From 5467fb025537eb92313fd3a557b2051cb41ba5e8 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 6 Oct 2006 15:36:29 +0100 Subject: =?UTF-8?q?[MTD=20NAND]=20Initial=20import=20of=20CAF=C3=89=20NAND?= =?UTF-8?q?=20driver.?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/Kconfig | 7 + drivers/mtd/nand/Makefile | 1 + drivers/mtd/nand/cafe_nand.c | 635 +++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 643 insertions(+) create mode 100644 drivers/mtd/nand/cafe_nand.c (limited to 'drivers') diff --git a/drivers/mtd/nand/Kconfig b/drivers/mtd/nand/Kconfig index c99302e..5e97e63 100644 --- a/drivers/mtd/nand/Kconfig +++ b/drivers/mtd/nand/Kconfig @@ -232,6 +232,13 @@ config MTD_NAND_CS553X If you say "m", the module will be called "cs553x_nand.ko". +config MTD_NAND_CAFE + tristate "NAND support for OLPC CAFÉ chip" + depends on PCI + help + Use NAND flash attached to the CAFÉ chip designed for the $100 + laptop. + config MTD_NAND_NANDSIM tristate "Support for NAND Flash Simulator" depends on MTD_NAND && MTD_PARTITIONS diff --git a/drivers/mtd/nand/Makefile b/drivers/mtd/nand/Makefile index f747593..9346b83 100644 --- a/drivers/mtd/nand/Makefile +++ b/drivers/mtd/nand/Makefile @@ -6,6 +6,7 @@ obj-$(CONFIG_MTD_NAND) += nand.o nand_ecc.o obj-$(CONFIG_MTD_NAND_IDS) += nand_ids.o +obj-$(CONFIG_MTD_NAND_CAFE) += cafe_nand.o obj-$(CONFIG_MTD_NAND_SPIA) += spia.o obj-$(CONFIG_MTD_NAND_AMS_DELTA) += ams-delta.o obj-$(CONFIG_MTD_NAND_TOTO) += toto.o diff --git a/drivers/mtd/nand/cafe_nand.c b/drivers/mtd/nand/cafe_nand.c new file mode 100644 index 0000000..8d7a795 --- /dev/null +++ b/drivers/mtd/nand/cafe_nand.c @@ -0,0 +1,635 @@ +/* + * cafe_nand.c + * + * Copyright © 2006 Red Hat, Inc. + * Copyright © 2006 David Woodhouse + */ + +//#define DEBUG + +#include +#undef DEBUG +#include +#include +#include +#include +#include +#include + +#define CAFE_NAND_CTRL1 0x00 +#define CAFE_NAND_CTRL2 0x04 +#define CAFE_NAND_CTRL3 0x08 +#define CAFE_NAND_STATUS 0x0c +#define CAFE_NAND_IRQ 0x10 +#define CAFE_NAND_IRQ_MASK 0x14 +#define CAFE_NAND_DATA_LEN 0x18 +#define CAFE_NAND_ADDR1 0x1c +#define CAFE_NAND_ADDR2 0x20 +#define CAFE_NAND_TIMING1 0x24 +#define CAFE_NAND_TIMING2 0x28 +#define CAFE_NAND_TIMING3 0x2c +#define CAFE_NAND_NONMEM 0x30 +#define CAFE_NAND_DMA_CTRL 0x40 +#define CAFE_NAND_DMA_ADDR0 0x44 +#define CAFE_NAND_DMA_ADDR1 0x48 +#define CAFE_NAND_READ_DATA 0x1000 +#define CAFE_NAND_WRITE_DATA 0x2000 + +struct cafe_priv { + struct nand_chip nand; + struct pci_dev *pdev; + void __iomem *mmio; + uint32_t ctl1; + uint32_t ctl2; + int datalen; + int nr_data; + int data_pos; + int page_addr; + dma_addr_t dmaaddr; + unsigned char *dmabuf; + +}; + +static int usedma = 1; +module_param(usedma, int, 0644); + +static int cafe_device_ready(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); + + uint32_t irqs = readl(cafe->mmio + 0x10); + writel(irqs, cafe->mmio+0x10); + dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", + result?"":" not", irqs, readl(cafe->mmio + 0x10), + readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + return result; +} + + +static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(cafe->dmabuf + cafe->datalen, buf, len); + else + memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); + cafe->datalen += len; + + dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", + len, cafe->datalen); +} + +static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(buf, cafe->dmabuf + cafe->datalen, len); + else + memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); + + dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", + len, cafe->datalen); + cafe->datalen += len; +} + +static uint8_t cafe_read_byte(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + uint8_t d; + + cafe_read_buf(mtd, &d, 1); + dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); + + return d; +} + +static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, + int column, int page_addr) +{ + struct cafe_priv *cafe = mtd->priv; + int adrbytes = 0; + uint32_t ctl1; + uint32_t doneint = 0x80000000; + int i; + + dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", + command, column, page_addr); + + if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { + /* Second half of a command we already calculated */ + writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); + ctl1 = cafe->ctl1; + dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", + cafe->ctl1, cafe->nr_data); + goto do_command; + } + /* Reset ECC engine */ + writel(0, cafe->mmio + CAFE_NAND_CTRL2); + + /* Emulate NAND_CMD_READOOB on large-page chips */ + if (mtd->writesize > 512 && + command == NAND_CMD_READOOB) { + column += mtd->writesize; + command = NAND_CMD_READ0; + } + + /* FIXME: Do we need to send read command before sending data + for small-page chips, to position the buffer correctly? */ + + if (column != -1) { + writel(column, cafe->mmio + 0x1c); + adrbytes = 2; + if (page_addr != -1) + goto write_adr2; + } else if (page_addr != -1) { + writel(page_addr & 0xffff, cafe->mmio + 0x1c); + page_addr >>= 16; + write_adr2: + writel(page_addr, cafe->mmio+0x20); + adrbytes += 2; + if (mtd->size > mtd->writesize << 16) + adrbytes++; + } + + cafe->data_pos = cafe->datalen = 0; + + /* Set command valid bit */ + ctl1 = 0x80000000 | command; + + /* Set RD or WR bits as appropriate */ + if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { + ctl1 |= (1<<26); /* rd */ + /* Always 5 bytes, for now */ + cafe->datalen = 5; + /* And one address cycle -- even for STATUS, since the controller doesn't work without */ + adrbytes = 1; + } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || + command == NAND_CMD_READOOB || command == NAND_CMD_RNDOUT) { + ctl1 |= 1<<26; /* rd */ + /* For now, assume just read to end of page */ + cafe->datalen = mtd->writesize + mtd->oobsize - column; + } else if (command == NAND_CMD_SEQIN) + ctl1 |= 1<<25; /* wr */ + + /* Set number of address bytes */ + if (adrbytes) + ctl1 |= ((adrbytes-1)|8) << 27; + + if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { + /* Ignore the first command of a pair; the hardware + deals with them both at once, later */ + cafe->ctl1 = ctl1; + cafe->ctl2 = 0; + dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", + cafe->ctl1, cafe->datalen); + return; + } + /* RNDOUT and READ0 commands need a following byte */ + if (command == NAND_CMD_RNDOUT) + writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); + else if (command == NAND_CMD_READ0 && mtd->writesize > 512) + writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); + + do_command: + if (cafe->datalen == 2112) + cafe->datalen = 2062; + dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + /* NB: The datasheet lies -- we really should be subtracting 1 here */ + writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); + writel(0x90000000, cafe->mmio + 0x10); + if (usedma && (ctl1 & (3<<25))) { + uint32_t dmactl = 0xc0000000 + cafe->datalen; + /* If WR or RD bits set, set up DMA */ + if (ctl1 & (1<<26)) { + /* It's a read */ + dmactl |= (1<<29); + /* ... so it's done when the DMA is done, not just + the command. */ + doneint = 0x10000000; + } + writel(dmactl, cafe->mmio + 0x40); + } +#if 0 + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); +#endif + cafe->datalen = 0; + +#if 0 + printk("About to write command %08x\n", ctl1); + for (i=0; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); +#endif + writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); + /* Apply this short delay always to ensure that we do wait tWB in + * any case on any machine. */ + ndelay(100); + + if (1) { + int c = 50000; + uint32_t irqs; + + while (c--) { + irqs = readl(cafe->mmio + 0x10); + if (irqs & doneint) + break; + udelay(1); + if (!(c & 1000)) + dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); + cpu_relax(); + } + writel(doneint, cafe->mmio + 0x10); + dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + 0x10)); + } + + + cafe->ctl2 &= ~(1<<8); + cafe->ctl2 &= ~(1<<30); + + switch (command) { + + case NAND_CMD_CACHEDPROG: + case NAND_CMD_PAGEPROG: + case NAND_CMD_ERASE1: + case NAND_CMD_ERASE2: + case NAND_CMD_SEQIN: + case NAND_CMD_RNDIN: + case NAND_CMD_STATUS: + case NAND_CMD_DEPLETE1: + case NAND_CMD_RNDOUT: + case NAND_CMD_STATUS_ERROR: + case NAND_CMD_STATUS_ERROR0: + case NAND_CMD_STATUS_ERROR1: + case NAND_CMD_STATUS_ERROR2: + case NAND_CMD_STATUS_ERROR3: + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + return; + } + nand_wait_ready(mtd); + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); +} + +static void cafe_select_chip(struct mtd_info *mtd, int chipnr) +{ + //struct cafe_priv *cafe = mtd->priv; + // dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); +} +static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) +{ + struct mtd_info *mtd = id; + struct cafe_priv *cafe = mtd->priv; + uint32_t irqs = readl(cafe->mmio + 0x10); + writel(irqs & ~0x90000000, cafe->mmio + 0x10); + if (!irqs) + return IRQ_NONE; + + dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + 0x10)); + return IRQ_HANDLED; +} + +static void cafe_nand_bug(struct mtd_info *mtd) +{ + BUG(); +} + +static int cafe_nand_write_oob(struct mtd_info *mtd, + struct nand_chip *chip, int page) +{ + int status = 0; + + WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, mtd->writesize, page); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + + return status & NAND_STATUS_FAIL ? -EIO : 0; +} + +/* Don't use -- use nand_read_oob_std for now */ +static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, + int page, int sndcmd) +{ + chip->cmdfunc(mtd, NAND_CMD_READOOB, 0, page); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + return 1; +} +/** + * cafe_nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read + * @mtd: mtd info structure + * @chip: nand chip info structure + * @buf: buffer to store read data + * + * The hw generator calculates the error syndrome automatically. Therefor + * we need a special oob layout and handling. + */ +static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, + uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + WARN_ON(chip->oob_poi != chip->buffers->oobrbuf); + + dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); + + chip->read_buf(mtd, buf, mtd->writesize); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + + return 0; +} + +static char foo[14]; +static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, + struct nand_chip *chip, const uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); + + chip->write_buf(mtd, buf, mtd->writesize); + chip->write_buf(mtd, foo, 14); + // chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + + /* Set up ECC autogeneration */ + cafe->ctl2 |= (1<<27) | (1<<30); + if (mtd->writesize == 2048) + cafe->ctl2 |= (1<<29); +} + +static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, + const uint8_t *buf, int page, int cached, int raw) +{ + int status; + + WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, 0x00, page); + + if (unlikely(raw)) + chip->ecc.write_page_raw(mtd, chip, buf); + else + chip->ecc.write_page(mtd, chip, buf); + + /* + * Cached progamming disabled for now, Not sure if its worth the + * trouble. The speed gain is not very impressive. (2.3->2.6Mib/s) + */ + cached = 0; + + if (!cached || !(chip->options & NAND_CACHEPRG)) { + + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + /* + * See if operation failed and additional status checks are + * available + */ + if ((status & NAND_STATUS_FAIL) && (chip->errstat)) + status = chip->errstat(mtd, chip, FL_WRITING, status, + page); + + if (status & NAND_STATUS_FAIL) + return -EIO; + } else { + chip->cmdfunc(mtd, NAND_CMD_CACHEDPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + } + +#ifdef CONFIG_MTD_NAND_VERIFY_WRITE + /* Send command to read back the data */ + chip->cmdfunc(mtd, NAND_CMD_READ0, 0, page); + + if (chip->verify_buf(mtd, buf, mtd->writesize)) + return -EIO; +#endif + return 0; +} + + +static int __devinit cafe_nand_probe(struct pci_dev *pdev, + const struct pci_device_id *ent) +{ + struct mtd_info *mtd; + struct cafe_priv *cafe; + uint32_t ctrl; + int err = 0; + + err = pci_enable_device(pdev); + if (err) + return err; + + pci_set_master(pdev); + + mtd = kzalloc(sizeof(*mtd) + sizeof(struct cafe_priv), GFP_KERNEL); + if (!mtd) { + dev_warn(&pdev->dev, "failed to alloc mtd_info\n"); + return -ENOMEM; + } + cafe = (void *)(&mtd[1]); + + mtd->priv = cafe; + mtd->owner = THIS_MODULE; + + cafe->pdev = pdev; + cafe->mmio = pci_iomap(pdev, 0, 0); + if (!cafe->mmio) { + dev_warn(&pdev->dev, "failed to iomap\n"); + err = -ENOMEM; + goto out_free_mtd; + } + cafe->dmabuf = dma_alloc_coherent(&cafe->pdev->dev, 2112 + sizeof(struct nand_buffers), + &cafe->dmaaddr, GFP_KERNEL); + if (!cafe->dmabuf) { + err = -ENOMEM; + goto out_ior; + } + cafe->nand.buffers = (void *)cafe->dmabuf + 2112; + + cafe->nand.cmdfunc = cafe_nand_cmdfunc; + cafe->nand.dev_ready = cafe_device_ready; + cafe->nand.read_byte = cafe_read_byte; + cafe->nand.read_buf = cafe_read_buf; + cafe->nand.write_buf = cafe_write_buf; + cafe->nand.select_chip = cafe_select_chip; + + cafe->nand.chip_delay = 0; + + /* Enable the following for a flash based bad block table */ + cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; + + /* Timings from Marvell's test code (not verified or calculated by us) */ + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); +#if 1 + writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); + writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); + writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); +#else + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); +#endif + writel(0xdfffffff, cafe->mmio + 0x14); + err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); + if (err) { + dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); + + goto out_free_dma; + } +#if 1 + /* Disable master reset, enable NAND clock */ + ctrl = readl(cafe->mmio + 0x3004); + ctrl &= 0xffffeff0; + ctrl |= 0x00007000; + writel(ctrl | 0x05, cafe->mmio + 0x3004); + writel(ctrl | 0x0a, cafe->mmio + 0x3004); + writel(0, cafe->mmio + 0x40); + + writel(0x7006, cafe->mmio + 0x3004); + writel(0x700a, cafe->mmio + 0x3004); + + /* Set up DMA address */ + writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); + if (sizeof(cafe->dmaaddr) > 4) + writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); + else + writel(0, cafe->mmio + 0x48); + dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", + readl(cafe->mmio+0x44), cafe->dmabuf); + + /* Enable NAND IRQ in global IRQ mask register */ + writel(0x80000007, cafe->mmio + 0x300c); + dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", + readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); +#endif +#if 1 + mtd->writesize=2048; + mtd->oobsize = 0x40; + memset(cafe->dmabuf, 0xa5, 2112); + cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + cafe->nand.cmdfunc(mtd, NAND_CMD_READ0, 0, 0); + // nand_wait_ready(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + writel(0x84600070, cafe->mmio); + udelay(10); + dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); +#endif + /* Scan to find existance of the device */ + if (nand_scan_ident(mtd, 1)) { + err = -ENXIO; + goto out_irq; + } + + cafe->ctl2 = 1<<27; /* Reed-Solomon ECC */ + if (mtd->writesize == 2048) + cafe->ctl2 |= 1<<29; /* 2KiB page size */ + + /* Set up ECC according to the type of chip we found */ + if (mtd->writesize == 512 || mtd->writesize == 2048) { + cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; + cafe->nand.ecc.size = mtd->writesize; + cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; + cafe->nand.ecc.calculate = (void *)cafe_nand_bug; + cafe->nand.ecc.correct = (void *)cafe_nand_bug; + cafe->nand.write_page = cafe_nand_write_page; + cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; + cafe->nand.ecc.write_oob = cafe_nand_write_oob; + cafe->nand.ecc.read_page = cafe_nand_read_page; + cafe->nand.ecc.read_oob = cafe_nand_read_oob; + + } else { + printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", + mtd->writesize); + cafe->nand.ecc.mode = NAND_ECC_NONE; + } + + err = nand_scan_tail(mtd); + if (err) + goto out_irq; + + + pci_set_drvdata(pdev, mtd); + add_mtd_device(mtd); + goto out; + + out_irq: + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + out_free_dma: + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + out_ior: + pci_iounmap(pdev, cafe->mmio); + out_free_mtd: + kfree(mtd); + out: + return err; +} + +static void __devexit cafe_nand_remove(struct pci_dev *pdev) +{ + struct mtd_info *mtd = pci_get_drvdata(pdev); + struct cafe_priv *cafe = mtd->priv; + + del_mtd_device(mtd); + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + nand_release(mtd); + pci_iounmap(pdev, cafe->mmio); + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + kfree(mtd); +} + +static struct pci_device_id cafe_nand_tbl[] = { + { 0x11ab, 0x4100, PCI_ANY_ID, PCI_ANY_ID, PCI_CLASS_MEMORY_FLASH << 8, 0xFFFF0 } +}; + +MODULE_DEVICE_TABLE(pci, cafe_nand_tbl); + +static struct pci_driver cafe_nand_pci_driver = { + .name = "CAFÉ NAND", + .id_table = cafe_nand_tbl, + .probe = cafe_nand_probe, + .remove = __devexit_p(cafe_nand_remove), +#ifdef CONFIG_PMx + .suspend = cafe_nand_suspend, + .resume = cafe_nand_resume, +#endif +}; + +static int cafe_nand_init(void) +{ + return pci_register_driver(&cafe_nand_pci_driver); +} + +static void cafe_nand_exit(void) +{ + pci_unregister_driver(&cafe_nand_pci_driver); +} +module_init(cafe_nand_init); +module_exit(cafe_nand_exit); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("David Woodhouse "); +MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); + +/* Correct ECC for 2048 bytes of 0xff: + 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ -- cgit v1.1 From 1ef93a0f668c8736cb6b6c3a43a5b8101efa24af Mon Sep 17 00:00:00 2001 From: Adrian Bunk Date: Mon, 9 Oct 2006 01:16:38 +0200 Subject: [MTD] SSFDC must depend on BLOCK MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This patch fixes the following compile error with CONFIG_SSFDC=m, CONFIG_BLOCK=n: <-- snip --> ... CC [M] drivers/mtd/mtd_blkdevs.o /home/bunk/linux/kernel-2.6/git/linux-2.6/drivers/mtd/mtd_blkdevs.c:40: warning: ‘struct request’ declared inside parameter list /home/bunk/linux/kernel-2.6/git/linux-2.6/drivers/mtd/mtd_blkdevs.c:40: warning: its scope is only this definition or declaration, which is probably not what you want /home/bunk/linux/kernel-2.6/git/linux-2.6/drivers/mtd/mtd_blkdevs.c: In function ‘do_blktrans_request’: /home/bunk/linux/kernel-2.6/git/linux-2.6/drivers/mtd/mtd_blkdevs.c:45: error: dereferencing pointer to incomplete type ... make[3]: *** [drivers/mtd/mtd_blkdevs.o] Error 1 <-- snip --> Bug report by Jesper Juhl. This patch also removes a pointless "default n" from the SSFDC option. Signed-off-by: Adrian Bunk Signed-off-by: David Woodhouse --- drivers/mtd/Kconfig | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/Kconfig b/drivers/mtd/Kconfig index a304b34..291660a 100644 --- a/drivers/mtd/Kconfig +++ b/drivers/mtd/Kconfig @@ -265,8 +265,7 @@ config RFD_FTL config SSFDC tristate "NAND SSFDC (SmartMedia) read only translation layer" - depends on MTD - default n + depends on MTD && BLOCK help This enables read only access to SmartMedia formatted NAND flash. You can mount it with FAT file system. -- cgit v1.1 From 8dd851de8184bb39c4ea86de20a0ed2496e6eb0d Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 20 Oct 2006 02:11:40 +0100 Subject: =?UTF-8?q?[MTD=20NAND]=20OLPC=20CAF=C3=89=20driver=20update?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit - Fix OOB handling, bad block table marker placement - Some cleanups, enable runtime-optional debugging - Allow BBT stuff to be skipped Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe_nand.c | 135 +++++++++++++++++++++++++++++++------------ 1 file changed, 99 insertions(+), 36 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe_nand.c b/drivers/mtd/nand/cafe_nand.c index 8d7a795..60cb019 100644 --- a/drivers/mtd/nand/cafe_nand.c +++ b/drivers/mtd/nand/cafe_nand.c @@ -5,7 +5,7 @@ * Copyright © 2006 David Woodhouse */ -//#define DEBUG +#define DEBUG #include #undef DEBUG @@ -53,15 +53,24 @@ struct cafe_priv { static int usedma = 1; module_param(usedma, int, 0644); +static int skipbbt = 0; +module_param(skipbbt, int, 0644); + +static int debug = 0; +module_param(debug, int, 0644); + +#define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) + + static int cafe_device_ready(struct mtd_info *mtd) { struct cafe_priv *cafe = mtd->priv; int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - uint32_t irqs = readl(cafe->mmio + 0x10); - writel(irqs, cafe->mmio+0x10); - dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", - result?"":" not", irqs, readl(cafe->mmio + 0x10), + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", + result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); return result; } @@ -77,7 +86,7 @@ static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); cafe->datalen += len; - dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", len, cafe->datalen); } @@ -90,7 +99,7 @@ static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) else memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); - dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", len, cafe->datalen); cafe->datalen += len; } @@ -101,7 +110,7 @@ static uint8_t cafe_read_byte(struct mtd_info *mtd) uint8_t d; cafe_read_buf(mtd, &d, 1); - dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); + cafe_dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); return d; } @@ -115,14 +124,14 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, uint32_t doneint = 0x80000000; int i; - dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", + cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", command, column, page_addr); if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { /* Second half of a command we already calculated */ writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); ctl1 = cafe->ctl1; - dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", + cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); goto do_command; } @@ -163,7 +172,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { ctl1 |= (1<<26); /* rd */ /* Always 5 bytes, for now */ - cafe->datalen = 5; + cafe->datalen = 4; /* And one address cycle -- even for STATUS, since the controller doesn't work without */ adrbytes = 1; } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || @@ -183,7 +192,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, deals with them both at once, later */ cafe->ctl1 = ctl1; cafe->ctl2 = 0; - dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", + cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", cafe->ctl1, cafe->datalen); return; } @@ -194,13 +203,14 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); do_command: - if (cafe->datalen == 2112) - cafe->datalen = 2062; - dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + // ECC on read only works if we ... + // if (cafe->datalen == 2112) + // cafe->datalen = 2062; + cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); /* NB: The datasheet lies -- we really should be subtracting 1 here */ writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); - writel(0x90000000, cafe->mmio + 0x10); + writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); if (usedma && (ctl1 & (3<<25))) { uint32_t dmactl = 0xc0000000 + cafe->datalen; /* If WR or RD bits set, set up DMA */ @@ -230,20 +240,20 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, ndelay(100); if (1) { - int c = 50000; + int c = 500000; uint32_t irqs; while (c--) { - irqs = readl(cafe->mmio + 0x10); + irqs = readl(cafe->mmio + CAFE_NAND_IRQ); if (irqs & doneint) break; udelay(1); - if (!(c & 1000)) - dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); + if (!(c % 100000)) + cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); cpu_relax(); } - writel(doneint, cafe->mmio + 0x10); - dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + 0x10)); + writel(doneint, cafe->mmio + CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); } @@ -276,18 +286,18 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, static void cafe_select_chip(struct mtd_info *mtd, int chipnr) { //struct cafe_priv *cafe = mtd->priv; - // dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); + // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); } static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) { struct mtd_info *mtd = id; struct cafe_priv *cafe = mtd->priv; - uint32_t irqs = readl(cafe->mmio + 0x10); - writel(irqs & ~0x90000000, cafe->mmio + 0x10); + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); if (!irqs) return IRQ_NONE; - dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + 0x10)); + cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); return IRQ_HANDLED; } @@ -335,7 +345,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, WARN_ON(chip->oob_poi != chip->buffers->oobrbuf); - dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); + cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); @@ -343,7 +353,44 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, return 0; } -static char foo[14]; +static struct nand_ecclayout cafe_oobinfo_2048 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 50}} +}; + +/* Ick. The BBT code really ought to be able to work this bit out + for itself from the above */ +static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; +static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; + +static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_bbt_pattern +}; + +static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_mirror_pattern +}; + +static struct nand_ecclayout cafe_oobinfo_512 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 2}} +}; + + static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, struct nand_chip *chip, const uint8_t *buf) { @@ -352,8 +399,7 @@ static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); chip->write_buf(mtd, buf, mtd->writesize); - chip->write_buf(mtd, foo, 14); - // chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); /* Set up ECC autogeneration */ cafe->ctl2 |= (1<<27) | (1<<30); @@ -410,6 +456,10 @@ static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, return 0; } +static int cafe_nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) +{ + return 0; +} static int __devinit cafe_nand_probe(struct pci_dev *pdev, const struct pci_device_id *ent) @@ -461,6 +511,11 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, /* Enable the following for a flash based bad block table */ cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; + + if (skipbbt) { + cafe->nand.options |= NAND_SKIP_BBTSCAN; + cafe->nand.block_bad = cafe_nand_block_bad; + } /* Timings from Marvell's test code (not verified or calculated by us) */ writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); @@ -473,7 +528,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); #endif - writel(0xdfffffff, cafe->mmio + 0x14); + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); @@ -498,18 +553,18 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); else writel(0, cafe->mmio + 0x48); - dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", + cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", readl(cafe->mmio+0x44), cafe->dmabuf); /* Enable NAND IRQ in global IRQ mask register */ writel(0x80000007, cafe->mmio + 0x300c); - dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", + cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); #endif #if 1 mtd->writesize=2048; mtd->oobsize = 0x40; - memset(cafe->dmabuf, 0xa5, 2112); + memset(cafe->dmabuf, 0x5a, 2112); cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); cafe->nand.read_byte(mtd); cafe->nand.read_byte(mtd); @@ -528,7 +583,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, #if 0 writel(0x84600070, cafe->mmio); udelay(10); - dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); + cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); #endif /* Scan to find existance of the device */ if (nand_scan_ident(mtd, 1)) { @@ -545,6 +600,9 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; cafe->nand.ecc.size = mtd->writesize; cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.layout = &cafe_oobinfo_2048; + cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; + cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; cafe->nand.ecc.calculate = (void *)cafe_nand_bug; cafe->nand.ecc.correct = (void *)cafe_nand_bug; @@ -564,7 +622,6 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, if (err) goto out_irq; - pci_set_drvdata(pdev, mtd); add_mtd_device(mtd); goto out; @@ -633,3 +690,9 @@ MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); /* Correct ECC for 2048 bytes of 0xff: 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ + +/* dwmw2's B-test board, in case of completely screwing it: +Bad eraseblock 2394 at 0x12b40000 +Bad eraseblock 2627 at 0x14860000 +Bad eraseblock 3349 at 0x1a2a0000 +*/ -- cgit v1.1 From c9073ce02adfa273a3d6d53eac8c4c035510ad9c Mon Sep 17 00:00:00 2001 From: Ryan Jackson Date: Fri, 20 Oct 2006 14:41:01 -0700 Subject: [MTD] MAPS: Add parameter to amd76xrom to override rom window size The 2 bits controlling the window size are often set to allow reading the BIOS, but too small to allow writing, since the lock registers are 4MiB lower in the address space than the data. This is intended to prevent flashing the bios, perhaps accidentally. The bits are 6 and 7. If both bits are set, it is a 5MiB window. If only the 7 Bit is set, it is a 4MiB window. Otherwise, it is a 64KiB window. This parameter allows the driver to override the BIOS settings. Signed-off-by: Ryan Jackson Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/maps/amd76xrom.c | 34 ++++++++++++++++++++++++++++------ 1 file changed, 28 insertions(+), 6 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/amd76xrom.c b/drivers/mtd/maps/amd76xrom.c index 797caff..78b6711 100644 --- a/drivers/mtd/maps/amd76xrom.c +++ b/drivers/mtd/maps/amd76xrom.c @@ -7,6 +7,7 @@ #include #include +#include #include #include #include @@ -44,6 +45,23 @@ struct amd76xrom_map_info { char map_name[sizeof(MOD_NAME) + 2 + ADDRESS_NAME_LEN]; }; +/* The 2 bits controlling the window size are often set to allow reading + * the BIOS, but too small to allow writing, since the lock registers are + * 4MiB lower in the address space than the data. + * + * This is intended to prevent flashing the bios, perhaps accidentally. + * + * This parameter allows the normal driver to over-ride the BIOS settings. + * + * The bits are 6 and 7. If both bits are set, it is a 5MiB window. + * If only the 7 Bit is set, it is a 4MiB window. Otherwise, a + * 64KiB window. + * + */ +static uint win_size_bits; +module_param(win_size_bits, uint, 0); +MODULE_PARM_DESC(win_size_bits, "ROM window size bits override for 0x43 byte, normally set by BIOS."); + static struct amd76xrom_window amd76xrom_window = { .maps = LIST_HEAD_INIT(amd76xrom_window.maps), }; @@ -95,6 +113,16 @@ static int __devinit amd76xrom_init_one (struct pci_dev *pdev, /* Remember the pci dev I find the window in - already have a ref */ window->pdev = pdev; + /* Enable the selected rom window. This is often incorrectly + * set up by the BIOS, and the 4MiB offset for the lock registers + * requires the full 5MiB of window space. + * + * This 'write, then read' approach leaves the bits for + * other uses of the hardware info. + */ + pci_read_config_byte(pdev, 0x43, &byte); + pci_write_config_byte(pdev, 0x43, byte | win_size_bits ); + /* Assume the rom window is properly setup, and find it's size */ pci_read_config_byte(pdev, 0x43, &byte); if ((byte & ((1<<7)|(1<<6))) == ((1<<7)|(1<<6))) { @@ -129,12 +157,6 @@ static int __devinit amd76xrom_init_one (struct pci_dev *pdev, (unsigned long long)window->rsrc.end); } -#if 0 - - /* Enable the selected rom window */ - pci_read_config_byte(pdev, 0x43, &byte); - pci_write_config_byte(pdev, 0x43, byte | rwindow->segen_bits); -#endif /* Enable writes through the rom window */ pci_read_config_byte(pdev, 0x40, &byte); -- cgit v1.1 From 89072ef99367cd6fab37b85d6a59a575084c2d2c Mon Sep 17 00:00:00 2001 From: Ryan Jackson Date: Fri, 20 Oct 2006 14:41:03 -0700 Subject: [MTD] CHIPS: Support for SST 49LF040B flash chip Add chip driver and JEDEC probe support for the SST 49LF040B flash chip. Signed-off-by: Ryan Jackson Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/chips/cfi_cmdset_0002.c | 8 ++++++-- drivers/mtd/chips/jedec_probe.c | 15 +++++++++++++++ 2 files changed, 21 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/chips/cfi_cmdset_0002.c b/drivers/mtd/chips/cfi_cmdset_0002.c index 702ae4c..ca0882b 100644 --- a/drivers/mtd/chips/cfi_cmdset_0002.c +++ b/drivers/mtd/chips/cfi_cmdset_0002.c @@ -48,6 +48,7 @@ #define MANUFACTURER_ATMEL 0x001F #define MANUFACTURER_SST 0x00BF #define SST49LF004B 0x0060 +#define SST49LF040B 0x0050 #define SST49LF008A 0x005a #define AT49BV6416 0x00d6 @@ -233,6 +234,7 @@ static struct cfi_fixup cfi_fixup_table[] = { }; static struct cfi_fixup jedec_fixup_table[] = { { MANUFACTURER_SST, SST49LF004B, fixup_use_fwh_lock, NULL, }, + { MANUFACTURER_SST, SST49LF040B, fixup_use_fwh_lock, NULL, }, { MANUFACTURER_SST, SST49LF008A, fixup_use_fwh_lock, NULL, }, { 0, 0, NULL, NULL } }; @@ -519,10 +521,12 @@ static int get_chip(struct map_info *map, struct flchip *chip, unsigned long adr if (mode == FL_WRITING) /* FIXME: Erase-suspend-program appears broken. */ goto sleep; - if (!(mode == FL_READY || mode == FL_POINT + if (!( mode == FL_READY + || mode == FL_POINT || !cfip || (mode == FL_WRITING && (cfip->EraseSuspend & 0x2)) - || (mode == FL_WRITING && (cfip->EraseSuspend & 0x1)))) + || (mode == FL_WRITING && (cfip->EraseSuspend & 0x1) + ))) goto sleep; /* We could check to see if we're trying to access the sector diff --git a/drivers/mtd/chips/jedec_probe.c b/drivers/mtd/chips/jedec_probe.c index 1154dac..63d1287 100644 --- a/drivers/mtd/chips/jedec_probe.c +++ b/drivers/mtd/chips/jedec_probe.c @@ -154,6 +154,7 @@ #define SST39SF010A 0x00B5 #define SST39SF020A 0x00B6 #define SST49LF004B 0x0060 +#define SST49LF040B 0x0050 #define SST49LF008A 0x005a #define SST49LF030A 0x001C #define SST49LF040A 0x0051 @@ -1401,6 +1402,20 @@ static const struct amd_flash_info jedec_table[] = { } }, { .mfr_id = MANUFACTURER_SST, + .dev_id = SST49LF040B, + .name = "SST 49LF040B", + .uaddr = { + [0] = MTD_UADDR_0x5555_0x2AAA /* x8 */ + }, + .DevSize = SIZE_512KiB, + .CmdSet = P_ID_AMD_STD, + .NumEraseRegions= 1, + .regions = { + ERASEINFO(0x01000,128), + } + }, { + + .mfr_id = MANUFACTURER_SST, .dev_id = SST49LF004B, .name = "SST 49LF004B", .uaddr = { -- cgit v1.1 From 29175778b07aa60e7f8030bd95d69f70070cc1f7 Mon Sep 17 00:00:00 2001 From: Lew Glendenning Date: Fri, 20 Oct 2006 14:41:04 -0700 Subject: [MTD] MAPS: Support for BIOS flash chips on Intel ESB2 southbridge Add MTD map driver for BIOS flash chips connected to the Intel ESB2 southbridge. [akpm@osdl.org: coding-style fixes, build fix] Signed-off-by: Ryan Jackson Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/maps/Kconfig | 9 + drivers/mtd/maps/Makefile | 1 + drivers/mtd/maps/esb2rom.c | 449 +++++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 459 insertions(+) create mode 100644 drivers/mtd/maps/esb2rom.c (limited to 'drivers') diff --git a/drivers/mtd/maps/Kconfig b/drivers/mtd/maps/Kconfig index 24747bd..7514a9b 100644 --- a/drivers/mtd/maps/Kconfig +++ b/drivers/mtd/maps/Kconfig @@ -184,6 +184,15 @@ config MTD_ICHXROM BE VERY CAREFUL. +config MTD_ESB2ROM + tristate "BIOS flash chip on Intel ESB Controller Hub 2" + depends on X86 && MTD_JEDECPROBE + help + Support for treating the BIOS flash chip on ESB2 motherboards + as an MTD device - with this you can reprogram your BIOS. + + BE VERY CAREFUL. + config MTD_SCB2_FLASH tristate "BIOS flash chip on Intel SCB2 boards" depends on X86 && MTD_JEDECPROBE diff --git a/drivers/mtd/maps/Makefile b/drivers/mtd/maps/Makefile index 191c192..9061432 100644 --- a/drivers/mtd/maps/Makefile +++ b/drivers/mtd/maps/Makefile @@ -17,6 +17,7 @@ obj-$(CONFIG_MTD_DC21285) += dc21285.o obj-$(CONFIG_MTD_DILNETPC) += dilnetpc.o obj-$(CONFIG_MTD_L440GX) += l440gx.o obj-$(CONFIG_MTD_AMD76XROM) += amd76xrom.o +obj-$(CONFIG_MTD_ESB2ROM) += esb2rom.o obj-$(CONFIG_MTD_ICHXROM) += ichxrom.o obj-$(CONFIG_MTD_TSUNAMI) += tsunami_flash.o obj-$(CONFIG_MTD_LUBBOCK) += lubbock-flash.o diff --git a/drivers/mtd/maps/esb2rom.c b/drivers/mtd/maps/esb2rom.c new file mode 100644 index 0000000..e1c7814 --- /dev/null +++ b/drivers/mtd/maps/esb2rom.c @@ -0,0 +1,449 @@ +/* + * esb2rom.c + * + * Normal mappings of flash chips in physical memory + * through the Intel ESB2 Southbridge. + * + * This was derived from ichxrom.c in May 2006 by + * Lew Glendenning + * + * Eric Biederman, of course, was a major help in this effort. + */ + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#define MOD_NAME KBUILD_BASENAME + +#define ADDRESS_NAME_LEN 18 + +#define ROM_PROBE_STEP_SIZE (64*1024) /* 64KiB */ + +#define BIOS_CNTL 0xDC +#define BIOS_LOCK_ENABLE 0x02 +#define BIOS_WRITE_ENABLE 0x01 + +/* This became a 16-bit register, and EN2 has disappeared */ +#define FWH_DEC_EN1 0xD8 +#define FWH_F8_EN 0x8000 +#define FWH_F0_EN 0x4000 +#define FWH_E8_EN 0x2000 +#define FWH_E0_EN 0x1000 +#define FWH_D8_EN 0x0800 +#define FWH_D0_EN 0x0400 +#define FWH_C8_EN 0x0200 +#define FWH_C0_EN 0x0100 +#define FWH_LEGACY_F_EN 0x0080 +#define FWH_LEGACY_E_EN 0x0040 +/* reserved 0x0020 and 0x0010 */ +#define FWH_70_EN 0x0008 +#define FWH_60_EN 0x0004 +#define FWH_50_EN 0x0002 +#define FWH_40_EN 0x0001 + +/* these are 32-bit values */ +#define FWH_SEL1 0xD0 +#define FWH_SEL2 0xD4 + +#define FWH_8MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN | FWH_C8_EN | FWH_C0_EN | \ + FWH_70_EN | FWH_60_EN | FWH_50_EN | FWH_40_EN) + +#define FWH_7MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN | FWH_C8_EN | FWH_C0_EN | \ + FWH_70_EN | FWH_60_EN | FWH_50_EN) + +#define FWH_6MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN | FWH_C8_EN | FWH_C0_EN | \ + FWH_70_EN | FWH_60_EN) + +#define FWH_5MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN | FWH_C8_EN | FWH_C0_EN | \ + FWH_70_EN) + +#define FWH_4MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN | FWH_C8_EN | FWH_C0_EN) + +#define FWH_3_5MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN | FWH_C8_EN) + +#define FWH_3MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN | FWH_D0_EN) + +#define FWH_2_5MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN | \ + FWH_D8_EN) + +#define FWH_2MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN | FWH_E0_EN) + +#define FWH_1_5MiB (FWH_F8_EN | FWH_F0_EN | FWH_E8_EN) + +#define FWH_1MiB (FWH_F8_EN | FWH_F0_EN) + +#define FWH_0_5MiB (FWH_F8_EN) + + +struct esb2rom_window { + void __iomem* virt; + unsigned long phys; + unsigned long size; + struct list_head maps; + struct resource rsrc; + struct pci_dev *pdev; +}; + +struct esb2rom_map_info { + struct list_head list; + struct map_info map; + struct mtd_info *mtd; + struct resource rsrc; + char map_name[sizeof(MOD_NAME) + 2 + ADDRESS_NAME_LEN]; +}; + +static struct esb2rom_window esb2rom_window = { + .maps = LIST_HEAD_INIT(esb2rom_window.maps), +}; + +static void esb2rom_cleanup(struct esb2rom_window *window) +{ + struct esb2rom_map_info *map, *scratch; + u8 byte; + + /* Disable writes through the rom window */ + pci_read_config_byte(window->pdev, BIOS_CNTL, &byte); + pci_write_config_byte(window->pdev, BIOS_CNTL, + byte & ~BIOS_WRITE_ENABLE); + + /* Free all of the mtd devices */ + list_for_each_entry_safe(map, scratch, &window->maps, list) { + if (map->rsrc.parent) + release_resource(&map->rsrc); + del_mtd_device(map->mtd); + map_destroy(map->mtd); + list_del(&map->list); + kfree(map); + } + if (window->rsrc.parent) + release_resource(&window->rsrc); + if (window->virt) { + iounmap(window->virt); + window->virt = NULL; + window->phys = 0; + window->size = 0; + window->pdev = NULL; + } +} + +static int __devinit esb2rom_init_one(struct pci_dev *pdev, + const struct pci_device_id *ent) +{ + static char *rom_probe_types[] = { "cfi_probe", "jedec_probe", NULL }; + struct esb2rom_window *window = &esb2rom_window; + struct esb2rom_map_info *map = NULL; + unsigned long map_top; + u8 byte; + u16 word; + + /* For now I just handle the ecb2 and I assume there + * are not a lot of resources up at the top of the address + * space. It is possible to handle other devices in the + * top 16MiB but it is very painful. Also since + * you can only really attach a FWH to an ICHX there + * a number of simplifications you can make. + * + * Also you can page firmware hubs if an 8MiB window isn't enough + * but don't currently handle that case either. + */ + window->pdev = pdev; + + /* RLG: experiment 2. Force the window registers to the widest values */ + +/* + pci_read_config_word(pdev, FWH_DEC_EN1, &word); + printk(KERN_DEBUG "Original FWH_DEC_EN1 : %x\n", word); + pci_write_config_byte(pdev, FWH_DEC_EN1, 0xff); + pci_read_config_byte(pdev, FWH_DEC_EN1, &byte); + printk(KERN_DEBUG "New FWH_DEC_EN1 : %x\n", byte); + + pci_read_config_byte(pdev, FWH_DEC_EN2, &byte); + printk(KERN_DEBUG "Original FWH_DEC_EN2 : %x\n", byte); + pci_write_config_byte(pdev, FWH_DEC_EN2, 0x0f); + pci_read_config_byte(pdev, FWH_DEC_EN2, &byte); + printk(KERN_DEBUG "New FWH_DEC_EN2 : %x\n", byte); +*/ + + /* Find a region continuous to the end of the ROM window */ + window->phys = 0; + pci_read_config_word(pdev, FWH_DEC_EN1, &word); + printk(KERN_DEBUG "pci_read_config_byte : %x\n", word); + + if ((word & FWH_8MiB) == FWH_8MiB) + window->phys = 0xff400000; + else if ((word & FWH_7MiB) == FWH_7MiB) + window->phys = 0xff500000; + else if ((word & FWH_6MiB) == FWH_6MiB) + window->phys = 0xff600000; + else if ((word & FWH_5MiB) == FWH_5MiB) + window->phys = 0xFF700000; + else if ((word & FWH_4MiB) == FWH_4MiB) + window->phys = 0xffc00000; + else if ((word & FWH_3_5MiB) == FWH_3_5MiB) + window->phys = 0xffc80000; + else if ((word & FWH_3MiB) == FWH_3MiB) + window->phys = 0xffd00000; + else if ((word & FWH_2_5MiB) == FWH_2_5MiB) + window->phys = 0xffd80000; + else if ((word & FWH_2MiB) == FWH_2MiB) + window->phys = 0xffe00000; + else if ((word & FWH_1_5MiB) == FWH_1_5MiB) + window->phys = 0xffe80000; + else if ((word & FWH_1MiB) == FWH_1MiB) + window->phys = 0xfff00000; + else if ((word & FWH_0_5MiB) == FWH_0_5MiB) + window->phys = 0xfff80000; + + /* reserved 0x0020 and 0x0010 */ + window->phys -= 0x400000UL; + window->size = (0xffffffffUL - window->phys) + 1UL; + + /* Enable writes through the rom window */ + pci_read_config_byte(pdev, BIOS_CNTL, &byte); + if (!(byte & BIOS_WRITE_ENABLE) && (byte & (BIOS_LOCK_ENABLE))) { + /* The BIOS will generate an error if I enable + * this device, so don't even try. + */ + printk(KERN_ERR MOD_NAME ": firmware access control, I can't enable writes\n"); + goto out; + } + pci_write_config_byte(pdev, BIOS_CNTL, byte | BIOS_WRITE_ENABLE); + + /* + * Try to reserve the window mem region. If this fails then + * it is likely due to the window being "reseved" by the BIOS. + */ + window->rsrc.name = MOD_NAME; + window->rsrc.start = window->phys; + window->rsrc.end = window->phys + window->size - 1; + window->rsrc.flags = IORESOURCE_MEM | IORESOURCE_BUSY; + if (request_resource(&iomem_resource, &window->rsrc)) { + window->rsrc.parent = NULL; + printk(KERN_DEBUG MOD_NAME + ": %s(): Unable to register resource" + " 0x%.08llx-0x%.08llx - kernel bug?\n", + __func__, + (unsigned long long)window->rsrc.start, + (unsigned long long)window->rsrc.end); + } + + /* Map the firmware hub into my address space. */ + window->virt = ioremap_nocache(window->phys, window->size); + if (!window->virt) { + printk(KERN_ERR MOD_NAME ": ioremap(%08lx, %08lx) failed\n", + window->phys, window->size); + goto out; + } + + /* Get the first address to look for an rom chip at */ + map_top = window->phys; + if ((window->phys & 0x3fffff) != 0) { + /* if not aligned on 4MiB, look 4MiB lower in address space */ + map_top = window->phys + 0x400000; + } +#if 1 + /* The probe sequence run over the firmware hub lock + * registers sets them to 0x7 (no access). + * (Insane hardware design, but most copied Intel's.) + * ==> Probe at most the last 4M of the address space. + */ + if (map_top < 0xffc00000) + map_top = 0xffc00000; +#endif + /* Loop through and look for rom chips */ + while ((map_top - 1) < 0xffffffffUL) { + struct cfi_private *cfi; + unsigned long offset; + int i; + + if (!map) + map = kmalloc(sizeof(*map), GFP_KERNEL); + if (!map) { + printk(KERN_ERR MOD_NAME ": kmalloc failed"); + goto out; + } + memset(map, 0, sizeof(*map)); + INIT_LIST_HEAD(&map->list); + map->map.name = map->map_name; + map->map.phys = map_top; + offset = map_top - window->phys; + map->map.virt = (void __iomem *) + (((unsigned long)(window->virt)) + offset); + map->map.size = 0xffffffffUL - map_top + 1UL; + /* Set the name of the map to the address I am trying */ + sprintf(map->map_name, "%s @%08lx", + MOD_NAME, map->map.phys); + + /* Firmware hubs only use vpp when being programmed + * in a factory setting. So in-place programming + * needs to use a different method. + */ + for(map->map.bankwidth = 32; map->map.bankwidth; + map->map.bankwidth >>= 1) { + char **probe_type; + /* Skip bankwidths that are not supported */ + if (!map_bankwidth_supported(map->map.bankwidth)) + continue; + + /* Setup the map methods */ + simple_map_init(&map->map); + + /* Try all of the probe methods */ + probe_type = rom_probe_types; + for(; *probe_type; probe_type++) { + map->mtd = do_map_probe(*probe_type, &map->map); + if (map->mtd) + goto found; + } + } + map_top += ROM_PROBE_STEP_SIZE; + continue; + found: + /* Trim the size if we are larger than the map */ + if (map->mtd->size > map->map.size) { + printk(KERN_WARNING MOD_NAME + " rom(%u) larger than window(%lu). fixing...\n", + map->mtd->size, map->map.size); + map->mtd->size = map->map.size; + } + if (window->rsrc.parent) { + /* + * Registering the MTD device in iomem may not be possible + * if there is a BIOS "reserved" and BUSY range. If this + * fails then continue anyway. + */ + map->rsrc.name = map->map_name; + map->rsrc.start = map->map.phys; + map->rsrc.end = map->map.phys + map->mtd->size - 1; + map->rsrc.flags = IORESOURCE_MEM | IORESOURCE_BUSY; + if (request_resource(&window->rsrc, &map->rsrc)) { + printk(KERN_ERR MOD_NAME + ": cannot reserve MTD resource\n"); + map->rsrc.parent = NULL; + } + } + + /* Make the whole region visible in the map */ + map->map.virt = window->virt; + map->map.phys = window->phys; + cfi = map->map.fldrv_priv; + for(i = 0; i < cfi->numchips; i++) + cfi->chips[i].start += offset; + + /* Now that the mtd devices is complete claim and export it */ + map->mtd->owner = THIS_MODULE; + if (add_mtd_device(map->mtd)) { + map_destroy(map->mtd); + map->mtd = NULL; + goto out; + } + + /* Calculate the new value of map_top */ + map_top += map->mtd->size; + + /* File away the map structure */ + list_add(&map->list, &window->maps); + map = NULL; + } + + out: + /* Free any left over map structures */ + kfree(map); + + /* See if I have any map structures */ + if (list_empty(&window->maps)) { + esb2rom_cleanup(window); + return -ENODEV; + } + return 0; +} + +static void __devexit esb2rom_remove_one (struct pci_dev *pdev) +{ + struct esb2rom_window *window = &esb2rom_window; + esb2rom_cleanup(window); +} + +static struct pci_device_id esb2rom_pci_tbl[] __devinitdata = { + { PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82801BA_0, + PCI_ANY_ID, PCI_ANY_ID, }, + { PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82801CA_0, + PCI_ANY_ID, PCI_ANY_ID, }, + { PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82801DB_0, + PCI_ANY_ID, PCI_ANY_ID, }, + { PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82801EB_0, + PCI_ANY_ID, PCI_ANY_ID, }, + { PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_ESB_1, + PCI_ANY_ID, PCI_ANY_ID, }, + { PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_ESB2_0, + PCI_ANY_ID, PCI_ANY_ID, }, + { 0, }, +}; + +#if 0 +MODULE_DEVICE_TABLE(pci, esb2rom_pci_tbl); + +static struct pci_driver esb2rom_driver = { + .name = MOD_NAME, + .id_table = esb2rom_pci_tbl, + .probe = esb2rom_init_one, + .remove = esb2rom_remove_one, +}; +#endif + +static int __init init_esb2rom(void) +{ + struct pci_dev *pdev; + struct pci_device_id *id; + int retVal; + + pdev = NULL; + for (id = esb2rom_pci_tbl; id->vendor; id++) { + printk(KERN_DEBUG "device id = %x\n", id->device); + pdev = pci_find_device(id->vendor, id->device, NULL); + if (pdev) { + printk(KERN_DEBUG "matched device = %x\n", id->device); + break; + } + } + if (pdev) { + printk(KERN_DEBUG "matched device id %x\n", id->device); + retVal = esb2rom_init_one(pdev, &esb2rom_pci_tbl[0]); + printk(KERN_DEBUG "retVal = %d\n", retVal); + return retVal; + } + return -ENXIO; +#if 0 + return pci_register_driver(&esb2rom_driver); +#endif +} + +static void __exit cleanup_esb2rom(void) +{ + esb2rom_remove_one(esb2rom_window.pdev); +} + +module_init(init_esb2rom); +module_exit(cleanup_esb2rom); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("Lew Glendenning "); +MODULE_DESCRIPTION("MTD map driver for BIOS chips on the ESB2 southbridge"); -- cgit v1.1 From f33686b5a79674bec0e1aa553d420485e3a12899 Mon Sep 17 00:00:00 2001 From: Alexey Dobriyan Date: Fri, 20 Oct 2006 14:41:05 -0700 Subject: [MTD] JEDEC probe: fix comment typo (devic) Signed-off-by: Alexey Dobriyan Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/chips/jedec_probe.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/chips/jedec_probe.c b/drivers/mtd/chips/jedec_probe.c index 63d1287..58e561e 100644 --- a/drivers/mtd/chips/jedec_probe.c +++ b/drivers/mtd/chips/jedec_probe.c @@ -1889,7 +1889,7 @@ static int cfi_jedec_setup(struct cfi_private *p_cfi, int index) /* - * There is a BIG problem properly ID'ing the JEDEC devic and guaranteeing + * There is a BIG problem properly ID'ing the JEDEC device and guaranteeing * the mapped address, unlock addresses, and proper chip ID. This function * attempts to minimize errors. It is doubtfull that this probe will ever * be perfect - consequently there should be some module parameters that -- cgit v1.1 From c7438d02b384e82261e28fc280167f4e7a65e822 Mon Sep 17 00:00:00 2001 From: Alan Cox Date: Fri, 20 Oct 2006 14:41:06 -0700 Subject: [MTD] MAPS: esb2rom: use hotplug safe interfaces Fairly self explanatory. Keep a reference initially, drop it when we free up the driver resources. Signed-off-by: Alan Cox Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/maps/esb2rom.c | 7 ++++--- 1 file changed, 4 insertions(+), 3 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/esb2rom.c b/drivers/mtd/maps/esb2rom.c index e1c7814..a9d808a 100644 --- a/drivers/mtd/maps/esb2rom.c +++ b/drivers/mtd/maps/esb2rom.c @@ -140,8 +140,8 @@ static void esb2rom_cleanup(struct esb2rom_window *window) window->virt = NULL; window->phys = 0; window->size = 0; - window->pdev = NULL; } + pci_dev_put(window->pdev); } static int __devinit esb2rom_init_one(struct pci_dev *pdev, @@ -164,7 +164,7 @@ static int __devinit esb2rom_init_one(struct pci_dev *pdev, * Also you can page firmware hubs if an 8MiB window isn't enough * but don't currently handle that case either. */ - window->pdev = pdev; + window->pdev = pci_dev_get(pdev); /* RLG: experiment 2. Force the window registers to the widest values */ @@ -418,7 +418,7 @@ static int __init init_esb2rom(void) pdev = NULL; for (id = esb2rom_pci_tbl; id->vendor; id++) { printk(KERN_DEBUG "device id = %x\n", id->device); - pdev = pci_find_device(id->vendor, id->device, NULL); + pdev = pci_get_device(id->vendor, id->device, NULL); if (pdev) { printk(KERN_DEBUG "matched device = %x\n", id->device); break; @@ -427,6 +427,7 @@ static int __init init_esb2rom(void) if (pdev) { printk(KERN_DEBUG "matched device id %x\n", id->device); retVal = esb2rom_init_one(pdev, &esb2rom_pci_tbl[0]); + pci_dev_put(pdev); printk(KERN_DEBUG "retVal = %d\n", retVal); return retVal; } -- cgit v1.1 From 42cb1403af8a755b3dfebeb9d2a5f73bc48832a1 Mon Sep 17 00:00:00 2001 From: Andrew Victor Date: Thu, 19 Oct 2006 18:24:35 +0200 Subject: [MTD] NAND: AT91 NAND driver This version only differs from version posted by Savin Zlobec (20 Jun 2006) in that the AT91RM9200-specific chip-select / bus setup code has been moved from the at91_nand.c driver into the processor-specific file. From: Savin Zlobec Signed-off-by: Andrew Victor Signed-off-by: David Woodhouse --- drivers/mtd/nand/Kconfig | 7 ++ drivers/mtd/nand/Makefile | 1 + drivers/mtd/nand/at91_nand.c | 220 +++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 228 insertions(+) create mode 100644 drivers/mtd/nand/at91_nand.c (limited to 'drivers') diff --git a/drivers/mtd/nand/Kconfig b/drivers/mtd/nand/Kconfig index 1831340..b4b1656 100644 --- a/drivers/mtd/nand/Kconfig +++ b/drivers/mtd/nand/Kconfig @@ -232,6 +232,13 @@ config MTD_NAND_CS553X If you say "m", the module will be called "cs553x_nand.ko". +config MTD_NAND_AT91 + bool "Support for NAND Flash / SmartMedia on AT91" + depends on MTD_NAND && ARCH_AT91 + help + Enables support for NAND Flash / Smart Media Card interface + on Atmel AT91 processors. + config MTD_NAND_NANDSIM tristate "Support for NAND Flash Simulator" depends on MTD_NAND && MTD_PARTITIONS diff --git a/drivers/mtd/nand/Makefile b/drivers/mtd/nand/Makefile index f747593..27c9f0a 100644 --- a/drivers/mtd/nand/Makefile +++ b/drivers/mtd/nand/Makefile @@ -22,5 +22,6 @@ obj-$(CONFIG_MTD_NAND_TS7250) += ts7250.o obj-$(CONFIG_MTD_NAND_NANDSIM) += nandsim.o obj-$(CONFIG_MTD_NAND_CS553X) += cs553x_nand.o obj-$(CONFIG_MTD_NAND_NDFC) += ndfc.o +obj-$(CONFIG_MTD_NAND_AT91) += at91_nand.o nand-objs = nand_base.o nand_bbt.o diff --git a/drivers/mtd/nand/at91_nand.c b/drivers/mtd/nand/at91_nand.c new file mode 100644 index 0000000..a58ed37 --- /dev/null +++ b/drivers/mtd/nand/at91_nand.c @@ -0,0 +1,220 @@ +/* + * drivers/mtd/nand/at91_nand.c + * + * Copyright (C) 2003 Rick Bronson + * + * Derived from drivers/mtd/nand/autcpu12.c + * Copyright (c) 2001 Thomas Gleixner (gleixner@autronix.de) + * + * Derived from drivers/mtd/spia.c + * Copyright (C) 2000 Steven J. Hill (sjhill@cotw.com) + * + * This program is free software; you can redistribute it and/or modify + * it under the terms of the GNU General Public License version 2 as + * published by the Free Software Foundation. + * + */ + +#include +#include +#include +#include +#include +#include + +#include +#include + +#include +#include +#include + +struct at91_nand_host { + struct nand_chip nand_chip; + struct mtd_info mtd; + void __iomem *io_base; + struct at91_nand_data *board; +}; + +/* + * Hardware specific access to control-lines + */ +static void at91_nand_cmd_ctrl(struct mtd_info *mtd, int cmd, unsigned int ctrl) +{ + struct nand_chip *nand_chip = mtd->priv; + struct at91_nand_host *host = nand_chip->priv; + + if (cmd == NAND_CMD_NONE) + return; + + if (ctrl & NAND_CLE) + writeb(cmd, host->io_base + (1 << host->board->cle)); + else + writeb(cmd, host->io_base + (1 << host->board->ale)); +} + +/* + * Read the Device Ready pin. + */ +static int at91_nand_device_ready(struct mtd_info *mtd) +{ + struct nand_chip *nand_chip = mtd->priv; + struct at91_nand_host *host = nand_chip->priv; + + return at91_get_gpio_value(host->board->rdy_pin); +} + +/* + * Enable NAND. + */ +static void at91_nand_enable(struct at91_nand_host *host) +{ + if (host->board->enable_pin) + at91_set_gpio_value(host->board->enable_pin, 0); +} + +/* + * Disable NAND. + */ +static void at91_nand_disable(struct at91_nand_host *host) +{ + if (host->board->enable_pin) + at91_set_gpio_value(host->board->enable_pin, 1); +} + +/* + * Probe for the NAND device. + */ +static int __init at91_nand_probe(struct platform_device *pdev) +{ + struct at91_nand_host *host; + struct mtd_info *mtd; + struct nand_chip *nand_chip; + int res; + +#ifdef CONFIG_MTD_PARTITIONS + struct mtd_partition *partitions = NULL; + int num_partitions = 0; +#endif + + /* Allocate memory for the device structure (and zero it) */ + host = kzalloc(sizeof(struct at91_nand_host), GFP_KERNEL); + if (!host) { + printk(KERN_ERR "at91_nand: failed to allocate device structure.\n"); + return -ENOMEM; + } + + host->io_base = ioremap(pdev->resource[0].start, + pdev->resource[0].end - pdev->resource[0].start + 1); + if (host->io_base == NULL) { + printk(KERN_ERR "at91_nand: ioremap failed\n"); + kfree(host); + return -EIO; + } + + mtd = &host->mtd; + nand_chip = &host->nand_chip; + host->board = pdev->dev.platform_data; + + nand_chip->priv = host; /* link the private data structures */ + mtd->priv = nand_chip; + mtd->owner = THIS_MODULE; + + /* Set address of NAND IO lines */ + nand_chip->IO_ADDR_R = host->io_base; + nand_chip->IO_ADDR_W = host->io_base; + nand_chip->cmd_ctrl = at91_nand_cmd_ctrl; + nand_chip->dev_ready = at91_nand_device_ready; + nand_chip->ecc.mode = NAND_ECC_SOFT; /* enable ECC */ + nand_chip->chip_delay = 20; /* 20us command delay time */ + + platform_set_drvdata(pdev, host); + at91_nand_enable(host); + + if (host->board->det_pin) { + if (at91_get_gpio_value(host->board->det_pin)) { + printk ("No SmartMedia card inserted.\n"); + res = ENXIO; + goto out; + } + } + + /* Scan to find existance of the device */ + if (nand_scan(mtd, 1)) { + res = -ENXIO; + goto out; + } + +#ifdef CONFIG_MTD_PARTITIONS + if (host->board->partition_info) + partitions = host->board->partition_info(mtd->size, &num_partitions); + + if ((!partitions) || (num_partitions == 0)) { + printk(KERN_ERR "at91_nand: No parititions defined, or unsupported device.\n"); + res = ENXIO; + goto release; + } + + res = add_mtd_partitions(mtd, partitions, num_partitions); +#else + res = add_mtd_device(mtd); +#endif + + if (!res) + return res; + +release: + nand_release(mtd); +out: + at91_nand_disable(host); + platform_set_drvdata(pdev, NULL); + iounmap(host->io_base); + kfree(host); + return res; +} + +/* + * Remove a NAND device. + */ +static int __devexit at91_nand_remove(struct platform_device *pdev) +{ + struct at91_nand_host *host = platform_get_drvdata(pdev); + struct mtd_info *mtd = &host->mtd; + + nand_release(mtd); + + at91_nand_disable(host); + + iounmap(host->io_base); + kfree(host); + + return 0; +} + +static struct platform_driver at91_nand_driver = { + .probe = at91_nand_probe, + .remove = at91_nand_remove, + .driver = { + .name = "at91_nand", + .owner = THIS_MODULE, + }, +}; + +static int __init at91_nand_init(void) +{ + return platform_driver_register(&at91_nand_driver); +} + + +static void __exit at91_nand_exit(void) +{ + platform_driver_unregister(&at91_nand_driver); +} + + +module_init(at91_nand_init); +module_exit(at91_nand_exit); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("Rick Bronson"); +MODULE_DESCRIPTION("NAND/SmartMedia driver for AT91RM9200"); -- cgit v1.1 From d25ade71ef80e6312b3e0b53583db518ebb11798 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Ricard=20Wanderl=C3=B6f?= Date: Tue, 17 Oct 2006 17:27:11 +0200 Subject: [MTD] mtdchar: Fix MEMGETOOBSEL and ECCGETLAYOUT ioctls MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit 1. The ECCGETLAYOUT ioctl copy_to_user() call has a superfluous '&' causing the resulting information to be garbage rather than the intended mtd->ecclayout. 2. The MEMGETOOBSEL misses copying mtd->ecclayout->eccbytes so the resulting field of the returned structure contains garbage. Signed-off-by: Ricard Wanderlöf Signed-off-by: David Woodhouse --- drivers/mtd/mtdchar.c | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/mtdchar.c b/drivers/mtd/mtdchar.c index 5b6acfc..866c8e0 100644 --- a/drivers/mtd/mtdchar.c +++ b/drivers/mtd/mtdchar.c @@ -616,6 +616,7 @@ static int mtd_ioctl(struct inode *inode, struct file *file, memcpy(&oi.eccpos, mtd->ecclayout->eccpos, sizeof(oi.eccpos)); memcpy(&oi.oobfree, mtd->ecclayout->oobfree, sizeof(oi.oobfree)); + oi.eccbytes = mtd->ecclayout->eccbytes; if (copy_to_user(argp, &oi, sizeof(struct nand_oobinfo))) return -EFAULT; @@ -715,7 +716,7 @@ static int mtd_ioctl(struct inode *inode, struct file *file, if (!mtd->ecclayout) return -EOPNOTSUPP; - if (copy_to_user(argp, &mtd->ecclayout, + if (copy_to_user(argp, mtd->ecclayout, sizeof(struct nand_ecclayout))) return -EFAULT; break; -- cgit v1.1 From 6652018c829c26d6ab0524c5c74f70daa5ed478d Mon Sep 17 00:00:00 2001 From: Yoichi Yuasa Date: Thu, 12 Oct 2006 17:38:15 +0900 Subject: [MTD] MAPS: Remove ITE 8172G and Globespan IVR MTD support MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit This patch has removed ITE 8172G and Globespan IVR MTD support. These boards support have already been removed. Signed-off-by: Yoichi Yuasa Acked-by: Ralf Bächle Signed-off-by: David Woodhouse --- drivers/mtd/maps/cstm_mips_ixx.c | 121 +-------------------------------------- 1 file changed, 1 insertion(+), 120 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/cstm_mips_ixx.c b/drivers/mtd/maps/cstm_mips_ixx.c index df2c38e..d57eba2 100644 --- a/drivers/mtd/maps/cstm_mips_ixx.c +++ b/drivers/mtd/maps/cstm_mips_ixx.c @@ -40,62 +40,6 @@ #include #include -#if defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) -#define CC_GCR 0xB4013818 -#define CC_GPBCR 0xB401380A -#define CC_GPBDR 0xB4013808 -#define CC_M68K_DEVICE 1 -#define CC_M68K_FUNCTION 6 -#define CC_CONFADDR 0xB8004000 -#define CC_CONFDATA 0xB8004004 -#define CC_FC_FCR 0xB8002004 -#define CC_FC_DCR 0xB8002008 -#define CC_GPACR 0xB4013802 -#define CC_GPAICR 0xB4013804 -#endif /* defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) */ - -#if defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) -void cstm_mips_ixx_set_vpp(struct map_info *map,int vpp) -{ - static DEFINE_SPINLOCK(vpp_lock); - static int vpp_count = 0; - unsigned long flags; - - spin_lock_irqsave(&vpp_lock, flags); - - if (vpp) { - if (!vpp_count++) { - __u16 data; - __u8 data1; - static u8 first = 1; - - // Set GPIO port B pin3 to high - data = *(__u16 *)(CC_GPBCR); - data = (data & 0xff0f) | 0x0040; - *(__u16 *)CC_GPBCR = data; - *(__u8 *)CC_GPBDR = (*(__u8*)CC_GPBDR) | 0x08; - if (first) { - first = 0; - /* need to have this delay for first - enabling vpp after powerup */ - udelay(40); - } - } - } else { - if (!