| Commit message (Collapse) | Author | Age | Files | Lines |
|---|
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
When we use an initial delay, e.g.: 'perf record --delay 1000', we do not
enable the events until that delay has passed after we started the workload,
including the tracking event, i.e. the one for which we have attr.mmap, etc,
enabled to ask the kernel to generate the PERF_RECORD_{MMAP,COMM,EXEC} metadata
events that will then allow us to resolve addresses in samples to the map, dso
and symbol. There will be a shadow that even synthesizing samples won't cover,
i.e. the workload that we start and other processes forking while we
wait for the initial delay to expire.
So use a dummy event to be the tracking one and make it be enabled on exec.
Before:
# perf record --delay 1000 stress --cpu 1 --timeout 5
stress: info: [9029] dispatching hogs: 1 cpu, 0 io, 0 vm, 0 hdd
stress: info: [9029] successful run completed in 5s
[ perf record: Woken up 3 times to write data ]
[ perf record: Captured and wrote 0.624 MB perf.data (15908 samples) ]
# perf script | head
:9031 9031 32001.826888: 1 cycles:ppp: ffffffff831aa30d event_function (/lib/modules/4.14.0-rc6+/build/vmlinux)
:9031 9031 32001.826893: 1 cycles:ppp: ffffffff8300d1a0 intel_bts_enable_local (/lib/modules/4.14.0-rc6+/build/vmlinux)
:9031 9031 32001.826895: 7 cycles:ppp: ffffffff83023870 sched_clock (/lib/modules/4.14.0-rc6+/build/vmlinux)
:9031 9031 32001.826897: 103 cycles:ppp: ffffffff8300c331 intel_pmu_handle_irq (/lib/modules/4.14.0-rc6+/build/vmlinux)
:9031 9031 32001.826899: 1615 cycles:ppp: ffffffff830231f8 native_sched_clock (/lib/modules/4.14.0-rc6+/build/vmlinux)
:9031 9031 32001.826902: 26724 cycles:ppp: ffffffff8384c6a7 native_irq_return_iret (/lib/modules/4.14.0-rc6+/build/vmlinux)
:9031 9031 32001.826913: 329739 cycles:ppp: 7fb2a5410932 [unknown] ([unknown])
:9031 9031 32001.827033: 1225451 cycles:ppp: 7fb2a5410930 [unknown] ([unknown])
:9031 9031 32001.827474: 1391725 cycles:ppp: 7fb2a5410930 [unknown] ([unknown])
:9031 9031 32001.827978: 1233697 cycles:ppp: 7fb2a5410928 [unknown] ([unknown])
#
After:
# perf record --delay 1000 stress --cpu 1 --timeout 5
stress: info: [9741] dispatching hogs: 1 cpu, 0 io, 0 vm, 0 hdd
stress: info: [9741] successful run completed in 5s
[ perf record: Woken up 3 times to write data ]
[ perf record: Captured and wrote 0.751 MB perf.data (15976 samples) ]
# perf script | head
stress 9742 32110.959106: 1 cycles:ppp: ffffffff831b26f6 __perf_event_task_sched_in (/lib/modules/4.14.0-rc6+/build/vmlinux)
stress 9742 32110.959110: 1 cycles:ppp: ffffffff8300c2e9 intel_pmu_handle_irq (/lib/modules/4.14.0-rc6+/build/vmlinux)
stress 9742 32110.959112: 7 cycles:ppp: ffffffff830231e0 native_sched_clock (/lib/modules/4.14.0-rc6+/build/vmlinux)
stress 9742 32110.959115: 101 cycles:ppp: ffffffff83023870 sched_clock (/lib/modules/4.14.0-rc6+/build/vmlinux)
stress 9742 32110.959117: 1533 cycles:ppp: ffffffff830231f8 native_sched_clock (/lib/modules/4.14.0-rc6+/build/vmlinux)
stress 9742 32110.959119: 23992 cycles:ppp: ffffffff831b0900 ctx_sched_in (/lib/modules/4.14.0-rc6+/build/vmlinux)
stress 9742 32110.959129: 329406 cycles:ppp: 7f4b1b661930 __random_r (/usr/lib64/libc-2.25.so)
stress 9742 32110.959249: 1288322 cycles:ppp: 5566e1e7cbc9 hogcpu (/usr/bin/stress)
stress 9742 32110.959712: 1464046 cycles:ppp: 7f4b1b66179e __random (/usr/lib64/libc-2.25.so)
stress 9742 32110.960241: 1266918 cycles:ppp: 7f4b1b66195b __random_r (/usr/lib64/libc-2.25.so)
#
Reported-by: Bram Stolk <b.stolk@gmail.com>
Tested-by: Bram Stolk <b.stolk@gmail.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Andi Kleen <ak@linux.intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Fixes: 6619a53ef757 ("perf record: Add --initial-delay option")
Link: http://lkml.kernel.org/n/tip-nrdfchshqxf7diszhxcecqb9@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
The evsel->idx field is used mainly to access the right bucket in
per-event arrays such as the annotation ones, but also to set
evsel->tracking, that in turn will decide what of the events will ask
for PERF_RECORD_{MMAP,COMM,EXEC} to be generated, i.e. which
perf_event_attr will have its mmap, etc fields set.
When we were adding the "dummy" event using perf_evlist__add_dummy() we
were not setting it correctly, which could result in multiple tracking
events.
Now that I'll try using a dummy event to be the tracking one when using
'perf record --delay', i.e. when we process the --delay
setting we may already have the evlist set up, like with:
perf record -e cycles,instructions --delay 1000 ./workload
We will need to add a "dummy" event, then reset evsel->tracking for the
first event, "cycles", and set it instead to the dummy one, and also
setting its attr.enable_on_exec, so that we get the PERF_RECORD_MMAP,
etc metadata events while waiting to enable the explicitely requested
events, so lets get this straight and set the right evsel->idx.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Bram Stolk <b.stolk@gmail.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-nrdfchshqxf7diszhxcecqb9@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| |\
| |
| |
| |
| |
| | |
To pick up fixes.
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
Last minute upstream update to one of the UAPI headers - sync it with tooling,
to address this warning:
Warning: Kernel ABI header at 'tools/include/uapi/drm/i915_drm.h' differs from latest version at 'include/uapi/drm/i915_drm.h'
Cc: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: linux-kernel@vger.kernel.org
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | |\
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
git://git.kernel.org/pub/scm/linux/kernel/git/acme/linux into perf/urgent
Pull perf tooling fixes from Arnaldo Carvalho de Melo.
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Otherwise 'perf trace' leaves a temporary file /tmp/perf-vdso.so-XXXXXX.
$ perf trace -o log true
$ ls -l /tmp/perf-vdso.*
-rw------- 1 root root 8192 Nov 8 03:08 /tmp/perf-vdso.so-5bCpD0
Signed-off-by: Andrei Vagin <avagin@openvz.org>
Reviewed-by: Jiri Olsa <jolsa@redhat.com>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Vasily Averin <vvs@virtuozzo.com>
Link: http://lkml.kernel.org/r/20171108002246.8924-1-avagin@openvz.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Looks like I've reached the new level of stupidity, adding missing braces.
