summaryrefslogtreecommitdiffstats
path: root/tools/perf/util/parse-events.l
Commit message (Collapse)AuthorAgeFilesLines
* Merge branch 'perf-core-for-linus' of ↵Linus Torvalds2017-11-131-1/+2
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip Pull perf updates from Ingo Molnar: "The main changes in this cycle were: Kernel: - kprobes updates: use better W^X patterns for code modifications, improve optprobes, remove jprobes. (Masami Hiramatsu, Kees Cook) - core fixes: event timekeeping (enabled/running times statistics) fixes, perf_event_read() locking fixes and cleanups, etc. (Peter Zijlstra) - Extend x86 Intel free-running PEBS support and support x86 user-register sampling in perf record and perf script. (Andi Kleen) Tooling: - Completely rework the way inline frames are handled. Instead of querying for the inline nodes on-demand in the individual tools, we now create proper callchain nodes for inlined frames. (Milian Wolff) - 'perf trace' updates (Arnaldo Carvalho de Melo) - Implement a way to print formatted output to per-event files in 'perf script' to facilitate generate flamegraphs, elliminating the need to write scripts to do that separation (yuzhoujian, Arnaldo Carvalho de Melo) - Update vendor events JSON metrics for Intel's Broadwell, Broadwell Server, Haswell, Haswell Server, IvyBridge, IvyTown, JakeTown, Sandy Bridge, Skylake, SkyLake Server - and Goldmont Plus V1 (Andi Kleen, Kan Liang) - Multithread the synthesizing of PERF_RECORD_ events for pre-existing threads in 'perf top', speeding up that phase, greatly improving the user experience in systems such as Intel's Knights Mill (Kan Liang) - Introduce the concept of weak groups in 'perf stat': try to set up a group, but if it's not schedulable fallback to not using a group. That gives us the best of both worlds: groups if they work, but still a usable fallback if they don't. E.g: (Andi Kleen) - perf sched timehist enhancements (David Ahern) - ... various other enhancements, updates, cleanups and fixes" * 'perf-core-for-linus' of git://git.kernel.org/pub/scm/linux/kernel/git/tip/tip: (139 commits) kprobes: Don't spam the build log with deprecation warnings arm/kprobes: Remove jprobe test case arm/kprobes: Fix kretprobe test to check correct counter perf srcline: Show correct function name for srcline of callchains perf srcline: Fix memory leak in addr2inlines() perf trace beauty kcmp: Beautify arguments perf trace beauty: Implement pid_fd beautifier tools include uapi: Grab a copy of linux/kcmp.h perf callchain: Fix double mapping al->addr for children without self period perf stat: Make --per-thread update shadow stats to show metrics perf stat: Move the shadow stats scale computation in perf_stat__update_shadow_stats perf tools: Add perf_data_file__write function perf tools: Add struct perf_data_file perf tools: Rename struct perf_data_file to perf_data perf script: Print information about per-event-dump files perf trace beauty prctl: Generate 'option' string table from kernel headers tools include uapi: Grab a copy of linux/prctl.h perf script: Allow creating per-event dump files perf evsel: Restore evsel->priv as a tool private area perf script: Use event_format__fprintf() ...