--vpp_count) { - __u16 data; - - // Set GPIO port B pin3 to high - data = *(__u16 *)(CC_GPBCR); - data = (data & 0xff3f) | 0x0040; - *(__u16 *)CC_GPBCR = data; - *(__u8 *)CC_GPBDR = (*(__u8*)CC_GPBDR) & 0xf7; - } - } - spin_unlock_irqrestore(&vpp_lock, flags); -} -#endif - /* board and partition description */ #define MAX_PHYSMAP_PARTITIONS 8 @@ -107,29 +51,6 @@ struct cstm_mips_ixx_info { int num_partitions; }; -#if defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) -#define PHYSMAP_NUMBER 1 // number of board desc structs needed, one per contiguous flash type -const struct cstm_mips_ixx_info cstm_mips_ixx_board_desc[PHYSMAP_NUMBER] = -{ - { // 28F128J3A in 2x16 configuration - "big flash", // name - 0x08000000, // window_addr - 0x02000000, // window_size - 4, // bankwidth - 1, // num_partitions - } - -}; -static struct mtd_partition cstm_mips_ixx_partitions[PHYSMAP_NUMBER][MAX_PHYSMAP_PARTITIONS] = { -{ // 28F128J3A in 2x16 configuration - { - .name = "main partition ", - .size = 0x02000000, // 128 x 2 x 128k byte sectors - .offset = 0, - }, -}, -}; -#else /* defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) */ #define PHYSMAP_NUMBER 1 // number of board desc structs needed, one per contiguous flash type const struct cstm_mips_ixx_info cstm_mips_ixx_board_desc[PHYSMAP_NUMBER] = { @@ -151,7 +72,6 @@ static struct mtd_partition cstm_mips_ixx_partitions[PHYSMAP_NUMBER][MAX_PHYSMAP }, }, }; -#endif /* defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) */ struct map_info cstm_mips_ixx_map[PHYSMAP_NUMBER]; @@ -184,17 +104,10 @@ int __init init_cstm_mips_ixx(void) cstm_mips_ixx_map[i].name = cstm_mips_ixx_board_desc[i].name; cstm_mips_ixx_map[i].size = cstm_mips_ixx_board_desc[i].window_size; cstm_mips_ixx_map[i].bankwidth = cstm_mips_ixx_board_desc[i].bankwidth; -#if defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) - cstm_mips_ixx_map[i].set_vpp = cstm_mips_ixx_set_vpp; -#endif simple_map_init(&cstm_mips_ixx_map[i]); //printk(KERN_NOTICE "cstm_mips_ixx: ioremap is %x\n",(unsigned int)(cstm_mips_ixx_map[i].virt)); } -#if defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) - setup_ITE_IVR_flash(); -#endif /* defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) */ - for (i=0;i> 8 >>1; // Bug: we must shift one more bit - - /* need to set ITE flash to 32 bits instead of default 8 */ -#ifdef CONFIG_MIPS_IVR - *(__u32 *)CC_FC_FCR = 0x55; - *(__u32 *)CC_GPACR = 0xfffc; -#else - *(__u32 *)CC_FC_FCR = 0x77; -#endif - /* turn bursting off */ - *(__u32 *)CC_FC_DCR = 0x0; - - /* setup for one chip 4 byte PCI access */ - PCISetULongByOffset(CC_M68K_DEVICE, CC_M68K_FUNCTION, 0x60, size | base); - PCISetULongByOffset(CC_M68K_DEVICE, CC_M68K_FUNCTION, 0x64, 0x02); -} -#endif /* defined(CONFIG_MIPS_ITE8172) || defined(CONFIG_MIPS_IVR) */ module_init(init_cstm_mips_ixx); module_exit(cleanup_cstm_mips_ixx); @@ -280,4 +161,4 @@ module_exit(cleanup_cstm_mips_ixx); MODULE_LICENSE("GPL"); MODULE_AUTHOR("Alice Hennessy "); -MODULE_DESCRIPTION("MTD map driver for ITE 8172G and Globespan IVR boards"); +MODULE_DESCRIPTION("MTD map driver for MIPS boards"); -- cgit v1.1 From 47e37743381823a5c2d51ef88cfc3d6cff1f8580 Mon Sep 17 00:00:00 2001 From: Vijay Kumar Date: Sun, 8 Oct 2006 22:00:37 +0530 Subject: [MTD] NAND: nandsim page-wise allocation (1/2) This patch removes code that does chip mapping. The chip mapping code is no longer used. Signed-off-by: Vijay Kumar Signed-off-by: David Woodhouse --- drivers/mtd/nand/nandsim.c | 22 ---------------------- 1 file changed, 22 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nandsim.c b/drivers/mtd/nand/nandsim.c index 545ff25..5dd3c4e 100644 --- a/drivers/mtd/nand/nandsim.c +++ b/drivers/mtd/nand/nandsim.c @@ -37,10 +37,6 @@ #include #include #include -#ifdef CONFIG_NS_ABS_POS -#include -#endif - /* Default simulator parameters values */ #if !defined(CONFIG_NANDSIM_FIRST_ID_BYTE) || \ @@ -440,14 +436,6 @@ init_nandsim(struct mtd_info *mtd) printk("options: %#x\n", ns->options); /* Map / allocate and initialize the flash image */ -#ifdef CONFIG_NS_ABS_POS - ns->mem.byte = ioremap(CONFIG_NS_ABS_POS, ns->geom.totszoob); - if (!ns->mem.byte) { - NS_ERR("init_nandsim: failed to map the NAND flash image at address %p\n", - (void *)CONFIG_NS_ABS_POS); - return -ENOMEM; - } -#else ns->mem.byte = vmalloc(ns->geom.totszoob); if (!ns->mem.byte) { NS_ERR("init_nandsim: unable to allocate %u bytes for flash image\n", @@ -455,7 +443,6 @@ init_nandsim(struct mtd_info *mtd) return -ENOMEM; } memset(ns->mem.byte, 0xFF, ns->geom.totszoob); -#endif /* Allocate / initialize the internal buffer */ ns->buf.byte = kmalloc(ns->geom.pgszoob, GFP_KERNEL); @@ -474,11 +461,7 @@ init_nandsim(struct mtd_info *mtd) return 0; error: -#ifdef CONFIG_NS_ABS_POS - iounmap(ns->mem.byte); -#else vfree(ns->mem.byte); -#endif return -ENOMEM; } @@ -490,12 +473,7 @@ static void free_nandsim(struct nandsim *ns) { kfree(ns->buf.byte); - -#ifdef CONFIG_NS_ABS_POS - iounmap(ns->mem.byte); -#else vfree(ns->mem.byte); -#endif return; } -- cgit v1.1 From d086d43640a40dda7783f3c56724048685586d17 Mon Sep 17 00:00:00 2001 From: Vijay Kumar Date: Sun, 8 Oct 2006 22:02:31 +0530 Subject: [MTD] NAND: nandsim page-wise allocation (2/2) For page wise allocation, an array of flash page pointers is allocated during initialization. The flash pages are themselves allocated when a write occurs to the page. The flash pages are deallocated when they are erased. Signed-off-by: Vijay Kumar Signed-off-by: David Woodhouse --- drivers/mtd/nand/nandsim.c | 162 ++++++++++++++++++++++++++++++++++++++------- 1 file changed, 138 insertions(+), 24 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nandsim.c b/drivers/mtd/nand/nandsim.c index 5dd3c4e..f00e195 100644 --- a/drivers/mtd/nand/nandsim.c +++ b/drivers/mtd/nand/nandsim.c @@ -227,6 +227,14 @@ MODULE_PARM_DESC(dbg, "Output debug information if not zero"); #define NS_MAX_PREVSTATES 1 /* + * A union to represent flash memory contents and flash buffer. + */ +union ns_mem { + u_char *byte; /* for byte access */ + uint16_t *word; /* for 16-bit word access */ +}; + +/* * The structure which describes all the internal simulator data. */ struct nandsim { @@ -243,17 +251,11 @@ struct nandsim { uint16_t npstates; /* number of previous states saved */ uint16_t stateidx; /* current state index */ - /* The simulated NAND flash image */ - union flash_media { - u_char *byte; - uint16_t *word; - } mem; + /* The simulated NAND flash pages array */ + union ns_mem *pages; /* Internal buffer of page + OOB size bytes */ - union internal_buffer { - u_char *byte; /* for byte access */ - uint16_t *word; /* for 16-bit word access */ - } buf; + union ns_mem buf; /* NAND flash "geometry" */ struct nandsin_geometry { @@ -342,6 +344,46 @@ static struct mtd_info *nsmtd; static u_char ns_verify_buf[NS_LARGEST_PAGE_SIZE]; /* + * Allocate array of page pointers and initialize the array to NULL + * pointers. + * + * RETURNS: 0 if success, -ENOMEM if memory alloc fails. + */ +static int +alloc_device(struct nandsim *ns) +{ + int i; + + ns->pages = vmalloc(ns->geom.pgnum * sizeof(union ns_mem)); + if (!ns->pages) { + NS_ERR("alloc_map: unable to allocate page array\n"); + return -ENOMEM; + } + for (i = 0; i < ns->geom.pgnum; i++) { + ns->pages[i].byte = NULL; + } + + return 0; +} + +/* + * Free any allocated pages, and free the array of page pointers. + */ +static void +free_device(struct nandsim *ns) +{ + int i; + + if (ns->pages) { + for (i = 0; i < ns->geom.pgnum; i++) { + if (ns->pages[i].byte) + kfree(ns->pages[i].byte); + } + vfree(ns->pages); + } +} + +/* * Initialize the nandsim structure. * * RETURNS: 0 if success, -ERRNO if failure. @@ -435,14 +477,8 @@ init_nandsim(struct mtd_info *mtd) printk("sector address bytes: %u\n", ns->geom.secaddrbytes); printk("options: %#x\n", ns->options); - /* Map / allocate and initialize the flash image */ - ns->mem.byte = vmalloc(ns->geom.totszoob); - if (!ns->mem.byte) { - NS_ERR("init_nandsim: unable to allocate %u bytes for flash image\n", - ns->geom.totszoob); - return -ENOMEM; - } - memset(ns->mem.byte, 0xFF, ns->geom.totszoob); + if (alloc_device(ns) != 0) + goto error; /* Allocate / initialize the internal buffer */ ns->buf.byte = kmalloc(ns->geom.pgszoob, GFP_KERNEL); @@ -461,7 +497,7 @@ init_nandsim(struct mtd_info *mtd) return 0; error: - vfree(ns->mem.byte); + free_device(ns); return -ENOMEM; } @@ -473,7 +509,7 @@ static void free_nandsim(struct nandsim *ns) { kfree(ns->buf.byte); - vfree(ns->mem.byte); + free_device(ns); return; } @@ -769,6 +805,84 @@ find_operation(struct nandsim *ns, uint32_t flag) } /* + * Returns a pointer to the current page. + */ +static inline union ns_mem *NS_GET_PAGE(struct nandsim *ns) +{ + return &(ns->pages[ns->regs.row]); +} + +/* + * Retuns a pointer to the current byte, within the current page. + */ +static inline u_char *NS_PAGE_BYTE_OFF(struct nandsim *ns) +{ + return NS_GET_PAGE(ns)->byte + ns->regs.column + ns->regs.off; +} + +/* + * Fill the NAND buffer with data read from the specified page. + */ +static void read_page(struct nandsim *ns, int num) +{ + union ns_mem *mypage; + + mypage = NS_GET_PAGE(ns); + if (mypage->byte == NULL) { + NS_DBG("read_page: page %d not allocated\n", ns->regs.row); + memset(ns->buf.byte, 0xFF, num); + } else { + NS_DBG("read_page: page %d allocated, reading from %d\n", + ns->regs.row, ns->regs.column + ns->regs.off); + memcpy(ns->buf.byte, NS_PAGE_BYTE_OFF(ns), num); + } +} + +/* + * Erase all pages in the specified sector. + */ +static void erase_sector(struct nandsim *ns) +{ + union ns_mem *mypage; + int i; + + mypage = NS_GET_PAGE(ns); + for (i = 0; i < ns->geom.pgsec; i++) { + if (mypage->byte != NULL) { + NS_DBG("erase_sector: freeing page %d\n", ns->regs.row+i); + kfree(mypage->byte); + mypage->byte = NULL; + } + mypage++; + } +} + +/* + * Program the specified page with the contents from the NAND buffer. + */ +static int prog_page(struct nandsim *ns, int num) +{ + union ns_mem *mypage; + u_char *pg_off; + + mypage = NS_GET_PAGE(ns); + if (mypage->byte == NULL) { + NS_DBG("prog_page: allocating page %d\n", ns->regs.row); + mypage->byte = kmalloc(ns->geom.pgszoob, GFP_KERNEL); + if (mypage->byte == NULL) { + NS_ERR("prog_page: error allocating memory for page %d\n", ns->regs.row); + return -1; + } + memset(mypage->byte, 0xFF, ns->geom.pgszoob); + } + + pg_off = NS_PAGE_BYTE_OFF(ns); + memcpy(pg_off, ns->buf.byte, num); + + return 0; +} + +/* * If state has any action bit, perform this action. * * RETURNS: 0 if success, -1 if error. @@ -776,7 +890,7 @@ find_operation(struct nandsim *ns, uint32_t flag) static int do_state_action(struct nandsim *ns, uint32_t action) { - int i, num; + int num; int busdiv = ns->busw == 8 ? 1 : 2; action &= ACTION_MASK; @@ -800,7 +914,7 @@ do_state_action(struct nandsim *ns, uint32_t action) break; } num = ns->geom.pgszoob - ns->regs.off - ns->regs.column; - memcpy(ns->buf.byte, ns->mem.byte + NS_RAW_OFFSET(ns) + ns->regs.off, num); + read_page(ns, num); NS_DBG("do_state_action: (ACTION_CPY:) copy %d bytes to int buf, raw offset %d\n", num, NS_RAW_OFFSET(ns) + ns->regs.off); @@ -841,7 +955,7 @@ do_state_action(struct nandsim *ns, uint32_t action) ns->regs.row, NS_RAW_OFFSET(ns)); NS_LOG("erase sector %d\n", ns->regs.row >> (ns->geom.secshift - ns->geom.pgshift)); - memset(ns->mem.byte + NS_RAW_OFFSET(ns), 0xFF, ns->geom.secszoob); + erase_sector(ns); NS_MDELAY(erase_delay); @@ -864,8 +978,8 @@ do_state_action(struct nandsim *ns, uint32_t action) return -1; } - for (i = 0; i < num; i++) - ns->mem.byte[NS_RAW_OFFSET(ns) + ns->regs.off + i] &= ns->buf.byte[i]; + if (prog_page(ns, num) == -1) + return -1; NS_DBG("do_state_action: copy %d bytes from int buf to (%#x, %#x), raw off = %d\n", num, ns->regs.row, ns->regs.column, NS_RAW_OFFSET(ns) + ns->regs.off); -- cgit v1.1 From a5602146c5abea7dfb0c9f4fe6f5870ebdafbc9f Mon Sep 17 00:00:00 2001 From: Vijay Kumar Date: Sat, 14 Oct 2006 21:33:34 +0530 Subject: [MTD] NAND: nandsim coding style fix Removes line break after return type in function definitions, to be consistent with the Linux coding style. Signed-off-by: Vijay Kumar Signed-off-by: David Woodhouse --- drivers/mtd/nand/nandsim.c | 57 ++++++++++++++++------------------------------ 1 file changed, 19 insertions(+), 38 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nandsim.c b/drivers/mtd/nand/nandsim.c index f00e195..28ee785 100644 --- a/drivers/mtd/nand/nandsim.c +++ b/drivers/mtd/nand/nandsim.c @@ -349,8 +349,7 @@ static u_char ns_verify_buf[NS_LARGEST_PAGE_SIZE]; * * RETURNS: 0 if success, -ENOMEM if memory alloc fails. */ -static int -alloc_device(struct nandsim *ns) +static int alloc_device(struct nandsim *ns) { int i; @@ -369,8 +368,7 @@ alloc_device(struct nandsim *ns) /* * Free any allocated pages, and free the array of page pointers. */ -static void -free_device(struct nandsim *ns) +static void free_device(struct nandsim *ns) { int i; @@ -388,8 +386,7 @@ free_device(struct nandsim *ns) * * RETURNS: 0 if success, -ERRNO if failure. */ -static int -init_nandsim(struct mtd_info *mtd) +static int init_nandsim(struct mtd_info *mtd) { struct nand_chip *chip = (struct nand_chip *)mtd->priv; struct nandsim *ns = (struct nandsim *)(chip->priv); @@ -505,8 +502,7 @@ error: /* * Free the nandsim structure. */ -static void -free_nandsim(struct nandsim *ns) +static void free_nandsim(struct nandsim *ns) { kfree(ns->buf.byte); free_device(ns); @@ -517,8 +513,7 @@ free_nandsim(struct nandsim *ns) /* * Returns the string representation of 'state' state. */ -static char * -get_state_name(uint32_t state) +static char *get_state_name(uint32_t state) { switch (NS_STATE(state)) { case STATE_CMD_READ0: @@ -576,8 +571,7 @@ get_state_name(uint32_t state) * * RETURNS: 1 if wrong command, 0 if right. */ -static int -check_command(int cmd) +static int check_command(int cmd) { switch (cmd) { @@ -603,8 +597,7 @@ check_command(int cmd) /* * Returns state after command is accepted by command number. */ -static uint32_t -get_state_by_command(unsigned command) +static uint32_t get_state_by_command(unsigned command) { switch (command) { case NAND_CMD_READ0: @@ -640,8 +633,7 @@ get_state_by_command(unsigned command) /* * Move an address byte to the correspondent internal register. */ -static inline void -accept_addr_byte(struct nandsim *ns, u_char bt) +static inline void accept_addr_byte(struct nandsim *ns, u_char bt) { uint byte = (uint)bt; @@ -659,8 +651,7 @@ accept_addr_byte(struct nandsim *ns, u_char bt) /* * Switch to STATE_READY state. */ -static inline void -switch_to_ready_state(struct nandsim *ns, u_char status) +static inline void switch_to_ready_state(struct nandsim *ns, u_char status) { NS_DBG("switch_to_ready_state: switch to %s state\n", get_state_name(STATE_READY)); @@ -719,8 +710,7 @@ switch_to_ready_state(struct nandsim *ns, u_char status) * -1 - several matches. * 0 - operation is found. */ -static int -find_operation(struct nandsim *ns, uint32_t flag) +static int find_operation(struct nandsim *ns, uint32_t flag) { int opsfound = 0; int i, j, idx = 0; @@ -887,8 +877,7 @@ static int prog_page(struct nandsim *ns, int num) * * RETURNS: 0 if success, -1 if error. */ -static int -do_state_action(struct nandsim *ns, uint32_t action) +static int do_state_action(struct nandsim *ns, uint32_t action) { int num; int busdiv = ns->busw == 8 ? 1 : 2; @@ -1020,8 +1009,7 @@ do_state_action(struct nandsim *ns, uint32_t action) /* * Switch simulator's state. */ -static void -switch_state(struct nandsim *ns) +static void switch_state(struct nandsim *ns) { if (ns->op) { /* @@ -1162,8 +1150,7 @@ switch_state(struct nandsim *ns) } } -static u_char -ns_nand_read_byte(struct mtd_info *mtd) +static u_char ns_nand_read_byte(struct mtd_info *mtd) { struct nandsim *ns = (struct nandsim *)((struct nand_chip *)mtd->priv)->priv; u_char outb = 0x00; @@ -1236,8 +1223,7 @@ ns_nand_read_byte(struct mtd_info *mtd) return outb; } -static void -ns_nand_write_byte(struct mtd_info *mtd, u_char byte) +static void ns_nand_write_byte(struct mtd_info *mtd, u_char byte) { struct nandsim *ns = (struct nandsim *)((struct nand_chip *)mtd->priv)->priv; @@ -1400,15 +1386,13 @@ static void ns_hwcontrol(struct mtd_info *mtd, int cmd, unsigned int bitmask) ns_nand_write_byte(mtd, cmd); } -static int -ns_device_ready(struct mtd_info *mtd) +static int ns_device_ready(struct mtd_info *mtd) { NS_DBG("device_ready\n"); return 1; } -static uint16_t -ns_nand_read_word(struct mtd_info *mtd) +static uint16_t ns_nand_read_word(struct mtd_info *mtd) { struct nand_chip *chip = (struct nand_chip *)mtd->priv; @@ -1417,8 +1401,7 @@ ns_nand_read_word(struct mtd_info *mtd) return chip->read_byte(mtd) | (chip->read_byte(mtd) << 8); } -static void -ns_nand_write_buf(struct mtd_info *mtd, const u_char *buf, int len) +static void ns_nand_write_buf(struct mtd_info *mtd, const u_char *buf, int len) { struct nandsim *ns = (struct nandsim *)((struct nand_chip *)mtd->priv)->priv; @@ -1445,8 +1428,7 @@ ns_nand_write_buf(struct mtd_info *mtd, const u_char *buf, int len) } } -static void -ns_nand_read_buf(struct mtd_info *mtd, u_char *buf, int len) +static void ns_nand_read_buf(struct mtd_info *mtd, u_char *buf, int len) { struct nandsim *ns = (struct nandsim *)((struct nand_chip *)mtd->priv)->priv; @@ -1499,8 +1481,7 @@ ns_nand_read_buf(struct mtd_info *mtd, u_char *buf, int len) return; } -static int -ns_nand_verify_buf(struct mtd_info *mtd, const u_char *buf, int len) +static int ns_nand_verify_buf(struct mtd_info *mtd, const u_char *buf, int len) { ns_nand_read_buf(mtd, (u_char *)&ns_verify_buf[0], len); -- cgit v1.1 From d29ebdbee4c196adddf9f412e6ea1f211656744f Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Thu, 19 Oct 2006 16:04:02 +0300 Subject: [MTD] core: trivial comments fix Signed-off-by: Artem Bityutskiy Signed-off-by: David Woodhouse --- drivers/mtd/nand/nand_base.c | 12 ++++++------ 1 file changed, 6 insertions(+), 6 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nand_base.c b/drivers/mtd/nand/nand_base.c index baece61..53c66d5 100644 --- a/drivers/mtd/nand/nand_base.c +++ b/drivers/mtd/nand/nand_base.c @@ -755,7 +755,7 @@ static int nand_read_page_raw(struct mtd_info *mtd, struct nand_chip *chip, } /** - * nand_read_page_swecc - {REPLACABLE] software ecc based page read function + * nand_read_page_swecc - [REPLACABLE] software ecc based page read function * @mtd: mtd info structure * @chip: nand chip info structure * @buf: buffer to store read data @@ -795,7 +795,7 @@ static int nand_read_page_swecc(struct mtd_info *mtd, struct nand_chip *chip, } /** - * nand_read_page_hwecc - {REPLACABLE] hardware ecc based page read function + * nand_read_page_hwecc - [REPLACABLE] hardware ecc based page read function * @mtd: mtd info structure * @chip: nand chip info structure * @buf: buffer to store read data @@ -839,7 +839,7 @@ static int nand_read_page_hwecc(struct mtd_info *mtd, struct nand_chip *chip, } /** - * nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read + * nand_read_page_syndrome - [REPLACABLE] hardware ecc syndrom based page read * @mtd: mtd info structure * @chip: nand chip info structure * @buf: buffer to store read data @@ -1375,7 +1375,7 @@ static void nand_write_page_raw(struct mtd_info *mtd, struct nand_chip *chip, } /** - * nand_write_page_swecc - {REPLACABLE] software ecc based page write function + * nand_write_page_swecc - [REPLACABLE] software ecc based page write function * @mtd: mtd info structure * @chip: nand chip info structure * @buf: data buffer @@ -1401,7 +1401,7 @@ static void nand_write_page_swecc(struct mtd_info *mtd, struct nand_chip *chip, } /** - * nand_write_page_hwecc - {REPLACABLE] hardware ecc based page write function + * nand_write_page_hwecc - [REPLACABLE] hardware ecc based page write function * @mtd: mtd info structure * @chip: nand chip info structure * @buf: data buffer @@ -1429,7 +1429,7 @@ static void nand_write_page_hwecc(struct mtd_info *mtd, struct nand_chip *chip, } /** - * nand_write_page_syndrome - {REPLACABLE] hardware ecc syndrom based page write + * nand_write_page_syndrome - [REPLACABLE] hardware ecc syndrom based page write * @mtd: mtd info structure * @chip: nand chip info structure * @buf: data buffer -- cgit v1.1 From a86aaa6ddf32b0401e64e74174042866e0fb3e20 Mon Sep 17 00:00:00 2001 From: David Anders Date: Thu, 19 Oct 2006 19:33:19 +0300 Subject: [MTD] NOR: leave Intel chips in read-array mode on suspend During some testing with several samsung s3c24xx based devices it was discovered that often the cfi_cmdset_0001.c would not leave the chip in read-array mode on suspend. this is an issue if the same flash chip is used for the bootloader that needs to be read on resume. Signed-off-by: David Anders Signed-off-by: Nicolas Pitre Signed-off-by: David Woodhouse --- drivers/mtd/chips/cfi_cmdset_0001.c | 2 ++ 1 file changed, 2 insertions(+) (limited to 'drivers') diff --git a/drivers/mtd/chips/cfi_cmdset_0001.c b/drivers/mtd/chips/cfi_cmdset_0001.c index 7ea49a0..e249736 100644 --- a/drivers/mtd/chips/cfi_cmdset_0001.c +++ b/drivers/mtd/chips/cfi_cmdset_0001.c @@ -2224,6 +2224,8 @@ static int cfi_intelext_suspend(struct mtd_info *mtd) case FL_CFI_QUERY: case FL_JEDEC_QUERY: if (chip->oldstate == FL_READY) { + /* place the chip in a known state before suspend */ + map_write(map, CMD(0xFF), cfi->chips[i].start); chip->oldstate = chip->state; chip->state = FL_PM_SUSPENDED; /* No need to wake_up() on this state change - -- cgit v1.1 From 82810b7b6cc7a74c68881a13b0eb66c7a6370fcc Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Fri, 20 Oct 2006 11:23:56 +0300 Subject: [MTD] NAND: nandsim: support subpage write As flash cannot do 0->1 bit transitions when programming, do not do this in the simulator too. This makes nandsim able to accept subpage writes. Signed-off-by: Artem Bityutskiy Signed-off-by: David Woodhouse --- drivers/mtd/nand/nandsim.c | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nandsim.c b/drivers/mtd/nand/nandsim.c index 28ee785..abebcab 100644 --- a/drivers/mtd/nand/nandsim.c +++ b/drivers/mtd/nand/nandsim.c @@ -852,6 +852,7 @@ static void erase_sector(struct nandsim *ns) */ static int prog_page(struct nandsim *ns, int num) { + int i; union ns_mem *mypage; u_char *pg_off; @@ -867,7 +868,8 @@ static int prog_page(struct nandsim *ns, int num) } pg_off = NS_PAGE_BYTE_OFF(ns); - memcpy(pg_off, ns->buf.byte, num); + for (i = 0; i < num; i++) + pg_off[i] &= ns->buf.byte[i]; return 0; } -- cgit v1.1 From 7dcdcbef5d2b60d1db68fd2c07351f7afd8ad376 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sat, 21 Oct 2006 17:09:53 +0100 Subject: [MTD] NAND: Combined oob buffer so it's contiguous with data MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Ditch the separate oobrbuf and oobwbuf fields from the chip buffers, and use only a single buffer immediately after the data. This accommodates NAND controllers such as the OLPC CAFÉ chip, which can't do scatter/gather DMA so needs the OOB buffer to be contiguous with the data, for both read and write. Signed-off-by: David Woodhouse --- drivers/mtd/nand/nand_base.c | 15 +++++---------- 1 file changed, 5 insertions(+), 10 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nand_base.c b/drivers/mtd/nand/nand_base.c index 53c66d5..29090c6 100644 --- a/drivers/mtd/nand/nand_base.c +++ b/drivers/mtd/nand/nand_base.c @@ -971,7 +971,6 @@ static int nand_do_read_ops(struct mtd_info *mtd, loff_t from, page = realpage & chip->pagemask; col = (int)(from & (mtd->writesize - 1)); - chip->oob_poi = chip->buffers->oobrbuf; buf = ops->datbuf; oob = ops->oobbuf; @@ -1270,8 +1269,6 @@ static int nand_do_read_oob(struct mtd_info *mtd, loff_t from, realpage = (int)(from >> chip->page_shift); page = realpage & chip->pagemask; - chip->oob_poi = chip->buffers->oobrbuf; - while(1) { sndcmd = chip->ecc.read_oob(mtd, chip, page, sndcmd); buf = nand_transfer_oob(chip, buf, ops); @@ -1625,7 +1622,9 @@ static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, (chip->pagebuf << chip->page_shift) < (to + ops->len)) chip->pagebuf = -1; - chip->oob_poi = chip->buffers->oobwbuf; + /* If we're not given explicit OOB data, let it be 0xFF */ + if (likely(!oob)) + memset(chip->oob_poi, 0xff, mtd->oobsize); while(1) { int cached = writelen > bytes && page != blockmask; @@ -1654,9 +1653,6 @@ static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, } } - if (unlikely(oob)) - memset(chip->oob_poi, 0xff, mtd->oobsize); - ops->retlen = ops->len - writelen; return ret; } @@ -1744,7 +1740,6 @@ static int nand_do_write_oob(struct mtd_info *mtd, loff_t to, if (page == chip->pagebuf) chip->pagebuf = -1; - chip->oob_poi = chip->buffers->oobwbuf; memset(chip->oob_poi, 0xff, mtd->oobsize); nand_fill_oob(chip, ops->oobbuf, ops); status = chip->ecc.write_oob(mtd, chip, page & chip->pagemask); @@ -2348,8 +2343,8 @@ int nand_scan_tail(struct mtd_info *mtd) if (!chip->buffers) return -ENOMEM; - /* Preset the internal oob write buffer */ - memset(chip->buffers->oobwbuf, 0xff, mtd->oobsize); + /* Set the internal oob buffer location, just after the page data */ + chip->oob_poi = chip->buffers + mtd->writesize; /* * If no default placement scheme is given, select an appropriate one -- cgit v1.1 From 784f4d5e66ac1d962091e08fe5a4b238ed8c793d Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sun, 22 Oct 2006 01:47:45 +0100 Subject: [MTD] NAND: Correct setting of chip->oob_poi OOB buffer Signed-off-by: David Woodhouse --- drivers/mtd/nand/nand_base.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nand_base.c b/drivers/mtd/nand/nand_base.c index 29090c6..f23ab2c 100644 --- a/drivers/mtd/nand/nand_base.c +++ b/drivers/mtd/nand/nand_base.c @@ -2344,7 +2344,7 @@ int nand_scan_tail(struct mtd_info *mtd) return -ENOMEM; /* Set the internal oob buffer location, just after the page data */ - chip->oob_poi = chip->buffers + mtd->writesize; + chip->oob_poi = chip->buffers->databuf + mtd->writesize; /* * If no default placement scheme is given, select an appropriate one -- cgit v1.1 From 04459d7c6239193fa8de4a5107ee8fdb0f366e35 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sun, 22 Oct 2006 02:18:48 +0100 Subject: =?UTF-8?q?[MTD]=20NAND:=20Add=20hardware=20ECC=20correction=20sup?= =?UTF-8?q?port=20to=20CAF=C3=89=20NAND=20driver?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 722 ++++++++++++++++++++++ drivers/mtd/nand/cafe_ecc.c | 1348 ++++++++++++++++++++++++++++++++++++++++++ drivers/mtd/nand/cafe_nand.c | 698 ---------------------- 3 files changed, 2070 insertions(+), 698 deletions(-) create mode 100644 drivers/mtd/nand/cafe.c create mode 100644 drivers/mtd/nand/cafe_ecc.c delete mode 100644 drivers/mtd/nand/cafe_nand.c (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c new file mode 100644 index 0000000..1fe1108 --- /dev/null +++ b/drivers/mtd/nand/cafe.c @@ -0,0 +1,722 @@ +/* + * cafe_nand.c + * + * Copyright © 2006 Red Hat, Inc. + * Copyright © 2006 David Woodhouse + */ + +#define DEBUG + +#include +#undef DEBUG +#include +#include +#include +#include +#include +#include + +#define CAFE_NAND_CTRL1 0x00 +#define CAFE_NAND_CTRL2 0x04 +#define CAFE_NAND_CTRL3 0x08 +#define CAFE_NAND_STATUS 0x0c +#define CAFE_NAND_IRQ 0x10 +#define CAFE_NAND_IRQ_MASK 0x14 +#define CAFE_NAND_DATA_LEN 0x18 +#define CAFE_NAND_ADDR1 0x1c +#define CAFE_NAND_ADDR2 0x20 +#define CAFE_NAND_TIMING1 0x24 +#define CAFE_NAND_TIMING2 0x28 +#define CAFE_NAND_TIMING3 0x2c +#define CAFE_NAND_NONMEM 0x30 +#define CAFE_NAND_ECC_RESULT 0x3C +#define CAFE_NAND_ECC_SYN01 0x50 +#define CAFE_NAND_ECC_SYN23 0x54 +#define CAFE_NAND_ECC_SYN45 0x58 +#define CAFE_NAND_ECC_SYN67 0x5c +#define CAFE_NAND_DMA_CTRL 0x40 +#define CAFE_NAND_DMA_ADDR0 0x44 +#define CAFE_NAND_DMA_ADDR1 0x48 +#define CAFE_NAND_READ_DATA 0x1000 +#define CAFE_NAND_WRITE_DATA 0x2000 + +int cafe_correct_ecc(unsigned char *buf, + unsigned short *chk_syndrome_list); + +struct cafe_priv { + struct nand_chip nand; + struct pci_dev *pdev; + void __iomem *mmio; + uint32_t ctl1; + uint32_t ctl2; + int datalen; + int nr_data; + int data_pos; + int page_addr; + dma_addr_t dmaaddr; + unsigned char *dmabuf; + +}; + +static int usedma = 0; +module_param(usedma, int, 0644); + +static int skipbbt = 0; +module_param(skipbbt, int, 0644); + +static int debug = 0; +module_param(debug, int, 0644); + +/* Hrm. Why isn't this already conditional on something in the struct device? */ +#define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) + + +static int cafe_device_ready(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); + + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", + result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), + readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + return result; +} + + +static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(cafe->dmabuf + cafe->datalen, buf, len); + else + memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); + cafe->datalen += len; + + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", + len, cafe->datalen); +} + +static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) +{ + struct cafe_priv *cafe = mtd->priv; + + if (usedma) + memcpy(buf, cafe->dmabuf + cafe->datalen, len); + else + memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); + + cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", + len, cafe->datalen); + cafe->datalen += len; +} + +static uint8_t cafe_read_byte(struct mtd_info *mtd) +{ + struct cafe_priv *cafe = mtd->priv; + uint8_t d; + + cafe_read_buf(mtd, &d, 1); + cafe_dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); + + return d; +} + +static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, + int column, int page_addr) +{ + struct cafe_priv *cafe = mtd->priv; + int adrbytes = 0; + uint32_t ctl1; + uint32_t doneint = 0x80000000; + int i; + + cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", + command, column, page_addr); + + if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { + /* Second half of a command we already calculated */ + writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); + ctl1 = cafe->ctl1; + cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", + cafe->ctl1, cafe->nr_data); + goto do_command; + } + /* Reset ECC engine */ + writel(0, cafe->mmio + CAFE_NAND_CTRL2); + + /* Emulate NAND_CMD_READOOB on large-page chips */ + if (mtd->writesize > 512 && + command == NAND_CMD_READOOB) { + column += mtd->writesize; + command = NAND_CMD_READ0; + } + + /* FIXME: Do we need to send read command before sending data + for small-page chips, to position the buffer correctly? */ + + if (column != -1) { + writel(column, cafe->mmio + 0x1c); + adrbytes = 2; + if (page_addr != -1) + goto write_adr2; + } else if (page_addr != -1) { + writel(page_addr & 0xffff, cafe->mmio + 0x1c); + page_addr >>= 16; + write_adr2: + writel(page_addr, cafe->mmio+0x20); + adrbytes += 2; + if (mtd->size > mtd->writesize << 16) + adrbytes++; + } + + cafe->data_pos = cafe->datalen = 0; + + /* Set command valid bit */ + ctl1 = 0x80000000 | command; + + /* Set RD or WR bits as appropriate */ + if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { + ctl1 |= (1<<26); /* rd */ + /* Always 5 bytes, for now */ + cafe->datalen = 4; + /* And one address cycle -- even for STATUS, since the controller doesn't work without */ + adrbytes = 1; + } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || + command == NAND_CMD_READOOB || command == NAND_CMD_RNDOUT) { + ctl1 |= 1<<26; /* rd */ + /* For now, assume just read to end of page */ + cafe->datalen = mtd->writesize + mtd->oobsize - column; + } else if (command == NAND_CMD_SEQIN) + ctl1 |= 1<<25; /* wr */ + + /* Set number of address bytes */ + if (adrbytes) + ctl1 |= ((adrbytes-1)|8) << 27; + + if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { + /* Ignore the first command of a pair; the hardware + deals with them both at once, later */ + cafe->ctl1 = ctl1; + cafe->ctl2 = 0; + cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", + cafe->ctl1, cafe->datalen); + return; + } + /* RNDOUT and READ0 commands need a following byte */ + if (command == NAND_CMD_RNDOUT) + writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); + else if (command == NAND_CMD_READ0 && mtd->writesize > 512) + writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); + + do_command: +#if 0 + // ECC on read only works if we ... + if (cafe->datalen == 2112) + cafe->datalen = 2062; +#endif + cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + /* NB: The datasheet lies -- we really should be subtracting 1 here */ + writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); + writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); + if (usedma && (ctl1 & (3<<25))) { + uint32_t dmactl = 0xc0000000 + cafe->datalen; + /* If WR or RD bits set, set up DMA */ + if (ctl1 & (1<<26)) { + /* It's a read */ + dmactl |= (1<<29); + /* ... so it's done when the DMA is done, not just + the command. */ + doneint = 0x10000000; + } + writel(dmactl, cafe->mmio + 0x40); + } +#if 0 + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); + printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); +#endif + cafe->datalen = 0; + +#if 0 + printk("About to write command %08x\n", ctl1); + for (i=0; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); +#endif + writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); + /* Apply this short delay always to ensure that we do wait tWB in + * any case on any machine. */ + ndelay(100); + + if (1) { + int c = 500000; + uint32_t irqs; + + while (c--) { + irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + if (irqs & doneint) + break; + udelay(1); + if (!(c % 100000)) + cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); + cpu_relax(); + } + writel(doneint, cafe->mmio + CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + } + + + cafe->ctl2 &= ~(1<<8); + cafe->ctl2 &= ~(1<<30); + + switch (command) { + + case NAND_CMD_CACHEDPROG: + case NAND_CMD_PAGEPROG: + case NAND_CMD_ERASE1: + case NAND_CMD_ERASE2: + case NAND_CMD_SEQIN: + case NAND_CMD_RNDIN: + case NAND_CMD_STATUS: + case NAND_CMD_DEPLETE1: + case NAND_CMD_RNDOUT: + case NAND_CMD_STATUS_ERROR: + case NAND_CMD_STATUS_ERROR0: + case NAND_CMD_STATUS_ERROR1: + case NAND_CMD_STATUS_ERROR2: + case NAND_CMD_STATUS_ERROR3: + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + return; + } + nand_wait_ready(mtd); + writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); +} + +static void cafe_select_chip(struct mtd_info *mtd, int chipnr) +{ + //struct cafe_priv *cafe = mtd->priv; + // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); +} +static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) +{ + struct mtd_info *mtd = id; + struct cafe_priv *cafe = mtd->priv; + uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); + if (!irqs) + return IRQ_NONE; + + cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + return IRQ_HANDLED; +} + +static void cafe_nand_bug(struct mtd_info *mtd) +{ + BUG(); +} + +static int cafe_nand_write_oob(struct mtd_info *mtd, + struct nand_chip *chip, int page) +{ + int status = 0; + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, mtd->writesize, page); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + + return status & NAND_STATUS_FAIL ? -EIO : 0; +} + +/* Don't use -- use nand_read_oob_std for now */ +static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, + int page, int sndcmd) +{ + chip->cmdfunc(mtd, NAND_CMD_READOOB, 0, page); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + return 1; +} +/** + * cafe_nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read + * @mtd: mtd info structure + * @chip: nand chip info structure + * @buf: buffer to store read data + * + * The hw generator calculates the error syndrome automatically. Therefor + * we need a special oob layout and handling. + */ +static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, + uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", + readl(cafe->mmio + CAFE_NAND_ECC_RESULT), + readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); + + chip->read_buf(mtd, buf, mtd->writesize); + chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); + + if (readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { + unsigned short syn[8]; + int i; + + for (i=0; i<8; i+=2) { + uint32_t tmp = readl(cafe->mmio + CAFE_NAND_ECC_SYN01 + (i*2)); + syn[i] = tmp & 0xfff; + syn[i+1] = (tmp >> 16) & 0xfff; + } + + if ((i = cafe_correct_ecc(buf, syn)) < 0) { + dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); + mtd->ecc_stats.failed++; + } else { + dev_dbg(&cafe->pdev->dev, "Corrected %d symbol errors\n", i); + mtd->ecc_stats.corrected += i; + } + } + + + return 0; +} + +static struct nand_ecclayout cafe_oobinfo_2048 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 50}} +}; + +/* Ick. The BBT code really ought to be able to work this bit out + for itself from the above */ +static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; +static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; + +static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_bbt_pattern +}; + +static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 4, + .veroffs = 18, + .maxblocks = 4, + .pattern = cafe_mirror_pattern +}; + +static struct nand_ecclayout cafe_oobinfo_512 = { + .eccbytes = 14, + .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, + .oobfree = {{14, 2}} +}; + +static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, + struct nand_chip *chip, const uint8_t *buf) +{ + struct cafe_priv *cafe = mtd->priv; + + chip->write_buf(mtd, buf, mtd->writesize); + chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); + + /* Set up ECC autogeneration */ + cafe->ctl2 |= (1<<27) | (1<<30); + if (mtd->writesize == 2048) + cafe->ctl2 |= (1<<29); +} + +static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, + const uint8_t *buf, int page, int cached, int raw) +{ + int status; + + chip->cmdfunc(mtd, NAND_CMD_SEQIN, 0x00, page); + + if (unlikely(raw)) + chip->ecc.write_page_raw(mtd, chip, buf); + else + chip->ecc.write_page(mtd, chip, buf); + + /* + * Cached progamming disabled for now, Not sure if its worth the + * trouble. The speed gain is not very impressive. (2.3->2.6Mib/s) + */ + cached = 0; + + if (!cached || !(chip->options & NAND_CACHEPRG)) { + + chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + /* + * See if operation failed and additional status checks are + * available + */ + if ((status & NAND_STATUS_FAIL) && (chip->errstat)) + status = chip->errstat(mtd, chip, FL_WRITING, status, + page); + + if (status & NAND_STATUS_FAIL) + return -EIO; + } else { + chip->cmdfunc(mtd, NAND_CMD_CACHEDPROG, -1, -1); + status = chip->waitfunc(mtd, chip); + } + +#ifdef CONFIG_MTD_NAND_VERIFY_WRITE + /* Send command to read back the data */ + chip->cmdfunc(mtd, NAND_CMD_READ0, 0, page); + + if (chip->verify_buf(mtd, buf, mtd->writesize)) + return -EIO; +#endif + return 0; +} + +static int cafe_nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) +{ + return 0; +} + +static int __devinit cafe_nand_probe(struct pci_dev *pdev, + const struct pci_device_id *ent) +{ + struct mtd_info *mtd; + struct cafe_priv *cafe; + uint32_t ctrl; + int err = 0; + + err = pci_enable_device(pdev); + if (err) + return err; + + pci_set_master(pdev); + + mtd = kzalloc(sizeof(*mtd) + sizeof(struct cafe_priv), GFP_KERNEL); + if (!mtd) { + dev_warn(&pdev->dev, "failed to alloc mtd_info\n"); + return -ENOMEM; + } + cafe = (void *)(&mtd[1]); + + mtd->priv = cafe; + mtd->owner = THIS_MODULE; + + cafe->pdev = pdev; + cafe->mmio = pci_iomap(pdev, 0, 0); + if (!cafe->mmio) { + dev_warn(&pdev->dev, "failed to iomap\n"); + err = -ENOMEM; + goto out_free_mtd; + } + cafe->dmabuf = dma_alloc_coherent(&cafe->pdev->dev, 2112 + sizeof(struct nand_buffers), + &cafe->dmaaddr, GFP_KERNEL); + if (!cafe->dmabuf) { + err = -ENOMEM; + goto out_ior; + } + cafe->nand.buffers = (void *)cafe->dmabuf + 2112; + + cafe->nand.cmdfunc = cafe_nand_cmdfunc; + cafe->nand.dev_ready = cafe_device_ready; + cafe->nand.read_byte = cafe_read_byte; + cafe->nand.read_buf = cafe_read_buf; + cafe->nand.write_buf = cafe_write_buf; + cafe->nand.select_chip = cafe_select_chip; + + cafe->nand.chip_delay = 0; + + /* Enable the following for a flash based bad block table */ + cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; + + if (skipbbt) { + cafe->nand.options |= NAND_SKIP_BBTSCAN; + cafe->nand.block_bad = cafe_nand_block_bad; + } + + /* Timings from Marvell's test code (not verified or calculated by us) */ + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); +#if 1 + writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); + writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); + writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); +#else + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); +#endif + writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); + err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); + if (err) { + dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); + + goto out_free_dma; + } +#if 1 + /* Disable master reset, enable NAND clock */ + ctrl = readl(cafe->mmio + 0x3004); + ctrl &= 0xffffeff0; + ctrl |= 0x00007000; + writel(ctrl | 0x05, cafe->mmio + 0x3004); + writel(ctrl | 0x0a, cafe->mmio + 0x3004); + writel(0, cafe->mmio + 0x40); + + writel(0x7006, cafe->mmio + 0x3004); + writel(0x700a, cafe->mmio + 0x3004); + + /* Set up DMA address */ + writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); + if (sizeof(cafe->dmaaddr) > 4) + writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); + else + writel(0, cafe->mmio + 0x48); + cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", + readl(cafe->mmio+0x44), cafe->dmabuf); + + /* Enable NAND IRQ in global IRQ mask register */ + writel(0x80000007, cafe->mmio + 0x300c); + cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", + readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); +#endif +#if 1 + mtd->writesize=2048; + mtd->oobsize = 0x40; + memset(cafe->dmabuf, 0x5a, 2112); + cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + cafe->nand.cmdfunc(mtd, NAND_CMD_READ0, 0, 0); + // nand_wait_ready(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); + cafe->nand.read_byte(mtd); +#endif +#if 0 + writel(0x84600070, cafe->mmio); + udelay(10); + cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); +#endif + /* Scan to find existance of the device */ + if (nand_scan_ident(mtd, 1)) { + err = -ENXIO; + goto out_irq; + } + + cafe->ctl2 = 1<<27; /* Reed-Solomon ECC */ + if (mtd->writesize == 2048) + cafe->ctl2 |= 1<<29; /* 2KiB page size */ + + /* Set up ECC according to the type of chip we found */ + if (mtd->writesize == 512 || mtd->writesize == 2048) { + cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; + cafe->nand.ecc.size = mtd->writesize; + cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.layout = &cafe_oobinfo_2048; + cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; + cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; + cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; + cafe->nand.ecc.calculate = (void *)cafe_nand_bug; + cafe->nand.ecc.correct = (void *)cafe_nand_bug; + cafe->nand.write_page = cafe_nand_write_page; + cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; + cafe->nand.ecc.write_oob = cafe_nand_write_oob; + cafe->nand.ecc.read_page = cafe_nand_read_page; + cafe->nand.ecc.read_oob = cafe_nand_read_oob; + + } else { + printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", + mtd->writesize); + cafe->nand.ecc.mode = NAND_ECC_NONE; + } + + err = nand_scan_tail(mtd); + if (err) + goto out_irq; + + pci_set_drvdata(pdev, mtd); + add_mtd_device(mtd); + goto out; + + out_irq: + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + out_free_dma: + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + out_ior: + pci_iounmap(pdev, cafe->mmio); + out_free_mtd: + kfree(mtd); + out: + return err; +} + +static void __devexit cafe_nand_remove(struct pci_dev *pdev) +{ + struct mtd_info *mtd = pci_get_drvdata(pdev); + struct cafe_priv *cafe = mtd->priv; + + del_mtd_device(mtd); + /* Disable NAND IRQ in global IRQ mask register */ + writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + free_irq(pdev->irq, mtd); + nand_release(mtd); + pci_iounmap(pdev, cafe->mmio); + dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); + kfree(mtd); +} + +static struct pci_device_id cafe_nand_tbl[] = { + { 0x11ab, 0x4100, PCI_ANY_ID, PCI_ANY_ID, PCI_CLASS_MEMORY_FLASH << 8, 0xFFFF0 } +}; + +MODULE_DEVICE_TABLE(pci, cafe_nand_tbl); + +static struct pci_driver cafe_nand_pci_driver = { + .name = "CAFÉ NAND", + .id_table = cafe_nand_tbl, + .probe = cafe_nand_probe, + .remove = __devexit_p(cafe_nand_remove), +#ifdef CONFIG_PMx + .suspend = cafe_nand_suspend, + .resume = cafe_nand_resume, +#endif +}; + +static int cafe_nand_init(void) +{ + return pci_register_driver(&cafe_nand_pci_driver); +} + +static void cafe_nand_exit(void) +{ + pci_unregister_driver(&cafe_nand_pci_driver); +} +module_init(cafe_nand_init); +module_exit(cafe_nand_exit); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("David Woodhouse "); +MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); + +/* Correct ECC for 2048 bytes of 0xff: + 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ + +/* dwmw2's B-test board, in case of completely screwing it: +Bad eraseblock 2394 at 0x12b40000 +Bad eraseblock 2627 at 0x14860000 +Bad eraseblock 3349 at 0x1a2a0000 +*/ diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c new file mode 100644 index 0000000..4df28a8 --- /dev/null +++ b/drivers/mtd/nand/cafe_ecc.c @@ -0,0 +1,1348 @@ +/* Error correction for CAFÉ NAND controller + * + * © 2006 Marvell, Inc. + * Author: Tom Chiou + * + * This program is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License as published by the Free + * Software Foundation; either version 2 of the License, or (at your option) + * any later version. + * + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for + * more details. + * + * You should have received a copy of the GNU General Public License along with + * this program; if not, write to the Free Software Foundation, Inc., 59 + * Temple Place - Suite 330, Boston, MA 02111-1307, USA. + */ + +#include +#include + +static unsigned short gf4096_mul(unsigned short, unsigned short); +static unsigned short gf64_mul(unsigned short, unsigned short); +static unsigned short gf4096_inv(unsigned short); +static unsigned short err_pos(unsigned short); +static void find_4bit_err_coefs(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short *); +static void zero_4x5_col3(unsigned short[4][5]); +static void zero_4x5_col2(unsigned short[4][5]); +static void zero_4x5_col1(unsigned short[4][5]); +static void swap_4x5_rows(unsigned short[4][5], int, int, int); +static void swap_2x3_rows(unsigned short m[2][3]); +static void solve_4x5(unsigned short m[4][5], unsigned short *, int *); +static void sort_coefs(int *, unsigned short *, int); +static void find_4bit_err_pats(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short *); +static void find_3bit_err_coefs(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short *); +static void zero_3x4_col2(unsigned short[3][4]); +static void zero_3x4_col1(unsigned short[3][4]); +static void swap_3x4_rows(unsigned short[3][4], int, int, int); +static void solve_3x4(unsigned short[3][4], unsigned short *, int *); +static void find_3bit_err_pats(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short *); + +static void find_2bit_err_pats(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short *); +static void find_2x2_soln(unsigned short, unsigned short, unsigned short, + unsigned short, unsigned short, unsigned short, + unsigned short *); +static void solve_2x3(unsigned short[2][3], unsigned short *); +static int chk_no_err_only(unsigned short *, unsigned short *); +static int chk_1_err_only(unsigned short *, unsigned short *); +static int chk_2_err_only(unsigned short *, unsigned short *); +static int chk_3_err_only(unsigned short *, unsigned short *); +static int chk_4_err_only(unsigned short *, unsigned short *); + +static unsigned short gf64_mul(unsigned short a, unsigned short b) +{ + unsigned short tmp1, tmp2, tmp3, tmp4, tmp5; + unsigned short c_bit0, c_bit1, c_bit2, c_bit3, c_bit4, c_bit5, c; + + tmp1 = ((a) ^ (a >> 5)); + tmp2 = ((a >> 4) ^ (a >> 5)); + tmp3 = ((a >> 3) ^ (a >> 4)); + tmp4 = ((a >> 2) ^ (a >> 3)); + tmp5 = ((a >> 1) ^ (a >> 2)); + + c_bit0 = ((a & b) ^ ((a >> 5) & (b >> 1)) ^ ((a >> 4) & (b >> 2)) ^ + ((a >> 3) & (b >> 3)) ^ ((a >> 2) & (b >> 4)) ^ ((a >> 1) & (b >> 5))) & 0x1; + + c_bit1 = (((a >> 1) & b) ^ (tmp1 & (b >> 1)) ^ (tmp2 & (b >> 2)) ^ + (tmp3 & (b >> 3)) ^ (tmp4 & (b >> 4)) ^ (tmp5 & (b >> 5))) & 0x1; + + c_bit2 = (((a >> 2) & b) ^ ((a >> 1) & (b >> 1)) ^ (tmp1 & (b >> 2)) ^ + (tmp2 & (b >> 3)) ^ (tmp3 & (b >> 4)) ^ (tmp4 & (b >> 5))) & 0x1; + + c_bit3 = (((a >> 3) & b) ^ ((a >> 2) & (b >> 1)) ^ ((a >> 1) & (b >> 2)) ^ + (tmp1 & (b >> 3)) ^ (tmp2 & (b >> 4)) ^ (tmp3 & (b >> 5))) & 0x1; + + c_bit4 = (((a >> 4) & b) ^ ((a >> 3) & (b >> 1)) ^ ((a >> 2) & (b >> 2)) ^ + ((a >> 1) & (b >> 3)) ^ (tmp1 & (b >> 4)) ^ (tmp2 & (b >> 5))) & 0x1; + + c_bit5 = (((a >> 5) & b) ^ ((a >> 4) & (b >> 1)) ^ ((a >> 3) & (b >> 2)) ^ + ((a >> 2) & (b >> 3)) ^ ((a >> 1) & (b >> 4)) ^ (tmp1 & (b >> 5))) & 0x1; + + c = c_bit0 | (c_bit1 << 1) | (c_bit2 << 2) | (c_bit3 << 3) | (c_bit4 << 4) | (c_bit5 << 5); + + return c; +} + +static unsigned short gf4096_mul(unsigned short a, unsigned short b) +{ + unsigned short ah, al, bh, bl, alxah, blxbh, ablh, albl, ahbh, ahbhB, c; + + ah = (a >> 6) & 0x3f; + al = a & 0x3f; + bh = (b >> 6) & 0x3f; + bl = b & 0x3f; + alxah = al ^ ah; + blxbh = bl ^ bh; + + ablh = gf64_mul(alxah, blxbh); + albl = gf64_mul(al, bl); + ahbh = gf64_mul(ah, bh); + + ahbhB = ((ahbh & 0x1) << 5) | + ((ahbh & 0x20) >> 1) | + ((ahbh & 0x10) >> 1) | ((ahbh & 0x8) >> 1) | ((ahbh & 0x4) >> 1) | (((ahbh >> 1) ^ ahbh) & 0x1); + + c = ((ablh ^ albl) << 6) | (ahbhB ^ albl); + return c; +} + +static void find_2bit_err_pats(unsigned short s0, unsigned short s1, unsigned short r0, unsigned short r1, unsigned short *pats) +{ + find_2x2_soln(0x1, 0x1, r0, r1, s0, s1, pats); +} + +static void find_3bit_err_coefs(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short s3, unsigned short s4, unsigned short s5, unsigned short *coefs) +{ + unsigned short m[3][4]; + int row_order[3]; + + row_order[0] = 0; + row_order[1] = 1; + row_order[2] = 2; + m[0][0] = s2; + m[0][1] = s1; + m[0][2] = s0; + m[0][3] = s3; + m[1][0] = s3; + m[1][1] = s2; + m[1][2] = s1; + m[1][3] = s4; + m[2][0] = s4; + m[2][1] = s3; + m[2][2] = s2; + m[2][3] = s5; + + if (m[0][2] != 0x0) { + zero_3x4_col2(m); + } else if (m[1][2] != 0x0) { + swap_3x4_rows(m, 0, 1, 4); + zero_3x4_col2(m); + } else if (m[2][2] != 0x0) { + swap_3x4_rows(m, 0, 2, 4); + zero_3x4_col2(m); + } else { + printk(KERN_ERR "Error: find_3bit_err_coefs, s0,s1,s2 all zeros!\n"); + } + + if (m[1][1] != 0x0) { + zero_3x4_col1(m); + } else if (m[2][1] != 0x0) { + swap_3x4_rows(m, 1, 2, 4); + zero_3x4_col1(m); + } else { + printk(KERN_ERR "Error: find_3bit_err_coefs, cannot resolve col 1!\n"); + } + + /* solve coefs */ + solve_3x4(m, coefs, row_order); +} + +static void zero_3x4_col2(unsigned short m[3][4]) +{ + unsigned short minv1, minv2; + + minv1 = gf4096_mul(m[1][2], gf4096_inv(m[0][2])); + minv2 = gf4096_mul(m[2][2], gf4096_inv(m[0][2])); + m[1][0] = m[1][0] ^ gf4096_mul(m[0][0], minv1); + m[1][1] = m[1][1] ^ gf4096_mul(m[0][1], minv1); + m[1][3] = m[1][3] ^ gf4096_mul(m[0][3], minv1); + m[2][0] = m[2][0] ^ gf4096_mul(m[0][0], minv2); + m[2][1] = m[2][1] ^ gf4096_mul(m[0][1], minv2); + m[2][3] = m[2][3] ^ gf4096_mul(m[0][3], minv2); +} + +static void zero_3x4_col1(unsigned short m[3][4]) +{ + unsigned short minv; + minv = gf4096_mul(m[2][1], gf4096_inv(m[1][1])); + m[2][0] = m[2][0] ^ gf4096_mul(m[1][0], minv); + m[2][3] = m[2][3] ^ gf4096_mul(m[1][3], minv); +} + +static void swap_3x4_rows(unsigned short m[3][4], int i, int j, int col_width) +{ + unsigned short tmp0; + int cnt; + for (cnt = 0; cnt < col_width; cnt++) { + tmp0 = m[i][cnt]; + m[i][cnt] = m[j][cnt]; + m[j][cnt] = tmp0; + } +} + +static void solve_3x4(unsigned short m[3][4], unsigned short *coefs, int *row_order) +{ + unsigned short tmp[3]; + tmp[0] = gf4096_mul(m[2][3], gf4096_inv(m[2][0])); + tmp[1] = gf4096_mul((gf4096_mul(tmp[0], m[1][0]) ^ m[1][3]), gf4096_inv(m[1][1])); + tmp[2] = gf4096_mul((gf4096_mul(tmp[0], m[0][0]) ^ gf4096_mul(tmp[1], m[0][1]) ^ m[0][3]), gf4096_inv(m[0][2])); + sort_coefs(row_order, tmp, 3); + coefs[0] = tmp[0]; + coefs[1] = tmp[1]; + coefs[2] = tmp[2]; +} + +static void find_3bit_err_pats(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short r0, + unsigned short r1, unsigned short r2, + unsigned short *pats) +{ + find_2x2_soln(r0 ^ r2, r1 ^ r2, + gf4096_mul(r0, r0 ^ r2), gf4096_mul(r1, r1 ^ r2), + gf4096_mul(s0, r2) ^ s1, gf4096_mul(s1, r2) ^ s2, pats); + pats[2] = s0 ^ pats[0] ^ pats[1]; +} + +static void find_4bit_err_coefs(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short s3, + unsigned short s4, unsigned short s5, + unsigned short s6, unsigned short s7, + unsigned short *coefs) +{ + unsigned short m[4][5]; + int row_order[4]; + + row_order[0] = 0; + row_order[1] = 1; + row_order[2] = 2; + row_order[3] = 3; + + m[0][0] = s3; + m[0][1] = s2; + m[0][2] = s1; + m[0][3] = s0; + m[0][4] = s4; + m[1][0] = s4; + m[1][1] = s3; + m[1][2] = s2; + m[1][3] = s1; + m[1][4] = s5; + m[2][0] = s5; + m[2][1] = s4; + m[2][2] = s3; + m[2][3] = s2; + m[2][4] = s6; + m[3][0] = s6; + m[3][1] = s5; + m[3][2] = s4; + m[3][3] = s3; + m[3][4] = s7; + + if (m[0][3] != 0x0) { + zero_4x5_col3(m); + } else if (m[1][3] != 0x0) { + swap_4x5_rows(m, 0, 1, 5); + zero_4x5_col3(m); + } else if (m[2][3] != 0x0) { + swap_4x5_rows(m, 0, 2, 5); + zero_4x5_col3(m); + } else if (m[3][3] != 0x0) { + swap_4x5_rows(m, 0, 3, 5); + zero_4x5_col3(m); + } else { + printk(KERN_ERR "Error: find_4bit_err_coefs, s0,s1,s2,s3 all zeros!\n"); + } + + if (m[1][2] != 0x0) { + zero_4x5_col2(m); + } else if (m[2][2] != 0x0) { + swap_4x5_rows(m, 1, 2, 5); + zero_4x5_col2(m); + } else if (m[3][2] != 0x0) { + swap_4x5_rows(m, 1, 3, 5); + zero_4x5_col2(m); + } else { + printk(KERN_ERR "Error: find_4bit_err_coefs, cannot resolve col 2!\n"); + } + + if (m[2][1] != 0x0) { + zero_4x5_col1(m); + } else if (m[3][1] != 0x0) { + swap_4x5_rows(m, 2, 3, 5); + zero_4x5_col1(m); + } else { + printk(KERN_ERR "Error: find_4bit_err_coefs, cannot resolve col 1!\n"); + } + + solve_4x5(m, coefs, row_order); +} + +static void zero_4x5_col3(unsigned short m[4][5]) +{ + unsigned short minv1, minv2, minv3; + + minv1 = gf4096_mul(m[1][3], gf4096_inv(m[0][3])); + minv2 = gf4096_mul(m[2][3], gf4096_inv(m[0][3])); + minv3 = gf4096_mul(m[3][3], gf4096_inv(m[0][3])); + + m[1][0] = m[1][0] ^ gf4096_mul(m[0][0], minv1); + m[1][1] = m[1][1] ^ gf4096_mul(m[0][1], minv1); + m[1][2] = m[1][2] ^ gf4096_mul(m[0][2], minv1); + m[1][4] = m[1][4] ^ gf4096_mul(m[0][4], minv1); + m[2][0] = m[2][0] ^ gf4096_mul(m[0][0], minv2); + m[2][1] = m[2][1] ^ gf4096_mul(m[0][1], minv2); + m[2][2] = m[2][2] ^ gf4096_mul(m[0][2], minv2); + m[2][4] = m[2][4] ^ gf4096_mul(m[0][4], minv2); + m[3][0] = m[3][0] ^ gf4096_mul(m[0][0], minv3); + m[3][1] = m[3][1] ^ gf4096_mul(m[0][1], minv3); + m[3][2] = m[3][2] ^ gf4096_mul(m[0][2], minv3); + m[3][4] = m[3][4] ^ gf4096_mul(m[0][4], minv3); +} + +static void zero_4x5_col2(unsigned short m[4][5]) +{ + unsigned short minv2, minv3; + + minv2 = gf4096_mul(m[2][2], gf4096_inv(m[1][2])); + minv3 = gf4096_mul(m[3][2], gf4096_inv(m[1][2])); + + m[2][0] = m[2][0] ^ gf4096_mul(m[1][0], minv2); + m[2][1] = m[2][1] ^ gf4096_mul(m[1][1], minv2); + m[2][4] = m[2][4] ^ gf4096_mul(m[1][4], minv2); + m[3][0] = m[3][0] ^ gf4096_mul(m[1][0], minv3); + m[3][1] = m[3][1] ^ gf4096_mul(m[1][1], minv3); + m[3][4] = m[3][4] ^ gf4096_mul(m[1][4], minv3); +} + +static void zero_4x5_col1(unsigned short m[4][5]) +{ + unsigned short minv; + + minv = gf4096_mul(m[3][1], gf4096_inv(m[2][1])); + + m[3][0] = m[3][0] ^ gf4096_mul(m[2][0], minv); + m[3][4] = m[3][4] ^ gf4096_mul(m[2][4], minv); +} + +static void swap_4x5_rows(unsigned short m[4][5], int i, int j, int col_width) +{ + unsigned short tmp0; + int cnt; + + for (cnt = 0; cnt < col_width; cnt++) { + tmp0 = m[i][cnt]; + m[i][cnt] = m[j][cnt]; + m[j][cnt] = tmp0; + } +} + +static void solve_4x5(unsigned short m[4][5], unsigned short *coefs, int *row_order) +{ + unsigned short tmp[4]; + + tmp[0] = gf4096_mul(m[3][4], gf4096_inv(m[3][0])); + tmp[1] = gf4096_mul((gf4096_mul(tmp[0], m[2][0]) ^ m[2][4]), gf4096_inv(m[2][1])); + tmp[2] = gf4096_mul((gf4096_mul(tmp[0], m[1][0]) ^ gf4096_mul(tmp[1], m[1][1]) ^ m[1][4]), gf4096_inv(m[1][2])); + tmp[3] = gf4096_mul((gf4096_mul(tmp[0], m[0][0]) ^ + gf4096_mul(tmp[1], m[0][1]) ^ gf4096_mul(tmp[2], m[0][2]) ^ m[0][4]), gf4096_inv(m[0][3])); + sort_coefs(row_order, tmp, 4); + coefs[0] = tmp[0]; + coefs[1] = tmp[1]; + coefs[2] = tmp[2]; + coefs[3] = tmp[3]; +} + +static void sort_coefs(int *order, unsigned short *soln, int len) +{ + int cnt, start_cnt, least_ord, least_cnt; + unsigned short tmp0; + for (start_cnt = 0; start_cnt < len; start_cnt++) { + for (cnt = start_cnt; cnt < len; cnt++) { + if (cnt == start_cnt) { + least_ord = order[cnt]; + least_cnt = start_cnt; + } else { + if (least_ord > order[cnt]) { + least_ord = order[cnt]; + least_cnt = cnt; + } + } + } + if (least_cnt != start_cnt) { + tmp0 = order[least_cnt]; + order[least_cnt] = order[start_cnt]; + order[start_cnt] = tmp0; + tmp0 = soln[least_cnt]; + soln[least_cnt] = soln[start_cnt]; + soln[start_cnt] = tmp0; + } + } +} + +static void find_4bit_err_pats(unsigned short s0, unsigned short s1, + unsigned short s2, unsigned short s3, + unsigned short z1, unsigned short z2, + unsigned short z3, unsigned short z4, + unsigned short *pats) +{ + unsigned short z4_z1, z3z4_z3z3, z4_z2, s0z4_s1, z1z4_z1z1, + z4_z3, z2z4_z2z2, s1z4_s2, z3z3z4_z3z3z3, z1z1z4_z1z1z1, z2z2z4_z2z2z2, s2z4_s3; + unsigned short tmp0, tmp1, tmp2, tmp3; + + z4_z1 = z4 ^ z1; + z3z4_z3z3 = gf4096_mul(z3, z4) ^ gf4096_mul(z3, z3); + z4_z2 = z4 ^ z2; + s0z4_s1 = gf4096_mul(s0, z4) ^ s1; + z1z4_z1z1 = gf4096_mul(z1, z4) ^ gf4096_mul(z1, z1); + z4_z3 = z4 ^ z3; + z2z4_z2z2 = gf4096_mul(z2, z4) ^ gf4096_mul(z2, z2); + s1z4_s2 = gf4096_mul(s1, z4) ^ s2; + z3z3z4_z3z3z3 = gf4096_mul(gf4096_mul(z3, z3), z4) ^ gf4096_mul(gf4096_mul(z3, z3), z3); + z1z1z4_z1z1z1 = gf4096_mul(gf4096_mul(z1, z1), z4) ^ gf4096_mul(gf4096_mul(z1, z1), z1); + z2z2z4_z2z2z2 = gf4096_mul(gf4096_mul(z2, z2), z4) ^ gf4096_mul(gf4096_mul(z2, z2), z2); + s2z4_s3 = gf4096_mul(s2, z4) ^ s3; + + //find err pat 0,1 + find_2x2_soln(gf4096_mul(z4_z1, z3z4_z3z3) ^ + gf4096_mul(z1z4_z1z1, z4_z3), gf4096_mul(z4_z2, + z3z4_z3z3) ^ + gf4096_mul(z2z4_z2z2, z4_z3), gf4096_mul(z1z4_z1z1, + z3z3z4_z3z3z3) ^ + gf4096_mul(z1z1z4_z1z1z1, z3z4_z3z3), + gf4096_mul(z2z4_z2z2, + z3z3z4_z3z3z3) ^ gf4096_mul(z2z2z4_z2z2z2, + z3z4_z3z3), + gf4096_mul(s0z4_s1, z3z4_z3z3) ^ gf4096_mul(s1z4_s2, + z4_z3), + gf4096_mul(s1z4_s2, z3z3z4_z3z3z3) ^ gf4096_mul(s2z4_s3, z3z4_z3z3), pats); + tmp0 = pats[0]; + tmp1 = pats[1]; + tmp2 = pats[0] ^ pats[1] ^ s0; + tmp3 = gf4096_mul(pats[0], z1) ^ gf4096_mul(pats[1], z2) ^ s1; + + //find err pat 2,3 + find_2x2_soln(0x1, 0x1, z3, z4, tmp2, tmp3, pats); + pats[2] = pats[0]; + pats[3] = pats[1]; + pats[0] = tmp0; + pats[1] = tmp1; +} + +static void find_2x2_soln(unsigned short c00, unsigned short c01, + unsigned short c10, unsigned short c11, + unsigned short lval0, unsigned short lval1, + unsigned short *soln) +{ + unsigned short m[2][3]; + m[0][0] = c00; + m[0][1] = c01; + m[0][2] = lval0; + m[1][0] = c10; + m[1][1] = c11; + m[1][2] = lval1; + + if (m[0][1] != 0x0) { + /* */ + } else if (m[1][1] != 0x0) { + swap_2x3_rows(m); + } else { + printk(KERN_ERR "Warning: find_2bit_err_coefs, s0,s1 all zeros!