href="#doc_section_3_5_3_2">3.5.3.2</a> </div> +<a id="xo_open_log" href="#xo_open_log">xo_open_log</a> +</h4> +<p id="doc_section_3_5_3_2_p_1">xo_open_log functions similar to openlog(3), allowing customization of the program name, the log facility number, and the additional option flags described in <a href="#priority" title="Priority, Facility, and Flags">Section 3.5.1</a>.</p> +<div id="doc_figure_u.118"></div> <pre> + void + xo_open_log (const char *ident, int logopt, int facility); + </pre> </div> +<div class="content"> +<h4 id="doc_section_3_5_3_3"> +<div class="self-section-number"> +<a href="#doc_section_3_5_3_3">3.5.3.3</a> </div> +<a id="xo_close_log" href="#xo_close_log">xo_close_log</a> +</h4> +<p id="doc_section_3_5_3_3_p_1">xo_close_log functions similar to closelog(3), closing the log file and releasing any associated resources.</p> +<div id="doc_figure_u.119"></div> <pre> + void + xo_close_log (void); + </pre> </div> +<div class="content"> +<h4 id="doc_section_3_5_3_4"> +<div class="self-section-number"> +<a href="#doc_section_3_5_3_4">3.5.3.4</a> </div> +<a id="xo_set_logmask" href="#xo_set_logmask">xo_set_logmask</a> +</h4> +<p id="doc_section_3_5_3_4_p_1">xo_set_logmask function similar to setlogmask(3), restricting the set of generated log event to those whose associated bit is set in maskpri. Use LOG_MASK(pri) to find the appropriate bit, or LOG_UPTO(toppri) to create a mask for all priorities up to and including toppri.</p> +<div id="doc_figure_u.120"></div> <pre> + int + xo_set_logmask (int maskpri); + + Example: + setlogmask(LOG_UPTO(LOG_WARN)); + </pre> </div> +<div class="content"> +<h4 id="doc_section_3_5_3_5"> +<div class="self-section-number"> +<a href="#doc_section_3_5_3_5">3.5.3.5</a> </div> +<a id="xo_set_syslog_enterprise_id" href="#xo_set_syslog_enterprise_id">xo_set_syslog_enterprise_id</a> +</h4> +<p id="doc_section_3_5_3_5_p_1">Use the xo_set_syslog_enterprise_id to supply a platform- or application-specific enterprise id. This value is used in any future syslog messages.</p> +<p id="doc_section_3_5_3_5_p_2">Ideally, the operating system should supply a default value via the "kern.syslog.enterprise_id" sysctl value. Lacking that, the application should provide a suitable value.</p> +<div id="doc_figure_u.121"></div> <pre> + void + xo_set_syslog_enterprise_id (unsigned short eid); + </pre> <p id="doc_section_3_5_3_5_p_4">Enterprise IDs are administered by IANA, the Internet Assigned Number Authority. The complete list is EIDs on their web site:</p> +<p id="doc_section_3_5_3_5_p_5"> <a href="https://www.iana.org/assignments/enterprise-numbers/enterprise-numbers">https://www.iana.org/assignments/enterprise-numbers/enterprise-numbers</a></p> +<p id="doc_section_3_5_3_5_p_6">New EIDs can be requested from IANA using the following page:</p> +<p id="doc_section_3_5_3_5_p_7"> <a href="http://pen.iana.org/pen/PenApplication.page">http://pen.iana.org/pen/PenApplication.page</a></p> +<p id="doc_section_3_5_3_5_p_8">Each software development organization that defines a set of syslog messages should register their own EID and use that value in their software to ensure that messages can be uniquely identified by the combination of EID + message name.</p> +</div> +</div> +</div> +<div class="content"> +<h2 id="doc_section_3_6"> +<div class="self-section-number"> +<a href="#doc_section_3_6">3.6</a> </div> +<a id="creating-custom-encoders" href="#creating-custom-encoders">Creating Custom Encoders</a> +</h2> +<p id="doc_section_3_6_p_1">The number of encoding schemes in current use is staggering, with new and distinct schemes appearing daily. While libxo provide XML, JSON, HMTL, and text natively, there are requirements for other encodings.</p> +<p id="doc_section_3_6_p_2">Rather than bake support for all possible encoders into libxo, the API allows them to be defined externally. libxo can then interfaces with these encoding modules using a simplistic API. libxo processes all functions calls, handles state transitions, performs all formatting, and then passes the results as operations to a customized encoding function, which implements specific encoding logic as required. This means your encoder doesn't need to detect errors with unbalanced open/close operations but can rely on libxo to pass correct data.</p> +<p id="doc_section_3_6_p_3">By making a simple API, libxo internals are not exposed, insulating the encoder and the library from future or internal changes.</p> +<p id="doc_section_3_6_p_4">The three elements of the API are:</p> +<p id="doc_section_3_6_p_5"> </p> +<ul> +<li>loading</li> +<li>initialization</li> +<li>operations</li> +</ul> +<p id="doc_section_3_6_p_6">The following sections provide details about these topics.</p> +<p id="doc_section_3_6_p_7">libxo source contain an encoder for Concise Binary Object Representation, aka CBOR (RFC 7049) which can be used as used as an example for the API.</p> +<p id="doc_section_3_6_p_8">Section Contents: </p> +<ul> +<li><a href="#loading-encoders" title="Loading Encoders">Section 3.6.1</a></li> +<li><a href="#encoder-initialization" title="Encoder Initialization">Section 3.6.2</a></li> +<li><a href="#operations" title="Operations">Section 3.6.3</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_3_6_1"> +<div class="self-section-number"> +<a href="#doc_section_3_6_1">3.6.1</a> </div> +<a id="loading-encoders" href="#loading-encoders">Loading Encoders</a> +</h3> +<p id="doc_section_3_6_1_p_1">Encoders can be registered statically or discovered dynamically. Applications can choose to call the xo_encoder_register() function to explicitly register encoders, but more typically they are built as shared libraries, placed in the libxo/extensions directory, and loaded based on name. libxo looks for a file with the name of the encoder and an extension of ".enc". This can be a file or a symlink to the shared library file that supports the encoder.</p> +<div id="doc_figure_u.122"></div> <pre> + % ls -1 lib/libxo/extensions/*.enc + lib/libxo/extensions/cbor.enc + lib/libxo/extensions/test.enc + </pre> </div> +<div class="content"> +<h3 id="doc_section_3_6_2"> +<div class="self-section-number"> +<a href="#doc_section_3_6_2">3.6.2</a> </div> +<a id="encoder-initialization" href="#encoder-initialization">Encoder Initialization</a> +</h3> +<p id="doc_section_3_6_2_p_1">Each encoder must export a symbol used to access the library, which must have the following signature:</p> +<div id="doc_figure_u.123"></div> <pre> + int xo_encoder_library_init (XO_ENCODER_INIT_ARGS); + </pre> <p id="doc_section_3_6_2_p_3">XO_ENCODER_INIT_ARGS is a macro defined in xo_encoder.h that defines an argument called "arg", a pointer of the type xo_encoder_init_args_t. This structure contains two fields:</p> +<p id="doc_section_3_6_2_p_4"> </p> +<ul> +<li>xei_version is the version number of the API as implemented within libxo. This version is currently as 1 using XO_ENCODER_VERSION. This number can be checked to ensure compatibility. The working assumption is that all versions should be backward compatible, but each side may need to accurately know the version supported by the other side. xo_encoder_library_init can optionally check this value, and must then set it to the version number used by the encoder, allowing libxo to detect version differences and react accordingly. For example, if version 2 adds new operations, then libxo will know that an encoding library that set xei_version to 1 cannot be expected to handle those new operations.</li> +<li>xei_handler must be set to a pointer to a function of type xo_encoder_func_t, as defined in xo_encoder.h. This function takes a set of parameters: -- xop is a pointer to the opaque xo_handle_t structure -- op is an integer representing the current operation -- name is a string whose meaning differs by operation -- value is a string whose meaning differs by operation -- private is an opaque structure provided by the encoder</li> +</ul> +<p id="doc_section_3_6_2_p_5">Additional arguments may be added in the future, so handler functions should use the XO_ENCODER_HANDLER_ARGS macro. An appropriate "extern" declaration is provided to help catch errors.</p> +<p id="doc_section_3_6_2_p_6">Once the encoder initialization function has completed processing, it should return zero to indicate that no error has occurred. A non-zero return code will cause the handle initialization to fail.</p> +</div> +<div class="content"> +<h3 id="doc_section_3_6_3"> +<div class="self-section-number"> +<a href="#doc_section_3_6_3">3.6.3</a> </div> +<a id="operations" href="#operations">Operations</a> +</h3> +<p id="doc_section_3_6_3_p_1">The encoder API defines a set of operations representing the processing model of libxo. Content is formatted within libxo, and callbacks are made to the encoder's handler function when data is ready to be processed.</p> +<div id="doc_table_u.17"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Operation</th> +<th class="left">Meaning (Base function)</th> +</tr></thead> +<tbody> +<tr> +<td>XO_OP_CREATE</td> +<td>Called when the handle is created</td> +</tr> +<tr> +<td>XO_OP_OPEN_CONTAINER</td> +<td>Container opened (xo_open_container)</td> +</tr> +<tr> +<td>XO_OP_CLOSE_CONTAINER</td> +<td>Container closed (xo_close_container)</td> +</tr> +<tr> +<td>XO_OP_OPEN_LIST</td> +<td>List opened (xo_open_list)</td> +</tr> +<tr> +<td>XO_OP_CLOSE_LIST</td> +<td>List closed (xo_close_list)</td> +</tr> +<tr> +<td>XO_OP_OPEN_LEAF_LIST</td> +<td>Leaf list opened (xo_open_leaf_list)</td> +</tr> +<tr> +<td>XO_OP_CLOSE_LEAF_LIST</td> +<td>Leaf list closed (xo_close_leaf_list)</td> +</tr> +<tr> +<td>XO_OP_OPEN_INSTANCE</td> +<td>Instance opened (xo_open_instance)</td> +</tr> +<tr> +<td>XO_OP_CLOSE_INSTANCE</td> +<td>Instance closed (xo_close_instance)</td> +</tr> +<tr> +<td>XO_OP_STRING</td> +<td>Field with Quoted UTF-8 string</td> +</tr> +<tr> +<td>XO_OP_CONTENT</td> +<td>Field with content</td> +</tr> +<tr> +<td>XO_OP_FINISH</td> +<td>Finish any pending output</td> +</tr> +<tr> +<td>XO_OP_FLUSH</td> +<td>Flush any buffered output</td> +</tr> +<tr> +<td>XO_OP_DESTROY</td> +<td>Clean up resources</td> +</tr> +<tr> +<td>XO_OP_ATTRIBUTE</td> +<td>An attribute name/value pair</td> +</tr> +<tr> +<td>XO_OP_VERSION</td> +<td>A version string</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_3_6_3_p_2">For all the open and close operations, the name parameter holds the name of the construct. For string, content, and attribute operations, the name parameter is the name of the field and the value parameter is the value. "string" are differentiated from "content" to allow differing treatment of true, false, null, and numbers from real strings, though content values are formatted as strings before the handler is called. For version operations, the value parameter contains the version.