Committer testing:
Given the following eBPF C filter, that will add a record when it
returns true, i.e. when the tv_nsec variable is > 2000ns, should be
built and installed via sys_bpf(), but fails to do so before this patch:
# cat filter.c
#include <uapi/linux/bpf.h>
#define SEC(NAME) __attribute__((section(NAME), used))
SEC("func=hrtimer_nanosleep rqtp->tv_nsec")
int func(void *ctx, int err, long nsec)
{
return nsec > 1000;
}
char _license[] SEC("license") = "GPL";
int _version SEC("version") = LINUX_VERSION_CODE;
#
# perf trace -e nanosleep,filter.c usleep 1
invalid or unsupported event: 'filter.c'
Run 'perf list' for a list of valid events
Usage: perf trace [<options>] [<command>]
or: perf trace [<options>] -- <command> [<options>]
or: perf trace record [<options>] [<command>]
or: perf trace record [<options>] -- <command> [<options>]
-e, --event <event> event/syscall selector. use 'perf list' to list available events
#
And works again after it is applied, the nothing is inserted when the co
# perf trace -e *sleep,filter.c usleep 1
0.000 ( 0.066 ms): usleep/23994 nanosleep(rqtp: 0x7ffead94a0d0) = 0
# perf trace -e *sleep,filter.c usleep 2
0.000 ( 0.008 ms): usleep/24378 nanosleep(rqtp: 0x7fffa021ba50) ...
0.008 ( ): perf_bpf_probe:func:(ffffffffb410cb30) tv_nsec=2000)
0.000 ( 0.066 ms): usleep/24378 ... [continued]: nanosleep()) = 0
#
The intent of 9445464bb831 is kept:
# perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..cuted.core,krava/'
\___ unknown term
valid terms: cmask,pc,event,edge,in_tx,any,ldlat,inv,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period
Run 'perf list' for a list of valid events
Usage: perf stat [<options>] [<command>]
-e, --event <event> event selector. use 'perf list' to list available events
#
# perf stat -e 'cpu/uops_executed.core,period=1/' true
Performance counter stats for 'true':
808,332 cpu/uops_executed.core,period=1/
0.002997237 seconds time elapsed
#
Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT")
Link: http://lkml.kernel.org/n/tip-diea0ihbwpxfw6938huv3whj@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Arnaldo reported broken builds in some distros using a newer flex
release, 2.6.4, found in Alpine Linux 3.6 and Edge, with flex not
spotting the REJECT macro:
CC /tmp/build/perf/util/parse-events-flex.o
util/parse-events.l: In function 'parse_events_lex':
/tmp/build/perf/util/parse-events-flex.c:4734:16: error: \
'reject_used_but_not_detected' undeclared (first use in this function)
It's happening because we put the REJECT under another USER_REJECT macro
in following commit:
9445464bb831 perf tools: Unwind properly location after REJECT
Fortunately flex provides option for force it to use REJECT, adding it
to parse-events.l.
Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Reported-by: Markus Trippelsdorf <markus@trippelsdorf.de>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Reviewed-by: Andi Kleen <andi@firstfloor.org>
Tested-by: Arnaldo Carvalho de Melo <acme@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT")
Link: http://lkml.kernel.org/n/tip-7kdont984mw12ijk7rji6b8p@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| |\ \ \
| |/ /
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Conflicts:
tools/perf/arch/arm/annotate/instructions.c
tools/perf/arch/arm64/annotate/instructions.c
tools/perf/arch/powerpc/annotate/instructions.c
tools/perf/arch/s390/annotate/instructions.c
tools/perf/arch/x86/tests/intel-cqm.c
tools/perf/ui/tui/progress.c
tools/perf/util/zlib.c
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | |\ \
| | |/
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip
Pull perf fixes from Ingo Molnar:
"Various fixes:
- synchronize kernel and tooling headers
- cgroup support fix
- two tooling fixes"
* 'perf-urgent-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip:
tools/headers: Synchronize kernel ABI headers
perf/cgroup: Fix perf cgroup hierarchy support
perf tools: Unwind properly location after REJECT
perf symbols: Fix memory corruption because of zero length symbols
|
| | | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
After the SPDX license tags were added a number of tooling headers got out of
sync with their kernel variants, generating lots of build warnings.
Sync them:
- tools/arch/x86/include/asm/disabled-features.h,
tools/arch/x86/include/asm/required-features.h,
tools/include/linux/hash.h:
Remove the SPDX tag where the kernel version does not have it.
- tools/include/asm-generic/bitops/__fls.h,
tools/include/asm-generic/bitops/arch_hweight.h,
tools/include/asm-generic/bitops/const_hweight.h,
tools/include/asm-generic/bitops/fls.h,
tools/include/asm-generic/bitops/fls64.h,
tools/include/uapi/asm-generic/ioctls.h,
tools/include/uapi/asm-generic/mman-common.h,
tools/include/uapi/sound/asound.h,
tools/include/uapi/linux/kvm.h,
tools/include/uapi/linux/perf_event.h,
tools/include/uapi/linux/sched.h,
tools/include/uapi/linux/vhost.h,
tools/include/uapi/sound/asound.h:
Add the SPDX tag of the respective kernel header.
- tools/include/uapi/linux/bpf_common.h,
tools/include/uapi/linux/fcntl.h,
tools/include/uapi/linux/hw_breakpoint.h,
tools/include/uapi/linux/mman.h,
tools/include/uapi/linux/stat.h,
Change the tag to the kernel header version:
-/* SPDX-License-Identifier: GPL-2.0 */
+/* SPDX-License-Identifier: GPL-2.0 WITH Linux-syscall-note */
Also sync other header details:
- include/uapi/sound/asound.h:
Fix pointless end of line whitespace noise the header grew in this cycle.
- tools/arch/x86/lib/memcpy_64.S:
Sync the code and add tools/include/asm/export.h with dummy wrappers
to support building the kernel side code in a tooling header environment.
- tools/include/uapi/asm-generic/mman.h,
tools/include/uapi/linux/bpf.h:
Sync other details that don't impact tooling's use of the ABIs.
Acked-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Cc: linux-kernel@vger.kernel.org
Cc: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
Cc: Linus Torvalds <torvalds@linux-foundation.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Thomas Gleixner <tglx@linutronix.de>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: Stephen Rothwell <sfr@canb.auug.org.au>
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | | |\
| | | |
| | | |
| | | | |
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
We have defined YY_USER_ACTION to keep trace of the column location
during events parsing, but we need to clean it up when we call REJECT.
When REJECT is called, the lexer shrinks the text and re-runs the
matching, so we need to address it in resuming the previous location
value to keep it correct for error display, like:
Before:
$ perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..38;5;9:mi=01;05;37;41:su=48;5;196;38;5;15:sg=48;5;1\
1;38;5;16:ca=48;5;196;38;5;226:tw=48;5;10;38;5;16:ow=48;5;10;38;5;21:st=48;5;\
21;38;50
�'
\___ unknown term
After:
$ ./perf stat -e 'cpu/uops_executed.core,krava/' true
event syntax error: '..cuted.core,krava/'
\___ unknown term
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Reported-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com>
Tested-by: Andi Kleen <ak@linux.intel.com>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-vug2hchlny30jfsfrumbym26@git.kernel.org
Link: http://lkml.kernel.org/r/20171009140944.GD28623@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Perf top is often crashing at very random locations on powerpc. After
investigating, I found the crash only happens when sample is of zero
length symbol. Powerpc kernel has many such symbols which does not
contain length details in vmlinux binary and thus start and end
addresses of such symbols are same.
Structure
struct sym_hist {
u64 nr_samples;
u64 period;
struct sym_hist_entry addr[0];
};
has last member 'addr[]' of size zero. 'addr[]' is an array of addresses
that belongs to one symbol (function). If function consist of 100
instructions, 'addr' points to an array of 100 'struct sym_hist_entry'
elements. For zero length symbol, it points to the *empty* array, i.e.
no members in the array and thus offset 0 is also invalid for such
array.
static int __symbol__inc_addr_samples(...)