\n"); + } + + solve_2x3(m, soln); +} + +static void swap_2x3_rows(unsigned short m[2][3]) +{ + unsigned short tmp0; + int cnt; + + for (cnt = 0; cnt < 3; cnt++) { + tmp0 = m[0][cnt]; + m[0][cnt] = m[1][cnt]; + m[1][cnt] = tmp0; + } +} + +static void solve_2x3(unsigned short m[2][3], unsigned short *coefs) +{ + unsigned short minv; + + minv = gf4096_mul(m[1][1], gf4096_inv(m[0][1])); + m[1][0] = m[1][0] ^ gf4096_mul(m[0][0], minv); + m[1][2] = m[1][2] ^ gf4096_mul(m[0][2], minv); + coefs[0] = gf4096_mul(m[1][2], gf4096_inv(m[1][0])); + coefs[1] = gf4096_mul((gf4096_mul(coefs[0], m[0][0]) ^ m[0][2]), gf4096_inv(m[0][1])); +} + +static unsigned char gf64_inv[64] = { + 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, + 61, 54, 51, 39, 26, 35, 14, 24, 23, 15, 20, 34, 11, 53, 45, 6, + 63, 2, 27, 21, 56, 9, 50, 19, 13, 47, 48, 5, 7, 30, 12, 41, + 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32}; + +static unsigned short gf4096_inv(unsigned short din) +{ + unsigned short alahxal, ah2B, deno, inv, bl, bh; + unsigned short ah, al, ahxal; + unsigned short dout; + + ah = (din >> 6) & 0x3f; + al = din & 0x3f; + ahxal = ah ^ al; + ah2B = (((ah ^ (ah >> 3)) & 0x1) << 5) | + ((ah >> 1) & 0x10) | + ((((ah >> 5) ^ (ah >> 2)) & 0x1) << 3) | + ((ah >> 2) & 0x4) | ((((ah >> 4) ^ (ah >> 1)) & 0x1) << 1) | (ah & 0x1); + alahxal = gf64_mul(ahxal, al); + deno = alahxal ^ ah2B; + inv = gf64_inv[deno]; + bl = gf64_mul(inv, ahxal); + bh = gf64_mul(inv, ah); + dout = ((bh & 0x3f) << 6) | (bl & 0x3f); + return (((bh & 0x3f) << 6) | (bl & 0x3f)); +} + +static unsigned short err_pos_lut[4096] = { + 0xfff, 0x000, 0x451, 0xfff, 0xfff, 0x3cf, 0xfff, 0x041, + 0xfff, 0xfff, 0xfff, 0xfff, 0x28a, 0xfff, 0x492, 0xfff, + 0x145, 0xfff, 0xfff, 0x514, 0xfff, 0x082, 0xfff, 0xfff, + 0xfff, 0x249, 0x38e, 0x410, 0xfff, 0x104, 0x208, 0x1c7, + 0xfff, 0xfff, 0xfff, 0xfff, 0x2cb, 0xfff, 0xfff, 0xfff, + 0x0c3, 0x34d, 0x4d3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x186, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x30c, 0x555, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x166, 0xfff, 0xfff, 0xfff, 0xfff, + 0x385, 0x14e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e1, + 0xfff, 0xfff, 0xfff, 0xfff, 0x538, 0xfff, 0x16d, 0xfff, + 0xfff, 0xfff, 0x45b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x29c, 0x2cc, 0x30b, 0x2b3, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0b3, 0xfff, 0x2f7, + 0xfff, 0x32b, 0xfff, 0xfff, 0xfff, 0xfff, 0x0a7, 0xfff, + 0xfff, 0x2da, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x07e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x11c, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x22f, 0xfff, 0x1f4, 0xfff, 0xfff, + 0x2b0, 0x504, 0xfff, 0x114, 0xfff, 0xfff, 0xfff, 0x21d, + 0xfff, 0xfff, 0xfff, 0xfff, 0x00d, 0x3c4, 0x340, 0x10f, + 0xfff, 0xfff, 0x266, 0x02e, 0xfff, 0xfff, 0xfff, 0x4f8, + 0x337, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x07b, 0x168, 0xfff, 0xfff, 0x0fe, + 0xfff, 0xfff, 0x51a, 0xfff, 0x458, 0xfff, 0x36d, 0xfff, + 0xfff, 0xfff, 0xfff, 0x073, 0x37d, 0x415, 0x550, 0xfff, + 0xfff, 0xfff, 0x23b, 0x4b4, 0xfff, 0xfff, 0xfff, 0x1a1, + 0xfff, 0xfff, 0x3aa, 0xfff, 0x117, 0x04d, 0x341, 0xfff, + 0xfff, 0xfff, 0xfff, 0x518, 0x03e, 0x0f2, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x363, 0xfff, 0x0b9, 0xfff, 0xfff, + 0x241, 0xfff, 0xfff, 0x049, 0xfff, 0xfff, 0xfff, 0xfff, + 0x15f, 0x52d, 0xfff, 0xfff, 0xfff, 0x29e, 0xfff, 0xfff, + 0xfff, 0xfff, 0x4cf, 0x0fc, 0xfff, 0x36f, 0x3d3, 0xfff, + 0x228, 0xfff, 0xfff, 0x45e, 0xfff, 0xfff, 0xfff, 0xfff, + 0x238, 0xfff, 0xfff, 0xfff, 0xfff, 0x47f, 0xfff, 0xfff, + 0x43a, 0x265, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e8, + 0xfff, 0xfff, 0x01a, 0xfff, 0xfff, 0xfff, 0xfff, 0x21e, + 0x1fc, 0x40b, 0xfff, 0xfff, 0xfff, 0x2d0, 0x159, 0xfff, + 0xfff, 0x313, 0xfff, 0xfff, 0x05c, 0x4cc, 0xfff, 0xfff, + 0x0f6, 0x3d5, 0xfff, 0xfff, 0xfff, 0x54f, 0xfff, 0xfff, + 0xfff, 0x172, 0x1e4, 0x07c, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x53c, 0x1ad, 0x535, + 0x19b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x092, 0xfff, 0x2be, 0xfff, 0xfff, 0x482, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0e6, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x476, 0xfff, 0x51d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x342, 0x2b5, 0x22e, 0x09a, 0xfff, 0x08d, + 0x44f, 0x3ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d1, 0xfff, + 0xfff, 0x543, 0xfff, 0x48f, 0xfff, 0x3d2, 0xfff, 0x0d5, + 0x113, 0x0ec, 0x427, 0xfff, 0xfff, 0xfff, 0x4c4, 0xfff, + 0xfff, 0x50a, 0xfff, 0x144, 0xfff, 0x105, 0x39f, 0x294, + 0x164, 0xfff, 0x31a, 0xfff, 0xfff, 0x49a, 0xfff, 0x130, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1be, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x49e, 0x371, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x0e8, 0x49c, 0x0f4, 0xfff, + 0x338, 0x1a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x36c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x1ae, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x31b, 0xfff, 0xfff, 0x2dd, 0x522, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f4, + 0x3c6, 0x30d, 0xfff, 0xfff, 0xfff, 0xfff, 0x34c, 0x18f, + 0x30a, 0xfff, 0x01f, 0x079, 0xfff, 0xfff, 0x54d, 0x46b, + 0x28c, 0x37f, 0xfff, 0xfff, 0xfff, 0xfff, 0x355, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x14f, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x359, 0x3fe, 0x3c5, 0xfff, 0xfff, + 0xfff, 0xfff, 0x423, 0xfff, 0xfff, 0x34a, 0x22c, 0xfff, + 0x25a, 0xfff, 0xfff, 0x4ad, 0xfff, 0x28d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x547, 0xfff, 0xfff, 0xfff, 0xfff, + 0x2e2, 0xfff, 0xfff, 0x1d5, 0xfff, 0x2a8, 0xfff, 0xfff, + 0x03f, 0xfff, 0xfff, 0xfff, 0xfff, 0x3eb, 0x0fa, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x55b, 0xfff, + 0x08e, 0xfff, 0x3ae, 0xfff, 0x3a4, 0xfff, 0x282, 0x158, + 0xfff, 0x382, 0xfff, 0xfff, 0x499, 0xfff, 0xfff, 0x08a, + 0xfff, 0xfff, 0xfff, 0x456, 0x3be, 0xfff, 0x1e2, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x559, 0xfff, 0x1a0, 0xfff, + 0xfff, 0x0b4, 0xfff, 0xfff, 0xfff, 0x2df, 0xfff, 0xfff, + 0xfff, 0x07f, 0x4f5, 0xfff, 0xfff, 0x27c, 0x133, 0x017, + 0xfff, 0x3fd, 0xfff, 0xfff, 0xfff, 0x44d, 0x4cd, 0x17a, + 0x0d7, 0x537, 0xfff, 0xfff, 0x353, 0xfff, 0xfff, 0x351, + 0x366, 0xfff, 0x44a, 0xfff, 0x1a6, 0xfff, 0xfff, 0xfff, + 0x291, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1e3, + 0xfff, 0xfff, 0xfff, 0xfff, 0x389, 0xfff, 0x07a, 0xfff, + 0x1b6, 0x2ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x24e, 0x074, + 0xfff, 0xfff, 0x3dc, 0xfff, 0x4e3, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4eb, 0xfff, 0xfff, 0x3b8, 0x4de, 0xfff, 0x19c, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x262, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x076, 0x4e8, 0x3da, + 0xfff, 0x531, 0xfff, 0xfff, 0x14a, 0xfff, 0x0a2, 0x433, + 0x3df, 0x1e9, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e7, 0x285, + 0x2d8, 0xfff, 0xfff, 0xfff, 0x349, 0x18d, 0x098, 0xfff, + 0x0df, 0x4bf, 0xfff, 0xfff, 0x0b2, 0xfff, 0x346, 0x24d, + 0xfff, 0xfff, 0xfff, 0x24f, 0x4fa, 0x2f9, 0xfff, 0xfff, + 0x3c9, 0xfff, 0x2b4, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x056, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x179, 0xfff, 0x0e9, 0x3f0, 0x33d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x1fd, 0xfff, 0xfff, 0x526, 0xfff, + 0xfff, 0xfff, 0x53d, 0xfff, 0xfff, 0xfff, 0x170, 0x331, + 0xfff, 0x068, 0xfff, 0xfff, 0xfff, 0x3f7, 0xfff, 0x3d8, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x09f, 0x556, 0xfff, 0xfff, 0x02d, 0xfff, 0xfff, + 0x553, 0xfff, 0xfff, 0xfff, 0x1f0, 0xfff, 0xfff, 0x4d6, + 0x41e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d5, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x248, 0xfff, 0xfff, 0xfff, 0x0a3, + 0xfff, 0x217, 0xfff, 0xfff, 0xfff, 0x4f1, 0x209, 0xfff, + 0xfff, 0x475, 0x234, 0x52b, 0x398, 0xfff, 0x08b, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2c2, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x268, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4a3, 0xfff, 0x0aa, 0xfff, 0x1d9, 0xfff, 0xfff, + 0xfff, 0xfff, 0x155, 0xfff, 0xfff, 0xfff, 0xfff, 0x0bf, + 0x539, 0xfff, 0xfff, 0x2f1, 0x545, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2a7, 0x06f, 0xfff, 0x378, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x25e, 0xfff, + 0xfff, 0xfff, 0xfff, 0x15d, 0x02a, 0xfff, 0xfff, 0x0bc, + 0x235, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x150, 0xfff, 0x1a9, 0xfff, 0xfff, 0xfff, 0xfff, 0x381, + 0xfff, 0x04e, 0x270, 0x13f, 0xfff, 0xfff, 0x405, 0xfff, + 0x3cd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x2ef, 0xfff, 0x06a, 0xfff, 0xfff, 0xfff, 0x34f, + 0x212, 0xfff, 0xfff, 0x0e2, 0xfff, 0x083, 0x298, 0xfff, + 0xfff, 0xfff, 0x0c2, 0xfff, 0xfff, 0x52e, 0xfff, 0x488, + 0xfff, 0xfff, 0xfff, 0x36b, 0xfff, 0xfff, 0xfff, 0x442, + 0x091, 0xfff, 0x41c, 0xfff, 0xfff, 0x3a5, 0xfff, 0x4e6, + 0xfff, 0xfff, 0x40d, 0x31d, 0xfff, 0xfff, 0xfff, 0x4c1, + 0x053, 0xfff, 0x418, 0x13c, 0xfff, 0x350, 0xfff, 0x0ae, + 0xfff, 0xfff, 0x41f, 0xfff, 0x470, 0xfff, 0x4ca, 0xfff, + 0xfff, 0xfff, 0x02b, 0x450, 0xfff, 0x1f8, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x293, 0xfff, + 0xfff, 0xfff, 0xfff, 0x411, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x0b8, 0xfff, 0xfff, 0xfff, + 0x3e1, 0xfff, 0xfff, 0xfff, 0xfff, 0x43c, 0xfff, 0x2b2, + 0x2ab, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ec, + 0xfff, 0xfff, 0xfff, 0x3f8, 0x034, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x11a, 0xfff, 0x541, 0x45c, 0x134, + 0x1cc, 0xfff, 0xfff, 0xfff, 0x469, 0xfff, 0xfff, 0x44b, + 0x161, 0xfff, 0xfff, 0xfff, 0x055, 0xfff, 0xfff, 0xfff, + 0xfff, 0x307, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d1, 0xfff, + 0xfff, 0xfff, 0x124, 0x37b, 0x26b, 0x336, 0xfff, 0xfff, + 0x2e4, 0x3cb, 0xfff, 0xfff, 0x0f8, 0x3c8, 0xfff, 0xfff, + 0xfff, 0x461, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4b5, + 0x2cf, 0xfff, 0xfff, 0xfff, 0x20f, 0xfff, 0x35a, 0xfff, + 0x490, 0xfff, 0x185, 0xfff, 0xfff, 0xfff, 0xfff, 0x42e, + 0xfff, 0xfff, 0xfff, 0xfff, 0x54b, 0xfff, 0xfff, 0xfff, + 0x146, 0xfff, 0x412, 0xfff, 0xfff, 0xfff, 0x1ff, 0xfff, + 0xfff, 0x3e0, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d5, 0xfff, + 0x4df, 0x505, 0xfff, 0x413, 0xfff, 0x1a5, 0xfff, 0x3b2, + 0xfff, 0xfff, 0xfff, 0x35b, 0xfff, 0x116, 0xfff, 0xfff, + 0x171, 0x4d0, 0xfff, 0x154, 0x12d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x468, 0x4db, 0xfff, + 0xfff, 0x1df, 0xfff, 0xfff, 0xfff, 0xfff, 0x05a, 0xfff, + 0x0f1, 0x403, 0xfff, 0x22b, 0x2e0, 0xfff, 0xfff, 0xfff, + 0x2b7, 0x373, 0xfff, 0xfff, 0xfff, 0xfff, 0x13e, 0xfff, + 0xfff, 0xfff, 0x0d0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x329, 0x1d2, 0x3fa, 0x047, 0xfff, 0x2f2, 0xfff, 0xfff, + 0x141, 0x0ac, 0x1d7, 0xfff, 0x07d, 0xfff, 0xfff, 0xfff, + 0x1c1, 0xfff, 0x487, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x045, 0xfff, 0xfff, 0xfff, 0xfff, + 0x288, 0x0cd, 0xfff, 0xfff, 0xfff, 0xfff, 0x226, 0x1d8, + 0xfff, 0x153, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4cb, + 0x528, 0xfff, 0xfff, 0xfff, 0x20a, 0x343, 0x3a1, 0xfff, + 0xfff, 0xfff, 0x2d7, 0x2d3, 0x1aa, 0x4c5, 0xfff, 0xfff, + 0xfff, 0x42b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3e9, 0xfff, 0x20b, 0x260, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x37c, 0x2fd, + 0xfff, 0xfff, 0x2c8, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x31e, 0xfff, 0x335, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x135, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x35c, 0x4dd, 0x129, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x1ef, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x34e, 0xfff, 0xfff, 0xfff, 0xfff, 0x407, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3ad, 0xfff, 0xfff, 0xfff, + 0x379, 0xfff, 0xfff, 0x1d0, 0x38d, 0xfff, 0xfff, 0x1e8, + 0x184, 0x3c1, 0x1c4, 0xfff, 0x1f9, 0xfff, 0xfff, 0x424, + 0xfff, 0xfff, 0xfff, 0xfff, 0x1d3, 0x0d4, 0xfff, 0x4e9, + 0xfff, 0xfff, 0xfff, 0x530, 0x107, 0xfff, 0x106, 0x04f, + 0xfff, 0xfff, 0x4c7, 0x503, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x15c, 0xfff, 0x23f, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4f3, 0xfff, 0xfff, 0x3c7, + 0xfff, 0x278, 0xfff, 0xfff, 0x0a6, 0xfff, 0xfff, 0xfff, + 0x122, 0x1cf, 0xfff, 0x327, 0xfff, 0x2e5, 0xfff, 0x29d, + 0xfff, 0xfff, 0x3f1, 0xfff, 0xfff, 0x48d, 0xfff, 0xfff, + 0xfff, 0xfff, 0x054, 0xfff, 0xfff, 0xfff, 0xfff, 0x178, + 0x27e, 0x4e0, 0x352, 0x02f, 0x09c, 0xfff, 0x2a0, 0xfff, + 0xfff, 0x46a, 0x457, 0xfff, 0xfff, 0x501, 0xfff, 0x2ba, + 0xfff, 0xfff, 0xfff, 0x54e, 0x2e7, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x551, 0xfff, 0xfff, 0x1db, 0x2aa, 0xfff, + 0xfff, 0x4bc, 0xfff, 0xfff, 0x395, 0xfff, 0x0de, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x455, 0xfff, 0x17e, + 0xfff, 0x221, 0x4a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x388, 0xfff, 0xfff, 0xfff, 0x308, 0xfff, 0xfff, 0xfff, + 0x20e, 0x4b9, 0xfff, 0x273, 0x20c, 0x09e, 0xfff, 0x057, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3f2, 0xfff, 0x1a8, 0x3a6, + 0x14c, 0xfff, 0xfff, 0x071, 0xfff, 0xfff, 0x53a, 0xfff, + 0xfff, 0xfff, 0xfff, 0x109, 0xfff, 0xfff, 0x399, 0xfff, + 0x061, 0x4f0, 0x39e, 0x244, 0xfff, 0x035, 0xfff, 0xfff, + 0x305, 0x47e, 0x297, 0xfff, 0xfff, 0x2b8, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1bc, 0xfff, 0x2fc, + 0xfff, 0xfff, 0x554, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b6, + 0xfff, 0xfff, 0xfff, 0x515, 0x397, 0xfff, 0xfff, 0x12f, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e5, + 0xfff, 0x4fc, 0xfff, 0xfff, 0x05e, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x0a8, 0x3af, 0x015, 0xfff, 0xfff, 0xfff, + 0xfff, 0x138, 0xfff, 0xfff, 0xfff, 0x540, 0xfff, 0xfff, + 0xfff, 0x027, 0x523, 0x2f0, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x16c, 0xfff, 0x27d, 0xfff, 0xfff, 0xfff, + 0xfff, 0x04c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4dc, + 0xfff, 0xfff, 0x059, 0x301, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x1a3, 0xfff, 0x15a, 0xfff, 0xfff, + 0x0a5, 0xfff, 0x435, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x051, 0xfff, 0xfff, 0x131, 0xfff, 0x4f4, 0xfff, + 0xfff, 0xfff, 0xfff, 0x441, 0xfff, 0x4fb, 0xfff, 0x03b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ed, 0x274, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d3, 0x55e, 0x1b3, + 0xfff, 0x0bd, 0xfff, 0xfff, 0xfff, 0xfff, 0x225, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4b7, 0xfff, 0xfff, 0x2ff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c3, 0xfff, + 0x383, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f6, + 0xfff, 0xfff, 0x1ee, 0xfff, 0x03d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x26f, 0x1dc, 0xfff, 0x0db, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x0ce, 0xfff, 0xfff, 0x127, 0x03a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x311, 0xfff, + 0xfff, 0x13d, 0x09d, 0x47b, 0x2a6, 0x50d, 0x510, 0x19a, + 0xfff, 0x354, 0x414, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x44c, 0x3b0, 0xfff, 0x23d, 0x429, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x4c0, 0x416, 0xfff, 0x05b, 0xfff, 0xfff, 0x137, 0xfff, + 0x25f, 0x49f, 0xfff, 0x279, 0x013, 0xfff, 0xfff, 0xfff, + 0x269, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d0, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x077, 0xfff, 0xfff, 0x3fb, + 0xfff, 0xfff, 0xfff, 0xfff, 0x271, 0x3a0, 0xfff, 0xfff, + 0x40f, 0xfff, 0xfff, 0x3de, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ab, 0x26a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x489, 0xfff, 0xfff, + 0x252, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b7, 0x42f, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b7, + 0xfff, 0x2bb, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x0f7, 0x01d, 0xfff, 0x067, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4e2, 0xfff, 0xfff, 0x4bb, 0xfff, + 0xfff, 0xfff, 0x17b, 0xfff, 0x0ee, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x36e, 0xfff, 0xfff, 0xfff, 0x533, 0xfff, + 0xfff, 0xfff, 0x4d4, 0x356, 0xfff, 0xfff, 0x375, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4a4, 0x513, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4ff, 0xfff, 0x2af, + 0xfff, 0xfff, 0x026, 0xfff, 0x0ad, 0xfff, 0xfff, 0xfff, + 0xfff, 0x26e, 0xfff, 0xfff, 0xfff, 0xfff, 0x493, 0xfff, + 0x463, 0x4d2, 0x4be, 0xfff, 0xfff, 0xfff, 0xfff, 0x4f2, + 0x0b6, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x32d, 0x315, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x13a, 0x4a1, 0xfff, 0x27a, 0xfff, 0xfff, 0xfff, + 0x47a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x334, 0xfff, 0xfff, 0xfff, 0xfff, 0x54c, 0xfff, 0xfff, + 0xfff, 0x0c9, 0x007, 0xfff, 0xfff, 0x12e, 0xfff, 0x0ff, + 0xfff, 0xfff, 0x3f5, 0x509, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1c3, 0x2ad, 0xfff, 0xfff, 0x47c, 0x261, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x152, 0xfff, 0xfff, 0xfff, 0x339, + 0xfff, 0x243, 0x1c0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x063, 0xfff, 0xfff, 0x254, 0xfff, 0xfff, 0x173, 0xfff, + 0x0c7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x362, 0x259, 0x485, 0x374, 0x0dc, 0x3ab, 0xfff, + 0x1c5, 0x534, 0x544, 0xfff, 0xfff, 0x508, 0xfff, 0x402, + 0x408, 0xfff, 0x0e7, 0xfff, 0xfff, 0x00a, 0x205, 0xfff, + 0xfff, 0x2b9, 0xfff, 0xfff, 0xfff, 0x465, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x23a, 0xfff, 0xfff, 0xfff, + 0xfff, 0x147, 0x19d, 0x115, 0x214, 0xfff, 0x090, 0x368, + 0xfff, 0x210, 0xfff, 0xfff, 0x280, 0x52a, 0x163, 0x148, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x326, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2de, 0xfff, 0xfff, 0xfff, 0xfff, + 0x206, 0x2c1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x189, 0xfff, 0xfff, 0xfff, 0xfff, 0x367, 0xfff, 0x1a4, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x443, 0xfff, 0x27b, + 0xfff, 0xfff, 0x251, 0x549, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x188, 0x04b, 0xfff, 0xfff, 0xfff, 0x31f, + 0x4a6, 0xfff, 0x246, 0x1de, 0x156, 0xfff, 0xfff, 0xfff, + 0x3a9, 0xfff, 0xfff, 0xfff, 0x2fa, 0xfff, 0x128, 0x0d1, + 0x449, 0x255, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x258, 0xfff, 0xfff, 0xfff, + 0x532, 0xfff, 0xfff, 0xfff, 0x303, 0x517, 0xfff, 0xfff, + 0x2a9, 0x24a, 0xfff, 0xfff, 0x231, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x4b6, 0x516, 0xfff, 0xfff, 0x0e4, 0x0eb, + 0xfff, 0x4e4, 0xfff, 0x275, 0xfff, 0xfff, 0x031, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x025, 0x21a, 0xfff, 0x0cc, + 0x45f, 0x3d9, 0x289, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x23e, 0xfff, 0xfff, 0xfff, 0x438, 0x097, + 0x419, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x0a9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x37e, 0x0e0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x431, + 0x372, 0xfff, 0xfff, 0xfff, 0x1ba, 0x06e, 0xfff, 0x1b1, + 0xfff, 0xfff, 0x12a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x193, 0xfff, 0xfff, 0xfff, 0xfff, 0x10a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x048, 0x1b4, + 0xfff, 0xfff, 0xfff, 0xfff, 0x295, 0x140, 0x108, 0xfff, + 0xfff, 0xfff, 0xfff, 0x16f, 0xfff, 0x0a4, 0x37a, 0xfff, + 0x29a, 0xfff, 0x284, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c6, + 0x2a2, 0x3a3, 0xfff, 0x201, 0xfff, 0xfff, 0xfff, 0x4bd, + 0x005, 0x54a, 0x3b5, 0x204, 0x2ee, 0x11d, 0x436, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3ec, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x11f, 0x498, 0x21c, 0xfff, + 0xfff, 0xfff, 0x3d6, 0xfff, 0x4ab, 0xfff, 0x432, 0x2eb, + 0x542, 0x4fd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4ce, 0xfff, 0xfff, 0x2fb, 0xfff, + 0xfff, 0x2e1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b9, 0x037, 0x0dd, + 0xfff, 0xfff, 0xfff, 0x2bf, 0x521, 0x496, 0x095, 0xfff, + 0xfff, 0x328, 0x070, 0x1bf, 0xfff, 0x393, 0xfff, 0xfff, + 0x102, 0xfff, 0xfff, 0x21b, 0xfff, 0x142, 0x263, 0x519, + 0xfff, 0x2a5, 0x177, 0xfff, 0x14d, 0x471, 0x4ae, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1f6, 0xfff, 0x481, 0xfff, 0xfff, 0xfff, 0x151, 0xfff, + 0xfff, 0xfff, 0x085, 0x33f, 0xfff, 0xfff, 0xfff, 0x084, + 0xfff, 0xfff, 0xfff, 0x345, 0x3a2, 0xfff, 0xfff, 0x0a0, + 0x0da, 0x024, 0xfff, 0xfff, 0xfff, 0x1bd, 0xfff, 0x55c, + 0x467, 0x445, 0xfff, 0xfff, 0xfff, 0x052, 0xfff, 0xfff, + 0xfff, 0xfff, 0x51e, 0xfff, 0xfff, 0x39d, 0xfff, 0x35f, + 0xfff, 0x376, 0x3ee, 0xfff, 0xfff, 0xfff, 0xfff, 0x448, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x16a, + 0xfff, 0x036, 0x38f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x211, + 0xfff, 0xfff, 0xfff, 0x230, 0xfff, 0xfff, 0x3ba, 0xfff, + 0xfff, 0xfff, 0x3ce, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x229, 0xfff, 0x176, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x00b, 0xfff, 0x162, 0x018, 0xfff, + 0xfff, 0x233, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x400, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x12b, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x3f4, 0xfff, 0x0f0, 0xfff, 0x1ac, 0xfff, 0xfff, + 0x119, 0xfff, 0x2c0, 0xfff, 0xfff, 0xfff, 0x49b, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x23c, 0xfff, + 0x4b3, 0x010, 0x064, 0xfff, 0xfff, 0x4ba, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x3c2, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x006, 0x196, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x100, 0x191, 0xfff, + 0x1ea, 0x29f, 0xfff, 0xfff, 0xfff, 0x276, 0xfff, 0xfff, + 0x2b1, 0x3b9, 0xfff, 0x03c, 0xfff, 0xfff, 0xfff, 0x180, + 0xfff, 0x08f, 0xfff, 0xfff, 0x19e, 0x019, 0xfff, 0x0b0, + 0x0fd, 0x332, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x06b, 0x2e8, 0xfff, 0x446, 0xfff, 0xfff, 0x004, + 0x247, 0x197, 0xfff, 0x112, 0x169, 0x292, 0xfff, 0x302, + 0xfff, 0xfff, 0x33b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x287, 0x21f, 0xfff, 0x3ea, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e7, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x3a8, 0xfff, 0xfff, 0x2bc, 0xfff, + 0x484, 0x296, 0xfff, 0x1c9, 0x08c, 0x1e5, 0x48a, 0xfff, + 0x360, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1ca, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x10d, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x066, 0x2ea, 0x28b, 0x25b, 0xfff, 0x072, + 0xfff, 0xfff, 0xfff, 0xfff, 0x2b6, 0xfff, 0xfff, 0x272, + 0xfff, 0xfff, 0x525, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x2ca, 0xfff, 0xfff, 0xfff, 0x299, 0xfff, 0xfff, 0xfff, + 0x558, 0x41a, 0xfff, 0x4f7, 0x557, 0xfff, 0x4a0, 0x344, + 0x12c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x125, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x40e, 0xfff, 0xfff, 0x502, 0xfff, 0x103, 0x3e6, 0xfff, + 0x527, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x45d, 0xfff, 0xfff, 0xfff, 0xfff, + 0x44e, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d2, 0x4c9, 0x35e, + 0x459, 0x2d9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x17d, + 0x0c4, 0xfff, 0xfff, 0xfff, 0x3ac, 0x390, 0x094, 0xfff, + 0x483, 0x0ab, 0xfff, 0x253, 0xfff, 0x391, 0xfff, 0xfff, + 0xfff, 0xfff, 0x123, 0x0ef, 0xfff, 0xfff, 0xfff, 0x330, + 0x38c, 0xfff, 0xfff, 0x2ae, 0xfff, 0xfff, 0xfff, 0x042, + 0x012, 0x06d, 0xfff, 0xfff, 0xfff, 0x32a, 0x3db, 0x364, + 0x2dc, 0xfff, 0x30f, 0x3d7, 0x4a5, 0x050, 0xfff, 0xfff, + 0x029, 0xfff, 0xfff, 0xfff, 0xfff, 0x1d1, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x480, 0xfff, + 0x4ed, 0x081, 0x0a1, 0xfff, 0xfff, 0xfff, 0x30e, 0x52f, + 0x257, 0xfff, 0xfff, 0x447, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x401, 0x3cc, 0xfff, 0xfff, 0x0fb, + 0x2c9, 0x42a, 0x314, 0x33e, 0x3bd, 0x318, 0xfff, 0x10e, + 0x2a1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x24c, + 0x506, 0xfff, 0x267, 0xfff, 0xfff, 0x219, 0xfff, 0x1eb, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x309, 0x3e2, 0x46c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x384, 0xfff, 0xfff, 0xfff, 0xfff, 0x50c, 0xfff, 0x24b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x038, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x194, + 0x143, 0x3e3, 0xfff, 0xfff, 0xfff, 0x4c2, 0xfff, 0xfff, + 0x0e1, 0x25c, 0xfff, 0x237, 0xfff, 0x1fe, 0xfff, 0xfff, + 0xfff, 0x065, 0x2a4, 0xfff, 0x386, 0x55a, 0x11b, 0xfff, + 0xfff, 0x192, 0xfff, 0x183, 0x00e, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4b2, 0x18e, 0xfff, 0xfff, 0xfff, + 0xfff, 0x486, 0x4ef, 0x0c6, 0x380, 0xfff, 0x4a8, 0xfff, + 0x0c5, 0xfff, 0xfff, 0xfff, 0xfff, 0x093, 0x1b8, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e6, + 0xfff, 0x0f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x28e, 0xfff, 0x53b, 0x420, 0x22a, 0x33a, 0xfff, 0x387, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2a3, 0xfff, 0xfff, + 0xfff, 0x428, 0x500, 0xfff, 0xfff, 0x120, 0x2c6, 0x290, + 0x2f5, 0x0e3, 0xfff, 0x0b7, 0xfff, 0x319, 0x474, 0xfff, + 0xfff, 0xfff, 0x529, 0x014, 0xfff, 0x41b, 0x40a, 0x18b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d9, + 0xfff, 0x38a, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ce, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3b1, 0xfff, 0xfff, 0x05d, + 0x2c4, 0xfff, 0xfff, 0x4af, 0xfff, 0x030, 0xfff, 0xfff, + 0x203, 0xfff, 0x277, 0x256, 0xfff, 0xfff, 0xfff, 0x4f9, + 0xfff, 0x2c7, 0xfff, 0x466, 0x016, 0x1cd, 0xfff, 0x167, + 0xfff, 0xfff, 0x0c8, 0xfff, 0x43d, 0xfff, 0xfff, 0x020, + 0xfff, 0xfff, 0x232, 0x1cb, 0x1e0, 0xfff, 0xfff, 0x347, + 0xfff, 0x478, 0xfff, 0x365, 0xfff, 0xfff, 0xfff, 0xfff, + 0x358, 0xfff, 0x10b, 0xfff, 0x35d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x452, 0x22d, 0xfff, 0xfff, 0x47d, 0xfff, + 0x2f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x460, 0xfff, + 0xfff, 0xfff, 0x50b, 0xfff, 0xfff, 0xfff, 0x2ec, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4b1, 0x422, 0xfff, 0xfff, + 0xfff, 0x2d4, 0xfff, 0x239, 0xfff, 0xfff, 0xfff, 0x439, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x491, 0x075, 0xfff, 0xfff, 0xfff, 0x06c, 0xfff, + 0xfff, 0x0f9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x139, 0xfff, 0x4f6, 0xfff, 0xfff, 0x409, 0xfff, + 0xfff, 0x15b, 0xfff, 0xfff, 0x348, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4a2, 0x49d, 0xfff, 0x033, 0x175, 0xfff, 0x039, + 0xfff, 0x312, 0x40c, 0xfff, 0xfff, 0x325, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4aa, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x165, 0x3bc, 0x48c, 0x310, 0x096, + 0xfff, 0xfff, 0x250, 0x1a2, 0xfff, 0xfff, 0xfff, 0xfff, + 0x20d, 0x2ac, 0xfff, 0xfff, 0x39b, 0xfff, 0x377, 0xfff, + 0x512, 0x495, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x357, 0x4ea, 0xfff, 0xfff, + 0xfff, 0xfff, 0x198, 0xfff, 0xfff, 0xfff, 0x434, 0x04a, + 0xfff, 0xfff, 0xfff, 0xfff, 0x062, 0xfff, 0x1d6, 0x1c8, + 0xfff, 0x1f3, 0x281, 0xfff, 0x462, 0xfff, 0xfff, 0xfff, + 0x4b0, 0xfff, 0x207, 0xfff, 0xfff, 0xfff, 0xfff, 0x3dd, + 0xfff, 0xfff, 0x55d, 0xfff, 0x552, 0x494, 0x1af, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x227, 0xfff, 0xfff, 0x069, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x43e, + 0x0b5, 0xfff, 0x524, 0x2d2, 0xfff, 0xfff, 0xfff, 0x28f, + 0xfff, 0x01b, 0x50e, 0xfff, 0xfff, 0x1bb, 0xfff, 0xfff, + 0x41d, 0xfff, 0x32e, 0x48e, 0xfff, 0x1f7, 0x224, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x394, 0xfff, 0xfff, 0xfff, + 0xfff, 0x52c, 0xfff, 0xfff, 0xfff, 0x392, 0xfff, 0x1e7, + 0xfff, 0xfff, 0x3f9, 0x3a7, 0xfff, 0x51f, 0xfff, 0x0bb, + 0x118, 0x3ca, 0xfff, 0x1dd, 0xfff, 0x48b, 0xfff, 0xfff, + 0xfff, 0xfff, 0x50f, 0xfff, 0x0d6, 0xfff, 0x1fa, 0xfff, + 0x11e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d7, 0xfff, 0x078, + 0x008, 0xfff, 0x25d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x032, 0x33c, 0xfff, 0x4d9, 0x160, 0xfff, 0xfff, 0x300, + 0x0b1, 0xfff, 0x322, 0xfff, 0x4ec, 0xfff, 0xfff, 0x200, + 0x00c, 0x369, 0x473, 0xfff, 0xfff, 0x32c, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x53e, 0x3d4, 0x417, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x34b, 0x001, 0x39a, 0x02c, 0xfff, 0xfff, 0x2ce, 0x00f, + 0xfff, 0x0ba, 0xfff, 0xfff, 0xfff, 0xfff, 0x060, 0xfff, + 0x406, 0xfff, 0xfff, 0xfff, 0x4ee, 0x4ac, 0xfff, 0x43f, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x29b, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x216, + 0x190, 0xfff, 0x396, 0x464, 0xfff, 0xfff, 0x323, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e9, 0xfff, 0x26d, + 0x2cd, 0x040, 0xfff, 0xfff, 0xfff, 0xfff, 0x38b, 0x3c0, + 0xfff, 0xfff, 0xfff, 0x1f2, 0xfff, 0x0ea, 0xfff, 0xfff, + 0x472, 0xfff, 0x1fb, 0xfff, 0xfff, 0x0af, 0x27f, 0xfff, + 0xfff, 0xfff, 0x479, 0x023, 0xfff, 0x0d8, 0x3b3, 0xfff, + 0xfff, 0xfff, 0x121, 0xfff, 0xfff, 0x3bf, 0xfff, 0xfff, + 0x16b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x45a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x0be, 0xfff, 0xfff, 0xfff, 0x111, 0xfff, 0x220, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x09b, 0x218, 0xfff, 0x022, 0x202, 0xfff, + 0x4c8, 0xfff, 0x0ed, 0xfff, 0xfff, 0x182, 0xfff, 0xfff, + 0xfff, 0x17f, 0x213, 0xfff, 0x321, 0x36a, 0xfff, 0x086, + 0xfff, 0xfff, 0xfff, 0x43b, 0x088, 0xfff, 0xfff, 0xfff, + 0xfff, 0x26c, 0xfff, 0x2f8, 0x3b4, 0xfff, 0xfff, 0xfff, + 0x132, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x333, 0x444, + 0x0c1, 0x4d8, 0x46d, 0x264, 0xfff, 0xfff, 0xfff, 0xfff, + 0x426, 0xfff, 0xfff, 0xfff, 0xfff, 0x2fe, 0xfff, 0xfff, + 0xfff, 0xfff, 0x011, 0xfff, 0x05f, 0xfff, 0xfff, 0xfff, + 0xfff, 0x10c, 0x101, 0xfff, 0xfff, 0xfff, 0xfff, 0x110, + 0xfff, 0x044, 0x304, 0x361, 0x404, 0xfff, 0x51b, 0x099, + 0xfff, 0x440, 0xfff, 0xfff, 0xfff, 0x222, 0xfff, 0xfff, + 0xfff, 0xfff, 0x1b5, 0xfff, 0x136, 0x430, 0xfff, 0x1da, + 0xfff, 0xfff, 0xfff, 0x043, 0xfff, 0x17c, 0xfff, 0xfff, + 0xfff, 0x01c, 0xfff, 0xfff, 0xfff, 0x425, 0x236, 0xfff, + 0x317, 0xfff, 0xfff, 0x437, 0x3fc, 0xfff, 0x1f1, 0xfff, + 0x324, 0xfff, 0xfff, 0x0ca, 0x306, 0xfff, 0x548, 0xfff, + 0x46e, 0xfff, 0xfff, 0xfff, 0x4b8, 0x1c2, 0x286, 0xfff, + 0xfff, 0x087, 0x18a, 0x19f, 0xfff, 0xfff, 0xfff, 0xfff, + 0x18c, 0xfff, 0x215, 0xfff, 0xfff, 0xfff, 0xfff, 0x283, + 0xfff, 0xfff, 0xfff, 0x126, 0xfff, 0xfff, 0x370, 0xfff, + 0x53f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x31c, 0xfff, + 0x4d1, 0xfff, 0xfff, 0xfff, 0x021, 0xfff, 0x157, 0xfff, + 0xfff, 0x028, 0x16e, 0xfff, 0x421, 0xfff, 0x1c6, 0xfff, + 0xfff, 0x511, 0xfff, 0xfff, 0x39c, 0x46f, 0x1b2, 0xfff, + 0xfff, 0x316, 0xfff, 0xfff, 0x009, 0xfff, 0xfff, 0x195, + 0xfff, 0x240, 0x546, 0xfff, 0xfff, 0x520, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x454, 0xfff, 0xfff, 0xfff, + 0x3f3, 0xfff, 0xfff, 0x187, 0xfff, 0x4a9, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x51c, 0x453, 0x1e6, 0xfff, + 0xfff, 0xfff, 0x1b0, 0xfff, 0x477, 0xfff, 0xfff, 0xfff, + 0x4fe, 0xfff, 0x32f, 0xfff, 0xfff, 0x15e, 0x1d4, 0xfff, + 0x0e5, 0xfff, 0xfff, 0xfff, 0x242, 0x14b, 0x046, 0xfff, + 0x3f6, 0x3bb, 0x3e4, 0xfff, 0xfff, 0x2e3, 0xfff, 0x245, + 0xfff, 0x149, 0xfff, 0xfff, 0xfff, 0x2db, 0xfff, 0xfff, + 0x181, 0xfff, 0x089, 0x2c5, 0xfff, 0x1f5, 0xfff, 0x2d6, + 0x507, 0xfff, 0x42d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x080, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3c3, 0x320, 0xfff, 0x1e1, + 0xfff, 0x0f5, 0x13b, 0xfff, 0xfff, 0xfff, 0x003, 0x4da, + 0xfff, 0xfff, 0xfff, 0x42c, 0xfff, 0xfff, 0x0cb, 0xfff, + 0x536, 0x2c3, 0xfff, 0xfff, 0xfff, 0xfff, 0x199, 0xfff, + 0xfff, 0x0c0, 0xfff, 0x01e, 0x497, 0xfff, 0xfff, 0x3e5, + 0xfff, 0xfff, 0xfff, 0x0cf, 0xfff, 0x2bd, 0xfff, 0x223, + 0xfff, 0x3ff, 0xfff, 0x058, 0x174, 0x3ef, 0xfff, 0x002 +}; + +static unsigned short err_pos(unsigned short din) +{ + BUG_ON(din > 4096); + BUG_ON(err_pos_lut[din] == 0xfff); + return err_pos_lut[din]; +} +static int chk_no_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + if ((chk_syndrome_list[0] | chk_syndrome_list[1] | + chk_syndrome_list[2] | chk_syndrome_list[3] | + chk_syndrome_list[4] | chk_syndrome_list[5] | + chk_syndrome_list[6] | chk_syndrome_list[7]) != 0x0) { + return -EINVAL; + } else { + err_info[0] = 0x0; + return 0; + } +} +static int chk_1_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short tmp0, tmp1, tmp2, tmp3, tmp4, tmp5, tmp6; + tmp0 = gf4096_mul(chk_syndrome_list[1], gf4096_inv(chk_syndrome_list[0])); + tmp1 = gf4096_mul(chk_syndrome_list[2], gf4096_inv(chk_syndrome_list[1])); + tmp2 = gf4096_mul(chk_syndrome_list[3], gf4096_inv(chk_syndrome_list[2])); + tmp3 = gf4096_mul(chk_syndrome_list[4], gf4096_inv(chk_syndrome_list[3])); + tmp4 = gf4096_mul(chk_syndrome_list[5], gf4096_inv(chk_syndrome_list[4])); + tmp5 = gf4096_mul(chk_syndrome_list[6], gf4096_inv(chk_syndrome_list[5])); + tmp6 = gf4096_mul(chk_syndrome_list[7], gf4096_inv(chk_syndrome_list[6])); + if ((tmp0 == tmp1) & (tmp1 == tmp2) & (tmp2 == tmp3) & (tmp3 == tmp4) & (tmp4 == tmp5) & (tmp5 == tmp6)) { + err_info[0] = 0x1; // encode 1-symbol error as 0x1 + err_info[1] = err_pos(tmp0); + err_info[1] = (unsigned short)(0x55e - err_info[1]); + err_info[5] = chk_syndrome_list[0]; + return 0; + } else + return -EINVAL; +} +static int chk_2_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short tmp0, tmp1, tmp2, tmp3, tmp4, tmp5, tmp6, tmp7; + unsigned short coefs[4]; + unsigned short err_pats[4]; + int found_num_root = 0; + unsigned short bit2_root0, bit2_root1; + unsigned short bit2_root0_inv, bit2_root1_inv; + unsigned short err_loc_eqn, test_root; + unsigned short bit2_loc0, bit2_loc1; + unsigned short bit2_pat0, bit2_pat1; + + find_2x2_soln(chk_syndrome_list[1], + chk_syndrome_list[0], + chk_syndrome_list[2], chk_syndrome_list[1], chk_syndrome_list[2], chk_syndrome_list[3], coefs); + for (test_root = 0x1; test_root < 0xfff; test_root++) { + err_loc_eqn = + gf4096_mul(coefs[1], gf4096_mul(test_root, test_root)) ^ gf4096_mul(coefs[0], test_root) ^ 0x1; + if (err_loc_eqn == 0x0) { + if (found_num_root == 0) { + bit2_root0 = test_root; + found_num_root = 1; + } else if (found_num_root == 1) { + bit2_root1 = test_root; + found_num_root = 2; + break; + } + } + } + if (found_num_root != 2) + return -EINVAL; + else { + bit2_root0_inv = gf4096_inv(bit2_root0); + bit2_root1_inv = gf4096_inv(bit2_root1); + find_2bit_err_pats(chk_syndrome_list[0], + chk_syndrome_list[1], bit2_root0_inv, bit2_root1_inv, err_pats); + bit2_pat0 = err_pats[0]; + bit2_pat1 = err_pats[1]; + //for(x+1) + tmp0 = gf4096_mul(gf4096_mul(bit2_root0_inv, bit2_root0_inv), gf4096_mul(bit2_root0_inv, bit2_root0_inv)); //rinv0^4 + tmp1 = gf4096_mul(bit2_root0_inv, tmp0); //rinv0^5 + tmp2 = gf4096_mul(bit2_root0_inv, tmp1); //rinv0^6 + tmp3 = gf4096_mul(bit2_root0_inv, tmp2); //rinv0^7 + tmp4 = gf4096_mul(gf4096_mul(bit2_root1_inv, bit2_root1_inv), gf4096_mul(bit2_root1_inv, bit2_root1_inv)); //rinv1^4 + tmp5 = gf4096_mul(bit2_root1_inv, tmp4); //rinv1^5 + tmp6 = gf4096_mul(bit2_root1_inv, tmp5); //rinv1^6 + tmp7 = gf4096_mul(bit2_root1_inv, tmp6); //rinv1^7 + //check if only 2-bit error + if ((chk_syndrome_list[4] == + (gf4096_mul(bit2_pat0, tmp0) ^ + gf4096_mul(bit2_pat1, + tmp4))) & (chk_syndrome_list[5] == + (gf4096_mul(bit2_pat0, tmp1) ^ + gf4096_mul(bit2_pat1, + tmp5))) & + (chk_syndrome_list[6] == + (gf4096_mul(bit2_pat0, tmp2) ^ + gf4096_mul(bit2_pat1, + tmp6))) & (chk_syndrome_list[7] == + (gf4096_mul(bit2_pat0, tmp3) ^ gf4096_mul(bit2_pat1, tmp7)))) { + if ((err_pos(bit2_root0_inv) == 0xfff) | (err_pos(bit2_root1_inv) == 0xfff)) { + return -EINVAL; + } else { + bit2_loc0 = 0x55e - err_pos(bit2_root0_inv); + bit2_loc1 = 0x55e - err_pos(bit2_root1_inv); + err_info[0] = 0x2; // encode 2-symbol error as 0x2 + err_info[1] = bit2_loc0; + err_info[2] = bit2_loc1; + err_info[5] = bit2_pat0; + err_info[6] = bit2_pat1; + return 0; + } + } else + return -EINVAL; + } +} +static int chk_3_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short tmp0, tmp1, tmp2, tmp3, tmp4, tmp5; + unsigned short coefs[4]; + unsigned short err_pats[4]; + int found_num_root = 0; + unsigned short bit3_root0, bit3_root1, bit3_root2; + unsigned short bit3_root0_inv, bit3_root1_inv, bit3_root2_inv; + unsigned short err_loc_eqn, test_root; + + find_3bit_err_coefs(chk_syndrome_list[0], chk_syndrome_list[1], + chk_syndrome_list[2], chk_syndrome_list[3], + chk_syndrome_list[4], chk_syndrome_list[5], coefs); + + for (test_root = 0x1; test_root < 0xfff; test_root++) { + err_loc_eqn = gf4096_mul(coefs[2], + gf4096_mul(gf4096_mul(test_root, test_root), + test_root)) ^ gf4096_mul(coefs[1], gf4096_mul(test_root, test_root)) + ^ gf4096_mul(coefs[0], test_root) ^ 0x1; + + if (err_loc_eqn == 0x0) { + if (found_num_root == 0) { + bit3_root0 = test_root; + found_num_root = 1; + } else if (found_num_root == 1) { + bit3_root1 = test_root; + found_num_root = 2; + } else if (found_num_root == 2) { + bit3_root2 = test_root; + found_num_root = 3; + break; + } + } + } + if (found_num_root != 3) + return -EINVAL; + else { + bit3_root0_inv = gf4096_inv(bit3_root0); + bit3_root1_inv = gf4096_inv(bit3_root1); + bit3_root2_inv = gf4096_inv(bit3_root2); + + find_3bit_err_pats(chk_syndrome_list[0], chk_syndrome_list[1], + chk_syndrome_list[2], bit3_root0_inv, + bit3_root1_inv, bit3_root2_inv, err_pats); + + //check if only 3-bit error + tmp0 = gf4096_mul(bit3_root0_inv, bit3_root0_inv); + tmp0 = gf4096_mul(tmp0, tmp0); + tmp0 = gf4096_mul(tmp0, bit3_root0_inv); + tmp0 = gf4096_mul(tmp0, bit3_root0_inv); //rinv0^6 + tmp1 = gf4096_mul(tmp0, bit3_root0_inv); //rinv0^7 + tmp2 = gf4096_mul(bit3_root1_inv, bit3_root1_inv); + tmp2 = gf4096_mul(tmp2, tmp2); + tmp2 = gf4096_mul(tmp2, bit3_root1_inv); + tmp2 = gf4096_mul(tmp2, bit3_root1_inv); //rinv1^6 + tmp3 = gf4096_mul(tmp2, bit3_root1_inv); //rinv1^7 + tmp4 = gf4096_mul(bit3_root2_inv, bit3_root2_inv); + tmp4 = gf4096_mul(tmp4, tmp4); + tmp4 = gf4096_mul(tmp4, bit3_root2_inv); + tmp4 = gf4096_mul(tmp4, bit3_root2_inv); //rinv2^6 + tmp5 = gf4096_mul(tmp4, bit3_root2_inv); //rinv2^7 + + //check if only 3 errors + if ((chk_syndrome_list[6] == (gf4096_mul(err_pats[0], tmp0) ^ + gf4096_mul(err_pats[1], tmp2) ^ + gf4096_mul(err_pats[2], tmp4))) & + (chk_syndrome_list[7] == (gf4096_mul(err_pats[0], tmp1) ^ + gf4096_mul(err_pats[1], tmp3) ^ gf4096_mul(err_pats[2], tmp5)))) { + if ((err_pos(bit3_root0_inv) == 0xfff) | + (err_pos(bit3_root1_inv) == 0xfff) | (err_pos(bit3_root2_inv) == 0xfff)) { + return -EINVAL; + } else { + err_info[0] = 0x3; + err_info[1] = (0x55e - err_pos(bit3_root0_inv)); + err_info[2] = (0x55e - err_pos(bit3_root1_inv)); + err_info[3] = (0x55e - err_pos(bit3_root2_inv)); + err_info[5] = err_pats[0]; + err_info[6] = err_pats[1]; + err_info[7] = err_pats[2]; + return 0; + } + } else + return -EINVAL; + } +} +static int chk_4_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) +{ + unsigned short coefs[4]; + unsigned short err_pats[4]; + int found_num_root = 0; + unsigned short bit4_root0, bit4_root1, bit4_root2, bit4_root3; + unsigned short bit4_root0_inv, bit4_root1_inv, bit4_root2_inv, bit4_root3_inv; + unsigned short err_loc_eqn, test_root; + + find_4bit_err_coefs(chk_syndrome_list[0], + chk_syndrome_list[1], + chk_syndrome_list[2], + chk_syndrome_list[3], + chk_syndrome_list[4], + chk_syndrome_list[5], chk_syndrome_list[6], chk_syndrome_list[7], coefs); + + for (test_root = 0x1; test_root < 0xfff; test_root++) { + err_loc_eqn = + gf4096_mul(coefs[3], + gf4096_mul(gf4096_mul + (gf4096_mul(test_root, test_root), + test_root), + test_root)) ^ gf4096_mul(coefs[2], + gf4096_mul + (gf4096_mul(test_root, test_root), test_root)) + ^ gf4096_mul(coefs[1], gf4096_mul(test_root, test_root)) ^ gf4096_mul(coefs[0], test_root) + ^ 0x1; + if (err_loc_eqn == 0x0) { + if (found_num_root == 0) { + bit4_root0 = test_root; + found_num_root = 1; + } else if (found_num_root == 1) { + bit4_root1 = test_root; + found_num_root = 2; + } else if (found_num_root == 2) { + bit4_root2 = test_root; + found_num_root = 3; + } else { + found_num_root = 4; + bit4_root3 = test_root; + break; + } + } + } + if (found_num_root != 4) { + return -EINVAL; + } else { + bit4_root0_inv = gf4096_inv(bit4_root0); + bit4_root1_inv = gf4096_inv(bit4_root1); + bit4_root2_inv = gf4096_inv(bit4_root2); + bit4_root3_inv = gf4096_inv(bit4_root3); + find_4bit_err_pats(chk_syndrome_list[0], + chk_syndrome_list[1], + chk_syndrome_list[2], + chk_syndrome_list[3], + bit4_root0_inv, bit4_root1_inv, bit4_root2_inv, bit4_root3_inv, err_pats); + err_info[0] = 0x4; + err_info[1] = (0x55e - err_pos(bit4_root0_inv)); + err_info[2] = (0x55e - err_pos(bit4_root1_inv)); + err_info[3] = (0x55e - err_pos(bit4_root2_inv)); + err_info[4] = (0x55e - err_pos(bit4_root3_inv)); + err_info[5] = err_pats[0]; + err_info[6] = err_pats[1]; + err_info[7] = err_pats[2]; + err_info[8] = err_pats[3]; + return 0; + } +} + +void correct_12bit_symbol(unsigned char *buf, unsigned short sym, + unsigned short val) +{ + if (unlikely(sym > 1366)) { + printk(KERN_ERR "Error: symbol %d out of range; cannot correct\n", sym); + } else if (sym == 0) { + buf[0] ^= val; + } else if (sym & 1) { + buf[1+(3*(sym-1))/2] ^= (val >> 4); + buf[2+(3*(sym-1))/2] ^= ((val & 0xf) << 4); + } else { + buf[2+(3*(sym-2))/2] ^= (val >> 8); + buf[3+(3*(sym-2))/2] ^= (val & 0xff); + } + + +} + +int cafe_correct_ecc(unsigned char *buf, + unsigned short *chk_syndrome_list) +{ + unsigned short err_info[9]; + int i; + + if (chk_no_err_only(chk_syndrome_list, err_info) && + chk_1_err_only(chk_syndrome_list, err_info) && + chk_2_err_only(chk_syndrome_list, err_info) && + chk_3_err_only(chk_syndrome_list, err_info) && + chk_4_err_only(chk_syndrome_list, err_info)) { + return -EIO; + } + + for (i=0; i < err_info[0]; i++) + correct_12bit_symbol(buf, err_info[1+i], err_info[5+i]); + + return err_info[0]; +} + diff --git a/drivers/mtd/nand/cafe_nand.c b/drivers/mtd/nand/cafe_nand.c deleted file mode 100644 index 60cb019..0000000 --- a/drivers/mtd/nand/cafe_nand.c +++ /dev/null @@ -1,698 +0,0 @@ -/* - * cafe_nand.c - * - * Copyright © 2006 Red Hat, Inc. - * Copyright © 2006 David Woodhouse - */ - -#define DEBUG - -#include -#undef DEBUG -#include -#include -#include -#include -#include -#include - -#define CAFE_NAND_CTRL1 0x00 -#define CAFE_NAND_CTRL2 0x04 -#define CAFE_NAND_CTRL3 0x08 -#define CAFE_NAND_STATUS 0x0c -#define CAFE_NAND_IRQ 0x10 -#define CAFE_NAND_IRQ_MASK 0x14 -#define CAFE_NAND_DATA_LEN 0x18 -#define CAFE_NAND_ADDR1 0x1c -#define CAFE_NAND_ADDR2 0x20 -#define CAFE_NAND_TIMING1 0x24 -#define CAFE_NAND_TIMING2 0x28 -#define CAFE_NAND_TIMING3 0x2c -#define CAFE_NAND_NONMEM 0x30 -#define CAFE_NAND_DMA_CTRL 0x40 -#define CAFE_NAND_DMA_ADDR0 0x44 -#define CAFE_NAND_DMA_ADDR1 0x48 -#define CAFE_NAND_READ_DATA 0x1000 -#define CAFE_NAND_WRITE_DATA 0x2000 - -struct cafe_priv { - struct nand_chip nand; - struct pci_dev *pdev; - void __iomem *mmio; - uint32_t ctl1; - uint32_t ctl2; - int datalen; - int nr_data; - int data_pos; - int page_addr; - dma_addr_t dmaaddr; - unsigned char *dmabuf; - -}; - -static int usedma = 1; -module_param(usedma, int, 0644); - -static int skipbbt = 0; -module_param(skipbbt, int, 0644); - -static int debug = 0; -module_param(debug, int, 0644); - -#define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) - - -static int cafe_device_ready(struct mtd_info *mtd) -{ - struct cafe_priv *cafe = mtd->priv; - int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - writel(irqs, cafe->mmio+CAFE_NAND_IRQ); - cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", - result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), - readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); - return result; -} - - -static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) -{ - struct cafe_priv *cafe = mtd->priv; - - if (usedma) - memcpy(cafe->dmabuf + cafe->datalen, buf, len); - else - memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); - cafe->datalen += len; - - cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", - len, cafe->datalen); -} - -static void cafe_read_buf(struct mtd_info *mtd, uint8_t *buf, int len) -{ - struct cafe_priv *cafe = mtd->priv; - - if (usedma) - memcpy(buf, cafe->dmabuf + cafe->datalen, len); - else - memcpy_fromio(buf, cafe->mmio + CAFE_NAND_READ_DATA + cafe->datalen, len); - - cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes from position 0x%x in read buffer.\n", - len, cafe->datalen); - cafe->datalen += len; -} - -static uint8_t cafe_read_byte(struct mtd_info *mtd) -{ - struct cafe_priv *cafe = mtd->priv; - uint8_t d; - - cafe_read_buf(mtd, &d, 1); - cafe_dev_dbg(&cafe->pdev->dev, "Read %02x\n", d); - - return d; -} - -static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, - int column, int page_addr) -{ - struct cafe_priv *cafe = mtd->priv; - int adrbytes = 0; - uint32_t ctl1; - uint32_t doneint = 0x80000000; - int i; - - cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", - command, column, page_addr); - - if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { - /* Second half of a command we already calculated */ - writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); - ctl1 = cafe->ctl1; - cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", - cafe->ctl1, cafe->nr_data); - goto do_command; - } - /* Reset ECC engine */ - writel(0, cafe->mmio + CAFE_NAND_CTRL2); - - /* Emulate NAND_CMD_READOOB on large-page chips */ - if (mtd->writesize > 512 && - command == NAND_CMD_READOOB) { - column += mtd->writesize; - command = NAND_CMD_READ0; - } - - /* FIXME: Do we need to send read command before sending data - for small-page chips, to position the buffer correctly? */ - - if (column != -1) { - writel(column, cafe->mmio + 0x1c); - adrbytes = 2; - if (page_addr != -1) - goto write_adr2; - } else if (page_addr != -1) { - writel(page_addr & 0xffff, cafe->mmio + 0x1c); - page_addr >>= 16; - write_adr2: - writel(page_addr, cafe->mmio+0x20); - adrbytes += 2; - if (mtd->size > mtd->writesize << 16) - adrbytes++; - } - - cafe->data_pos = cafe->datalen = 0; - - /* Set command valid bit */ - ctl1 = 0x80000000 | command; - - /* Set RD or WR bits as appropriate */ - if (command == NAND_CMD_READID || command == NAND_CMD_STATUS) { - ctl1 |= (1<<26); /* rd */ - /* Always 5 bytes, for now */ - cafe->datalen = 4; - /* And one address cycle -- even for STATUS, since the controller doesn't work without */ - adrbytes = 1; - } else if (command == NAND_CMD_READ0 || command == NAND_CMD_READ1 || - command == NAND_CMD_READOOB || command == NAND_CMD_RNDOUT) { - ctl1 |= 1<<26; /* rd */ - /* For now, assume just read to end of page */ - cafe->datalen = mtd->writesize + mtd->oobsize - column; - } else if (command == NAND_CMD_SEQIN) - ctl1 |= 1<<25; /* wr */ - - /* Set number of address bytes */ - if (adrbytes) - ctl1 |= ((adrbytes-1)|8) << 27; - - if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { - /* Ignore the first command of a pair; the hardware - deals with them both at once, later */ - cafe->ctl1 = ctl1; - cafe->ctl2 = 0; - cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", - cafe->ctl1, cafe->datalen); - return; - } - /* RNDOUT and READ0 commands need a following byte */ - if (command == NAND_CMD_RNDOUT) - writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); - else if (command == NAND_CMD_READ0 && mtd->writesize > 512) - writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); - - do_command: - // ECC on read only works if we ... - // if (cafe->datalen == 2112) - // cafe->datalen = 2062; - cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", - cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); - /* NB: The datasheet lies -- we really should be subtracting 1 here */ - writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); - writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); - if (usedma && (ctl1 & (3<<25))) { - uint32_t dmactl = 0xc0000000 + cafe->datalen; - /* If WR or RD bits set, set up DMA */ - if (ctl1 & (1<<26)) { - /* It's a read */ - dmactl |= (1<<29); - /* ... so it's done when the DMA is done, not just - the command. */ - doneint = 0x10000000; - } - writel(dmactl, cafe->mmio + 0x40); - } -#if 0 - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); -#endif - cafe->datalen = 0; - -#if 0 - printk("About to write command %08x\n", ctl1); - for (i=0; i< 0x5c; i+=4) - printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); -#endif - writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); - /* Apply this short delay always to ensure that we do wait tWB in - * any case on any machine. */ - ndelay(100); - - if (1) { - int c = 500000; - uint32_t irqs; - - while (c--) { - irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - if (irqs & doneint) - break; - udelay(1); - if (!(c % 100000)) - cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); - cpu_relax(); - } - writel(doneint, cafe->mmio + CAFE_NAND_IRQ); - cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); - } - - - cafe->ctl2 &= ~(1<<8); - cafe->ctl2 &= ~(1<<30); - - switch (command) { - - case NAND_CMD_CACHEDPROG: - case NAND_CMD_PAGEPROG: - case NAND_CMD_ERASE1: - case NAND_CMD_ERASE2: - case NAND_CMD_SEQIN: - case NAND_CMD_RNDIN: - case NAND_CMD_STATUS: - case NAND_CMD_DEPLETE1: - case NAND_CMD_RNDOUT: - case NAND_CMD_STATUS_ERROR: - case NAND_CMD_STATUS_ERROR0: - case NAND_CMD_STATUS_ERROR1: - case NAND_CMD_STATUS_ERROR2: - case NAND_CMD_STATUS_ERROR3: - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); - return; - } - nand_wait_ready(mtd); - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); -} - -static void cafe_select_chip(struct mtd_info *mtd, int chipnr) -{ - //struct cafe_priv *cafe = mtd->priv; - // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); -} -static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) -{ - struct mtd_info *mtd = id; - struct cafe_priv *cafe = mtd->priv; - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); - if (!irqs) - return IRQ_NONE; - - cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); - return IRQ_HANDLED; -} - -static void cafe_nand_bug(struct mtd_info *mtd) -{ - BUG(); -} - -static int cafe_nand_write_oob(struct mtd_info *mtd, - struct nand_chip *chip, int page) -{ - int status = 0; - - WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); - - chip->cmdfunc(mtd, NAND_CMD_SEQIN, mtd->writesize, page); - chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); - chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); - status = chip->waitfunc(mtd, chip); - - return status & NAND_STATUS_FAIL ? -EIO : 0; -} - -/* Don't use -- use nand_read_oob_std for now */ -static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, - int page, int sndcmd) -{ - chip->cmdfunc(mtd, NAND_CMD_READOOB, 0, page); - chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - return 1; -} -/** - * cafe_nand_read_page_syndrome - {REPLACABLE] hardware ecc syndrom based page read - * @mtd: mtd info structure - * @chip: nand chip info structure - * @buf: buffer to store read data - * - * The hw generator calculates the error syndrome automatically. Therefor - * we need a special oob layout and handling. - */ -static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, - uint8_t *buf) -{ - struct cafe_priv *cafe = mtd->priv; - - WARN_ON(chip->oob_poi != chip->buffers->oobrbuf); - - cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", readl(cafe->mmio + 0x3c), readl(cafe->mmio + 0x50)); - - chip->read_buf(mtd, buf, mtd->writesize); - chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - - return 0; -} - -static struct nand_ecclayout cafe_oobinfo_2048 = { - .eccbytes = 14, - .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, - .oobfree = {{14, 50}} -}; - -/* Ick. The BBT code really ought to be able to work this bit out - for itself from the above */ -static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; -static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; - -static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { - .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE - | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, - .offs = 14, - .len = 4, - .veroffs = 18, - .maxblocks = 4, - .pattern = cafe_bbt_pattern -}; - -static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { - .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE - | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, - .offs = 14, - .len = 4, - .veroffs = 18, - .maxblocks = 4, - .pattern = cafe_mirror_pattern -}; - -static struct nand_ecclayout cafe_oobinfo_512 = { - .eccbytes = 14, - .eccpos = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13}, - .oobfree = {{14, 2}} -}; - - -static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, - struct nand_chip *chip, const uint8_t *buf) -{ - struct cafe_priv *cafe = mtd->priv; - - WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); - - chip->write_buf(mtd, buf, mtd->writesize); - chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); - - /* Set up ECC autogeneration */ - cafe->ctl2 |= (1<<27) | (1<<30); - if (mtd->writesize == 2048) - cafe->ctl2 |= (1<<29); -} - -static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, - const uint8_t *buf, int page, int cached, int raw) -{ - int status; - - WARN_ON(chip->oob_poi != chip->buffers->oobwbuf); - - chip->cmdfunc(mtd, NAND_CMD_SEQIN, 0x00, page); - - if (unlikely(raw)) - chip->ecc.write_page_raw(mtd, chip, buf); - else - chip->ecc.write_page(mtd, chip, buf); - - /* - * Cached progamming disabled for now, Not sure if its worth the - * trouble. The speed gain is not very impressive. (2.3->2.6Mib/s) - */ - cached = 0; - - if (!cached || !(chip->options & NAND_CACHEPRG)) { - - chip->cmdfunc(mtd, NAND_CMD_PAGEPROG, -1, -1); - status = chip->waitfunc(mtd, chip); - /* - * See if operation failed and additional status checks are - * available - */ - if ((status & NAND_STATUS_FAIL) && (chip->errstat)) - status = chip->errstat(mtd, chip, FL_WRITING, status, - page); - - if (status & NAND_STATUS_FAIL) - return -EIO; - } else { - chip->cmdfunc(mtd, NAND_CMD_CACHEDPROG, -1, -1); - status = chip->waitfunc(mtd, chip); - } - -#ifdef CONFIG_MTD_NAND_VERIFY_WRITE - /* Send command to read back the data */ - chip->cmdfunc(mtd, NAND_CMD_READ0, 0, page); - - if (chip->verify_buf(mtd, buf, mtd->writesize)) - return -EIO; -#endif - return 0; -} - -static int cafe_nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) -{ - return 0; -} - -static int __devinit cafe_nand_probe(struct pci_dev *pdev, - const struct pci_device_id *ent) -{ - struct mtd_info *mtd; - struct cafe_priv *cafe; - uint32_t ctrl; - int err = 0; - - err = pci_enable_device(pdev); - if (err) - return err; - - pci_set_master(pdev); - - mtd = kzalloc(sizeof(*mtd) + sizeof(struct cafe_priv), GFP_KERNEL); - if (!mtd) { - dev_warn(&pdev->dev, "failed to alloc mtd_info\n"); - return -ENOMEM; - } - cafe = (void *)(&mtd[1]); - - mtd->priv = cafe; - mtd->owner = THIS_MODULE; - - cafe->pdev = pdev; - cafe->mmio = pci_iomap(pdev, 0, 0); - if (!cafe->mmio) { - dev_warn(&pdev->dev, "failed to iomap\n"); - err = -ENOMEM; - goto out_free_mtd; - } - cafe->dmabuf = dma_alloc_coherent(&cafe->pdev->dev, 2112 + sizeof(struct nand_buffers), - &cafe->dmaaddr, GFP_KERNEL); - if (!cafe->dmabuf) { - err = -ENOMEM; - goto out_ior; - } - cafe->nand.buffers = (void *)cafe->dmabuf + 2112; - - cafe->nand.cmdfunc = cafe_nand_cmdfunc; - cafe->nand.dev_ready = cafe_device_ready; - cafe->nand.read_byte = cafe_read_byte; - cafe->nand.read_buf = cafe_read_buf; - cafe->nand.write_buf = cafe_write_buf; - cafe->nand.select_chip = cafe_select_chip; - - cafe->nand.chip_delay = 0; - - /* Enable the following for a flash based bad block table */ - cafe->nand.options = NAND_USE_FLASH_BBT | NAND_NO_AUTOINCR | NAND_OWN_BUFFERS; - - if (skipbbt) { - cafe->nand.options |= NAND_SKIP_BBTSCAN; - cafe->nand.block_bad = cafe_nand_block_bad; - } - - /* Timings from Marvell's test code (not verified or calculated by us) */ - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); -#if 1 - writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); - writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); - writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); -#else - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); -#endif - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); - err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); - if (err) { - dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); - - goto out_free_dma; - } -#if 1 - /* Disable master reset, enable NAND clock */ - ctrl = readl(cafe->mmio + 0x3004); - ctrl &= 0xffffeff0; - ctrl |= 0x00007000; - writel(ctrl | 0x05, cafe->mmio + 0x3004); - writel(ctrl | 0x0a, cafe->mmio + 0x3004); - writel(0, cafe->mmio + 0x40); - - writel(0x7006, cafe->mmio + 0x3004); - writel(0x700a, cafe->mmio + 0x3004); - - /* Set up DMA address */ - writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); - if (sizeof(cafe->dmaaddr) > 4) - writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); - else - writel(0, cafe->mmio + 0x48); - cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", - readl(cafe->mmio+0x44), cafe->dmabuf); - - /* Enable NAND IRQ in global IRQ mask register */ - writel(0x80000007, cafe->mmio + 0x300c); - cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", - readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); -#endif -#if 1 - mtd->writesize=2048; - mtd->oobsize = 0x40; - memset(cafe->dmabuf, 0x5a, 2112); - cafe->nand.cmdfunc(mtd, NAND_CMD_READID, 0, -1); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); -#endif -#if 0 - cafe->nand.cmdfunc(mtd, NAND_CMD_READ0, 0, 0); - // nand_wait_ready(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); - cafe->nand.read_byte(mtd); -#endif -#if 0 - writel(0x84600070, cafe->mmio); - udelay(10); - cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); -#endif - /* Scan to find existance of the device */ - if (nand_scan_ident(mtd, 1)) { - err = -ENXIO; - goto out_irq; - } - - cafe->ctl2 = 1<<27; /* Reed-Solomon ECC */ - if (mtd->writesize == 2048) - cafe->ctl2 |= 1<<29; /* 2KiB page size */ - - /* Set up ECC according to the type of chip we found */ - if (mtd->writesize == 512 || mtd->writesize == 2048) { - cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; - cafe->nand.ecc.size = mtd->writesize; - cafe->nand.ecc.bytes = 14; - cafe->nand.ecc.layout = &cafe_oobinfo_2048; - cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; - cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; - cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; - cafe->nand.ecc.calculate = (void *)cafe_nand_bug; - cafe->nand.ecc.correct = (void *)cafe_nand_bug; - cafe->nand.write_page = cafe_nand_write_page; - cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; - cafe->nand.ecc.write_oob = cafe_nand_write_oob; - cafe->nand.ecc.read_page = cafe_nand_read_page; - cafe->nand.ecc.read_oob = cafe_nand_read_oob; - - } else { - printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", - mtd->writesize); - cafe->nand.ecc.mode = NAND_ECC_NONE; - } - - err = nand_scan_tail(mtd); - if (err) - goto out_irq; - - pci_set_drvdata(pdev, mtd); - add_mtd_device(mtd); - goto out; - - out_irq: - /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); - free_irq(pdev->irq, mtd); - out_free_dma: - dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); - out_ior: - pci_iounmap(pdev, cafe->mmio); - out_free_mtd: - kfree(mtd); - out: - return err; -} - -static void __devexit cafe_nand_remove(struct pci_dev *pdev) -{ - struct mtd_info *mtd = pci_get_drvdata(pdev); - struct cafe_priv *cafe = mtd->priv; - - del_mtd_device(mtd); - /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); - free_irq(pdev->irq, mtd); - nand_release(mtd); - pci_iounmap(pdev, cafe->mmio); - dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); - kfree(mtd); -} - -static struct pci_device_id cafe_nand_tbl[] = { - { 0x11ab, 0x4100, PCI_ANY_ID, PCI_ANY_ID, PCI_CLASS_MEMORY_FLASH << 8, 0xFFFF0 } -}; - -MODULE_DEVICE_TABLE(pci, cafe_nand_tbl); - -static struct pci_driver cafe_nand_pci_driver = { - .name = "CAFÉ NAND", - .id_table = cafe_nand_tbl, - .probe = cafe_nand_probe, - .remove = __devexit_p(cafe_nand_remove), -#ifdef CONFIG_PMx - .suspend = cafe_nand_suspend, - .resume = cafe_nand_resume, -#endif -}; - -static int cafe_nand_init(void) -{ - return pci_register_driver(&cafe_nand_pci_driver); -} - -static void cafe_nand_exit(void) -{ - pci_unregister_driver(&cafe_nand_pci_driver); -} -module_init(cafe_nand_init); -module_exit(cafe_nand_exit); - -MODULE_LICENSE("GPL"); -MODULE_AUTHOR("David Woodhouse "); -MODULE_DESCRIPTION("NAND flash driver for OLPC CAFE chip"); - -/* Correct ECC for 2048 bytes of 0xff: - 41 a0 71 65 54 27 f3 93 ec a9 be ed 0b a1 */ - -/* dwmw2's B-test board, in case of completely screwing it: -Bad eraseblock 2394 at 0x12b40000 -Bad eraseblock 2627 at 0x14860000 -Bad eraseblock 3349 at 0x1a2a0000 -*/ -- cgit v1.1 From fbad5696c5c45982d02e05b85922bad6eb6e6349 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sun, 22 Oct 2006 15:09:33 +0100 Subject: =?UTF-8?q?[MTD]=20NAND:=20CAF=C3=89=20NAND=20driver=20cleanup,=20?= =?UTF-8?q?fix=20ECC=20on=20reading=20empty=20flash?