</p> +<p id="doc_section_3_6_3_p_3">All strings are encoded in UTF-8.</p> +</div> +</div> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_4" class="np"> +<div class="self-section-number"> +<a href="#doc_section_4">4_</a> </div> +<a id="the-xo-utility" href="#the-xo-utility">The "xo" Utility</a> +</h1> +<p id="doc_section_4_p_1">The "xo" utility allows command line access to the functionality of the libxo library. Using "xo", shell scripts can emit XML, JSON, and HTML using the same commands that emit text output.</p> +<p id="doc_section_4_p_2">The style of output can be selected using a specific option: "‑X" for XML, "‑J" for JSON, "‑H" for HTML, or "‑T" for TEXT, which is the default. The "--style <style>" option can also be used. The LIBXO_OPTIONS environment variable can also be used to set the style, as well as other flags.</p> +<p id="doc_section_4_p_3">The "xo" utility accepts a format string suitable for xo_emit() and a set of zero or more arguments used to supply data for that string.</p> +<div id="doc_figure_u.124"></div> <pre> + xo "The {k:name} weighs {:weight/%d} pounds.\n" fish 6 + + TEXT: + The fish weighs 6 pounds. + XML: + <name>fish</name> + <weight>6</weight> + JSON: + "name": "fish", + "weight": 6 + HTML: + <div class="line"> + <div class="text">The </div> + <div class="data" data-tag="name">fish</div> + <div class="text"> weighs </div> + <div class="data" data-tag="weight">6</div> + <div class="text"> pounds.</div> + </div> + </pre> <p id="doc_section_4_p_5">The "--wrap <path>" option can be used to wrap emitted content in a specific hierarchy. The path is a set of hierarchical names separated by the '/' character.</p> +<div id="doc_figure_u.125"></div> <pre> + xo --wrap top/a/b/c '{:tag}' value + + XML: + <top> + <a> + <b> + <c> + <tag>value</tag> + </c> + </b> + </a> + </top> + JSON: + "top": { + "a": { + "b": { + "c": { + "tag": "value" + } + } + } + } + </pre> <p id="doc_section_4_p_7">The "--open <path>" and "--close <path>" can be used to emit hierarchical information without the matching close and open tag. This allows a shell script to emit open tags, data, and then close tags. The "‑‑depth" option may be used to set the depth for indentation. The "‑‑leading‑xpath" may be used to prepend data to the XPath values used for HTML output style.</p> +<div id="doc_figure_u.126"></div> <pre> + #!/bin/sh + xo --open top/data + xo --depth 2 '{tag}' value + xo --close top/data + XML: + <top> + <data> + <tag>value</tag> + </data> + </top> + JSON: + "top": { + "data": { + "tag": "value" + } + } + </pre> <p id="doc_section_4_p_9">Section Contents: </p> +<ul> +<li><a href="#command-line-options" title="Command Line Options">Section 4.1</a></li> +<li><a href="#example-2" title="Example">Section 4.2</a></li> +</ul> +<div class="content"> +<h2 id="doc_section_4_1"> +<div class="self-section-number"> +<a href="#doc_section_4_1">4.1</a> </div> +<a id="command-line-options" href="#command-line-options">Command Line Options</a> +</h2> +<p id="doc_section_4_1_p_1">Usage: xo [options] format [fields]</p> +<div id="doc_figure_u.127"></div> <pre> + --close <path> Close tags for the given path + --depth <num> Set the depth for pretty printing + --help Display this help text + --html OR -H Generate HTML output + --json OR -J Generate JSON output + --leading-xpath <path> Add a prefix to generated XPaths (HTML) + --open <path> Open tags for the given path + --pretty OR -p Make 'pretty' output (add indent, newlines) + --style <style> Generate given style (xml, json, text, html) + --text OR -T Generate text output (the default style) + --version Display version information + --warn OR -W Display warnings in text on stderr + --warn-xml Display warnings in xml on stdout + --wrap <path> Wrap output in a set of containers + --xml OR -X Generate XML output + --xpath Add XPath data to HTML output); + </pre> </div> +<div class="content"> +<h2 id="doc_section_4_2"> +<div class="self-section-number"> +<a href="#doc_section_4_2">4.2</a> </div> +<a id="example-2" href="#example-2">Example</a> +</h2> +<div id="doc_figure_u.128"></div> <pre> + % xo 'The {:product} is {:status}\n' stereo "in route" + The stereo is in route + % ./xo/xo -p -X 'The {:product} is {:status}\n' stereo "in route" + <product>stereo</product> + <status>in route</status> + </pre> </div> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_5" class="np"> +<div class="self-section-number"> +<a href="#doc_section_5">5_</a> </div> +<a id="xolint" href="#xolint">xolint</a> +</h1> +<p id="doc_section_5_p_1">xolint is a tool for reporting common mistakes in format strings in source code that invokes xo_emit(). It allows these errors to be diagnosed at build time, rather than waiting until runtime.</p> +<p id="doc_section_5_p_2">xolint takes the one or more C files as arguments, and reports and errors, warning, or informational messages as needed.</p> +<div id="doc_table_u.18"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Option</th> +<th class="left">Meaning</th> +</tr></thead> +<tbody> +<tr> +<td>-c</td> +<td>Invoke 'cpp' against the input file</td> +</tr> +<tr> +<td>-C <flags></td> +<td>Flags that are passed to 'cpp</td> +</tr> +<tr> +<td>-d</td> +<td>Enable debug output</td> +</tr> +<tr> +<td>-D</td> +<td>Generate documentation for all xolint messages</td> +</tr> +<tr> +<td>-I</td> +<td>Generate info table code</td> +</tr> +<tr> +<td>-p</td> +<td>Print the offending lines after the message</td> +</tr> +<tr> +<td>-V</td> +<td>Print vocabulary of all field names</td> +</tr> +<tr> +<td>-X</td> +<td>Extract samples from xolint, suitable for testing</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_5_p_3">The output message will contain the source filename and line number, the class of the message, the message, and, if -p is given, the line that contains the error:</p> +<div id="doc_figure_u.129"></div> <pre> + % xolint.pl -t xolint.c + xolint.c: 16: error: anchor format should be "%d" + 16 xo_emit("{[:/%s}"); + </pre> <p id="doc_section_5_p_5">The "‑I" option will generate a table of xo_info_t structures ,</p> +<p id="doc_section_5_p_6">The "‑V" option does not report errors, but prints a complete list of all field names, sorted alphabetically. The output can help spot inconsistencies and spelling errors.</p> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_6" class="np"> +<div class="self-section-number"> +<a href="#doc_section_6">6_</a> </div> +<a id="xohtml" href="#xohtml">xohtml</a> +</h1> +<p id="doc_section_6_p_1">xohtml is a tool for turning the output of libxo-enabled commands into html files suitable for display in modern HTML web browsers. It can be used to test and debug HTML output, as well as to make the user ache to escape the world of 70s terminal devices.</p> +<p id="doc_section_6_p_2">xohtml is given a command, either on the command line or via the "‑c" option. If not command is given, standard input is used. The command's output is wrapped in HTML tags, with references to supporting CSS and Javascript files, and written to standard output or the file given in the "‑f" option. The "‑b" option can be used to provide an alternative base path for the support files.</p> +<div id="doc_table_u.19"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Option</th> +<th class="left">Meaning</th> +</tr></thead> +<tbody> +<tr> +<td>-b <base></td> +<td>Base path for finding css/javascript files</td> +</tr> +<tr> +<td>-c <command></td> +<td>Command to execute</td> +</tr> +<tr> +<td>-f <file></td> +<td>Output file name</td> +</tr> +</tbody> +</table></div> +<p id="doc_section_6_p_3">The "‑c" option takes a full command with arguments, including any libxo options needed to generate html ("‑‑libxo=html"). This value must be quoted if it consists of multiple tokens.</p> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_7" class="np"> +<div class="self-section-number"> +<a href="#doc_section_7">7_</a> </div> +<a id="xopo" href="#xopo">xopo</a> +</h1> +<p id="doc_section_7_p_1">The "xopo" utility filters ".pot" files generated by the "xgettext" utility to remove formatting information suitable for use with the "{G:}" modifier. This means that when the developer changes the formatting portion of the field definitions, or the fields modifiers, the string passed to gettext(3) is unchanged, avoiding the expense of updating any existing translation files (".po" files).</p> +<p id="doc_section_7_p_2">The syntax for the xopo command is one of two forms; it can be used as a filter for processing a .po or .pot file, rewriting the "msgid" strings with a simplified message string. In this mode, the input is either standard input or a file given by the "‑f" option, and the output is either standard output or a file given by the "‑o" option.</p> +<p id="doc_section_7_p_3">In the second mode, a simple message given using the "‑s" option on the command, and the simplified version of that message is printed on stdout.</p> +<div id="doc_table_u.20"><table summary="" class="tt full" cellpadding="3" cellspacing="0"> +<thead><tr> +<th class="left">Option</th> +<th class="left">Meaning</th> +</tr></thead> +<tbody> +<tr> +<td>-o <file></td> +<td>Output file name</td> +</tr> +<tr> +<td>-f <file></td> +<td>Use the given .po file as input</td> +</tr> +<tr> +<td>-s <text></td> +<td>Simplify a format string</td> +</tr> +</tbody> +</table></div> +<div id="doc_figure_u.130"></div> <pre> + EXAMPLE: + % xopo -s "There are {:count/%u} {:event/%.6s} events\n" + There are {:count} {:event} events\n + + % xgettext --default-domain=foo --no-wrap \ + --add-comments --keyword=xo_emit --keyword=xo_emit_h \ + --keyword=xo_emit_warn -C -E -n --foreign-user \ + -o foo.pot.raw foo.c + % xopo -f foo.pot.raw -o foo.pot + </pre> <p id="doc_section_7_p_5">Use of the "‑‑no‑wrap" option for xgettext is required to ensure that incoming msgid strings are not wrapped across multiple lines.</p> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_8" class="np"> +<div class="self-section-number"> +<a href="#doc_section_8">8_</a> </div> +<a id="faqs" href="#faqs">FAQs</a> +</h1> +<p id="doc_section_8_p_1">This section contains the set of questions that users typically ask, along with answers that might be helpful.