{
...
offset = addr - sym->start;
h = annotation__histogram(notes, evidx);
h->nr_samples++;
h->addr[offset].nr_samples++;
h->period += sample->period;
h->addr[offset].period += sample->period;
...
}
Here, when 'addr' is same as 'sym->start', 'offset' becomes 0, which is
valid for normal symbols but *invalid* for zero length symbols and thus
updating h->addr[offset] causes memory corruption.
Fix this by adding one dummy element for zero length symbols.
Link: https://lkml.org/lkml/2016/10/10/148
Fixes: edee44be5919 ("perf annotate: Don't throw error for zero length symbols")
Signed-off-by: Ravi Bangoria <ravi.bangoria@linux.vnet.ibm.com>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Acked-by: Namhyung Kim <namhyung@kernel.org>
Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Kim Phillips <kim.phillips@arm.com>
Cc: Naveen N. Rao <naveen.n.rao@linux.vnet.ibm.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Taeung Song <treeze.taeung@gmail.com>
Link: http://lkml.kernel.org/r/1508854806-10542-1-git-send-email-ravi.bangoria@linux.vnet.ibm.com
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | |/
| |/|
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
kernel's latest version
This fixes the following warning:
warning: objtool: x86 instruction decoder differs from kernel
Reported-by: Stephen Rothwell <sfr@canb.auug.org.au>
Signed-off-by: Josh Poimboeuf <jpoimboe@redhat.com>
Cc: Linus Torvalds <torvalds@linux-foundation.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Thomas Gleixner <tglx@linutronix.de>
Link: http://lkml.kernel.org/r/013315a808ccf5580abc293808827c8e2b5e1354.1509719152.git.jpoimboe@redhat.com
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | |\ \
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/gregkh/driver-core
Pull initial SPDX identifiers from Greg KH:
"License cleanup: add SPDX license identifiers to some files
Many source files in the tree are missing licensing information, which
makes it harder for compliance tools to determine the correct license.
By default all files without license information are under the default
license of the kernel, which is GPL version 2.
Update the files which contain no license information with the
'GPL-2.0' SPDX license identifier. The SPDX identifier is a legally
binding shorthand, which can be used instead of the full boiler plate
text.
This patch is based on work done by Thomas Gleixner and Kate Stewart
and Philippe Ombredanne.
How this work was done:
Patches were generated and checked against linux-4.14-rc6 for a subset
of the use cases:
- file had no licensing information it it.
- file was a */uapi/* one with no licensing information in it,
- file was a */uapi/* one with existing licensing information,
Further patches will be generated in subsequent months to fix up cases
where non-standard license headers were used, and references to
license had to be inferred by heuristics based on keywords.
The analysis to determine which SPDX License Identifier to be applied
to a file was done in a spreadsheet of side by side results from of
the output of two independent scanners (ScanCode & Windriver)
producing SPDX tag:value files created by Philippe Ombredanne.
Philippe prepared the base worksheet, and did an initial spot review
of a few 1000 files.
The 4.13 kernel was the starting point of the analysis with 60,537
files assessed. Kate Stewart did a file by file comparison of the
scanner results in the spreadsheet to determine which SPDX license
identifier(s) to be applied to the file. She confirmed any
determination that was not immediately clear with lawyers working with
the Linux Foundation.
Criteria used to select files for SPDX license identifier tagging was:
- Files considered eligible had to be source code files.
- Make and config files were included as candidates if they contained
>5 lines of source
- File already had some variant of a license header in it (even if <5
lines).
All documentation files were explicitly excluded.
The following heuristics were used to determine which SPDX license
identifiers to apply.
- when both scanners couldn't find any license traces, file was
considered to have no license information in it, and the top level
COPYING file license applied.
For non */uapi/* files that summary was:
SPDX license identifier # files
---------------------------------------------------|-------
GPL-2.0 11139
and resulted in the first patch in this series.
If that file was a */uapi/* path one, it was "GPL-2.0 WITH
Linux-syscall-note" otherwise it was "GPL-2.0". Results of that
was:
SPDX license identifier # files
---------------------------------------------------|-------
GPL-2.0 WITH Linux-syscall-note 930
and resulted in the second patch in this series.
- if a file had some form of licensing information in it, and was one
of the */uapi/* ones, it was denoted with the Linux-syscall-note if
any GPL family license was found in the file or had no licensing in
it (per prior point). Results summary:
SPDX license identifier # files
---------------------------------------------------|------
GPL-2.0 WITH Linux-syscall-note 270
GPL-2.0+ WITH Linux-syscall-note 169
((GPL-2.0 WITH Linux-syscall-note) OR BSD-2-Clause) 21
((GPL-2.0 WITH Linux-syscall-note) OR BSD-3-Clause) 17
LGPL-2.1+ WITH Linux-syscall-note 15
GPL-1.0+ WITH Linux-syscall-note 14
((GPL-2.0+ WITH Linux-syscall-note) OR BSD-3-Clause) 5
LGPL-2.0+ WITH Linux-syscall-note 4
LGPL-2.1 WITH Linux-syscall-note 3
((GPL-2.0 WITH Linux-syscall-note) OR MIT) 3
((GPL-2.0 WITH Linux-syscall-note) AND MIT) 1
and that resulted in the third patch in this series.
- when the two scanners agreed on the detected license(s), that
became the concluded license(s).
- when there was disagreement between the two scanners (one detected
a license but the other didn't, or they both detected different
licenses) a manual inspection of the file occurred.
- In most cases a manual inspection of the information in the file
resulted in a clear resolution of the license that should apply
(and which scanner probably needed to revisit its heuristics).
- When it was not immediately clear, the license identifier was
confirmed with lawyers working with the Linux Foundation.
- If there was any question as to the appropriate license identifier,
the file was flagged for further research and to be revisited later
in time.
In total, over 70 hours of logged manual review was done on the
spreadsheet to determine the SPDX license identifiers to apply to the
source files by Kate, Philippe, Thomas and, in some cases,
confirmation by lawyers working with the Linux Foundation.
Kate also obtained a third independent scan of the 4.13 code base from
FOSSology, and compared selected files where the other two scanners
disagreed against that SPDX file, to see if there was new insights.
The Windriver scanner is based on an older version of FOSSology in
part, so they are related.
Thomas did random spot checks in about 500 files from the spreadsheets
for the uapi headers and agreed with SPDX license identifier in the
files he inspected. For the non-uapi files Thomas did random spot
checks in about 15000 files.
In initial set of patches against 4.14-rc6, 3 files were found to have
copy/paste license identifier errors, and have been fixed to reflect
the correct identifier.
Additionally Philippe spent 10 hours this week doing a detailed manual
inspection and review of the 12,461 patched files from the initial
patch version early this week with:
- a full scancode scan run, collecting the matched texts, detected
license ids and scores
- reviewing anything where there was a license detected (about 500+
files) to ensure that the applied SPDX license was correct
- reviewing anything where there was no detection but the patch
license was not GPL-2.0 WITH Linux-syscall-note to ensure that the
applied SPDX license was correct
This produced a worksheet with 20 files needing minor correction. This
worksheet was then exported into 3 different .csv files for the
different types of files to be modified.