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/Makefile | 3 +- drivers/mtd/nand/cafe.c | 149 +++++++++++++++++++++++++++++++------------- drivers/mtd/nand/cafe_ecc.c | 5 +- 3 files changed, 109 insertions(+), 48 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/Makefile b/drivers/mtd/nand/Makefile index 7cebc10..f7a53f0 100644 --- a/drivers/mtd/nand/Makefile +++ b/drivers/mtd/nand/Makefile @@ -25,4 +25,5 @@ obj-$(CONFIG_MTD_NAND_CS553X) += cs553x_nand.o obj-$(CONFIG_MTD_NAND_NDFC) += ndfc.o obj-$(CONFIG_MTD_NAND_AT91) += at91_nand.o -nand-objs = nand_base.o nand_bbt.o +nand-objs := nand_base.o nand_bbt.o +cafe_nand-objs := cafe.o cafe_ecc.o diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 1fe1108..10132ef 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -1,5 +1,5 @@ /* - * cafe_nand.c + * Driver for One Laptop Per Child ‘CAFÉ’ controller, aka Marvell 88ALP01 * * Copyright © 2006 Red Hat, Inc. * Copyright © 2006 David Woodhouse @@ -30,13 +30,13 @@ #define CAFE_NAND_TIMING3 0x2c #define CAFE_NAND_NONMEM 0x30 #define CAFE_NAND_ECC_RESULT 0x3C +#define CAFE_NAND_DMA_CTRL 0x40 +#define CAFE_NAND_DMA_ADDR0 0x44 +#define CAFE_NAND_DMA_ADDR1 0x48 #define CAFE_NAND_ECC_SYN01 0x50 #define CAFE_NAND_ECC_SYN23 0x54 #define CAFE_NAND_ECC_SYN45 0x58 #define CAFE_NAND_ECC_SYN67 0x5c -#define CAFE_NAND_DMA_CTRL 0x40 -#define CAFE_NAND_DMA_ADDR0 0x44 -#define CAFE_NAND_DMA_ADDR1 0x48 #define CAFE_NAND_READ_DATA 0x1000 #define CAFE_NAND_WRITE_DATA 0x2000 @@ -75,12 +75,14 @@ static int cafe_device_ready(struct mtd_info *mtd) { struct cafe_priv *cafe = mtd->priv; int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + return result; } @@ -93,6 +95,7 @@ static void cafe_write_buf(struct mtd_info *mtd, const uint8_t *buf, int len) memcpy(cafe->dmabuf + cafe->datalen, buf, len); else memcpy_toio(cafe->mmio + CAFE_NAND_WRITE_DATA + cafe->datalen, buf, len); + cafe->datalen += len; cafe_dev_dbg(&cafe->pdev->dev, "Copy 0x%x bytes to write buffer. datalen 0x%x\n", @@ -131,14 +134,13 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, int adrbytes = 0; uint32_t ctl1; uint32_t doneint = 0x80000000; - int i; cafe_dev_dbg(&cafe->pdev->dev, "cmdfunc %02x, 0x%x, 0x%x\n", command, column, page_addr); if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { /* Second half of a command we already calculated */ - writel(cafe->ctl2 | 0x100 | command, cafe->mmio + 0x04); + writel(cafe->ctl2 | 0x100 | command, cafe->mmio + CAFE_NAND_CTRL2); ctl1 = cafe->ctl1; cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); @@ -158,12 +160,12 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, for small-page chips, to position the buffer correctly? */ if (column != -1) { - writel(column, cafe->mmio + 0x1c); + writel(column, cafe->mmio + CAFE_NAND_ADDR1); adrbytes = 2; if (page_addr != -1) goto write_adr2; } else if (page_addr != -1) { - writel(page_addr & 0xffff, cafe->mmio + 0x1c); + writel(page_addr & 0xffff, cafe->mmio + CAFE_NAND_ADDR1); page_addr >>= 16; write_adr2: writel(page_addr, cafe->mmio+0x20); @@ -212,13 +214,15 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); do_command: -#if 0 - // ECC on read only works if we ... +#if 1 + /* http://dev.laptop.org/ticket/200 + ECC on read only works if we read precisely 0x80e bytes */ if (cafe->datalen == 2112) cafe->datalen = 2062; #endif cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + /* NB: The datasheet lies -- we really should be subtracting 1 here */ writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); @@ -232,18 +236,16 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, the command. */ doneint = 0x10000000; } - writel(dmactl, cafe->mmio + 0x40); + writel(dmactl, cafe->mmio + CAFE_NAND_DMA_CTRL); } -#if 0 - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); - printk("DMA setup is %x, status %x, ctl1 %x\n", readl(cafe->mmio + 0x40), readl(cafe->mmio + 0x0c), readl(cafe->mmio)); -#endif cafe->datalen = 0; #if 0 + { int i; printk("About to write command %08x\n", ctl1); for (i=0; i< 0x5c; i+=4) printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); + } #endif writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); /* Apply this short delay always to ensure that we do wait tWB in @@ -299,6 +301,7 @@ static void cafe_select_chip(struct mtd_info *mtd, int chipnr) //struct cafe_priv *cafe = mtd->priv; // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); } + static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) { struct mtd_info *mtd = id; @@ -347,14 +350,34 @@ static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, * The hw generator calculates the error syndrome automatically. Therefor * we need a special oob layout and handling. */ + +static unsigned short cafe_empty_syndromes[8] = { 4095, 748, 2629, 2920, 875, 1454, 51, 1456 }; + +static int is_all_ff(unsigned char *buf, int len) +{ + unsigned long *lbuf = (void *)buf; + int i; + + for (i=0; i < (len/sizeof(long)); i++) { + if (lbuf[i] != ~0UL) + return 0; + } + i *= sizeof(long); + for (; i< len; i++) { + if (buf[i] != 0xff) + return 0; + } + return 1; +} + static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, uint8_t *buf) { struct cafe_priv *cafe = mtd->priv; - dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", - readl(cafe->mmio + CAFE_NAND_ECC_RESULT), - readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); + cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", + readl(cafe->mmio + CAFE_NAND_ECC_RESULT), + readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); @@ -369,7 +392,13 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, syn[i+1] = (tmp >> 16) & 0xfff; } - if ((i = cafe_correct_ecc(buf, syn)) < 0) { + /* FIXME: http://dev.laptop.org/ticket/215 */ + if (!memcmp(syn, cafe_empty_syndromes, sizeof(syn)) + && is_all_ff(chip->oob_poi, 14) + && is_all_ff(buf, mtd->writesize)) { + dev_dbg(&cafe->pdev->dev, "ECC error reported on empty block\n"); + /* It was an empty block. Nothing to fix here except the hardware */ + } else if ((i = cafe_correct_ecc(buf, syn)) < 0) { dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); mtd->ecc_stats.failed++; } else { @@ -389,9 +418,13 @@ static struct nand_ecclayout cafe_oobinfo_2048 = { }; /* Ick. The BBT code really ought to be able to work this bit out - for itself from the above */ -static uint8_t cafe_bbt_pattern[] = {'B', 'b', 't', '0' }; -static uint8_t cafe_mirror_pattern[] = {'1', 't', 'b', 'B' }; + for itself from the above, at least for the 2KiB case */ +static uint8_t cafe_bbt_pattern_2048[] = { 'B', 'b', 't', '0' }; +static uint8_t cafe_mirror_pattern_2048[] = { '1', 't', 'b', 'B' }; + +static uint8_t cafe_bbt_pattern_512[] = { 0xBB }; +static uint8_t cafe_mirror_pattern_512[] = { 0xBC }; + static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE @@ -400,7 +433,7 @@ static struct nand_bbt_descr cafe_bbt_main_descr_2048 = { .len = 4, .veroffs = 18, .maxblocks = 4, - .pattern = cafe_bbt_pattern + .pattern = cafe_bbt_pattern_2048 }; static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { @@ -410,7 +443,7 @@ static struct nand_bbt_descr cafe_bbt_mirror_descr_2048 = { .len = 4, .veroffs = 18, .maxblocks = 4, - .pattern = cafe_mirror_pattern + .pattern = cafe_mirror_pattern_2048 }; static struct nand_ecclayout cafe_oobinfo_512 = { @@ -419,6 +452,27 @@ static struct nand_ecclayout cafe_oobinfo_512 = { .oobfree = {{14, 2}} }; +static struct nand_bbt_descr cafe_bbt_main_descr_512 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 1, + .veroffs = 15, + .maxblocks = 4, + .pattern = cafe_bbt_pattern_512 +}; + +static struct nand_bbt_descr cafe_bbt_mirror_descr_512 = { + .options = NAND_BBT_LASTBLOCK | NAND_BBT_CREATE | NAND_BBT_WRITE + | NAND_BBT_2BIT | NAND_BBT_VERSION | NAND_BBT_PERCHIP, + .offs = 14, + .len = 1, + .veroffs = 15, + .maxblocks = 4, + .pattern = cafe_mirror_pattern_512 +}; + + static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, struct nand_chip *chip, const uint8_t *buf) { @@ -566,19 +620,21 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, ctrl |= 0x00007000; writel(ctrl | 0x05, cafe->mmio + 0x3004); writel(ctrl | 0x0a, cafe->mmio + 0x3004); - writel(0, cafe->mmio + 0x40); + writel(0, cafe->mmio + CAFE_NAND_DMA_CTRL); writel(0x7006, cafe->mmio + 0x3004); writel(0x700a, cafe->mmio + 0x3004); /* Set up DMA address */ - writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + 0x44); + writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + CAFE_NAND_DMA_ADDR0); if (sizeof(cafe->dmaaddr) > 4) - writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + 0x48); + /* Shift in two parts to shut the compiler up */ + writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + CAFE_NAND_DMA_ADDR1); else - writel(0, cafe->mmio + 0x48); + writel(0, cafe->mmio + CAFE_NAND_DMA_ADDR1); + cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", - readl(cafe->mmio+0x44), cafe->dmabuf); + readl(cafe->mmio + CAFE_NAND_DMA_ADDR0), cafe->dmabuf); /* Enable NAND IRQ in global IRQ mask register */ writel(0x80000007, cafe->mmio + 0x300c); @@ -620,27 +676,30 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->ctl2 |= 1<<29; /* 2KiB page size */ /* Set up ECC according to the type of chip we found */ - if (mtd->writesize == 512 || mtd->writesize == 2048) { - cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; - cafe->nand.ecc.size = mtd->writesize; - cafe->nand.ecc.bytes = 14; + if (mtd->writesize == 2048) { cafe->nand.ecc.layout = &cafe_oobinfo_2048; cafe->nand.bbt_td = &cafe_bbt_main_descr_2048; cafe->nand.bbt_md = &cafe_bbt_mirror_descr_2048; - cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; - cafe->nand.ecc.calculate = (void *)cafe_nand_bug; - cafe->nand.ecc.correct = (void *)cafe_nand_bug; - cafe->nand.write_page = cafe_nand_write_page; - cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; - cafe->nand.ecc.write_oob = cafe_nand_write_oob; - cafe->nand.ecc.read_page = cafe_nand_read_page; - cafe->nand.ecc.read_oob = cafe_nand_read_oob; - + } else if (mtd->writesize == 512) { + cafe->nand.ecc.layout = &cafe_oobinfo_512; + cafe->nand.bbt_td = &cafe_bbt_main_descr_512; + cafe->nand.bbt_md = &cafe_bbt_mirror_descr_512; } else { - printk(KERN_WARNING "Unexpected NAND flash writesize %d. Using software ECC\n", + printk(KERN_WARNING "Unexpected NAND flash writesize %d. Aborting\n", mtd->writesize); - cafe->nand.ecc.mode = NAND_ECC_NONE; + goto out_irq; } + cafe->nand.ecc.mode = NAND_ECC_HW_SYNDROME; + cafe->nand.ecc.size = mtd->writesize; + cafe->nand.ecc.bytes = 14; + cafe->nand.ecc.hwctl = (void *)cafe_nand_bug; + cafe->nand.ecc.calculate = (void *)cafe_nand_bug; + cafe->nand.ecc.correct = (void *)cafe_nand_bug; + cafe->nand.write_page = cafe_nand_write_page; + cafe->nand.ecc.write_page = cafe_nand_write_page_lowlevel; + cafe->nand.ecc.write_oob = cafe_nand_write_oob; + cafe->nand.ecc.read_page = cafe_nand_read_page; + cafe->nand.ecc.read_oob = cafe_nand_read_oob; err = nand_scan_tail(mtd); if (err) diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index 4df28a8..c4bec37 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -499,10 +499,11 @@ static void solve_2x3(unsigned short m[2][3], unsigned short *coefs) } static unsigned char gf64_inv[64] = { - 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, + 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, 61, 54, 51, 39, 26, 35, 14, 24, 23, 15, 20, 34, 11, 53, 45, 6, 63, 2, 27, 21, 56, 9, 50, 19, 13, 47, 48, 5, 7, 30, 12, 41, - 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32}; + 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32 +}; static unsigned short gf4096_inv(unsigned short din) { -- cgit v1.1 From 470b0a90d6a21cb72b671215f12ec7ec8a0db2c0 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Mon, 23 Oct 2006 14:29:04 +0100 Subject: =?UTF-8?q?[MTD]=20NAND:=20Disable=20ECC=20checking=20on=20CAF?= =?UTF-8?q?=C3=89=20since=20it's=20broken=20for=20now?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 10132ef..6bcb430 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -67,6 +67,9 @@ module_param(skipbbt, int, 0644); static int debug = 0; module_param(debug, int, 0644); +static int checkecc = 0; +module_param(checkecc, int, 0644); + /* Hrm. Why isn't this already conditional on something in the struct device? */ #define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) @@ -214,7 +217,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); do_command: -#if 1 +#if 0 /* http://dev.laptop.org/ticket/200 ECC on read only works if we read precisely 0x80e bytes */ if (cafe->datalen == 2112) @@ -382,7 +385,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - if (readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { + if (checkecc && readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { unsigned short syn[8]; int i; -- cgit v1.1 From ff0dab64b4e9ce3a073365342297e76ddaae9697 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Ricard=20Wanderl=C3=B6f?= Date: Mon, 23 Oct 2006 09:33:34 +0200 Subject: [MTD] NAND: Fix nand_default_mark_blockbad() when flash-based BBT disabled MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit When a flash-based BBT is not used, nand_default_mark_blockbad() is supposed to mark the block bad in the oob. However, it sets the wrong length variable so that no bad block marker is in fact written. This patch attempts to rectify that. (As note, it seems to be that logically, it shouldn't be necessary to set both length variables, as one appears to be for the main buffer, and one for the oob buffer, but this is how it is done in several places, including the code for the mtd character device MEMWRITEOOB and MEMREADOOB ioctls. I'm not sure if this is a temporary solution during some rework of the mtd infrastructure, or whether there is a deeper thought here.) Signed-off-by: Ricard Wanderlöf Signed-off-by: David Woodhouse --- drivers/mtd/nand/nand_base.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nand_base.c b/drivers/mtd/nand/nand_base.c index f23ab2c..8df36e2 100644 --- a/drivers/mtd/nand/nand_base.c +++ b/drivers/mtd/nand/nand_base.c @@ -362,7 +362,7 @@ static int nand_default_block_markbad(struct mtd_info *mtd, loff_t ofs) * access */ ofs += mtd->oobsize; - chip->ops.len = 2; + chip->ops.len = chip->ops.ooblen = 2; chip->ops.datbuf = NULL; chip->ops.oobbuf = buf; chip->ops.ooboffs = chip->badblockpos & ~0x01; -- cgit v1.1 From 2c8cfdcbeb1ab0ec7bbd5af1be311b55281154c4 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 09:53:08 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Caf=C3=A9=20ECC=20--=20remove=20spuriou?= =?UTF-8?q?s=20BUG=5FON()=20in=20err=5Fpos()?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Being a value which isn't in the table is a case we explicitly check for in the caller. Don't BUG_ON() because it does actually happen in practice. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe_ecc.c | 1 - 1 file changed, 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index c4bec37..4621460 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -1045,7 +1045,6 @@ static unsigned short err_pos_lut[4096] = { static unsigned short err_pos(unsigned short din) { BUG_ON(din > 4096); - BUG_ON(err_pos_lut[din] == 0xfff); return err_pos_lut[din]; } static int chk_no_err_only(unsigned short *chk_syndrome_list, unsigned short *err_info) -- cgit v1.1 From dcc41bc81c872862652d68af8993b9fa32ce56a4 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 09:55:34 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Reset=20Caf=C3=A9=20controller=20before?= =?UTF-8?q?=20initialising.?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Fixes http://dev.laptop.org/ticket/237 Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 4 ++++ 1 file changed, 4 insertions(+) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 6bcb430..dd274c8 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -598,6 +598,10 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->nand.block_bad = cafe_nand_block_bad; } + /* Start off by resetting the NAND controller completely */ + writel(1, cafe->mmio + 0x3034); + writel(0, cafe->mmio + 0x3034); + /* Timings from Marvell's test code (not verified or calculated by us) */ writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); #if 1 -- cgit v1.1 From b478c775a0c306c84215a1138e49fab540b94a5d Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 14:50:04 +0300 Subject: =?UTF-8?q?[MTD]=20CAF=C3=89=20NAND:=20Add=20'slowtiming'=20parame?= =?UTF-8?q?ter,=20default=20usedma=20and=20checkecc=20on?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 26 +++++++++++++++----------- 1 file changed, 15 insertions(+), 11 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index dd274c8..d894c72 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -58,7 +58,7 @@ struct cafe_priv { }; -static int usedma = 0; +static int usedma = 1; module_param(usedma, int, 0644); static int skipbbt = 0; @@ -67,9 +67,12 @@ module_param(skipbbt, int, 0644); static int debug = 0; module_param(debug, int, 0644); -static int checkecc = 0; +static int checkecc = 1; module_param(checkecc, int, 0644); +static int slowtiming = 0; +module_param(slowtiming, int, 0644); + /* Hrm. Why isn't this already conditional on something in the struct device? */ #define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) @@ -604,15 +607,16 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, /* Timings from Marvell's test code (not verified or calculated by us) */ writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); -#if 1 - writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); - writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); - writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); -#else - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); -#endif + + if (!slowtiming) { + writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); + writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); + writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); + } else { + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); + writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); + } writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { -- cgit v1.1 From 7608194c4ae454fab23b8d940986eeb9c58c3478 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 15:40:51 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Add=20ECC=20debugging=20for=20CAF=C3=89?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe_ecc.c | 39 ++++++++++++++++++++++++++++++++++++--- 1 file changed, 36 insertions(+), 3 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index 4621460..2d29265 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -19,6 +19,7 @@ */ #include +#include #include static unsigned short gf4096_mul(unsigned short, unsigned short); @@ -1322,16 +1323,43 @@ void correct_12bit_symbol(unsigned char *buf, unsigned short sym, buf[2+(3*(sym-2))/2] ^= (val >> 8); buf[3+(3*(sym-2))/2] ^= (val & 0xff); } - - } +static int debugecc = 0; +module_param(debugecc, int, 0644); + int cafe_correct_ecc(unsigned char *buf, unsigned short *chk_syndrome_list) { unsigned short err_info[9]; int i; + if (debugecc) { + printk(KERN_WARNING "cafe_correct_ecc invoked. Syndromes %x %x %x %x %x %x %x %x\n", + chk_syndrome_list[0], chk_syndrome_list[1], + chk_syndrome_list[2], chk_syndrome_list[3], + chk_syndrome_list[4], chk_syndrome_list[5], + chk_syndrome_list[6], chk_syndrome_list[7]); + for (i=0; i < 2048; i+=16) { + printk(KERN_WARNING "D %04x: %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x\n", + i, + buf[i], buf[i+1], buf[i+2], buf[i+3], + buf[i+4], buf[i+5], buf[i+6], buf[i+7], + buf[i+8], buf[i+9], buf[i+10], buf[i+11], + buf[i+12], buf[i+13], buf[i+14], buf[i+15]); + } + for ( ; i < 2112; i+=16) { + printk(KERN_WARNING "O %02x: %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x %02x\n", + i - 2048, + buf[i], buf[i+1], buf[i+2], buf[i+3], + buf[i+4], buf[i+5], buf[i+6], buf[i+7], + buf[i+8], buf[i+9], buf[i+10], buf[i+11], + buf[i+12], buf[i+13], buf[i+14], buf[i+15]); + } + } + + + if (chk_no_err_only(chk_syndrome_list, err_info) && chk_1_err_only(chk_syndrome_list, err_info) && chk_2_err_only(chk_syndrome_list, err_info) && @@ -1340,8 +1368,13 @@ int cafe_correct_ecc(unsigned char *buf, return -EIO; } - for (i=0; i < err_info[0]; i++) + for (i=0; i < err_info[0]; i++) { + if (debugecc) + printk(KERN_WARNING "Correct symbol %d with 0x%03x\n", + err_info[1+i], err_info[5+i]); + correct_12bit_symbol(buf, err_info[1+i], err_info[5+i]); + } return err_info[0]; } -- cgit v1.1 From 63a1423763c6c38eeeaf6dc8cee986514ab67aed Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Fri, 27 Oct 2006 22:12:02 +0300 Subject: [MTD] NAND: Remove empty block ECC workaround They fixed the hardware so that ECC doesn't fail on reading an empty block. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 28 +--------------------------- 1 file changed, 1 insertion(+), 27 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index d894c72..887040c 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -356,26 +356,6 @@ static int cafe_nand_read_oob(struct mtd_info *mtd, struct nand_chip *chip, * The hw generator calculates the error syndrome automatically. Therefor * we need a special oob layout and handling. */ - -static unsigned short cafe_empty_syndromes[8] = { 4095, 748, 2629, 2920, 875, 1454, 51, 1456 }; - -static int is_all_ff(unsigned char *buf, int len) -{ - unsigned long *lbuf = (void *)buf; - int i; - - for (i=0; i < (len/sizeof(long)); i++) { - if (lbuf[i] != ~0UL) - return 0; - } - i *= sizeof(long); - for (; i< len; i++) { - if (buf[i] != 0xff) - return 0; - } - return 1; -} - static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, uint8_t *buf) { @@ -398,13 +378,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, syn[i+1] = (tmp >> 16) & 0xfff; } - /* FIXME: http://dev.laptop.org/ticket/215 */ - if (!memcmp(syn, cafe_empty_syndromes, sizeof(syn)) - && is_all_ff(chip->oob_poi, 14) - && is_all_ff(buf, mtd->writesize)) { - dev_dbg(&cafe->pdev->dev, "ECC error reported on empty block\n"); - /* It was an empty block. Nothing to fix here except the hardware */ - } else if ((i = cafe_correct_ecc(buf, syn)) < 0) { + if ((i = cafe_correct_ecc(buf, syn)) < 0) { dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); mtd->ecc_stats.failed++; } else { -- cgit v1.1 From a020727b1628cb4d7b70733222253c7fa3ec6113 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sat, 28 Oct 2006 17:08:38 +0300 Subject: =?UTF-8?q?[MTD]=20NAND:=20Fix=20timing=20calculation=20in=20CAF?= =?UTF-8?q?=C3=89=20debugging=20message?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 887040c..35a8687 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -272,7 +272,8 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cpu_relax(); } writel(doneint, cafe->mmio + CAFE_NAND_IRQ); - cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", command, 50000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", + command, 500000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); } -- cgit v1.1 From 195a253b6632e2b7e6319f2f67120e708646554e Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Tue, 31 Oct 2006 12:30:11 +0800 Subject: =?UTF-8?q?[MTD]=20NAND:=20Use=20register=20#defines=20throughout?= =?UTF-8?q?=20CAF=C3=89=20driver,=20not=20numbers?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Also use cafe_readl() and cafe_writel() abstraction to make code slightly cleaner -- especially if we want to use it in PIO mode. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 118 ++++++++++++++++++++++++++---------------------- 1 file changed, 63 insertions(+), 55 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 35a8687..175cf82 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -40,6 +40,11 @@ #define CAFE_NAND_READ_DATA 0x1000 #define CAFE_NAND_WRITE_DATA 0x2000 +#define CAFE_GLOBAL_CTRL 0x3004 +#define CAFE_GLOBAL_IRQ 0x3008 +#define CAFE_GLOBAL_IRQ_MASK 0x300c +#define CAFE_NAND_RESET 0x3034 + int cafe_correct_ecc(unsigned char *buf, unsigned short *chk_syndrome_list); @@ -76,18 +81,21 @@ module_param(slowtiming, int, 0644); /* Hrm. Why isn't this already conditional on something in the struct device? */ #define cafe_dev_dbg(dev, args...) do { if (debug) dev_dbg(dev, ##args); } while(0) +/* Make it easier to switch to PIO if we need to */ +#define cafe_readl(cafe, addr) readl((cafe)->mmio + CAFE_##addr) +#define cafe_writel(cafe, datum, addr) writel(datum, (cafe)->mmio + CAFE_##addr) static int cafe_device_ready(struct mtd_info *mtd) { struct cafe_priv *cafe = mtd->priv; - int result = !!(readl(cafe->mmio + CAFE_NAND_STATUS) | 0x40000000); - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + int result = !!(cafe_readl(cafe, NAND_STATUS) | 0x40000000); + uint32_t irqs = cafe_readl(cafe, NAND_IRQ); - writel(irqs, cafe->mmio+CAFE_NAND_IRQ); + cafe_writel(cafe, irqs, NAND_IRQ); cafe_dev_dbg(&cafe->pdev->dev, "NAND device is%s ready, IRQ %x (%x) (%x,%x)\n", - result?"":" not", irqs, readl(cafe->mmio + CAFE_NAND_IRQ), - readl(cafe->mmio + 0x3008), readl(cafe->mmio + 0x300c)); + result?"":" not", irqs, cafe_readl(cafe, NAND_IRQ), + cafe_readl(cafe, GLOBAL_IRQ), cafe_readl(cafe, GLOBAL_IRQ_MASK)); return result; } @@ -146,14 +154,14 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, if (command == NAND_CMD_ERASE2 || command == NAND_CMD_PAGEPROG) { /* Second half of a command we already calculated */ - writel(cafe->ctl2 | 0x100 | command, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2 | 0x100 | command, NAND_CTRL2); ctl1 = cafe->ctl1; cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); goto do_command; } /* Reset ECC engine */ - writel(0, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, 0, NAND_CTRL2); /* Emulate NAND_CMD_READOOB on large-page chips */ if (mtd->writesize > 512 && @@ -166,15 +174,15 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, for small-page chips, to position the buffer correctly? */ if (column != -1) { - writel(column, cafe->mmio + CAFE_NAND_ADDR1); + cafe_writel(cafe, column, NAND_ADDR1); adrbytes = 2; if (page_addr != -1) goto write_adr2; } else if (page_addr != -1) { - writel(page_addr & 0xffff, cafe->mmio + CAFE_NAND_ADDR1); + cafe_writel(cafe, page_addr & 0xffff, NAND_ADDR1); page_addr >>= 16; write_adr2: - writel(page_addr, cafe->mmio+0x20); + cafe_writel(cafe, page_addr, NAND_ADDR2); adrbytes += 2; if (mtd->size > mtd->writesize << 16) adrbytes++; @@ -215,9 +223,9 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, } /* RNDOUT and READ0 commands need a following byte */ if (command == NAND_CMD_RNDOUT) - writel(cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_RNDOUTSTART, NAND_CTRL2); else if (command == NAND_CMD_READ0 && mtd->writesize > 512) - writel(cafe->ctl2 | 0x100 | NAND_CMD_READSTART, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_READSTART, NAND_CTRL2); do_command: #if 0 @@ -227,11 +235,11 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe->datalen = 2062; #endif cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", - cafe->datalen, ctl1, readl(cafe->mmio+CAFE_NAND_CTRL2)); + cafe->datalen, ctl1, cafe_readl(cafe, NAND_CTRL2)); /* NB: The datasheet lies -- we really should be subtracting 1 here */ - writel(cafe->datalen, cafe->mmio + CAFE_NAND_DATA_LEN); - writel(0x90000000, cafe->mmio + CAFE_NAND_IRQ); + cafe_writel(cafe, cafe->datalen, NAND_DATA_LEN); + cafe_writel(cafe, 0x90000000, NAND_IRQ); if (usedma && (ctl1 & (3<<25))) { uint32_t dmactl = 0xc0000000 + cafe->datalen; /* If WR or RD bits set, set up DMA */ @@ -242,7 +250,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, the command. */ doneint = 0x10000000; } - writel(dmactl, cafe->mmio + CAFE_NAND_DMA_CTRL); + cafe_writel(cafe, dmactl, NAND_DMA_CTRL); } cafe->datalen = 0; @@ -253,7 +261,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); } #endif - writel(ctl1, cafe->mmio + CAFE_NAND_CTRL1); + cafe_writel(cafe, ctl1, NAND_CTRL1); /* Apply this short delay always to ensure that we do wait tWB in * any case on any machine. */ ndelay(100); @@ -263,7 +271,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, uint32_t irqs; while (c--) { - irqs = readl(cafe->mmio + CAFE_NAND_IRQ); + irqs = cafe_readl(cafe, NAND_IRQ); if (irqs & doneint) break; udelay(1); @@ -271,9 +279,9 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe_dev_dbg(&cafe->pdev->dev, "Wait for ready, IRQ %x\n", irqs); cpu_relax(); } - writel(doneint, cafe->mmio + CAFE_NAND_IRQ); + cafe_writel(cafe, doneint, NAND_IRQ); cafe_dev_dbg(&cafe->pdev->dev, "Command %x completed after %d usec, irqs %x (%x)\n", - command, 500000-c, irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + command, 500000-c, irqs, cafe_readl(cafe, NAND_IRQ)); } @@ -296,11 +304,11 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, case NAND_CMD_STATUS_ERROR1: case NAND_CMD_STATUS_ERROR2: case NAND_CMD_STATUS_ERROR3: - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2, NAND_CTRL2); return; } nand_wait_ready(mtd); - writel(cafe->ctl2, cafe->mmio + CAFE_NAND_CTRL2); + cafe_writel(cafe, cafe->ctl2, NAND_CTRL2); } static void cafe_select_chip(struct mtd_info *mtd, int chipnr) @@ -313,12 +321,12 @@ static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) { struct mtd_info *mtd = id; struct cafe_priv *cafe = mtd->priv; - uint32_t irqs = readl(cafe->mmio + CAFE_NAND_IRQ); - writel(irqs & ~0x90000000, cafe->mmio + CAFE_NAND_IRQ); + uint32_t irqs = cafe_readl(cafe, NAND_IRQ); + cafe_writel(cafe, irqs & ~0x90000000, NAND_IRQ); if (!irqs) return IRQ_NONE; - cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, readl(cafe->mmio + CAFE_NAND_IRQ)); + cafe_dev_dbg(&cafe->pdev->dev, "irq, bits %x (%x)\n", irqs, cafe_readl(cafe, NAND_IRQ)); return IRQ_HANDLED; } @@ -363,18 +371,18 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, struct cafe_priv *cafe = mtd->priv; cafe_dev_dbg(&cafe->pdev->dev, "ECC result %08x SYN1,2 %08x\n", - readl(cafe->mmio + CAFE_NAND_ECC_RESULT), - readl(cafe->mmio + CAFE_NAND_ECC_SYN01)); + cafe_readl(cafe, NAND_ECC_RESULT), + cafe_readl(cafe, NAND_ECC_SYN01)); chip->read_buf(mtd, buf, mtd->writesize); chip->read_buf(mtd, chip->oob_poi, mtd->oobsize); - if (checkecc && readl(cafe->mmio + CAFE_NAND_ECC_RESULT) & (1<<18)) { + if (checkecc && cafe_readl(cafe, NAND_ECC_RESULT) & (1<<18)) { unsigned short syn[8]; int i; for (i=0; i<8; i+=2) { - uint32_t tmp = readl(cafe->mmio + CAFE_NAND_ECC_SYN01 + (i*2)); + uint32_t tmp = cafe_readl(cafe, NAND_ECC_SYN01 + (i*2)); syn[i] = tmp & 0xfff; syn[i+1] = (tmp >> 16) & 0xfff; } @@ -577,22 +585,22 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, } /* Start off by resetting the NAND controller completely */ - writel(1, cafe->mmio + 0x3034); - writel(0, cafe->mmio + 0x3034); + cafe_writel(cafe, 1, NAND_RESET); + cafe_writel(cafe, 0, NAND_RESET); - /* Timings from Marvell's test code (not verified or calculated by us) */ - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); + cafe_writel(cafe, 0xffffffff, NAND_IRQ_MASK); + /* Timings from Marvell's test code (not verified or calculated by us) */ if (!slowtiming) { - writel(0x01010a0a, cafe->mmio + CAFE_NAND_TIMING1); - writel(0x24121212, cafe->mmio + CAFE_NAND_TIMING2); - writel(0x11000000, cafe->mmio + CAFE_NAND_TIMING3); + cafe_writel(cafe, 0x01010a0a, NAND_TIMING1); + cafe_writel(cafe, 0x24121212, NAND_TIMING2); + cafe_writel(cafe, 0x11000000, NAND_TIMING3); } else { - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING1); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING2); - writel(0xffffffff, cafe->mmio + CAFE_NAND_TIMING3); + cafe_writel(cafe, 0xffffffff, NAND_TIMING1); + cafe_writel(cafe, 0xffffffff, NAND_TIMING2); + cafe_writel(cafe, 0xffffffff, NAND_TIMING3); } - writel(0xffffffff, cafe->mmio + CAFE_NAND_IRQ_MASK); + cafe_writel(cafe, 0xffffffff, NAND_IRQ_MASK); err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); @@ -601,31 +609,31 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, } #if 1 /* Disable master reset, enable NAND clock */ - ctrl = readl(cafe->mmio + 0x3004); + ctrl = cafe_readl(cafe, GLOBAL_CTRL); ctrl &= 0xffffeff0; ctrl |= 0x00007000; - writel(ctrl | 0x05, cafe->mmio + 0x3004); - writel(ctrl | 0x0a, cafe->mmio + 0x3004); - writel(0, cafe->mmio + CAFE_NAND_DMA_CTRL); + cafe_writel(cafe, ctrl | 0x05, GLOBAL_CTRL); + cafe_writel(cafe, ctrl | 0x0a, GLOBAL_CTRL); + cafe_writel(cafe, 0, NAND_DMA_CTRL); - writel(0x7006, cafe->mmio + 0x3004); - writel(0x700a, cafe->mmio + 0x3004); + cafe_writel(cafe, 0x7006, GLOBAL_CTRL); + cafe_writel(cafe, 0x700a, GLOBAL_CTRL); /* Set up DMA address */ - writel(cafe->dmaaddr & 0xffffffff, cafe->mmio + CAFE_NAND_DMA_ADDR0); + cafe_writel(cafe, cafe->dmaaddr & 0xffffffff, NAND_DMA_ADDR0); if (sizeof(cafe->dmaaddr) > 4) /* Shift in two parts to shut the compiler up */ - writel((cafe->dmaaddr >> 16) >> 16, cafe->mmio + CAFE_NAND_DMA_ADDR1); + cafe_writel(cafe, (cafe->dmaaddr >> 16) >> 16, NAND_DMA_ADDR1); else - writel(0, cafe->mmio + CAFE_NAND_DMA_ADDR1); + cafe_writel(cafe, 0, NAND_DMA_ADDR1); cafe_dev_dbg(&cafe->pdev->dev, "Set DMA address to %x (virt %p)\n", - readl(cafe->mmio + CAFE_NAND_DMA_ADDR0), cafe->dmabuf); + cafe_readl(cafe, NAND_DMA_ADDR0), cafe->dmabuf); /* Enable NAND IRQ in global IRQ mask register */ - writel(0x80000007, cafe->mmio + 0x300c); + cafe_writel(cafe, 0x80000007, GLOBAL_IRQ_MASK); cafe_dev_dbg(&cafe->pdev->dev, "Control %x, IRQ mask %x\n", - readl(cafe->mmio + 0x3004), readl(cafe->mmio + 0x300c)); + cafe_readl(cafe, GLOBAL_CTRL), cafe_readl(cafe, GLOBAL_IRQ_MASK)); #endif #if 1 mtd->writesize=2048; @@ -649,7 +657,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, #if 0 writel(0x84600070, cafe->mmio); udelay(10); - cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", readl(cafe->mmio + 0x30)); + cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", cafe_readl(cafe, NAND_NONMEM)); #endif /* Scan to find existance of the device */ if (nand_scan_ident(mtd, 1)) { @@ -697,7 +705,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, out_irq: /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + cafe_writel(cafe, ~1 & cafe_readl(cafe, GLOBAL_IRQ_MASK), GLOBAL_IRQ_MASK); free_irq(pdev->irq, mtd); out_free_dma: dma_free_coherent(&cafe->pdev->dev, 2112, cafe->dmabuf, cafe->dmaaddr); @@ -716,7 +724,7 @@ static void __devexit cafe_nand_remove(struct pci_dev *pdev) del_mtd_device(mtd); /* Disable NAND IRQ in global IRQ mask register */ - writel(~1 & readl(cafe->mmio + 0x300c), cafe->mmio + 0x300c); + cafe_writel(cafe, ~1 & cafe_readl(cafe, GLOBAL_IRQ_MASK), GLOBAL_IRQ_MASK); free_irq(pdev->irq, mtd); nand_release(mtd); pci_iounmap(pdev, cafe->mmio); -- cgit v1.1 From be8444bdf34f7ba21e2364ca296c68e81033e3b2 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Tue, 31 Oct 2006 12:36:04 +0800 Subject: =?UTF-8?q?[MTD]=20NAND:=20Add=20register=20debugging=20spew=20opt?= =?UTF-8?q?ion=20to=20CAF=C3=89=20driver?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 26 +++++++++++++------------- 1 file changed, 13 insertions(+), 13 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index 175cf82..c5d03b0 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -72,6 +72,9 @@ module_param(skipbbt, int, 0644); static int debug = 0; module_param(debug, int, 0644); +static int regdebug = 0; +module_param(regdebug, int, 0644); + static int checkecc = 1; module_param(checkecc, int, 0644); @@ -228,12 +231,6 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_READSTART, NAND_CTRL2); do_command: -#if 0 - /* http://dev.laptop.org/ticket/200 - ECC on read only works if we read precisely 0x80e bytes */ - if (cafe->datalen == 2112) - cafe->datalen = 2062; -#endif cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, cafe_readl(cafe, NAND_CTRL2)); @@ -254,13 +251,13 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, } cafe->datalen = 0; -#if 0 - { int i; - printk("About to write command %08x\n", ctl1); - for (i=0; i< 0x5c; i+=4) - printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); + if (unlikely(regdebug)) { + int i; + printk("About to write command %08x to register 0\n", ctl1); + for (i=4; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); } -#endif + cafe_writel(cafe, ctl1, NAND_CTRL1); /* Apply this short delay always to ensure that we do wait tWB in * any case on any machine. */ @@ -388,7 +385,10 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, } if ((i = cafe_correct_ecc(buf, syn)) < 0) { - dev_dbg(&cafe->pdev->dev, "Failed to correct ECC\n"); + dev_dbg(&cafe->pdev->dev, "Failed to correct ECC at %08x\n", + cafe_readl(cafe, NAND_ADDR2) * 2048); + for (i=0; i< 0x5c; i+=4) + printk("Register %x: %08x\n", i, readl(cafe->mmio + i)); mtd->ecc_stats.failed++; } else { dev_dbg(&cafe->pdev->dev, "Corrected %d symbol errors\n", i); -- cgit v1.1 From cad40654c312fc51bdb520e9be91e29a9742bbcb Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Wed, 1 Nov 2006 08:19:20 +0800 Subject: =?UTF-8?q?[MTD]=20NAND:=20Fix=20ECC=20settings=20in=20CAF=C3=89?= =?UTF-8?q?=20controller=20driver.?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit We were resetting cafe->ctl2 to zero after an erase (and also during a write, but it was correctly reset after that). This meant that ECC reads after an erase were failing. Doh. Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 10 +++------- 1 file changed, 3 insertions(+), 7 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index c5d03b0..fad304b 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -159,6 +159,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, /* Second half of a command we already calculated */ cafe_writel(cafe, cafe->ctl2 | 0x100 | command, NAND_CTRL2); ctl1 = cafe->ctl1; + cafe->ctl2 &= ~(1<<30); cafe_dev_dbg(&cafe->pdev->dev, "Continue command, ctl1 %08x, #data %d\n", cafe->ctl1, cafe->nr_data); goto do_command; @@ -219,7 +220,6 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, /* Ignore the first command of a pair; the hardware deals with them both at once, later */ cafe->ctl1 = ctl1; - cafe->ctl2 = 0; cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", cafe->ctl1, cafe->datalen); return; @@ -281,9 +281,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, command, 500000-c, irqs, cafe_readl(cafe, NAND_IRQ)); } - - cafe->ctl2 &= ~(1<<8); - cafe->ctl2 &= ~(1<<30); + WARN_ON(cafe->ctl2 & (1<<30)); switch (command) { @@ -471,9 +469,7 @@ static void cafe_nand_write_page_lowlevel(struct mtd_info *mtd, chip->write_buf(mtd, chip->oob_poi, mtd->oobsize); /* Set up ECC autogeneration */ - cafe->ctl2 |= (1<<27) | (1<<30); - if (mtd->writesize == 2048) - cafe->ctl2 |= (1<<29); + cafe->ctl2 |= (1<<30); } static int cafe_nand_write_page(struct mtd_info *mtd, struct nand_chip *chip, -- cgit v1.1 From 2c22120fbd017d78ad2b6825ba573db3ef539bca Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Thu, 16 Nov 2006 11:23:48 +0900 Subject: MTD: OneNAND: interrupt based wait support We can use the two methods to wait. 1. polling: read interrupt status register 2. interrupt: use kernel ineterrupt mechanism To use interrupt method, you first connect onenand interrupt pin to your platform and configure interrupt properly Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/generic.c | 1 + drivers/mtd/onenand/onenand_base.c | 109 ++++++++++++++++++++++++++++++++++++- 2 files changed, 108 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/generic.c b/drivers/mtd/onenand/generic.c index af06a80..cdf80c6 100644 --- a/drivers/mtd/onenand/generic.c +++ b/drivers/mtd/onenand/generic.c @@ -63,6 +63,7 @@ static int __devinit generic_onenand_probe(struct device *dev) } info->onenand.mmcontrol = pdata->mmcontrol; + info->onenand.irq = platform_get_irq(pdev, 0); info->mtd.name = pdev->dev.bus_id; info->mtd.priv = &info->onenand; diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index 8ed68b2..aea13a3 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -13,6 +13,7 @@ #include #include #include +#include #include #include #include @@ -339,6 +340,111 @@ static int onenand_wait(struct mtd_info *mtd, int state) return 0; } +/* + * onenand_interrupt - [DEFAULT] onenand interrupt handler + * @param irq onenand interrupt number + * @param dev_id interrupt data + * + * complete the work + */ +static irqreturn_t onenand_interrupt(int irq, void *data) +{ + struct onenand_chip *this = (struct onenand_chip *) data; + + /* To handle shared interrupt */ + if (!this->complete.done) + complete(&this->complete); + + return IRQ_HANDLED; +} + +/* + * onenand_interrupt_wait - [DEFAULT] wait until the command is done + * @param mtd MTD device structure + * @param state state to select the max. timeout value + * + * Wait for command done. + */ +static int onenand_interrupt_wait(struct mtd_info *mtd, int state) +{ + struct onenand_chip *this = mtd->priv; + + /* To prevent soft lockup */ + touch_softlockup_watchdog(); + + wait_for_completion(&this->complete); + + return onenand_wait(mtd, state); +} + +/* + * onenand_try_interrupt_wait - [DEFAULT] try interrupt wait + * @param mtd MTD device structure + * @param state state to select the max. timeout value + * + * Try interrupt based wait (It is used one-time) + */ +static int onenand_try_interrupt_wait(struct mtd_info *mtd, int state) +{ + struct onenand_chip *this = mtd->priv; + unsigned long remain, timeout; + + /* We use interrupt wait first */ + this->wait = onenand_interrupt_wait; + + /* To prevent soft lockup */ + touch_softlockup_watchdog(); + + timeout = msecs_to_jiffies(100); + remain = wait_for_completion_timeout(&this->complete, timeout); + if (!remain) { + printk(KERN_INFO "OneNAND: There's no interrupt. " + "We use the normal wait\n"); + + /* Release the irq */ + free_irq(this->irq, this); + + this->wait = onenand_wait; + } + + return onenand_wait(mtd, state); +} + +/* + * onenand_setup_wait - [OneNAND Interface] setup onenand wait method + * @param mtd MTD device structure + * + * There's two method to wait onenand work + * 1. polling - read interrupt status register + * 2. interrupt - use the kernel interrupt method + */ +static void onenand_setup_wait(struct mtd_info *mtd) +{ + struct onenand_chip *this = mtd->priv; + int syscfg; + + init_completion(&this->complete); + + if (this->irq <= 0) { + this->wait = onenand_wait; + return; + } + + if (request_irq(this->irq, &onenand_interrupt, + IRQF_SHARED, "onenand", this)) { + /* If we can't get irq, use the normal wait */ + this->wait = onenand_wait; + return; + } + + /* Enable interrupt */ + syscfg = this->read_word(this->base + ONENAND_REG_SYS_CFG1); + syscfg |= ONENAND_SYS_CFG1_IOBE; + this->write_word(syscfg, this->base + ONENAND_REG_SYS_CFG1); + + this->wait = onenand_try_interrupt_wait; +} + /** * onenand_bufferram_offset - [DEFAULT] BufferRAM offset * @param mtd MTD data structure @@ -1129,7 +1235,6 @@ static void onenand_sync(struct mtd_info *mtd) onenand_release_device(mtd); } - /** * onenand_block_isbad - [MTD Interface] Check whether the block at the given offset is bad * @param mtd MTD device structure @@ -1846,7 +1951,7 @@ int onenand_scan(struct mtd_info *mtd, int maxchips) if (!this->command) this->command = onenand_command; if (!this->wait) - this->wait = onenand_wait; + onenand_setup_wait(mtd); if (!this->read_bufferram) this->read_bufferram = onenand_read_bufferram; -- cgit v1.1 From 08f782b60a633cbd926ef5e49de303a752390719 Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Thu, 16 Nov 2006 11:29:39 +0900 Subject: [MTD] OneNAND: lock support Now you can use mtd lock inferface on OneNAND The idea is from Nemakal, Vijaya, thanks Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 63 +++++++++++++++++++++++++++++--------- 1 file changed, 48 insertions(+), 15 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index aea13a3..bef4f26 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -1301,32 +1301,38 @@ static int onenand_block_markbad(struct mtd_info *mtd, loff_t ofs) } /** - * onenand_unlock - [MTD Interface] Unlock block(s) + * onenand_do_lock_cmd - [OneNAND Interface] Lock or unlock block(s) * @param mtd MTD device structure * @param ofs offset relative to mtd start - * @param len number of bytes to unlock + * @param len number of bytes to lock or unlock * - * Unlock one or more blocks + * Lock or unlock one or more blocks */ -static int onenand_unlock(struct mtd_info *mtd, loff_t ofs, size_t len) +static int onenand_do_lock_cmd(struct mtd_info *mtd, loff_t ofs, size_t len, int cmd) { struct onenand_chip *this = mtd->priv; int start, end, block, value, status; + int wp_status_mask; start = ofs >> this->erase_shift; end = len >> this->erase_shift; + if (cmd == ONENAND_CMD_LOCK) + wp_status_mask = ONENAND_WP_LS; + else + wp_status_mask = ONENAND_WP_US; + /* Continuous lock scheme */ if (this->options & ONENAND_HAS_CONT_LOCK) { /* Set start block address */ this->write_word(start, this->base + ONENAND_REG_START_BLOCK_ADDRESS); /* Set end block address */ this->write_word(start + end - 1, this->base + ONENAND_REG_END_BLOCK_ADDRESS); - /* Write unlock command */ - this->command(mtd, ONENAND_CMD_UNLOCK, 0, 0); + /* Write lock command */ + this->command(mtd, cmd, 0, 0); /* There's no return value */ - this->wait(mtd, FL_UNLOCKING); + this->wait(mtd, FL_LOCKING); /* Sanity check */ while (this->read_word(this->base + ONENAND_REG_CTRL_STATUS) @@ -1335,7 +1341,7 @@ static int onenand_unlock(struct mtd_info *mtd, loff_t ofs, size_t len) /* Check lock status */ status = this->read_word(this->base + ONENAND_REG_WP_STATUS); - if (!(status & ONENAND_WP_US)) + if (!(status & wp_status_mask)) printk(KERN_ERR "wp status = 0x%x\n", status); return 0; @@ -1351,11 +1357,11 @@ static int onenand_unlock(struct mtd_info *mtd, loff_t ofs, size_t len) this->write_word(value, this->base + ONENAND_REG_START_ADDRESS2); /* Set start block address */ this->write_word(block, this->base + ONENAND_REG_START_BLOCK_ADDRESS); - /* Write unlock command */ - this->command(mtd, ONENAND_CMD_UNLOCK, 0, 0); + /* Write lock command */ + this->command(mtd, cmd, 0, 0); /* There's no return value */ - this->wait(mtd, FL_UNLOCKING); + this->wait(mtd, FL_LOCKING); /* Sanity check */ while (this->read_word(this->base + ONENAND_REG_CTRL_STATUS) @@ -1364,7 +1370,7 @@ static int onenand_unlock(struct mtd_info *mtd, loff_t ofs, size_t len) /* Check lock status */ status = this->read_word(this->base + ONENAND_REG_WP_STATUS); - if (!(status & ONENAND_WP_US)) + if (!(status & wp_status_mask)) printk(KERN_ERR "block = %d, wp status = 0x%x\n", block, status); } @@ -1372,6 +1378,33 @@ static int onenand_unlock(struct mtd_info *mtd, loff_t ofs, size_t len) } /** + * onenand_lock - [MTD Interface] Lock block(s) + * @param mtd MTD device structure + * @param ofs offset relative to mtd start + * @param len number of bytes to unlock + * + * Lock one or more blocks + */ +static int onenand_lock(struct mtd_info *mtd, loff_t ofs, size_t len) +{ + return onenand_do_lock_cmd(mtd, ofs, len, ONENAND_CMD_LOCK); +} + + +/** + * onenand_unlock - [MTD Interface] Unlock block(s) + * @param mtd MTD device structure + * @param ofs offset relative to mtd start + * @param len number of bytes to unlock + * + * Unlock one or more blocks + */ +static int onenand_unlock(struct mtd_info *mtd, loff_t ofs, size_t len) +{ + return onenand_do_lock_cmd(mtd, ofs, len, ONENAND_CMD_UNLOCK); +} + +/** * onenand_check_lock_status - [OneNAND Interface] Check lock status * @param this onenand chip data structure * @@ -1415,7 +1448,7 @@ static int onenand_unlock_all(struct mtd_info *mtd) this->command(mtd, ONENAND_CMD_UNLOCK_ALL, 0, 0); /* There's no return value */ - this->wait(mtd, FL_UNLOCKING); + this->wait(mtd, FL_LOCKING); /* Sanity check */ while (this->read_word(this->base + ONENAND_REG_CTRL_STATUS) @@ -1439,7 +1472,7 @@ static int onenand_unlock_all(struct mtd_info *mtd) return 0; } - mtd->unlock(mtd, 0x0, this->chipsize); + onenand_unlock(mtd, 0x0, this->chipsize); return 0; } @@ -2027,7 +2060,7 @@ int onenand_scan(struct mtd_info *mtd, int maxchips) mtd->lock_user_prot_reg = onenand_lock_user_prot_reg; #endif mtd->sync = onenand_sync; - mtd->lock = NULL; + mtd->lock = onenand_lock; mtd->unlock = onenand_unlock; mtd->suspend = onenand_suspend; mtd->resume = onenand_resume; -- cgit v1.1 From f4f91ac3c833abbd7181ff2122c6b48a653b4e55 Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Thu, 16 Nov 2006 12:03:56 +0900 Subject: [MTD] OneNAND: Single bit error detection Idea from Jarkko Lavinen Signed-off-by: Jarkko Lavinen Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 18 +++++++++++++----- drivers/mtd/onenand/onenand_bbt.c | 1 + 2 files changed, 14 insertions(+), 5 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index bef4f26..fc84ddc 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -331,9 +331,12 @@ static int onenand_wait(struct mtd_info *mtd, int state) if (interrupt & ONENAND_INT_READ) { ecc = this->read_word(this->base + ONENAND_REG_ECC_STATUS); - if (ecc & ONENAND_ECC_2BIT_ALL) { + if (ecc) { DEBUG(MTD_DEBUG_LEVEL0, "onenand_wait: ECC error = 0x%04x\n", ecc); - return -EBADMSG; + if (ecc & ONENAND_ECC_2BIT_ALL) + mtd->ecc_stats.failed++; + else if (ecc & ONENAND_ECC_1BIT_ALL) + mtd->ecc_stats.corrected++; } } @@ -715,6 +718,7 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, size_t *retlen, u_char *buf) { struct onenand_chip *this = mtd->priv; + struct mtd_ecc_stats stats; int read = 0, column; int thislen; int ret = 0; @@ -733,6 +737,7 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, /* TODO handling oob */ + stats = mtd->ecc_stats; while (read < len) { thislen = min_t(int, mtd->writesize, len - read); @@ -774,7 +779,11 @@ out: * retlen == desired len and result == -EBADMSG */ *retlen = read; - return ret; + + if (mtd->ecc_stats.failed - stats.failed) + return -EBADMSG; + + return mtd->ecc_stats.corrected - stats.corrected ? -EUCLEAN : 0; } /** @@ -1390,7 +1399,6 @@ static int onenand_lock(struct mtd_info *mtd, loff_t ofs, size_t len) return onenand_do_lock_cmd(mtd, ofs, len, ONENAND_CMD_LOCK); } - /** * onenand_unlock - [MTD Interface] Unlock block(s) * @param mtd MTD device structure @@ -1900,7 +1908,7 @@ static int onenand_probe(struct mtd_info *mtd) /* Read manufacturer and device IDs from Register */ maf_id = this->read_word(this->base + ONENAND_REG_MANUFACTURER_ID); dev_id = this->read_word(this->base + ONENAND_REG_DEVICE_ID); - ver_id= this->read_word(this->base + ONENAND_REG_VERSION_ID); + ver_id = this->read_word(this->base + ONENAND_REG_VERSION_ID); /* Check OneNAND device */ if (maf_id != bram_maf_id || dev_id != bram_dev_id) diff --git a/drivers/mtd/onenand/onenand_bbt.c b/drivers/mtd/onenand/onenand_bbt.c index 1b00dac..c8067b8 100644 --- a/drivers/mtd/onenand/onenand_bbt.c +++ b/drivers/mtd/onenand/onenand_bbt.c @@ -100,6 +100,7 @@ static int create_bbt(struct mtd_info *mtd, uint8_t *buf, struct nand_bbt_descr bbm->bbt[i >> 3] |= 0x03 << (i & 0x6); printk(KERN_WARNING "Bad eraseblock %d at 0x%08x\n", i >> 1, (unsigned int) from); + mtd->ecc_stats.badblocks++; break; } } -- cgit v1.1 From 1605cd3d9c5001790c2e36979cf1eff1f222fbc5 Mon Sep 17 00:00:00 2001 From: Adrian Bunk Date: Wed, 22 Nov 2006 05:38:11 +0100 Subject: [MTD] [NAND] rtc_from4.c: use lib/bitrev.c This patch converts drivers/mtd/nand/rtc_from4.c to use the new lib/bitrev.c Signed-off-by: Adrian Bunk Signed-off-by: David Woodhouse --- drivers/mtd/nand/Kconfig | 1 + drivers/mtd/nand/rtc_from4.c | 44 ++------------------------------------------ 2 files changed, 3 insertions(+), 42 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/Kconfig b/drivers/mtd/nand/Kconfig index b4b1656..c600868 100644 --- a/drivers/mtd/nand/Kconfig +++ b/drivers/mtd/nand/Kconfig @@ -90,6 +90,7 @@ config MTD_NAND_RTC_FROM4 depends on MTD_NAND && SH_SOLUTION_ENGINE select REED_SOLOMON select REED_SOLOMON_DEC8 + select BITREVERSE help This enables the driver for the Renesas Technology AG-AND flash interface board (FROM_BOARD4) diff --git a/drivers/mtd/nand/rtc_from4.c b/drivers/mtd/nand/rtc_from4.c index f8c4964..4a83a7d 100644 --- a/drivers/mtd/nand/rtc_from4.c +++ b/drivers/mtd/nand/rtc_from4.c @@ -24,6 +24,7 @@ #include #include #include +#include #include #include #include @@ -152,47 +153,6 @@ static struct nand_ecclayout rtc_from4_nand_oobinfo = { .oobfree = {{32, 32}} }; -/* Aargh. I missed the reversed bit order, when I - * was talking to Renesas about the FPGA. - * - * The table is used for bit reordering and inversion - * of the ecc byte which we get from the FPGA - */ -static uint8_t revbits[256] = { - 0x00, 0x80, 0x40, 0xc0, 0x20, 0xa0, 0x60, 0xe0, - 0x10, 0x90, 0x50, 0xd0, 0x30, 0xb0, 0x70, 0xf0, - 0x08, 0x88, 0x48, 0xc8, 0x28, 0xa8, 0x68, 0xe8, - 0x18, 0x98, 0x58, 0xd8, 0x38, 0xb8, 0x78, 0xf8, - 0x04, 0x84, 0x44, 0xc4, 0x24, 0xa4, 0x64, 0xe4, - 0x14, 0x94, 0x54, 0xd4, 0x34, 0xb4, 0x74, 0xf4, - 0x0c, 0x8c, 0x4c, 0xcc, 0x2c, 0xac, 0x6c, 0xec, - 0x1c, 0x9c, 0x5c, 0xdc, 0x3c, 0xbc, 0x7c, 0xfc, - 0x02, 0x82, 0x42, 0xc2, 0x22, 0xa2, 0x62, 0xe2, - 0x12, 0x92, 0x52, 0xd2, 0x32, 0xb2, 0x72, 0xf2, - 0x0a, 0x8a, 0x4a, 0xca, 0x2a, 0xaa, 0x6a, 0xea, - 0x1a, 0x9a, 0x5a, 0xda, 0x3a, 0xba, 0x7a, 0xfa, - 0x06, 0x86, 0x46, 0xc6, 0x26, 0xa6, 0x66, 0xe6, - 0x16, 0x96, 0x56, 0xd6, 0x36, 0xb6, 0x76, 0xf6, - 0x0e, 0x8e, 0x4e, 0xce, 0x2e, 0xae, 0x6e, 0xee, - 0x1e, 0x9e, 0x5e, 0xde, 0x3e, 0xbe, 0x7e, 0xfe, - 0x01, 0x81, 0x41, 0xc1, 0x21, 0xa1, 0x61, 0xe1, - 0x11, 0x91, 0x51, 0xd1, 0x31, 0xb1, 0x71, 0xf1, - 0x09, 0x89, 0x49, 0xc9, 0x29, 0xa9, 0x69, 0xe9, - 0x19, 0x99, 0x59, 0xd9, 0x39, 0xb9, 0x79, 0xf9, - 0x05, 0x85, 0x45, 0xc5, 0x25, 0xa5, 0x65, 0xe5, - 0x15, 0x95, 0x55, 0xd5, 0x35, 0xb5, 0x75, 0xf5, - 0x0d, 0x8d, 0x4d, 0xcd, 0x2d, 0xad, 0x6d, 0xed, - 0x1d, 0x9d, 0x5d, 0xdd, 0x3d, 0xbd, 0x7d, 0xfd, - 0x03, 0x83, 0x43, 0xc3, 0x23, 0xa3, 0x63, 0xe3, - 0x13, 0x93, 0x53, 0xd3, 0x33, 0xb3, 0x73, 0xf3, - 0x0b, 0x8b, 0x4b, 0xcb, 0x2b, 0xab, 0x6b, 0xeb, - 0x1b, 0x9b, 0x5b, 0xdb, 0x3b, 0xbb, 0x7b, 0xfb, - 0x07, 0x87, 0x47, 0xc7, 0x27, 0xa7, 0x67, 0xe7, - 0x17, 0x97, 0x57, 0xd7, 0x37, 0xb7, 0x77, 0xf7, - 0x0f, 0x8f, 0x4f, 0xcf, 0x2f, 0xaf, 0x6f, 0xef, - 0x1f, 0x9f, 0x5f, 0xdf, 0x3f, 0xbf, 0x7f, 0xff, -}; - #endif /* @@ -397,7 +357,7 @@ static int rtc_from4_correct_data(struct mtd_info *mtd, const u_char *buf, u_cha /* Read the syndrom pattern from the FPGA and correct the bitorder */ rs_ecc = (volatile unsigned short *)(rtc_from4_fio_base + RTC_FROM4_RS_ECC); for (i = 0; i < 8; i++) { - ecc[i] = revbits[(*rs_ecc) & 0xFF]; + ecc[i] = byte_rev_table[(*rs_ecc) & 0xFF]; rs_ecc++; } -- cgit v1.1 From ddacff1f20fc5c96cc73e2975258e05d298c97cc Mon Sep 17 00:00:00 2001 From: Adrian Bunk Date: Sat, 25 Nov 2006 20:15:41 +0100 Subject: [MTD] make drivers/mtd/cmdlinepart.c:mtdpart_setup() static This patch makes the needlessly global mtdpart_setup() static. Signed-off-by: Adrian Bunk Signed-off-by: David Woodhouse --- drivers/mtd/cmdlinepart.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/cmdlinepart.c b/drivers/mtd/cmdlinepart.c index a7a7bfe..3402ce4 100644 --- a/drivers/mtd/cmdlinepart.c +++ b/drivers/mtd/cmdlinepart.c @@ -346,7 +346,7 @@ static int parse_cmdline_partitions(struct mtd_info *master, * * This function needs to be visible for bootloaders. */ -int mtdpart_setup(char *s) +static int mtdpart_setup(char *s) { cmdline = s; return 1; -- cgit v1.1 From 4010db56c8fe5bbb8e223bf9c9c36d41e9ad4f79 Mon Sep 17 00:00:00 2001 From: Stefan Roese Date: Fri, 10 Nov 2006 12:19:32 +0100 Subject: [MTD] [NAND] Fix endianess bug in ndfc.c The writel() call accidentally clears all bits in the NDFC_CCR register (endianess problem). Now __raw_writel() is used instead. Tested on Bamboo with NAND on chip select 0 and chip select 1. Signed-off-by: Stefan Roese Signed-off-by: David Woodhouse --- drivers/mtd/nand/ndfc.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/ndfc.c b/drivers/mtd/nand/ndfc.c index 039c759..fd7a8d5 100644 --- a/drivers/mtd/nand/ndfc.c +++ b/drivers/mtd/nand/ndfc.c @@ -56,7 +56,7 @@ static void ndfc_select_chip(struct mtd_info *mtd, int chip) ccr |= NDFC_CCR_BS(chip + pchip->chip_offset); } else ccr |= NDFC_CCR_RESET_CE; - writel(ccr, ndfc->ndfcbase + NDFC_CCR); + __raw_writel(ccr, ndfc->ndfcbase + NDFC_CCR); } static void ndfc_hwcontrol(struct mtd_info *mtd, int cmd, unsigned int ctrl) -- cgit v1.1 From 90afffc8bd79d130b58acd18f972ce4e00b8e20f Mon Sep 17 00:00:00 2001 From: Dave Olsen Date: Mon, 6 Nov 2006 16:33:57 -0700 Subject: [MTD] [MAPS] Support for BIOS flash chips on the nvidia ck804 southbridge Add support for accessing BIOS flash chips connected to the NVIDIA ck804 southbridge. Signed-off-by: Ryan Jackson Signed-off-by: David Woodhouse --- drivers/mtd/maps/Kconfig | 9 ++ drivers/mtd/maps/Makefile | 1 + drivers/mtd/maps/ck804xrom.c | 356 +++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 366 insertions(+) create mode 100644 drivers/mtd/maps/ck804xrom.c (limited to 'drivers') diff --git a/drivers/mtd/maps/Kconfig b/drivers/mtd/maps/Kconfig index 7514a9b..fa74668 100644 --- a/drivers/mtd/maps/Kconfig +++ b/drivers/mtd/maps/Kconfig @@ -193,6 +193,15 @@ config MTD_ESB2ROM BE VERY CAREFUL. +config MTD_CK804XROM + tristate "BIOS flash chip on Nvidia CK804" + depends on X86 && MTD_JEDECPROBE + help + Support for treating the BIOS flash chip on nvidia motherboards + as an MTD device - with this you can reprogram your BIOS. + + BE VERY CAREFUL. + config MTD_SCB2_FLASH tristate "BIOS flash chip on Intel SCB2 boards" depends on X86 && MTD_JEDECPROBE diff --git a/drivers/mtd/maps/Makefile b/drivers/mtd/maps/Makefile index 9061432..3450521 100644 --- a/drivers/mtd/maps/Makefile +++ b/drivers/mtd/maps/Makefile @@ -19,6 +19,7 @@ obj-$(CONFIG_MTD_L440GX) += l440gx.o obj-$(CONFIG_MTD_AMD76XROM) += amd76xrom.o obj-$(CONFIG_MTD_ESB2ROM) += esb2rom.o obj-$(CONFIG_MTD_ICHXROM) += ichxrom.o +obj-$(CONFIG_MTD_CK804XROM) += ck804xrom.o obj-$(CONFIG_MTD_TSUNAMI) += tsunami_flash.o obj-$(CONFIG_MTD_LUBBOCK) += lubbock-flash.o obj-$(CONFIG_MTD_MAINSTONE) += mainstone-flash.o diff --git a/drivers/mtd/maps/ck804xrom.c b/drivers/mtd/maps/ck804xrom.c new file mode 100644 index 0000000..c222b88 --- /dev/null +++ b/drivers/mtd/maps/ck804xrom.c @@ -0,0 +1,356 @@ +/* + * ck804xrom.c + * + * Normal mappings of chips in physical memory + * + * Dave Olsen + * Ryan Jackson + */ + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +#define MOD_NAME KBUILD_BASENAME + +#define ADDRESS_NAME_LEN 18 + +#define ROM_PROBE_STEP_SIZE (64*1024) + +struct ck804xrom_window { + void __iomem *virt; + unsigned long phys; + unsigned long size; + struct list_head maps; + struct resource rsrc; + struct pci_dev *pdev; +}; + +struct ck804xrom_map_info { + struct list_head list; + struct map_info map; + struct mtd_info *mtd; + struct resource rsrc; + char map_name[sizeof(MOD_NAME) + 2 + ADDRESS_NAME_LEN]; +}; + + +/* The 2 bits controlling the window size are often set to allow reading + * the BIOS, but too small to allow writing, since the lock registers are + * 4MiB lower in the address space than the data. + * + * This is intended to prevent flashing the bios, perhaps accidentally. + * + * This parameter allows the normal driver to override the BIOS settings. + * + * The bits are 6 and 7. If both bits are set, it is a 5MiB window. + * If only the 7 Bit is set, it is a 4MiB window. Otherwise, a + * 64KiB window. + * + */ +static uint win_size_bits = 0; +module_param(win_size_bits, uint, 0); +MODULE_PARM_DESC(win_size_bits, "ROM window size bits override for 0x88 byte, normally set by BIOS."); + +static struct ck804xrom_window ck804xrom_window = { + .maps = LIST_HEAD_INIT(ck804xrom_window.maps), +}; + +static void ck804xrom_cleanup(struct ck804xrom_window *window) +{ + struct ck804xrom_map_info *map, *scratch; + u8 byte; + + if (window->pdev) { + /* Disable writes through the rom window */ + pci_read_config_byte(window->pdev, 0x6d, &byte); + pci_write_config_byte(window->pdev, 0x6d, byte & ~1); + } + + /* Free all of the mtd devices */ + list_for_each_entry_safe(map, scratch, &window->maps, list) { + if (map->rsrc.parent) + release_resource(&map->rsrc); + + del_mtd_device(map->mtd); + map_destroy(map->mtd); + list_del(&map->list); + kfree(map); + } + if (window->rsrc.parent) + release_resource(&window->rsrc); + + if (window->virt) { + iounmap(window->virt); + window->virt = NULL; + window->phys = 0; + window->size = 0; + } + pci_dev_put(window->pdev); +} + + +static int __devinit ck804xrom_init_one (struct pci_dev *pdev, + const struct pci_device_id *ent) +{ + static char *rom_probe_types[] = { "cfi_probe", "jedec_probe", NULL }; + u8 byte; + struct ck804xrom_window *window = &ck804xrom_window; + struct ck804xrom_map_info *map = NULL; + unsigned long map_top; + + /* Remember the pci dev I find the window in */ + window->pdev = pci_dev_get(pdev); + + /* Enable the selected rom window. This is often incorrectly + * set up by the BIOS, and the 4MiB offset for the lock registers + * requires the full 5MiB of window space. + * + * This 'write, then read' approach leaves the bits for + * other uses of the hardware info. + */ + pci_read_config_byte(pdev, 0x88, &byte); + pci_write_config_byte(pdev, 0x88, byte | win_size_bits ); + + + /* Assume the rom window is properly setup, and find it's size */ + pci_read_config_byte(pdev, 0x88, &byte); + + if ((byte & ((1<<7)|(1<<6))) == ((1<<7)|(1<<6))) + window->phys = 0xffb00000; /* 5MiB */ + else if ((byte & (1<<7)) == (1<<7)) + window->phys = 0xffc00000; /* 4MiB */ + else + window->phys = 0xffff0000; /* 64KiB */ + + window->size = 0xffffffffUL - window->phys + 1UL; + + /* + * Try to reserve the window mem region. If this fails then + * it is likely due to a fragment of the window being + * "reserved" by the BIOS. In the case that the + * request_mem_region() fails then once the rom size is + * discovered we will try to reserve the unreserved fragment. + */ + window->rsrc.name = MOD_NAME; + window->rsrc.start = window->phys; + window->rsrc.end = window->phys + window->size - 1; + window->rsrc.flags = IORESOURCE_MEM | IORESOURCE_BUSY; + if (request_resource(&iomem_resource, &window->rsrc)) { + window->rsrc.parent = NULL; + printk(KERN_ERR MOD_NAME + " %s(): Unable to register resource" + " 0x%.016llx-0x%.016llx - kernel bug?