</p> +<p id="doc_section_8_p_2">Section Contents: </p> +<ul> +<li><a href="#general" title="General">Section 8.1</a></li> +<li><a href="#what-does-this-message-mean" title="What does this message mean?">Section 8.2</a></li> +</ul> +<p id="doc_section_8_p_3">Section Contents: </p> +<ul> +<li><a href="#general" title="General">Section 8.1</a></li> +<li><a href="#what-does-this-message-mean" title="What does this message mean?">Section 8.2</a></li> +</ul> +<div class="content"> +<h2 id="doc_section_8_1"> +<div class="self-section-number"> +<a href="#doc_section_8_1">8.1</a> </div> +<a id="general" href="#general">General</a> +</h2> +<p id="doc_section_8_1_p_1">Section Contents: </p> +<ul> +<li><a href="#can-you-share-the-history-of-libxo" title="Can you share the history of libxo?">Section 8.1.1</a></li> +<li><a href="#did-the-complex-semantics-of-format-strings-evolve-over-time" title="Did the complex semantics of format strings evolve over time?">Section 8.1.2</a></li> +<li><a href="#good-field-names" title="What makes a good field name?">Section 8.1.3</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_8_1_1"> +<div class="self-section-number"> +<a href="#doc_section_8_1_1">8.1.1</a> </div> +<a id="can-you-share-the-history-of-libxo" href="#can-you-share-the-history-of-libxo">Can you share the history of libxo?</a> +</h3> +<p id="doc_section_8_1_1_p_1">In 2001, we added an XML API to the JUNOS operating system, which is built on top of FreeBSD. Eventually this API became standardized as the NETCONF API (RFC 6241). As part of this effort, we modified many FreeBSD utilities to emit XML, typically via a "‑X" switch. The results were mixed. The cost of maintaining this code, updating it and carrying it were non-trivial, and contributed to our expense (and the associated delay) with upgrading the version of FreeBSD on which each release of JUNOS is based.</p> +<p id="doc_section_8_1_1_p_2">A recent (2014) effort within JUNOS aims at removing our modifications to the underlying FreeBSD code as a means of reducing the expense and delay. JUNOS is structured to have system components generate XML that is rendered by the CLI (think: login shell) into human-readable text. This allows the API to use the same plumbing as the CLI, and ensures that all components emit XML, and that it is emitted with knowledge of the consumer of that XML, yielding an API that have no incremental cost or feature delay.</p> +<p id="doc_section_8_1_1_p_3">libxo is an effort to mix the best aspects of the JUNOS strategy into FreeBSD in a seemless way, allowing commands to make printf-like output calls without needing to care how the output is rendered.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_1_2"> +<div class="self-section-number"> +<a href="#doc_section_8_1_2">8.1.2</a> </div> +<a id="did-the-complex-semantics-of-format-strings-evolve-over-time" href="#did-the-complex-semantics-of-format-strings-evolve-over-time">Did the complex semantics of format strings evolve over time?</a> +</h3> +<p id="doc_section_8_1_2_p_1">The history is both long and short: libxo's functionality is based on what JUNOS does in a data modeling language called ODL (output definition language). In JUNOS, all subcomponents generate XML, which is feed to the CLI, where data from the ODL files tell is how to render that XML into text. ODL might had a set of tags like:</p> +<div id="doc_figure_u.131"></div> <pre> + tag docsis-state { + help "State of the DOCSIS interface"; + type string; + } + + tag docsis-mode { + help "DOCSIS mode (2.0/3.0) of the DOCSIS interface"; + type string; + } + + tag docsis-upstream-speed { + help "Operational upstream speed of the interface"; + type string; + } + + tag downstream-scanning { + help "Result of scanning in downstream direction"; + type string; + } + + tag ranging { + help "Result of ranging action"; + type string; + } + + tag signal-to-noise-ratio { + help "Signal to noise ratio for all channels"; + type string; + } + + tag power { + help "Operational power of the signal on all channels"; + type string; + } + + format docsis-status-format { + picture " + State : @, Mode: @, Upstream speed: @ + Downstream scanning: @, Ranging: @ + Signal to noise ratio: @ + Power: @ +"; + line { + field docsis-state; + field docsis-mode; + field docsis-upstream-speed; + field downstream-scanning; + field ranging; + field signal-to-noise-ratio; + field power; + } + } + </pre> <p id="doc_section_8_1_2_p_3">These tag definitions are compiled into field definitions that are triggered when matching XML elements are seen. ODL also supports other means of defining output.</p> +<p id="doc_section_8_1_2_p_4">The roles and modifiers describe these details.</p> +<p id="doc_section_8_1_2_p_5">In moving these ideas to bsd, two things had to happen: the formatting had to happen at the source since BSD won't have a JUNOS-like CLI to do the rendering, and we can't depend on external data models like ODL, which was seen as too hard a sell to the BSD community.</p> +<p id="doc_section_8_1_2_p_6">The results were that the xo_emit strings are used to encode the roles, modifiers, names, and formats. They are dense and a bit cryptic, but not so unlike printf format strings that developers will be lost.</p> +<p id="doc_section_8_1_2_p_7">libxo is a new implementation of these ideas and is distinct from the previous implementation in JUNOS.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_1_3"> +<div class="self-section-number"> +<a href="#doc_section_8_1_3">8.1.3</a> </div> +<a id="good-field-names" href="#good-field-names">What makes a good field name?</a> +</h3> +<p id="doc_section_8_1_3_p_1">To make useful, consistent field names, follow these guidelines:</p> +<p id="doc_section_8_1_3_p_2"> </p> +<dl> +<dt>Use lower case, even for TLAs</dt> +<dd>Lower case is more civilized. Even TLAs should be lower case to avoid scenarios where the differences between "XPath" and "Xpath" drive your users crazy. Using "xpath" is simpler and better.</dd> +<dt>Use hyphens, not underscores</dt> +<dd>Use of hyphens is traditional in XML, and the XOF_UNDERSCORES flag can be used to generate underscores in JSON, if desired. But the raw field name should use hyphens.</dd> +<dt>Use full words</dt> +<dd>Don't abbreviate especially when the abbreviation is not obvious or not widely used. Use "data‑size", not "dsz" or "dsize". Use "interface" instead of "ifname", "if‑name", "iface", "if", or "intf".</dd> +<dt>Use <verb>-<units></dt> +<dd>Using the form <verb>-<units> or <verb>-<classifier>-<units> helps in making consistent, useful names, avoiding the situation where one app uses "sent‑packet" and another "packets‑sent" and another "packets‑we‑have‑sent". The <units> can be dropped when it is obvious, as can obvious words in the classification. Use "receive‑after‑window‑packets" instead of "received‑packets‑of‑data‑after‑window".</dd> +<dt>Reuse existing field names</dt> +<dd>Nothing's worse than writing expressions like:</dd> +</dl> +<div id="doc_figure_u.132"></div> <pre> + if ($src1/process[pid == $pid]/name == + $src2/proc-table/proc-list + /proc-entry[process-id == $pid]/proc-name) { + ... + } + </pre> <p id="doc_section_8_1_3_p_4">Find someone else who is expressing similar data and follow their fields and hierarchy. Remember the quote is not "Consistency is the hobgoblin of little minds", but "A foolish consistency is the hobgoblin of little minds".</p> +<p id="doc_section_8_1_3_p_5"> </p> +<dl> +<dt>Use containment as scoping</dt> +<dd>In the previous example, all the names are prefixed with "proc‑", which is redundant given that they are nested under the process table.</dd> +<dt>Think about your users</dt> +<dd>Have empathy for your users, choosing clear and useful fields that contain clear and useful data. You may need to augment the display content with xo_attr() calls (<a href="#xo_attr" title="Attributes (xo_attr)">Section 3.2.1</a>) or "{e:}" fields (<a href="#e-modifier" title="The Encoding Modifier ({e:})">Section 2.2.2.3</a>) to make the data useful.</dd> +<dt>Don't use an arbitrary number postfix</dt> +<dd>What does "errors2" mean? No one will know. "errors‑after‑restart" would be a better choice. Think of your users, and think of the future. If you make "errors2", the next guy will happily make "errors3" and before you know it, someone will be asking what's the difference between errors37 and errors63.</dd> +<dt>Be consistent, uniform, unsurprising, and predictable</dt> +<dd>Think of your field vocabulary as an API. You want it useful, expressive, meaningful, direct, and obvious. You want the client application's programmer to move between without the need to understand a variety of opinions on how fields are named. They should see the system as a single cohesive whole, not a sack of cats.</dd> +</dl> +<p id="doc_section_8_1_3_p_6">Field names constitute the means by which client programmers interact with our system. By choosing wise names now, you are making their lives better.</p> +<p id="doc_section_8_1_3_p_7">After using "xolint" to find errors in your field descriptors, use "xolint -V" to spell check your field names and to detect different names for the same data. "dropped‑short" and "dropped‑too‑short" are both reasonable names, but using them both will lead users to ask the difference between the two fields. If there is no difference, use only one of the field names. If there is a difference, change the names to make that difference more obvious.</p> +</div> +</div> +<div class="content"> +<h2 id="doc_section_8_2"> +<div class="self-section-number"> +<a href="#doc_section_8_2">8.2</a> </div> +<a id="what-does-this-message-mean" href="#what-does-this-message-mean">What does this message mean?