These .csv files were then reviewed by Greg. Thomas wrote a script to
parse the csv files and add the proper SPDX tag to the file, in the
format that the file expected. This script was further refined by Greg
based on the output to detect more types of files automatically and to
distinguish between header and source .c files (which need different
comment types.) Finally Greg ran the script using the .csv files to
generate the patches.
Reviewed-by: Kate Stewart <kstewart@linuxfoundation.org>
Reviewed-by: Philippe Ombredanne <pombredanne@nexb.com>
Reviewed-by: Thomas Gleixner <tglx@linutronix.de>
Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>"
* tag 'spdx_identifiers-4.14-rc8' of git://git.kernel.org/pub/scm/linux/kernel/git/gregkh/driver-core:
License cleanup: add SPDX license identifier to uapi header files with a license
License cleanup: add SPDX license identifier to uapi header files with no license
License cleanup: add SPDX GPL-2.0 license identifier to files with no license
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Many user space API headers have licensing information, which is either
incomplete, badly formatted or just a shorthand for referring to the
license under which the file is supposed to be. This makes it hard for
compliance tools to determine the correct license.
Update these files with an SPDX license identifier. The identifier was
chosen based on the license information in the file.
GPL/LGPL licensed headers get the matching GPL/LGPL SPDX license
identifier with the added 'WITH Linux-syscall-note' exception, which is
the officially assigned exception identifier for the kernel syscall
exception:
NOTE! This copyright does *not* cover user programs that use kernel
services by normal system calls - this is merely considered normal use
of the kernel, and does *not* fall under the heading of "derived work".
This exception makes it possible to include GPL headers into non GPL
code, without confusing license compliance tools.
Headers which have either explicit dual licensing or are just licensed
under a non GPL license are updated with the corresponding SPDX
identifier and the GPLv2 with syscall exception identifier. The format
is:
((GPL-2.0 WITH Linux-syscall-note) OR SPDX-ID-OF-OTHER-LICENSE)
SPDX license identifiers are a legally binding shorthand, which can be
used instead of the full boiler plate text. The update does not remove
existing license information as this has to be done on a case by case
basis and the copyright holders might have to be consulted. This will
happen in a separate step.
This patch is based on work done by Thomas Gleixner and Kate Stewart and
Philippe Ombredanne. See the previous patch in this series for the
methodology of how this patch was researched.
Reviewed-by: Kate Stewart <kstewart@linuxfoundation.org>
Reviewed-by: Philippe Ombredanne <pombredanne@nexb.com>
Reviewed-by: Thomas Gleixner <tglx@linutronix.de>
Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
license
Many user space API headers are missing licensing information, which
makes it hard for compliance tools to determine the correct license.
By default are files without license information under the default
license of the kernel, which is GPLV2. Marking them GPLV2 would exclude
them from being included in non GPLV2 code, which is obviously not
intended. The user space API headers fall under the syscall exception
which is in the kernels COPYING file:
NOTE! This copyright does *not* cover user programs that use kernel
services by normal system calls - this is merely considered normal use
of the kernel, and does *not* fall under the heading of "derived work".
otherwise syscall usage would not be possible.
Update the files which contain no license information with an SPDX
license identifier. The chosen identifier is 'GPL-2.0 WITH
Linux-syscall-note' which is the officially assigned identifier for the
Linux syscall exception. SPDX license identifiers are a legally binding
shorthand, which can be used instead of the full boiler plate text.
This patch is based on work done by Thomas Gleixner and Kate Stewart and
Philippe Ombredanne. See the previous patch in this series for the
methodology of how this patch was researched.
Reviewed-by: Kate Stewart <kstewart@linuxfoundation.org>
Reviewed-by: Philippe Ombredanne <pombredanne@nexb.com>
Reviewed-by: Thomas Gleixner <tglx@linutronix.de>
Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
|
| | | |/
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | |
| | | |
Many source files in the tree are missing licensing information, which
makes it harder for compliance tools to determine the correct license.
By default all files without license information are under the default
license of the kernel, which is GPL version 2.
Update the files which contain no license information with the 'GPL-2.0'
SPDX license identifier. The SPDX identifier is a legally binding
shorthand, which can be used instead of the full boiler plate text.
This patch is based on work done by Thomas Gleixner and Kate Stewart and
Philippe Ombredanne.
How this work was done:
Patches were generated and checked against linux-4.14-rc6 for a subset of
the use cases:
- file had no licensing information it it.
- file was a */uapi/* one with no licensing information in it,
- file was a */uapi/* one with existing licensing information,
Further patches will be generated in subsequent months to fix up cases
where non-standard license headers were used, and references to license
had to be inferred by heuristics based on keywords.
The analysis to determine which SPDX License Identifier to be applied to
a file was done in a spreadsheet of side by side results from of the
output of two independent scanners (ScanCode & Windriver) producing SPDX
tag:value files created by Philippe Ombredanne. Philippe prepared the
base worksheet, and did an initial spot review of a few 1000 files.
The 4.13 kernel was the starting point of the analysis with 60,537 files
assessed. Kate Stewart did a file by file comparison of the scanner
results in the spreadsheet to determine which SPDX license identifier(s)
to be applied to the file. She confirmed any determination that was not
immediately clear with lawyers working with the Linux Foundation.
Criteria used to select files for SPDX license identifier tagging was:
- Files considered eligible had to be source code files.
- Make and config files were included as candidates if they contained >5
lines of source
- File already had some variant of a license header in it (even if <5
lines).
All documentation files were explicitly excluded.
The following heuristics were used to determine which SPDX license
identifiers to apply.
- when both scanners couldn't find any license traces, file was
considered to have no license information in it, and the top level
COPYING file license applied.
For non */uapi/* files that summary was:
SPDX license identifier # files
---------------------------------------------------|-------
GPL-2.0 11139
and resulted in the first patch in this series.
If that file was a */uapi/* path one, it was "GPL-2.0 WITH
Linux-syscall-note" otherwise it was "GPL-2.0". Results of that was:
SPDX license identifier # files
---------------------------------------------------|-------
GPL-2.0 WITH Linux-syscall-note 930
and resulted in the second patch in this series.
- if a file had some form of licensing information in it, and was one
of the */uapi/* ones, it was denoted with the Linux-syscall-note if
any GPL family license was found in the file or had no licensing in
it (per prior point). Results summary:
SPDX license identifier # files
---------------------------------------------------|------
GPL-2.0 WITH Linux-syscall-note 270
GPL-2.0+ WITH Linux-syscall-note 169
((GPL-2.0 WITH Linux-syscall-note) OR BSD-2-Clause) 21
((GPL-2.0 WITH Linux-syscall-note) OR BSD-3-Clause) 17
LGPL-2.1+ WITH Linux-syscall-note 15
GPL-1.0+ WITH Linux-syscall-note 14
((GPL-2.0+ WITH Linux-syscall-note) OR BSD-3-Clause) 5
LGPL-2.0+ WITH Linux-syscall-note 4
LGPL-2.1 WITH Linux-syscall-note 3
((GPL-2.0 WITH Linux-syscall-note) OR MIT) 3
((GPL-2.0 WITH Linux-syscall-note) AND MIT) 1
and that resulted in the third patch in this series.
- when the two scanners agreed on the detected license(s), that became
the concluded license(s).
- when there was disagreement between the two scanners (one detected a
license but the other didn't, or they both detected different
licenses) a manual inspection of the file occurred.
- In most cases a manual inspection of the information in the file
resulted in a clear resolution of the license that should apply (and
which scanner probably needed to revisit its heuristics).
- When it was not immediately clear, the license identifier was
confirmed with lawyers working with the Linux Foundation.