\n", + __func__, + (unsigned long long)window->rsrc.start, + (unsigned long long)window->rsrc.end); + } + + + /* Enable writes through the rom window */ + pci_read_config_byte(pdev, 0x6d, &byte); + pci_write_config_byte(pdev, 0x6d, byte | 1); + + /* FIXME handle registers 0x80 - 0x8C the bios region locks */ + + /* For write accesses caches are useless */ + window->virt = ioremap_nocache(window->phys, window->size); + if (!window->virt) { + printk(KERN_ERR MOD_NAME ": ioremap(%08lx, %08lx) failed\n", + window->phys, window->size); + goto out; + } + + /* Get the first address to look for a rom chip at */ + map_top = window->phys; +#if 1 + /* The probe sequence run over the firmware hub lock + * registers sets them to 0x7 (no access). + * Probe at most the last 4MiB of the address space. + */ + if (map_top < 0xffc00000) + map_top = 0xffc00000; +#endif + /* Loop through and look for rom chips. Since we don't know the + * starting address for each chip, probe every ROM_PROBE_STEP_SIZE + * bytes from the starting address of the window. + */ + while((map_top - 1) < 0xffffffffUL) { + struct cfi_private *cfi; + unsigned long offset; + int i; + + if (!map) + map = kmalloc(sizeof(*map), GFP_KERNEL); + + if (!map) { + printk(KERN_ERR MOD_NAME ": kmalloc failed"); + goto out; + } + memset(map, 0, sizeof(*map)); + INIT_LIST_HEAD(&map->list); + map->map.name = map->map_name; + map->map.phys = map_top; + offset = map_top - window->phys; + map->map.virt = (void __iomem *) + (((unsigned long)(window->virt)) + offset); + map->map.size = 0xffffffffUL - map_top + 1UL; + /* Set the name of the map to the address I am trying */ + sprintf(map->map_name, "%s @%08lx", + MOD_NAME, map->map.phys); + + /* There is no generic VPP support */ + for(map->map.bankwidth = 32; map->map.bankwidth; + map->map.bankwidth >>= 1) + { + char **probe_type; + /* Skip bankwidths that are not supported */ + if (!map_bankwidth_supported(map->map.bankwidth)) + continue; + + /* Setup the map methods */ + simple_map_init(&map->map); + + /* Try all of the probe methods */ + probe_type = rom_probe_types; + for(; *probe_type; probe_type++) { + map->mtd = do_map_probe(*probe_type, &map->map); + if (map->mtd) + goto found; + } + } + map_top += ROM_PROBE_STEP_SIZE; + continue; + found: + /* Trim the size if we are larger than the map */ + if (map->mtd->size > map->map.size) { + printk(KERN_WARNING MOD_NAME + " rom(%u) larger than window(%lu). fixing...\n", + map->mtd->size, map->map.size); + map->mtd->size = map->map.size; + } + if (window->rsrc.parent) { + /* + * Registering the MTD device in iomem may not be possible + * if there is a BIOS "reserved" and BUSY range. If this + * fails then continue anyway. + */ + map->rsrc.name = map->map_name; + map->rsrc.start = map->map.phys; + map->rsrc.end = map->map.phys + map->mtd->size - 1; + map->rsrc.flags = IORESOURCE_MEM | IORESOURCE_BUSY; + if (request_resource(&window->rsrc, &map->rsrc)) { + printk(KERN_ERR MOD_NAME + ": cannot reserve MTD resource\n"); + map->rsrc.parent = NULL; + } + } + + /* Make the whole region visible in the map */ + map->map.virt = window->virt; + map->map.phys = window->phys; + cfi = map->map.fldrv_priv; + for(i = 0; i < cfi->numchips; i++) + cfi->chips[i].start += offset; + + /* Now that the mtd devices is complete claim and export it */ + map->mtd->owner = THIS_MODULE; + if (add_mtd_device(map->mtd)) { + map_destroy(map->mtd); + map->mtd = NULL; + goto out; + } + + + /* Calculate the new value of map_top */ + map_top += map->mtd->size; + + /* File away the map structure */ + list_add(&map->list, &window->maps); + map = NULL; + } + + out: + /* Free any left over map structures */ + if (map) + kfree(map); + + /* See if I have any map structures */ + if (list_empty(&window->maps)) { + ck804xrom_cleanup(window); + return -ENODEV; + } + return 0; +} + + +static void __devexit ck804xrom_remove_one (struct pci_dev *pdev) +{ + struct ck804xrom_window *window = &ck804xrom_window; + + ck804xrom_cleanup(window); +} + +static struct pci_device_id ck804xrom_pci_tbl[] = { + { PCI_VENDOR_ID_NVIDIA, 0x0051, + PCI_ANY_ID, PCI_ANY_ID, }, /* nvidia ck804 */ + { 0, } +}; + +MODULE_DEVICE_TABLE(pci, ck804xrom_pci_tbl); + +#if 0 +static struct pci_driver ck804xrom_driver = { + .name = MOD_NAME, + .id_table = ck804xrom_pci_tbl, + .probe = ck804xrom_init_one, + .remove = ck804xrom_remove_one, +}; +#endif + +static int __init init_ck804xrom(void) +{ + struct pci_dev *pdev; + struct pci_device_id *id; + int retVal; + pdev = NULL; + + for(id = ck804xrom_pci_tbl; id->vendor; id++) { + pdev = pci_find_device(id->vendor, id->device, NULL); + if (pdev) + break; + } + if (pdev) { + retVal = ck804xrom_init_one(pdev, &ck804xrom_pci_tbl[0]); + pci_dev_put(pdev); + return retVal; + } + return -ENXIO; +#if 0 + return pci_module_init(&ck804xrom_driver); +#endif +} + +static void __exit cleanup_ck804xrom(void) +{ + ck804xrom_remove_one(ck804xrom_window.pdev); +} + +module_init(init_ck804xrom); +module_exit(cleanup_ck804xrom); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("Eric Biederman , Dave Olsen "); +MODULE_DESCRIPTION("MTD map driver for BIOS chips on the Nvidia ck804 southbridge"); + -- cgit v1.1 From 191876729901d0c8dab8a331f9a1e4b73a56457b Mon Sep 17 00:00:00 2001 From: Richard Purdie Date: Fri, 27 Oct 2006 09:09:33 +0100 Subject: [MTD] Allow variable block sizes in mtd_blkdevs Currently, mtd_blkdevs enforces a block size of 512, even if the drivers can seemingly request a different size. This patch fixes mtd_blkdevs so block sizes other than 512 work correctly. Signed-off-by: Richard Purdie Signed-off-by: David Woodhouse --- drivers/mtd/ftl.c | 3 ++- drivers/mtd/inftlcore.c | 3 ++- drivers/mtd/mtd_blkdevs.c | 15 +++++++++------ drivers/mtd/mtdblock.c | 3 ++- drivers/mtd/mtdblock_ro.c | 3 ++- drivers/mtd/nftlcore.c | 3 ++- drivers/mtd/rfd_ftl.c | 3 ++- 7 files changed, 21 insertions(+), 12 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/ftl.c b/drivers/mtd/ftl.c index 8a878b3..da39355 100644 --- a/drivers/mtd/ftl.c +++ b/drivers/mtd/ftl.c @@ -1054,7 +1054,7 @@ static void ftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) le32_to_cpu(partition->header.FormattedSize) >> 10); #endif partition->mbd.size = le32_to_cpu(partition->header.FormattedSize) >> 9; - partition->mbd.blksize = SECTOR_SIZE; + partition->mbd.tr = tr; partition->mbd.devnum = -1; if (!add_mtd_blktrans_dev((void *)partition)) @@ -1076,6 +1076,7 @@ struct mtd_blktrans_ops ftl_tr = { .name = "ftl", .major = FTL_MAJOR, .part_bits = PART_BITS, + .blksize = SECTOR_SIZE, .readsect = ftl_readsect, .writesect = ftl_writesect, .getgeo = ftl_getgeo, diff --git a/drivers/mtd/inftlcore.c b/drivers/mtd/inftlcore.c index 4116535..a1b2de6 100644 --- a/drivers/mtd/inftlcore.c +++ b/drivers/mtd/inftlcore.c @@ -77,7 +77,7 @@ static void inftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) inftl->mbd.mtd = mtd; inftl->mbd.devnum = -1; - inftl->mbd.blksize = 512; + inftl->mbd.tr = tr; if (INFTL_mount(inftl) < 0) { @@ -945,6 +945,7 @@ static struct mtd_blktrans_ops inftl_tr = { .name = "inftl", .major = INFTL_MAJOR, .part_bits = INFTL_PARTN_BITS, + .blksize = 512, .getgeo = inftl_getgeo, .readsect = inftl_readblock, .writesect = inftl_writeblock, diff --git a/drivers/mtd/mtd_blkdevs.c b/drivers/mtd/mtd_blkdevs.c index 178b53b..b5d62cb 100644 --- a/drivers/mtd/mtd_blkdevs.c +++ b/drivers/mtd/mtd_blkdevs.c @@ -42,19 +42,20 @@ static int do_blktrans_request(struct mtd_blktrans_ops *tr, unsigned long block, nsect; char *buf; - block = req->sector; - nsect = req->current_nr_sectors; + block = req->sector << 9 >> tr->blkshift; + nsect = req->current_nr_sectors << 9 >> tr->blkshift; + buf = req->buffer; if (!blk_fs_request(req)) return 0; - if (block + nsect > get_capacity(req->rq_disk)) + if (req->sector + req->current_nr_sectors > get_capacity(req->rq_disk)) return 0; switch(rq_data_dir(req)) { case READ: - for (; nsect > 0; nsect--, block++, buf += 512) + for (; nsect > 0; nsect--, block++, buf += tr->blksize) if (tr->readsect(dev, block, buf)) return 0; return 1; @@ -63,7 +64,7 @@ static int do_blktrans_request(struct mtd_blktrans_ops *tr, if (!tr->writesect) return 0; - for (; nsect > 0; nsect--, block++, buf += 512) + for (; nsect > 0; nsect--, block++, buf += tr->blksize) if (tr->writesect(dev, block, buf)) return 0; return 1; @@ -297,7 +298,7 @@ int add_mtd_blktrans_dev(struct mtd_blktrans_dev *new) /* 2.5 has capacity in units of 512 bytes while still having BLOCK_SIZE_BITS set to 10. Just to keep us amused. */ - set_capacity(gd, (new->size * new->blksize) >> 9); + set_capacity(gd, (new->size * tr->blksize) >> 9); gd->private_data = new; new->blkcore_priv = gd; @@ -401,6 +402,8 @@ int register_mtd_blktrans(struct mtd_blktrans_ops *tr) } tr->blkcore_priv->rq->queuedata = tr; + blk_queue_hardsect_size(tr->blkcore_priv->rq, tr->blksize); + tr->blkshift = ffs(tr->blksize) - 1; ret = kernel_thread(mtd_blktrans_thread, tr, CLONE_KERNEL); if (ret < 0) { diff --git a/drivers/mtd/mtdblock.c b/drivers/mtd/mtdblock.c index 04ed3469..a052648 100644 --- a/drivers/mtd/mtdblock.c +++ b/drivers/mtd/mtdblock.c @@ -348,7 +348,7 @@ static void mtdblock_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) dev->mtd = mtd; dev->devnum = mtd->index; - dev->blksize = 512; + dev->size = mtd->size >> 9; dev->tr = tr; @@ -368,6 +368,7 @@ static struct mtd_blktrans_ops mtdblock_tr = { .name = "mtdblock", .major = 31, .part_bits = 0, + .blksize = 512, .open = mtdblock_open, .flush = mtdblock_flush, .release = mtdblock_release, diff --git a/drivers/mtd/mtdblock_ro.c b/drivers/mtd/mtdblock_ro.c index 29563ed..642ccc6 100644 --- a/drivers/mtd/mtdblock_ro.c +++ b/drivers/mtd/mtdblock_ro.c @@ -42,7 +42,7 @@ static void mtdblock_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) dev->mtd = mtd; dev->devnum = mtd->index; - dev->blksize = 512; + dev->size = mtd->size >> 9; dev->tr = tr; dev->readonly = 1; @@ -60,6 +60,7 @@ static struct mtd_blktrans_ops mtdblock_tr = { .name = "mtdblock", .major = 31, .part_bits = 0, + .blksize = 512, .readsect = mtdblock_readsect, .writesect = mtdblock_writesect, .add_mtd = mtdblock_add_mtd, diff --git a/drivers/mtd/nftlcore.c b/drivers/mtd/nftlcore.c index b5a5f8d..d974ada 100644 --- a/drivers/mtd/nftlcore.c +++ b/drivers/mtd/nftlcore.c @@ -67,7 +67,7 @@ static void nftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) nftl->mbd.mtd = mtd; nftl->mbd.devnum = -1; - nftl->mbd.blksize = 512; + nftl->mbd.tr = tr; if (NFTL_mount(nftl) < 0) { @@ -797,6 +797,7 @@ static struct mtd_blktrans_ops nftl_tr = { .name = "nftl", .major = NFTL_MAJOR, .part_bits = NFTL_PARTN_BITS, + .blksize = 512, .getgeo = nftl_getgeo, .readsect = nftl_readblock, #ifdef CONFIG_NFTL_RW diff --git a/drivers/mtd/rfd_ftl.c b/drivers/mtd/rfd_ftl.c index fa4362f..d60cc66 100644 --- a/drivers/mtd/rfd_ftl.c +++ b/drivers/mtd/rfd_ftl.c @@ -787,7 +787,6 @@ static void rfd_ftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) if (scan_header(part) == 0) { part->mbd.size = part->sector_count; - part->mbd.blksize = SECTOR_SIZE; part->mbd.tr = tr; part->mbd.devnum = -1; if (!(mtd->flags & MTD_WRITEABLE)) @@ -829,6 +828,8 @@ struct mtd_blktrans_ops rfd_ftl_tr = { .name = "rfd", .major = RFD_FTL_MAJOR, .part_bits = PART_BITS, + .blksize = SECTOR_SIZE, + .readsect = rfd_ftl_readsect, .writesect = rfd_ftl_writesect, .getgeo = rfd_ftl_getgeo, -- cgit v1.1 From 7014568bad55c20b7ee4f439d78c9e875912d51f Mon Sep 17 00:00:00 2001 From: Vitaly Wool Date: Fri, 3 Nov 2006 18:20:38 +0300 Subject: [MTD] [NAND] remove len/ooblen confusion. MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit As was discussed between Ricard Wanderlöf, David Woodhouse, Artem Bityutskiy and me, the current API for reading/writing OOB is confusing. The thing that introduces confusion is the need to specify ops.len together with ops.ooblen for reads/writes that concern only OOB not data area. So, ops.len is overloaded: when ops.datbuf != NULL it serves to specify the length of the data read, and when ops.datbuf == NULL, it serves to specify the full OOB read length. The patch inlined below is the slightly updated version of the previous patch serving the same purpose, but with the new Artem's comments taken into account. Artem, BTW, thanks a lot for your valuable input! Signed-off-by: Vitaly Wool Signed-off-by: David Woodhouse --- drivers/mtd/inftlcore.c | 6 ++---- drivers/mtd/mtdchar.c | 12 +++++------ drivers/mtd/mtdconcat.c | 39 ++++++++++++++++++++------------- drivers/mtd/mtdpart.c | 4 ++-- drivers/mtd/nand/nand_base.c | 51 ++++++++++++++++++++++++++++++-------------- drivers/mtd/nand/nand_bbt.c | 5 ++--- drivers/mtd/nftlcore.c | 6 ++---- drivers/mtd/ssfdc.c | 5 ++--- 8 files changed, 74 insertions(+), 54 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/inftlcore.c b/drivers/mtd/inftlcore.c index a1b2de6..d2f54c0 100644 --- a/drivers/mtd/inftlcore.c +++ b/drivers/mtd/inftlcore.c @@ -163,10 +163,9 @@ int inftl_read_oob(struct mtd_info *mtd, loff_t offs, size_t len, ops.ooblen = len; ops.oobbuf = buf; ops.datbuf = NULL; - ops.len = len; res = mtd->read_oob(mtd, offs & ~(mtd->writesize - 1), &ops); - *retlen = ops.retlen; + *retlen = ops.oobretlen; return res; } @@ -184,10 +183,9 @@ int inftl_write_oob(struct mtd_info *mtd, loff_t offs, size_t len, ops.ooblen = len; ops.oobbuf = buf; ops.datbuf = NULL; - ops.len = len; res = mtd->write_oob(mtd, offs & ~(mtd->writesize - 1), &ops); - *retlen = ops.retlen; + *retlen = ops.oobretlen; return res; } diff --git a/drivers/mtd/mtdchar.c b/drivers/mtd/mtdchar.c index 866c8e0..07618f5 100644 --- a/drivers/mtd/mtdchar.c +++ b/drivers/mtd/mtdchar.c @@ -499,13 +499,12 @@ static int mtd_ioctl(struct inode *inode, struct file *file, if (ret) return ret; - ops.len = buf.length; ops.ooblen = buf.length; ops.ooboffs = buf.start & (mtd->oobsize - 1); ops.datbuf = NULL; ops.mode = MTD_OOB_PLACE; - if (ops.ooboffs && ops.len > (mtd->oobsize - ops.ooboffs)) + if (ops.ooboffs && ops.ooblen > (mtd->oobsize - ops.ooboffs)) return -EINVAL; ops.oobbuf = kmalloc(buf.length, GFP_KERNEL); @@ -520,7 +519,7 @@ static int mtd_ioctl(struct inode *inode, struct file *file, buf.start &= ~(mtd->oobsize - 1); ret = mtd->write_oob(mtd, buf.start, &ops); - if (copy_to_user(argp + sizeof(uint32_t), &ops.retlen, + if (copy_to_user(argp + sizeof(uint32_t), &ops.oobretlen, sizeof(uint32_t))) ret = -EFAULT; @@ -548,7 +547,6 @@ static int mtd_ioctl(struct inode *inode, struct file *file, if (ret) return ret; - ops.len = buf.length; ops.ooblen = buf.length; ops.ooboffs = buf.start & (mtd->oobsize - 1); ops.datbuf = NULL; @@ -564,10 +562,10 @@ static int mtd_ioctl(struct inode *inode, struct file *file, buf.start &= ~(mtd->oobsize - 1); ret = mtd->read_oob(mtd, buf.start, &ops); - if (put_user(ops.retlen, (uint32_t __user *)argp)) + if (put_user(ops.oobretlen, (uint32_t __user *)argp)) ret = -EFAULT; - else if (ops.retlen && copy_to_user(buf.ptr, ops.oobbuf, - ops.retlen)) + else if (ops.oobretlen && copy_to_user(buf.ptr, ops.oobbuf, + ops.oobretlen)) ret = -EFAULT; kfree(ops.oobbuf); diff --git a/drivers/mtd/mtdconcat.c b/drivers/mtd/mtdconcat.c index 1fea631..cf927a8 100644 --- a/drivers/mtd/mtdconcat.c +++ b/drivers/mtd/mtdconcat.c @@ -247,7 +247,7 @@ concat_read_oob(struct mtd_info *mtd, loff_t from, struct mtd_oob_ops *ops) struct mtd_oob_ops devops = *ops; int i, err, ret = 0; - ops->retlen = 0; + ops->retlen = ops->oobretlen = 0; for (i = 0; i < concat->num_subdev; i++) { struct mtd_info *subdev = concat->subdev[i]; @@ -263,6 +263,7 @@ concat_read_oob(struct mtd_info *mtd, loff_t from, struct mtd_oob_ops *ops) err = subdev->read_oob(subdev, from, &devops); ops->retlen += devops.retlen; + ops->oobretlen += devops.oobretlen; /* Save information about bitflips! */ if (unlikely(err)) { @@ -278,14 +279,18 @@ concat_read_oob(struct mtd_info *mtd, loff_t from, struct mtd_oob_ops *ops) return err; } - devops.len = ops->len - ops->retlen; - if (!devops.len) - return ret; - - if (devops.datbuf) + if (devops.datbuf) { + devops.len = ops->len - ops->retlen; + if (!devops.len) + return ret; devops.datbuf += devops.retlen; - if (devops.oobbuf) - devops.oobbuf += devops.ooblen; + } + if (devops.oobbuf) { + devops.ooblen = ops->ooblen - ops->oobretlen; + if (!devops.ooblen) + return ret; + devops.oobbuf += ops->oobretlen; + } from = 0; } @@ -321,14 +326,18 @@ concat_write_oob(struct mtd_info *mtd, loff_t to, struct mtd_oob_ops *ops) if (err) return err; - devops.len = ops->len - ops->retlen; - if (!devops.len) - return 0; - - if (devops.datbuf) + if (devops.datbuf) { + devops.len = ops->len - ops->retlen; + if (!devops.len) + return 0; devops.datbuf += devops.retlen; - if (devops.oobbuf) - devops.oobbuf += devops.ooblen; + } + if (devops.oobbuf) { + devops.ooblen = ops->ooblen - ops->oobretlen; + if (!devops.ooblen) + return 0; + devops.oobbuf += devops.oobretlen; + } to = 0; } return -EINVAL; diff --git a/drivers/mtd/mtdpart.c b/drivers/mtd/mtdpart.c index 06a9303..a20f75f 100644 --- a/drivers/mtd/mtdpart.c +++ b/drivers/mtd/mtdpart.c @@ -94,7 +94,7 @@ static int part_read_oob(struct mtd_info *mtd, loff_t from, if (from >= mtd->size) return -EINVAL; - if (from + ops->len > mtd->size) + if (ops->datbuf && from + ops->len > mtd->size) return -EINVAL; res = part->master->read_oob(part->master, from + part->offset, ops); @@ -161,7 +161,7 @@ static int part_write_oob(struct mtd_info *mtd, loff_t to, if (to >= mtd->size) return -EINVAL; - if (to + ops->len > mtd->size) + if (ops->datbuf && to + ops->len > mtd->size) return -EINVAL; return part->master->write_oob(part->master, to + part->offset, ops); } diff --git a/drivers/mtd/nand/nand_base.c b/drivers/mtd/nand/nand_base.c index 8df36e2..5dcb2e0 100644 --- a/drivers/mtd/nand/nand_base.c +++ b/drivers/mtd/nand/nand_base.c @@ -897,12 +897,11 @@ static int nand_read_page_syndrome(struct mtd_info *mtd, struct nand_chip *chip, * @chip: nand chip structure * @oob: oob destination address * @ops: oob ops structure + * @len: size of oob to transfer */ static uint8_t *nand_transfer_oob(struct nand_chip *chip, uint8_t *oob, - struct mtd_oob_ops *ops) + struct mtd_oob_ops *ops, size_t len) { - size_t len = ops->ooblen; - switch(ops->mode) { case MTD_OOB_PLACE: @@ -960,6 +959,7 @@ static int nand_do_read_ops(struct mtd_info *mtd, loff_t from, int sndcmd = 1; int ret = 0; uint32_t readlen = ops->len; + uint32_t oobreadlen = ops->ooblen; uint8_t *bufpoi, *oob, *buf; stats = mtd->ecc_stats; @@ -1006,10 +1006,17 @@ static int nand_do_read_ops(struct mtd_info *mtd, loff_t from, if (unlikely(oob)) { /* Raw mode does data:oob:data:oob */ - if (ops->mode != MTD_OOB_RAW) - oob = nand_transfer_oob(chip, oob, ops); - else - buf = nand_transfer_oob(chip, buf, ops); + if (ops->mode != MTD_OOB_RAW) { + int toread = min(oobreadlen, + chip->ecc.layout->oobavail); + if (toread) { + oob = nand_transfer_oob(chip, + oob, ops, toread); + oobreadlen -= toread; + } + } else + buf = nand_transfer_oob(chip, + buf, ops, mtd->oobsize); } if (!(chip->options & NAND_NO_READRDY)) { @@ -1056,6 +1063,8 @@ static int nand_do_read_ops(struct mtd_info *mtd, loff_t from, } ops->retlen = ops->len - (size_t) readlen; + if (oob) + ops->oobretlen = ops->ooblen - oobreadlen; if (ret) return ret; @@ -1256,12 +1265,18 @@ static int nand_do_read_oob(struct mtd_info *mtd, loff_t from, int page, realpage, chipnr, sndcmd = 1; struct nand_chip *chip = mtd->priv; int blkcheck = (1 << (chip->phys_erase_shift - chip->page_shift)) - 1; - int readlen = ops->len; + int readlen = ops->ooblen; + int len; uint8_t *buf = ops->oobbuf; DEBUG(MTD_DEBUG_LEVEL3, "nand_read_oob: from = 0x%08Lx, len = %i\n", (unsigned long long)from, readlen); + if (ops->mode == MTD_OOB_RAW) + len = mtd->oobsize; + else + len = chip->ecc.layout->oobavail; + chipnr = (int)(from >> chip->chip_shift); chip->select_chip(mtd, chipnr); @@ -1271,7 +1286,9 @@ static int nand_do_read_oob(struct mtd_info *mtd, loff_t from, while(1) { sndcmd = chip->ecc.read_oob(mtd, chip, page, sndcmd); - buf = nand_transfer_oob(chip, buf, ops); + + len = min(len, readlen); + buf = nand_transfer_oob(chip, buf, ops, len); if (!(chip->options & NAND_NO_READRDY)) { /* @@ -1286,7 +1303,7 @@ static int nand_do_read_oob(struct mtd_info *mtd, loff_t from, nand_wait_ready(mtd); } - readlen -= ops->ooblen; + readlen -= len; if (!readlen) break; @@ -1308,7 +1325,7 @@ static int nand_do_read_oob(struct mtd_info *mtd, loff_t from, sndcmd = 1; } - ops->retlen = ops->len; + ops->oobretlen = ops->ooblen; return 0; } @@ -1329,7 +1346,7 @@ static int nand_read_oob(struct mtd_info *mtd, loff_t from, ops->retlen = 0; /* Do not allow reads past end of device */ - if ((from + ops->len) > mtd->size) { + if (ops->datbuf && (from + ops->len) > mtd->size) { DEBUG(MTD_DEBUG_LEVEL0, "nand_read_oob: " "Attempt read beyond end of device\n"); return -EINVAL; @@ -1654,6 +1671,8 @@ static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, } ops->retlen = ops->len - writelen; + if (unlikely(oob)) + ops->oobretlen = ops->ooblen; return ret; } @@ -1709,10 +1728,10 @@ static int nand_do_write_oob(struct mtd_info *mtd, loff_t to, struct nand_chip *chip = mtd->priv; DEBUG(MTD_DEBUG_LEVEL3, "nand_write_oob: to = 0x%08x, len = %i\n", - (unsigned int)to, (int)ops->len); + (unsigned int)to, (int)ops->ooblen); /* Do not allow write past end of page */ - if ((ops->ooboffs + ops->len) > mtd->oobsize) { + if ((ops->ooboffs + ops->ooblen) > mtd->oobsize) { DEBUG(MTD_DEBUG_LEVEL0, "nand_write_oob: " "Attempt to write past end of page\n"); return -EINVAL; @@ -1748,7 +1767,7 @@ static int nand_do_write_oob(struct mtd_info *mtd, loff_t to, if (status) return status; - ops->retlen = ops->len; + ops->oobretlen = ops->ooblen; return 0; } @@ -1768,7 +1787,7 @@ static int nand_write_oob(struct mtd_info *mtd, loff_t to, ops->retlen = 0; /* Do not allow writes past end of device */ - if ((to + ops->len) > mtd->size) { + if (ops->datbuf && (to + ops->len) > mtd->size) { DEBUG(MTD_DEBUG_LEVEL0, "nand_read_oob: " "Attempt read beyond end of device\n"); return -EINVAL; diff --git a/drivers/mtd/nand/nand_bbt.c b/drivers/mtd/nand/nand_bbt.c index 9402653..4e74fe9 100644 --- a/drivers/mtd/nand/nand_bbt.c +++ b/drivers/mtd/nand/nand_bbt.c @@ -333,7 +333,6 @@ static int scan_block_fast(struct mtd_info *mtd, struct nand_bbt_descr *bd, struct mtd_oob_ops ops; int j, ret; - ops.len = mtd->oobsize; ops.ooblen = mtd->oobsize; ops.oobbuf = buf; ops.ooboffs = 0; @@ -676,10 +675,10 @@ static int write_bbt(struct mtd_info *mtd, uint8_t *buf, "bad block table\n"); } /* Read oob data */ - ops.len = (len >> this->page_shift) * mtd->oobsize; + ops.ooblen = (len >> this->page_shift) * mtd->oobsize; ops.oobbuf = &buf[len]; res = mtd->read_oob(mtd, to + mtd->writesize, &ops); - if (res < 0 || ops.retlen != ops.len) + if (res < 0 || ops.oobretlen != ops.ooblen) goto outerr; /* Calc the byte offset in the buffer */ diff --git a/drivers/mtd/nftlcore.c b/drivers/mtd/nftlcore.c index d974ada..f4d3854 100644 --- a/drivers/mtd/nftlcore.c +++ b/drivers/mtd/nftlcore.c @@ -147,10 +147,9 @@ int nftl_read_oob(struct mtd_info *mtd, loff_t offs, size_t len, ops.ooblen = len; ops.oobbuf = buf; ops.datbuf = NULL; - ops.len = len; res = mtd->read_oob(mtd, offs & ~(mtd->writesize - 1), &ops); - *retlen = ops.retlen; + *retlen = ops.oobretlen; return res; } @@ -168,10 +167,9 @@ int nftl_write_oob(struct mtd_info *mtd, loff_t offs, size_t len, ops.ooblen = len; ops.oobbuf = buf; ops.datbuf = NULL; - ops.len = len; res = mtd->write_oob(mtd, offs & ~(mtd->writesize - 1), &ops); - *retlen = ops.retlen; + *retlen = ops.oobretlen; return res; } diff --git a/drivers/mtd/ssfdc.c b/drivers/mtd/ssfdc.c index 79d3bb6..e834cc1 100644 --- a/drivers/mtd/ssfdc.c +++ b/drivers/mtd/ssfdc.c @@ -172,13 +172,12 @@ static int read_raw_oob(struct mtd_info *mtd, loff_t offs, uint8_t *buf) ops.mode = MTD_OOB_RAW; ops.ooboffs = 0; - ops.ooblen = mtd->oobsize; - ops.len = OOB_SIZE; + ops.ooblen = OOB_SIZE; ops.oobbuf = buf; ops.datbuf = NULL; ret = mtd->read_oob(mtd, offs, &ops); - if (ret < 0 || ops.retlen != OOB_SIZE) + if (ret < 0 || ops.oobretlen != OOB_SIZE) return -1; return 0; -- cgit v1.1 From 998a43e72d20afa7566dad66fd866fe939a89c09 Mon Sep 17 00:00:00 2001 From: Randy Dunlap Date: Tue, 28 Nov 2006 23:40:46 +0000 Subject: [MTD] Fix printk format warning in physmap. (resources again) Fix printk format warning: drivers/mtd/maps/physmap.c:93: warning: long long unsigned int format, long unsigned int arg (arg 2) Signed-off-by: Randy Dunlap Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/maps/physmap.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/physmap.c b/drivers/mtd/maps/physmap.c index d171776..bb67c50 100644 --- a/drivers/mtd/maps/physmap.c +++ b/drivers/mtd/maps/physmap.c @@ -89,7 +89,7 @@ static int physmap_flash_probe(struct platform_device *dev) return -ENODEV; printk(KERN_NOTICE "physmap platform flash device: %.8llx at %.8llx\n", - (unsigned long long)dev->resource->end - dev->resource->start + 1, + (unsigned long long)(dev->resource->end - dev->resource->start + 1), (unsigned long long)dev->resource->start); info = kmalloc(sizeof(struct physmap_flash_info), GFP_KERNEL); -- cgit v1.1 From 95b93a0cd46682c6d9e8eea803fda510cb6b863a Mon Sep 17 00:00:00 2001 From: Burman Yan Date: Wed, 15 Nov 2006 21:10:29 +0200 Subject: [MTD] replace kmalloc+memset with kzalloc Signed-off-by: Yan Burman Signed-off-by: David Woodhouse --- drivers/mtd/afs.c | 3 +-- drivers/mtd/chips/amd_flash.c | 3 +-- drivers/mtd/chips/cfi_cmdset_0001.c | 3 +-- drivers/mtd/chips/cfi_cmdset_0002.c | 3 +-- drivers/mtd/chips/cfi_cmdset_0020.c | 3 +-- drivers/mtd/chips/gen_probe.c | 3 +-- drivers/mtd/chips/jedec.c | 3 +-- drivers/mtd/chips/map_absent.c | 4 +--- drivers/mtd/chips/map_ram.c | 4 +--- drivers/mtd/chips/map_rom.c | 4 +--- drivers/mtd/chips/sharp.c | 7 ++----- drivers/mtd/cmdlinepart.c | 3 +-- drivers/mtd/devices/block2mtd.c | 3 +-- drivers/mtd/devices/ms02-nv.c | 18 ++++++------------ drivers/mtd/devices/phram.c | 4 +--- drivers/mtd/devices/slram.c | 7 ++----- drivers/mtd/ftl.c | 4 +--- drivers/mtd/inftlcore.c | 3 +-- drivers/mtd/maps/ceiva.c | 3 +-- drivers/mtd/maps/integrator-flash.c | 4 +--- drivers/mtd/maps/omap_nor.c | 4 +--- drivers/mtd/maps/pcmciamtd.c | 3 +-- drivers/mtd/maps/physmap.c | 3 +-- drivers/mtd/maps/plat-ram.c | 3 +-- drivers/mtd/maps/sa1100-flash.c | 4 +--- drivers/mtd/maps/tqm834x.c | 8 ++------ drivers/mtd/maps/tqm8xxl.c | 3 +-- drivers/mtd/mtd_blkdevs.c | 4 +--- drivers/mtd/mtdblock.c | 7 ++----- drivers/mtd/mtdblock_ro.c | 4 +--- drivers/mtd/mtdchar.c | 3 +-- drivers/mtd/mtdconcat.c | 3 +-- drivers/mtd/mtdpart.c | 3 +-- drivers/mtd/nand/diskonchip.c | 3 +-- drivers/mtd/nand/nand_bbt.c | 6 ++---- drivers/mtd/nand/nandsim.c | 4 +--- drivers/mtd/nftlcore.c | 3 +-- drivers/mtd/onenand/generic.c | 4 +--- drivers/mtd/onenand/onenand_bbt.c | 10 +++------- drivers/mtd/redboot.c | 4 +--- 40 files changed, 52 insertions(+), 123 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/afs.c b/drivers/mtd/afs.c index 6a45be0..52d51eb 100644 --- a/drivers/mtd/afs.c +++ b/drivers/mtd/afs.c @@ -207,11 +207,10 @@ static int parse_afs_partitions(struct mtd_info *mtd, if (!sz) return ret; - parts = kmalloc(sz, GFP_KERNEL); + parts = kzalloc(sz, GFP_KERNEL); if (!parts) return -ENOMEM; - memset(parts, 0, sz); str = (char *)(parts + idx); /* diff --git a/drivers/mtd/chips/amd_flash.c b/drivers/mtd/chips/amd_flash.c index 16eaca6..e7999f1 100644 --- a/drivers/mtd/chips/amd_flash.c +++ b/drivers/mtd/chips/amd_flash.c @@ -643,13 +643,12 @@ static struct mtd_info *amd_flash_probe(struct map_info *map) int reg_idx; int offset; - mtd = (struct mtd_info*)kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) { printk(KERN_WARNING "%s: kmalloc failed for info structure\n", map->name); return NULL; } - memset(mtd, 0, sizeof(*mtd)); mtd->priv = map; memset(&temp, 0, sizeof(temp)); diff --git a/drivers/mtd/chips/cfi_cmdset_0001.c b/drivers/mtd/chips/cfi_cmdset_0001.c index e249736..11de545 100644 --- a/drivers/mtd/chips/cfi_cmdset_0001.c +++ b/drivers/mtd/chips/cfi_cmdset_0001.c @@ -337,12 +337,11 @@ struct mtd_info *cfi_cmdset_0001(struct map_info *map, int primary) struct mtd_info *mtd; int i; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) { printk(KERN_ERR "Failed to allocate memory for MTD device\n"); return NULL; } - memset(mtd, 0, sizeof(*mtd)); mtd->priv = map; mtd->type = MTD_NORFLASH; diff --git a/drivers/mtd/chips/cfi_cmdset_0002.c b/drivers/mtd/chips/cfi_cmdset_0002.c index ca0882b..e3acd39 100644 --- a/drivers/mtd/chips/cfi_cmdset_0002.c +++ b/drivers/mtd/chips/cfi_cmdset_0002.c @@ -257,12 +257,11 @@ struct mtd_info *cfi_cmdset_0002(struct map_info *map, int primary) struct mtd_info *mtd; int i; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) { printk(KERN_WARNING "Failed to allocate memory for MTD device\n"); return NULL; } - memset(mtd, 0, sizeof(*mtd)); mtd->priv = map; mtd->type = MTD_NORFLASH; diff --git a/drivers/mtd/chips/cfi_cmdset_0020.c b/drivers/mtd/chips/cfi_cmdset_0020.c index fae70a5..d56849f 100644 --- a/drivers/mtd/chips/cfi_cmdset_0020.c +++ b/drivers/mtd/chips/cfi_cmdset_0020.c @@ -172,7 +172,7 @@ static struct mtd_info *cfi_staa_setup(struct map_info *map) int i,j; unsigned long devsize = (1<cfiq->DevSize) * cfi->interleave; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); //printk(KERN_DEBUG "number of CFI chips: %d\n", cfi->numchips); if (!mtd) { @@ -181,7 +181,6 @@ static struct mtd_info *cfi_staa_setup(struct map_info *map) return NULL; } - memset(mtd, 0, sizeof(*mtd)); mtd->priv = map; mtd->type = MTD_NORFLASH; mtd->size = devsize * cfi->numchips; diff --git a/drivers/mtd/chips/gen_probe.c b/drivers/mtd/chips/gen_probe.c index cdb0f59..77843d5 100644 --- a/drivers/mtd/chips/gen_probe.c +++ b/drivers/mtd/chips/gen_probe.c @@ -113,13 +113,12 @@ static struct cfi_private *genprobe_ident_chips(struct map_info *map, struct chi } mapsize = (max_chips + BITS_PER_LONG-1) / BITS_PER_LONG; - chip_map = kmalloc(mapsize, GFP_KERNEL); + chip_map = kzalloc(mapsize, GFP_KERNEL); if (!chip_map) { printk(KERN_WARNING "%s: kmalloc failed for CFI chip map\n", map->name); kfree(cfi.cfiq); return NULL; } - memset (chip_map, 0, mapsize); set_bit(0, chip_map); /* Mark first chip valid */ diff --git a/drivers/mtd/chips/jedec.c b/drivers/mtd/chips/jedec.c index 2c3f019..14e57b2 100644 --- a/drivers/mtd/chips/jedec.c +++ b/drivers/mtd/chips/jedec.c @@ -116,11 +116,10 @@ static struct mtd_info *jedec_probe(struct map_info *map) char Part[200]; memset(&priv,0,sizeof(priv)); - MTD = kmalloc(sizeof(struct mtd_info) + sizeof(struct jedec_private), GFP_KERNEL); + MTD = kzalloc(sizeof(struct mtd_info) + sizeof(struct jedec_private), GFP_KERNEL); if (!MTD) return NULL; - memset(MTD, 0, sizeof(struct mtd_info) + sizeof(struct jedec_private)); priv = (struct jedec_private *)&MTD[1]; my_bank_size = map->size; diff --git a/drivers/mtd/chips/map_absent.c b/drivers/mtd/chips/map_absent.c index ac01a94..fc478c0 100644 --- a/drivers/mtd/chips/map_absent.c +++ b/drivers/mtd/chips/map_absent.c @@ -47,13 +47,11 @@ static struct mtd_info *map_absent_probe(struct map_info *map) { struct mtd_info *mtd; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) { return NULL; } - memset(mtd, 0, sizeof(*mtd)); - map->fldrv = &map_absent_chipdrv; mtd->priv = map; mtd->name = map->name; diff --git a/drivers/mtd/chips/map_ram.c b/drivers/mtd/chips/map_ram.c index 3a66680..5cb6d52 100644 --- a/drivers/mtd/chips/map_ram.c +++ b/drivers/mtd/chips/map_ram.c @@ -55,12 +55,10 @@ static struct mtd_info *map_ram_probe(struct map_info *map) #endif /* OK. It seems to be RAM. */ - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) return NULL; - memset(mtd, 0, sizeof(*mtd)); - map->fldrv = &mapram_chipdrv; mtd->priv = map; mtd->name = map->name; diff --git a/drivers/mtd/chips/map_rom.c b/drivers/mtd/chips/map_rom.c index 1b328b1..cb27f85 100644 --- a/drivers/mtd/chips/map_rom.c +++ b/drivers/mtd/chips/map_rom.c @@ -31,12 +31,10 @@ static struct mtd_info *map_rom_probe(struct map_info *map) { struct mtd_info *mtd; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) return NULL; - memset(mtd, 0, sizeof(*mtd)); - map->fldrv = &maprom_chipdrv; mtd->priv = map; mtd->name = map->name; diff --git a/drivers/mtd/chips/sharp.c b/drivers/mtd/chips/sharp.c index 967abbe..c9cd3d2 100644 --- a/drivers/mtd/chips/sharp.c +++ b/drivers/mtd/chips/sharp.c @@ -112,18 +112,16 @@ static struct mtd_info *sharp_probe(struct map_info *map) struct sharp_info *sharp = NULL; int width; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if(!mtd) return NULL; - sharp = kmalloc(sizeof(*sharp), GFP_KERNEL); + sharp = kzalloc(sizeof(*sharp), GFP_KERNEL); if(!sharp) { kfree(mtd); return NULL; } - memset(mtd, 0, sizeof(*mtd)); - width = sharp_probe_map(map,mtd); if(!width){ kfree(mtd); @@ -143,7 +141,6 @@ static struct mtd_info *sharp_probe(struct map_info *map) mtd->writesize = 1; mtd->name = map->name; - memset(sharp, 0, sizeof(*sharp)); sharp->chipshift = 23; sharp->numchips = 1; sharp->chips[0].start = 0; diff --git a/drivers/mtd/cmdlinepart.c b/drivers/mtd/cmdlinepart.c index 3402ce4..23fab14 100644 --- a/drivers/mtd/cmdlinepart.c +++ b/drivers/mtd/cmdlinepart.c @@ -163,13 +163,12 @@ static struct mtd_partition * newpart(char *s, *num_parts = this_part + 1; alloc_size = *num_parts * sizeof(struct mtd_partition) + extra_mem_size; - parts = kmalloc(alloc_size, GFP_KERNEL); + parts = kzalloc(alloc_size, GFP_KERNEL); if (!parts) { printk(KERN_ERR ERRP "out of memory\n"); return NULL; } - memset(parts, 0, alloc_size); extra_mem = (unsigned char *)(parts + *num_parts); } /* enter this partition (offset will be calculated later if it is zero at this point) */ diff --git a/drivers/mtd/devices/block2mtd.c b/drivers/mtd/devices/block2mtd.c index 401c6a2..6d917a4 100644 --- a/drivers/mtd/devices/block2mtd.c +++ b/drivers/mtd/devices/block2mtd.c @@ -295,10 +295,9 @@ static struct block2mtd_dev *add_device(char *devname, int erase_size) if (!devname) return NULL; - dev = kmalloc(sizeof(struct block2mtd_dev), GFP_KERNEL); + dev = kzalloc(sizeof(struct block2mtd_dev), GFP_KERNEL); if (!dev) return NULL; - memset(dev, 0, sizeof(*dev)); /* Get a handle on the device */ bdev = open_bdev_excl(devname, O_RDWR, NULL); diff --git a/drivers/mtd/devices/ms02-nv.c b/drivers/mtd/devices/ms02-nv.c index 08dfb89..9cff119 100644 --- a/drivers/mtd/devices/ms02-nv.c +++ b/drivers/mtd/devices/ms02-nv.c @@ -131,11 +131,10 @@ static int __init ms02nv_init_one(ulong addr) int ret = -ENODEV; /* The module decodes 8MiB of address space. */ - mod_res = kmalloc(sizeof(*mod_res), GFP_KERNEL); + mod_res = kzalloc(sizeof(*mod_res), GFP_KERNEL); if (!mod_res) return -ENOMEM; - memset(mod_res, 0, sizeof(*mod_res)); mod_res->name = ms02nv_name; mod_res->start = addr; mod_res->end = addr + MS02NV_SLOT_SIZE - 1; @@ -153,24 +152,21 @@ static int __init ms02nv_init_one(ulong addr) } ret = -ENOMEM; - mtd = kmalloc(sizeof(*mtd), GFP_KERNEL); + mtd = kzalloc(sizeof(*mtd), GFP_KERNEL); if (!mtd) goto err_out_mod_res_rel; - memset(mtd, 0, sizeof(*mtd)); - mp = kmalloc(sizeof(*mp), GFP_KERNEL); + mp = kzalloc(sizeof(*mp), GFP_KERNEL); if (!mp) goto err_out_mtd; - memset(mp, 0, sizeof(*mp)); mtd->priv = mp; mp->resource.module = mod_res; /* Firmware's diagnostic NVRAM area. */ - diag_res = kmalloc(sizeof(*diag_res), GFP_KERNEL); + diag_res = kzalloc(sizeof(*diag_res), GFP_KERNEL); if (!diag_res) goto err_out_mp; - memset(diag_res, 0, sizeof(*diag_res)); diag_res->name = ms02nv_res_diag_ram; diag_res->start = addr; diag_res->end = addr + MS02NV_RAM - 1; @@ -180,11 +176,10 @@ static int __init ms02nv_init_one(ulong addr) mp->resource.diag_ram = diag_res; /* User-available general-purpose NVRAM area. */ - user_res = kmalloc(sizeof(*user_res), GFP_KERNEL); + user_res = kzalloc(sizeof(*user_res), GFP_KERNEL); if (!user_res) goto err_out_diag_res; - memset(user_res, 0, sizeof(*user_res)); user_res->name = ms02nv_res_user_ram; user_res->start = addr + MS02NV_RAM; user_res->end = addr + size - 1; @@ -194,11 +189,10 @@ static int __init ms02nv_init_one(ulong addr) mp->resource.user_ram = user_res; /* Control and status register. */ - csr_res = kmalloc(sizeof(*csr_res), GFP_KERNEL); + csr_res = kzalloc(sizeof(*csr_res), GFP_KERNEL); if (!csr_res) goto err_out_user_res; - memset(csr_res, 0, sizeof(*csr_res)); csr_res->name = ms02nv_res_csr; csr_res->start = addr + MS02NV_CSR; csr_res->end = addr + MS02NV_CSR + 3; diff --git a/drivers/mtd/devices/phram.c b/drivers/mtd/devices/phram.c index 6c7337f..56cc1ca 100644 --- a/drivers/mtd/devices/phram.c +++ b/drivers/mtd/devices/phram.c @@ -126,12 +126,10 @@ static int register_device(char *name, unsigned long start, unsigned long len) struct phram_mtd_list *new; int ret = -ENOMEM; - new = kmalloc(sizeof(*new), GFP_KERNEL); + new = kzalloc(sizeof(*new), GFP_KERNEL); if (!new) goto out0; - memset(new, 0, sizeof(*new)); - ret = -EIO; new->mtd.priv = ioremap(start, len); if (!new->mtd.priv) { diff --git a/drivers/mtd/devices/slram.c b/drivers/mtd/devices/slram.c index 542a0c0..5f49248 100644 --- a/drivers/mtd/devices/slram.c +++ b/drivers/mtd/devices/slram.c @@ -168,19 +168,16 @@ static int register_device(char *name, unsigned long start, unsigned long length E("slram: Cannot allocate new MTD device.\n"); return(-ENOMEM); } - (*curmtd)->mtdinfo = kmalloc(sizeof(struct mtd_info), GFP_KERNEL); + (*curmtd)->mtdinfo = kzalloc(sizeof(struct mtd_info), GFP_KERNEL); (*curmtd)->next = NULL; if ((*curmtd)->mtdinfo) { - memset((char *)(*curmtd)->mtdinfo, 0, sizeof(struct mtd_info)); (*curmtd)->mtdinfo->priv = - kmalloc(sizeof(slram_priv_t), GFP_KERNEL); + kzalloc(sizeof(slram_priv_t), GFP_KERNEL); if (!(*curmtd)->mtdinfo->priv) { kfree((*curmtd)->mtdinfo); (*curmtd)->mtdinfo = NULL; - } else { - memset((*curmtd)->mtdinfo->priv,0,sizeof(slram_priv_t)); } } diff --git a/drivers/mtd/ftl.c b/drivers/mtd/ftl.c index da39355..24235d4 100644 --- a/drivers/mtd/ftl.c +++ b/drivers/mtd/ftl.c @@ -1033,7 +1033,7 @@ static void ftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) { partition_t *partition; - partition = kmalloc(sizeof(partition_t), GFP_KERNEL); + partition = kzalloc(sizeof(partition_t), GFP_KERNEL); if (!partition) { printk(KERN_WARNING "No memory to scan for FTL on %s\n", @@ -1041,8 +1041,6 @@ static void ftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) return; } - memset(partition, 0, sizeof(partition_t)); - partition->mbd.mtd = mtd; if ((scan_header(partition) == 0) && diff --git a/drivers/mtd/inftlcore.c b/drivers/mtd/inftlcore.c index d2f54c0..b0e3965 100644 --- a/drivers/mtd/inftlcore.c +++ b/drivers/mtd/inftlcore.c @@ -67,13 +67,12 @@ static void inftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) DEBUG(MTD_DEBUG_LEVEL3, "INFTL: add_mtd for %s\n", mtd->name); - inftl = kmalloc(sizeof(*inftl), GFP_KERNEL); + inftl = kzalloc(sizeof(*inftl), GFP_KERNEL); if (!inftl) { printk(KERN_WARNING "INFTL: Out of memory for data structures\n"); return; } - memset(inftl, 0, sizeof(*inftl)); inftl->mbd.mtd = mtd; inftl->mbd.devnum = -1; diff --git a/drivers/mtd/maps/ceiva.c b/drivers/mtd/maps/ceiva.c index 0402c21..629e6e2 100644 --- a/drivers/mtd/maps/ceiva.c +++ b/drivers/mtd/maps/ceiva.c @@ -122,10 +122,9 @@ static int __init clps_setup_mtd(struct clps_info *clps, int nr, struct mtd_info /* * Allocate the map_info structs in one go. */ - maps = kmalloc(sizeof(struct map_info) * nr, GFP_KERNEL); + maps = kzalloc(sizeof(struct map_info) * nr, GFP_KERNEL); if (!maps) return -ENOMEM; - memset(maps, 0, sizeof(struct map_info) * nr); /* * Claim and then map the memory regions. */ diff --git a/drivers/mtd/maps/integrator-flash.c b/drivers/mtd/maps/integrator-flash.c index c8db01b..6946d80 100644 --- a/drivers/mtd/maps/integrator-flash.c +++ b/drivers/mtd/maps/integrator-flash.c @@ -75,14 +75,12 @@ static int armflash_probe(struct platform_device *dev) int err; void __iomem *base; - info = kmalloc(sizeof(struct armflash_info), GFP_KERNEL); + info = kzalloc(sizeof(struct armflash_info), GFP_KERNEL); if (!info) { err = -ENOMEM; goto out; } - memset(info, 0, sizeof(struct armflash_info)); - info->plat = plat; if (plat && plat->init) { err = plat->init(); diff --git a/drivers/mtd/maps/omap_nor.c b/drivers/mtd/maps/omap_nor.c index 418afff..e8d9ae5 100644 --- a/drivers/mtd/maps/omap_nor.c +++ b/drivers/mtd/maps/omap_nor.c @@ -78,12 +78,10 @@ static int __devinit omapflash_probe(struct platform_device *pdev) struct resource *res = pdev->resource; unsigned long size = res->end - res->start + 1; - info = kmalloc(sizeof(struct omapflash_info), GFP_KERNEL); + info = kzalloc(sizeof(struct omapflash_info), GFP_KERNEL); if (!info) return -ENOMEM; - memset(info, 0, sizeof(struct omapflash_info)); - if (!request_mem_region(res->start, size, "flash")) { err = -EBUSY; goto out_free_info; diff --git a/drivers/mtd/maps/pcmciamtd.c b/drivers/mtd/maps/pcmciamtd.c index 995347b..eaeb56a 100644 --- a/drivers/mtd/maps/pcmciamtd.c +++ b/drivers/mtd/maps/pcmciamtd.c @@ -735,11 +735,10 @@ static int pcmciamtd_probe(struct pcmcia_device *link) struct pcmciamtd_dev *dev; /* Create new memory card device */ - dev = kmalloc(sizeof(*dev), GFP_KERNEL); + dev = kzalloc(sizeof(*dev), GFP_KERNEL); if (!dev) return -ENOMEM; DEBUG(1, "dev=0x%p", dev); - memset(dev, 0, sizeof(*dev)); dev->p_dev = link; link->priv = dev; diff --git a/drivers/mtd/maps/physmap.c b/drivers/mtd/maps/physmap.c index bb67c50..28c5ffd 100644 --- a/drivers/mtd/maps/physmap.c +++ b/drivers/mtd/maps/physmap.c @@ -92,12 +92,11 @@ static int physmap_flash_probe(struct platform_device *dev) (unsigned long long)(dev->resource->end - dev->resource->start + 1), (unsigned long long)dev->resource->start); - info = kmalloc(sizeof(struct physmap_flash_info), GFP_KERNEL); + info = kzalloc(sizeof(struct physmap_flash_info), GFP_KERNEL); if (info == NULL) { err = -ENOMEM; goto err_out; } - memset(info, 0, sizeof(*info)); platform_set_drvdata(dev, info); diff --git a/drivers/mtd/maps/plat-ram.c b/drivers/mtd/maps/plat-ram.c index 5d3c754..2b6504e 100644 --- a/drivers/mtd/maps/plat-ram.c +++ b/drivers/mtd/maps/plat-ram.c @@ -147,14 +147,13 @@ static int platram_probe(struct platform_device *pdev) pdata = pdev->dev.platform_data; - info = kmalloc(sizeof(*info), GFP_KERNEL); + info = kzalloc(sizeof(*info), GFP_KERNEL); if (info == NULL) { dev_err(&pdev->dev, "no memory for flash info\n"); err = -ENOMEM; goto exit_error; } - memset(info, 0, sizeof(*info)); platform_set_drvdata(pdev, info); info->dev = &pdev->dev; diff --git a/drivers/mtd/maps/sa1100-flash.c b/drivers/mtd/maps/sa1100-flash.c index 950bf1c..f904e6b 100644 --- a/drivers/mtd/maps/sa1100-flash.c +++ b/drivers/mtd/maps/sa1100-flash.c @@ -273,14 +273,12 @@ sa1100_setup_mtd(struct platform_device *pdev, struct flash_platform_data *plat) /* * Allocate the map_info structs in one go. */ - info = kmalloc(size, GFP_KERNEL); + info = kzalloc(size, GFP_KERNEL); if (!info) { ret = -ENOMEM; goto out; } - memset(info, 0, size); - if (plat->init) { ret = plat->init(); if (ret) diff --git a/drivers/mtd/maps/tqm834x.c b/drivers/mtd/maps/tqm834x.c index 58e5912..9adc970 100644 --- a/drivers/mtd/maps/tqm834x.c +++ b/drivers/mtd/maps/tqm834x.c @@ -132,20 +132,16 @@ static int __init init_tqm834x_mtd(void) pr_debug("%s: chip probing count %d\n", __FUNCTION__, idx); - map_banks[idx] = - (struct map_info *)kmalloc(sizeof(struct map_info), - GFP_KERNEL); + map_banks[idx] = kzalloc(sizeof(struct map_info), GFP_KERNEL); if (map_banks[idx] == NULL) { ret = -ENOMEM; goto error_mem; } - memset((void *)map_banks[idx], 0, sizeof(struct map_info)); - map_banks[idx]->name = (char *)kmalloc(16, GFP_KERNEL); + map_banks[idx]->name = kzalloc(16, GFP_KERNEL); if (map_banks[idx]->name == NULL) { ret = -ENOMEM; goto error_mem; } - memset((void *)map_banks[idx]->name, 0, 16); sprintf(map_banks[idx]->name, "TQM834x-%d", idx); map_banks[idx]->size = flash_size; diff --git a/drivers/mtd/maps/tqm8xxl.c b/drivers/mtd/maps/tqm8xxl.c index 19578ba..37e4ded 100644 --- a/drivers/mtd/maps/tqm8xxl.c +++ b/drivers/mtd/maps/tqm8xxl.c @@ -134,14 +134,13 @@ int __init init_tqm_mtd(void) printk(KERN_INFO "%s: chip probing count %d\n", __FUNCTION__, idx); - map_banks[idx] = (struct map_info *)kmalloc(sizeof(struct map_info), GFP_KERNEL); + map_banks[idx] = kzalloc(sizeof(struct map_info), GFP_KERNEL); if(map_banks[idx] == NULL) { ret = -ENOMEM; /* FIXME: What if some MTD devices were probed already? */ goto error_mem; } - memset((void *)map_banks[idx], 0, sizeof(struct map_info)); map_banks[idx]->name = (char *)kmalloc(16, GFP_KERNEL); if (!map_banks[idx]->name) { diff --git a/drivers/mtd/mtd_blkdevs.c b/drivers/mtd/mtd_blkdevs.c index b5d62cb..b879a66 100644 --- a/drivers/mtd/mtd_blkdevs.c +++ b/drivers/mtd/mtd_blkdevs.c @@ -373,12 +373,10 @@ int register_mtd_blktrans(struct mtd_blktrans_ops *tr) if (!blktrans_notifier.list.next) register_mtd_user(&blktrans_notifier); - tr->blkcore_priv = kmalloc(sizeof(*tr->blkcore_priv), GFP_KERNEL); + tr->blkcore_priv = kzalloc(sizeof(*tr->blkcore_priv), GFP_KERNEL); if (!tr->blkcore_priv) return -ENOMEM; - memset(tr->blkcore_priv, 0, sizeof(*tr->blkcore_priv)); - mutex_lock(&mtd_table_mutex); ret = register_blkdev(tr->major, tr->name); diff --git a/drivers/mtd/mtdblock.c b/drivers/mtd/mtdblock.c index a052648..952da30 100644 --- a/drivers/mtd/mtdblock.c +++ b/drivers/mtd/mtdblock.c @@ -278,11 +278,10 @@ static int mtdblock_open(struct mtd_blktrans_dev *mbd) } /* OK, it's not open. Create cache info for it */ - mtdblk = kmalloc(sizeof(struct mtdblk_dev), GFP_KERNEL); + mtdblk = kzalloc(sizeof(struct mtdblk_dev), GFP_KERNEL); if (!mtdblk) return -ENOMEM; - memset(mtdblk, 0, sizeof(*mtdblk)); mtdblk->count = 1; mtdblk->mtd = mtd; @@ -339,13 +338,11 @@ static int mtdblock_flush(struct mtd_blktrans_dev *dev) static void mtdblock_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) { - struct mtd_blktrans_dev *dev = kmalloc(sizeof(*dev), GFP_KERNEL); + struct mtd_blktrans_dev *dev = kzalloc(sizeof(*dev), GFP_KERNEL); if (!dev) return; - memset(dev, 0, sizeof(*dev)); - dev->mtd = mtd; dev->devnum = mtd->index; diff --git a/drivers/mtd/mtdblock_ro.c b/drivers/mtd/mtdblock_ro.c index 642ccc6..f79dbb4 100644 --- a/drivers/mtd/mtdblock_ro.c +++ b/drivers/mtd/mtdblock_ro.c @@ -33,13 +33,11 @@ static int mtdblock_writesect(struct mtd_blktrans_dev *dev, static void mtdblock_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) { - struct mtd_blktrans_dev *dev = kmalloc(sizeof(*dev), GFP_KERNEL); + struct mtd_blktrans_dev *dev = kzalloc(sizeof(*dev), GFP_KERNEL); if (!dev) return; - memset(dev, 0, sizeof(*dev)); - dev->mtd = mtd; dev->devnum = mtd->index; diff --git a/drivers/mtd/mtdchar.c b/drivers/mtd/mtdchar.c index 07618f5..7c4adc6 100644 --- a/drivers/mtd/mtdchar.c +++ b/drivers/mtd/mtdchar.c @@ -431,7 +431,7 @@ static int mtd_ioctl(struct inode *inode, struct file *file, if(!(file->f_mode & 2)) return -EPERM; - erase=kmalloc(sizeof(struct erase_info),GFP_KERNEL); + erase=kzalloc(sizeof(struct erase_info),GFP_KERNEL); if (!erase) ret = -ENOMEM; else { @@ -440,7 +440,6 @@ static int mtd_ioctl(struct inode *inode, struct file *file, init_waitqueue_head(&waitq); - memset (erase,0,sizeof(struct erase_info)); if (copy_from_user(&erase->addr, argp, sizeof(struct erase_info_user))) { kfree(erase); diff --git a/drivers/mtd/mtdconcat.c b/drivers/mtd/mtdconcat.c index cf927a8..ec51483 100644 --- a/drivers/mtd/mtdconcat.c +++ b/drivers/mtd/mtdconcat.c @@ -708,14 +708,13 @@ struct mtd_info *mtd_concat_create(struct mtd_info *subdev[], /* subdevices to c /* allocate the device structure */ size = SIZEOF_STRUCT_MTD_CONCAT(num_devs); - concat = kmalloc(size, GFP_KERNEL); + concat = kzalloc(size, GFP_KERNEL); if (!concat) { printk ("memory allocation error while creating concatenated device \"%s\"\n", name); return NULL; } - memset(concat, 0, size); concat->subdev = (struct mtd_info **) (concat + 1); /* diff --git a/drivers/mtd/mtdpart.c b/drivers/mtd/mtdpart.c index a20f75f..89692f8 100644 --- a/drivers/mtd/mtdpart.c +++ b/drivers/mtd/mtdpart.c @@ -323,14 +323,13 @@ int add_mtd_partitions(struct mtd_info *master, for (i = 0; i < nbparts; i++) { /* allocate the partition structure */ - slave = kmalloc (sizeof(*slave), GFP_KERNEL); + slave = kzalloc (sizeof(*slave), GFP_KERNEL); if (!slave) { printk ("memory allocation error while creating partitions for \"%s\"\n", master->name); del_mtd_partitions(master); return -ENOMEM; } - memset(slave, 0, sizeof(*slave)); list_add(&slave->list, &mtd_partitions); /* set up the MTD object for this partition */ diff --git a/drivers/mtd/nand/diskonchip.c b/drivers/mtd/nand/diskonchip.c index 6107f53..12608c1 100644 --- a/drivers/mtd/nand/diskonchip.c +++ b/drivers/mtd/nand/diskonchip.c @@ -1635,13 +1635,12 @@ static int __init doc_probe(unsigned long physadr) len = sizeof(struct mtd_info) + sizeof(struct nand_chip) + sizeof(struct doc_priv) + (2 * sizeof(struct nand_bbt_descr)); - mtd = kmalloc(len, GFP_KERNEL); + mtd = kzalloc(len, GFP_KERNEL); if (!mtd) { printk(KERN_ERR "DiskOnChip kmalloc (%d bytes) failed!\n", len); ret = -ENOMEM; goto fail; } - memset(mtd, 0, len); nand = (struct nand_chip *) (mtd + 1); doc = (struct doc_priv *) (nand + 1); diff --git a/drivers/mtd/nand/nand_bbt.c b/drivers/mtd/nand/nand_bbt.c index 4e74fe9..5e121ce 100644 --- a/drivers/mtd/nand/nand_bbt.c +++ b/drivers/mtd/nand/nand_bbt.c @@ -960,14 +960,12 @@ int nand_scan_bbt(struct mtd_info *mtd, struct nand_bbt_descr *bd) struct nand_bbt_descr *md = this->bbt_md; len = mtd->size >> (this->bbt_erase_shift + 2); - /* Allocate memory (2bit per block) */ - this->bbt = kmalloc(len, GFP_KERNEL); + /* Allocate memory (2bit per block) and clear the memory bad block table */ + this->bbt = kzalloc(len, GFP_KERNEL); if (!this->bbt) { printk(KERN_ERR "nand_scan_bbt: Out of memory\n"); return -ENOMEM; } - /* Clear the memory bad block table */ - memset(this->bbt, 0x00, len); /* If no primary table decriptor is given, scan the device * to build a memory based bad block table diff --git a/drivers/mtd/nand/nandsim.c b/drivers/mtd/nand/nandsim.c index abebcab..3d39451 100644 --- a/drivers/mtd/nand/nandsim.c +++ b/drivers/mtd/nand/nandsim.c @@ -1511,14 +1511,12 @@ static int __init ns_init_module(void) } /* Allocate and initialize mtd_info, nand_chip and nandsim structures */ - nsmtd = kmalloc(sizeof(struct mtd_info) + sizeof(struct nand_chip) + nsmtd = kzalloc(sizeof(struct mtd_info) + sizeof(struct nand_chip) + sizeof(struct nandsim), GFP_KERNEL); if (!nsmtd) { NS_ERR("unable to allocate core structures.\n"); return -ENOMEM; } - memset(nsmtd, 0, sizeof(struct mtd_info) + sizeof(struct nand_chip) + - sizeof(struct nandsim)); chip = (struct nand_chip *)(nsmtd + 1); nsmtd->priv = (void *)chip; nand = (struct nandsim *)(chip + 1); diff --git a/drivers/mtd/nftlcore.c b/drivers/mtd/nftlcore.c index f4d3854..4b1ba4f 100644 --- a/drivers/mtd/nftlcore.c +++ b/drivers/mtd/nftlcore.c @@ -57,13 +57,12 @@ static void nftl_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) DEBUG(MTD_DEBUG_LEVEL1, "NFTL: add_mtd for %s\n", mtd->name); - nftl = kmalloc(sizeof(struct NFTLrecord), GFP_KERNEL); + nftl = kzalloc(sizeof(struct NFTLrecord), GFP_KERNEL); if (!nftl) { printk(KERN_WARNING "NFTL: out of memory for data structures\n"); return; } - memset(nftl, 0, sizeof(*nftl)); nftl->mbd.mtd = mtd; nftl->mbd.devnum = -1; diff --git a/drivers/mtd/onenand/generic.c b/drivers/mtd/onenand/generic.c index af06a80..53eb563 100644 --- a/drivers/mtd/onenand/generic.c +++ b/drivers/mtd/onenand/generic.c @@ -45,12 +45,10 @@ static int __devinit generic_onenand_probe(struct device *dev) unsigned long size = res->end - res->start + 1; int err; - info = kmalloc(sizeof(struct onenand_info), GFP_KERNEL); + info = kzalloc(sizeof(struct onenand_info), GFP_KERNEL); if (!info) return -ENOMEM; - memset(info, 0, sizeof(struct onenand_info)); - if (!request_mem_region(res->start, size, dev->driver->name)) { err = -EBUSY; goto out_free_info; diff --git a/drivers/mtd/onenand/onenand_bbt.c b/drivers/mtd/onenand/onenand_bbt.c index 1b00dac..e3822c1 100644 --- a/drivers/mtd/onenand/onenand_bbt.c +++ b/drivers/mtd/onenand/onenand_bbt.c @@ -177,14 +177,12 @@ int onenand_scan_bbt(struct mtd_info *mtd, struct nand_bbt_descr *bd) int len, ret = 0; len = mtd->size >> (this->erase_shift + 2); - /* Allocate memory (2bit per block) */ - bbm->bbt = kmalloc(len, GFP_KERNEL); + /* Allocate memory (2bit per block) and clear the memory bad block table */ + bbm->bbt = kzalloc(len, GFP_KERNEL); if (!bbm->bbt) { printk(KERN_ERR "onenand_scan_bbt: Out of memory\n"); return -ENOMEM; } - /* Clear the memory bad block table */ - memset(bbm->bbt, 0x00, len); /* Set the bad block position */ bbm->badblockpos = ONENAND_BADBLOCK_POS; @@ -230,14 +228,12 @@ int onenand_default_bbt(struct mtd_info *mtd) struct onenand_chip *this = mtd->priv; struct bbm_info *bbm; - this->bbm = kmalloc(sizeof(struct bbm_info), GFP_KERNEL); + this->bbm = kzalloc(sizeof(struct bbm_info), GFP_KERNEL); if (!this->bbm) return -ENOMEM; bbm = this->bbm; - memset(bbm, 0, sizeof(struct bbm_info)); - /* 1KB page has same configuration as 2KB page */ if (!bbm->badblock_pattern) bbm->badblock_pattern = &largepage_memorybased; diff --git a/drivers/mtd/redboot.c b/drivers/mtd/redboot.c index 5b58523..4b27721 100644 --- a/drivers/mtd/redboot.c +++ b/drivers/mtd/redboot.c @@ -165,15 +165,13 @@ static int parse_redboot_partitions(struct mtd_info *master, } } #endif - parts = kmalloc(sizeof(*parts)*nrparts + nulllen + namelen, GFP_KERNEL); + parts = kzalloc(sizeof(*parts)*nrparts + nulllen + namelen, GFP_KERNEL); if (!parts) { ret = -ENOMEM; goto out; } - memset(parts, 0, sizeof(*parts)*nrparts + nulllen + namelen); - nullname = (char *)&parts[nrparts]; #ifdef CONFIG_MTD_REDBOOT_PARTS_UNALLOCATED if (nulllen > 0) { -- cgit v1.1 From 28bdd4a72d158083b7c7f56ec4ef5dfaf75d9464 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Wed, 29 Nov 2006 00:04:59 +0000 Subject: =?UTF-8?q?[MTD]=20[NAND]=20Update=20CAF=C3=89=20driver=20interrup?= =?UTF-8?q?t=20handler=20prototype?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Signed-off-by: David Woodhouse --- drivers/mtd/nand/cafe.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index fad304b..c0a5ec1 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -312,7 +312,7 @@ static void cafe_select_chip(struct mtd_info *mtd, int chipnr) // cafe_dev_dbg(&cafe->pdev->dev, "select_chip %d\n", chipnr); } -static int cafe_nand_interrupt(int irq, void *id, struct pt_regs *regs) +static int cafe_nand_interrupt(int irq, void *id) { struct mtd_info *mtd = id; struct cafe_priv *cafe = mtd->priv; -- cgit v1.1 From fc029194999a4563d356cdf728e0c44fb7a49105 Mon Sep 17 00:00:00 2001 From: Timo Lindhorst Date: Mon, 27 Nov 2006 13:35:49 +0100 Subject: [MTD] [NAND] fix ifdef option in nand_ecc.c Fix up the config option in the #ifdef statements in nand_ecc.c Signed-off-by: Timo Lindhorst Signed-off-by: David Woodhouse --- drivers/mtd/nand/nand_ecc.c | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nand_ecc.c b/drivers/mtd/nand/nand_ecc.c index dd438ca..fde593e 100644 --- a/drivers/mtd/nand/nand_ecc.c +++ b/drivers/mtd/nand/nand_ecc.c @@ -112,7 +112,7 @@ int nand_calculate_ecc(struct mtd_info *mtd, const u_char *dat, tmp2 |= (reg2 & 0x01) << 0; /* B7 -> B0 */ /* Calculate final ECC code */ -#ifdef CONFIG_NAND_ECC_SMC +#ifdef CONFIG_MTD_NAND_ECC_SMC ecc_code[0] = ~tmp2; ecc_code[1] = ~tmp1; #else @@ -148,7 +148,7 @@ int nand_correct_data(struct mtd_info *mtd, u_char *dat, { uint8_t s0, s1, s2; -#ifdef CONFIG_NAND_ECC_SMC +#ifdef CONFIG_MTD_NAND_ECC_SMC s0 = calc_ecc[0] ^ read_ecc[0]; s1 = calc_ecc[1] ^ read_ecc[1]; s2 = calc_ecc[2] ^ read_ecc[2]; -- cgit v1.1 From ce1060494a205d528aa72fea23bdae607396e621 Mon Sep 17 00:00:00 2001 From: Andrew Morton Date: Wed, 29 Nov 2006 00:19:14 +0000 Subject: [MTD] Tidy bitrev usage in rtc_from4.c Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/nand/rtc_from4.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/rtc_from4.c b/drivers/mtd/nand/rtc_from4.c index 4a83a7d..02deec3 100644 --- a/drivers/mtd/nand/rtc_from4.c +++ b/drivers/mtd/nand/rtc_from4.c @@ -357,7 +357,7 @@ static int rtc_from4_correct_data(struct mtd_info *mtd, const u_char *buf, u_cha /* Read the syndrom pattern from the FPGA and correct the bitorder */ rs_ecc = (volatile unsigned short *)(rtc_from4_fio_base + RTC_FROM4_RS_ECC); for (i = 0; i < 8; i++) { - ecc[i] = byte_rev_table[(*rs_ecc) & 0xFF]; + ecc[i] = bitrev8(*rs_ecc); rs_ecc++; } -- cgit v1.1 From eb6cf7bb71baa109041c04357b930a0c0bfa0db7 Mon Sep 17 00:00:00 2001 From: Yoichi Yuasa Date: Wed, 25 Oct 2006 23:29:17 +0900 Subject: [MTD] fix map probe name for cstm_mips_ixx This patch has fixed name of map probe for cstm_mips_ixx.c Signed-off-by: Yoichi Yuasa Signed-off-by: Artem Bityutskiy --- drivers/mtd/maps/cstm_mips_ixx.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/cstm_mips_ixx.c b/drivers/mtd/maps/cstm_mips_ixx.c index d57eba2..2ef22a5 100644 --- a/drivers/mtd/maps/cstm_mips_ixx.c +++ b/drivers/mtd/maps/cstm_mips_ixx.c @@ -115,7 +115,7 @@ int __init init_cstm_mips_ixx(void) //printk(KERN_NOTICE "phymap %d cfi_probe: mymtd is %x\n",i,(unsigned int)mymtd); if (!mymtd) { jedec = 1; - mymtd = (struct mtd_info *)do_map_probe("jedec", &cstm_mips_ixx_map[i]); + mymtd = (struct mtd_info *)do_map_probe("jedec_probe", &cstm_mips_ixx_map[i]); printk(KERN_NOTICE "cstm_mips_ixx %d jedec: mymtd is %x\n",i,(unsigned int)mymtd); } if (mymtd) { -- cgit v1.1 From f6a7ecb18dabd88bd9f28e7bece564cabe8ffe82 Mon Sep 17 00:00:00 2001 From: Josh Boyer Date: Mon, 20 Nov 2006 20:15:36 -0600 Subject: [MTD] add MTD_BLKDEVS Kconfig option Add a MTD_BLKDEVS Kconfig option to cleanup the makefile a bit Signed-off-by: Josh Boyer Signed-off-by: Artem Bityutskiy --- drivers/mtd/Kconfig | 12 ++++++++++++ drivers/mtd/Makefile | 15 ++++++++------- 2 files changed, 20 insertions(+), 7 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/Kconfig b/drivers/mtd/Kconfig index 291660a..26f75c2 100644 --- a/drivers/mtd/Kconfig +++ b/drivers/mtd/Kconfig @@ -164,9 +164,15 @@ config MTD_CHAR memory chips, and also use ioctl() to obtain information about the device, or to erase parts of it. +config MTD_BLKDEVS + tristate "Common interface to block layer for MTD 'translation layers'" + depends on MTD && BLOCK + default n + config MTD_BLOCK tristate "Caching block device access to MTD devices" depends on MTD && BLOCK + select MTD_BLKDEVS ---help--- Although most flash chips have an erase size too large to be useful as block devices, it is possible to use MTD devices which are based @@ -189,6 +195,7 @@ config MTD_BLOCK config MTD_BLOCK_RO tristate "Readonly block device access to MTD devices" depends on MTD_BLOCK!