| * Merge branch 'linus' into perf/core, to fix conflictsIngo Molnar2017-11-071-2/+6
| |\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Conflicts: tools/perf/arch/arm/annotate/instructions.c tools/perf/arch/arm64/annotate/instructions.c tools/perf/arch/powerpc/annotate/instructions.c tools/perf/arch/s390/annotate/instructions.c tools/perf/arch/x86/tests/intel-cqm.c tools/perf/ui/tui/progress.c tools/perf/util/zlib.c Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * \ Merge branch 'perf/urgent' into perf/core, to pick up fixesIngo Molnar2017-10-201-2/+15
| |\ \ | | | | | | | | | | | | Signed-off-by: Ingo Molnar <mingo@kernel.org>
| * | | perf stat: Support duration_time for metricsAndi Kleen2017-09-131-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some of the metrics formulas (like GFLOPs) need to know how long the measurement period is. Support an internal event called duration_time, which reports time in second. It maps to the dummy event, but is special cased for statistics to report the walltime duration. So far it is not printed, but only used internally for metrics. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/20170831194036.30146-10-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
| * | | perf tools: Support weak groups in 'perf stat'Andi Kleen2017-09-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Setting up groups can be complicated due to the complicated scheduling restrictions of different PMUs. User tools usually don't understand all these restrictions. Still in many cases it is useful to set up groups and they work most of the time. However if the group is set up wrong some members will not report any value because they never get scheduled. Add a concept of a 'weak group': try to set up a group, but if it's not schedulable fallback to not using a group. That gives us the best of both worlds: groups if they work, but still a usable fallback if they don't. In theory it would be possible to have more complex fallback strategies (e.g. try to split the group in half), but the simple fallback of not using a group seems to work for now. So far the weak group is only implemented for perf stat, not for record. Here's an unschedulable group (on IvyBridge with SMT on) % perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1 73,806,067 branches 4,848,144 branch-misses # 6.57% of all branches 14,754,458 l1d.replacement 24,905,558 l2_lines_in.all <not supported> l2_rqsts.all_code_rd <------- will never report anything With the weak group: % perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}:W' -a sleep 1 125,366,055 branches (80.02%) 9,208,402 branch-misses # 7.35% of all branches (80.01%) 24,560,249 l1d.replacement (80.00%) 43,174,971 l2_lines_in.all (80.05%) 31,891,457 l2_rqsts.all_code_rd (79.92%) The extra event scheduled with some extra multiplexing v2: Move fallback code to separate function. Add comment on for_each_group_member Adjust to new perf_evsel__close interface v3: Fix debug print out. Committer testing: Before: # perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1 Performance counter stats for 'system wide': <not counted> branches <not counted> branch-misses <not counted> l1d.replacement <not counted> l2_lines_in.all <not supported> l2_rqsts.all_code_rd 1.002147212 seconds time elapsed # perf stat -e '{branches,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}' -a sleep 1 Performance counter stats for 'system wide': 83,207,892 branches 11,065,444 l1d.replacement 28,484,024 l2_lines_in.all 12,186,179 l2_rqsts.all_code_rd 1.001739493 seconds time elapsed After: # perf stat -e '{branches,branch-misses,l1d.replacement,l2_lines_in.all,l2_rqsts.all_code_rd}':W -a sleep 1 Performance counter stats for 'system wide': 543,323,909 branches (80.01%) 27,100,512 branch-misses # 4.99% of all branches (80.02%) 50,402,905 l1d.replacement (80.03%) 67,385,892 l2_lines_in.all (80.01%) 21,352,885 l2_rqsts.all_code_rd (79.94%) 1.001086658 seconds time elapsed # Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Link: http://lkml.kernel.org/r/20170831194036.30146-2-andi@firstfloor.org [ Add a "'perf stat' only, for now" comment in the man page, suggested by Jiri ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | perf tools: Fix eBPF event specification parsingJiri Olsa2017-11-091-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Looks like I've reached the new level of stupidity, adding missing braces. Committer testing: Given the following eBPF C filter, that will add a record when it returns true, i.e. when the tv_nsec variable is > 2000ns, should be built and installed via sys_bpf(), but fails to do so before this patch: # cat filter.c #include <uapi/linux/bpf.h> #define SEC(NAME) __attribute__((section(NAME), used)) SEC("func=hrtimer_nanosleep rqtp->tv_nsec") int func(void *ctx, int err, long nsec) { return nsec > 1000; } char _license[] SEC("license") = "GPL"; int _version SEC("version") = LINUX_VERSION_CODE; # # perf trace -e nanosleep,filter.c usleep 1 invalid or unsupported event: 'filter.c' Run 'perf list' for a list of valid events Usage: perf trace [<options>] [<command>] or: perf trace [<options>] -- <command> [<options>] or: perf trace record [<options>] [<command>] or: perf trace record [<options>] -- <command> [<options>] -e, --event <event> event/syscall selector. use 'perf list' to list available events # And works again after it is applied, the nothing is inserted when the co # perf trace -e *sleep,filter.c usleep 1 0.000 ( 0.066 ms): usleep/23994 nanosleep(rqtp: 0x7ffead94a0d0) = 0 # perf trace -e *sleep,filter.c usleep 2 0.000 ( 0.008 ms): usleep/24378 nanosleep(rqtp: 0x7fffa021ba50) ... 