- If there was any question as to the appropriate license identifier,
the file was flagged for further research and to be revisited later
in time.
In total, over 70 hours of logged manual review was done on the
spreadsheet to determine the SPDX license identifiers to apply to the
source files by Kate, Philippe, Thomas and, in some cases, confirmation
by lawyers working with the Linux Foundation.
Kate also obtained a third independent scan of the 4.13 code base from
FOSSology, and compared selected files where the other two scanners
disagreed against that SPDX file, to see if there was new insights. The
Windriver scanner is based on an older version of FOSSology in part, so
they are related.
Thomas did random spot checks in about 500 files from the spreadsheets
for the uapi headers and agreed with SPDX license identifier in the
files he inspected. For the non-uapi files Thomas did random spot checks
in about 15000 files.
In initial set of patches against 4.14-rc6, 3 files were found to have
copy/paste license identifier errors, and have been fixed to reflect the
correct identifier.
Additionally Philippe spent 10 hours this week doing a detailed manual
inspection and review of the 12,461 patched files from the initial patch
version early this week with:
- a full scancode scan run, collecting the matched texts, detected
license ids and scores
- reviewing anything where there was a license detected (about 500+
files) to ensure that the applied SPDX license was correct
- reviewing anything where there was no detection but the patch license
was not GPL-2.0 WITH Linux-syscall-note to ensure that the applied
SPDX license was correct
This produced a worksheet with 20 files needing minor correction. This
worksheet was then exported into 3 different .csv files for the
different types of files to be modified.
These .csv files were then reviewed by Greg. Thomas wrote a script to
parse the csv files and add the proper SPDX tag to the file, in the
format that the file expected. This script was further refined by Greg
based on the output to detect more types of files automatically and to
distinguish between header and source .c files (which need different
comment types.) Finally Greg ran the script using the .csv files to
generate the patches.
Reviewed-by: Kate Stewart <kstewart@linuxfoundation.org>
Reviewed-by: Philippe Ombredanne <pombredanne@nexb.com>
Reviewed-by: Thomas Gleixner <tglx@linutronix.de>
Signed-off-by: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
|
| | |\ \
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/shuah/linux-kselftest
Pull kselftest fix from Shuah Khan:
"This consists of a single fix to a regression to printing individual
test results to the console. An earlier commit changed it to printing
just the summary of results, which will negatively impact users that
rely on console log to look at the individual test failures.
This fix makes it optional to print summary and by default results get
printed to the console"
* tag 'linux-kselftest-4.14-rc7' of git://git.kernel.org/pub/scm/linux/kernel/git/shuah/linux-kselftest:
selftests: lib.mk: print individual test results to console by default
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Change run_tests to print individual test results to console by default.
Introduce "summary" option to print individual test results to a file
/tmp/test_name and just print the summary to the console.
This change is necessary to support use-cases where test machines get
rebooted once tests are run and the console log should contain the full
results.
In the following example, individual test results with "summary=1" option
are written to /tmp/kcmp_test
make --silent TARGETS=kcmp kselftest
TAP version 13
selftests: kcmp_test
========================================
pid1: 30126 pid2: 30127 FD: 2 FILES: 2 VM: 1 FS: 2 SIGHAND: 2 IO:
0 SYSVSEM: 0 INV: -1
PASS: 0 returned as expected
PASS: 0 returned as expected
FAIL: 0 expected but -1 returned (Invalid argument)
Pass 2 Fail 1 Xfail 0 Xpass 0 Skip 0 Error 0
1..3
Bail out!
Pass 2 Fail 1 Xfail 0 Xpass 0 Skip 0 Error 0
1..3
Pass 0 Fail 0 Xfail 0 Xpass 0 Skip 0 Error 0
1..0
ok 1..1 selftests: kcmp_test [PASS]
make --silent TARGETS=kcmp summary=1 kselftest
TAP version 13
selftests: kcmp_test
========================================
ok 1..1 selftests: kcmp_test [PASS]
Signed-off-by: Shuah Khan <shuahkh@osg.samsung.com>
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Now that SK_REDIRECT is no longer a valid return code. Remove it
from the UAPI completely. Then do a namespace remapping internal
to sockmap so SK_REDIRECT is no longer externally visible.
Patchs primary change is to do a namechange from SK_REDIRECT to
__SK_REDIRECT
Reported-by: Alexei Starovoitov <ast@kernel.org>
Signed-off-by: John Fastabend <john.fastabend@gmail.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | |
| | | |
| | | |
| | | |
| | | |
| | | |
| | | | |
Fixes: 31c2611b66e0 ("selftests: Introduce a new test case to tc testsuite")
Fixes: 76b903ee198d ("selftests: Introduce tc testsuite")
Signed-off-by: Brenda J. Butler <bjb@mojatatu.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | |\ \ \
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Pull networking fixes from David Miller:
1) Fix route leak in xfrm_bundle_create().
2) In mac80211, validate user rate mask before configuring it. From
Johannes Berg.
3) Properly enforce memory limits in fair queueing code, from Toke
Hoiland-Jorgensen.
4) Fix lockdep splat in inet_csk_route_req(), from Eric Dumazet.
5) Fix TSO header allocation and management in mvpp2 driver, from Yan
Markman.
6) Don't take socket lock in BH handler in strparser code, from Tom
Herbert.
7) Don't show sockets from other namespaces in AF_UNIX code, from
Andrei Vagin.
8) Fix double free in error path of tap_open(), from Girish Moodalbail.
9) Fix TX map failure path in igb and ixgbe, from Jean-Philippe Brucker
and Alexander Duyck.
10) Fix DCB mode programming in stmmac driver, from Jose Abreu.
11) Fix err_count handling in various tunnels (ipip, ip6_gre). From Xin
Long.
12) Properly align SKB head before building SKB in tuntap, from Jason
Wang.
13) Avoid matching qdiscs with a zero handle during lookups, from Cong
Wang.
14) Fix various endianness bugs in sctp, from Xin Long.
15) Fix tc filter callback races and add selftests which trigger the
problem, from Cong Wang.
* git://git.kernel.org/pub/scm/linux/kernel/git/davem/net: (73 commits)
selftests: Introduce a new test case to tc testsuite
selftests: Introduce a new script to generate tc batch file
net_sched: fix call_rcu() race on act_sample module removal
net_sched: add rtnl assertion to tcf_exts_destroy()
net_sched: use tcf_queue_work() in tcindex filter
net_sched: use tcf_queue_work() in rsvp filter
net_sched: use tcf_queue_work() in route filter
net_sched: use tcf_queue_work() in u32 filter
net_sched: use tcf_queue_work() in matchall filter
net_sched: use tcf_queue_work() in fw filter
net_sched: use tcf_queue_work() in flower filter
net_sched: use tcf_queue_work() in flow filter
net_sched: use tcf_queue_work() in cgroup filter
net_sched: use tcf_queue_work() in bpf filter
net_sched: use tcf_queue_work() in basic filter
net_sched: introduce a workqueue for RCU callbacks of tc filter
sctp: fix some type cast warnings introduced since very beginning
sctp: fix a type cast warnings that causes a_rwnd gets the wrong value
sctp: fix some type cast warnings introduced by transport rhashtable
sctp: fix some type cast warnings introduced by stream reconf
...
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
In this patchset, we fixed a tc bug. This patch adds the test case
that reproduces the bug. To run this test case, user should specify
an existing NIC device:
# sudo ./tdc.py -d enp4s0f0
This test case belongs to category "flower". If user doesn't specify
a NIC device, the test cases belong to "flower" will not be run.