=y && MTD && BLOCK + select MTD_BLKDEVS help This allows you to mount read-only file systems (such as cramfs) from an MTD device, without the overhead (and danger) of the caching @@ -200,6 +207,7 @@ config MTD_BLOCK_RO config FTL tristate "FTL (Flash Translation Layer) support" depends on MTD && BLOCK + select MTD_BLKDEVS ---help--- This provides support for the original Flash Translation Layer which is part of the PCMCIA specification. It uses a kind of pseudo- @@ -216,6 +224,7 @@ config FTL config NFTL tristate "NFTL (NAND Flash Translation Layer) support" depends on MTD && BLOCK + select MTD_BLKDEVS ---help--- This provides support for the NAND Flash Translation Layer which is used on M-Systems' DiskOnChip devices. It uses a kind of pseudo- @@ -239,6 +248,7 @@ config NFTL_RW config INFTL tristate "INFTL (Inverse NAND Flash Translation Layer) support" depends on MTD && BLOCK + select MTD_BLKDEVS ---help--- This provides support for the Inverse NAND Flash Translation Layer which is used on M-Systems' newer DiskOnChip devices. It @@ -256,6 +266,7 @@ config INFTL config RFD_FTL tristate "Resident Flash Disk (Flash Translation Layer) support" depends on MTD && BLOCK + select MTD_BLKDEVS ---help--- This provides support for the flash translation layer known as the Resident Flash Disk (RFD), as used by the Embedded BIOS @@ -266,6 +277,7 @@ config RFD_FTL config SSFDC tristate "NAND SSFDC (SmartMedia) read only translation layer" depends on MTD && BLOCK + select MTD_BLKDEVS help This enables read only access to SmartMedia formatted NAND flash. You can mount it with FAT file system. diff --git a/drivers/mtd/Makefile b/drivers/mtd/Makefile index 1e36b9a..c130e62 100644 --- a/drivers/mtd/Makefile +++ b/drivers/mtd/Makefile @@ -15,13 +15,14 @@ obj-$(CONFIG_MTD_AFS_PARTS) += afs.o # 'Users' - code which presents functionality to userspace. obj-$(CONFIG_MTD_CHAR) += mtdchar.o -obj-$(CONFIG_MTD_BLOCK) += mtdblock.o mtd_blkdevs.o -obj-$(CONFIG_MTD_BLOCK_RO) += mtdblock_ro.o mtd_blkdevs.o -obj-$(CONFIG_FTL) += ftl.o mtd_blkdevs.o -obj-$(CONFIG_NFTL) += nftl.o mtd_blkdevs.o -obj-$(CONFIG_INFTL) += inftl.o mtd_blkdevs.o -obj-$(CONFIG_RFD_FTL) += rfd_ftl.o mtd_blkdevs.o -obj-$(CONFIG_SSFDC) += ssfdc.o mtd_blkdevs.o +obj-$(CONFIG_MTD_BLKDEVS) += mtd_blkdevs.o +obj-$(CONFIG_MTD_BLOCK) += mtdblock.o +obj-$(CONFIG_MTD_BLOCK_RO) += mtdblock_ro.o +obj-$(CONFIG_FTL) += ftl.o +obj-$(CONFIG_NFTL) += nftl.o +obj-$(CONFIG_INFTL) += inftl.o +obj-$(CONFIG_RFD_FTL) += rfd_ftl.o +obj-$(CONFIG_SSFDC) += ssfdc.o nftl-objs := nftlcore.o nftlmount.o inftl-objs := inftlcore.o inftlmount.o -- cgit v1.1 From 29072b96078ffde36f03d51e6b5d0cff1ba8c7df Mon Sep 17 00:00:00 2001 From: Thomas Gleixner Date: Thu, 28 Sep 2006 15:38:36 +0200 Subject: [MTD] NAND: add subpage write support Many SLC NANDs support up to 4 writes at one NAND page. Add support of this feature. Signed-off-by: Artem Bityutskiy --- drivers/mtd/mtdconcat.c | 1 + drivers/mtd/mtdpart.c | 1 + drivers/mtd/nand/nand_base.c | 53 ++++++++++++++++++++++++++++++++++++-------- 3 files changed, 46 insertions(+), 9 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/mtdconcat.c b/drivers/mtd/mtdconcat.c index ec51483..0690268 100644 --- a/drivers/mtd/mtdconcat.c +++ b/drivers/mtd/mtdconcat.c @@ -772,6 +772,7 @@ struct mtd_info *mtd_concat_create(struct mtd_info *subdev[], /* subdevices to c concat->mtd.ecc_stats.badblocks += subdev[i]->ecc_stats.badblocks; if (concat->mtd.writesize != subdev[i]->writesize || + concat->mtd.subpage_sft != subdev[i]->subpage_sft || concat->mtd.oobsize != subdev[i]->oobsize || concat->mtd.ecctype != subdev[i]->ecctype || concat->mtd.eccsize != subdev[i]->eccsize || diff --git a/drivers/mtd/mtdpart.c b/drivers/mtd/mtdpart.c index 89692f8..bafd2fb 100644 --- a/drivers/mtd/mtdpart.c +++ b/drivers/mtd/mtdpart.c @@ -340,6 +340,7 @@ int add_mtd_partitions(struct mtd_info *master, slave->mtd.oobsize = master->oobsize; slave->mtd.ecctype = master->ecctype; slave->mtd.eccsize = master->eccsize; + slave->mtd.subpage_sft = master->subpage_sft; slave->mtd.name = parts[i].name; slave->mtd.bank_size = master->bank_size; diff --git a/drivers/mtd/nand/nand_base.c b/drivers/mtd/nand/nand_base.c index 5dcb2e0..eed3271 100644 --- a/drivers/mtd/nand/nand_base.c +++ b/drivers/mtd/nand/nand_base.c @@ -1590,7 +1590,7 @@ static uint8_t *nand_fill_oob(struct nand_chip *chip, uint8_t *oob, return NULL; } -#define NOTALIGNED(x) (x & (mtd->writesize-1)) != 0 +#define NOTALIGNED(x) (x & (chip->subpagesize - 1)) != 0 /** * nand_do_write_ops - [Internal] NAND write with ECC @@ -1603,15 +1603,16 @@ static uint8_t *nand_fill_oob(struct nand_chip *chip, uint8_t *oob, static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, struct mtd_oob_ops *ops) { - int chipnr, realpage, page, blockmask; + int chipnr, realpage, page, blockmask, column; struct nand_chip *chip = mtd->priv; uint32_t writelen = ops->len; uint8_t *oob = ops->oobbuf; uint8_t *buf = ops->datbuf; - int bytes = mtd->writesize; - int ret; + int ret, subpage; ops->retlen = 0; + if (!writelen) + return 0; /* reject writes, which are not page aligned */ if (NOTALIGNED(to) || NOTALIGNED(ops->len)) { @@ -1620,8 +1621,11 @@ static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, return -EINVAL; } - if (!writelen) - return 0; + column = to & (mtd->writesize - 1); + subpage = column || (writelen & (mtd->writesize - 1)); + + if (subpage && oob) + return -EINVAL; chipnr = (int)(to >> chip->chip_shift); chip->select_chip(mtd, chipnr); @@ -1644,12 +1648,24 @@ static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, memset(chip->oob_poi, 0xff, mtd->oobsize); while(1) { + int bytes = mtd->writesize; int cached = writelen > bytes && page != blockmask; + uint8_t *wbuf = buf; + + /* Partial page write ? */ + if (unlikely(column || writelen < (mtd->writesize - 1))) { + cached = 0; + bytes = min_t(int, bytes - column, (int) writelen); + chip->pagebuf = -1; + memset(chip->buffers->databuf, 0xff, mtd->writesize); + memcpy(&chip->buffers->databuf[column], buf, bytes); + wbuf = chip->buffers->databuf; + } if (unlikely(oob)) oob = nand_fill_oob(chip, oob, ops); - ret = chip->write_page(mtd, chip, buf, page, cached, + ret = chip->write_page(mtd, chip, wbuf, page, cached, (ops->mode == MTD_OOB_RAW)); if (ret) break; @@ -1658,6 +1674,7 @@ static int nand_do_write_ops(struct mtd_info *mtd, loff_t to, if (!writelen) break; + column = 0; buf += bytes; realpage++; @@ -2201,8 +2218,8 @@ static struct nand_flash_dev *nand_get_flash_type(struct mtd_info *mtd, /* Newer devices have all the information in additional id bytes */ if (!type->pagesize) { int extid; - /* The 3rd id byte contains non relevant data ATM */ - extid = chip->read_byte(mtd); + /* The 3rd id byte holds MLC / multichip data */ + chip->cellinfo = chip->read_byte(mtd); /* The 4th id byte is the important one */ extid = chip->read_byte(mtd); /* Calc pagesize */ @@ -2482,6 +2499,24 @@ int nand_scan_tail(struct mtd_info *mtd) } chip->ecc.total = chip->ecc.steps * chip->ecc.bytes; + /* + * Allow subpage writes up to ecc.steps. Not possible for MLC + * FLASH. + */ + if (!(chip->options & NAND_NO_SUBPAGE_WRITE) && + !(chip->cellinfo & NAND_CI_CELLTYPE_MSK)) { + switch(chip->ecc.steps) { + case 2: + mtd->subpage_sft = 1; + break; + case 4: + case 8: + mtd->subpage_sft = 2; + break; + } + } + chip->subpagesize = mtd->writesize >> mtd->subpage_sft; + /* Initialize state */ chip->state = FL_READY; -- cgit v1.1 From 7799308f34d3c3371a319559687c78c0f2506fcf Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Wed, 11 Oct 2006 14:52:44 +0300 Subject: [MTD] add get_mtd_device_nm() function This patch adds one more function to the MTD interface to make it possible to open MTD devices by their names, not only numbers. This is very handy in many situations. Also, MTD device number depend on load order and may vary, while names are fixed. Signed-off-by: Artem Bityutskiy --- drivers/mtd/mtdcore.c | 38 ++++++++++++++++++++++++++++++++++++++ 1 file changed, 38 insertions(+) (limited to 'drivers') diff --git a/drivers/mtd/mtdcore.c b/drivers/mtd/mtdcore.c index c4d26de..06ec9f8 100644 --- a/drivers/mtd/mtdcore.c +++ b/drivers/mtd/mtdcore.c @@ -15,6 +15,7 @@ #include #include #include +#include #include #include #include @@ -223,6 +224,42 @@ struct mtd_info *get_mtd_device(struct mtd_info *mtd, int num) return ret; } +/** + * get_mtd_device_nm - obtain a validated handle for an MTD device by + * device name + * @name: MTD device name to open + * + * This function returns MTD device description structure in case of + * success and an error code in case of failure. + */ + +struct mtd_info *get_mtd_device_nm(const char *name) +{ + int i; + struct mtd_info *mtd = ERR_PTR(-ENODEV); + + mutex_lock(&mtd_table_mutex); + + for (i = 0; i < MAX_MTD_DEVICES; i++) { + if (mtd_table[i] && !strcmp(name, mtd_table[i]->name)) { + mtd = mtd_table[i]; + break; + } + } + + if (i == MAX_MTD_DEVICES) + goto out_unlock; + + if (!try_module_get(mtd->owner)) + goto out_unlock; + + mtd->usecount++; + +out_unlock: + mutex_unlock(&mtd_table_mutex); + return mtd; +} + void put_mtd_device(struct mtd_info *mtd) { int c; @@ -267,6 +304,7 @@ int default_mtd_writev(struct mtd_info *mtd, const struct kvec *vecs, EXPORT_SYMBOL(add_mtd_device); EXPORT_SYMBOL(del_mtd_device); EXPORT_SYMBOL(get_mtd_device); +EXPORT_SYMBOL(get_mtd_device_nm); EXPORT_SYMBOL(put_mtd_device); EXPORT_SYMBOL(register_mtd_user); EXPORT_SYMBOL(unregister_mtd_user); -- cgit v1.1 From 9fe912cea32aec18f860c95e8574410b5892481b Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Wed, 11 Oct 2006 14:52:45 +0300 Subject: [MTD] add get and put methods This patch adds get_device() and put_device() methods to the MTD description structure (struct mtd_info). These methods are called by MTD whenever the MTD device is get or put. They are needed when the underlying driver is something smarter then just flash chip driver, for example UBI. Signed-off-by: Artem Bityutskiy --- drivers/mtd/mtdcore.c | 37 ++++++++++++++++++++++++++++++------- 1 file changed, 30 insertions(+), 7 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/mtdcore.c b/drivers/mtd/mtdcore.c index 06ec9f8..f11f55f 100644 --- a/drivers/mtd/mtdcore.c +++ b/drivers/mtd/mtdcore.c @@ -214,12 +214,23 @@ struct mtd_info *get_mtd_device(struct mtd_info *mtd, int num) ret = NULL; } - if (ret && !try_module_get(ret->owner)) + if (!ret) + goto out_unlock; + + if (!try_module_get(ret->owner)) { + ret = NULL; + goto out_unlock; + } + + if (ret->get_device && ret->get_device(ret)) { + module_put(ret->owner); ret = NULL; + goto out_unlock; + } - if (ret) - ret->usecount++; + ret->usecount++; +out_unlock: mutex_unlock(&mtd_table_mutex); return ret; } @@ -235,8 +246,8 @@ struct mtd_info *get_mtd_device(struct mtd_info *mtd, int num) struct mtd_info *get_mtd_device_nm(const char *name) { - int i; - struct mtd_info *mtd = ERR_PTR(-ENODEV); + int i, err = -ENODEV; + struct mtd_info *mtd = NULL; mutex_lock(&mtd_table_mutex); @@ -247,17 +258,27 @@ struct mtd_info *get_mtd_device_nm(const char *name) } } - if (i == MAX_MTD_DEVICES) + if (!mtd) goto out_unlock; if (!try_module_get(mtd->owner)) goto out_unlock; + if (mtd->get_device) { + err = mtd->get_device(mtd); + if (err) + goto out_put; + } + mtd->usecount++; + mutex_unlock(&mtd_table_mutex); + return mtd; +out_put: + module_put(mtd->owner); out_unlock: mutex_unlock(&mtd_table_mutex); - return mtd; + return ERR_PTR(err); } void put_mtd_device(struct mtd_info *mtd) @@ -266,6 +287,8 @@ void put_mtd_device(struct mtd_info *mtd) mutex_lock(&mtd_table_mutex); c = --mtd->usecount; + if (mtd->put_device) + mtd->put_device(mtd); mutex_unlock(&mtd_table_mutex); BUG_ON(c < 0); -- cgit v1.1 From 9c74034f8fc5d93fbe5656421cbbdc4c76ddda28 Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Wed, 11 Oct 2006 14:52:47 +0300 Subject: [MTD] return error code from get_mtd_device() get_mtd_device() returns NULL in case of any failure. Teach it to return an error code instead. Fix all users as well. Signed-off-by: Artem Bityutskiy --- drivers/mtd/maps/nettel.c | 3 ++- drivers/mtd/mtdchar.c | 5 +++-- drivers/mtd/mtdcore.c | 24 +++++++++++++----------- 3 files changed, 18 insertions(+), 14 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/nettel.c b/drivers/mtd/maps/nettel.c index f9e8e5b..528e523 100644 --- a/drivers/mtd/maps/nettel.c +++ b/drivers/mtd/maps/nettel.c @@ -20,6 +20,7 @@ #include #include #include +#include #include #include #include @@ -178,7 +179,7 @@ int nettel_eraseconfig(void) init_waitqueue_head(&wait_q); mtd = get_mtd_device(NULL, 2); - if (mtd) { + if (!IS_ERR(mtd)) { nettel_erase.mtd = mtd; nettel_erase.callback = nettel_erasecallback; nettel_erase.callback = NULL; diff --git a/drivers/mtd/mtdchar.c b/drivers/mtd/mtdchar.c index 7c4adc6..3013d08 100644 --- a/drivers/mtd/mtdchar.c +++ b/drivers/mtd/mtdchar.c @@ -7,6 +7,7 @@ #include #include +#include #include #include #include @@ -100,8 +101,8 @@ static int mtd_open(struct inode *inode, struct file *file) mtd = get_mtd_device(NULL, devnum); - if (!mtd) - return -ENODEV; + if (IS_ERR(mtd)) + return PTR_ERR(mtd); if (MTD_ABSENT == mtd->type) { put_mtd_device(mtd); diff --git a/drivers/mtd/mtdcore.c b/drivers/mtd/mtdcore.c index f11f55f..60f237f 100644 --- a/drivers/mtd/mtdcore.c +++ b/drivers/mtd/mtdcore.c @@ -193,14 +193,14 @@ int unregister_mtd_user (struct mtd_notifier *old) * Given a number and NULL address, return the num'th entry in the device * table, if any. Given an address and num == -1, search the device table * for a device with that address and return if it's still present. Given - * both, return the num'th driver only if its address matches. Return NULL - * if not. + * both, return the num'th driver only if its address matches. Return + * error code if not. */ struct mtd_info *get_mtd_device(struct mtd_info *mtd, int num) { struct mtd_info *ret = NULL; - int i; + int i, err = -ENODEV; mutex_lock(&mtd_table_mutex); @@ -217,22 +217,24 @@ struct mtd_info *get_mtd_device(struct mtd_info *mtd, int num) if (!ret) goto out_unlock; - if (!try_module_get(ret->owner)) { - ret = NULL; + if (!try_module_get(ret->owner)) goto out_unlock; - } - if (ret->get_device && ret->get_device(ret)) { - module_put(ret->owner); - ret = NULL; - goto out_unlock; + if (ret->get_device) { + err = ret->get_device(ret); + if (err) + goto out_put; } ret->usecount++; + mutex_unlock(&mtd_table_mutex); + return ret; +out_put: + module_put(ret->owner); out_unlock: mutex_unlock(&mtd_table_mutex); - return ret; + return ERR_PTR(err); } /** -- cgit v1.1 From dd36f2673573fc027945d488342f2f70664f0448 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Wed, 29 Nov 2006 16:33:03 +0000 Subject: [MTD] Use EXPORT_SYMBOL_GPL() for exported symbols. While we're fixing up the newly-added symbol, change the neighbouring ones too, for consistency and also to reflect the author's interpretation of the GPL -- which is that _no_ non-GPL modules are permitted. The author always intended his code to be released under the GPL, and believes that any new interpretation of 'EXPORT_SYMBOL' as being any different from 'EXPORT_SYMBOL_GPL' is entirely invalid; the GPL requires that _all_ exports have the semantics of the new 'EXPORT_SYMBOL_GPL', which means the extra four characters are entirely redundant. But since those four extra characters trigger the check for illegal modules in a way that just EXPORT_SYMBOL does not, it's useful to change anyway. This action in no way indicates an admission that there is any legal distinction between the two states, and in particular does not indicate that the author believes that non-GPL modules may use symbols exported with EXPORT_SYMBOL alone. Signed-off-by: David Woodhouse --- drivers/mtd/mtdcore.c | 18 +++++++++--------- 1 file changed, 9 insertions(+), 9 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/mtdcore.c b/drivers/mtd/mtdcore.c index 60f237f..7070110 100644 --- a/drivers/mtd/mtdcore.c +++ b/drivers/mtd/mtdcore.c @@ -298,7 +298,7 @@ void put_mtd_device(struct mtd_info *mtd) } /* default_mtd_writev - default mtd writev method for MTD devices that - * dont implement their own + * don't implement their own */ int default_mtd_writev(struct mtd_info *mtd, const struct kvec *vecs, @@ -326,14 +326,14 @@ int default_mtd_writev(struct mtd_info *mtd, const struct kvec *vecs, return ret; } -EXPORT_SYMBOL(add_mtd_device); -EXPORT_SYMBOL(del_mtd_device); -EXPORT_SYMBOL(get_mtd_device); -EXPORT_SYMBOL(get_mtd_device_nm); -EXPORT_SYMBOL(put_mtd_device); -EXPORT_SYMBOL(register_mtd_user); -EXPORT_SYMBOL(unregister_mtd_user); -EXPORT_SYMBOL(default_mtd_writev); +EXPORT_SYMBOL_GPL(add_mtd_device); +EXPORT_SYMBOL_GPL(del_mtd_device); +EXPORT_SYMBOL_GPL(get_mtd_device); +EXPORT_SYMBOL_GPL(get_mtd_device_nm); +EXPORT_SYMBOL_GPL(put_mtd_device); +EXPORT_SYMBOL_GPL(register_mtd_user); +EXPORT_SYMBOL_GPL(unregister_mtd_user); +EXPORT_SYMBOL_GPL(default_mtd_writev); #ifdef CONFIG_PROC_FS -- cgit v1.1 From c9ac5977299dd106ddb759e7e10035770dff185b Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Thu, 30 Nov 2006 08:17:38 +0000 Subject: [MTD] Remove trailing whitespace The newly-added cafe_ecc.c had a lot of it because of the way the lookup table was auto-generated; clean up the other files too while we're at it. Signed-off-by: David Woodhouse --- drivers/mtd/chips/gen_probe.c | 2 +- drivers/mtd/maps/bast-flash.c | 2 +- drivers/mtd/maps/ck804xrom.c | 2 +- drivers/mtd/maps/nettel.c | 2 +- drivers/mtd/nand/cafe.c | 17 +- drivers/mtd/nand/cafe_ecc.c | 1046 ++++++++++++++++++------------------ drivers/mtd/nand/cs553x_nand.c | 4 +- drivers/mtd/nand/s3c2410.c | 2 +- drivers/mtd/onenand/onenand_base.c | 2 +- 9 files changed, 539 insertions(+), 540 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/chips/gen_probe.c b/drivers/mtd/chips/gen_probe.c index 77843d5..2eb696d 100644 --- a/drivers/mtd/chips/gen_probe.c +++ b/drivers/mtd/chips/gen_probe.c @@ -40,7 +40,7 @@ struct mtd_info *mtd_do_chip_probe(struct map_info *map, struct chip_probe *cp) if (mtd) { if (mtd->size > map->size) { printk(KERN_WARNING "Reducing visibility of %ldKiB chip to %ldKiB\n", - (unsigned long)mtd->size >> 10, + (unsigned long)mtd->size >> 10, (unsigned long)map->size >> 10); mtd->size = map->size; } diff --git a/drivers/mtd/maps/bast-flash.c b/drivers/mtd/maps/bast-flash.c index e074bb6..fc3b267 100644 --- a/drivers/mtd/maps/bast-flash.c +++ b/drivers/mtd/maps/bast-flash.c @@ -131,7 +131,7 @@ static int bast_flash_probe(struct platform_device *pdev) info->map.phys = res->start; info->map.size = res->end - res->start + 1; - info->map.name = pdev->dev.bus_id; + info->map.name = pdev->dev.bus_id; info->map.bankwidth = 2; if (info->map.size > AREA_MAXSIZE) diff --git a/drivers/mtd/maps/ck804xrom.c b/drivers/mtd/maps/ck804xrom.c index c222b88..238d42e 100644 --- a/drivers/mtd/maps/ck804xrom.c +++ b/drivers/mtd/maps/ck804xrom.c @@ -26,7 +26,7 @@ #define ADDRESS_NAME_LEN 18 -#define ROM_PROBE_STEP_SIZE (64*1024) +#define ROM_PROBE_STEP_SIZE (64*1024) struct ck804xrom_window { void __iomem *virt; diff --git a/drivers/mtd/maps/nettel.c b/drivers/mtd/maps/nettel.c index 528e523..9f53c65 100644 --- a/drivers/mtd/maps/nettel.c +++ b/drivers/mtd/maps/nettel.c @@ -472,7 +472,7 @@ out_unmap2: iounmap(nettel_amd_map.virt); return(rc); - + } /****************************************************************************/ diff --git a/drivers/mtd/nand/cafe.c b/drivers/mtd/nand/cafe.c index c0a5ec1..b8d9b64 100644 --- a/drivers/mtd/nand/cafe.c +++ b/drivers/mtd/nand/cafe.c @@ -1,4 +1,4 @@ -/* +/* * Driver for One Laptop Per Child ‘CAFÉ’ controller, aka Marvell 88ALP01 * * Copyright © 2006 Red Hat, Inc. @@ -60,7 +60,6 @@ struct cafe_priv { int page_addr; dma_addr_t dmaaddr; unsigned char *dmabuf; - }; static int usedma = 1; @@ -217,7 +216,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, ctl1 |= ((adrbytes-1)|8) << 27; if (command == NAND_CMD_SEQIN || command == NAND_CMD_ERASE1) { - /* Ignore the first command of a pair; the hardware + /* Ignore the first command of a pair; the hardware deals with them both at once, later */ cafe->ctl1 = ctl1; cafe_dev_dbg(&cafe->pdev->dev, "Setup for delayed command, ctl1 %08x, dlen %x\n", @@ -231,7 +230,7 @@ static void cafe_nand_cmdfunc(struct mtd_info *mtd, unsigned command, cafe_writel(cafe, cafe->ctl2 | 0x100 | NAND_CMD_READSTART, NAND_CTRL2); do_command: - cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", + cafe_dev_dbg(&cafe->pdev->dev, "dlen %x, ctl1 %x, ctl2 %x\n", cafe->datalen, ctl1, cafe_readl(cafe, NAND_CTRL2)); /* NB: The datasheet lies -- we really should be subtracting 1 here */ @@ -380,7 +379,7 @@ static int cafe_nand_read_page(struct mtd_info *mtd, struct nand_chip *chip, uint32_t tmp = cafe_readl(cafe, NAND_ECC_SYN01 + (i*2)); syn[i] = tmp & 0xfff; syn[i+1] = (tmp >> 16) & 0xfff; - } + } if ((i = cafe_correct_ecc(buf, syn)) < 0) { dev_dbg(&cafe->pdev->dev, "Failed to correct ECC at %08x\n", @@ -404,7 +403,7 @@ static struct nand_ecclayout cafe_oobinfo_2048 = { .oobfree = {{14, 50}} }; -/* Ick. The BBT code really ought to be able to work this bit out +/* Ick. The BBT code really ought to be able to work this bit out for itself from the above, at least for the 2KiB case */ static uint8_t cafe_bbt_pattern_2048[] = { 'B', 'b', 't', '0' }; static uint8_t cafe_mirror_pattern_2048[] = { '1', 't', 'b', 'B' }; @@ -579,7 +578,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, cafe->nand.options |= NAND_SKIP_BBTSCAN; cafe->nand.block_bad = cafe_nand_block_bad; } - + /* Start off by resetting the NAND controller completely */ cafe_writel(cafe, 1, NAND_RESET); cafe_writel(cafe, 0, NAND_RESET); @@ -600,7 +599,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, err = request_irq(pdev->irq, &cafe_nand_interrupt, SA_SHIRQ, "CAFE NAND", mtd); if (err) { dev_warn(&pdev->dev, "Could not register IRQ %d\n", pdev->irq); - + goto out_free_dma; } #if 1 @@ -654,7 +653,7 @@ static int __devinit cafe_nand_probe(struct pci_dev *pdev, writel(0x84600070, cafe->mmio); udelay(10); cafe_dev_dbg(&cafe->pdev->dev, "Status %x\n", cafe_readl(cafe, NAND_NONMEM)); -#endif +#endif /* Scan to find existance of the device */ if (nand_scan_ident(mtd, 1)) { err = -ENXIO; diff --git a/drivers/mtd/nand/cafe_ecc.c b/drivers/mtd/nand/cafe_ecc.c index 2d29265..1b9fa05 100644 --- a/drivers/mtd/nand/cafe_ecc.c +++ b/drivers/mtd/nand/cafe_ecc.c @@ -1,20 +1,20 @@ -/* Error correction for CAFÉ NAND controller +/* Error correction for CAFÉ NAND controller * * © 2006 Marvell, Inc. * Author: Tom Chiou * - * This program is free software; you can redistribute it and/or modify it - * under the terms of the GNU General Public License as published by the Free - * Software Foundation; either version 2 of the License, or (at your option) + * This program is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License as published by the Free + * Software Foundation; either version 2 of the License, or (at your option) * any later version. * - * This program is distributed in the hope that it will be useful, but WITHOUT - * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or - * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for + * This program is distributed in the hope that it will be useful, but WITHOUT + * ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or + * FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License for * more details. * * You should have received a copy of the GNU General Public License along with - * this program; if not, write to the Free Software Foundation, Inc., 59 + * this program; if not, write to the Free Software Foundation, Inc., 59 * Temple Place - Suite 330, Boston, MA 02111-1307, USA. */ @@ -500,9 +500,9 @@ static void solve_2x3(unsigned short m[2][3], unsigned short *coefs) } static unsigned char gf64_inv[64] = { - 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, - 61, 54, 51, 39, 26, 35, 14, 24, 23, 15, 20, 34, 11, 53, 45, 6, - 63, 2, 27, 21, 56, 9, 50, 19, 13, 47, 48, 5, 7, 30, 12, 41, + 0, 1, 33, 62, 49, 43, 31, 44, 57, 37, 52, 28, 46, 40, 22, 25, + 61, 54, 51, 39, 26, 35, 14, 24, 23, 15, 20, 34, 11, 53, 45, 6, + 63, 2, 27, 21, 56, 9, 50, 19, 13, 47, 48, 5, 7, 30, 12, 41, 42, 4, 38, 18, 10, 29, 17, 60, 36, 8, 59, 58, 55, 16, 3, 32 }; @@ -529,517 +529,517 @@ static unsigned short gf4096_inv(unsigned short din) } static unsigned short err_pos_lut[4096] = { - 0xfff, 0x000, 0x451, 0xfff, 0xfff, 0x3cf, 0xfff, 0x041, - 0xfff, 0xfff, 0xfff, 0xfff, 0x28a, 0xfff, 0x492, 0xfff, - 0x145, 0xfff, 0xfff, 0x514, 0xfff, 0x082, 0xfff, 0xfff, - 0xfff, 0x249, 0x38e, 0x410, 0xfff, 0x104, 0x208, 0x1c7, - 0xfff, 0xfff, 0xfff, 0xfff, 0x2cb, 0xfff, 0xfff, 0xfff, - 0x0c3, 0x34d, 0x4d3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x186, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x30c, 0x555, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x166, 0xfff, 0xfff, 0xfff, 0xfff, - 0x385, 0x14e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e1, - 0xfff, 0xfff, 0xfff, 0xfff, 0x538, 0xfff, 0x16d, 0xfff, - 0xfff, 0xfff, 0x45b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x29c, 0x2cc, 0x30b, 0x2b3, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0b3, 0xfff, 0x2f7, - 0xfff, 0x32b, 0xfff, 0xfff, 0xfff, 0xfff, 0x0a7, 0xfff, - 0xfff, 0x2da, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x07e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x11c, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x22f, 0xfff, 0x1f4, 0xfff, 0xfff, - 0x2b0, 0x504, 0xfff, 0x114, 0xfff, 0xfff, 0xfff, 0x21d, - 0xfff, 0xfff, 0xfff, 0xfff, 0x00d, 0x3c4, 0x340, 0x10f, - 0xfff, 0xfff, 0x266, 0x02e, 0xfff, 0xfff, 0xfff, 0x4f8, - 0x337, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x07b, 0x168, 0xfff, 0xfff, 0x0fe, - 0xfff, 0xfff, 0x51a, 0xfff, 0x458, 0xfff, 0x36d, 0xfff, - 0xfff, 0xfff, 0xfff, 0x073, 0x37d, 0x415, 0x550, 0xfff, - 0xfff, 0xfff, 0x23b, 0x4b4, 0xfff, 0xfff, 0xfff, 0x1a1, - 0xfff, 0xfff, 0x3aa, 0xfff, 0x117, 0x04d, 0x341, 0xfff, - 0xfff, 0xfff, 0xfff, 0x518, 0x03e, 0x0f2, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x363, 0xfff, 0x0b9, 0xfff, 0xfff, - 0x241, 0xfff, 0xfff, 0x049, 0xfff, 0xfff, 0xfff, 0xfff, - 0x15f, 0x52d, 0xfff, 0xfff, 0xfff, 0x29e, 0xfff, 0xfff, - 0xfff, 0xfff, 0x4cf, 0x0fc, 0xfff, 0x36f, 0x3d3, 0xfff, - 0x228, 0xfff, 0xfff, 0x45e, 0xfff, 0xfff, 0xfff, 0xfff, - 0x238, 0xfff, 0xfff, 0xfff, 0xfff, 0x47f, 0xfff, 0xfff, - 0x43a, 0x265, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e8, - 0xfff, 0xfff, 0x01a, 0xfff, 0xfff, 0xfff, 0xfff, 0x21e, - 0x1fc, 0x40b, 0xfff, 0xfff, 0xfff, 0x2d0, 0x159, 0xfff, - 0xfff, 0x313, 0xfff, 0xfff, 0x05c, 0x4cc, 0xfff, 0xfff, - 0x0f6, 0x3d5, 0xfff, 0xfff, 0xfff, 0x54f, 0xfff, 0xfff, - 0xfff, 0x172, 0x1e4, 0x07c, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x53c, 0x1ad, 0x535, - 0x19b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x092, 0xfff, 0x2be, 0xfff, 0xfff, 0x482, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0e6, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x476, 0xfff, 0x51d, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x342, 0x2b5, 0x22e, 0x09a, 0xfff, 0x08d, - 0x44f, 0x3ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d1, 0xfff, - 0xfff, 0x543, 0xfff, 0x48f, 0xfff, 0x3d2, 0xfff, 0x0d5, - 0x113, 0x0ec, 0x427, 0xfff, 0xfff, 0xfff, 0x4c4, 0xfff, - 0xfff, 0x50a, 0xfff, 0x144, 0xfff, 0x105, 0x39f, 0x294, - 0x164, 0xfff, 0x31a, 0xfff, 0xfff, 0x49a, 0xfff, 0x130, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x1be, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x49e, 0x371, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x0e8, 0x49c, 0x0f4, 0xfff, - 0x338, 0x1a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x36c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x1ae, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x31b, 0xfff, 0xfff, 0x2dd, 0x522, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f4, - 0x3c6, 0x30d, 0xfff, 0xfff, 0xfff, 0xfff, 0x34c, 0x18f, - 0x30a, 0xfff, 0x01f, 0x079, 0xfff, 0xfff, 0x54d, 0x46b, - 0x28c, 0x37f, 0xfff, 0xfff, 0xfff, 0xfff, 0x355, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x14f, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x359, 0x3fe, 0x3c5, 0xfff, 0xfff, - 0xfff, 0xfff, 0x423, 0xfff, 0xfff, 0x34a, 0x22c, 0xfff, - 0x25a, 0xfff, 0xfff, 0x4ad, 0xfff, 0x28d, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x547, 0xfff, 0xfff, 0xfff, 0xfff, - 0x2e2, 0xfff, 0xfff, 0x1d5, 0xfff, 0x2a8, 0xfff, 0xfff, - 0x03f, 0xfff, 0xfff, 0xfff, 0xfff, 0x3eb, 0x0fa, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x55b, 0xfff, - 0x08e, 0xfff, 0x3ae, 0xfff, 0x3a4, 0xfff, 0x282, 0x158, - 0xfff, 0x382, 0xfff, 0xfff, 0x499, 0xfff, 0xfff, 0x08a, - 0xfff, 0xfff, 0xfff, 0x456, 0x3be, 0xfff, 0x1e2, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x559, 0xfff, 0x1a0, 0xfff, - 0xfff, 0x0b4, 0xfff, 0xfff, 0xfff, 0x2df, 0xfff, 0xfff, - 0xfff, 0x07f, 0x4f5, 0xfff, 0xfff, 0x27c, 0x133, 0x017, - 0xfff, 0x3fd, 0xfff, 0xfff, 0xfff, 0x44d, 0x4cd, 0x17a, - 0x0d7, 0x537, 0xfff, 0xfff, 0x353, 0xfff, 0xfff, 0x351, - 0x366, 0xfff, 0x44a, 0xfff, 0x1a6, 0xfff, 0xfff, 0xfff, - 0x291, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1e3, - 0xfff, 0xfff, 0xfff, 0xfff, 0x389, 0xfff, 0x07a, 0xfff, - 0x1b6, 0x2ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x24e, 0x074, - 0xfff, 0xfff, 0x3dc, 0xfff, 0x4e3, 0xfff, 0xfff, 0xfff, - 0xfff, 0x4eb, 0xfff, 0xfff, 0x3b8, 0x4de, 0xfff, 0x19c, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x262, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x076, 0x4e8, 0x3da, - 0xfff, 0x531, 0xfff, 0xfff, 0x14a, 0xfff, 0x0a2, 0x433, - 0x3df, 0x1e9, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e7, 0x285, - 0x2d8, 0xfff, 0xfff, 0xfff, 0x349, 0x18d, 0x098, 0xfff, - 0x0df, 0x4bf, 0xfff, 0xfff, 0x0b2, 0xfff, 0x346, 0x24d, - 0xfff, 0xfff, 0xfff, 0x24f, 0x4fa, 0x2f9, 0xfff, 0xfff, - 0x3c9, 0xfff, 0x2b4, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x056, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x179, 0xfff, 0x0e9, 0x3f0, 0x33d, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x1fd, 0xfff, 0xfff, 0x526, 0xfff, - 0xfff, 0xfff, 0x53d, 0xfff, 0xfff, 0xfff, 0x170, 0x331, - 0xfff, 0x068, 0xfff, 0xfff, 0xfff, 0x3f7, 0xfff, 0x3d8, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x09f, 0x556, 0xfff, 0xfff, 0x02d, 0xfff, 0xfff, - 0x553, 0xfff, 0xfff, 0xfff, 0x1f0, 0xfff, 0xfff, 0x4d6, - 0x41e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d5, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x248, 0xfff, 0xfff, 0xfff, 0x0a3, - 0xfff, 0x217, 0xfff, 0xfff, 0xfff, 0x4f1, 0x209, 0xfff, - 0xfff, 0x475, 0x234, 0x52b, 0x398, 0xfff, 0x08b, 0xfff, - 0xfff, 0xfff, 0xfff, 0x2c2, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x268, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x4a3, 0xfff, 0x0aa, 0xfff, 0x1d9, 0xfff, 0xfff, - 0xfff, 0xfff, 0x155, 0xfff, 0xfff, 0xfff, 0xfff, 0x0bf, - 0x539, 0xfff, 0xfff, 0x2f1, 0x545, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x2a7, 0x06f, 0xfff, 0x378, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x25e, 0xfff, - 0xfff, 0xfff, 0xfff, 0x15d, 0x02a, 0xfff, 0xfff, 0x0bc, - 0x235, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x150, 0xfff, 0x1a9, 0xfff, 0xfff, 0xfff, 0xfff, 0x381, - 0xfff, 0x04e, 0x270, 0x13f, 0xfff, 0xfff, 0x405, 0xfff, - 0x3cd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x2ef, 0xfff, 0x06a, 0xfff, 0xfff, 0xfff, 0x34f, - 0x212, 0xfff, 0xfff, 0x0e2, 0xfff, 0x083, 0x298, 0xfff, - 0xfff, 0xfff, 0x0c2, 0xfff, 0xfff, 0x52e, 0xfff, 0x488, - 0xfff, 0xfff, 0xfff, 0x36b, 0xfff, 0xfff, 0xfff, 0x442, - 0x091, 0xfff, 0x41c, 0xfff, 0xfff, 0x3a5, 0xfff, 0x4e6, - 0xfff, 0xfff, 0x40d, 0x31d, 0xfff, 0xfff, 0xfff, 0x4c1, - 0x053, 0xfff, 0x418, 0x13c, 0xfff, 0x350, 0xfff, 0x0ae, - 0xfff, 0xfff, 0x41f, 0xfff, 0x470, 0xfff, 0x4ca, 0xfff, - 0xfff, 0xfff, 0x02b, 0x450, 0xfff, 0x1f8, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x293, 0xfff, - 0xfff, 0xfff, 0xfff, 0x411, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x0b8, 0xfff, 0xfff, 0xfff, - 0x3e1, 0xfff, 0xfff, 0xfff, 0xfff, 0x43c, 0xfff, 0x2b2, - 0x2ab, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ec, - 0xfff, 0xfff, 0xfff, 0x3f8, 0x034, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x11a, 0xfff, 0x541, 0x45c, 0x134, - 0x1cc, 0xfff, 0xfff, 0xfff, 0x469, 0xfff, 0xfff, 0x44b, - 0x161, 0xfff, 0xfff, 0xfff, 0x055, 0xfff, 0xfff, 0xfff, - 0xfff, 0x307, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d1, 0xfff, - 0xfff, 0xfff, 0x124, 0x37b, 0x26b, 0x336, 0xfff, 0xfff, - 0x2e4, 0x3cb, 0xfff, 0xfff, 0x0f8, 0x3c8, 0xfff, 0xfff, - 0xfff, 0x461, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4b5, - 0x2cf, 0xfff, 0xfff, 0xfff, 0x20f, 0xfff, 0x35a, 0xfff, - 0x490, 0xfff, 0x185, 0xfff, 0xfff, 0xfff, 0xfff, 0x42e, - 0xfff, 0xfff, 0xfff, 0xfff, 0x54b, 0xfff, 0xfff, 0xfff, - 0x146, 0xfff, 0x412, 0xfff, 0xfff, 0xfff, 0x1ff, 0xfff, - 0xfff, 0x3e0, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d5, 0xfff, - 0x4df, 0x505, 0xfff, 0x413, 0xfff, 0x1a5, 0xfff, 0x3b2, - 0xfff, 0xfff, 0xfff, 0x35b, 0xfff, 0x116, 0xfff, 0xfff, - 0x171, 0x4d0, 0xfff, 0x154, 0x12d, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x468, 0x4db, 0xfff, - 0xfff, 0x1df, 0xfff, 0xfff, 0xfff, 0xfff, 0x05a, 0xfff, - 0x0f1, 0x403, 0xfff, 0x22b, 0x2e0, 0xfff, 0xfff, 0xfff, - 0x2b7, 0x373, 0xfff, 0xfff, 0xfff, 0xfff, 0x13e, 0xfff, - 0xfff, 0xfff, 0x0d0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x329, 0x1d2, 0x3fa, 0x047, 0xfff, 0x2f2, 0xfff, 0xfff, - 0x141, 0x0ac, 0x1d7, 0xfff, 0x07d, 0xfff, 0xfff, 0xfff, - 0x1c1, 0xfff, 0x487, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x045, 0xfff, 0xfff, 0xfff, 0xfff, - 0x288, 0x0cd, 0xfff, 0xfff, 0xfff, 0xfff, 0x226, 0x1d8, - 0xfff, 0x153, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4cb, - 0x528, 0xfff, 0xfff, 0xfff, 0x20a, 0x343, 0x3a1, 0xfff, - 0xfff, 0xfff, 0x2d7, 0x2d3, 0x1aa, 0x4c5, 0xfff, 0xfff, - 0xfff, 0x42b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x3e9, 0xfff, 0x20b, 0x260, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x37c, 0x2fd, - 0xfff, 0xfff, 0x2c8, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x31e, 0xfff, 0x335, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x135, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x35c, 0x4dd, 0x129, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x1ef, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x34e, 0xfff, 0xfff, 0xfff, 0xfff, 0x407, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x3ad, 0xfff, 0xfff, 0xfff, - 0x379, 0xfff, 0xfff, 0x1d0, 0x38d, 0xfff, 0xfff, 0x1e8, - 0x184, 0x3c1, 0x1c4, 0xfff, 0x1f9, 0xfff, 0xfff, 0x424, - 0xfff, 0xfff, 0xfff, 0xfff, 0x1d3, 0x0d4, 0xfff, 0x4e9, - 0xfff, 0xfff, 0xfff, 0x530, 0x107, 0xfff, 0x106, 0x04f, - 0xfff, 0xfff, 0x4c7, 0x503, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x15c, 0xfff, 0x23f, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x4f3, 0xfff, 0xfff, 0x3c7, - 0xfff, 0x278, 0xfff, 0xfff, 0x0a6, 0xfff, 0xfff, 0xfff, - 0x122, 0x1cf, 0xfff, 0x327, 0xfff, 0x2e5, 0xfff, 0x29d, - 0xfff, 0xfff, 0x3f1, 0xfff, 0xfff, 0x48d, 0xfff, 0xfff, - 0xfff, 0xfff, 0x054, 0xfff, 0xfff, 0xfff, 0xfff, 0x178, - 0x27e, 0x4e0, 0x352, 0x02f, 0x09c, 0xfff, 0x2a0, 0xfff, - 0xfff, 0x46a, 0x457, 0xfff, 0xfff, 0x501, 0xfff, 0x2ba, - 0xfff, 0xfff, 0xfff, 0x54e, 0x2e7, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x551, 0xfff, 0xfff, 0x1db, 0x2aa, 0xfff, - 0xfff, 0x4bc, 0xfff, 0xfff, 0x395, 0xfff, 0x0de, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x455, 0xfff, 0x17e, - 0xfff, 0x221, 0x4a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x388, 0xfff, 0xfff, 0xfff, 0x308, 0xfff, 0xfff, 0xfff, - 0x20e, 0x4b9, 0xfff, 0x273, 0x20c, 0x09e, 0xfff, 0x057, - 0xfff, 0xfff, 0xfff, 0xfff, 0x3f2, 0xfff, 0x1a8, 0x3a6, - 0x14c, 0xfff, 0xfff, 0x071, 0xfff, 0xfff, 0x53a, 0xfff, - 0xfff, 0xfff, 0xfff, 0x109, 0xfff, 0xfff, 0x399, 0xfff, - 0x061, 0x4f0, 0x39e, 0x244, 0xfff, 0x035, 0xfff, 0xfff, - 0x305, 0x47e, 0x297, 0xfff, 0xfff, 0x2b8, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1bc, 0xfff, 0x2fc, - 0xfff, 0xfff, 0x554, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b6, - 0xfff, 0xfff, 0xfff, 0x515, 0x397, 0xfff, 0xfff, 0x12f, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e5, - 0xfff, 0x4fc, 0xfff, 0xfff, 0x05e, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x0a8, 0x3af, 0x015, 0xfff, 0xfff, 0xfff, - 0xfff, 0x138, 0xfff, 0xfff, 0xfff, 0x540, 0xfff, 0xfff, - 0xfff, 0x027, 0x523, 0x2f0, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x16c, 0xfff, 0x27d, 0xfff, 0xfff, 0xfff, - 0xfff, 0x04c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4dc, - 0xfff, 0xfff, 0x059, 0x301, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x1a3, 0xfff, 0x15a, 0xfff, 0xfff, - 0x0a5, 0xfff, 0x435, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x051, 0xfff, 0xfff, 0x131, 0xfff, 0x4f4, 0xfff, - 0xfff, 0xfff, 0xfff, 0x441, 0xfff, 0x4fb, 0xfff, 0x03b, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ed, 0x274, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d3, 0x55e, 0x1b3, - 0xfff, 0x0bd, 0xfff, 0xfff, 0xfff, 0xfff, 0x225, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x4b7, 0xfff, 0xfff, 0x2ff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c3, 0xfff, - 0x383, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f6, - 0xfff, 0xfff, 0x1ee, 0xfff, 0x03d, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x26f, 0x1dc, 0xfff, 0x0db, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x0ce, 0xfff, 0xfff, 0x127, 0x03a, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x311, 0xfff, - 0xfff, 0x13d, 0x09d, 0x47b, 0x2a6, 0x50d, 0x510, 0x19a, - 0xfff, 0x354, 0x414, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x44c, 0x3b0, 0xfff, 0x23d, 0x429, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x4c0, 0x416, 0xfff, 0x05b, 0xfff, 0xfff, 0x137, 0xfff, - 0x25f, 0x49f, 0xfff, 0x279, 0x013, 0xfff, 0xfff, 0xfff, - 0x269, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d0, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x077, 0xfff, 0xfff, 0x3fb, - 0xfff, 0xfff, 0xfff, 0xfff, 0x271, 0x3a0, 0xfff, 0xfff, - 0x40f, 0xfff, 0xfff, 0x3de, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ab, 0x26a, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x489, 0xfff, 0xfff, - 0x252, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b7, 0x42f, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b7, - 0xfff, 0x2bb, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x0f7, 0x01d, 0xfff, 0x067, 0xfff, - 0xfff, 0xfff, 0xfff, 0x4e2, 0xfff, 0xfff, 0x4bb, 0xfff, - 0xfff, 0xfff, 0x17b, 0xfff, 0x0ee, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x36e, 0xfff, 0xfff, 0xfff, 0x533, 0xfff, - 0xfff, 0xfff, 0x4d4, 0x356, 0xfff, 0xfff, 0x375, 0xfff, - 0xfff, 0xfff, 0xfff, 0x4a4, 0x513, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4ff, 0xfff, 0x2af, - 0xfff, 0xfff, 0x026, 0xfff, 0x0ad, 0xfff, 0xfff, 0xfff, - 0xfff, 0x26e, 0xfff, 0xfff, 0xfff, 0xfff, 0x493, 0xfff, - 0x463, 0x4d2, 0x4be, 0xfff, 0xfff, 0xfff, 0xfff, 0x4f2, - 0x0b6, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x32d, 0x315, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x13a, 0x4a1, 0xfff, 0x27a, 0xfff, 0xfff, 0xfff, - 0x47a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x334, 0xfff, 0xfff, 0xfff, 0xfff, 0x54c, 0xfff, 0xfff, - 0xfff, 0x0c9, 0x007, 0xfff, 0xfff, 0x12e, 0xfff, 0x0ff, - 0xfff, 0xfff, 0x3f5, 0x509, 0xfff, 0xfff, 0xfff, 0xfff, - 0x1c3, 0x2ad, 0xfff, 0xfff, 0x47c, 0x261, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x152, 0xfff, 0xfff, 0xfff, 0x339, - 0xfff, 0x243, 0x1c0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x063, 0xfff, 0xfff, 0x254, 0xfff, 0xfff, 0x173, 0xfff, - 0x0c7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x362, 0x259, 0x485, 0x374, 0x0dc, 0x3ab, 0xfff, - 0x1c5, 0x534, 0x544, 0xfff, 0xfff, 0x508, 0xfff, 0x402, - 0x408, 0xfff, 0x0e7, 0xfff, 0xfff, 0x00a, 0x205, 0xfff, - 0xfff, 0x2b9, 0xfff, 0xfff, 0xfff, 0x465, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x23a, 0xfff, 0xfff, 0xfff, - 0xfff, 0x147, 0x19d, 0x115, 0x214, 0xfff, 0x090, 0x368, - 0xfff, 0x210, 0xfff, 0xfff, 0x280, 0x52a, 0x163, 0x148, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x326, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x2de, 0xfff, 0xfff, 0xfff, 0xfff, - 0x206, 0x2c1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x189, 0xfff, 0xfff, 0xfff, 0xfff, 0x367, 0xfff, 0x1a4, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x443, 0xfff, 0x27b, - 0xfff, 0xfff, 0x251, 0x549, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x188, 0x04b, 0xfff, 0xfff, 0xfff, 0x31f, - 0x4a6, 0xfff, 0x246, 0x1de, 0x156, 0xfff, 0xfff, 0xfff, - 0x3a9, 0xfff, 0xfff, 0xfff, 0x2fa, 0xfff, 0x128, 0x0d1, - 0x449, 0x255, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x258, 0xfff, 0xfff, 0xfff, - 0x532, 0xfff, 0xfff, 0xfff, 0x303, 0x517, 0xfff, 0xfff, - 0x2a9, 0x24a, 0xfff, 0xfff, 0x231, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x4b6, 0x516, 0xfff, 0xfff, 0x0e4, 0x0eb, - 0xfff, 0x4e4, 0xfff, 0x275, 0xfff, 0xfff, 0x031, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x025, 0x21a, 0xfff, 0x0cc, - 0x45f, 0x3d9, 0x289, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x23e, 0xfff, 0xfff, 0xfff, 0x438, 0x097, - 0x419, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x0a9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x37e, 0x0e0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x431, - 0x372, 0xfff, 0xfff, 0xfff, 0x1ba, 0x06e, 0xfff, 0x1b1, - 0xfff, 0xfff, 0x12a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x193, 0xfff, 0xfff, 0xfff, 0xfff, 0x10a, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x048, 0x1b4, - 0xfff, 0xfff, 0xfff, 0xfff, 0x295, 0x140, 0x108, 0xfff, - 0xfff, 0xfff, 0xfff, 0x16f, 0xfff, 0x0a4, 0x37a, 0xfff, - 0x29a, 0xfff, 0x284, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c6, - 0x2a2, 0x3a3, 0xfff, 0x201, 0xfff, 0xfff, 0xfff, 0x4bd, - 0x005, 0x54a, 0x3b5, 0x204, 0x2ee, 0x11d, 0x436, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x3ec, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x11f, 0x498, 0x21c, 0xfff, - 0xfff, 0xfff, 0x3d6, 0xfff, 0x4ab, 0xfff, 0x432, 0x2eb, - 0x542, 0x4fd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x4ce, 0xfff, 0xfff, 0x2fb, 0xfff, - 0xfff, 0x2e1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b9, 0x037, 0x0dd, - 0xfff, 0xfff, 0xfff, 0x2bf, 0x521, 0x496, 0x095, 0xfff, - 0xfff, 0x328, 0x070, 0x1bf, 0xfff, 0x393, 0xfff, 0xfff, - 0x102, 0xfff, 0xfff, 0x21b, 0xfff, 0x142, 0x263, 0x519, - 0xfff, 0x2a5, 0x177, 0xfff, 0x14d, 0x471, 0x4ae, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x1f6, 0xfff, 0x481, 0xfff, 0xfff, 0xfff, 0x151, 0xfff, - 0xfff, 0xfff, 0x085, 0x33f, 0xfff, 0xfff, 0xfff, 0x084, - 0xfff, 0xfff, 0xfff, 0x345, 0x3a2, 0xfff, 0xfff, 0x0a0, - 0x0da, 0x024, 0xfff, 0xfff, 0xfff, 0x1bd, 0xfff, 0x55c, - 0x467, 0x445, 0xfff, 0xfff, 0xfff, 0x052, 0xfff, 0xfff, - 0xfff, 0xfff, 0x51e, 0xfff, 0xfff, 0x39d, 0xfff, 0x35f, - 0xfff, 0x376, 0x3ee, 0xfff, 0xfff, 0xfff, 0xfff, 0x448, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x16a, - 0xfff, 0x036, 0x38f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x211, - 0xfff, 0xfff, 0xfff, 0x230, 0xfff, 0xfff, 0x3ba, 0xfff, - 0xfff, 0xfff, 0x3ce, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x229, 0xfff, 0x176, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x00b, 0xfff, 0x162, 0x018, 0xfff, - 0xfff, 0x233, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x400, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x12b, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x3f4, 0xfff, 0x0f0, 0xfff, 0x1ac, 0xfff, 0xfff, - 0x119, 0xfff, 0x2c0, 0xfff, 0xfff, 0xfff, 0x49b, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x23c, 0xfff, - 0x4b3, 0x010, 0x064, 0xfff, 0xfff, 0x4ba, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x3c2, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x006, 0x196, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x100, 0x191, 0xfff, - 0x1ea, 0x29f, 0xfff, 0xfff, 0xfff, 0x276, 0xfff, 0xfff, - 0x2b1, 0x3b9, 0xfff, 0x03c, 0xfff, 0xfff, 0xfff, 0x180, - 0xfff, 0x08f, 0xfff, 0xfff, 0x19e, 0x019, 0xfff, 0x0b0, - 0x0fd, 0x332, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x06b, 0x2e8, 0xfff, 0x446, 0xfff, 0xfff, 0x004, - 0x247, 0x197, 0xfff, 0x112, 0x169, 0x292, 0xfff, 0x302, - 0xfff, 0xfff, 0x33b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x287, 0x21f, 0xfff, 0x3ea, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e7, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x3a8, 0xfff, 0xfff, 0x2bc, 0xfff, - 0x484, 0x296, 0xfff, 0x1c9, 0x08c, 0x1e5, 0x48a, 0xfff, - 0x360, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x1ca, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x10d, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x066, 0x2ea, 0x28b, 0x25b, 0xfff, 0x072, - 0xfff, 0xfff, 0xfff, 0xfff, 0x2b6, 0xfff, 0xfff, 0x272, - 0xfff, 0xfff, 0x525, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x2ca, 0xfff, 0xfff, 0xfff, 0x299, 0xfff, 0xfff, 0xfff, - 0x558, 0x41a, 0xfff, 0x4f7, 0x557, 0xfff, 0x4a0, 0x344, - 0x12c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x125, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x40e, 0xfff, 0xfff, 0x502, 0xfff, 0x103, 0x3e6, 0xfff, - 0x527, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x45d, 0xfff, 0xfff, 0xfff, 0xfff, - 0x44e, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d2, 0x4c9, 0x35e, - 0x459, 0x2d9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x17d, - 0x0c4, 0xfff, 0xfff, 0xfff, 0x3ac, 0x390, 0x094, 0xfff, - 0x483, 0x0ab, 0xfff, 0x253, 0xfff, 0x391, 0xfff, 0xfff, - 0xfff, 0xfff, 0x123, 0x0ef, 0xfff, 0xfff, 0xfff, 0x330, - 0x38c, 0xfff, 0xfff, 0x2ae, 0xfff, 0xfff, 0xfff, 0x042, - 0x012, 0x06d, 0xfff, 0xfff, 0xfff, 0x32a, 0x3db, 0x364, - 0x2dc, 0xfff, 0x30f, 0x3d7, 0x4a5, 0x050, 0xfff, 0xfff, - 0x029, 0xfff, 0xfff, 0xfff, 0xfff, 0x1d1, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x480, 0xfff, - 0x4ed, 0x081, 0x0a1, 0xfff, 0xfff, 0xfff, 0x30e, 0x52f, - 0x257, 0xfff, 0xfff, 0x447, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x401, 0x3cc, 0xfff, 0xfff, 0x0fb, - 0x2c9, 0x42a, 0x314, 0x33e, 0x3bd, 0x318, 0xfff, 0x10e, - 0x2a1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x24c, - 0x506, 0xfff, 0x267, 0xfff, 0xfff, 0x219, 0xfff, 0x1eb, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x309, 0x3e2, 0x46c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x384, 0xfff, 0xfff, 0xfff, 0xfff, 0x50c, 0xfff, 0x24b, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x038, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x194, - 0x143, 0x3e3, 0xfff, 0xfff, 0xfff, 0x4c2, 0xfff, 0xfff, - 0x0e1, 0x25c, 0xfff, 0x237, 0xfff, 0x1fe, 0xfff, 0xfff, - 0xfff, 0x065, 0x2a4, 0xfff, 0x386, 0x55a, 0x11b, 0xfff, - 0xfff, 0x192, 0xfff, 0x183, 0x00e, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x4b2, 0x18e, 0xfff, 0xfff, 0xfff, - 0xfff, 0x486, 0x4ef, 0x0c6, 0x380, 0xfff, 0x4a8, 0xfff, - 0x0c5, 0xfff, 0xfff, 0xfff, 0xfff, 0x093, 0x1b8, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e6, - 0xfff, 0x0f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x28e, 0xfff, 0x53b, 0x420, 0x22a, 0x33a, 0xfff, 0x387, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2a3, 0xfff, 0xfff, - 0xfff, 0x428, 0x500, 0xfff, 0xfff, 0x120, 0x2c6, 0x290, - 0x2f5, 0x0e3, 0xfff, 0x0b7, 0xfff, 0x319, 0x474, 0xfff, - 0xfff, 0xfff, 0x529, 0x014, 0xfff, 0x41b, 0x40a, 0x18b, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d9, - 0xfff, 0x38a, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ce, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x3b1, 0xfff, 0xfff, 0x05d, - 0x2c4, 0xfff, 0xfff, 0x4af, 0xfff, 0x030, 0xfff, 0xfff, - 0x203, 0xfff, 0x277, 0x256, 0xfff, 0xfff, 0xfff, 0x4f9, - 0xfff, 0x2c7, 0xfff, 0x466, 0x016, 0x1cd, 0xfff, 0x167, - 0xfff, 0xfff, 0x0c8, 0xfff, 0x43d, 0xfff, 0xfff, 0x020, - 0xfff, 0xfff, 0x232, 0x1cb, 0x1e0, 0xfff, 0xfff, 0x347, - 0xfff, 0x478, 0xfff, 0x365, 0xfff, 0xfff, 0xfff, 0xfff, - 0x358, 0xfff, 0x10b, 0xfff, 0x35d, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x452, 0x22d, 0xfff, 0xfff, 0x47d, 0xfff, - 0x2f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x460, 0xfff, - 0xfff, 0xfff, 0x50b, 0xfff, 0xfff, 0xfff, 0x2ec, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x4b1, 0x422, 0xfff, 0xfff, - 0xfff, 0x2d4, 0xfff, 0x239, 0xfff, 0xfff, 0xfff, 0x439, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x491, 0x075, 0xfff, 0xfff, 0xfff, 0x06c, 0xfff, - 0xfff, 0x0f9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x139, 0xfff, 0x4f6, 0xfff, 0xfff, 0x409, 0xfff, - 0xfff, 0x15b, 0xfff, 0xfff, 0x348, 0xfff, 0xfff, 0xfff, - 0xfff, 0x4a2, 0x49d, 0xfff, 0x033, 0x175, 0xfff, 0x039, - 0xfff, 0x312, 0x40c, 0xfff, 0xfff, 0x325, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x4aa, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0x165, 0x3bc, 0x48c, 0x310, 0x096, - 0xfff, 0xfff, 0x250, 0x1a2, 0xfff, 0xfff, 0xfff, 0xfff, - 0x20d, 0x2ac, 0xfff, 0xfff, 0x39b, 0xfff, 0x377, 0xfff, - 0x512, 0x495, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x357, 0x4ea, 0xfff, 0xfff, - 0xfff, 0xfff, 0x198, 0xfff, 0xfff, 0xfff, 0x434, 0x04a, - 0xfff, 0xfff, 0xfff, 0xfff, 0x062, 0xfff, 0x1d6, 0x1c8, - 0xfff, 0x1f3, 0x281, 0xfff, 0x462, 0xfff, 0xfff, 0xfff, - 0x4b0, 0xfff, 0x207, 0xfff, 0xfff, 0xfff, 0xfff, 0x3dd, - 0xfff, 0xfff, 0x55d, 0xfff, 0x552, 0x494, 0x1af, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x227, 0xfff, 0xfff, 0x069, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x43e, - 0x0b5, 0xfff, 0x524, 0x2d2, 0xfff, 0xfff, 0xfff, 0x28f, - 0xfff, 0x01b, 0x50e, 0xfff, 0xfff, 0x1bb, 0xfff, 0xfff, - 0x41d, 0xfff, 0x32e, 0x48e, 0xfff, 0x1f7, 0x224, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x394, 0xfff, 0xfff, 0xfff, - 0xfff, 0x52c, 0xfff, 0xfff, 0xfff, 0x392, 0xfff, 0x1e7, - 0xfff, 0xfff, 0x3f9, 0x3a7, 0xfff, 0x51f, 0xfff, 0x0bb, - 0x118, 0x3ca, 0xfff, 0x1dd, 0xfff, 0x48b, 0xfff, 0xfff, - 0xfff, 0xfff, 0x50f, 0xfff, 0x0d6, 0xfff, 0x1fa, 0xfff, - 0x11e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d7, 0xfff, 0x078, - 0x008, 0xfff, 0x25d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x032, 0x33c, 0xfff, 0x4d9, 0x160, 0xfff, 0xfff, 0x300, - 0x0b1, 0xfff, 0x322, 0xfff, 0x4ec, 0xfff, 0xfff, 0x200, - 0x00c, 0x369, 0x473, 0xfff, 0xfff, 0x32c, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x53e, 0x3d4, 0x417, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x34b, 0x001, 0x39a, 0x02c, 0xfff, 0xfff, 0x2ce, 0x00f, - 0xfff, 0x0ba, 0xfff, 0xfff, 0xfff, 0xfff, 0x060, 0xfff, - 0x406, 0xfff, 0xfff, 0xfff, 0x4ee, 0x4ac, 0xfff, 0x43f, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x29b, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x216, - 0x190, 0xfff, 0x396, 0x464, 0xfff, 0xfff, 0x323, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e9, 0xfff, 0x26d, - 0x2cd, 0x040, 0xfff, 0xfff, 0xfff, 0xfff, 0x38b, 0x3c0, - 0xfff, 0xfff, 0xfff, 0x1f2, 0xfff, 0x0ea, 0xfff, 0xfff, - 0x472, 0xfff, 0x1fb, 0xfff, 0xfff, 0x0af, 0x27f, 0xfff, - 0xfff, 0xfff, 0x479, 0x023, 0xfff, 0x0d8, 0x3b3, 0xfff, - 0xfff, 0xfff, 0x121, 0xfff, 0xfff, 0x3bf, 0xfff, 0xfff, - 0x16b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x45a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0x0be, 0xfff, 0xfff, 0xfff, 0x111, 0xfff, 0x220, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0x09b, 0x218, 0xfff, 0x022, 0x202, 0xfff, - 0x4c8, 0xfff, 0x0ed, 0xfff, 0xfff, 0x182, 0xfff, 0xfff, - 0xfff, 0x17f, 0x213, 0xfff, 0x321, 0x36a, 0xfff, 0x086, - 0xfff, 0xfff, 0xfff, 0x43b, 0x088, 0xfff, 0xfff, 0xfff, - 0xfff, 0x26c, 0xfff, 0x2f8, 0x3b4, 0xfff, 0xfff, 0xfff, - 0x132, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x333, 0x444, - 0x0c1, 0x4d8, 0x46d, 0x264, 0xfff, 0xfff, 0xfff, 0xfff, - 0x426, 0xfff, 0xfff, 0xfff, 0xfff, 0x2fe, 0xfff, 0xfff, - 0xfff, 0xfff, 0x011, 0xfff, 0x05f, 0xfff, 0xfff, 0xfff, - 0xfff, 0x10c, 0x101, 0xfff, 0xfff, 0xfff, 0xfff, 0x110, - 0xfff, 0x044, 0x304, 0x361, 0x404, 0xfff, 0x51b, 0x099, - 0xfff, 0x440, 0xfff, 0xfff, 0xfff, 0x222, 0xfff, 0xfff, - 0xfff, 0xfff, 0x1b5, 0xfff, 0x136, 0x430, 0xfff, 0x1da, - 0xfff, 0xfff, 0xfff, 0x043, 0xfff, 0x17c, 0xfff, 0xfff, - 0xfff, 0x01c, 0xfff, 0xfff, 0xfff, 0x425, 0x236, 0xfff, - 0x317, 0xfff, 0xfff, 0x437, 0x3fc, 0xfff, 0x1f1, 0xfff, - 0x324, 0xfff, 0xfff, 0x0ca, 0x306, 0xfff, 0x548, 0xfff, - 0x46e, 0xfff, 0xfff, 0xfff, 0x4b8, 0x1c2, 0x286, 0xfff, - 0xfff, 0x087, 0x18a, 0x19f, 0xfff, 0xfff, 0xfff, 0xfff, - 0x18c, 0xfff, 0x215, 0xfff, 0xfff, 0xfff, 0xfff, 0x283, - 0xfff, 0xfff, 0xfff, 0x126, 0xfff, 0xfff, 0x370, 0xfff, - 0x53f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x31c, 0xfff, - 0x4d1, 0xfff, 0xfff, 0xfff, 0x021, 0xfff, 0x157, 0xfff, - 0xfff, 0x028, 0x16e, 0xfff, 0x421, 0xfff, 0x1c6, 0xfff, - 0xfff, 0x511, 0xfff, 0xfff, 0x39c, 0x46f, 0x1b2, 0xfff, - 0xfff, 0x316, 0xfff, 0xfff, 0x009, 0xfff, 0xfff, 0x195, - 0xfff, 0x240, 0x546, 0xfff, 0xfff, 0x520, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x454, 0xfff, 0xfff, 0xfff, - 0x3f3, 0xfff, 0xfff, 0x187, 0xfff, 0x4a9, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x51c, 0x453, 0x1e6, 0xfff, - 0xfff, 0xfff, 0x1b0, 0xfff, 0x477, 0xfff, 0xfff, 0xfff, - 0x4fe, 0xfff, 0x32f, 0xfff, 0xfff, 0x15e, 0x1d4, 0xfff, - 0x0e5, 0xfff, 0xfff, 0xfff, 0x242, 0x14b, 0x046, 0xfff, - 0x3f6, 0x3bb, 0x3e4, 0xfff, 0xfff, 0x2e3, 0xfff, 0x245, - 0xfff, 0x149, 0xfff, 0xfff, 0xfff, 0x2db, 0xfff, 0xfff, - 0x181, 0xfff, 0x089, 0x2c5, 0xfff, 0x1f5, 0xfff, 0x2d6, - 0x507, 0xfff, 0x42d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0x080, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, - 0xfff, 0xfff, 0xfff, 0xfff, 0x3c3, 0x320, 0xfff, 0x1e1, - 0xfff, 0x0f5, 0x13b, 0xfff, 0xfff, 0xfff, 0x003, 0x4da, - 0xfff, 0xfff, 0xfff, 0x42c, 0xfff, 0xfff, 0x0cb, 0xfff, - 0x536, 0x2c3, 0xfff, 0xfff, 0xfff, 0xfff, 0x199, 0xfff, - 0xfff, 0x0c0, 0xfff, 0x01e, 0x497, 0xfff, 0xfff, 0x3e5, - 0xfff, 0xfff, 0xfff, 0x0cf, 0xfff, 0x2bd, 0xfff, 0x223, + 0xfff, 0x000, 0x451, 0xfff, 0xfff, 0x3cf, 0xfff, 0x041, + 0xfff, 0xfff, 0xfff, 0xfff, 0x28a, 0xfff, 0x492, 0xfff, + 0x145, 0xfff, 0xfff, 0x514, 0xfff, 0x082, 0xfff, 0xfff, + 0xfff, 0x249, 0x38e, 0x410, 0xfff, 0x104, 0x208, 0x1c7, + 0xfff, 0xfff, 0xfff, 0xfff, 0x2cb, 0xfff, 0xfff, 0xfff, + 0x0c3, 0x34d, 0x4d3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x186, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x30c, 0x555, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x166, 0xfff, 0xfff, 0xfff, 0xfff, + 0x385, 0x14e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e1, + 0xfff, 0xfff, 0xfff, 0xfff, 0x538, 0xfff, 0x16d, 0xfff, + 0xfff, 0xfff, 0x45b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x29c, 0x2cc, 0x30b, 0x2b3, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0b3, 0xfff, 0x2f7, + 0xfff, 0x32b, 0xfff, 0xfff, 0xfff, 0xfff, 0x0a7, 0xfff, + 0xfff, 0x2da, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x07e, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x11c, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x22f, 0xfff, 0x1f4, 0xfff, 0xfff, + 0x2b0, 0x504, 0xfff, 0x114, 0xfff, 0xfff, 0xfff, 0x21d, + 0xfff, 0xfff, 0xfff, 0xfff, 0x00d, 0x3c4, 0x340, 0x10f, + 0xfff, 0xfff, 0x266, 0x02e, 0xfff, 0xfff, 0xfff, 0x4f8, + 0x337, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x07b, 0x168, 0xfff, 0xfff, 0x0fe, + 0xfff, 0xfff, 0x51a, 0xfff, 0x458, 0xfff, 0x36d, 0xfff, + 0xfff, 0xfff, 0xfff, 0x073, 0x37d, 0x415, 0x550, 0xfff, + 0xfff, 0xfff, 0x23b, 0x4b4, 0xfff, 0xfff, 0xfff, 0x1a1, + 0xfff, 0xfff, 0x3aa, 0xfff, 0x117, 0x04d, 0x341, 0xfff, + 0xfff, 0xfff, 0xfff, 0x518, 0x03e, 0x0f2, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x363, 0xfff, 0x0b9, 0xfff, 0xfff, + 0x241, 0xfff, 0xfff, 0x049, 0xfff, 0xfff, 0xfff, 0xfff, + 0x15f, 0x52d, 0xfff, 0xfff, 0xfff, 0x29e, 0xfff, 0xfff, + 0xfff, 0xfff, 0x4cf, 0x0fc, 0xfff, 0x36f, 0x3d3, 0xfff, + 0x228, 0xfff, 0xfff, 0x45e, 0xfff, 0xfff, 0xfff, 0xfff, + 0x238, 0xfff, 0xfff, 0xfff, 0xfff, 0x47f, 0xfff, 0xfff, + 0x43a, 0x265, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e8, + 0xfff, 0xfff, 0x01a, 0xfff, 0xfff, 0xfff, 0xfff, 0x21e, + 0x1fc, 0x40b, 0xfff, 0xfff, 0xfff, 0x2d0, 0x159, 0xfff, + 0xfff, 0x313, 0xfff, 0xfff, 0x05c, 0x4cc, 0xfff, 0xfff, + 0x0f6, 0x3d5, 0xfff, 0xfff, 0xfff, 0x54f, 0xfff, 0xfff, + 0xfff, 0x172, 0x1e4, 0x07c, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x53c, 0x1ad, 0x535, + 0x19b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x092, 0xfff, 0x2be, 0xfff, 0xfff, 0x482, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0e6, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x476, 0xfff, 0x51d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x342, 0x2b5, 0x22e, 0x09a, 0xfff, 0x08d, + 0x44f, 0x3ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d1, 0xfff, + 0xfff, 0x543, 0xfff, 0x48f, 0xfff, 0x3d2, 0xfff, 0x0d5, + 0x113, 0x0ec, 0x427, 0xfff, 0xfff, 0xfff, 0x4c4, 0xfff, + 0xfff, 0x50a, 0xfff, 0x144, 0xfff, 0x105, 0x39f, 0x294, + 0x164, 0xfff, 0x31a, 0xfff, 0xfff, 0x49a, 0xfff, 0x130, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1be, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x49e, 0x371, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x0e8, 0x49c, 0x0f4, 0xfff, + 0x338, 0x1a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x36c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x1ae, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x31b, 0xfff, 0xfff, 0x2dd, 0x522, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f4, + 0x3c6, 0x30d, 0xfff, 0xfff, 0xfff, 0xfff, 0x34c, 0x18f, + 0x30a, 0xfff, 0x01f, 0x079, 0xfff, 0xfff, 0x54d, 0x46b, + 0x28c, 0x37f, 0xfff, 0xfff, 0xfff, 0xfff, 0x355, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x14f, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x359, 0x3fe, 0x3c5, 0xfff, 0xfff, + 0xfff, 0xfff, 0x423, 0xfff, 0xfff, 0x34a, 0x22c, 0xfff, + 0x25a, 0xfff, 0xfff, 0x4ad, 0xfff, 0x28d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x547, 0xfff, 0xfff, 0xfff, 0xfff, + 0x2e2, 0xfff, 0xfff, 0x1d5, 0xfff, 0x2a8, 0xfff, 0xfff, + 0x03f, 0xfff, 0xfff, 0xfff, 0xfff, 0x3eb, 0x0fa, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x55b, 0xfff, + 0x08e, 0xfff, 0x3ae, 0xfff, 0x3a4, 0xfff, 0x282, 0x158, + 0xfff, 0x382, 0xfff, 0xfff, 0x499, 0xfff, 0xfff, 0x08a, + 0xfff, 0xfff, 0xfff, 0x456, 0x3be, 0xfff, 0x1e2, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x559, 0xfff, 0x1a0, 0xfff, + 0xfff, 0x0b4, 0xfff, 0xfff, 0xfff, 0x2df, 0xfff, 0xfff, + 0xfff, 0x07f, 0x4f5, 0xfff, 0xfff, 0x27c, 0x133, 0x017, + 0xfff, 0x3fd, 0xfff, 0xfff, 0xfff, 0x44d, 0x4cd, 0x17a, + 0x0d7, 0x537, 0xfff, 0xfff, 0x353, 0xfff, 0xfff, 0x351, + 0x366, 0xfff, 0x44a, 0xfff, 0x1a6, 0xfff, 0xfff, 0xfff, + 0x291, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1e3, + 0xfff, 0xfff, 0xfff, 0xfff, 0x389, 0xfff, 0x07a, 0xfff, + 0x1b6, 0x2ed, 0xfff, 0xfff, 0xfff, 0xfff, 0x24e, 0x074, + 0xfff, 0xfff, 0x3dc, 0xfff, 0x4e3, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4eb, 0xfff, 0xfff, 0x3b8, 0x4de, 0xfff, 0x19c, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x262, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x076, 0x4e8, 0x3da, + 0xfff, 0x531, 0xfff, 0xfff, 0x14a, 0xfff, 0x0a2, 0x433, + 0x3df, 0x1e9, 0xfff, 0xfff, 0xfff, 0xfff, 0x3e7, 0x285, + 0x2d8, 0xfff, 0xfff, 0xfff, 0x349, 0x18d, 0x098, 0xfff, + 0x0df, 0x4bf, 0xfff, 0xfff, 0x0b2, 0xfff, 0x346, 0x24d, + 0xfff, 0xfff, 0xfff, 0x24f, 0x4fa, 0x2f9, 0xfff, 0xfff, + 0x3c9, 0xfff, 0x2b4, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x056, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x179, 0xfff, 0x0e9, 0x3f0, 0x33d, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x1fd, 0xfff, 0xfff, 0x526, 0xfff, + 0xfff, 0xfff, 0x53d, 0xfff, 0xfff, 0xfff, 0x170, 0x331, + 0xfff, 0x068, 0xfff, 0xfff, 0xfff, 0x3f7, 0xfff, 0x3d8, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x09f, 0x556, 0xfff, 0xfff, 0x02d, 0xfff, 0xfff, + 0x553, 0xfff, 0xfff, 0xfff, 0x1f0, 0xfff, 0xfff, 0x4d6, + 0x41e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d5, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x248, 0xfff, 0xfff, 0xfff, 0x0a3, + 0xfff, 0x217, 0xfff, 0xfff, 0xfff, 0x4f1, 0x209, 0xfff, + 0xfff, 0x475, 0x234, 0x52b, 0x398, 0xfff, 0x08b, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2c2, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x268, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4a3, 0xfff, 0x0aa, 0xfff, 0x1d9, 0xfff, 0xfff, + 0xfff, 0xfff, 0x155, 0xfff, 0xfff, 0xfff, 0xfff, 0x0bf, + 0x539, 0xfff, 0xfff, 0x2f1, 0x545, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2a7, 0x06f, 0xfff, 0x378, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x25e, 0xfff, + 0xfff, 0xfff, 0xfff, 0x15d, 0x02a, 0xfff, 0xfff, 0x0bc, + 0x235, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x150, 0xfff, 0x1a9, 0xfff, 0xfff, 0xfff, 0xfff, 0x381, + 0xfff, 0x04e, 0x270, 0x13f, 0xfff, 0xfff, 0x405, 0xfff, + 0x3cd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x2ef, 0xfff, 0x06a, 0xfff, 0xfff, 0xfff, 0x34f, + 0x212, 0xfff, 0xfff, 0x0e2, 0xfff, 0x083, 0x298, 0xfff, + 0xfff, 0xfff, 0x0c2, 0xfff, 0xfff, 0x52e, 0xfff, 0x488, + 0xfff, 0xfff, 0xfff, 0x36b, 0xfff, 0xfff, 0xfff, 0x442, + 0x091, 0xfff, 0x41c, 0xfff, 0xfff, 0x3a5, 0xfff, 0x4e6, + 0xfff, 0xfff, 0x40d, 0x31d, 0xfff, 0xfff, 0xfff, 0x4c1, + 0x053, 0xfff, 0x418, 0x13c, 0xfff, 0x350, 0xfff, 0x0ae, + 0xfff, 0xfff, 0x41f, 0xfff, 0x470, 0xfff, 0x4ca, 0xfff, + 0xfff, 0xfff, 0x02b, 0x450, 0xfff, 0x1f8, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x293, 0xfff, + 0xfff, 0xfff, 0xfff, 0x411, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x0b8, 0xfff, 0xfff, 0xfff, + 0x3e1, 0xfff, 0xfff, 0xfff, 0xfff, 0x43c, 0xfff, 0x2b2, + 0x2ab, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ec, + 0xfff, 0xfff, 0xfff, 0x3f8, 0x034, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x11a, 0xfff, 0x541, 0x45c, 0x134, + 0x1cc, 0xfff, 0xfff, 0xfff, 0x469, 0xfff, 0xfff, 0x44b, + 0x161, 0xfff, 0xfff, 0xfff, 0x055, 0xfff, 0xfff, 0xfff, + 0xfff, 0x307, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d1, 0xfff, + 0xfff, 0xfff, 0x124, 0x37b, 0x26b, 0x336, 0xfff, 0xfff, + 0x2e4, 0x3cb, 0xfff, 0xfff, 0x0f8, 0x3c8, 0xfff, 0xfff, + 0xfff, 0x461, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4b5, + 0x2cf, 0xfff, 0xfff, 0xfff, 0x20f, 0xfff, 0x35a, 0xfff, + 0x490, 0xfff, 0x185, 0xfff, 0xfff, 0xfff, 0xfff, 0x42e, + 0xfff, 0xfff, 0xfff, 0xfff, 0x54b, 0xfff, 0xfff, 0xfff, + 0x146, 0xfff, 0x412, 0xfff, 0xfff, 0xfff, 0x1ff, 0xfff, + 0xfff, 0x3e0, 0xfff, 0xfff, 0xfff, 0xfff, 0x2d5, 0xfff, + 0x4df, 0x505, 0xfff, 0x413, 0xfff, 0x1a5, 0xfff, 0x3b2, + 0xfff, 0xfff, 0xfff, 0x35b, 0xfff, 0x116, 0xfff, 0xfff, + 0x171, 0x4d0, 0xfff, 0x154, 0x12d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x468, 0x4db, 0xfff, + 0xfff, 0x1df, 0xfff, 0xfff, 0xfff, 0xfff, 0x05a, 0xfff, + 0x0f1, 0x403, 0xfff, 0x22b, 0x2e0, 0xfff, 0xfff, 0xfff, + 0x2b7, 0x373, 0xfff, 0xfff, 0xfff, 0xfff, 0x13e, 0xfff, + 0xfff, 0xfff, 0x0d0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x329, 0x1d2, 0x3fa, 0x047, 0xfff, 0x2f2, 0xfff, 0xfff, + 0x141, 0x0ac, 0x1d7, 0xfff, 0x07d, 0xfff, 0xfff, 0xfff, + 0x1c1, 0xfff, 0x487, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x045, 0xfff, 0xfff, 0xfff, 0xfff, + 0x288, 0x0cd, 0xfff, 0xfff, 0xfff, 0xfff, 0x226, 0x1d8, + 0xfff, 0x153, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4cb, + 0x528, 0xfff, 0xfff, 0xfff, 0x20a, 0x343, 0x3a1, 0xfff, + 0xfff, 0xfff, 0x2d7, 0x2d3, 0x1aa, 0x4c5, 0xfff, 0xfff, + 0xfff, 0x42b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3e9, 0xfff, 0x20b, 0x260, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x37c, 0x2fd, + 0xfff, 0xfff, 0x2c8, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x31e, 0xfff, 0x335, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x135, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x35c, 0x4dd, 0x129, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x1ef, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x34e, 0xfff, 0xfff, 0xfff, 0xfff, 0x407, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3ad, 0xfff, 0xfff, 0xfff, + 0x379, 