</a> +</h2> +<p id="doc_section_8_2_p_1">Section Contents: </p> +<ul> +<li><a href="#a-percent-sign-appearing-in-text-is-a-literal" title="'A percent sign appearing in text is a literal'">Section 8.2.1</a></li> +<li><a href="#unknown-long-name-for-rolemodifier" title="'Unknown long name for role/modifier'">Section 8.2.2</a></li> +<li><a href="#last-character-before-field-definition-is-a-field-type" title="'Last character before field definition is a field type'">Section 8.2.3</a></li> +<li><a href="#encoding-format-uses-different-number-of-arguments" title="'Encoding format uses different number of arguments'">Section 8.2.4</a></li> +<li><a href="#only-one-field-role-can-be-used" title="'Only one field role can be used'">Section 8.2.5</a></li> +<li><a href="#potential-missing-slash-after-c-d-n-l-or-t-with-format" title="'Potential missing slash after C, D, N, L, or T with format'">Section 8.2.6</a></li> +<li><a href="#an-encoding-format-cannot-be-given-roles-dnlt" title="'An encoding format cannot be given (roles: DNLT)'">Section 8.2.7</a></li> +<li><a href="#format-cannot-be-given-when-content-is-present-roles-cdln" title="'Format cannot be given when content is present (roles: CDLN)'">Section 8.2.8</a></li> +<li><a href="#field-has-color-without-fg--or-bg--role-c" title="'Field has color without fg- or bg- (role: C)'">Section 8.2.9</a></li> +<li><a href="#field-has-invalid-color-or-effect-role-c" title="'Field has invalid color or effect (role: C)'">Section 8.2.10</a></li> +<li><a href="#field-has-humanize-modifier-but-no-format-string" title="'Field has humanize modifier but no format string'">Section 8.2.11</a></li> +<li><a href="#field-has-hn--modifier-but-not-h-modifier" title="'Field has hn-* modifier but not 'h' modifier'">Section 8.2.12</a></li> +<li><a href="#value-field-must-have-a-name-as-content" title="'Value field must have a name (as content)")'">Section 8.2.13</a></li> +<li><a href="#use-hyphens-not-underscores-for-value-field-name" title="'Use hyphens, not underscores, for value field name'">Section 8.2.14</a></li> +<li><a href="#value-field-name-cannot-start-with-digit" title="'Value field name cannot start with digit'">Section 8.2.15</a></li> +<li><a href="#value-field-name-should-be-lower-case" title="'Value field name should be lower case'">Section 8.2.16</a></li> +<li><a href="#value-field-name-should-be-longer-than-two-characters" title="'Value field name should be longer than two characters'">Section 8.2.17</a></li> +<li><a href="#value-field-name-contains-invalid-character" title="'Value field name contains invalid character'">Section 8.2.18</a></li> +<li><a href="#decoration-field-contains-invalid-character" title="'decoration field contains invalid character'">Section 8.2.19</a></li> +<li><a href="#anchor-content-should-be-decimal-width" title="'Anchor content should be decimal width'">Section 8.2.20</a></li> +<li><a href="#anchor-format-should-be-d" title="'Anchor format should be "%d"'">Section 8.2.21</a></li> +<li><a href="#anchor-cannot-have-both-format-and-encoding-format" title="'Anchor cannot have both format and encoding format")'">Section 8.2.22</a></li> +<li><a href="#max-width-only-valid-for-strings" title="'Max width only valid for strings'">Section 8.2.23</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_8_2_1"> +<div class="self-section-number"> +<a href="#doc_section_8_2_1">8.2.1</a> </div> +<a id="a-percent-sign-appearing-in-text-is-a-literal" href="#a-percent-sign-appearing-in-text-is-a-literal">'A percent sign appearing in text is a literal'</a> +</h3> +<p id="doc_section_8_2_1_p_1">The message "A percent sign appearing in text is a literal" can be caused by code like:</p> +<div id="doc_figure_u.133"></div> <pre> + xo_emit("cost: %d", cost); + </pre> <p id="doc_section_8_2_1_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.134"></div> <pre> + xo_emit("{L:cost}: {:cost/%d}", cost); + </pre> <p id="doc_section_8_2_1_p_5">This can be a bit surprising and could be a field that was not properly converted to a libxo-style format string.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_2"> +<div class="self-section-number"> +<a href="#doc_section_8_2_2">8.2.2</a> </div> +<a id="unknown-long-name-for-rolemodifier" href="#unknown-long-name-for-rolemodifier">'Unknown long name for role/modifier'</a> +</h3> +<p id="doc_section_8_2_2_p_1">The message "Unknown long name for role/modifier" can be caused by code like:</p> +<div id="doc_figure_u.135"></div> <pre> + xo_emit("{,humanization:value}", value); + </pre> <p id="doc_section_8_2_2_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.136"></div> <pre> + xo_emit("{,humanize:value}", value); + </pre> <p id="doc_section_8_2_2_p_5">The hn-* modifiers (hn-decimal, hn-space, hn-1000) are only valid for fields with the {h:} modifier.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_3"> +<div class="self-section-number"> +<a href="#doc_section_8_2_3">8.2.3</a> </div> +<a id="last-character-before-field-definition-is-a-field-type" href="#last-character-before-field-definition-is-a-field-type">'Last character before field definition is a field type'</a> +</h3> +<p id="doc_section_8_2_3_p_1">The message "Last character before field definition is a field type" can be caused by code like:</p> +<p id="doc_section_8_2_3_p_2">A common typo:</p> +<div id="doc_figure_u.137"></div> <pre> + xo_emit("{T:Min} T{:Max}"); + </pre> <p id="doc_section_8_2_3_p_4">This code should be replaced with code like:</p> +<div id="doc_figure_u.138"></div> <pre> + xo_emit("{T:Min} {T:Max}"); + </pre> <p id="doc_section_8_2_3_p_6">Twiddling the "{" and the field role is a common typo.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_4"> +<div class="self-section-number"> +<a href="#doc_section_8_2_4">8.2.4</a> </div> +<a id="encoding-format-uses-different-number-of-arguments" href="#encoding-format-uses-different-number-of-arguments">'Encoding format uses different number of arguments'</a> +</h3> +<p id="doc_section_8_2_4_p_1">The message "Encoding format uses different number of arguments" can be caused by code like:</p> +<div id="doc_figure_u.139"></div> <pre> + xo_emit("{:name/%6.6s %%04d/%s}", name, number); + </pre> <p id="doc_section_8_2_4_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.140"></div> <pre> + xo_emit("{:name/%6.6s %04d/%s-%d}", name, number); + </pre> <p id="doc_section_8_2_4_p_5">Both format should consume the same number of arguments off the stack</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_5"> +<div class="self-section-number"> +<a href="#doc_section_8_2_5">8.2.5</a> </div> +<a id="only-one-field-role-can-be-used" href="#only-one-field-role-can-be-used">'Only one field role can be used'</a> +</h3> +<p id="doc_section_8_2_5_p_1">The message "Only one field role can be used" can be caused by code like:</p> +<div id="doc_figure_u.141"></div> <pre> + xo_emit("{LT:Max}"); + </pre> <p id="doc_section_8_2_5_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.142"></div> <pre> + xo_emit("{T:Max}"); + </pre> </div> +<div class="content"> +<h3 id="doc_section_8_2_6"> +<div class="self-section-number"> +<a href="#doc_section_8_2_6">8.2.6</a> </div> +<a id="potential-missing-slash-after-c-d-n-l-or-t-with-format" href="#potential-missing-slash-after-c-d-n-l-or-t-with-format">'Potential missing slash after C, D, N, L, or T with format'</a> +</h3> +<p id="doc_section_8_2_6_p_1">The message "Potential missing slash after C, D, N, L, or T with format" can be caused by code like:</p> +<div id="doc_figure_u.143"></div> <pre> + xo_emit("{T:%6.6s}\n", "Max"); + </pre> <p id="doc_section_8_2_6_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.144"></div> <pre> + xo_emit("{T:/%6.6s}\n", "Max"); + </pre> <p id="doc_section_8_2_6_p_5">The "%6.6s" will be a literal, not a field format. While it's possibly valid, it's likely a missing "/".</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_7"> +<div class="self-section-number"> +<a href="#doc_section_8_2_7">8.2.7</a> </div> +<a id="an-encoding-format-cannot-be-given-roles-dnlt" href="#an-encoding-format-cannot-be-given-roles-dnlt">'An encoding format cannot be given (roles: DNLT)'</a> +</h3> +<p id="doc_section_8_2_7_p_1">The message "An encoding format cannot be given (roles: DNLT)" can be caused by code like:</p> +<div id="doc_figure_u.145"></div> <pre> + xo_emit("{T:Max//%s}", "Max"); + </pre> <p id="doc_section_8_2_7_p_3">Fields with the C, D, N, L, and T roles are not emitted in the 'encoding' style (JSON, XML), so an encoding format would make no sense.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_8"> +<div class="self-section-number"> +<a href="#doc_section_8_2_8">8.2.8</a> </div> +<a id="format-cannot-be-given-when-content-is-present-roles-cdln" href="#format-cannot-be-given-when-content-is-present-roles-cdln">'Format cannot be given when content is present (roles: CDLN)'</a> +</h3> +<p id="doc_section_8_2_8_p_1">The message "Format cannot be given when content is present (roles: CDLN)" can be caused by code like:</p> +<div id="doc_figure_u.146"></div> <pre> + xo_emit("{N:Max/%6.6s}", "Max"); + </pre> <p id="doc_section_8_2_8_p_3">Fields with the C, D, L, or N roles can't have both static literal content ("{L:Label}") and a format ("{L:/%s}"). This error will also occur when the content has a backslash in it, like "{N:Type of I/O}"; backslashes should be escaped, like "{N:Type of I\\/O}". Note the double backslash, one for handling 'C' strings, and one for libxo.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_9"> +<div class="self-section-number"> +<a href="#doc_section_8_2_9">8.2.9</a> </div> +<a id="field-has-color-without-fg--or-bg--role-c" href="#field-has-color-without-fg--or-bg--role-c">'Field has color without fg- or bg- (role: C)'</a> +</h3> +<p id="doc_section_8_2_9_p_1">The message "Field has color without fg- or bg- (role: C)" can be caused by code like:</p> +<div id="doc_figure_u.147"></div> <pre> + xo_emit("{C:green}{:foo}{C:}", x); + </pre> <p id="doc_section_8_2_9_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.148"></div> <pre> + xo_emit("{C:fg-green}{:foo}{C:}", x); + </pre> <p id="doc_section_8_2_9_p_5">Colors must be prefixed by either "fg‑" or "bg‑".</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_10"> +<div class="self-section-number"> +<a href="#doc_section_8_2_10">8.2.10</a> </div> +<a id="field-has-invalid-color-or-effect-role-c" href="#field-has-invalid-color-or-effect-role-c">'Field has invalid color or effect (role: C)'</a> +</h3> +<p id="doc_section_8_2_10_p_1">The message "Field has invalid color or effect (role: C)" can be caused by code like:</p> +<div id="doc_figure_u.149"></div> <pre> + xo_emit("{C:fg-purple,bold}{:foo}{C:gween}", x); + </pre> <p id="doc_section_8_2_10_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.150"></div> <pre> + xo_emit("{C:fg-red,bold}{:foo}{C:fg-green}", x); + </pre> <p id="doc_section_8_2_10_p_5">The list of colors and effects are limited. The set of colors includes default, black, red, green, yellow, blue, magenta, cyan, and white, which must be prefixed by either "fg‑" or "bg‑". Effects are limited to bold, no-bold, underline, no-underline, inverse, no-inverse, normal, and reset. Values must be separated by commas.