In this test case, we create 1M filters and all filters share the same
action. When destroying all filters, kernel should not panic. It takes
about 18s to run it.
Acked-by: Jamal Hadi Salim <jhs@mojatatu.com>
Acked-by: Lucas Bates <lucasb@mojatatu.com>
Signed-off-by: Chris Mi <chrism@mellanox.com>
Signed-off-by: Cong Wang <xiyou.wangcong@gmail.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
# ./tdc_batch.py -h
usage: tdc_batch.py [-h] [-n NUMBER] [-o] [-s] [-p] device file
TC batch file generator
positional arguments:
device device name
file batch file name
optional arguments:
-h, --help show this help message and exit
-n NUMBER, --number NUMBER
how many lines in batch file
-o, --skip_sw skip_sw (offload), by default skip_hw
-s, --share_action all filters share the same action
-p, --prio all filters have different prio
Acked-by: Jamal Hadi Salim <jhs@mojatatu.com>
Acked-by: Lucas Bates <lucasb@mojatatu.com>
Signed-off-by: Chris Mi <chrism@mellanox.com>
Signed-off-by: Cong Wang <xiyou.wangcong@gmail.com>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Recent additions to support multiple programs in cgroups impose
a strict requirement, "all yes is yes, any no is no". To enforce
this the infrastructure requires the 'no' return code, SK_DROP in
this case, to be 0.
To apply these rules to SK_SKB program types the sk_actions return
codes need to be adjusted.
This fix adds SK_PASS and makes 'SK_DROP = 0'. Finally, remove
SK_ABORTED to remove any chance that the API may allow aborted
program flows to be passed up the stack. This would be incorrect
behavior and allow programs to break existing policies.
Signed-off-by: John Fastabend <john.fastabend@gmail.com>
Acked-by: Alexei Starovoitov <ast@kernel.org>
Signed-off-by: David S. Miller <davem@davemloft.net>
|
| | |\ \ \ \
| | |_|_|/
| |/| | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/masahiroy/linux-kbuild
Pull Kbuild fixes from Masahiro Yamada:
- fix O= building on dash
- remove unused dependency in Makefile
- fix default of a choice in Kconfig
- fix typos and documentation style
- fix command options unrecognized by sparse
* tag 'kbuild-fixes-v4.14-2' of git://git.kernel.org/pub/scm/linux/kernel/git/masahiroy/linux-kbuild:
kbuild: clang: fix build failures with sparse check
kbuild doc: a bundle of fixes on makefiles.txt
Makefile: kselftest: fix grammar typo
kbuild: Fix optimization level choice default
kbuild: drop unused symverfile in Makefile.modpost
kbuild: revert $(realpath ...) to $(shell cd ... && /bin/pwd)
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
I thought commit 8e9b46679923 ("kbuild: use $(abspath ...) instead of
$(shell cd ... && /bin/pwd)") was a safe conversion, but it changed
the behavior.
$(abspath ...) / $(realpath ...) does not expand shell special
characters, such as '~'.
Here is a simple Makefile example:
---------------->8----------------
$(info /bin/pwd: $(shell cd ~/; /bin/pwd))
$(info abspath: $(abspath ~/))
$(info realpath: $(realpath ~/))
all:
@:
---------------->8----------------
$ make
/bin/pwd: /home/masahiro
abspath: /home/masahiro/workspace/~
realpath:
This can be a real problem if 'make O=~/foo' is invoked from another
Makefile or primitive shell like dash.
This commit partially reverts 8e9b46679923.
Fixes: 8e9b46679923 ("kbuild: use $(abspath ...) instead of $(shell cd ... && /bin/pwd)")
Reported-by: Julien Grall <julien.grall@arm.com>
Signed-off-by: Masahiro Yamada <yamada.masahiro@socionext.com>
Tested-by: Julien Grall <julien.grall@arm.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
When libbfd is not used, it doesn't show proper function name and reuse
the original symbol of the sample. That's because it passes the
original sym to inline_list__append(). As `addr2line -f` returns
function names as well, use that to create an inline_sym and pass it to
inline_list__append().
For example, following data shows that inlined entries of main have same
name (main).
Before:
$ perf report -g srcline -q | head
45.22% inlining libm-2.26.so [.] __hypot_finite
|
---__hypot_finite ??:0
|
|--44.15%--hypot ??:0
| main complex:589
| main complex:597
| main complex:654
| main complex:664
| main inlining.cpp:14
After:
$ perf report -g srcline -q | head
45.22% inlining libm-2.26.so [.] __hypot_finite
|
---__hypot_finite
|
|--44.15%--hypot
| std::__complex_abs complex:589 (inlined)
| std::abs<double> complex:597 (inlined)
| std::_Norm_helper<true>::_S_do_it<double> complex:654 (inlined)
| std::norm<double> complex:664 (inlined)
| main inlining.cpp:14
Signed-off-by: Namhyung Kim <namhyung@kernel.org>
Reviewed-by: Jiri Olsa <jolsa@kernel.org>
Reviewed-by: Milian Wolff <milian.wolff@kdab.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: kernel-team@lge.com
Link: http://lkml.kernel.org/r/20171031020654.31163-2-namhyung@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
When libbfd is not used, addr2inlines() executes `addr2line -i` and
process output line by line. But it resets filename to NULL in the loop
so getline() allocates additional memory everytime instead of realloc.
Signed-off-by: Namhyung Kim <namhyung@kernel.org>
Acked-by: Jiri Olsa <jolsa@kernel.org>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Milian Wolff <milian.wolff@kdab.com>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: kernel-team@lge.com
Link: http://lkml.kernel.org/r/20171031020654.31163-1-namhyung@kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
For some unknown reason there is no entry in tracefs's syscalls for
kcmp, i.e. no tracefs/events/syscalls/sys_{enter,exit}_kcmp, so we need
to provide a data dictionary for the fields.
To beautify the 'type' argument we automatically generate a strarray
from tools/include/uapi/kcmp.h, the idx1 and idx2 args, nowadays used
only if type == KCMP_FILE, are masked for all the other types and a
lookup is made for the thread and fd to show the path, if possible,
getting it from the probe:vfs_getname if in place or from procfs, races
allowing.
A system wide strace like tracing session, with callchains shows just
one user so far in this fedora 25 machine:
# perf trace --max-stack 5 -e kcmp
<SNIP>
1502914.400 ( 0.001 ms): systemd/1 kcmp(pid1: 1 (systemd), pid2: 1 (systemd), type: FILE, idx1: 271<socket:[4723475]>, idx2: 25<socket:[4788686]>) = -1 ENOSYS Function not implemented
syscall (/usr/lib64/libc-2.25.so)
same_fd (/usr/lib/systemd/libsystemd-shared-233.so)
service_add_fd_store (/usr/lib/systemd/systemd)
service_notify_message.lto_priv.127 (/usr/lib/systemd/systemd)
1502914.407 ( 0.001 ms): systemd/1 kcmp(pid1: 1 (systemd), pid2: 1 (systemd), type: FILE, idx1: 270<socket:[4726396]>, idx2: 25<socket:[4788686]>) = -1 ENOSYS Function not implemented
syscall (/usr/lib64/libc-2.25.so)
same_fd (/usr/lib/systemd/libsystemd-shared-233.so)
service_add_fd_store (/usr/lib/systemd/systemd)
service_notify_message.lto_priv.127 (/usr/lib/systemd/systemd)
<SNIP>
The backtraces seem to agree this is really kcmp(), but this system
doesn't have the sys_kcmp(), bummer:
# uname -a
Linux jouet 4.14.0-rc3+ #1 SMP Fri Oct 13 12:21:12 -03 2017 x86_64 x86_64 x86_64 GNU/Linux
# grep kcmp /proc/kallsyms
ffffffffb60b8890 W sys_kcmp
$ grep CONFIG_CHECKPOINT_RESTORE ../build/v4.14.0-rc3+/.config
# CONFIG_CHECKPOINT_RESTORE is not set
$
So systemd uses it, good fedora kernel config has it:
$ grep CONFIG_CHECKPOINT_RESTORE /boot/config-4.13.4-200.fc26.x86_64
CONFIG_CHECKPOINT_RESTORE=y
[acme@jouet linux]$
/me goes to rebuild a kernel...