0xfff, 0xfff, 0x1d0, 0x38d, 0xfff, 0xfff, 0x1e8, + 0x184, 0x3c1, 0x1c4, 0xfff, 0x1f9, 0xfff, 0xfff, 0x424, + 0xfff, 0xfff, 0xfff, 0xfff, 0x1d3, 0x0d4, 0xfff, 0x4e9, + 0xfff, 0xfff, 0xfff, 0x530, 0x107, 0xfff, 0x106, 0x04f, + 0xfff, 0xfff, 0x4c7, 0x503, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x15c, 0xfff, 0x23f, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4f3, 0xfff, 0xfff, 0x3c7, + 0xfff, 0x278, 0xfff, 0xfff, 0x0a6, 0xfff, 0xfff, 0xfff, + 0x122, 0x1cf, 0xfff, 0x327, 0xfff, 0x2e5, 0xfff, 0x29d, + 0xfff, 0xfff, 0x3f1, 0xfff, 0xfff, 0x48d, 0xfff, 0xfff, + 0xfff, 0xfff, 0x054, 0xfff, 0xfff, 0xfff, 0xfff, 0x178, + 0x27e, 0x4e0, 0x352, 0x02f, 0x09c, 0xfff, 0x2a0, 0xfff, + 0xfff, 0x46a, 0x457, 0xfff, 0xfff, 0x501, 0xfff, 0x2ba, + 0xfff, 0xfff, 0xfff, 0x54e, 0x2e7, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x551, 0xfff, 0xfff, 0x1db, 0x2aa, 0xfff, + 0xfff, 0x4bc, 0xfff, 0xfff, 0x395, 0xfff, 0x0de, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x455, 0xfff, 0x17e, + 0xfff, 0x221, 0x4a7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x388, 0xfff, 0xfff, 0xfff, 0x308, 0xfff, 0xfff, 0xfff, + 0x20e, 0x4b9, 0xfff, 0x273, 0x20c, 0x09e, 0xfff, 0x057, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3f2, 0xfff, 0x1a8, 0x3a6, + 0x14c, 0xfff, 0xfff, 0x071, 0xfff, 0xfff, 0x53a, 0xfff, + 0xfff, 0xfff, 0xfff, 0x109, 0xfff, 0xfff, 0x399, 0xfff, + 0x061, 0x4f0, 0x39e, 0x244, 0xfff, 0x035, 0xfff, 0xfff, + 0x305, 0x47e, 0x297, 0xfff, 0xfff, 0x2b8, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1bc, 0xfff, 0x2fc, + 0xfff, 0xfff, 0x554, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b6, + 0xfff, 0xfff, 0xfff, 0x515, 0x397, 0xfff, 0xfff, 0x12f, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e5, + 0xfff, 0x4fc, 0xfff, 0xfff, 0x05e, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x0a8, 0x3af, 0x015, 0xfff, 0xfff, 0xfff, + 0xfff, 0x138, 0xfff, 0xfff, 0xfff, 0x540, 0xfff, 0xfff, + 0xfff, 0x027, 0x523, 0x2f0, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x16c, 0xfff, 0x27d, 0xfff, 0xfff, 0xfff, + 0xfff, 0x04c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4dc, + 0xfff, 0xfff, 0x059, 0x301, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x1a3, 0xfff, 0x15a, 0xfff, 0xfff, + 0x0a5, 0xfff, 0x435, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x051, 0xfff, 0xfff, 0x131, 0xfff, 0x4f4, 0xfff, + 0xfff, 0xfff, 0xfff, 0x441, 0xfff, 0x4fb, 0xfff, 0x03b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ed, 0x274, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d3, 0x55e, 0x1b3, + 0xfff, 0x0bd, 0xfff, 0xfff, 0xfff, 0xfff, 0x225, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4b7, 0xfff, 0xfff, 0x2ff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c3, 0xfff, + 0x383, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2f6, + 0xfff, 0xfff, 0x1ee, 0xfff, 0x03d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x26f, 0x1dc, 0xfff, 0x0db, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x0ce, 0xfff, 0xfff, 0x127, 0x03a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x311, 0xfff, + 0xfff, 0x13d, 0x09d, 0x47b, 0x2a6, 0x50d, 0x510, 0x19a, + 0xfff, 0x354, 0x414, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x44c, 0x3b0, 0xfff, 0x23d, 0x429, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x4c0, 0x416, 0xfff, 0x05b, 0xfff, 0xfff, 0x137, 0xfff, + 0x25f, 0x49f, 0xfff, 0x279, 0x013, 0xfff, 0xfff, 0xfff, + 0x269, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3d0, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x077, 0xfff, 0xfff, 0x3fb, + 0xfff, 0xfff, 0xfff, 0xfff, 0x271, 0x3a0, 0xfff, 0xfff, + 0x40f, 0xfff, 0xfff, 0x3de, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ab, 0x26a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x489, 0xfff, 0xfff, + 0x252, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b7, 0x42f, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x3b7, + 0xfff, 0x2bb, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x0f7, 0x01d, 0xfff, 0x067, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4e2, 0xfff, 0xfff, 0x4bb, 0xfff, + 0xfff, 0xfff, 0x17b, 0xfff, 0x0ee, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x36e, 0xfff, 0xfff, 0xfff, 0x533, 0xfff, + 0xfff, 0xfff, 0x4d4, 0x356, 0xfff, 0xfff, 0x375, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4a4, 0x513, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4ff, 0xfff, 0x2af, + 0xfff, 0xfff, 0x026, 0xfff, 0x0ad, 0xfff, 0xfff, 0xfff, + 0xfff, 0x26e, 0xfff, 0xfff, 0xfff, 0xfff, 0x493, 0xfff, + 0x463, 0x4d2, 0x4be, 0xfff, 0xfff, 0xfff, 0xfff, 0x4f2, + 0x0b6, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x32d, 0x315, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x13a, 0x4a1, 0xfff, 0x27a, 0xfff, 0xfff, 0xfff, + 0x47a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x334, 0xfff, 0xfff, 0xfff, 0xfff, 0x54c, 0xfff, 0xfff, + 0xfff, 0x0c9, 0x007, 0xfff, 0xfff, 0x12e, 0xfff, 0x0ff, + 0xfff, 0xfff, 0x3f5, 0x509, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1c3, 0x2ad, 0xfff, 0xfff, 0x47c, 0x261, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x152, 0xfff, 0xfff, 0xfff, 0x339, + 0xfff, 0x243, 0x1c0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x063, 0xfff, 0xfff, 0x254, 0xfff, 0xfff, 0x173, 0xfff, + 0x0c7, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x362, 0x259, 0x485, 0x374, 0x0dc, 0x3ab, 0xfff, + 0x1c5, 0x534, 0x544, 0xfff, 0xfff, 0x508, 0xfff, 0x402, + 0x408, 0xfff, 0x0e7, 0xfff, 0xfff, 0x00a, 0x205, 0xfff, + 0xfff, 0x2b9, 0xfff, 0xfff, 0xfff, 0x465, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x23a, 0xfff, 0xfff, 0xfff, + 0xfff, 0x147, 0x19d, 0x115, 0x214, 0xfff, 0x090, 0x368, + 0xfff, 0x210, 0xfff, 0xfff, 0x280, 0x52a, 0x163, 0x148, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x326, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x2de, 0xfff, 0xfff, 0xfff, 0xfff, + 0x206, 0x2c1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x189, 0xfff, 0xfff, 0xfff, 0xfff, 0x367, 0xfff, 0x1a4, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x443, 0xfff, 0x27b, + 0xfff, 0xfff, 0x251, 0x549, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x188, 0x04b, 0xfff, 0xfff, 0xfff, 0x31f, + 0x4a6, 0xfff, 0x246, 0x1de, 0x156, 0xfff, 0xfff, 0xfff, + 0x3a9, 0xfff, 0xfff, 0xfff, 0x2fa, 0xfff, 0x128, 0x0d1, + 0x449, 0x255, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x258, 0xfff, 0xfff, 0xfff, + 0x532, 0xfff, 0xfff, 0xfff, 0x303, 0x517, 0xfff, 0xfff, + 0x2a9, 0x24a, 0xfff, 0xfff, 0x231, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x4b6, 0x516, 0xfff, 0xfff, 0x0e4, 0x0eb, + 0xfff, 0x4e4, 0xfff, 0x275, 0xfff, 0xfff, 0x031, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x025, 0x21a, 0xfff, 0x0cc, + 0x45f, 0x3d9, 0x289, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x23e, 0xfff, 0xfff, 0xfff, 0x438, 0x097, + 0x419, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x0a9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x37e, 0x0e0, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x431, + 0x372, 0xfff, 0xfff, 0xfff, 0x1ba, 0x06e, 0xfff, 0x1b1, + 0xfff, 0xfff, 0x12a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x193, 0xfff, 0xfff, 0xfff, 0xfff, 0x10a, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x048, 0x1b4, + 0xfff, 0xfff, 0xfff, 0xfff, 0x295, 0x140, 0x108, 0xfff, + 0xfff, 0xfff, 0xfff, 0x16f, 0xfff, 0x0a4, 0x37a, 0xfff, + 0x29a, 0xfff, 0x284, 0xfff, 0xfff, 0xfff, 0xfff, 0x4c6, + 0x2a2, 0x3a3, 0xfff, 0x201, 0xfff, 0xfff, 0xfff, 0x4bd, + 0x005, 0x54a, 0x3b5, 0x204, 0x2ee, 0x11d, 0x436, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3ec, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x11f, 0x498, 0x21c, 0xfff, + 0xfff, 0xfff, 0x3d6, 0xfff, 0x4ab, 0xfff, 0x432, 0x2eb, + 0x542, 0x4fd, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4ce, 0xfff, 0xfff, 0x2fb, 0xfff, + 0xfff, 0x2e1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x1b9, 0x037, 0x0dd, + 0xfff, 0xfff, 0xfff, 0x2bf, 0x521, 0x496, 0x095, 0xfff, + 0xfff, 0x328, 0x070, 0x1bf, 0xfff, 0x393, 0xfff, 0xfff, + 0x102, 0xfff, 0xfff, 0x21b, 0xfff, 0x142, 0x263, 0x519, + 0xfff, 0x2a5, 0x177, 0xfff, 0x14d, 0x471, 0x4ae, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1f6, 0xfff, 0x481, 0xfff, 0xfff, 0xfff, 0x151, 0xfff, + 0xfff, 0xfff, 0x085, 0x33f, 0xfff, 0xfff, 0xfff, 0x084, + 0xfff, 0xfff, 0xfff, 0x345, 0x3a2, 0xfff, 0xfff, 0x0a0, + 0x0da, 0x024, 0xfff, 0xfff, 0xfff, 0x1bd, 0xfff, 0x55c, + 0x467, 0x445, 0xfff, 0xfff, 0xfff, 0x052, 0xfff, 0xfff, + 0xfff, 0xfff, 0x51e, 0xfff, 0xfff, 0x39d, 0xfff, 0x35f, + 0xfff, 0x376, 0x3ee, 0xfff, 0xfff, 0xfff, 0xfff, 0x448, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x16a, + 0xfff, 0x036, 0x38f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x211, + 0xfff, 0xfff, 0xfff, 0x230, 0xfff, 0xfff, 0x3ba, 0xfff, + 0xfff, 0xfff, 0x3ce, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x229, 0xfff, 0x176, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x00b, 0xfff, 0x162, 0x018, 0xfff, + 0xfff, 0x233, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x400, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x12b, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x3f4, 0xfff, 0x0f0, 0xfff, 0x1ac, 0xfff, 0xfff, + 0x119, 0xfff, 0x2c0, 0xfff, 0xfff, 0xfff, 0x49b, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x23c, 0xfff, + 0x4b3, 0x010, 0x064, 0xfff, 0xfff, 0x4ba, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x3c2, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x006, 0x196, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x100, 0x191, 0xfff, + 0x1ea, 0x29f, 0xfff, 0xfff, 0xfff, 0x276, 0xfff, 0xfff, + 0x2b1, 0x3b9, 0xfff, 0x03c, 0xfff, 0xfff, 0xfff, 0x180, + 0xfff, 0x08f, 0xfff, 0xfff, 0x19e, 0x019, 0xfff, 0x0b0, + 0x0fd, 0x332, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x06b, 0x2e8, 0xfff, 0x446, 0xfff, 0xfff, 0x004, + 0x247, 0x197, 0xfff, 0x112, 0x169, 0x292, 0xfff, 0x302, + 0xfff, 0xfff, 0x33b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x287, 0x21f, 0xfff, 0x3ea, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x4e7, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x3a8, 0xfff, 0xfff, 0x2bc, 0xfff, + 0x484, 0x296, 0xfff, 0x1c9, 0x08c, 0x1e5, 0x48a, 0xfff, + 0x360, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x1ca, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x10d, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x066, 0x2ea, 0x28b, 0x25b, 0xfff, 0x072, + 0xfff, 0xfff, 0xfff, 0xfff, 0x2b6, 0xfff, 0xfff, 0x272, + 0xfff, 0xfff, 0x525, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x2ca, 0xfff, 0xfff, 0xfff, 0x299, 0xfff, 0xfff, 0xfff, + 0x558, 0x41a, 0xfff, 0x4f7, 0x557, 0xfff, 0x4a0, 0x344, + 0x12c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x125, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x40e, 0xfff, 0xfff, 0x502, 0xfff, 0x103, 0x3e6, 0xfff, + 0x527, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x45d, 0xfff, 0xfff, 0xfff, 0xfff, + 0x44e, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d2, 0x4c9, 0x35e, + 0x459, 0x2d9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x17d, + 0x0c4, 0xfff, 0xfff, 0xfff, 0x3ac, 0x390, 0x094, 0xfff, + 0x483, 0x0ab, 0xfff, 0x253, 0xfff, 0x391, 0xfff, 0xfff, + 0xfff, 0xfff, 0x123, 0x0ef, 0xfff, 0xfff, 0xfff, 0x330, + 0x38c, 0xfff, 0xfff, 0x2ae, 0xfff, 0xfff, 0xfff, 0x042, + 0x012, 0x06d, 0xfff, 0xfff, 0xfff, 0x32a, 0x3db, 0x364, + 0x2dc, 0xfff, 0x30f, 0x3d7, 0x4a5, 0x050, 0xfff, 0xfff, + 0x029, 0xfff, 0xfff, 0xfff, 0xfff, 0x1d1, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x480, 0xfff, + 0x4ed, 0x081, 0x0a1, 0xfff, 0xfff, 0xfff, 0x30e, 0x52f, + 0x257, 0xfff, 0xfff, 0x447, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x401, 0x3cc, 0xfff, 0xfff, 0x0fb, + 0x2c9, 0x42a, 0x314, 0x33e, 0x3bd, 0x318, 0xfff, 0x10e, + 0x2a1, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x24c, + 0x506, 0xfff, 0x267, 0xfff, 0xfff, 0x219, 0xfff, 0x1eb, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x309, 0x3e2, 0x46c, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x384, 0xfff, 0xfff, 0xfff, 0xfff, 0x50c, 0xfff, 0x24b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x038, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x194, + 0x143, 0x3e3, 0xfff, 0xfff, 0xfff, 0x4c2, 0xfff, 0xfff, + 0x0e1, 0x25c, 0xfff, 0x237, 0xfff, 0x1fe, 0xfff, 0xfff, + 0xfff, 0x065, 0x2a4, 0xfff, 0x386, 0x55a, 0x11b, 0xfff, + 0xfff, 0x192, 0xfff, 0x183, 0x00e, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x4b2, 0x18e, 0xfff, 0xfff, 0xfff, + 0xfff, 0x486, 0x4ef, 0x0c6, 0x380, 0xfff, 0x4a8, 0xfff, + 0x0c5, 0xfff, 0xfff, 0xfff, 0xfff, 0x093, 0x1b8, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e6, + 0xfff, 0x0f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x28e, 0xfff, 0x53b, 0x420, 0x22a, 0x33a, 0xfff, 0x387, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2a3, 0xfff, 0xfff, + 0xfff, 0x428, 0x500, 0xfff, 0xfff, 0x120, 0x2c6, 0x290, + 0x2f5, 0x0e3, 0xfff, 0x0b7, 0xfff, 0x319, 0x474, 0xfff, + 0xfff, 0xfff, 0x529, 0x014, 0xfff, 0x41b, 0x40a, 0x18b, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x0d9, + 0xfff, 0x38a, 0xfff, 0xfff, 0xfff, 0xfff, 0x1ce, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3b1, 0xfff, 0xfff, 0x05d, + 0x2c4, 0xfff, 0xfff, 0x4af, 0xfff, 0x030, 0xfff, 0xfff, + 0x203, 0xfff, 0x277, 0x256, 0xfff, 0xfff, 0xfff, 0x4f9, + 0xfff, 0x2c7, 0xfff, 0x466, 0x016, 0x1cd, 0xfff, 0x167, + 0xfff, 0xfff, 0x0c8, 0xfff, 0x43d, 0xfff, 0xfff, 0x020, + 0xfff, 0xfff, 0x232, 0x1cb, 0x1e0, 0xfff, 0xfff, 0x347, + 0xfff, 0x478, 0xfff, 0x365, 0xfff, 0xfff, 0xfff, 0xfff, + 0x358, 0xfff, 0x10b, 0xfff, 0x35d, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x452, 0x22d, 0xfff, 0xfff, 0x47d, 0xfff, + 0x2f3, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x460, 0xfff, + 0xfff, 0xfff, 0x50b, 0xfff, 0xfff, 0xfff, 0x2ec, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4b1, 0x422, 0xfff, 0xfff, + 0xfff, 0x2d4, 0xfff, 0x239, 0xfff, 0xfff, 0xfff, 0x439, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x491, 0x075, 0xfff, 0xfff, 0xfff, 0x06c, 0xfff, + 0xfff, 0x0f9, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x139, 0xfff, 0x4f6, 0xfff, 0xfff, 0x409, 0xfff, + 0xfff, 0x15b, 0xfff, 0xfff, 0x348, 0xfff, 0xfff, 0xfff, + 0xfff, 0x4a2, 0x49d, 0xfff, 0x033, 0x175, 0xfff, 0x039, + 0xfff, 0x312, 0x40c, 0xfff, 0xfff, 0x325, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x4aa, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0x165, 0x3bc, 0x48c, 0x310, 0x096, + 0xfff, 0xfff, 0x250, 0x1a2, 0xfff, 0xfff, 0xfff, 0xfff, + 0x20d, 0x2ac, 0xfff, 0xfff, 0x39b, 0xfff, 0x377, 0xfff, + 0x512, 0x495, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x357, 0x4ea, 0xfff, 0xfff, + 0xfff, 0xfff, 0x198, 0xfff, 0xfff, 0xfff, 0x434, 0x04a, + 0xfff, 0xfff, 0xfff, 0xfff, 0x062, 0xfff, 0x1d6, 0x1c8, + 0xfff, 0x1f3, 0x281, 0xfff, 0x462, 0xfff, 0xfff, 0xfff, + 0x4b0, 0xfff, 0x207, 0xfff, 0xfff, 0xfff, 0xfff, 0x3dd, + 0xfff, 0xfff, 0x55d, 0xfff, 0x552, 0x494, 0x1af, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x227, 0xfff, 0xfff, 0x069, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x43e, + 0x0b5, 0xfff, 0x524, 0x2d2, 0xfff, 0xfff, 0xfff, 0x28f, + 0xfff, 0x01b, 0x50e, 0xfff, 0xfff, 0x1bb, 0xfff, 0xfff, + 0x41d, 0xfff, 0x32e, 0x48e, 0xfff, 0x1f7, 0x224, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x394, 0xfff, 0xfff, 0xfff, + 0xfff, 0x52c, 0xfff, 0xfff, 0xfff, 0x392, 0xfff, 0x1e7, + 0xfff, 0xfff, 0x3f9, 0x3a7, 0xfff, 0x51f, 0xfff, 0x0bb, + 0x118, 0x3ca, 0xfff, 0x1dd, 0xfff, 0x48b, 0xfff, 0xfff, + 0xfff, 0xfff, 0x50f, 0xfff, 0x0d6, 0xfff, 0x1fa, 0xfff, + 0x11e, 0xfff, 0xfff, 0xfff, 0xfff, 0x4d7, 0xfff, 0x078, + 0x008, 0xfff, 0x25d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x032, 0x33c, 0xfff, 0x4d9, 0x160, 0xfff, 0xfff, 0x300, + 0x0b1, 0xfff, 0x322, 0xfff, 0x4ec, 0xfff, 0xfff, 0x200, + 0x00c, 0x369, 0x473, 0xfff, 0xfff, 0x32c, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x53e, 0x3d4, 0x417, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x34b, 0x001, 0x39a, 0x02c, 0xfff, 0xfff, 0x2ce, 0x00f, + 0xfff, 0x0ba, 0xfff, 0xfff, 0xfff, 0xfff, 0x060, 0xfff, + 0x406, 0xfff, 0xfff, 0xfff, 0x4ee, 0x4ac, 0xfff, 0x43f, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x29b, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x216, + 0x190, 0xfff, 0x396, 0x464, 0xfff, 0xfff, 0x323, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x2e9, 0xfff, 0x26d, + 0x2cd, 0x040, 0xfff, 0xfff, 0xfff, 0xfff, 0x38b, 0x3c0, + 0xfff, 0xfff, 0xfff, 0x1f2, 0xfff, 0x0ea, 0xfff, 0xfff, + 0x472, 0xfff, 0x1fb, 0xfff, 0xfff, 0x0af, 0x27f, 0xfff, + 0xfff, 0xfff, 0x479, 0x023, 0xfff, 0x0d8, 0x3b3, 0xfff, + 0xfff, 0xfff, 0x121, 0xfff, 0xfff, 0x3bf, 0xfff, 0xfff, + 0x16b, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x45a, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0x0be, 0xfff, 0xfff, 0xfff, 0x111, 0xfff, 0x220, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0x09b, 0x218, 0xfff, 0x022, 0x202, 0xfff, + 0x4c8, 0xfff, 0x0ed, 0xfff, 0xfff, 0x182, 0xfff, 0xfff, + 0xfff, 0x17f, 0x213, 0xfff, 0x321, 0x36a, 0xfff, 0x086, + 0xfff, 0xfff, 0xfff, 0x43b, 0x088, 0xfff, 0xfff, 0xfff, + 0xfff, 0x26c, 0xfff, 0x2f8, 0x3b4, 0xfff, 0xfff, 0xfff, + 0x132, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x333, 0x444, + 0x0c1, 0x4d8, 0x46d, 0x264, 0xfff, 0xfff, 0xfff, 0xfff, + 0x426, 0xfff, 0xfff, 0xfff, 0xfff, 0x2fe, 0xfff, 0xfff, + 0xfff, 0xfff, 0x011, 0xfff, 0x05f, 0xfff, 0xfff, 0xfff, + 0xfff, 0x10c, 0x101, 0xfff, 0xfff, 0xfff, 0xfff, 0x110, + 0xfff, 0x044, 0x304, 0x361, 0x404, 0xfff, 0x51b, 0x099, + 0xfff, 0x440, 0xfff, 0xfff, 0xfff, 0x222, 0xfff, 0xfff, + 0xfff, 0xfff, 0x1b5, 0xfff, 0x136, 0x430, 0xfff, 0x1da, + 0xfff, 0xfff, 0xfff, 0x043, 0xfff, 0x17c, 0xfff, 0xfff, + 0xfff, 0x01c, 0xfff, 0xfff, 0xfff, 0x425, 0x236, 0xfff, + 0x317, 0xfff, 0xfff, 0x437, 0x3fc, 0xfff, 0x1f1, 0xfff, + 0x324, 0xfff, 0xfff, 0x0ca, 0x306, 0xfff, 0x548, 0xfff, + 0x46e, 0xfff, 0xfff, 0xfff, 0x4b8, 0x1c2, 0x286, 0xfff, + 0xfff, 0x087, 0x18a, 0x19f, 0xfff, 0xfff, 0xfff, 0xfff, + 0x18c, 0xfff, 0x215, 0xfff, 0xfff, 0xfff, 0xfff, 0x283, + 0xfff, 0xfff, 0xfff, 0x126, 0xfff, 0xfff, 0x370, 0xfff, + 0x53f, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0x31c, 0xfff, + 0x4d1, 0xfff, 0xfff, 0xfff, 0x021, 0xfff, 0x157, 0xfff, + 0xfff, 0x028, 0x16e, 0xfff, 0x421, 0xfff, 0x1c6, 0xfff, + 0xfff, 0x511, 0xfff, 0xfff, 0x39c, 0x46f, 0x1b2, 0xfff, + 0xfff, 0x316, 0xfff, 0xfff, 0x009, 0xfff, 0xfff, 0x195, + 0xfff, 0x240, 0x546, 0xfff, 0xfff, 0x520, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x454, 0xfff, 0xfff, 0xfff, + 0x3f3, 0xfff, 0xfff, 0x187, 0xfff, 0x4a9, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x51c, 0x453, 0x1e6, 0xfff, + 0xfff, 0xfff, 0x1b0, 0xfff, 0x477, 0xfff, 0xfff, 0xfff, + 0x4fe, 0xfff, 0x32f, 0xfff, 0xfff, 0x15e, 0x1d4, 0xfff, + 0x0e5, 0xfff, 0xfff, 0xfff, 0x242, 0x14b, 0x046, 0xfff, + 0x3f6, 0x3bb, 0x3e4, 0xfff, 0xfff, 0x2e3, 0xfff, 0x245, + 0xfff, 0x149, 0xfff, 0xfff, 0xfff, 0x2db, 0xfff, 0xfff, + 0x181, 0xfff, 0x089, 0x2c5, 0xfff, 0x1f5, 0xfff, 0x2d6, + 0x507, 0xfff, 0x42d, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0x080, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, 0xfff, + 0xfff, 0xfff, 0xfff, 0xfff, 0x3c3, 0x320, 0xfff, 0x1e1, + 0xfff, 0x0f5, 0x13b, 0xfff, 0xfff, 0xfff, 0x003, 0x4da, + 0xfff, 0xfff, 0xfff, 0x42c, 0xfff, 0xfff, 0x0cb, 0xfff, + 0x536, 0x2c3, 0xfff, 0xfff, 0xfff, 0xfff, 0x199, 0xfff, + 0xfff, 0x0c0, 0xfff, 0x01e, 0x497, 0xfff, 0xfff, 0x3e5, + 0xfff, 0xfff, 0xfff, 0x0cf, 0xfff, 0x2bd, 0xfff, 0x223, 0xfff, 0x3ff, 0xfff, 0x058, 0x174, 0x3ef, 0xfff, 0x002 }; @@ -1357,7 +1357,7 @@ int cafe_correct_ecc(unsigned char *buf, buf[i+12], buf[i+13], buf[i+14], buf[i+15]); } } - + if (chk_no_err_only(chk_syndrome_list, err_info) && diff --git a/drivers/mtd/nand/cs553x_nand.c b/drivers/mtd/nand/cs553x_nand.c index 94924d5..8296305 100644 --- a/drivers/mtd/nand/cs553x_nand.c +++ b/drivers/mtd/nand/cs553x_nand.c @@ -11,7 +11,7 @@ * published by the Free Software Foundation. * * Overview: - * This is a device driver for the NAND flash controller found on + * This is a device driver for the NAND flash controller found on * the AMD CS5535/CS5536 companion chipsets for the Geode processor. * */ @@ -303,7 +303,7 @@ static int __init cs553x_init(void) err = cs553x_init_one(i, !!(val & FLSH_MEM_IO), val & 0xFFFFFFFF); } - /* Register all devices together here. This means we can easily hack it to + /* Register all devices together here. This means we can easily hack it to do mtdconcat etc. if we want to. */ for (i = 0; i < NR_CS553X_CONTROLLERS; i++) { if (cs553x_mtd[i]) { diff --git a/drivers/mtd/nand/s3c2410.c b/drivers/mtd/nand/s3c2410.c index ff5cef2..8b32035 100644 --- a/drivers/mtd/nand/s3c2410.c +++ b/drivers/mtd/nand/s3c2410.c @@ -283,7 +283,7 @@ static void s3c2410_nand_hwcontrol(struct mtd_info *mtd, int cmd, unsigned int ctrl) { struct s3c2410_nand_info *info = s3c2410_nand_mtd_toinfo(mtd); - + if (cmd == NAND_CMD_NONE) return; diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index fc84ddc..c48aa79 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -406,7 +406,7 @@ static int onenand_try_interrupt_wait(struct mtd_info *mtd, int state) /* Release the irq */ free_irq(this->irq, this); - + this->wait = onenand_wait; } -- cgit v1.1 From 6c33cafc794d07c9254c160789120a0e98c088c9 Mon Sep 17 00:00:00 2001 From: Haavard Skinnemoen Date: Wed, 29 Nov 2006 14:26:07 +0100 Subject: [MTD] bugfix: DataFlash is not bit writable This patch fixes the "jffs2_flash_writev(): Non-contiguous write to 00825300 with mtd_dataflash" bug. Signed-off-by: Haavard Skinnemoen Signed-off-by: Artem Bityutskiy --- drivers/mtd/devices/mtd_dataflash.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/devices/mtd_dataflash.c b/drivers/mtd/devices/mtd_dataflash.c index 5db7160..10a4f4e 100644 --- a/drivers/mtd/devices/mtd_dataflash.c +++ b/drivers/mtd/devices/mtd_dataflash.c @@ -480,7 +480,7 @@ add_dataflash(struct spi_device *spi, char *name, device->writesize = pagesize; device->owner = THIS_MODULE; device->type = MTD_DATAFLASH; - device->flags = MTD_CAP_NORFLASH; + device->flags = MTD_WRITEABLE; device->erase = dataflash_erase; device->read = dataflash_read; device->write = dataflash_write; -- cgit v1.1 From 7dcb483de3b33e74ddd2040bd7b6ba96d86a91f8 Mon Sep 17 00:00:00 2001 From: Mariusz Kozlowski Date: Fri, 1 Dec 2006 09:59:49 +0000 Subject: [MTD] [NAND] Compile fix in rfc_from4.c Signed-off-by: Mariusz Kozlowski Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/nand/rtc_from4.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/rtc_from4.c b/drivers/mtd/nand/rtc_from4.c index 02deec3..9189ec8 100644 --- a/drivers/mtd/nand/rtc_from4.c +++ b/drivers/mtd/nand/rtc_from4.c @@ -456,7 +456,7 @@ static int rtc_from4_errstat(struct mtd_info *mtd, struct nand_chip *this, rtn = nand_do_read(mtd, page, len, &retlen, buf); /* if read failed or > 1-bit error corrected */ - if (rtn || (mtd->ecc_stats.corrected - corrected) > 1) { + if (rtn || (mtd->ecc_stats.corrected - corrected) > 1) er_stat |= 1 << 1; kfree(buf); } -- cgit v1.1 From 0b47d654089c5ce3f2ea26a4485db9bcead1e515 Mon Sep 17 00:00:00 2001 From: Yoshinori Sato Date: Fri, 1 Dec 2006 10:01:50 +0000 Subject: [MTD] redboot partition combined fis / config problem Can't analyze FIS directory in CYGSEM_REDBOOT_FLASH_COMBINED_FIS_AND_CONFIG really. Signed-off-by: Yoshinori Sato Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/redboot.c | 3 +++ 1 file changed, 3 insertions(+) (limited to 'drivers') diff --git a/drivers/mtd/redboot.c b/drivers/mtd/redboot.c index 4b27721..b525921 100644 --- a/drivers/mtd/redboot.c +++ b/drivers/mtd/redboot.c @@ -110,6 +110,9 @@ static int parse_redboot_partitions(struct mtd_info *master, } } break; + } else { + /* re-calculate of real numslots */ + numslots = buf[i].size / sizeof(struct fis_image_desc); } } if (i == numslots) { -- cgit v1.1 From 418b2e56b8a61ea85f7a9c5d327e1a2c61d1b2db Mon Sep 17 00:00:00 2001 From: Timo Lindhorst Date: Tue, 5 Dec 2006 15:23:33 +0100 Subject: [MTD] NAND: use SmartMedia ECC byte order for ndfc Select MTD_NAND_ECC_SMC (ECC byte order according to the Smart Media Specification) if MTD_NAND_NDFC is used. Using the wrong byte order causes fatal, unnoticed data damage. For further information see: http://lists.infradead.org/pipermail/linux-mtd/2006-November/016920.html Signed-off-by: Timo Lindhorst Signed-off-by: David Woodhouse --- drivers/mtd/nand/Kconfig | 1 + 1 file changed, 1 insertion(+) (limited to 'drivers') diff --git a/drivers/mtd/nand/Kconfig b/drivers/mtd/nand/Kconfig index 0662775..358f55a 100644 --- a/drivers/mtd/nand/Kconfig +++ b/drivers/mtd/nand/Kconfig @@ -133,6 +133,7 @@ config MTD_NAND_S3C2410_HWECC config MTD_NAND_NDFC tristate "NDFC NanD Flash Controller" depends on MTD_NAND && 44x + select MTD_NAND_ECC_SMC help NDFC Nand Flash Controllers are integrated in EP44x SoCs -- cgit v1.1 From 4a0c50c07a6100ca58d465bac951533347e18d71 Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Wed, 6 Dec 2006 21:52:32 +0200 Subject: [MTD] nandsim: bugfix in page addressing Number of address bytes for 64-128 MiB NANDs is 4, not 5. Signed-off-by: Artem Bityutskiy Signed-off-by: David Woodhouse --- drivers/mtd/nand/nandsim.c | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/nand/nandsim.c b/drivers/mtd/nand/nandsim.c index 3d39451..c3bca95 100644 --- a/drivers/mtd/nand/nandsim.c +++ b/drivers/mtd/nand/nandsim.c @@ -160,7 +160,7 @@ MODULE_PARM_DESC(dbg, "Output debug information if not zero"); /* After a command is input, the simulator goes to one of the following states */ #define STATE_CMD_READ0 0x00000001 /* read data from the beginning of page */ #define STATE_CMD_READ1 0x00000002 /* read data from the second half of page */ -#define STATE_CMD_READSTART 0x00000003 /* read data second command (large page devices) */ +#define STATE_CMD_READSTART 0x00000003 /* read data second command (large page devices) */ #define STATE_CMD_PAGEPROG 0x00000004 /* start page programm */ #define STATE_CMD_READOOB 0x00000005 /* read OOB area */ #define STATE_CMD_ERASE1 0x00000006 /* sector erase first command */ @@ -440,7 +440,7 @@ static int init_nandsim(struct mtd_info *mtd) } } else { if (ns->geom.totsz <= (128 << 20)) { - ns->geom.pgaddrbytes = 5; + ns->geom.pgaddrbytes = 4; ns->geom.secaddrbytes = 2; } else { ns->geom.pgaddrbytes = 5; -- cgit v1.1 From dd11b8cdf0c455f4cfbc5daa70aabce9dcc6c07b Mon Sep 17 00:00:00 2001 From: Andrew Victor Date: Fri, 8 Dec 2006 13:49:42 +0200 Subject: [MTD] NAND: Support for 16-bit bus-width on AT91. Add support for 16-bit NAND bus-width for the AT91 NAND driver. The 16-bit NAND is found on the Atmel AT91SAM9260-EK and AT91SAM9261-EK boards. Orignal Patch from Patrice Vilchez Signed-off-by: Andrew Victor Signed-off-by: David Woodhouse --- drivers/mtd/nand/at91_nand.c | 3 +++ 1 file changed, 3 insertions(+) (limited to 'drivers') diff --git a/drivers/mtd/nand/at91_nand.c b/drivers/mtd/nand/at91_nand.c index a58ed37..14b80cc 100644 --- a/drivers/mtd/nand/at91_nand.c +++ b/drivers/mtd/nand/at91_nand.c @@ -128,6 +128,9 @@ static int __init at91_nand_probe(struct platform_device *pdev) nand_chip->ecc.mode = NAND_ECC_SOFT; /* enable ECC */ nand_chip->chip_delay = 20; /* 20us command delay time */ + if (host->board->bus_width_16) /* 16-bit bus width */ + nand_chip->options |= NAND_BUSWIDTH_16; + platform_set_drvdata(pdev, host); at91_nand_enable(host); -- cgit v1.1 From f33665d931f33a0baf44fc5d3594b23f8118eb44 Mon Sep 17 00:00:00 2001 From: Rod Whitby Date: Wed, 6 Dec 2006 12:11:15 +1030 Subject: [MTD] Support combined RedBoot FIS directory and configuration area RedBoot supports storing the FIS directory and the RedBoot configuration area in the same block of flash memory. This is not the most common RedBoot configuration, but it is used on commercially available boards supported by the kernel. A recent patch to mtd/redboot.c (http://lkml.org/lkml/2006/3/20/410) which corrected the skipping of deleted table entries has exposed the latent problem of the kernel redboot parser running off the end of the FIS directory and interpreting the RedBoot configuration information as table entries. This patch terminates the table parsing when the first truly empty entry is found (table entry deletion only clears the first byte of the name, so two cleared bytes in a row indicates the end of the table), thereby supporting the combined redboot FIS directory and RedBoot configuration information flash layout scenario. Signed-off-by: Rod Whitby Signed-off-by: David Woodhouse --- drivers/mtd/redboot.c | 23 ++++++++++++++++++++--- 1 file changed, 20 insertions(+), 3 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/redboot.c b/drivers/mtd/redboot.c index b525921..035cd9b 100644 --- a/drivers/mtd/redboot.c +++ b/drivers/mtd/redboot.c @@ -96,7 +96,19 @@ static int parse_redboot_partitions(struct mtd_info *master, */ if (swab32(buf[i].size) == master->erasesize) { int j; - for (j = 0; j < numslots && buf[j].name[0] != 0xff; ++j) { + for (j = 0; j < numslots; ++j) { + + /* A single 0xff denotes a deleted entry. + * Two of them in a row is the end of the table. + */ + if (buf[j].name[0] == 0xff) { + if (buf[j].name[1] == 0xff) { + break; + } else { + continue; + } + } + /* The unsigned long fields were written with the * wrong byte sex, name and pad have no byte sex. */ @@ -126,8 +138,13 @@ static int parse_redboot_partitions(struct mtd_info *master, for (i = 0; i < numslots; i++) { struct fis_list *new_fl, **prev; - if (buf[i].name[0] == 0xff) - continue; + if (buf[i].name[0] == 0xff) { + if (buf[i].name[1] == 0xff) { + break; + } else { + continue; + } + } if (!redboot_checksum(&buf[i])) break; -- cgit v1.1 From a2c2fe4b242cb9c62951ae154594cffbb94ab2ad Mon Sep 17 00:00:00 2001 From: Vitaly Wool Date: Wed, 6 Dec 2006 13:17:49 +0300 Subject: [MTD] of_device-based physmap driver inlined below is the patch that adds physmap driver for of_device. It's an MTD part of the two-part support for flash/ROM devices based on Open Firmware descriptions. The arch part (currently only PowerPC which is no surprise) was introduced to powerpc folks earlier and recently the older version of the powerpc part has been included into the powerpc.git tree (see http://www.kernel.org/git/?p=linux/kernel/git/paulus/powerpc.git;a=commitdiff;h=28f9ec349ae47c91768b7bc5607db4442c818e11). drivers/mtd/maps/Kconfig | 9 + drivers/mtd/maps/Makefile | 1 drivers/mtd/maps/physmap_of.c | 255 ++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 265 insertions(+) Signed-off-by: Vitaly Wool Signed-off-by: Sergey Shtylyov Signed-off-by: David Woodhouse --- drivers/mtd/maps/Kconfig | 9 ++ drivers/mtd/maps/Makefile | 1 + drivers/mtd/maps/physmap_of.c | 255 ++++++++++++++++++++++++++++++++++++++++++ 3 files changed, 265 insertions(+) create mode 100644 drivers/mtd/maps/physmap_of.c (limited to 'drivers') diff --git a/drivers/mtd/maps/Kconfig b/drivers/mtd/maps/Kconfig index fa74668..4a51a3d 100644 --- a/drivers/mtd/maps/Kconfig +++ b/drivers/mtd/maps/Kconfig @@ -60,6 +60,15 @@ config MTD_PHYSMAP_BANKWIDTH Ignore this option if you use run-time physmap configuration (i.e., run-time calling physmap_configure()). +config MTD_PHYSMAP_OF + tristate "Flash device in physical memory map based on OF descirption" + depends on PPC_OF && (MTD_CFI || MTD_JEDECPROBE || MTD_ROM) + help + This provides a 'mapping' driver which allows the NOR Flash and + ROM driver code to communicate with chips which are mapped + physically into the CPU's memory. The mapping description here is + taken from OF device tree. + config MTD_SUN_UFLASH tristate "Sun Microsystems userflash support" depends on SPARC && MTD_CFI diff --git a/drivers/mtd/maps/Makefile b/drivers/mtd/maps/Makefile index 3450521..df019be 100644 --- a/drivers/mtd/maps/Makefile +++ b/drivers/mtd/maps/Makefile @@ -27,6 +27,7 @@ obj-$(CONFIG_MTD_MBX860) += mbx860.o obj-$(CONFIG_MTD_CEIVA) += ceiva.o obj-$(CONFIG_MTD_OCTAGON) += octagon-5066.o obj-$(CONFIG_MTD_PHYSMAP) += physmap.o +obj-$(CONFIG_MTD_PHYSMAP_OF) += physmap_of.o obj-$(CONFIG_MTD_PNC2000) += pnc2000.o obj-$(CONFIG_MTD_PCMCIA) += pcmciamtd.o obj-$(CONFIG_MTD_RPXLITE) += rpxlite.o diff --git a/drivers/mtd/maps/physmap_of.c b/drivers/mtd/maps/physmap_of.c new file mode 100644 index 0000000..7efe744 --- /dev/null +++ b/drivers/mtd/maps/physmap_of.c @@ -0,0 +1,255 @@ +/* + * Normal mappings of chips in physical memory for OF devices + * + * Copyright (C) 2006 MontaVista Software Inc. + * Author: Vitaly Wool + * + * This program is free software; you can redistribute it and/or modify it + * under the terms of the GNU General Public License as published by the + * Free Software Foundation; either version 2 of the License, or (at your + * option) any later version. + */ + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + +struct physmap_flash_info { + struct mtd_info *mtd; + struct map_info map; + struct resource *res; +#ifdef CONFIG_MTD_PARTITIONS + int nr_parts; + struct mtd_partition *parts; +#endif +}; + +static const char *rom_probe_types[] = { "cfi_probe", "jedec_probe", "map_rom", NULL }; +#ifdef CONFIG_MTD_PARTITIONS +static const char *part_probe_types[] = { "cmdlinepart", "RedBoot", NULL }; +#endif + +#ifdef CONFIG_MTD_PARTITIONS +static int parse_flash_partitions(struct device_node *node, + struct mtd_partition **parts) +{ + int i, plen, retval = -ENOMEM; + const u32 *part; + const char *name; + + part = get_property(node, "partitions", &plen); + if (part == NULL) + goto err; + + retval = plen / (2 * sizeof(u32)); + *parts = kzalloc(retval * sizeof(struct mtd_partition), GFP_KERNEL); + if (*parts == NULL) { + printk(KERN_ERR "Can't allocate the flash partition data!\n"); + goto err; + } + + name = get_property(node, "partition-names", &plen); + + for (i = 0; i < retval; i++) { + (*parts)[i].offset = *part++; + (*parts)[i].size = *part & ~1; + if (*part++ & 1) /* bit 0 set signifies read only partition */ + (*parts)[i].mask_flags = MTD_WRITEABLE; + + if (name != NULL && plen > 0) { + int len = strlen(name) + 1; + + (*parts)[i].name = (char *)name; + plen -= len; + name += len; + } else + (*parts)[i].name = "unnamed"; + } +err: + return retval; +} +#endif + +static int of_physmap_remove(struct of_device *dev) +{ + struct physmap_flash_info *info; + + info = dev_get_drvdata(&dev->dev); + if (info == NULL) + return 0; + dev_set_drvdata(&dev->dev, NULL); + + if (info->mtd != NULL) { +#ifdef CONFIG_MTD_PARTITIONS + if (info->nr_parts) { + del_mtd_partitions(info->mtd); + kfree(info->parts); + } else { + del_mtd_device(info->mtd); + } +#else + del_mtd_device(info->mtd); +#endif + map_destroy(info->mtd); + } + + if (info->map.virt != NULL) + iounmap(info->map.virt); + + if (info->res != NULL) { + release_resource(info->res); + kfree(info->res); + } + + return 0; +} + +static int __devinit of_physmap_probe(struct of_device *dev, const struct of_device_id *match) +{ + struct device_node *dp = dev->node; + struct resource res; + struct physmap_flash_info *info; + const char **probe_type; + const char *of_probe; + const u32 *width; + int err; + + + if (of_address_to_resource(dp, 0, &res)) { + dev_err(&dev->dev, "Can't get the flash mapping!\n"); + err = -EINVAL; + goto err_out; + } + + dev_dbg(&dev->dev, "physmap flash device: %.8llx at %.8llx\n", + (unsigned long long)res.end - res.start + 1, + (unsigned long long)res.start); + + info = kzalloc(sizeof(struct physmap_flash_info), GFP_KERNEL); + if (info == NULL) { + err = -ENOMEM; + goto err_out; + } + memset(info, 0, sizeof(*info)); + + dev_set_drvdata(&dev->dev, info); + + info->res = request_mem_region(res.start, res.end - res.start + 1, + dev->dev.bus_id); + if (info->res == NULL) { + dev_err(&dev->dev, "Could not reserve memory region\n"); + err = -ENOMEM; + goto err_out; + } + + width = get_property(dp, "bank-width", NULL); + if (width == NULL) { + dev_err(&dev->dev, "Can't get the flash bank width!\n"); + err = -EINVAL; + goto err_out; + } + + info->map.name = dev->dev.bus_id; + info->map.phys = res.start; + info->map.size = res.end - res.start + 1; + info->map.bankwidth = *width; + + info->map.virt = ioremap(info->map.phys, info->map.size); + if (info->map.virt == NULL) { + dev_err(&dev->dev, "Failed to ioremap flash region\n"); + err = EIO; + goto err_out; + } + + simple_map_init(&info->map); + + of_probe = get_property(dp, "probe-type", NULL); + if (of_probe == NULL) { + probe_type = rom_probe_types; + for (; info->mtd == NULL && *probe_type != NULL; probe_type++) + info->mtd = do_map_probe(*probe_type, &info->map); + } else if (!strcmp(of_probe, "CFI")) + info->mtd = do_map_probe("cfi_probe", &info->map); + else if (!strcmp(of_probe, "JEDEC")) + info->mtd = do_map_probe("jedec_probe", &info->map); + else { + if (strcmp(of_probe, "ROM")) + dev_dbg(&dev->dev, "map_probe: don't know probe type " + "'%s', mapping as rom\n"); + info->mtd = do_map_probe("mtd_rom", &info->map); + } + if (info->mtd == NULL) { + dev_err(&dev->dev, "map_probe failed\n"); + err = -ENXIO; + goto err_out; + } + info->mtd->owner = THIS_MODULE; + +#ifdef CONFIG_MTD_PARTITIONS + err = parse_mtd_partitions(info->mtd, part_probe_types, &info->parts, 0); + if (err > 0) { + add_mtd_partitions(info->mtd, info->parts, err); + } else if ((err = parse_flash_partitions(dp, &info->parts)) > 0) { + dev_info(&dev->dev, "Using OF partition information\n"); + add_mtd_partitions(info->mtd, info->parts, err); + info->nr_parts = err; + } else +#endif + + add_mtd_device(info->mtd); + return 0; + +err_out: + of_physmap_remove(dev); + return err; + + return 0; + + +} + +static struct of_device_id of_physmap_match[] = { + { + .type = "rom", + .compatible = "direct-mapped" + }, + { }, +}; + +MODULE_DEVICE_TABLE(of, of_physmap_match); + + +static struct of_platform_driver of_physmap_flash_driver = { + .name = "physmap-flash", + .match_table = of_physmap_match, + .probe = of_physmap_probe, + .remove = of_physmap_remove, +}; + +static int __init of_physmap_init(void) +{ + return of_register_platform_driver(&of_physmap_flash_driver); +} + +static void __exit of_physmap_exit(void) +{ + of_unregister_platform_driver(&of_physmap_flash_driver); +} + +module_init(of_physmap_init); +module_exit(of_physmap_exit); + +MODULE_LICENSE("GPL"); +MODULE_AUTHOR("Vitaly Wool "); +MODULE_DESCRIPTION("Configurable MTD map driver for OF"); -- cgit v1.1 From dffbc42b5adfc77a4165de9f170304eb596de3f4 Mon Sep 17 00:00:00 2001 From: Randy Dunlap Date: Mon, 4 Dec 2006 15:03:00 -0800 Subject: [MTD] ESB2ROM uses PCI ESB2ROM uses PCI interface functions. With CONFIG_PCI=n: drivers/mtd/maps/esb2rom.c: In function 'esb2rom_init_one': drivers/mtd/maps/esb2rom.c:167: warning: implicit declaration of function 'pci_dev_get' Signed-off-by: Randy Dunlap Signed-off-by: Andrew Morton Signed-off-by: David Woodhouse --- drivers/mtd/maps/Kconfig | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/maps/Kconfig b/drivers/mtd/maps/Kconfig index 4a51a3d..7aac68a 100644 --- a/drivers/mtd/maps/Kconfig +++ b/drivers/mtd/maps/Kconfig @@ -195,7 +195,7 @@ config MTD_ICHXROM config MTD_ESB2ROM tristate "BIOS flash chip on Intel ESB Controller Hub 2" - depends on X86 && MTD_JEDECPROBE + depends on X86 && MTD_JEDECPROBE && PCI help Support for treating the BIOS flash chip on ESB2 motherboards as an MTD device - with this you can reprogram your BIOS. -- cgit v1.1 From db06e2a93ff73270e0053c37c88073094e77913d Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Sun, 10 Dec 2006 11:48:54 +0000 Subject: [MTD] Fix SSFDC build for variable blocksize. Signed-off-by: David Woodhouse --- drivers/mtd/ssfdc.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/ssfdc.c b/drivers/mtd/ssfdc.c index e834cc1..60a3fba 100644 --- a/drivers/mtd/ssfdc.c +++ b/drivers/mtd/ssfdc.c @@ -311,7 +311,6 @@ static void ssfdcr_add_mtd(struct mtd_blktrans_ops *tr, struct mtd_info *mtd) ssfdc->mbd.mtd = mtd; ssfdc->mbd.devnum = -1; - ssfdc->mbd.blksize = SECTOR_SIZE; ssfdc->mbd.tr = tr; ssfdc->mbd.readonly = 1; @@ -446,6 +445,7 @@ static struct mtd_blktrans_ops ssfdcr_tr = { .name = "ssfdc", .major = SSFDCR_MAJOR, .part_bits = SSFDCR_PARTN_BITS, + .blksize = SECTOR_SIZE; .getgeo = ssfdcr_getgeo, .readsect = ssfdcr_readsect, .add_mtd = ssfdcr_add_mtd, -- cgit v1.1 From 76ab40e465e7615e582b9244a1a967bf3f074061 Mon Sep 17 00:00:00 2001 From: David Woodhouse Date: Mon, 11 Dec 2006 09:43:38 +0000 Subject: [MTD] Fix ssfdc blksize typo I will not commit even trivial and obvious one-line fixes without building. I will not commit even trivial and obvious one-line fixes without building. I will not commit even trivial and obvious one-line fixes without building. I will not commit even trivial and obvious one-line fixes without building. Only clever people can get away with that. Signed-off-by: David Woodhouse --- drivers/mtd/ssfdc.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/ssfdc.c b/drivers/mtd/ssfdc.c index 60a3fba..a5f3d60 100644 --- a/drivers/mtd/ssfdc.c +++ b/drivers/mtd/ssfdc.c @@ -445,7 +445,7 @@ static struct mtd_blktrans_ops ssfdcr_tr = { .name = "ssfdc", .major = SSFDCR_MAJOR, .part_bits = SSFDCR_PARTN_BITS, - .blksize = SECTOR_SIZE; + .blksize = SECTOR_SIZE, .getgeo = ssfdcr_getgeo, .readsect = ssfdcr_readsect, .add_mtd = ssfdcr_add_mtd, -- cgit v1.1 From 66a1e421b98edaa62c7d95cc53cb381efa3fb9bf Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Mon, 11 Dec 2006 01:34:23 +0000 Subject: [MTD] OneNAND: fix oob handling in recent oob patch There are missing place in recent MTD oob patch http://git.infradead.org/?p=mtd-2.6.git;a=commitdiff;h=7014568bad55c20b7ee4f439d78c9e875912d51f Signed-off-by: Kyungmin Park Signed-off-by: David Woodhouse --- drivers/mtd/onenand/onenand_base.c | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index c48aa79..63ca61b 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -871,8 +871,8 @@ static int onenand_read_oob(struct mtd_info *mtd, loff_t from, { BUG_ON(ops->mode != MTD_OOB_PLACE); - return onenand_do_read_oob(mtd, from + ops->ooboffs, ops->len, - &ops->retlen, ops->oobbuf); + return onenand_do_read_oob(mtd, from + ops->ooboffs, ops->ooblen, + &ops->oobretlen, ops->oobbuf); } #ifdef CONFIG_MTD_ONENAND_VERIFY_WRITE @@ -1114,8 +1114,8 @@ static int onenand_write_oob(struct mtd_info *mtd, loff_t to, { BUG_ON(ops->mode != MTD_OOB_PLACE); - return onenand_do_write_oob(mtd, to + ops->ooboffs, ops->len, - &ops->retlen, ops->oobbuf); + return onenand_do_write_oob(mtd, to + ops->ooboffs, ops->ooblen, + &ops->oobretlen, ops->oobbuf); } /** -- cgit v1.1 From 0bf3a9d82adc62fb05e3f108ddd46eb088960f26 Mon Sep 17 00:00:00 2001 From: Ralf Baechle Date: Mon, 11 Dec 2006 16:25:30 +0000 Subject: [MTD] Nuke IVR leftovers Support for the ITE8172 based boards was deleted a while ago so this is dead code. The Kconfig dependency on MIPS was wrong anyway, MIPS is a processor architecture and nothing else; guesses on systems architecture are likely to be wrong ... Signed-off-by: Ralf Baechle Signed-off-by: David Woodhouse --- drivers/mtd/maps/Kconfig | 44 ----------- drivers/mtd/maps/Makefile | 1 - drivers/mtd/maps/cstm_mips_ixx.c | 164 --------------------------------------- 3 files changed, 209 deletions(-) delete mode 100644 drivers/mtd/maps/cstm_mips_ixx.c (limited to 'drivers') diff --git a/drivers/mtd/maps/Kconfig b/drivers/mtd/maps/Kconfig index 7aac68a..3a33b98 100644 --- a/drivers/mtd/maps/Kconfig +++ b/drivers/mtd/maps/Kconfig @@ -382,50 +382,6 @@ config MTD_TQM834x TQ Components TQM834x boards. If you have one of these boards and would like to use the flash chips on it, say 'Y'. -config MTD_CSTM_MIPS_IXX - tristate "Flash chip mapping on ITE QED-4N-S01B, Globespan IVR or custom board" - depends on MIPS && MTD_CFI && MTD_JEDECPROBE && MTD_PARTITIONS - help - This provides a mapping driver for the Integrated Technology - Express, Inc (ITE) QED-4N-S01B eval board and the Globespan IVR - Reference Board. It provides the necessary addressing, length, - buswidth, vpp code and addition setup of the flash device for - these boards. In addition, this mapping driver can be used for - other boards via setting of the CONFIG_MTD_CSTM_MIPS_IXX_START/ - LEN/BUSWIDTH parameters. This mapping will provide one mtd device - using one partition. The start address can be offset from the - beginning of flash and the len can be less than the total flash - device size to allow a window into the flash. Both CFI and JEDEC - probes are called. - -config MTD_CSTM_MIPS_IXX_START - hex "Physical start address of flash mapping" - depends on MTD_CSTM_MIPS_IXX - default "0x8000000" - help - This is the physical memory location that the MTD driver will - use for the flash chips on your particular target board. - Refer to the memory map which should hopefully be in the - documentation for your board. - -config MTD_CSTM_MIPS_IXX_LEN - hex "Physical length of flash mapping" - depends on MTD_CSTM_MIPS_IXX - default "0x4000000" - help - This is the total length that the MTD driver will use for the - flash chips on your particular board. Refer to the memory - map which should hopefully be in the documentation for your - board. - -config MTD_CSTM_MIPS_IXX_BUSWIDTH - int "Bus width in octets" - depends on MTD_CSTM_MIPS_IXX - default "2" - help - This is the total bus width of the mapping of the flash chips - on your particular board. - config MTD_OCELOT tristate "Momenco Ocelot boot flash device" depends on MIPS && MOMENCO_OCELOT diff --git a/drivers/mtd/maps/Makefile b/drivers/mtd/maps/Makefile index df019be..071d0bf 100644 --- a/drivers/mtd/maps/Makefile +++ b/drivers/mtd/maps/Makefile @@ -12,7 +12,6 @@ obj-$(CONFIG_MTD_CDB89712) += cdb89712.o obj-$(CONFIG_MTD_ARM_INTEGRATOR)+= integrator-flash.o obj-$(CONFIG_MTD_BAST) += bast-flash.o obj-$(CONFIG_MTD_CFI_FLAGADM) += cfi_flagadm.o -obj-$(CONFIG_MTD_CSTM_MIPS_IXX) += cstm_mips_ixx.o obj-$(CONFIG_MTD_DC21285) += dc21285.o obj-$(CONFIG_MTD_DILNETPC) += dilnetpc.o obj-$(CONFIG_MTD_L440GX) += l440gx.o diff --git a/drivers/mtd/maps/cstm_mips_ixx.c b/drivers/mtd/maps/cstm_mips_ixx.c deleted file mode 100644 index 2ef22a5..0000000 --- a/drivers/mtd/maps/cstm_mips_ixx.c +++ /dev/null @@ -1,164 +0,0 @@ -/* - * $Id: cstm_mips_ixx.c,v 1.14 2005/11/07 11:14:26 gleixner Exp $ - * - * Mapping of a custom board with both AMD CFI and JEDEC flash in partitions. - * Config with both CFI and JEDEC device support. - * - * Basically physmap.c with the addition of partitions and - * an array of mapping info to accomodate more than one flash type per board. - * - * Copyright 2000 MontaVista Software Inc. - * - * This program is free software; you can redistribute it and/or modify it - * under the terms of the GNU General Public License as published by the - * Free Software Foundation; either version 2 of the License, or (at your - * option) any later version. - * - * THIS SOFTWARE IS PROVIDED ``AS IS'' AND ANY EXPRESS OR IMPLIED - * WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN - * NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, - * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT - * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF - * USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON - * ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT - * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF - * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - * - * You should have received a copy of the GNU General Public License along - * with this program; if not, write to the Free Software Foundation, Inc., - * 675 Mass Ave, Cambridge, MA 02139, USA. - */ - -#include -#include -#include -#include -#include -#include -#include -#include -#include - -/* board and partition description */ - -#define MAX_PHYSMAP_PARTITIONS 8 -struct cstm_mips_ixx_info { - char *name; - unsigned long window_addr; - unsigned long window_size; - int bankwidth; - int num_partitions; -}; - -#define PHYSMAP_NUMBER 1 // number of board desc structs needed, one per contiguous flash type -const struct cstm_mips_ixx_info cstm_mips_ixx_board_desc[PHYSMAP_NUMBER] = -{ - { - "MTD flash", // name - CONFIG_MTD_CSTM_MIPS_IXX_START, // window_addr - CONFIG_MTD_CSTM_MIPS_IXX_LEN, // window_size - CONFIG_MTD_CSTM_MIPS_IXX_BUSWIDTH, // bankwidth - 1, // num_partitions - }, - -}; -static struct mtd_partition cstm_mips_ixx_partitions[PHYSMAP_NUMBER][MAX_PHYSMAP_PARTITIONS] = { -{ - { - .name = "main partition", - .size = CONFIG_MTD_CSTM_MIPS_IXX_LEN, - .offset = 0, - }, -}, -}; - -struct map_info cstm_mips_ixx_map[PHYSMAP_NUMBER]; - -int __init init_cstm_mips_ixx(void) -{ - int i; - int jedec; - struct mtd_info *mymtd; - struct mtd_partition *parts; - - /* Initialize mapping */ - for (i=0;iowner = THIS_MODULE; - - cstm_mips_ixx_map[i].map_priv_2 = (unsigned long)mymtd; - add_mtd_partitions(mymtd, parts, cstm_mips_ixx_board_desc[i].num_partitions); - } - else { - for (i = 0; i < PHYSMAP_NUMBER; i++) { - if (cstm_mips_ixx_map[i].virt) { - iounmap(cstm_mips_ixx_map[i].virt); - cstm_mips_ixx_map[i].virt = NULL; - } - } - return -ENXIO; - } - } - return 0; -} - -static void __exit cleanup_cstm_mips_ixx(void) -{ - int i; - struct mtd_info *mymtd; - - for (i=0;i"); -MODULE_DESCRIPTION("MTD map driver for MIPS boards"); -- cgit v1.1 From f62724873652ddb19edf7f92843e9456fe3be3ea Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Fri, 22 Dec 2006 16:02:50 +0900 Subject: [MTD] OneNAND: fix onenand_wait bug Fix onenand_wait error reporting Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 38 +++++++++++++++----------------------- drivers/mtd/onenand/onenand_bbt.c | 3 ++- 2 files changed, 17 insertions(+), 24 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index 63ca61b..3fab4d1 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -318,15 +318,10 @@ static int onenand_wait(struct mtd_info *mtd, int state) ctrl = this->read_word(this->base + ONENAND_REG_CTRL_STATUS); if (ctrl & ONENAND_CTRL_ERROR) { - /* It maybe occur at initial bad block */ DEBUG(MTD_DEBUG_LEVEL0, "onenand_wait: controller error = 0x%04x\n", ctrl); - /* Clear other interrupt bits for preventing ECC error */ - interrupt &= ONENAND_INT_MASTER; - } - - if (ctrl & ONENAND_CTRL_LOCK) { - DEBUG(MTD_DEBUG_LEVEL0, "onenand_wait: it's locked error = 0x%04x\n", ctrl); - return -EACCES; + if (ctrl & ONENAND_CTRL_LOCK) + DEBUG(MTD_DEBUG_LEVEL0, "onenand_wait: it's locked error.\n"); + return ctrl; } if (interrupt & ONENAND_INT_READ) { @@ -750,21 +745,21 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, ret = this->wait(mtd, FL_READING); /* First copy data and check return value for ECC handling */ - onenand_update_bufferram(mtd, from, 1); + onenand_update_bufferram(mtd, from, !ret); } this->read_bufferram(mtd, ONENAND_DATARAM, buf, column, thislen); - read += thislen; - - if (read == len) - break; - if (ret) { DEBUG(MTD_DEBUG_LEVEL0, "onenand_read: read failed = %d\n", ret); goto out; } + read += thislen; + + if (read == len) + break; + from += thislen; buf += thislen; } @@ -832,16 +827,16 @@ int onenand_do_read_oob(struct mtd_info *mtd, loff_t from, size_t len, this->read_bufferram(mtd, ONENAND_SPARERAM, buf, column, thislen); + if (ret) { + DEBUG(MTD_DEBUG_LEVEL0, "onenand_read_oob: read failed = 0x%x\n", ret); + goto out; + } + read += thislen; if (read == len) break; - if (ret) { - DEBUG(MTD_DEBUG_LEVEL0, "onenand_read_oob: read failed = %d\n", ret); - goto out; - } - buf += thislen; /* Read more? */ @@ -1199,10 +1194,7 @@ static int onenand_erase(struct mtd_info *mtd, struct erase_info *instr) ret = this->wait(mtd, FL_ERASING); /* Check, if it is write protected */ if (ret) { - if (ret == -EPERM) - DEBUG(MTD_DEBUG_LEVEL0, "onenand_erase: Device is write protected!!!\n"); - else - DEBUG(MTD_DEBUG_LEVEL0, "onenand_erase: Failed erase, block %d\n", (unsigned) (addr >> this->erase_shift)); + DEBUG(MTD_DEBUG_LEVEL0, "onenand_erase: Failed erase, block %d\n", (unsigned) (addr >> this->erase_shift)); instr->state = MTD_ERASE_FAILED; instr->fail_addr = addr; goto erase_exit; diff --git a/drivers/mtd/onenand/onenand_bbt.c b/drivers/mtd/onenand/onenand_bbt.c index 6cceeca..98f8fd1 100644 --- a/drivers/mtd/onenand/onenand_bbt.c +++ b/drivers/mtd/onenand/onenand_bbt.c @@ -93,7 +93,8 @@ static int create_bbt(struct mtd_info *mtd, uint8_t *buf, struct nand_bbt_descr ret = onenand_do_read_oob(mtd, from + j * mtd->writesize + bd->offs, readlen, &retlen, &buf[0]); - if (ret) + /* If it is a initial bad block, just ignore it */ + if (ret && !(ret & ONENAND_CTRL_LOAD)) return ret; if (check_short_pattern(&buf[j * scanlen], scanlen, mtd->writesize, bd)) { -- cgit v1.1 From 60d84f9739a47d0ed8e19805d9056e39fba31c79 Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Fri, 22 Dec 2006 16:21:54 +0900 Subject: [MTD] OneNAND: add subpage write support OneNAND supports up to 4 writes at one NAND page. Add support of this feature. Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 56 ++++++++++++++++++++++++++++---------- 1 file changed, 42 insertions(+), 14 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index 3fab4d1..51fb840 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -192,8 +192,6 @@ static int onenand_command(struct mtd_info *mtd, int cmd, loff_t addr, size_t le struct onenand_chip *this = mtd->priv; int value, readcmd = 0, block_cmd = 0; int block, page; - /* Now we use page size operation */ - int sectors = 4, count = 4; /* Address translation */ switch (cmd) { @@ -245,6 +243,8 @@ static int onenand_command(struct mtd_info *mtd, int cmd, loff_t addr, size_t le } if (page != -1) { + /* Now we use page size operation */ + int sectors = 4, count = 4; int dataram; switch (cmd) { @@ -914,6 +914,10 @@ static int onenand_verify_page(struct mtd_info *mtd, u_char *buf, loff_t addr) void __iomem *dataram0, *dataram1; int ret = 0; + /* In partial page write, just skip it */ + if ((addr & (mtd->writesize - 1)) != 0) + return 0; + this->command(mtd, ONENAND_CMD_READ, addr, mtd->writesize); ret = this->wait(mtd, FL_READING); @@ -936,7 +940,7 @@ static int onenand_verify_page(struct mtd_info *mtd, u_char *buf, loff_t addr) #define onenand_verify_oob(...) (0) #endif -#define NOTALIGNED(x) ((x & (mtd->writesize - 1)) != 0) +#define NOTALIGNED(x) ((x & (this->subpagesize - 1)) != 0) /** * onenand_write - [MTD Interface] write buffer to FLASH @@ -954,6 +958,7 @@ static int onenand_write(struct mtd_info *mtd, loff_t to, size_t len, struct onenand_chip *this = mtd->priv; int written = 0; int ret = 0; + int column, subpage; DEBUG(MTD_DEBUG_LEVEL3, "onenand_write: to = 0x%08x, len = %i\n", (unsigned int) to, (int) len); @@ -972,45 +977,61 @@ static int onenand_write(struct mtd_info *mtd, loff_t to, size_t len, return -EINVAL; } + column = to & (mtd->writesize - 1); + subpage = column || (len & (mtd->writesize - 1)); + /* Grab the lock and see if the device is available */ onenand_get_device(mtd, FL_WRITING); /* Loop until all data write */ while (written < len) { - int thislen = min_t(int, mtd->writesize, len - written); - - this->command(mtd, ONENAND_CMD_BUFFERRAM, to, mtd->writesize); + int bytes = mtd->writesize; + int thislen = min_t(int, bytes, len - written); + u_char *wbuf = (u_char *) buf; + + this->command(mtd, ONENAND_CMD_BUFFERRAM, to, bytes); + + /* Partial page write */ + if (subpage) { + bytes = min_t(int, bytes - column, (int) len); + memset(this->page_buf, 0xff, mtd->writesize); + memcpy(this->page_buf + column, buf, bytes); + wbuf = this->page_buf; + /* Even though partial write, we need page size */ + thislen = mtd->writesize; + } - this->write_bufferram(mtd, ONENAND_DATARAM, buf, 0, thislen); + this->write_bufferram(mtd, ONENAND_DATARAM, wbuf, 0, thislen); this->write_bufferram(mtd, ONENAND_SPARERAM, ffchars, 0, mtd->oobsize); this->command(mtd, ONENAND_CMD_PROG, to, mtd->writesize); - onenand_update_bufferram(mtd, to, 1); + /* In partial page write we don't update bufferram */ + onenand_update_bufferram(mtd, to, !subpage); ret = this->wait(mtd, FL_WRITING); if (ret) { DEBUG(MTD_DEBUG_LEVEL0, "onenand_write: write filaed %d\n", ret); - goto out; + break; } - written += thislen; - /* Only check verify write turn on */ - ret = onenand_verify_page(mtd, (u_char *) buf, to); + ret = onenand_verify_page(mtd, (u_char *) wbuf, to); if (ret) { DEBUG(MTD_DEBUG_LEVEL0, "onenand_write: verify failed %d\n", ret); - goto out; + break; } + written += thislen; + if (written == len) break; + column = 0; to += thislen; buf += thislen; } -out: /* Deselect and wake up anyone waiting on the device */ onenand_release_device(mtd); @@ -2021,23 +2042,30 @@ int onenand_scan(struct mtd_info *mtd, int maxchips) init_waitqueue_head(&this->wq); spin_lock_init(&this->chip_lock); + /* + * Allow subpage writes up to oobsize. + */ switch (mtd->oobsize) { case 64: this->ecclayout = &onenand_oob_64; + mtd->subpage_sft = 2; break; case 32: this->ecclayout = &onenand_oob_32; + mtd->subpage_sft = 1; break; default: printk(KERN_WARNING "No OOB scheme defined for oobsize %d\n", mtd->oobsize); + mtd->subpage_sft = 0; /* To prevent kernel oops */ this->ecclayout = &onenand_oob_32; break; } + this->subpagesize = mtd->writesize >> mtd->subpage_sft; mtd->ecclayout = this->ecclayout; /* Fill in remaining MTD driver data */ -- cgit v1.1 From 61a7e1983e773b93aac172dadc97f1eb484536b4 Mon Sep 17 00:00:00 2001 From: Artem Bityutskiy Date: Tue, 26 Dec 2006 16:41:24 +0900 Subject: [MTD] OneNAND: release CPU in cycles This patch teaches OneNAND to release processor in read/write/erase cycles and let other processes proceed. Also, remove buggi touch watchdog call which only hides the problem instead of solving it. Signed-off-by: Artem Bityutskiy Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 16 +++++++++------- 1 file changed, 9 insertions(+), 7 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index 51fb840..0037cee 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -310,7 +310,6 @@ static int onenand_wait(struct mtd_info *mtd, int state) if (state != FL_READING) cond_resched(); - touch_softlockup_watchdog(); } /* To get correct interrupt status in timeout case */ interrupt = this->read_word(this->base + ONENAND_REG_INTERRUPT); @@ -367,9 +366,6 @@ static int onenand_interrupt_wait(struct mtd_info *mtd, int state) { struct onenand_chip *this = mtd->priv; - /* To prevent soft lockup */ - touch_softlockup_watchdog(); - wait_for_completion(&this->complete); return onenand_wait(mtd, state); @@ -390,9 +386,6 @@ static int onenand_try_interrupt_wait(struct mtd_info *mtd, int state) /* We use interrupt wait first */ this->wait = onenand_interrupt_wait; - /* To prevent soft lockup */ - touch_softlockup_watchdog(); - timeout = msecs_to_jiffies(100); remain = wait_for_completion_timeout(&this->complete, timeout); if (!remain) { @@ -734,6 +727,8 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, stats = mtd->ecc_stats; while (read < len) { + cond_resched(); + thislen = min_t(int, mtd->writesize, len - read); column = from & (mtd->writesize - 1); @@ -815,6 +810,8 @@ int onenand_do_read_oob(struct mtd_info *mtd, loff_t from, size_t len, column = from & (mtd->oobsize - 1); while (read < len) { + cond_resched(); + thislen = mtd->oobsize - column; thislen = min_t(int, thislen, len); @@ -989,6 +986,8 @@ static int onenand_write(struct mtd_info *mtd, loff_t to, size_t len, int thislen = min_t(int, bytes, len - written); u_char *wbuf = (u_char *) buf; + cond_resched(); + this->command(mtd, ONENAND_CMD_BUFFERRAM, to, bytes); /* Partial page write */ @@ -1075,6 +1074,8 @@ static int onenand_do_write_oob(struct mtd_info *mtd, loff_t to, size_t len, while (written < len) { int thislen = min_t(int, mtd->oobsize, len - written); + cond_resched(); + column = to & (mtd->oobsize - 1); this->command(mtd, ONENAND_CMD_BUFFERRAM, to, mtd->oobsize); @@ -1202,6 +1203,7 @@ static int onenand_erase(struct mtd_info *mtd, struct erase_info *instr) instr->state = MTD_ERASING; while (len) { + cond_resched(); /* Check if we have a bad block, we do not erase bad blocks */ if (onenand_block_checkbad(mtd, addr, 0, 0)) { -- cgit v1.1 From 2fd32d4af83f4535d12d3f6dd23189352a9596fa Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Fri, 29 Dec 2006 11:51:40 +0900 Subject: [MTD] OneNAND: fix onenand_wait bug in read ecc error Even though there is ECC error. OneNAND driver updates the buffram as valid Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 5 +++-- 1 file changed, 3 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index 0037cee..e80857b 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -298,7 +298,7 @@ static int onenand_wait(struct mtd_info *mtd, int state) unsigned long timeout; unsigned int flags = ONENAND_INT_MASTER; unsigned int interrupt = 0; - unsigned int ctrl, ecc; + unsigned int ctrl; /* The 20 msec is enough */ timeout = jiffies + msecs_to_jiffies(20); @@ -324,7 +324,7 @@ static int onenand_wait(struct mtd_info *mtd, int state) } if (interrupt & ONENAND_INT_READ) { - ecc = this->read_word(this->base + ONENAND_REG_ECC_STATUS); + int ecc = this->read_word(this->base + ONENAND_REG_ECC_STATUS); if (ecc) { DEBUG(MTD_DEBUG_LEVEL0, "onenand_wait: ECC error = 0x%04x\n", ecc); if (ecc & ONENAND_ECC_2BIT_ALL) @@ -332,6 +332,7 @@ static int onenand_wait(struct mtd_info *mtd, int state) else if (ecc & ONENAND_ECC_1BIT_ALL) mtd->ecc_stats.corrected++; } + return ecc; } return 0; -- cgit v1.1 From a8de85d557004d6d4e4cf79ecd6b97339b986fe9 Mon Sep 17 00:00:00 2001 From: Adrian Hunter Date: Thu, 4 Jan 2007 09:51:26 +0200 Subject: [MTD] OneNAND: Implement read-while-load Read-while-load enables higher performance read operations. Signed-off-by: Adrian Hunter Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 74 +++++++++++++++++++++----------------- 1 file changed, 42 insertions(+), 32 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index e80857b..abbe160 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -727,40 +727,47 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, /* TODO handling oob */ stats = mtd->ecc_stats; - while (read < len) { - cond_resched(); - - thislen = min_t(int, mtd->writesize, len - read); - - column = from & (mtd->writesize - 1); - if (column + thislen > mtd->writesize) - thislen = mtd->writesize - column; - - if (!onenand_check_bufferram(mtd, from)) { - this->command(mtd, ONENAND_CMD_READ, from, mtd->writesize); - - ret = this->wait(mtd, FL_READING); - /* First copy data and check return value for ECC handling */ - onenand_update_bufferram(mtd, from, !ret); - } - - this->read_bufferram(mtd, ONENAND_DATARAM, buf, column, thislen); - if (ret) { - DEBUG(MTD_DEBUG_LEVEL0, "onenand_read: read failed = %d\n", ret); - goto out; - } + /* Read-while-load method */ + + /* Do first load to bufferRAM */ + if (read < len) { + if (!onenand_check_bufferram(mtd, from)) { + this->command(mtd, ONENAND_CMD_READ, from, mtd->writesize); + ret = this->wait(mtd, FL_READING); + onenand_update_bufferram(mtd, from, !ret); + } + } + + thislen = min_t(int, mtd->writesize, len - read); + column = from & (mtd->writesize - 1); + if (column + thislen > mtd->writesize) + thislen = mtd->writesize - column; + + while (!ret) { + /* If there is more to load then start next load */ + from += thislen; + if (read + thislen < len) { + this->command(mtd, ONENAND_CMD_READ, from, mtd->writesize); + ONENAND_SET_PREV_BUFFERRAM(this); + } + /* While load is going, read from last bufferRAM */ + this->read_bufferram(mtd, ONENAND_DATARAM, buf, column, thislen); + /* See if we are done */ + read += thislen; + if (read == len) + break; + /* Set up for next read from bufferRAM */ + ONENAND_SET_NEXT_BUFFERRAM(this); + buf += thislen; + thislen = min_t(int, mtd->writesize, len - read); + column = 0; + cond_resched(); + /* Now wait for load */ + ret = this->wait(mtd, FL_READING); + onenand_update_bufferram(mtd, from, !ret); + } - read += thislen; - - if (read == len) - break; - - from += thislen; - buf += thislen; - } - -out: /* Deselect and wake up anyone waiting on the device */ onenand_release_device(mtd); @@ -774,6 +781,9 @@ out: if (mtd->ecc_stats.failed - stats.failed) return -EBADMSG; + if (ret) + return ret; + return mtd->ecc_stats.corrected - stats.corrected ? -EUCLEAN : 0; } -- cgit v1.1 From b3c9f8bfe7ab366a5d2495ebe5d2dc6fd7368122 Mon Sep 17 00:00:00 2001 From: Kyungmin Park Date: Fri, 5 Jan 2007 19:16:04 +0900 Subject: [MTD] OneNAND: return ecc error code only when 2-bit ecc occurs we don't need to return ecc error when 1-bit ecc. We only return error code when 2-bit ecc error Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index abbe160..2ea07f57 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -327,12 +327,12 @@ static int onenand_wait(struct mtd_info *mtd, int state) int ecc = this->read_word(this->base + ONENAND_REG_ECC_STATUS); if (ecc) { DEBUG(MTD_DEBUG_LEVEL0, "onenand_wait: ECC error = 0x%04x\n", ecc); - if (ecc & ONENAND_ECC_2BIT_ALL) + if (ecc & ONENAND_ECC_2BIT_ALL) { mtd->ecc_stats.failed++; - else if (ecc & ONENAND_ECC_1BIT_ALL) + return ecc; + } else if (ecc & ONENAND_ECC_1BIT_ALL) mtd->ecc_stats.corrected++; } - return ecc; } return 0; -- cgit v1.1 From 0fc2ccea4c8fa779053cb6f8984f6da399a81182 Mon Sep 17 00:00:00 2001 From: Adrian Hunter Date: Tue, 9 Jan 2007 17:55:21 +0200 Subject: [MTD] OneNAND: Handle DDP chip boundary during read-while-load The read-while-load method of reading from OneNAND needs to allow for the change of bufferRAM address at the boundary between the two chips in a double density (DDP) device. Signed-off-by: Adrian Hunter Signed-off-by: Kyungmin Park --- drivers/mtd/onenand/onenand_base.c | 15 ++++++++++++++- 1 file changed, 14 insertions(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/mtd/onenand/onenand_base.c b/drivers/mtd/onenand/onenand_base.c index 2ea07f57..2da6bb2 100644 --- a/drivers/mtd/onenand/onenand_base.c +++ b/drivers/mtd/onenand/onenand_base.c @@ -710,7 +710,7 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, struct mtd_ecc_stats stats; int read = 0, column; int thislen; - int ret = 0; + int ret = 0, boundary = 0; DEBUG(MTD_DEBUG_LEVEL3, "onenand_read: from = 0x%08x, len = %i\n", (unsigned int) from, (int) len); @@ -749,6 +749,17 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, from += thislen; if (read + thislen < len) { this->command(mtd, ONENAND_CMD_READ, from, mtd->writesize); + /* + * Chip boundary handling in DDP + * Now we issued chip 1 read and pointed chip 1 + * bufferam so we have to point chip 0 bufferam. + */ + if (this->device_id & ONENAND_DEVICE_IS_DDP && + unlikely(from == (this->chipsize >> 1))) { + this->write_word(0, this->base + ONENAND_REG_START_ADDRESS2); + boundary = 1; + } else + boundary = 0; ONENAND_SET_PREV_BUFFERRAM(this); } /* While load is going, read from last bufferRAM */ @@ -758,6 +769,8 @@ static int onenand_read(struct mtd_info *mtd, loff_t from, size_t len, if (read == len) break; /* Set up for next read from bufferRAM */ + if (unlikely(boundary)) + this->write_word(0x8000, this->base + ONENAND_REG_START_ADDRESS2); ONENAND_SET_NEXT_BUFFERRAM(this); buf += thislen; thislen = min_t(int, mtd->writesize, len - read); -- cgit v1.1 From c9d8c2b324d24ffb4fdcd93b3f752530a5a0a591 Mon Sep 17 00:00:00 2001 From: Daniel Ritz Date: Mon, 11 Dec 2006 18:17:45 +0100 Subject: usbtouchscreen: make ITM screens report BTN_TOUCH as zero when not touched ITM screens send invalid x/y data when not touched. this was fixes a while ago but the problem is if the screen is not touched anymore the driver never does not report BTN_TOUCH as zero. fix it by sending the report with the last valid coordinates when pressure is released. Signed-off-by: Daniel Ritz Cc: J.P. Delport Signed-off-by: Greg Kroah-Hartman --- drivers/usb/input/usbtouchscreen.c | 98 +++++++++++++++++++++++--------------- 1 file changed, 59 insertions(+), 39 deletions(-) (limited to 'drivers') diff --git a/drivers/usb/input/usbtouchscreen.c b/drivers/usb/input/usbtouchscreen.c index 7f3c57d..86e37a2 100644 --- a/drivers/usb/input/usbtouchscreen.c +++ b/drivers/usb/input/usbtouchscreen.c @@ -66,7 +66,7 @@ struct usbtouch_device_info { void (*process_pkt) (struct usbtouch_usb *usbtouch, unsigned char *pkt, int len); int (*get_pkt_len) (unsigned char *pkt, int len); - int (*read_data) (unsigned char *pkt, int *x, int *y, int *touch, int *press); + int (*read_data) (struct usbtouch_usb *usbtouch, unsigned char *pkt); int (*init) (struct usbtouch_usb *usbtouch); }; @@ -85,6 +85,9 @@ struct usbtouch_usb { struct usbtouch_device_info *type; char name[128]; char phys[64]; + + int x, y; + int touch, press; }; @@ -161,14 +164,14 @@ static struct usb_device_id usbtouch_devices[] = { #define EGALAX_PKT_TYPE_REPT 0x80 #define EGALAX_PKT_TYPE_DIAG 0x0A -static int egalax_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int egalax_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { if ((pkt[0] & EGALAX_PKT_TYPE_MASK) != EGALAX_PKT_TYPE_REPT) return 0; - *x = ((pkt[3] & 0x0F) << 7) | (pkt[4] & 0x7F); - *y = ((pkt[1] & 0x0F) << 7) | (pkt[2] & 0x7F); - *touch = pkt[0] & 0x01; + dev->x = ((pkt[3] & 0x0F) << 7) | (pkt[4] & 0x7F); + dev->y = ((pkt[1] & 0x0F) << 7) | (pkt[2] & 0x7F); + dev->touch = pkt[0] & 0x01; return 1; } @@ -195,11 +198,11 @@ static int egalax_get_pkt_len(unsigned char *buf, int len) * PanJit Part */ #ifdef CONFIG_USB_TOUCHSCREEN_PANJIT -static int panjit_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int panjit_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { - *x = ((pkt[2] & 0x0F) << 8) | pkt[1]; - *y = ((pkt[4] & 0x0F) << 8) | pkt[3]; - *touch = pkt[0] & 0x01; + dev->x = ((pkt[2] & 0x0F) << 8) | pkt[1]; + dev->y = ((pkt[4] & 0x0F) << 8) | pkt[3]; + dev->touch = pkt[0] & 0x01; return 1; } @@ -215,11 +218,11 @@ static int panjit_read_data(unsigned char *pkt, int *x, int *y, int *touch, int #define MTOUCHUSB_RESET 7 #define MTOUCHUSB_REQ_CTRLLR_ID 10 -static int mtouch_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int mtouch_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { - *x = (pkt[8] << 8) | pkt[7]; - *y = (pkt[10] << 8) | pkt[9]; - *touch = (pkt[2] & 0x40) ? 