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_11"> +<div class="self-section-number"> +<a href="#doc_section_8_2_11">8.2.11</a> </div> +<a id="field-has-humanize-modifier-but-no-format-string" href="#field-has-humanize-modifier-but-no-format-string">'Field has humanize modifier but no format string'</a> +</h3> +<p id="doc_section_8_2_11_p_1">The message "Field has humanize modifier but no format string" can be caused by code like:</p> +<div id="doc_figure_u.151"></div> <pre> + xo_emit("{h:value}", value); + </pre> <p id="doc_section_8_2_11_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.152"></div> <pre> + xo_emit("{h:value/%d}", value); + </pre> <p id="doc_section_8_2_11_p_5">Humanization is only value for numbers, which are not likely to use the default format ("%s").</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_12"> +<div class="self-section-number"> +<a href="#doc_section_8_2_12">8.2.12</a> </div> +<a id="field-has-hn--modifier-but-not-h-modifier" href="#field-has-hn--modifier-but-not-h-modifier">'Field has hn-* modifier but not 'h' modifier'</a> +</h3> +<p id="doc_section_8_2_12_p_1">The message "Field has hn-* modifier but not 'h' modifier" can be caused by code like:</p> +<div id="doc_figure_u.153"></div> <pre> + xo_emit("{,hn-1000:value}", value); + </pre> <p id="doc_section_8_2_12_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.154"></div> <pre> + xo_emit("{h,hn-1000:value}", value); + </pre> <p id="doc_section_8_2_12_p_5">The hn-* modifiers (hn-decimal, hn-space, hn-1000) are only valid for fields with the {h:} modifier.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_13"> +<div class="self-section-number"> +<a href="#doc_section_8_2_13">8.2.13</a> </div> +<a id="value-field-must-have-a-name-as-content" href="#value-field-must-have-a-name-as-content">'Value field must have a name (as content)")'</a> +</h3> +<p id="doc_section_8_2_13_p_1">The message "Value field must have a name (as content)")" can be caused by code like:</p> +<div id="doc_figure_u.155"></div> <pre> + xo_emit("{:/%s}", "value"); + </pre> <p id="doc_section_8_2_13_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.156"></div> <pre> + xo_emit("{:tag-name/%s}", "value"); + </pre> <p id="doc_section_8_2_13_p_5">The field name is used for XML and JSON encodings. These tags names are static and must appear directly in the field descriptor.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_14"> +<div class="self-section-number"> +<a href="#doc_section_8_2_14">8.2.14</a> </div> +<a id="use-hyphens-not-underscores-for-value-field-name" href="#use-hyphens-not-underscores-for-value-field-name">'Use hyphens, not underscores, for value field name'</a> +</h3> +<p id="doc_section_8_2_14_p_1">The message "Use hyphens, not underscores, for value field name" can be caused by code like:</p> +<div id="doc_figure_u.157"></div> <pre> + xo_emit("{:no_under_scores}", "bad"); + </pre> <p id="doc_section_8_2_14_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.158"></div> <pre> + xo_emit("{:no-under-scores}", "bad"); + </pre> <p id="doc_section_8_2_14_p_5">Use of hyphens is traditional in XML, and the XOF_UNDERSCORES flag can be used to generate underscores in JSON, if desired. But the raw field name should use hyphens.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_15"> +<div class="self-section-number"> +<a href="#doc_section_8_2_15">8.2.15</a> </div> +<a id="value-field-name-cannot-start-with-digit" href="#value-field-name-cannot-start-with-digit">'Value field name cannot start with digit'</a> +</h3> +<p id="doc_section_8_2_15_p_1">The message "Value field name cannot start with digit" can be caused by code like:</p> +<div id="doc_figure_u.159"></div> <pre> + xo_emit("{:10-gig/}"); + </pre> <p id="doc_section_8_2_15_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.160"></div> <pre> + xo_emit("{:ten-gig/}"); + </pre> <p id="doc_section_8_2_15_p_5">XML element names cannot start with a digit.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_16"> +<div class="self-section-number"> +<a href="#doc_section_8_2_16">8.2.16</a> </div> +<a id="value-field-name-should-be-lower-case" href="#value-field-name-should-be-lower-case">'Value field name should be lower case'</a> +</h3> +<p id="doc_section_8_2_16_p_1">The message "Value field name should be lower case" can be caused by code like:</p> +<div id="doc_figure_u.161"></div> <pre> + xo_emit("{:WHY-ARE-YOU-SHOUTING}", "NO REASON"); + </pre> <p id="doc_section_8_2_16_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.162"></div> <pre> + xo_emit("{:why-are-you-shouting}", "no reason"); + </pre> <p id="doc_section_8_2_16_p_5">Lower case is more civilized. Even TLAs should be lower case to avoid scenarios where the differences between "XPath" and "Xpath" drive your users crazy. Lower case rules the seas.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_17"> +<div class="self-section-number"> +<a href="#doc_section_8_2_17">8.2.17</a> </div> +<a id="value-field-name-should-be-longer-than-two-characters" href="#value-field-name-should-be-longer-than-two-characters">'Value field name should be longer than two characters'</a> +</h3> +<p id="doc_section_8_2_17_p_1">The message "Value field name should be longer than two characters" can be caused by code like:</p> +<div id="doc_figure_u.163"></div> <pre> + xo_emit("{:x}", "mumble"); + </pre> <p id="doc_section_8_2_17_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.164"></div> <pre> + xo_emit("{:something-meaningful}", "mumble"); + </pre> <p id="doc_section_8_2_17_p_5">Field names should be descriptive, and it's hard to be descriptive in less than two characters. Consider your users and try to make something more useful. Note that this error often occurs when the field type is placed after the colon ("{:T/%20s}"), instead of before it ("{T:/20s}").</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_18"> +<div class="self-section-number"> +<a href="#doc_section_8_2_18">8.2.18</a> </div> +<a id="value-field-name-contains-invalid-character" href="#value-field-name-contains-invalid-character">'Value field name contains invalid character'</a> +</h3> +<p id="doc_section_8_2_18_p_1">The message "Value field name contains invalid character" can be caused by code like:</p> +<div id="doc_figure_u.165"></div> <pre> + xo_emit("{:cost-in-$$/%u}", 15); + </pre> <p id="doc_section_8_2_18_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.166"></div> <pre> + xo_emit("{:cost-in-dollars/%u}", 15); + </pre> <p id="doc_section_8_2_18_p_5">An invalid character is often a sign of a typo, like "{:]}" instead of "{]:}". Field names are restricted to lower-case characters, digits, and hyphens.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_19"> +<div class="self-section-number"> +<a href="#doc_section_8_2_19">8.2.19</a> </div> +<a id="decoration-field-contains-invalid-character" href="#decoration-field-contains-invalid-character">'decoration field contains invalid character'</a> +</h3> +<p id="doc_section_8_2_19_p_1">The message "decoration field contains invalid character" can be caused by code like:</p> +<div id="doc_figure_u.167"></div> <pre> + xo_emit("{D:not good}"); + </pre> <p id="doc_section_8_2_19_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.168"></div> <pre> + xo_emit("{D:((}{:good}{D:))}", "yes"); + </pre> <p id="doc_section_8_2_19_p_5">This is minor, but fields should use proper roles. Decoration fields are meant to hold punctuation and other characters used to decorate the content, typically to make it more readable to human readers.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_20"> +<div class="self-section-number"> +<a href="#doc_section_8_2_20">8.2.20</a> </div> +<a id="anchor-content-should-be-decimal-width" href="#anchor-content-should-be-decimal-width">'Anchor content should be decimal width'</a> +</h3> +<p id="doc_section_8_2_20_p_1">The message "Anchor content should be decimal width" can be caused by code like:</p> +<div id="doc_figure_u.169"></div> <pre> + xo_emit("{[:mumble}"); + </pre> <p id="doc_section_8_2_20_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.170"></div> <pre> + xo_emit("{[:32}"); + </pre> <p id="doc_section_8_2_20_p_5">Anchors need an integer value to specify the width of the set of anchored fields. The value can be positive (for left padding/right justification) or negative (for right padding/left justification) and can appear in either the start or stop anchor field descriptor.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_21"> +<div class="self-section-number"> +<a href="#doc_section_8_2_21">8.2.21</a> </div> +<a id="anchor-format-should-be-d" href="#anchor-format-should-be-d">'Anchor format should be "%d"'</a> +</h3> +<p id="doc_section_8_2_21_p_1">The message "Anchor format should be "%d"" can be caused by code like:</p> +<div id="doc_figure_u.171"></div> <pre> + xo_emit("{[:/%s}"); + </pre> <p id="doc_section_8_2_21_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.172"></div> <pre> + xo_emit("{[:/%d}"); + </pre> <p id="doc_section_8_2_21_p_5">Anchors only grok integer values, and if the value is not static, if must be in an 'int' argument, represented by the "%d" format. Anything else is an error.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_22"> +<div class="self-section-number"> +<a href="#doc_section_8_2_22">8.2.22</a> </div> +<a id="anchor-cannot-have-both-format-and-encoding-format" href="#anchor-cannot-have-both-format-and-encoding-format">'Anchor cannot have both format and encoding format")'</a> +</h3> +<p id="doc_section_8_2_22_p_1">The message "Anchor cannot have both format and encoding format")" can be caused by code like:</p> +<div id="doc_figure_u.173"></div> <pre> + xo_emit("{[:32/%d}"); + </pre> <p id="doc_section_8_2_22_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.174"></div> <pre> + xo_emit("{[:32}"); + </pre> <p id="doc_section_8_2_22_p_5">Anchors can have a static value or argument for the width, but cannot have both.</p> +</div> +<div class="content"> +<h3 id="doc_section_8_2_23"> +<div class="self-section-number"> +<a href="#doc_section_8_2_23">8.2.23</a> </div> +<a id="max-width-only-valid-for-strings" href="#max-width-only-valid-for-strings">'Max width only valid for strings'</a> +</h3> +<p id="doc_section_8_2_23_p_1">The message "Max width only valid for strings" can be caused by code like:</p> +<div id="doc_figure_u.175"></div> <pre> + xo_emit("{:tag/%2.4.6d}", 55); + </pre> <p id="doc_section_8_2_23_p_3">This code should be replaced with code like:</p> +<div id="doc_figure_u.176"></div> <pre> + xo_emit("{:tag/%2.6d}", 55); + </pre> <p id="doc_section_8_2_23_p_5">libxo allows a true 'max width' in addition to the traditional printf-style 'max number of bytes to use for input'. But this is supported only for string values, since it makes no sense for non-strings. This error may occur from a typo, like "{:tag/%6..6d}" where only one period should be used.