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Andrey Vagin <avagin@openvz.org>
Cc: Cyrill Gorcunov <gorcunov@openvz.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-gz5fca968viw8m7hryjqvrln@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
One that given a pid and a fd, will try to get the path for that fd.
Will be used in the upcoming kcmp's KCMP_FILE beautifier.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Andrey Vagin <avagin@openvz.org>
Cc: Cyrill Gorcunov <gorcunov@openvz.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-7ketygp2dvs9h13wuakfncws@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
We will use it to generate tables for beautifying kcmp's 'type' arg.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Andrey Vagin <avagin@openvz.org>
Cc: Cyrill Gorcunov <gorcunov@openvz.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-r35zr79invmpinfe1zu57cas@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Milian Wolff found a problem he described in [1] and that for him would
get fixed:
"Note how most of the large offset values are now gone. Most notably, we
get proper srcline resolution for the random.h and complex headers."
Then Namhyung found the root cause:
"I looked into it and found a bug handling cumulative (children)
entries. For children entries that have no self period, the al->addr (so
he->ip) ends up having an doubly-mapped address.
It seems to be there from the beginning but only affects entries that
have no srclines - finding srcline itself is done using a different
address but it will show the invalid address if no srcline was found. I
think we should fix the commit c7405d85d7a3 ("perf tools: Update cpumode
for each cumulative entry")."
[1] https://lkml.kernel.org/r/20171018185350.14893-7-milian.wolff@kdab.com
Reported-by: Milian Wolff <milian.wolff@kdab.com>
Signed-off-by: Namhyung Kim <namhyung@kernel.org>
Tested-by: Milian Wolff <milian.wolff@kdab.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Jiri Olsa <jolsa@redhat.com>
Cc: kernel-team@lge.com
Fixes: c7405d85d7a3 ("perf tools: Update cpumode for each cumulative entry")
Link: https://lkml.kernel.org/r/20171020051533.GA2746@sejong
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
We should support this because it would allow easily to collect metrics
for different threads in applications.
Original patch from posted by Jin Yao in here [1].
1. Current output, for example:
root@skl:/tmp# perf stat --per-thread -p 21623
^C
Performance counter stats for process id '21623':
vmstat-21623 0.517479 task-clock (msec) # 0.000 CPUs utilized
vmstat-21623 1 context-switches
vmstat-21623 0 cpu-migrations
vmstat-21623 0 page-faults
vmstat-21623 461,306 cycles
vmstat-21623 630,724 instructions
vmstat-21623 136,265 branches
vmstat-21623 2,520 branch-misses
1.444020756 seconds time elapsed
root@skl:/tmp# perf stat --per-thread --metrics ipc -p 21623
^C
Performance counter stats for process id '21623':
vmstat-21623 631,185 inst_retired.any
vmstat-21623 605,893 cpu_clk_unhalted.thread
1.415679293 seconds time elapsed
2. With this patch, the result would be:
root@skl:/tmp# perf stat --per-thread -p 21623
^C
Performance counter stats for process id '21623':
vmstat-21623 0.533759 task-clock (msec) # 0.000 CPUs utilized
vmstat-21623 1 context-switches # 0.002 M/sec
vmstat-21623 0 cpu-migrations # 0.000 K/sec
vmstat-21623 0 page-faults # 0.000 K/sec
vmstat-21623 473,896 cycles # 0.888 GHz
vmstat-21623 631,072 instructions # 1.33 insn per cycle
vmstat-21623 136,307 branches # 255.372 M/sec
vmstat-21623 2,524 branch-misses # 1.85% of all branches
1.544862861 seconds time elapsed
root@skl:/tmp# perf stat --per-thread --metrics ipc -p 21623
^C
Performance counter stats for process id '21623':
vmstat-21623 1,259,104 inst_retired.any # 1.2 IPC
vmstat-21623 1,056,756 cpu_clk_unhalted.thread
2.040954502 seconds time elapsed
[1] https://marc.info/?l=linux-kernel&m=150777054620511&w=2
Originally-from: Jin Yao <yao.jin@linux.intel.com>
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-tr8ntktxmy4qc5769ajg5u6c@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
perf_stat__update_shadow_stats
Move the shadow stats scale computation to the
perf_stat__update_shadow_stats() function, so it's centralized and we
don't forget to do it. It also saves few lines of code.
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-htg7mmyxv6pcrf57qyo6msid@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Adding perf_data_file__write function to provide single file write
operation.
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-c3f9p4xzykr845ktqcek6p4t@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Add struct perf_data_file to represent a single file within a perf_data
struct.
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-c3f9p4xzykr845ktqcek6p4t@git.kernel.org
[ Fixup recent changes in 'perf script --per-event-dump' ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Rename struct perf_data_file to perf_data, because we will add the
possibility to have multiple files under perf.data, so the 'perf_data'
name fits better.
Signed-off-by: Jiri Olsa <jolsa@kernel.org>
Cc: Andi Kleen <andi@firstfloor.org>
Cc: Changbin Du <changbin.du@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jin Yao <yao.jin@linux.intel.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Peter Zijlstra <peterz@infradead.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-39wn4d77phel3dgkzo3lyan0@git.kernel.org
[ Fixup recent changes in 'perf script --per-event-dump' ]
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
For a file generated by "perf sched record sleep 50":
# perf script --per-event-dump
[ perf script: Wrote 23.121 MB perf.data.sched:sched_switch.dump (206015 samples) ]
[ perf script: Wrote 0.000 MB perf.data.sched:sched_stat_wait.dump (0 samples) ]
[ perf script: Wrote 0.000 MB perf.data.sched:sched_stat_sleep.dump (0 samples) ]
[ perf script: Wrote 0.000 MB perf.data.sched:sched_stat_iowait.dump (0 samples) ]
[ perf script: Wrote 17.680 MB perf.data.sched:sched_stat_runtime.dump (129342 samples) ]
[ perf script: Wrote 0.000 MB perf.data.sched:sched_process_fork.dump (24 samples) ]
[ perf script: Wrote 11.328 MB perf.data.sched:sched_wakeup.dump (106770 samples) ]
[ perf script: Wrote 0.000 MB perf.data.sched:sched_wakeup_new.dump (24 samples) ]
[ perf script: Wrote 2.477 MB perf.data.sched:sched_migrate_task.dump (20434 samples) ]
#
Similar to what is generated by 'perf record'.
Based-on-a-patch-by: yuzhoujian <yuzhoujian@didichuxing.com>
Suggested-by: Jiri Olsa <jolsa@kernel.org>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/r/1508921599-10832-3-git-send-email-yuzhoujian@didichuxing.com
Link: http://lkml.kernel.org/n/tip-xuketkkjuk2c0qz546ypd1u7@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
This is one more case where the way that syscall parameter values are
defined in kernel headers are easy to parse using a shell script that
will then generate the string table that gets used by the prctl 'option'
argument beautifier.