1 : 0; + dev->x = (pkt[8] << 8) | pkt[7]; + dev->y = (pkt[10] << 8) | pkt[9]; + dev->touch = (pkt[2] & 0x40) ? 1 : 0; return 1; } @@ -260,14 +263,32 @@ static int mtouch_init(struct usbtouch_usb *usbtouch) * ITM Part */ #ifdef CONFIG_USB_TOUCHSCREEN_ITM -static int itm_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int itm_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { - *x = ((pkt[0] & 0x1F) << 7) | (pkt[3] & 0x7F); - *y = ((pkt[1] & 0x1F) << 7) | (pkt[4] & 0x7F); - *press = ((pkt[2] & 0x01) << 7) | (pkt[5] & 0x7F); - *touch = ~pkt[7] & 0x20; + int touch; + /* + * ITM devices report invalid x/y data if not touched. + * if the screen was touched before but is not touched any more + * report touch as 0 with the last valid x/y data once. then stop + * reporting data until touched again. + */ + dev->press = ((pkt[2] & 0x01) << 7) | (pkt[5] & 0x7F); + + touch = ~pkt[7] & 0x20; + if (!touch) { + if (dev->touch) { + dev->touch = 0; + return 1; + } - return *touch; + return 0; + } + + dev->x = ((pkt[0] & 0x1F) << 7) | (pkt[3] & 0x7F); + dev->y = ((pkt[1] & 0x1F) << 7) | (pkt[4] & 0x7F); + dev->touch = touch; + + return 1; } #endif @@ -276,7 +297,7 @@ static int itm_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *pr * eTurboTouch part */ #ifdef CONFIG_USB_TOUCHSCREEN_ETURBO -static int eturbo_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int eturbo_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { unsigned int shift; @@ -285,9 +306,9 @@ static int eturbo_read_data(unsigned char *pkt, int *x, int *y, int *touch, int return 0; shift = (6 - (pkt[0] & 0x03)); - *x = ((pkt[3] << 7) | pkt[4]) >> shift; - *y = ((pkt[1] << 7) | pkt[2]) >> shift; - *touch = (pkt[0] & 0x10) ? 1 : 0; + dev->x = ((pkt[3] << 7) | pkt[4]) >> shift; + dev->y = ((pkt[1] << 7) | pkt[2]) >> shift; + dev->touch = (pkt[0] & 0x10) ? 1 : 0; return 1; } @@ -307,14 +328,14 @@ static int eturbo_get_pkt_len(unsigned char *buf, int len) * Gunze part */ #ifdef CONFIG_USB_TOUCHSCREEN_GUNZE -static int gunze_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int gunze_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { if (!(pkt[0] & 0x80) || ((pkt[1] | pkt[2] | pkt[3]) & 0x80)) return 0; - *x = ((pkt[0] & 0x1F) << 7) | (pkt[2] & 0x7F); - *y = ((pkt[1] & 0x1F) << 7) | (pkt[3] & 0x7F); - *touch = pkt[0] & 0x20; + dev->x = ((pkt[0] & 0x1F) << 7) | (pkt[2] & 0x7F); + dev->y = ((pkt[1] & 0x1F) << 7) | (pkt[3] & 0x7F); + dev->touch = pkt[0] & 0x20; return 1; } @@ -383,11 +404,11 @@ static int dmc_tsc10_init(struct usbtouch_usb *usbtouch) } -static int dmc_tsc10_read_data(unsigned char *pkt, int *x, int *y, int *touch, int *press) +static int dmc_tsc10_read_data(struct usbtouch_usb *dev, unsigned char *pkt) { - *x = ((pkt[2] & 0x03) << 8) | pkt[1]; - *y = ((pkt[4] & 0x03) << 8) | pkt[3]; - *touch = pkt[0] & 0x01; + dev->x = ((pkt[2] & 0x03) << 8) | pkt[1]; + dev->y = ((pkt[4] & 0x03) << 8) | pkt[3]; + dev->touch = pkt[0] & 0x01; return 1; } @@ -492,23 +513,22 @@ static struct usbtouch_device_info usbtouch_dev_info[] = { static void usbtouch_process_pkt(struct usbtouch_usb *usbtouch, unsigned char *pkt, int len) { - int x, y, touch, press; struct usbtouch_device_info *type = usbtouch->type; - if (!type->read_data(pkt, &x, &y, &touch, &press)) + if (!type->read_data(usbtouch, pkt)) return; - input_report_key(usbtouch->input, BTN_TOUCH, touch); + input_report_key(usbtouch->input, BTN_TOUCH, usbtouch->touch); if (swap_xy) { - input_report_abs(usbtouch->input, ABS_X, y); - input_report_abs(usbtouch->input, ABS_Y, x); + input_report_abs(usbtouch->input, ABS_X, usbtouch->y); + input_report_abs(usbtouch->input, ABS_Y, usbtouch->x); } else { - input_report_abs(usbtouch->input, ABS_X, x); - input_report_abs(usbtouch->input, ABS_Y, y); + input_report_abs(usbtouch->input, ABS_X, usbtouch->x); + input_report_abs(usbtouch->input, ABS_Y, usbtouch->y); } if (type->max_press) - input_report_abs(usbtouch->input, ABS_PRESSURE, press); + input_report_abs(usbtouch->input, ABS_PRESSURE, usbtouch->press); input_sync(usbtouch->input); } -- cgit v1.1 From d0ffff8fddd5853e4b2b101790ac0c3690655af5 Mon Sep 17 00:00:00 2001 From: Andres Salomon Date: Thu, 11 Jan 2007 18:39:16 -0500 Subject: USB: asix: Detect internal PHY and enable/use accordingly Different AX88772 dongles use different PHYs; the chip is capable of using both a primary and secondary PHY, and supports an internal and external PHY. It appears that some DUB-E100 devices use the internal PHY, so trying to use an external one will not work (note that this is different across revisions, as well; the "A" and "B" revs of the DUB-E100 use different PHYs!). The data sheet for the AX88772 chip specifies that the internal PHY id will be 0x10, so if that's read from the EEPROM, we should use that rather than attempting to use an external PHY. Thanks to Mitch Bradley for pointing this out! Signed-off-by: Andres Salomon Cc: David Hollis Cc: Chris Ball Signed-off-by: Greg Kroah-Hartman --- drivers/usb/net/asix.c | 18 +++++++++++++----- 1 file changed, 13 insertions(+), 5 deletions(-) (limited to 'drivers') diff --git a/drivers/usb/net/asix.c b/drivers/usb/net/asix.c index f538013..896449f 100644 --- a/drivers/usb/net/asix.c +++ b/drivers/usb/net/asix.c @@ -898,7 +898,7 @@ static int ax88772_link_reset(struct usbnet *dev) static int ax88772_bind(struct usbnet *dev, struct usb_interface *intf) { - int ret; + int ret, embd_phy; void *buf; u16 rx_ctl; struct asix_data *data = (struct asix_data *)&dev->data; @@ -919,13 +919,15 @@ static int ax88772_bind(struct usbnet *dev, struct usb_interface *intf) AX_GPIO_RSE | AX_GPIO_GPO_2 | AX_GPIO_GPO2EN, 5)) < 0) goto out2; + /* 0x10 is the phy id of the embedded 10/100 ethernet phy */ + embd_phy = ((asix_get_phy_addr(dev) & 0x1f) == 0x10 ? 1 : 0); if ((ret = asix_write_cmd(dev, AX_CMD_SW_PHY_SELECT, - 1, 0, 0, buf)) < 0) { + embd_phy, 0, 0, buf)) < 0) { dbg("Select PHY #1 failed: %d", ret); goto out2; } - if ((ret = asix_sw_reset(dev, AX_SWRESET_IPPD)) < 0) + if ((ret = asix_sw_reset(dev, AX_SWRESET_IPPD | AX_SWRESET_PRL)) < 0) goto out2; msleep(150); @@ -933,8 +935,14 @@ static int ax88772_bind(struct usbnet *dev, struct usb_interface *intf) goto out2; msleep(150); - if ((ret = asix_sw_reset(dev, AX_SWRESET_IPRL | AX_SWRESET_PRL)) < 0) - goto out2; + if (embd_phy) { + if ((ret = asix_sw_reset(dev, AX_SWRESET_IPRL)) < 0) + goto out2; + } + else { + if ((ret = asix_sw_reset(dev, AX_SWRESET_PRTE)) < 0) + goto out2; + } msleep(150); rx_ctl = asix_read_rx_ctl(dev); -- cgit v1.1 From deb31f1764e0a11bcfe8d44e0658f83d83860e84 Mon Sep 17 00:00:00 2001 From: Daniel Gollub Date: Tue, 16 Jan 2007 11:03:01 +0100 Subject: USB: rndis_host: fix crash while probing a Nokia S60 mobile Bug fix for driver rndis_host which fixes rndis_host probing certain Nokia S60 (Series 60) mobiles. While the rndis_host get probed by usbnet and tries to bind the Nokia mobile the bind is going to fail. The rndis_host module tries to release the device, in a wrong way, which cause the oops. Fixes Bugzilla #7201 Signed-off-by: Daniel Gollub Signed-off-by: Greg Kroah-Hartman --- drivers/usb/net/rndis_host.c | 23 ++++++++++++++--------- 1 file changed, 14 insertions(+), 9 deletions(-) (limited to 'drivers') diff --git a/drivers/usb/net/rndis_host.c b/drivers/usb/net/rndis_host.c index ea5f44d..a322a16 100644 --- a/drivers/usb/net/rndis_host.c +++ b/drivers/usb/net/rndis_host.c @@ -379,6 +379,7 @@ static int rndis_bind(struct usbnet *dev, struct usb_interface *intf) { int retval; struct net_device *net = dev->net; + struct cdc_state *info = (void *) &dev->data; union { void *buf; struct rndis_msg_hdr *header; @@ -397,7 +398,7 @@ static int rndis_bind(struct usbnet *dev, struct usb_interface *intf) return -ENOMEM; retval = usbnet_generic_cdc_bind(dev, intf); if (retval < 0) - goto done; + goto fail; net->hard_header_len += sizeof (struct rndis_data_hdr); @@ -412,10 +413,7 @@ static int rndis_bind(struct usbnet *dev, struct usb_interface *intf) if (unlikely(retval < 0)) { /* it might not even be an RNDIS device!! */ dev_err(&intf->dev, "RNDIS init failed, %d\n", retval); -fail: - usb_driver_release_interface(driver_of(intf), - ((struct cdc_state *)&(dev->data))->data); - goto done; + goto fail_and_release; } dev->hard_mtu = le32_to_cpu(u.init_c->max_transfer_size); /* REVISIT: peripheral "alignment" request is ignored ... */ @@ -431,7 +429,7 @@ fail: retval = rndis_command(dev, u.header); if (unlikely(retval < 0)) { dev_err(&intf->dev, "rndis get ethaddr, %d\n", retval); - goto fail; + goto fail_and_release; } tmp = le32_to_cpu(u.get_c->offset); if (unlikely((tmp + 8) > (1024 - ETH_ALEN) @@ -439,7 +437,7 @@ fail: dev_err(&intf->dev, "rndis ethaddr off %d len %d ?\n", tmp, le32_to_cpu(u.get_c->len)); retval = -EDOM; - goto fail; + goto fail_and_release; } memcpy(net->dev_addr, tmp + (char *)&u.get_c->request_id, ETH_ALEN); @@ -455,11 +453,18 @@ fail: retval = rndis_command(dev, u.header); if (unlikely(retval < 0)) { dev_err(&intf->dev, "rndis set packet filter, %d\n", retval); - goto fail; + goto fail_and_release; } retval = 0; -done: + + kfree(u.buf); + return retval; + +fail_and_release: + usb_set_intfdata(info->data, NULL); + usb_driver_release_interface(driver_of(intf), info->data); +fail: kfree(u.buf); return retval; } -- cgit v1.1 From 8d2bad8788a6f968247df409f50c757b1a5489f4 Mon Sep 17 00:00:00 2001 From: Oliver Neukum Date: Thu, 11 Jan 2007 10:14:33 +0100 Subject: USB: make usbhid ignore Imation Disc Stakka on request of the sourceforge project for this device, a kind of robotized CD storage, it should be ignored by the generic driver. Signed-off-by: Oliver Neukum Signed-off-by: Greg Kroah-Hartman --- drivers/usb/input/hid-core.c | 4 ++++ 1 file changed, 4 insertions(+) (limited to 'drivers') diff --git a/drivers/usb/input/hid-core.c b/drivers/usb/input/hid-core.c index 6e739ef..ea3636d 100644 --- a/drivers/usb/input/hid-core.c +++ b/drivers/usb/input/hid-core.c @@ -796,6 +796,9 @@ void usbhid_init_reports(struct hid_device *hid) #define USB_VENDOR_ID_LOGITECH 0x046d #define USB_DEVICE_ID_LOGITECH_USB_RECEIVER 0xc101 +#define USB_VENDOR_ID_IMATION 0x0718 +#define USB_DEVICE_ID_DISC_STAKKA 0xd000 + /* * Alphabetically sorted blacklist by quirk type. */ @@ -883,6 +886,7 @@ static const struct hid_blacklist { { USB_VENDOR_ID_GTCO_IPANEL_1, USB_DEVICE_ID_GTCO_10, HID_QUIRK_IGNORE }, { USB_VENDOR_ID_GTCO_IPANEL_2, USB_DEVICE_ID_GTCO_8, HID_QUIRK_IGNORE }, { USB_VENDOR_ID_GTCO_IPANEL_2, USB_DEVICE_ID_GTCO_d, HID_QUIRK_IGNORE }, + { USB_VENDOR_ID_IMATION, USB_DEVICE_ID_DISC_STAKKA, HID_QUIRK_IGNORE }, { USB_VENDOR_ID_KBGEAR, USB_DEVICE_ID_KBGEAR_JAMSTUDIO, HID_QUIRK_IGNORE }, { USB_VENDOR_ID_LD, USB_DEVICE_ID_LD_CASSY, HID_QUIRK_IGNORE }, { USB_VENDOR_ID_LD, USB_DEVICE_ID_LD_POCKETCASSY, HID_QUIRK_IGNORE }, -- cgit v1.1 From 379885a9b204dec9d0009b6b450e104389b4a590 Mon Sep 17 00:00:00 2001 From: Pete Zaitcev Date: Sat, 13 Jan 2007 15:17:46 -0800 Subject: USB: unusual_devs.h for 0x046b:ff40 American Megatrends did something wrong in their floppy emulator. It breaks with both kinds of MODE SENSE which our stack sends. Alan and I tried a few tweaks, and got LUNs sensed right, but US_FL_NO_WP_DETECT is still needed. I set the firmware bracket to 1.00 exactly, in case AMI or Sun fix it with a firmware update. Hey, you never know. Signed-off-by: Pete Zaitcev Signed-off-by: Phil Dibowitz Signed-off-by: Greg Kroah-Hartman --- drivers/usb/storage/unusual_devs.h | 12 ++++++++++++ 1 file changed, 12 insertions(+) (limited to 'drivers') diff --git a/drivers/usb/storage/unusual_devs.h b/drivers/usb/storage/unusual_devs.h index cddef3e..4ef6496 100644 --- a/drivers/usb/storage/unusual_devs.h +++ b/drivers/usb/storage/unusual_devs.h @@ -254,6 +254,18 @@ UNUSUAL_DEV( 0x045a, 0x5210, 0x0101, 0x0101, US_SC_SCSI, US_PR_KARMA, rio_karma_init, 0), #endif +/* + * This virtual floppy is found in Sun equipment (x4600, x4200m2, etc.) + * Reported by Pete Zaitcev + * This device chokes on both version of MODE SENSE which we have, so + * use_10_for_ms is not effective, and we use US_FL_NO_WP_DETECT. + */ +UNUSUAL_DEV( 0x046b, 0xff40, 0x0100, 0x0100, + "AMI", + "Virtual Floppy", + US_SC_DEVICE, US_PR_DEVICE, NULL, + US_FL_NO_WP_DETECT), + /* Patch submitted by Philipp Friedrich */ UNUSUAL_DEV( 0x0482, 0x0100, 0x0100, 0x0100, "Kyocera", -- cgit v1.1 From 53e8f84dc68f29c724bbb7e0675040386f6143ae Mon Sep 17 00:00:00 2001 From: "garrett_damore@tadpole.com" Date: Fri, 12 Jan 2007 17:10:28 -0800 Subject: USB: add vendor/device id for Option GT Max 3.6 cards This fixes http://bugzilla.kernel.org/show_bug.cgi?id=7814 Signed-off-by: Greg Kroah-Hartman --- drivers/usb/serial/option.c | 3 +++ 1 file changed, 3 insertions(+) (limited to 'drivers') diff --git a/drivers/usb/serial/option.c b/drivers/usb/serial/option.c index 5ca04e8..0fed43a 100644 --- a/drivers/usb/serial/option.c +++ b/drivers/usb/serial/option.c @@ -78,6 +78,7 @@ static int option_send_setup(struct usb_serial_port *port); #define OPTION_PRODUCT_FUSION2 0x6300 #define OPTION_PRODUCT_COBRA 0x6500 #define OPTION_PRODUCT_COBRA2 0x6600 +#define OPTION_PRODUCT_GTMAX36 0x6701 #define HUAWEI_PRODUCT_E600 0x1001 #define HUAWEI_PRODUCT_E220 0x1003 #define AUDIOVOX_PRODUCT_AIRCARD 0x0112 @@ -90,6 +91,7 @@ static struct usb_device_id option_ids[] = { { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_FUSION2) }, { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_COBRA) }, { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_COBRA2) }, + { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_GTMAX36) }, { USB_DEVICE(HUAWEI_VENDOR_ID, HUAWEI_PRODUCT_E600) }, { USB_DEVICE(HUAWEI_VENDOR_ID, HUAWEI_PRODUCT_E220) }, { USB_DEVICE(AUDIOVOX_VENDOR_ID, AUDIOVOX_PRODUCT_AIRCARD) }, @@ -104,6 +106,7 @@ static struct usb_device_id option_ids1[] = { { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_FUSION2) }, { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_COBRA) }, { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_COBRA2) }, + { USB_DEVICE(OPTION_VENDOR_ID, OPTION_PRODUCT_GTMAX36) }, { USB_DEVICE(HUAWEI_VENDOR_ID, HUAWEI_PRODUCT_E600) }, { USB_DEVICE(HUAWEI_VENDOR_ID, HUAWEI_PRODUCT_E220) }, { USB_DEVICE(AUDIOVOX_VENDOR_ID, AUDIOVOX_PRODUCT_AIRCARD) }, -- cgit v1.1 From b1bf4f412b4818869106ffcb5304d69551697b9c Mon Sep 17 00:00:00 2001 From: Greg Kroah-Hartman Date: Tue, 16 Jan 2007 15:41:03 -0800 Subject: USB: disable USB_MULTITHREAD_PROBE Disable the USB_MULTITHREAD_PROBE option because it causes crashes on people's machines and they never remember to actually read the config help files. No one likes this, everyone hates it, I'm going to go eat worms... The full logic will be ripped out later. Signed-off-by: Greg Kroah-Hartman --- drivers/usb/core/Kconfig | 16 ---------------- drivers/usb/core/hub.c | 9 +-------- 2 files changed, 1 insertion(+), 24 deletions(-) (limited to 'drivers') diff --git a/drivers/usb/core/Kconfig b/drivers/usb/core/Kconfig index f8324d8..3e66b2a 100644 --- a/drivers/usb/core/Kconfig +++ b/drivers/usb/core/Kconfig @@ -72,22 +72,6 @@ config USB_SUSPEND If you are unsure about this, say N here. -config USB_MULTITHREAD_PROBE - bool "USB Multi-threaded probe (EXPERIMENTAL)" - depends on USB && EXPERIMENTAL - default n - help - Say Y here if you want the USB core to spawn a new thread for - every USB device that is probed. This can cause a small speedup - in boot times on systems with a lot of different USB devices. - - This option should be safe to enable, but if any odd probing - problems are found, please disable it, or dynamically turn it - off in the /sys/module/usbcore/parameters/multithread_probe - file - - When in doubt, say N. - config USB_OTG bool depends on USB && EXPERIMENTAL diff --git a/drivers/usb/core/hub.c b/drivers/usb/core/hub.c index 2651c2e..1988224 100644 --- a/drivers/usb/core/hub.c +++ b/drivers/usb/core/hub.c @@ -88,14 +88,7 @@ static DECLARE_WAIT_QUEUE_HEAD(khubd_wait); static struct task_struct *khubd_task; /* multithreaded probe logic */ -static int multithread_probe = -#ifdef CONFIG_USB_MULTITHREAD_PROBE - 1; -#else - 0; -#endif -module_param(multithread_probe, bool, S_IRUGO); -MODULE_PARM_DESC(multithread_probe, "Run each USB device probe in a new thread"); +static int multithread_probe = 0; /* cycle leds on hubs that aren't blinking for attention */ static int blinkenlights = 0; -- cgit v1.1 From caaf26325d70f5b559a647d4c11d84ef5a3341a4 Mon Sep 17 00:00:00 2001 From: Petr Stetiar Date: Wed, 17 Jan 2007 06:30:39 -0800 Subject: USB: Fix for typo in ohci-ep93xx.c Attached patch fixes typo in USB driver reported by Chase Douglas on linux-cirrus mailing list. http://www.freelists.org/archives/linux-cirrus/12-2006/msg00003.html Signed-off-by: Petr Stetiar Signed-off-by: David Brownell Signed-off-by: Greg Kroah-Hartman --- drivers/usb/host/ohci-ep93xx.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/usb/host/ohci-ep93xx.c b/drivers/usb/host/ohci-ep93xx.c index 43ae696..3348b07 100644 --- a/drivers/usb/host/ohci-ep93xx.c +++ b/drivers/usb/host/ohci-ep93xx.c @@ -169,7 +169,7 @@ static int ohci_hcd_ep93xx_drv_remove(struct platform_device *pdev) static int ohci_hcd_ep93xx_drv_suspend(struct platform_device *pdev, pm_message_t state) { struct usb_hcd *hcd = platform_get_drvdata(pdev); - struct ochi_hcd *ohci = hcd_to_ohci(hcd); + struct ohci_hcd *ohci = hcd_to_ohci(hcd); if (time_before(jiffies, ohci->next_statechange)) msleep(5); -- cgit v1.1 From 39559b4ff89e390c42633d23d257e793a1177e03 Mon Sep 17 00:00:00 2001 From: Manuel Osdoba Date: Thu, 18 Jan 2007 21:28:45 +0100 Subject: USB: unusual_devs.h entry for nokia 6233 In appendix a patch for the nokia 6233 mobile phone is included. The patch is against 2.6.20-rc5. It is my first patch. Hopefully it has the right format. The code makes my nokia 6233 on my computer work. From: Manuel Osdoba Signed-off-by: Greg Kroah-Hartman --- drivers/usb/storage/unusual_devs.h | 7 +++++++ 1 file changed, 7 insertions(+) (limited to 'drivers') diff --git a/drivers/usb/storage/unusual_devs.h b/drivers/usb/storage/unusual_devs.h index 4ef6496..b49f2a7 100644 --- a/drivers/usb/storage/unusual_devs.h +++ b/drivers/usb/storage/unusual_devs.h @@ -197,6 +197,13 @@ UNUSUAL_DEV( 0x0421, 0x047c, 0x0370, 0x0370, US_SC_DEVICE, US_PR_DEVICE, NULL, US_FL_MAX_SECTORS_64 ), +/* Reported by Manuel Osdoba */ +UNUSUAL_DEV( 0x0421, 0x0492, 0x0452, 0x0452, + "Nokia", + "Nokia 6233", + US_SC_DEVICE, US_PR_DEVICE, NULL, + US_FL_MAX_SECTORS_64 ), + /* Reported by Alex Corcoles */ UNUSUAL_DEV( 0x0421, 0x0495, 0x0370, 0x0370, "Nokia", -- cgit v1.1 From 2e45785c529e0c60b1801b4fabacb05e0b8cdf87 Mon Sep 17 00:00:00 2001 From: Jean Delvare Date: Fri, 5 Jan 2007 09:17:56 +0100 Subject: PCI: Unhide the SMBus on the Asus P4P800-X Unhide the SMBus on the Asus P4P800-X (and probably some other models of the family.) This gives access to the memory module SPD EEPROMs. Thanks to Winbond for supporting the lm-sensors project with the donation of this motherboard. Signed-off-by: Jean Delvare Signed-off-by: Greg Kroah-Hartman --- drivers/pci/quirks.c | 5 +++++ 1 file changed, 5 insertions(+) (limited to 'drivers') diff --git a/drivers/pci/quirks.c b/drivers/pci/quirks.c index 0a70943..ef882a8 100644 --- a/drivers/pci/quirks.c +++ b/drivers/pci/quirks.c @@ -1002,6 +1002,11 @@ static void __init asus_hides_smbus_hostbridge(struct pci_dev *dev) case 0x186a: /* M6Ne notebook */ asus_hides_smbus = 1; } + if (dev->device == PCI_DEVICE_ID_INTEL_82865_HB) + switch (dev->subsystem_device) { + case 0x80f2: /* P4P800-X */ + asus_hides_smbus = 1; + } if (dev->device == PCI_DEVICE_ID_INTEL_82915GM_HB) { switch (dev->subsystem_device) { case 0x1882: /* M6V notebook */ -- cgit v1.1 From ae9608af9e300395ec032479621f32688c121141 Mon Sep 17 00:00:00 2001 From: Randy Dunlap Date: Tue, 9 Jan 2007 21:41:01 -0800 Subject: PCI: fix pci-driver kernel-doc Function short description should be on only one line. Signed-off-by: Randy Dunlap Signed-off-by: Greg Kroah-Hartman --- drivers/pci/pci-driver.c | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/pci/pci-driver.c b/drivers/pci/pci-driver.c index b8d2385..92d5e8d 100644 --- a/drivers/pci/pci-driver.c +++ b/drivers/pci/pci-driver.c @@ -150,8 +150,7 @@ const struct pci_device_id *pci_match_id(const struct pci_device_id *ids, } /** - * pci_match_device - Tell if a PCI device structure has a matching - * PCI device id structure + * pci_match_device - Tell if a PCI device structure has a matching PCI device id structure * @drv: the PCI driver to match against * @dev: the PCI device structure to match against * -- cgit v1.1 From a20f3a6d7e67a8aee571fb04634a631ba59f6e92 Mon Sep 17 00:00:00 2001 From: Ishai Rabinovitz Date: Tue, 16 Jan 2007 17:20:25 +0200 Subject: IB/srp: Check match_strdup() return Checks if the kmalloc in match_strdup() was successful, and bail out on looking at the token if it failed. Signed-off-by: Ishai Rabinovitz Signed-off-by: Roland Dreier --- drivers/infiniband/ulp/srp/ib_srp.c | 20 ++++++++++++++++++++ 1 file changed, 20 insertions(+) (limited to 'drivers') diff --git a/drivers/infiniband/ulp/srp/ib_srp.c b/drivers/infiniband/ulp/srp/ib_srp.c index cdecbf5..72611fd 100644 --- a/drivers/infiniband/ulp/srp/ib_srp.c +++ b/drivers/infiniband/ulp/srp/ib_srp.c @@ -1621,18 +1621,30 @@ static int srp_parse_options(const char *buf, struct srp_target_port *target) switch (token) { case SRP_OPT_ID_EXT: p = match_strdup(args); + if (!p) { + ret = -ENOMEM; + goto out; + } target->id_ext = cpu_to_be64(simple_strtoull(p, NULL, 16)); kfree(p); break; case SRP_OPT_IOC_GUID: p = match_strdup(args); + if (!p) { + ret = -ENOMEM; + goto out; + } target->ioc_guid = cpu_to_be64(simple_strtoull(p, NULL, 16)); kfree(p); break; case SRP_OPT_DGID: p = match_strdup(args); + if (!p) { + ret = -ENOMEM; + goto out; + } if (strlen(p) != 32) { printk(KERN_WARNING PFX "bad dest GID parameter '%s'\n", p); kfree(p); @@ -1656,6 +1668,10 @@ static int srp_parse_options(const char *buf, struct srp_target_port *target) case SRP_OPT_SERVICE_ID: p = match_strdup(args); + if (!p) { + ret = -ENOMEM; + goto out; + } target->service_id = cpu_to_be64(simple_strtoull(p, NULL, 16)); kfree(p); break; @@ -1693,6 +1709,10 @@ static int srp_parse_options(const char *buf, struct srp_target_port *target) case SRP_OPT_INITIATOR_EXT: p = match_strdup(args); + if (!p) { + ret = -ENOMEM; + goto out; + } target->initiator_ext = cpu_to_be64(simple_strtoull(p, NULL, 16)); kfree(p); break; -- cgit v1.1 From ce29d72cc737df3573854a4719f00385adf1c9a6 Mon Sep 17 00:00:00 2001 From: Hoang-Nam Nguyen Date: Fri, 19 Jan 2007 22:50:10 +0100 Subject: IB/ehca: Fix improper use of yield() with spinlock held Signed-off-by: Hoang-Nam Nguyen Signed-off-by: Roland Dreier --- drivers/infiniband/hw/ehca/ehca_cq.c | 5 ++++- 1 file changed, 4 insertions(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/infiniband/hw/ehca/ehca_cq.c b/drivers/infiniband/hw/ehca/ehca_cq.c index 93995b6..6074c89 100644 --- a/drivers/infiniband/hw/ehca/ehca_cq.c +++ b/drivers/infiniband/hw/ehca/ehca_cq.c @@ -344,8 +344,11 @@ int ehca_destroy_cq(struct ib_cq *cq) unsigned long flags; spin_lock_irqsave(&ehca_cq_idr_lock, flags); - while (my_cq->nr_callbacks) + while (my_cq->nr_callbacks) { + spin_unlock_irqrestore(&ehca_cq_idr_lock, flags); yield(); + spin_lock_irqsave(&ehca_cq_idr_lock, flags); + } idr_remove(&ehca_cq_idr, my_cq->token); spin_unlock_irqrestore(&ehca_cq_idr_lock, flags); -- cgit v1.1 From cea9ea67e9927da18af89b49bd949a8d65ba1b15 Mon Sep 17 00:00:00 2001 From: Hoang-Nam Nguyen Date: Fri, 19 Jan 2007 22:50:10 +0100 Subject: IB/ehca: Fix mismatched spin_unlock in irq handler The lock is taken with _irqsave and hence must be released with _irqrestore on all paths. Signed-off-by Hoang-Nam Nguyen Signed-off-by: Roland Dreier --- drivers/infiniband/hw/ehca/ehca_irq.c | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/infiniband/hw/ehca/ehca_irq.c b/drivers/infiniband/hw/ehca/ehca_irq.c index e7209af..c069be8 100644 --- a/drivers/infiniband/hw/ehca/ehca_irq.c +++ b/drivers/infiniband/hw/ehca/ehca_irq.c @@ -440,7 +440,8 @@ void ehca_tasklet_eq(unsigned long data) cq = idr_find(&ehca_cq_idr, token); if (cq == NULL) { - spin_unlock(&ehca_cq_idr_lock); + spin_unlock_irqrestore(&ehca_cq_idr_lock, + flags); break; } -- cgit v1.1 From e00154891137e3b0659556b877d45a16cabd700c Mon Sep 17 00:00:00 2001 From: Herbert Xu Date: Tue, 23 Jan 2007 14:10:00 +1100 Subject: [PATCH] vmx: Fix register constraint in launch code Both "=r" and "=g" breaks my build on i386: $ make CC [M] drivers/kvm/vmx.o {standard input}: Assembler messages: {standard input}:3318: Error: bad register name `%sil' make[1]: *** [drivers/kvm/vmx.o] Error 1 make: *** [_module_drivers/kvm] Error 2 The reason is that setbe requires an 8-bit register but "=r" does not constrain the target register to be one that has an 8-bit version on i386. According to http://gcc.gnu.org/bugzilla/show_bug.cgi?id=10153 the correct constraint is "=q". Signed-off-by: Herbert Xu Signed-off-by: Linus Torvalds --- drivers/kvm/vmx.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/kvm/vmx.c b/drivers/kvm/vmx.c index ce219e3..0aa2659 100644 --- a/drivers/kvm/vmx.c +++ b/drivers/kvm/vmx.c @@ -1824,7 +1824,7 @@ again: #endif "setbe %0 \n\t" "popf \n\t" - : "=g" (fail) + : "=q" (fail) : "r"(vcpu->launched), "d"((unsigned long)HOST_RSP), "c"(vcpu), [rax]"i"(offsetof(struct kvm_vcpu, regs[VCPU_REGS_RAX])), -- cgit v1.1 From 084384754ebe6636f9e5554ad30b3143b4a26c84 Mon Sep 17 00:00:00 2001 From: Avi Kivity Date: Mon, 22 Jan 2007 20:40:38 -0800 Subject: [PATCH] KVM: make sure there is a vcpu context loaded when destroying the mmu This makes the vmwrite errors on vm shutdown go away. Signed-off-by: Avi Kivity Cc: Ingo Molnar Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/kvm/kvm_main.c | 2 ++ 1 file changed, 2 insertions(+) (limited to 'drivers') diff --git a/drivers/kvm/kvm_main.c b/drivers/kvm/kvm_main.c index 67c1154..be4651a 100644 --- a/drivers/kvm/kvm_main.c +++ b/drivers/kvm/kvm_main.c @@ -272,7 +272,9 @@ static void kvm_free_physmem(struct kvm *kvm) static void kvm_free_vcpu(struct kvm_vcpu *vcpu) { + vcpu_load(vcpu->kvm, vcpu_slot(vcpu)); kvm_mmu_destroy(vcpu); + vcpu_put(vcpu); kvm_arch_ops->vcpu_free(vcpu); } -- cgit v1.1 From cccf748b810832cfab4dbb3ed4c7cf1a1ee35ad2 Mon Sep 17 00:00:00 2001 From: Avi Kivity Date: Mon, 22 Jan 2007 20:40:39 -0800 Subject: [PATCH] KVM: fix race between mmio reads and injected interrupts The kvm mmio read path looks like: 1. guest read faults 2. kvm emulates read, calls emulator_read_emulated() 3. fails as a read requires userspace help 4. exit to userspace 5. userspace emulates read, kvm sets vcpu->mmio_read_completed 6. re-enter guest, fault again 7. kvm emulates read, calls emulator_read_emulated() 8. succeeds as vcpu->mmio_read_emulated is set 9. instruction completes and guest is resumed A problem surfaces if the userspace exit (step 5) also requests an interrupt injection. In that case, the guest does not re-execute the original instruction, but the interrupt handler. The next time an mmio read is exectued (likely for a different address), step 3 will find vcpu->mmio_read_completed set and return the value read for the original instruction. The problem manifested itself in a few annoying ways: - little squares appear randomly on console when switching virtual terminals - ne2000 fails under nfs read load - rtl8139 complains about "pci errors" even though the device model is incapable of issuing them. Fix by skipping interrupt injection if an mmio read is pending. A better fix is to avoid re-entry into the guest, and re-emulating immediately instead. However that's a bit more complex. Signed-off-by: Avi Kivity Cc: Ingo Molnar Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/kvm/svm.c | 3 ++- drivers/kvm/vmx.c | 3 ++- 2 files changed, 4 insertions(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/kvm/svm.c b/drivers/kvm/svm.c index 714f6a7..7397bfbb 100644 --- a/drivers/kvm/svm.c +++ b/drivers/kvm/svm.c @@ -1407,7 +1407,8 @@ static int svm_vcpu_run(struct kvm_vcpu *vcpu, struct kvm_run *kvm_run) int r; again: - do_interrupt_requests(vcpu, kvm_run); + if (!vcpu->mmio_read_completed) + do_interrupt_requests(vcpu, kvm_run); clgi(); diff --git a/drivers/kvm/vmx.c b/drivers/kvm/vmx.c index 0aa2659..27f2751 100644 --- a/drivers/kvm/vmx.c +++ b/drivers/kvm/vmx.c @@ -1717,7 +1717,8 @@ again: vmcs_writel(HOST_GS_BASE, segment_base(gs_sel)); #endif - do_interrupt_requests(vcpu, kvm_run); + if (!vcpu->mmio_read_completed) + do_interrupt_requests(vcpu, kvm_run); if (vcpu->guest_debug.enabled) kvm_guest_debug_pre(vcpu); -- cgit v1.1 From 038e51de2e7ae2c8e9d8a0b15231f8509875dc33 Mon Sep 17 00:00:00 2001 From: Avi Kivity Date: Mon, 22 Jan 2007 20:40:40 -0800 Subject: [PATCH] KVM: x86 emulator: fix bit string instructions The various bit string instructions (bts, btc, etc.) fail to adjust the address correctly if the bit address is beyond BITS_PER_LONG. This bug creeped in as the emulator originally relied on cr2 to contain the memory address; however we now decode it from the mod r/m bits, and must adjust the offset to account for large bit indices. The patch is rather large because it switches src and dst decoding around, so that the bit index is available when decoding the memory address. This fixes workloads like the FC5 installer. Signed-off-by: Avi Kivity Cc: Ingo Molnar Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/kvm/x86_emulate.c | 98 +++++++++++++++++++++++++---------------------- 1 file changed, 52 insertions(+), 46 deletions(-) (limited to 'drivers') diff --git a/drivers/kvm/x86_emulate.c b/drivers/kvm/x86_emulate.c index be70795..7513cdd 100644 --- a/drivers/kvm/x86_emulate.c +++ b/drivers/kvm/x86_emulate.c @@ -61,6 +61,7 @@ #define ModRM (1<<6) /* Destination is only written; never read. */ #define Mov (1<<7) +#define BitOp (1<<8) static u8 opcode_table[256] = { /* 0x00 - 0x07 */ @@ -148,7 +149,7 @@ static u8 opcode_table[256] = { 0, 0, ByteOp | DstMem | SrcNone | ModRM, DstMem | SrcNone | ModRM }; -static u8 twobyte_table[256] = { +static u16 twobyte_table[256] = { /* 0x00 - 0x0F */ 0, SrcMem | ModRM | DstReg, 0, 0, 0, 0, ImplicitOps, 0, 0, 0, 0, 0, 0, ImplicitOps | ModRM, 0, 0, @@ -180,16 +181,16 @@ static u8 twobyte_table[256] = { /* 0x90 - 0x9F */ 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, /* 0xA0 - 0xA7 */ - 0, 0, 0, DstMem | SrcReg | ModRM, 0, 0, 0, 0, + 0, 0, 0, DstMem | SrcReg | ModRM | BitOp, 0, 0, 0, 0, /* 0xA8 - 0xAF */ - 0, 0, 0, DstMem | SrcReg | ModRM, 0, 0, 0, 0, + 0, 0, 0, DstMem | SrcReg | ModRM | BitOp, 0, 0, 0, 0, /* 0xB0 - 0xB7 */ ByteOp | DstMem | SrcReg | ModRM, DstMem | SrcReg | ModRM, 0, - DstMem | SrcReg | ModRM, + DstMem | SrcReg | ModRM | BitOp, 0, 0, ByteOp | DstReg | SrcMem | ModRM | Mov, DstReg | SrcMem16 | ModRM | Mov, /* 0xB8 - 0xBF */ - 0, 0, DstMem | SrcImmByte | ModRM, DstMem | SrcReg | ModRM, + 0, 0, DstMem | SrcImmByte | ModRM, DstMem | SrcReg | ModRM | BitOp, 0, 0, ByteOp | DstReg | SrcMem | ModRM | Mov, DstReg | SrcMem16 | ModRM | Mov, /* 0xC0 - 0xCF */ @@ -469,7 +470,8 @@ static int read_descriptor(struct x86_emulate_ctxt *ctxt, int x86_emulate_memop(struct x86_emulate_ctxt *ctxt, struct x86_emulate_ops *ops) { - u8 b, d, sib, twobyte = 0, rex_prefix = 0; + unsigned d; + u8 b, sib, twobyte = 0, rex_prefix = 0; u8 modrm, modrm_mod = 0, modrm_reg = 0, modrm_rm = 0; unsigned long *override_base = NULL; unsigned int op_bytes, ad_bytes, lock_prefix = 0, rep_prefix = 0, i; @@ -726,46 +728,6 @@ done_prefixes: ; } - /* Decode and fetch the destination operand: register or memory. */ - switch (d & DstMask) { - case ImplicitOps: - /* Special instructions do their own operand decoding. */ - goto special_insn; - case DstReg: - dst.type = OP_REG; - if ((d & ByteOp) - && !(twobyte_table && (b == 0xb6 || b == 0xb7))) { - dst.ptr = decode_register(modrm_reg, _regs, - (rex_prefix == 0)); - dst.val = *(u8 *) dst.ptr; - dst.bytes = 1; - } else { - dst.ptr = decode_register(modrm_reg, _regs, 0); - switch ((dst.bytes = op_bytes)) { - case 2: - dst.val = *(u16 *)dst.ptr; - break; - case 4: - dst.val = *(u32 *)dst.ptr; - break; - case 8: - dst.val = *(u64 *)dst.ptr; - break; - } - } - break; - case DstMem: - dst.type = OP_MEM; - dst.ptr = (unsigned long *)cr2; - dst.bytes = (d & ByteOp) ? 1 : op_bytes; - if (!(d & Mov) && /* optimisation - avoid slow emulated read */ - ((rc = ops->read_emulated((unsigned long)dst.ptr, - &dst.val, dst.bytes, ctxt)) != 0)) - goto done; - break; - } - dst.orig_val = dst.val; - /* * Decode and fetch the source operand: register, memory * or immediate. @@ -838,6 +800,50 @@ done_prefixes: break; } + /* Decode and fetch the destination operand: register or memory. */ + switch (d & DstMask) { + case ImplicitOps: + /* Special instructions do their own operand decoding. */ + goto special_insn; + case DstReg: + dst.type = OP_REG; + if ((d & ByteOp) + && !(twobyte_table && (b == 0xb6 || b == 0xb7))) { + dst.ptr = decode_register(modrm_reg, _regs, + (rex_prefix == 0)); + dst.val = *(u8 *) dst.ptr; + dst.bytes = 1; + } else { + dst.ptr = decode_register(modrm_reg, _regs, 0); + switch ((dst.bytes = op_bytes)) { + case 2: + dst.val = *(u16 *)dst.ptr; + break; + case 4: + dst.val = *(u32 *)dst.ptr; + break; + case 8: + dst.val = *(u64 *)dst.ptr; + break; + } + } + break; + case DstMem: + dst.type = OP_MEM; + dst.ptr = (unsigned long *)cr2; + dst.bytes = (d & ByteOp) ? 1 : op_bytes; + if (d & BitOp) { + dst.ptr += src.val / BITS_PER_LONG; + dst.bytes = sizeof(long); + } + if (!(d & Mov) && /* optimisation - avoid slow emulated read */ + ((rc = ops->read_emulated((unsigned long)dst.ptr, + &dst.val, dst.bytes, ctxt)) != 0)) + goto done; + break; + } + dst.orig_val = dst.val; + if (twobyte) goto twobyte_insn; -- cgit v1.1 From fc3dffe12148b9612870eb21b24f2aecefa9ea24 Mon Sep 17 00:00:00 2001 From: Avi Kivity Date: Mon, 22 Jan 2007 20:40:40 -0800 Subject: [PATCH] KVM: fix bogus pagefault on writable pages If a page is marked as dirty in the guest pte, set_pte_common() can set the writable bit on newly-instantiated shadow pte. This optimization avoids a write fault after the initial read fault. However, if a write fault instantiates the pte, fix_write_pf() incorrectly reports the fault as a guest page fault, and the guest oopses on what appears to be a correctly-mapped page. Fix is to detect the condition and only report a guest page fault on a user access to a kernel page. With the fix, a kvm guest can survive a whole night of running the kernel hacker's screensaver (make -j9 in a loop). Signed-off-by: Avi Kivity Cc: Ingo Molnar Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/kvm/paging_tmpl.h | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/kvm/paging_tmpl.h b/drivers/kvm/paging_tmpl.h index 2dbf430..6bc4195 100644 --- a/drivers/kvm/paging_tmpl.h +++ b/drivers/kvm/paging_tmpl.h @@ -274,7 +274,7 @@ static int FNAME(fix_write_pf)(struct kvm_vcpu *vcpu, struct kvm_mmu_page *page; if (is_writeble_pte(*shadow_ent)) - return 0; + return !user || (*shadow_ent & PT_USER_MASK); writable_shadow = *shadow_ent & PT_SHADOW_WRITABLE_MASK; if (user) { -- cgit v1.1 From 15c945c3d0913d73a7d57d7a0a3c4e2902598cc6 Mon Sep 17 00:00:00 2001 From: Jamie Lenehan Date: Mon, 22 Jan 2007 20:40:41 -0800 Subject: [PATCH] rtc-sh: act on rtc_wkalrm.enabled when setting an alarm This fixes the SH rtc driver correctly act on the "enabled" flag when setting an alarm. Signed-off-by: Jamie Lenehan Cc: David Brownell Cc: Alessandro Zummo Cc: Paul Mundt Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/rtc/rtc-sh.c | 12 +++++++----- 1 file changed, 7 insertions(+), 5 deletions(-) (limited to 'drivers') diff --git a/drivers/rtc/rtc-sh.c b/drivers/rtc/rtc-sh.c index e9e0934..198b9f2 100644 --- a/drivers/rtc/rtc-sh.c +++ b/drivers/rtc/rtc-sh.c @@ -492,10 +492,10 @@ static int sh_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *wkalrm) spin_lock_irq(&rtc->lock); - /* disable alarm interrupt and clear flag */ + /* disable alarm interrupt and clear the alarm flag */ rcr1 = readb(rtc->regbase + RCR1); - rcr1 &= ~RCR1_AF; - writeb(rcr1 & ~RCR1_AIE, rtc->regbase + RCR1); + rcr1 &= ~(RCR1_AF|RCR1_AIE); + writeb(rcr1, rtc->regbase + RCR1); rtc->rearm_aie = 0; @@ -510,8 +510,10 @@ static int sh_rtc_set_alarm(struct device *dev, struct rtc_wkalrm *wkalrm) mon += 1; sh_rtc_write_alarm_value(rtc, mon, RMONAR); - /* Restore interrupt activation status */ - writeb(rcr1, rtc->regbase + RCR1); + if (wkalrm->enabled) { + rcr1 |= RCR1_AIE; + writeb(rcr1, rtc->regbase + RCR1); + } spin_unlock_irq(&rtc->lock); -- cgit v1.1 From 79603a35009ff39562cd5634fa1cf513eb080f27 Mon Sep 17 00:00:00 2001 From: Mark Gross Date: Mon, 22 Jan 2007 20:40:44 -0800 Subject: [PATCH] tlclk: bug fix + misc fixes The following patch fixes a few problems with the tlclk driver. * bug in the select_amcb1_transmit_clock * racy read sys call * racy open sys call * use of add_timer where mod_timer would be better * change to the timer data parameter use Signed-off-by: Mark Gross Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/char/tlclk.c | 43 ++++++++++++++++++++++++++++--------------- 1 file changed, 28 insertions(+), 15 deletions(-) (limited to 'drivers') diff --git a/drivers/char/tlclk.c b/drivers/char/tlclk.c index 448d508..4fac2bd 100644 --- a/drivers/char/tlclk.c +++ b/drivers/char/tlclk.c @@ -186,6 +186,7 @@ static int got_event; /* if events processing have been done */ static void switchover_timeout(unsigned long data); static struct timer_list switchover_timer = TIMER_INITIALIZER(switchover_timeout , 0, 0); +static unsigned long tlclk_timer_data; static struct tlclk_alarms *alarm_events; @@ -197,10 +198,19 @@ static irqreturn_t tlclk_interrupt(int irq, void *dev_id); static DECLARE_WAIT_QUEUE_HEAD(wq); +static unsigned long useflags; +static DEFINE_MUTEX(tlclk_mutex); + static int tlclk_open(struct inode *inode, struct file *filp) { int result; + if (test_and_set_bit(0, &useflags)) + return -EBUSY; + /* this legacy device is always one per system and it doesn't + * know how to handle multiple concurrent clients. + */ + /* Make sure there is no interrupt pending while * initialising interrupt handler */ inb(TLCLK_REG6); @@ -221,6 +231,7 @@ static int tlclk_open(struct inode *inode, struct file *filp) static int tlclk_release(struct inode *inode, struct file *filp) { free_irq(telclk_interrupt, tlclk_interrupt); + clear_bit(0, &useflags); return 0; } @@ -230,26 +241,25 @@ static ssize_t tlclk_read(struct file *filp, char __user *buf, size_t count, { if (count < sizeof(struct tlclk_alarms)) return -EIO; + if (mutex_lock_interruptible(&tlclk_mutex)) + return -EINTR; + wait_event_interruptible(wq, got_event); - if (copy_to_user(buf, alarm_events, sizeof(struct tlclk_alarms))) + if (copy_to_user(buf, alarm_events, sizeof(struct tlclk_alarms))) { + mutex_unlock(&tlclk_mutex); return -EFAULT; + } memset(alarm_events, 0, sizeof(struct tlclk_alarms)); got_event = 0; + mutex_unlock(&tlclk_mutex); return sizeof(struct tlclk_alarms); } -static ssize_t tlclk_write(struct file *filp, const char __user *buf, size_t count, - loff_t *f_pos) -{ - return 0; -} - static const struct file_operations tlclk_fops = { .read = tlclk_read, - .write = tlclk_write, .open = tlclk_open, .release = tlclk_release, @@ -540,7 +550,7 @@ static ssize_t store_select_amcb1_transmit_clock(struct device *d, SET_PORT_BITS(TLCLK_REG3, 0xf8, 0x7); switch (val) { case CLK_8_592MHz: - SET_PORT_BITS(TLCLK_REG0, 0xfc, 1); + SET_PORT_BITS(TLCLK_REG0, 0xfc, 2); break; case CLK_11_184MHz: SET_PORT_BITS(TLCLK_REG0, 0xfc, 0); @@ -549,7 +559,7 @@ static ssize_t store_select_amcb1_transmit_clock(struct device *d, SET_PORT_BITS(TLCLK_REG0, 0xfc, 3); break; case CLK_44_736MHz: - SET_PORT_BITS(TLCLK_REG0, 0xfc, 2); + SET_PORT_BITS(TLCLK_REG0, 0xfc, 1); break; } } else @@ -839,11 +849,13 @@ static void __exit tlclk_cleanup(void) static void switchover_timeout(unsigned long data) { - if ((data & 1)) { - if ((inb(TLCLK_REG1) & 0x08) != (data & 0x08)) + unsigned long flags = *(unsigned long *) data; + + if ((flags & 1)) { + if ((inb(TLCLK_REG1) & 0x08) != (flags & 0x08)) alarm_events->switchover_primary++; } else { - if ((inb(TLCLK_REG1) & 0x08) != (data & 0x08)) + if ((inb(TLCLK_REG1) & 0x08) != (flags & 0x08)) alarm_events->switchover_secondary++; } @@ -901,8 +913,9 @@ static irqreturn_t tlclk_interrupt(int irq, void *dev_id) /* TIMEOUT in ~10ms */ switchover_timer.expires = jiffies + msecs_to_jiffies(10); - switchover_timer.data = inb(TLCLK_REG1); - add_timer(&switchover_timer); + tlclk_timer_data = inb(TLCLK_REG1); + switchover_timer.data = (unsigned long) &tlclk_timer_data; + mod_timer(&switchover_timer, switchover_timer.expires); } else { got_event = 1; wake_up(&wq); -- cgit v1.1 From 3a7122923e87fc5cdf8affa1845924a0def4657d Mon Sep 17 00:00:00 2001 From: Jeff Chua Date: Mon, 22 Jan 2007 20:40:50 -0800 Subject: [PATCH] acpi: remove "video device notify" message Seems to be some left-over debug code. Cc: Len Brown Signed-off-by: Andrew Morton Signed-off-by: Linus Torvalds --- drivers/acpi/video.c | 2 -- 1 file changed, 2 deletions(-) (limited to 'drivers') diff --git a/drivers/acpi/video.c b/drivers/acpi/video.c index 36b37d7..3d54680 100644 --- a/drivers/acpi/video.c +++ b/drivers/acpi/video.c @@ -1677,8 +1677,6 @@ static void acpi_video_device_notify(acpi_handle handle, u32 event, void *data) struct acpi_video_device *video_device = data; struct acpi_device *device = NULL; - - printk("video device notify\n"); if (!video_device) return; -- cgit v1.1 From 364ca8a897eadb2f0e76b7f0ffe94168f6d83d66 Mon Sep 17 00:00:00 2001 From: Yoichi Yuasa Date: Mon, 22 Jan 2007 23:01:06 +0900 Subject: [MIPS] Vr41xx: Fix after GENERIC_HARDIRQS_NO__DO_IRQ change Signed-off-by: Yoichi Yuasa Signed-off-by: Ralf Baechle --- drivers/char/vr41xx_giu.c | 114 +++++++++++++++++++++------------------------- 1 file changed, 52 insertions(+), 62 deletions(-) (limited to 'drivers') diff --git a/drivers/char/vr41xx_giu.c b/drivers/char/vr41xx_giu.c index a744dad..0cea8d4 100644 --- a/drivers/char/vr41xx_giu.c +++ b/drivers/char/vr41xx_giu.c @@ -3,7 +3,7 @@ * * Copyright (C) 2002 MontaVista Software Inc. * Author: Yoichi Yuasa - * Copyright (C) 2003-2005 Yoichi Yuasa + * Copyright (C) 2003-2007 Yoichi Yuasa * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by @@ -125,30 +125,17 @@ static inline uint16_t giu_clear(uint16_t offset, uint16_t clear) return data; } -static unsigned int startup_giuint_low_irq(unsigned int irq) +static void ack_giuint_low(unsigned int irq) { - unsigned int pin; - - pin = GPIO_PIN_OF_IRQ(irq); - giu_write(GIUINTSTATL, 1 << pin); - giu_set(GIUINTENL, 1 << pin); - - return 0; + giu_write(GIUINTSTATL, 1 << GPIO_PIN_OF_IRQ(irq)); } -static void shutdown_giuint_low_irq(unsigned int irq) +static void mask_giuint_low(unsigned int irq) { giu_clear(GIUINTENL, 1 << GPIO_PIN_OF_IRQ(irq)); } -static void enable_giuint_low_irq(unsigned int irq) -{ - giu_set(GIUINTENL, 1 << GPIO_PIN_OF_IRQ(irq)); -} - -#define disable_giuint_low_irq shutdown_giuint_low_irq - -static void ack_giuint_low_irq(unsigned int irq) +static void mask_ack_giuint_low(unsigned int irq) { unsigned int pin; @@ -157,46 +144,30 @@ static void ack_giuint_low_irq(unsigned int irq) giu_write(GIUINTSTATL, 1 << pin); } -static void end_giuint_low_irq(unsigned int irq) +static void unmask_giuint_low(unsigned int irq) { - if (!(irq_desc[irq].status & (IRQ_DISABLED | IRQ_INPROGRESS))) - giu_set(GIUINTENL, 1 << GPIO_PIN_OF_IRQ(irq)); + giu_set(GIUINTENL, 1 << GPIO_PIN_OF_IRQ(irq)); } -static struct hw_interrupt_type giuint_low_irq_type = { - .typename = "GIUINTL", - .startup = startup_giuint_low_irq, - .shutdown = shutdown_giuint_low_irq, - .enable = enable_giuint_low_irq, - .disable = disable_giuint_low_irq, - .ack = ack_giuint_low_irq, - .end = end_giuint_low_irq, +static struct irq_chip giuint_low_irq_chip = { + .name = "GIUINTL", + .ack = ack_giuint_low, + .mask = mask_giuint_low, + .mask_ack = mask_ack_giuint_low, + .unmask = unmask_giuint_low, }; -static unsigned int startup_giuint_high_irq(unsigned int irq) +static void ack_giuint_high(unsigned int irq) { - unsigned int pin; - - pin = GPIO_PIN_OF_IRQ(irq) - GIUINT_HIGH_OFFSET; - giu_write(GIUINTSTATH, 1 << pin); - giu_set(GIUINTENH, 1 << pin); - - return 0; + giu_write(GIUINTSTATH, 1 << (GPIO_PIN_OF_IRQ(irq) - GIUINT_HIGH_OFFSET)); } -static void shutdown_giuint_high_irq(unsigned int irq) +static void mask_giuint_high(unsigned int irq) { giu_clear(GIUINTENH, 1 << (GPIO_PIN_OF_IRQ(irq) - GIUINT_HIGH_OFFSET)); } -static void enable_giuint_high_irq(unsigned int irq) -{ - giu_set(GIUINTENH, 1 << (GPIO_PIN_OF_IRQ(irq) - GIUINT_HIGH_OFFSET)); -} - -#define disable_giuint_high_irq shutdown_giuint_high_irq - -static void ack_giuint_high_irq(unsigned int irq) +static void mask_ack_giuint_high(unsigned int irq) { unsigned int pin; @@ -205,20 +176,17 @@ static void ack_giuint_high_irq(unsigned int irq) giu_write(GIUINTSTATH, 1 << pin); } -static void end_giuint_high_irq(unsigned int irq) +static void unmask_giuint_high(unsigned int irq) { - if (!(irq_desc[irq].status & (IRQ_DISABLED | IRQ_INPROGRESS))) - giu_set(GIUINTENH, 1 << (GPIO_PIN_OF_IRQ(irq) - GIUINT_HIGH_OFFSET)); + giu_set(GIUINTENH, 1 << (GPIO_PIN_OF_IRQ(irq) - GIUINT_HIGH_OFFSET)); } -static struct hw_interrupt_type giuint_high_irq_type = { - .typename = "GIUINTH", - .startup = startup_giuint_high_irq, - .shutdown = shutdown_giuint_high_irq, - .enable = enable_giuint_high_irq, - .disable = disable_giuint_high_irq, - .ack = ack_giuint_high_irq, - .end = end_giuint_high_irq, +static struct irq_chip giuint_high_irq_chip = { + .name = "GIUINTH", + .ack = ack_giuint_high, + .mask = mask_giuint_high, + .mask_ack = mask_ack_giuint_high, + .unmask = unmask_giuint_high, }; static int giu_get_irq(unsigned int irq) @@ -282,9 +250,15 @@ void vr41xx_set_irq_trigger(unsigned int pin, irq_trigger_t trigger, irq_signal_ break; } } + set_irq_chip_and_handler(GIU_IRQ(pin), + &giuint_low_irq_chip, + handle_edge_irq); } else { giu_clear(GIUINTTYPL, mask); giu_clear(GIUINTHTSELL, mask); + set_irq_chip_and_handler(GIU_IRQ(pin), + &giuint_low_irq_chip, + handle_level_irq); } giu_write(GIUINTSTATL, mask); } else if (pin < GIUINT_HIGH_MAX) { @@ -311,9 +285,15 @@ void vr41xx_set_irq_trigger(unsigned int pin, irq_trigger_t trigger, irq_signal_ break; } } + set_irq_chip_and_handler(GIU_IRQ(pin), + &giuint_high_irq_chip, + handle_edge_irq); } else { giu_clear(GIUINTTYPH, mask); giu_clear(GIUINTHTSELH, mask); + set_irq_chip_and_handler(GIU_IRQ(pin), + &giuint_high_irq_chip, + handle_level_irq); } giu_write(GIUINTSTATH, mask); } @@ -617,10 +597,11 @@ static const struct file_operations gpio_fops = { static int __devinit giu_probe(struct platform_device *dev) { unsigned long start, size, flags = 0; - unsigned int nr_pins = 0; + unsigned int nr_pins = 0, trigger, i, pin; struct resource *res1, *res2 = NULL; void *base; - int retval, i; + struct irq_chip *chip; + int retval; switch (current_cpu_data.cputype) { case CPU_VR4111: @@ -688,11 +669,20 @@ static int __devinit giu_probe(struct platform_device *dev) giu_write(GIUINTENL, 0); giu_write(GIUINTENH, 0); + trigger = giu_read(GIUINTTYPH) << 16; + trigger |= giu_read(GIUINTTYPL); for (i = GIU_IRQ_BASE; i <= GIU_IRQ_LAST; i++) { - if (i < GIU_IRQ(GIUINT_HIGH_OFFSET)) - irq_desc[i].chip = &giuint_low_irq_type; + pin = GPIO_PIN_OF_IRQ(i); + if (pin < GIUINT_HIGH_OFFSET) + chip = &giuint_low_irq_chip; else - irq_desc[i].chip = &giuint_high_irq_type; + chip = &giuint_high_irq_chip; + + if (trigger & (1 << pin)) + set_irq_chip_and_handler(i, chip, handle_edge_irq); + else + set_irq_chip_and_handler(i, chip, handle_level_irq); + } return cascade_irq(GIUINT_IRQ, giu_get_irq); -- cgit v1.1 From c3ea6729feb304e0c3be74e8eca001215e78d1bc Mon Sep 17 00:00:00 2001 From: Al Viro Date: Tue, 23 Jan 2007 12:25:08 +0000 Subject: [PATCH] funsoft: ktermios fix Signed-off-by: Al Viro Signed-off-by: Linus Torvalds --- drivers/usb/serial/funsoft.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/usb/serial/funsoft.c b/drivers/usb/serial/funsoft.c index 31501c9..2bebd63 100644 --- a/drivers/usb/serial/funsoft.c +++ b/drivers/usb/serial/funsoft.c @@ -27,7 +27,7 @@ MODULE_DEVICE_TABLE(usb, id_table); static int funsoft_ioctl(struct usb_serial_port *port, struct file *file, unsigned int cmd, unsigned long arg) { - struct termios t; + struct ktermios t; dbg("%s - port %d, cmd 0x%04x", __FUNCTION__, port->number, cmd); -- cgit v1.1 From 0a3c4bdc1b197a7d37fc75643a68daf45fe0a7cc Mon Sep 17 00:00:00 2001 From: Al Viro Date: Tue, 23 Jan 2007 12:25:08 +0000 Subject: [PATCH] horizon.c: missing __devinit Signed-off-by: Al Viro Signed-off-by: Linus Torvalds --- drivers/atm/horizon.c | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) (limited to 'drivers') diff --git a/drivers/atm/horizon.c b/drivers/atm/horizon.c index 4dc1010..f96446c 100644 --- a/drivers/atm/horizon.c +++ b/drivers/atm/horizon.c @@ -1845,7 +1845,7 @@ static u16 __devinit read_bia (const hrz_dev * dev, u16 addr) /********** initialise a card **********/ -static int __init hrz_init (hrz_dev * dev) { +static int __devinit hrz_init (hrz_dev * dev) { int onefivefive; u16 chan; -- cgit v1.1 From 4384247b6910df91049f8d0bbd5c1075898ac290 Mon Sep 17 00:00:00 2001 From: Al Viro Date: Tue, 23 Jan 2007 12:25:08 +0000 Subject: [PATCH] s2io bogus memset memset() after kmalloc() on size * 8 would better be on size * 8, not just size; fixed by switching to kcalloc() - it's more idiomatic anyway. Signed-off-by: Al Viro Signed-off-by: Linus Torvalds --- drivers/net/s2io.c | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) (limited to 'drivers') diff --git a/drivers/net/s2io.c b/drivers/net/s2io.c index 250cdbe..1dd66b8 100644 --- a/drivers/net/s2io.c +++ b/drivers/net/s2io.c @@ -556,10 +556,9 @@ static int init_shared_mem(struct s2io_nic *nic) } } - nic->ufo_in_band_v = kmalloc((sizeof(u64) * size), GFP_KERNEL); + nic->ufo_in_band_v = kcalloc(size, sizeof(u64), GFP_KERNEL); if (!nic->ufo_in_band_v) return -ENOMEM; - memset(nic->ufo_in_band_v, 0, size); /* Allocation and initialization of RXDs in Rings */ size = 0; -- cgit v1.1 From 65ebe63420eae40fba73d3b4f79f99adc8e148b3 Mon Sep 17 00:00:00 2001 From: Stephen Hemminger Date: Tue, 23 Jan 2007 11:38:57 -0800 Subject: [PATCH] email change for shemminger@osdl.org Change my email address to reflect OSDL merger. Signed-off-by: Stephen Hemminger [ The irony. Somebody still has his sign-off message hardcoded in a script or his brainstem ;^] Signed-off-by: Linus Torvalds --- drivers/net/irda/stir4200.c | 2 +- drivers/net/skge.c | 2 +- drivers/net/sky2.c | 2 +- 3 files changed, 3 insertions(+), 3 deletions(-) (limited to 'drivers') diff --git a/drivers/net/irda/stir4200.c b/drivers/net/irda/stir4200.c index c14a746..20d306f 100644 --- a/drivers/net/irda/stir4200.c +++ b/drivers/net/irda/stir4200.c @@ -59,7 +59,7 @@ #include #include -MODULE_AUTHOR("Stephen Hemminger "); +MODULE_AUTHOR("Stephen Hemminger "); MODULE_DESCRIPTION("IrDA-USB Dongle Driver for SigmaTel STIr4200"); MODULE_LICENSE("GPL"); diff --git a/drivers/net/skge.c b/drivers/net/skge.c index deedfd5..45283f3 100644 --- a/drivers/net/skge.c +++ b/drivers/net/skge.c @@ -60,7 +60,7 @@ #define LINK_HZ (HZ/2) MODULE_DESCRIPTION("SysKonnect Gigabit Ethernet driver"); -MODULE_AUTHOR("Stephen Hemminger "); +MODULE_AUTHOR("Stephen Hemminger "); MODULE_LICENSE("GPL"); MODULE_VERSION(DRV_VERSION); diff --git a/drivers/net/sky2.c b/drivers/net/sky2.c index a6601e8..a2e804d 100644 --- a/drivers/net/sky2.c +++ b/drivers/net/sky2.c @@ -3691,6 +3691,6 @@ module_init(sky2_init_module); module_exit(sky2_cleanup_module); MODULE_DESCRIPTION("Marvell Yukon 2 Gigabit Ethernet driver"); -MODULE_AUTHOR("Stephen Hemminger "); +MODULE_AUTHOR("Stephen Hemminger "); MODULE_LICENSE("GPL"); MODULE_VERSION(DRV_VERSION); -- cgit v1.1 From 419dd8378dfa32985672ab7927b4bc827f33b332 Mon Sep 17 00:00:00 2001 From: Oleg Nesterov Date: Tue, 23 Jan 2007 20:04:13 -0300 Subject: V4L/DVB (5123): Buf_qbuf: fix: videobuf_queue->stream corruption and lockup We are doing ->buf_prepare(buf) before adding buf to q->stream list. This means that videobuf_qbuf() should not try to re-add a STATE_PREPARED buffer. Signed-off-by: Oleg Nesterov Signed-off-by: Mauro Carvalho Chehab --- drivers/media/video/video-buf.c | 1 + 1 file changed, 1 insertion(+) (limited to 'drivers') diff --git a/drivers/media/video/video-buf.c b/drivers/media/video/video-buf.c index 635d102..6504a58 100644 --- a/drivers/media/video/video-buf.c +++ b/drivers/media/video/video-buf.c @@ -700,6 +700,7 @@ videobuf_qbuf(struct videobuf_queue *q, goto done; } if (buf->state == STATE_QUEUED || + buf->state == STATE_PREPARED || buf->state == STATE_ACTIVE) { dprintk(1,"qbuf: buffer is already queued or active.\n"); goto done; -- cgit v1.1