</p> +</div> +</div> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_9" class="np"> +<div class="self-section-number"> +<a href="#doc_section_9">9_</a> </div> +<a id="howtos-focused-directions" href="#howtos-focused-directions">Howtos: Focused Directions</a> +</h1> +<p id="doc_section_9_p_1">This section provides task-oriented instructions for selected tasks. If you have a task that needs instructions, please open a request as an enhancement issue on github.</p> +<p id="doc_section_9_p_2">Section Contents: </p> +<ul> +<li><a href="#howto-report-bugs" title="Howto: Report bugs">Section 9.1</a></li> +<li><a href="#howto-install-libxo" title="Howto: Install libxo">Section 9.2</a></li> +<li><a href="#howto-convert-command-line-applications" title="Howto: Convert command line applications">Section 9.3</a></li> +<li><a href="#howto-use-xo-in-shell-scripts" title='Howto: Use "xo" in Shell Scripts'>Section 9.4</a></li> +<li><a href="#howto-i18n" title="Howto: Internationalization (i18n)">Section 9.5</a></li> +</ul> +<div class="content"> +<h2 id="doc_section_9_1"> +<div class="self-section-number"> +<a href="#doc_section_9_1">9.1</a> </div> +<a id="howto-report-bugs" href="#howto-report-bugs">Howto: Report bugs</a> +</h2> +<p id="doc_section_9_1_p_1">libxo uses github to track bugs or request enhancements. Please use the following URL:</p> +<p id="doc_section_9_1_p_2"> <a href="https://github.com/Juniper/libxo/issues">https://github.com/Juniper/libxo/issues</a></p> +</div> +<div class="content"> +<h2 id="doc_section_9_2"> +<div class="self-section-number"> +<a href="#doc_section_9_2">9.2</a> </div> +<a id="howto-install-libxo" href="#howto-install-libxo">Howto: Install libxo</a> +</h2> +<p id="doc_section_9_2_p_1">libxo is open source, under a new BSD license. Source code is available on github, as are recent releases. To get the most current release, please visit:</p> +<p id="doc_section_9_2_p_2"> <a href="https://github.com/Juniper/libxo/releases">https://github.com/Juniper/libxo/releases</a></p> +<p id="doc_section_9_2_p_3">After downloading and untarring the source code, building involves the following steps:</p> +<div id="doc_figure_u.177"></div> <pre> + sh bin/setup.sh + cd build + ../configure + make + make test + sudo make install + </pre> <p id="doc_section_9_2_p_5">libxo uses a distinct "build" directory to keep generated files separated from source files.</p> +<p id="doc_section_9_2_p_6">Use "../configure --help" to display available configuration options, which include the following:</p> +<div id="doc_figure_u.178"></div> <pre> + --enable-warnings Turn on compiler warnings + --enable-debug Turn on debugging + --enable-text-only Turn on text-only rendering + --enable-printflike Enable use of GCC __printflike attribute + --disable-libxo-options Turn off support for LIBXO_OPTIONS + --with-gettext=PFX Specify location of gettext installation + --with-libslax-prefix=PFX Specify location of libslax config + </pre> <p id="doc_section_9_2_p_8">Compiler warnings are a very good thing, but recent compiler version have added some very pedantic checks. While every attempt is made to keep libxo code warning-free, warnings are now optional. If you are doing development work on libxo, it is required that you use --enable-warnings to keep the code warning free, but most users need not use this option.</p> +<p id="doc_section_9_2_p_9">libxo provides the --enable-text-only option to reduce the footprint of the library for smaller installations. XML, JSON, and HTML rendering logic is removed.</p> +<p id="doc_section_9_2_p_10">The gettext library does not provide a simple means of learning its location, but libxo will look for it in /usr and /opt/local. If installed elsewhere, the installer will need to provide this information using the --with-gettext=/dir/path option.</p> +<p id="doc_section_9_2_p_11">libslax is not required by libxo; it contains the "oxtradoc" program used to format documentation.</p> +<p id="doc_section_9_2_p_12">For additional information, see <a href="#building-libxo" title="Building libxo">Section 1.1.2</a>.</p> +</div> +<div class="content"> +<h2 id="doc_section_9_3"> +<div class="self-section-number"> +<a href="#doc_section_9_3">9.3</a> </div> +<a id="howto-convert-command-line-applications" href="#howto-convert-command-line-applications">Howto: Convert command line applications</a> +</h2> +<div id="doc_figure_u.179"></div> <pre> + How do I convert an existing command line application? + </pre> <p id="doc_section_9_3_p_2">There are three basic steps for converting command line application to use libxo.</p> +<p id="doc_section_9_3_p_3"> </p> +<ul> +<li>Setting up the context</li> +<li>Converting printf calls</li> +<li>Creating hierarchy</li> +<li>Converting error functions</li> +</ul> +<p id="doc_section_9_3_p_4">Section Contents: </p> +<ul> +<li><a href="#setting-up-the-context" title="Setting up the context">Section 9.3.1</a></li> +<li><a href="#converting-printf-calls" title="Converting printf Calls">Section 9.3.2</a></li> +<li><a href="#creating-hierarchy" title="Creating Hierarchy">Section 9.3.3</a></li> +<li><a href="#converting-error-functions" title="Converting Error Functions">Section 9.3.4</a></li> +</ul> +<div class="content"> +<h3 id="doc_section_9_3_1"> +<div class="self-section-number"> +<a href="#doc_section_9_3_1">9.3.1</a> </div> +<a id="setting-up-the-context" href="#setting-up-the-context">Setting up the context</a> +</h3> +<p id="doc_section_9_3_1_p_1">To use libxo, you'll need to include the "xo.h" header file in your source code files:</p> +<div id="doc_figure_u.180"></div> <pre> + #include <libxo/xo.h> + </pre> <p id="doc_section_9_3_1_p_3">In your main() function, you'll need to call xo_parse_args to handling argument parsing (<a href="#xo_parse_args" title="Parsing Command-line Arguments (xo_parse_args)">Section 3.4.1</a>). This function removes libxo-specific arguments the program's argv and returns either the number of remaining arguments or -1 to indicate an error.</p> +<div id="doc_figure_u.181"></div> <pre> + int main (int argc, char **argv) + { + argc = xo_parse_args(argc, argv); + if (argc < 0) + return argc; + .... + } + </pre> <p id="doc_section_9_3_1_p_5">At the bottom of your main(), you'll need to call xo_finish() to complete output processing for the default handle (<a href="#handles" title="Handles">Section 2.5</a>). libxo provides the xo_finish_atexit function that is suitable for use with the atexit(3) function.</p> +<div id="doc_figure_u.182"></div> <pre> + atexit(xo_finish_atexit); + </pre> </div> +<div class="content"> +<h3 id="doc_section_9_3_2"> +<div class="self-section-number"> +<a href="#doc_section_9_3_2">9.3.2</a> </div> +<a id="converting-printf-calls" href="#converting-printf-calls">Converting printf Calls</a> +</h3> +<p id="doc_section_9_3_2_p_1">The second task is inspecting code for printf(3) calls and replacing them with xo_emit() calls. The format strings are similar in task, but libxo format strings wrap output fields in braces. The following two calls produce identical text output:</p> +<div id="doc_figure_u.183"></div> <pre> + printf("There are %d %s events\n", count, etype); + xo_emit("There are {:count/%d} {:event} events\n", count, etype); + </pre> <p id="doc_section_9_3_2_p_3">"count" and "event" are used as names for JSON and XML output. The "count" field uses the format "%d" and "event" uses the default "%s" format. Both are "value" roles, which is the default role.</p> +<p id="doc_section_9_3_2_p_4">Since text outside of output fields is passed verbatim, other roles are less important, but their proper use can help make output more useful. The "note" and "label" roles allow HTML output to recognize the relationship between text and the associated values, allowing appropriate "hover" and "onclick" behavior. Using the "units" role allows the presentation layer to perform conversions when needed. The "warning" and "error" roles allows use of color and font to draw attention to warnings. The "padding" role makes the use of vital whitespace more clear (<a href="#padding-role" title="The Padding Role ({P:})">Section 2.2.1.6</a>).</p> +<p id="doc_section_9_3_2_p_5">The "title" role indicates the headings of table and sections. This allows HTML output to use CSS to make this relationship more obvious.</p> +<div id="doc_figure_u.184"></div> <pre> + printf("Statistics:\n"); + xo_emit("{T:Statistics}:\n"); + </pre> <p id="doc_section_9_3_2_p_7">The "color" roles controls foreground and background colors, as well as effects like bold and underline (see <a href="#color-role" title="The Color Role ({C:})">Section 2.2.1.1</a>).</p> +<div id="doc_figure_u.185"></div> <pre> + xo_emit("{C:bold}required{C:}\n"); + </pre> <p id="doc_section_9_3_2_p_9">Finally, the start- and stop-anchor roles allow justification and padding over multiple fields (see <a href="#anchor-role" title="The Anchor Roles ({[:} and {]:})">Section 2.2.1.10</a>).</p> +<div id="doc_figure_u.186"></div> <pre> + snprintf(buf, sizeof(buf), "(%u/%u/%u)", min, ave, max); + printf("%30s", buf); + + xo_emit("{[:30}({:minimum/%u}/{:average/%u}/{:maximum/%u}{]:}", + min, ave, max); + </pre> </div> +<div class="content"> +<h3 id="doc_section_9_3_3"> +<div class="self-section-number"> +<a href="#doc_section_9_3_3">9.3.3</a> </div> +<a id="creating-hierarchy" href="#creating-hierarchy">Creating Hierarchy</a> +</h3> +<p id="doc_section_9_3_3_p_1">Text output doesn't have any sort of hierarchy, but XML and JSON require this. Typically applications use indentation to represent these relationship:</p> +<div id="doc_figure_u.187"></div> <pre> + printf("table %d\n", tnum); + for (i = 0; i < tmax; i++) { + printf(" %s %d\n", table[i].name, table[i].size); + } + + xo_emit("{T:/table %d}\n", tnum); + xo_open_list("table"); + for (i = 0; i < tmax; i++) { + xo_open_instance("table"); + xo_emit("{P: }{k:name} {:size/%d}\n", + table[i].name, table[i].size); + xo_close_instance("table"); + } + xo_close_list("table"); + </pre> <p id="doc_section_9_3_3_p_3">The open and close list functions are used before and after the list, and the open and close instance functions are used before and after each instance with in the list.