This way as soon as the header syncronization mechanism in perf's build
system detects a change in a copy of a kernel ABI header and that file
is syncronized, we get 'perf trace' updated automagically.
Further work needed for the PR_SET_ values, as well for using eBPF to
copy the non-integer arguments to/from the kernel.
E.g.: System wide prctl tracing:
# perf trace -e prctl
1668.028 ( 0.025 ms): TaskSchedulerR/10649 prctl(option: SET_NAME, arg2: 0x2b61d5db15d0) = 0
3365.663 ( 0.018 ms): chrome/10650 prctl(option: SET_SECCOMP, arg2: 2, arg4: 8 ) = -1 EFAULT Bad address
3366.585 ( 0.010 ms): chrome/10650 prctl(option: SET_NO_NEW_PRIVS, arg2: 1 ) = 0
3367.173 ( 0.009 ms): TaskSchedulerR/10652 prctl(option: SET_NAME, arg2: 0x2b61d2aaa300) = 0
3367.222 ( 0.003 ms): TaskSchedulerR/10653 prctl(option: SET_NAME, arg2: 0x2b61d2aaa1e0) = 0
3367.244 ( 0.002 ms): TaskSchedulerR/10654 prctl(option: SET_NAME, arg2: 0x2b61d2aaa0c0) = 0
3367.265 ( 0.002 ms): TaskSchedulerR/10655 prctl(option: SET_NAME, arg2: 0x2b61d2ac7f90) = 0
3367.281 ( 0.002 ms): Chrome_ChildIO/10656 prctl(option: SET_NAME, arg2: 0x7efbe406bb11) = 0
3367.220 ( 0.004 ms): TaskSchedulerS/10651 prctl(option: SET_NAME, arg2: 0x2b61d2ac1be0) = 0
3370.906 ( 0.010 ms): GpuMemoryThrea/10657 prctl(option: SET_NAME, arg2: 0x7efbe386ab11) = 0
3370.983 ( 0.003 ms): File/10658 prctl(option: SET_NAME, arg2: 0x7efbe3069b11 ) = 0
3384.272 ( 0.020 ms): Compositor/10659 prctl(option: SET_NAME, arg2: 0x7efbe2868b11 ) = 0
3612.091 ( 0.012 ms): DOM Worker/11489 prctl(option: SET_NAME, arg2: 0x7f49ab97ebf2 ) = 0
<SNIP>
4512.437 ( 0.004 ms): (sa1)/11490 prctl(option: SET_NAME, arg2: 0x7ffca15af844 ) = 0
4512.468 ( 0.002 ms): (sa1)/11490 prctl(option: SET_MM, arg2: ARG_START, arg3: 0x7f5cb7c81000) = 0
4512.472 ( 0.001 ms): (sa1)/11490 prctl(option: SET_MM, arg2: ARG_END, arg3: 0x7f5cb7c81006) = 0
4514.667 ( 0.002 ms): (sa1)/11490 prctl(option: GET_SECUREBITS ) = 0
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Andy Lutomirski <luto@kernel.org>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-q0s2uw579o5ei6xlh2zjirgz@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
We will use it to generate tables for beautifying prctl's 'option' arg
and some of the others eventually.
Cc: Andy Lutomirski <luto@kernel.org>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-cg8mpmz4hk9nfih685emnbk9@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Introduce a new option to dump trace output to files named by the
monitored events and update perf-script documentation accordingly.
Shown below is output of perf script command with the newly introduced
option.
$ perf record -e cycles -e cs -ag -- sleep 1
$ perf script --per-event-dump
$ ls
perf.data.cycles.dump perf.data.cs.dump
Without per-event-dump support, drawing flamegraphs for different events
would require post processing to separate events. You can monitor only
one event at a time if you want to get flamegraphs for different events.
Using this option, you can get the trace output files named by the
monitored events, and could draw flamegraphs according to the event's
name.
Based-on-a-patch-by: yuzhoujian <yuzhoujian@didichuxing.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/r/1508921599-10832-3-git-send-email-yuzhoujian@didichuxing.com
Link: http://lkml.kernel.org/n/tip-8ngzsjdhgiovkupl3r5yy570@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
When we started using it for stats and did it not just in
builtin-stat.c, but also for builtin-script.c, then it stopped being a
tool private area, so introduce a new pointer for these stats and leave
->priv to its original purpose.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Cc: yuzhoujian <yuzhoujian@didichuxing.com>
Fixes: cfc8874a4859 ("perf script: Process cpu/threads maps")
Link: http://lkml.kernel.org/n/tip-jtpzx3rjqo78snmmsdzwb2eb@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
Another case where we a1a587073ccd ("perf script: Use fprintf like
printing uniformly") forgot to redirect output to the FILE descriptor,
fix this too.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Cc: yuzhoujian <yuzhoujian@didichuxing.com>
Link: http://lkml.kernel.org/n/tip-jmwx4pgfezw98ezfoj9t957s@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
We have facilities for reporting unexpected, unlikely errors, use them.
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: Andi Kleen <ak@linux.intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Michael Ellerman <mpe@ellerman.id.au>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Cc: yuzhoujian <yuzhoujian@didichuxing.com>
Link: http://lkml.kernel.org/n/tip-c7j22xfjf1j773g7ufp607q0@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| | | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | |
| | | | | |
In a1a587073ccd ("perf script: Use fprintf like printing uniformly")
there were a few cases that were missed, fix it.
Reported-by: yuzhoujian <yuzhoujian@didichuxing.com>
Cc: Adrian Hunter <adrian.hunter@intel.com>
Cc: David Ahern <dsahern@gmail.com>
Cc: Jiri Olsa <jolsa@kernel.org>
Cc: Namhyung Kim <namhyung@kernel.org>
Cc: Wang Nan <wangnan0@huawei.com>
Link: http://lkml.kernel.org/n/tip-sq9hvfk5mkjdqzlpyiq7jkos@git.kernel.org
Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
|
| |\ \ \ \ \
| |/ / / /
| | | | |
| | | | | |
Signed-off-by: Ingo Molnar <mingo@kernel.org>
|
| | |\ \ \ \
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | |
| | | | | | |
git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip
Pull perf fixes from Thomas Gleixner:
"A series of fixes for perf tooling:
- Make xyarray return the X/Y size correctly which fixes a crash in
the exit code.
- Fix the libc path in test so it works not only on Debian/Ubuntu
correctly
- Check for eBPF file existance and output a useful error message
instead of failing to compile a non existant file
- Make sure perf_hpp_fmt is not longer references before freeing it
- Use list_del_init() in the histogram code to prevent a crash when
the already deleted element is deleted again
- Remove the leftovers of the removed '-l' option
- Add reviewer entries to the MAINTAINERS file"
* 'perf-urgent-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip:
perf test shell trace+probe_libc_inet_pton.sh: Be compatible with Debian/Ubuntu
perf xyarray: Fix wrong processing when closing evsel fd
perf buildid-list: Fix crash when processing PERF_RECORD_NAMESPACE
perf record: Fix documentation for a inexistent option '-l'
perf tools: Add long time reviewers to MAINTAINERS
perf tools: Check wether the eBPF file exists in event parsing
perf hists: Add extra integrity checks to fmt_free()
perf hists: Fix crash in perf_hpp__reset_output_field()
|