</p> +<p id="doc_section_9_3_3_p_4">Typically these developer looks for a "for" loop as an indication of where to put these calls.</p> +<p id="doc_section_9_3_3_p_5">In addition, the open and close container functions allow for organization levels of hierarchy.</p> +<div id="doc_figure_u.188"></div> <pre> + printf("Paging information:\n"); + printf(" Free: %lu\n", free); + printf(" Active: %lu\n", active); + printf(" Inactive: %lu\n", inactive); + + xo_open_container("paging-information"); + xo_emit("{P: }{L:Free: }{:free/%lu}\n", free); + xo_emit("{P: }{L:Active: }{:active/%lu}\n", active); + xo_emit("{P: }{L:Inactive: }{:inactive/%lu}\n", inactive); + xo_close_container("paging-information"); + </pre> </div> +<div class="content"> +<h3 id="doc_section_9_3_4"> +<div class="self-section-number"> +<a href="#doc_section_9_3_4">9.3.4</a> </div> +<a id="converting-error-functions" href="#converting-error-functions">Converting Error Functions</a> +</h3> +<p id="doc_section_9_3_4_p_1">libxo provides variants of the standard error and warning functions, err(3) and warn(3). There are two variants, one for putting the errors on standard error, and the other writes the errors and warnings to the handle using the appropriate encoding style:</p> +<div id="doc_figure_u.189"></div> <pre> + err(1, "cannot open output file: %s", file); + + xo_err(1, "cannot open output file: %s", file); + xo_emit_err(1, "cannot open output file: {:filename}", file); + </pre> </div> +</div> +<div class="content"><h2 id="doc_section_9_4"> +<div class="self-section-number"> +<a href="#doc_section_9_4">9.4</a> </div> +<a id="howto-use-xo-in-shell-scripts" href="#howto-use-xo-in-shell-scripts">Howto: Use "xo" in Shell Scripts</a> +</h2></div> +<div class="content"> +<h2 id="doc_section_9_5"> +<div class="self-section-number"> +<a href="#doc_section_9_5">9.5</a> </div> +<a id="howto-i18n" href="#howto-i18n">Howto: Internationalization (i18n)</a> +</h2> +<div id="doc_figure_u.190"></div> <pre> + How do I use libxo to support internationalization? + </pre> <p id="doc_section_9_5_p_2">libxo allows format and field strings to be used a keys into message catalogs to enable translation into a user's native language by invoking the standard gettext(3) functions.</p> +<p id="doc_section_9_5_p_3">gettext setup is a bit complicated: text strings are extracted from source files into "portable object template" (.pot) files using the "xgettext" command. For each language, this template file is used as the source for a message catalog in the "portable object" (.po) format, which are translated by hand and compiled into "machine object" (.mo) files using the "msgfmt" command. The .mo files are then typically installed in the /usr/share/locale or /opt/local/share/locale directories. At run time, the user's language settings are used to select a .mo file which is searched for matching messages. Text strings in the source code are used as keys to look up the native language strings in the .mo file.</p> +<p id="doc_section_9_5_p_4">Since the xo_emit format string is used as the key into the message catalog, libxo removes unimportant field formatting and modifiers from the format string before use so that minor formatting changes will not impact the expensive translation process. We don't want a developer change such as changing "/%06d" to "/%08d" to force hand inspection of all .po files. The simplified version can be generated for a single message using the "xopo -s <text>" command, or an entire .pot can be translated using the "xopo -f <input> -o <output>" command.</p> +<div id="doc_figure_u.191"></div> <pre> + EXAMPLE: + % xopo -s "There are {:count/%u} {:event/%.6s} events\n" + There are {:count} {:event} events\n + + Recommended workflow: + # Extract text messages + xgettext --default-domain=foo --no-wrap \ + --add-comments --keyword=xo_emit --keyword=xo_emit_h \ + --keyword=xo_emit_warn -C -E -n --foreign-user \ + -o foo.pot.raw foo.c + + # Simplify format strings for libxo + xopo -f foo.pot.raw -o foo.pot + + # For a new language, just copy the file + cp foo.pot po/LC/my_lang/foo.po + + # For an existing language: + msgmerge --no-wrap po/LC/my_lang/foo.po \ + foo.pot -o po/LC/my_lang/foo.po.new + + # Now the hard part: translate foo.po using tools + # like poedit or emacs' po-mode + + # Compile the finished file; Use of msgfmt's "-v" option is + # strongly encouraged, so that "fuzzy" entries are reported. + msgfmt -v -o po/my_lang/LC_MESSAGES/foo.mo po/my_lang/foo.po + + # Install the .mo file + sudo cp po/my_lang/LC_MESSAGES/foo.mo \ + /opt/local/share/locale/my_lang/LC_MESSAGE/ + </pre> <p id="doc_section_9_5_p_6">Once these steps are complete, you can use the "gettext" command to test the message catalog:</p> +<div id="doc_figure_u.192"></div> <pre> + gettext -d foo -e "some text" + </pre> <p id="doc_section_9_5_p_8">Section Contents: </p> +<ul><li><a href="#i18n-and-xo_emit" title="i18n and xo_emit">Section 9.5.1</a></li></ul> +<div class="content"> +<h3 id="doc_section_9_5_1"> +<div class="self-section-number"> +<a href="#doc_section_9_5_1">9.5.1</a> </div> +<a id="i18n-and-xo_emit" href="#i18n-and-xo_emit">i18n and xo_emit</a> +</h3> +<p id="doc_section_9_5_1_p_1">There are three features used in libxo used to support i18n:</p> +<p id="doc_section_9_5_1_p_2"> </p> +<ul> +<li>The "{G:}" role looks for a translation of the format string.</li> +<li>The "{g:}" modifier looks for a translation of the field.</li> +<li>The "{p:}" modifier looks for a pluralized version of the field.</li> +</ul> +<p id="doc_section_9_5_1_p_3">Together these three flags allows a single function call to give native language support, as well as libxo's normal XML, JSON, and HTML support.</p> +<div id="doc_figure_u.193"></div> <pre> + printf(gettext("Received %zu %s from {g:server} server\n"), + counter, ngettext("byte", "bytes", counter), + gettext("web")); + + xo_emit("{G:}Received {:received/%zu} {Ngp:byte,bytes} " + "from {g:server} server\n", counter, "web"); + </pre> <p id="doc_section_9_5_1_p_5">libxo will see the "{G:}" role and will first simplify the format string, removing field formats and modifiers.</p> +<div id="doc_figure_u.194"></div> <pre> + "Received {:received} {N:byte,bytes} from {:server} server\n" + </pre> <p id="doc_section_9_5_1_p_7">libxo calls gettext(3) with that string to get a localized version. If your language were Pig Latin, the result might look like:</p> +<div id="doc_figure_u.195"></div> <pre> + "Eceivedray {:received} {N:byte,bytes} omfray " + "{:server} erversay\n" + </pre> <p id="doc_section_9_5_1_p_9">Note the field names do not change and they should not be translated. The contents of the note ("byte,bytes") should also not be translated, since the "g" modifier will need the untranslated value as the key for the message catalog.</p> +<p id="doc_section_9_5_1_p_10">The field "{g:server}" requests the rendered value of the field be translated using gettext(3). In this example, "web" would be used.</p> +<p id="doc_section_9_5_1_p_11">The field "{Ngp:byte,bytes}" shows an example of plural form using the "p" modifier with the "g" modifier. The base singular and plural forms appear inside the field, separated by a comma. At run time, libxo uses the previous field's numeric value to decide which form to use by calling ngettext(3).</p> +<p id="doc_section_9_5_1_p_12">If a domain name is needed, it can be supplied as the content of the {G:} role. Domain names remain in use throughout the format string until cleared with another domain name.</p> +<div id="doc_figure_u.196"></div> <pre> + printf(dgettext("dns", "Host %s not found: %d(%s)\n"), + name, errno, dgettext("strerror", strerror(errno))); + + xo_emit("{G:dns}Host {:hostname} not found: " + "%d({G:strerror}{g:%m})\n", name, errno); + </pre> </div> +</div> +</div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc_section_10" class="np"> +<div class="self-section-number"> +<a href="#doc_section_10">10_</a> </div> +<a id="examples" href="#examples">Examples</a> +</h1> +<p id="doc_section_10_p_1">Section Contents: </p> +<ul><li><a href="#unit-test" title="Unit Test">Section 10.1</a></li></ul> +<div class="content"> +<h2 id="doc_section_10_1"> +<div class="self-section-number"> +<a href="#doc_section_10_1">10.1</a> </div> +<a id="unit-test" href="#unit-test">Unit Test</a> +</h2> +<p id="doc_section_10_1_p_1">Here is the unit test example:</p> +<div id="doc_figure_u.197"></div> <pre> + int + main (int argc, char **argv) + { + static char base_grocery[] = "GRO"; + static char base_hardware[] = "HRD"; + struct item { + const char *i_title; + int i_sold; + int i_instock; + int i_onorder; + const char *i_sku_base; + int i_sku_num; + }; + struct item list[] = { + { "gum", 1412, 54, 10, base_grocery, 415 }, + { "rope", 85, 4, 2, base_hardware, 212 }, + { "ladder", 0, 2, 1, base_hardware, 517 }, + { "bolt", 4123, 144, 42, base_hardware, 632 }, + { "water", 17, 14, 2, base_grocery, 2331 }, + { NULL, 0, 0, 0, NULL, 0 } + }; + struct item list2[] = { + { "fish", 1321, 45, 1, base_grocery, 533 }, + }; + struct item *ip; + xo_info_t info[] = { + { "in-stock", "number", "Number of items in stock" }, + { "name", "string", "Name of the item" }, + { "on-order", "number", "Number of items on order" }, + { "sku", "string", "Stock Keeping Unit" }, + { "sold", "number", "Number of items sold" }, + { NULL, NULL, NULL }, + }; + int info_count = (sizeof(info) / sizeof(info[0])) - 1; + + argc = xo_parse_args(argc, argv); + if (argc < 0) + exit(EXIT_FAILURE); + + xo_set_info(NULL, info, info_count); + + xo_open_container_h(NULL, "top"); + + xo_open_container("data"); + xo_open_list("item"); + + for (ip = list; ip->i_title; ip++) { + xo_open_instance("item"); + + xo_emit("{L:Item} '{k:name/%s}':\n", ip->i_title); + xo_emit("{P: }{L:Total sold}: {n:sold/%u%s}\n", + ip->i_sold, ip->i_sold ? ".0" : ""); + xo_emit("{P: }{Lwc:In stock}{:in-stock/%u}\n", + ip->i_instock); + xo_emit("{P: }{Lwc:On order}{:on-order/%u}\n", + ip->i_onorder); + xo_emit("{P: }{L:SKU}: {q:sku/%s-000-%u}\n", + ip->i_sku_base, ip->i_sku_num); + + xo_close_instance("item"); + } + + xo_close_list("item"); + xo_close_container("data"); + + xo_open_container("data"); + xo_open_list("item"); + + for (ip = list2; ip->i_title; ip++) { + xo_open_instance("item"); + + xo_emit("{L:Item} '{:name/%s}':\n", ip->i_title); + xo_emit("{P: }{L:Total sold}: {n:sold/%u%s}\n", + ip->i_sold, ip->i_sold ? ".0" : ""); + xo_emit("{P: }{Lwc:In stock}{:in-stock/%u}\n", + ip->i_instock); + xo_emit("{P: }{Lwc:On order}{:on-order/%u}\n", + ip->i_onorder); + xo_emit("{P: }{L:SKU}: {q:sku/%s-000-%u}\n", + ip->i_sku_base, ip->i_sku_num); + + xo_close_instance("item"); + } + + xo_close_list("item"); + xo_close_container("data"); + + xo_close_container_h(NULL, "top"); + + return 0; + } + </pre> <p id="doc_section_10_1_p_3">Text output:</p> +<div id="doc_figure_u.198"></div> <pre> + % ./testxo --libxo text + Item 'gum': + Total sold: 1412.0 + In stock: 54 + On order: 10 + SKU: GRO-000-415 + Item 'rope': + Total sold: 85.0 + In stock: 4 + On order: 2 + SKU: HRD-000-212 + Item 'ladder': + Total sold: 0 + In stock: 2 + On order: 1 + SKU: HRD-000-517 + Item 'bolt': + Total sold: 4123.0 + In stock: 144 + On order: 42 + SKU: HRD-000-632 + Item 'water': + Total sold: 17.0 + In stock: 14 + On order: 2 + SKU: GRO-000-2331 + Item 'fish': + Total sold: 1321.0 + In stock: 45 + On order: 1 + SKU: GRO-000-533 + </pre> <p id="doc_section_10_1_p_5">JSON output:</p> +<div id="doc_figure_u.199"></div> <pre> + % ./testxo --libxo json,pretty + "top": { + "data": { + "item": [ + { + "name": "gum", + "sold": 1412.0, + "in-stock": 54, + "on-order": 10, + "sku": "GRO-000-415" + }, + { + "name": "rope", + "sold": 85.0, + "in-stock": 4, + "on-order": 2, + "sku": "HRD-000-212" + }, + { + "name": "ladder", + "sold": 0, + "in-stock": 2, + "on-order": 1, + "sku": "HRD-000-517" + }, + { + "name": "bolt", + "sold": 4123.0, + "in-stock": 144, + "on-order": 42, + "sku": "HRD-000-632" + }, + { + "name": "water", + "sold": 17.0, + "in-stock": 14, + "on-order": 2, + "sku": "GRO-000-2331" + } + ] + }, + "data": { + "item": [ + { + "name": "fish", + "sold": 1321.0, + "in-stock": 45, + "on-order": 1, + "sku": "GRO-000-533" + } + ] + } + } + </pre> <p id="doc_section_10_1_p_7">XML output:</p> +<div id="doc_figure_u.200"></div> <pre> + % ./testxo --libxo pretty,xml + <top> + <data> + <item> + <name>gum</name> + <sold>1412.0</sold> + <in-stock>54</in-stock> + <on-order>10</on-order> + <sku>GRO-000-415</sku> + </item> + <item> + <name>rope</name> + <sold>85.0</sold> + <in-stock>4</in-stock> + <on-order>2</on-order> + <sku>HRD-000-212</sku> + </item> + <item> + <name>ladder</name> + <sold>0</sold> + <in-stock>2</in-stock> + <on-order>1</on-order> + <sku>HRD-000-517</sku> + </item> + <item> + <name>bolt</name> + <sold>4123.0</sold> + <in-stock>144</in-stock> + <on-order>42</on-order> + <sku>HRD-000-632</sku> + </item> + <item> + <name>water</name> + <sold>17.0</sold> + <in-stock>14</in-stock> + <on-order>2</on-order> + <sku>GRO-000-2331</sku> + </item> + </data> + <data> + <item> + <name>fish</name> + <sold>1321.0</sold> + <in-stock>45</in-stock> + <on-order>1</on-order> + <sku>GRO-000-533</sku> + </item> + </data> + </top> + </pre> <p id="doc_section_10_1_p_9">HMTL output:</p> +<div id="doc_figure_u.201"></div> <pre> + % ./testxo --libxo pretty,html + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name">gum</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold">1412.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">54</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order">10</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku">GRO-000-415</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name">rope</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold">85.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">4</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order">2</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku">HRD-000-212</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name">ladder</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold">0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">2</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order">1</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku">HRD-000-517</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name">bolt</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold">4123.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">144</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order">42</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku">HRD-000-632</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name">water</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold">17.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">14</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order">2</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku">GRO-000-2331</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name">fish</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold">1321.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock">45</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order">1</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku">GRO-000-533</div> + </div> + </pre> <p id="doc_section_10_1_p_11">HTML output with xpath and info flags:</p> +<div id="doc_figure_u.202"></div> <pre> + % ./testxo --libxo pretty,html,xpath,info + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name" + data-xpath="/top/data/item/name" data-type="string" + data-help="Name of the item">gum</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold" + data-xpath="/top/data/item/sold" data-type="number" + data-help="Number of items sold">1412.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" data-type="number" + data-help="Number of items in stock">54</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order" + data-xpath="/top/data/item/on-order" data-type="number" + data-help="Number of items on order">10</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku" + data-xpath="/top/data/item/sku" data-type="string" + data-help="Stock Keeping Unit">GRO-000-415</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name" + data-xpath="/top/data/item/name" data-type="string" + data-help="Name of the item">rope</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold" + data-xpath="/top/data/item/sold" data-type="number" + data-help="Number of items sold">85.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" data-type="number" + data-help="Number of items in stock">4</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order" + data-xpath="/top/data/item/on-order" data-type="number" + data-help="Number of items on order">2</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku" + data-xpath="/top/data/item/sku" data-type="string" + data-help="Stock Keeping Unit">HRD-000-212</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name" + data-xpath="/top/data/item/name" data-type="string" + data-help="Name of the item">ladder</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold" + data-xpath="/top/data/item/sold" data-type="number" + data-help="Number of items sold">0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" data-type="number" + data-help="Number of items in stock">2</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order" + data-xpath="/top/data/item/on-order" data-type="number" + data-help="Number of items on order">1</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku" + data-xpath="/top/data/item/sku" data-type="string" + data-help="Stock Keeping Unit">HRD-000-517</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name" + data-xpath="/top/data/item/name" data-type="string" + data-help="Name of the item">bolt</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold" + data-xpath="/top/data/item/sold" data-type="number" + data-help="Number of items sold">4123.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" data-type="number" + data-help="Number of items in stock">144</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order" + data-xpath="/top/data/item/on-order" data-type="number" + data-help="Number of items on order">42</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku" + data-xpath="/top/data/item/sku" data-type="string" + data-help="Stock Keeping Unit">HRD-000-632</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name" + data-xpath="/top/data/item/name" data-type="string" + data-help="Name of the item">water</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold" + data-xpath="/top/data/item/sold" data-type="number" + data-help="Number of items sold">17.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" data-type="number" + data-help="Number of items in stock">14</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order" + data-xpath="/top/data/item/on-order" data-type="number" + data-help="Number of items on order">2</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku" + data-xpath="/top/data/item/sku" data-type="string" + data-help="Stock Keeping Unit">GRO-000-2331</div> + </div> + <div class="line"> + <div class="label">Item</div> + <div class="text"> '</div> + <div class="data" data-tag="name" + data-xpath="/top/data/item/name" data-type="string" + data-help="Name of the item">fish</div> + <div class="text">':</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">Total sold</div> + <div class="text">: </div> + <div class="data" data-tag="sold" + data-xpath="/top/data/item/sold" data-type="number" + data-help="Number of items sold">1321.0</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">In stock</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="in-stock" + data-xpath="/top/data/item/in-stock" data-type="number" + data-help="Number of items in stock">45</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">On order</div> + <div class="decoration">:</div> + <div class="padding"> </div> + <div class="data" data-tag="on-order" + data-xpath="/top/data/item/on-order" data-type="number" + data-help="Number of items on order">1</div> + </div> + <div class="line"> + <div class="padding"> </div> + <div class="label">SKU</div> + <div class="text">: </div> + <div class="data" data-tag="sku" + data-xpath="/top/data/item/sku" data-type="string" + data-help="Stock Keeping Unit">GRO-000-533</div> + </div> + </pre> </div> +</div> +<div class="content"></div> +<hr class="noprint"> +<div class="content"> +<h1 id="doc.authors" class="np"><a href="#doc.authors">Author's Address</a></h1> +<address class="vcard"> +<span class="vcardline"><span class="fn">Phil Shafer</span><span class="n hidden"><span class="family-name">Shafer</span><span class="given-name">Phil</span></span></span><span class="org vcardline">Juniper Networks</span><span class="vcardline">EMail: <a href="mailto:phil@juniper.net"><span class="email">phil@juniper.net</span></a></span> +</address> +</div> +</body> +</html> |