0.008 ( ): perf_bpf_probe:func:(ffffffffb410cb30) tv_nsec=2000) 0.000 ( 0.066 ms): usleep/24378 ... [continued]: nanosleep()) = 0 # The intent of 9445464bb831 is kept: # perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..cuted.core,krava/' \___ unknown term valid terms: cmask,pc,event,edge,in_tx,any,ldlat,inv,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period Run 'perf list' for a list of valid events Usage: perf stat [<options>] [<command>] -e, --event <event> event selector. use 'perf list' to list available events # # perf stat -e 'cpu/uops_executed.core,period=1/' true Performance counter stats for 'true': 808,332 cpu/uops_executed.core,period=1/ 0.002997237 seconds time elapsed # Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Andi Kleen <andi@firstfloor.org> Cc: Namhyung Kim <namhyung@kernel.org> Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT") Link: http://lkml.kernel.org/n/tip-diea0ihbwpxfw6938huv3whj@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | | perf tools: Add "reject" option for parse-events.lJiri Olsa2017-11-091-0/+1
| |_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Arnaldo reported broken builds in some distros using a newer flex release, 2.6.4, found in Alpine Linux 3.6 and Edge, with flex not spotting the REJECT macro: CC /tmp/build/perf/util/parse-events-flex.o util/parse-events.l: In function 'parse_events_lex': /tmp/build/perf/util/parse-events-flex.c:4734:16: error: \ 'reject_used_but_not_detected' undeclared (first use in this function) It's happening because we put the REJECT under another USER_REJECT macro in following commit: 9445464bb831 perf tools: Unwind properly location after REJECT Fortunately flex provides option for force it to use REJECT, adding it to parse-events.l. Reported-by: Arnaldo Carvalho de Melo <acme@kernel.org> Reported-by: Markus Trippelsdorf <markus@trippelsdorf.de> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Reviewed-by: Andi Kleen <andi@firstfloor.org> Tested-by: Arnaldo Carvalho de Melo <acme@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Fixes: 9445464bb831 ("perf tools: Unwind properly location after REJECT") Link: http://lkml.kernel.org/n/tip-7kdont984mw12ijk7rji6b8p@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | | perf tools: Unwind properly location after REJECTJiri Olsa2017-10-271-2/+6
| |/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have defined YY_USER_ACTION to keep trace of the column location during events parsing, but we need to clean it up when we call REJECT. When REJECT is called, the lexer shrinks the text and re-runs the matching, so we need to address it in resuming the previous location value to keep it correct for error display, like: Before: $ perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..38;5;9:mi=01;05;37;41:su=48;5;196;38;5;15:sg=48;5;1\ 1;38;5;16:ca=48;5;196;38;5;226:tw=48;5;10;38;5;16:ow=48;5;10;38;5;21:st=48;5;\ 21;38;50 �' \___ unknown term After: $ ./perf stat -e 'cpu/uops_executed.core,krava/' true event syntax error: '..cuted.core,krava/' \___ unknown term Signed-off-by: Jiri Olsa <jolsa@kernel.org> Reported-by: Arnaldo Carvalho de Melo <acme@redhat.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Tested-by: Andi Kleen <ak@linux.intel.com> Cc: Changbin Du <changbin.du@intel.com> Cc: David Ahern <dsahern@gmail.com> Cc: Jin Yao <yao.jin@linux.intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/n/tip-vug2hchlny30jfsfrumbym26@git.kernel.org Link: http://lkml.kernel.org/r/20171009140944.GD28623@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* | perf tools: Check wether the eBPF file exists in event parsingJiri Olsa2017-10-131-2/+15
|/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adding the check wether the eBPF file exists, to consider it as eBPF input file. This way we can differentiate eBPF events from events that end up with same suffix as eBPF file. Before: $ perf stat -e 'cpu/uops_executed.core/' true bpf: builtin compilation failed: -95, try external compiler WARNING: unable to get correct kernel building directory. Hint: Set correct kbuild directory using 'kbuild-dir' option in [llvm] section of ~/.perfconfig or set it to "" to suppress kbuild detection. event syntax error: 'cpu/uops_executed.core/' \___ Failed to load cpu/uops_executed.c from source: 'version' section incorrect or lost After: $ perf stat -e 'cpu/uops_executed.core/' true Performance counter stats for 'true': 181,533 cpu/uops_executed.core/:u 0.002795447 seconds time elapsed If user makes type in the eBPF file, we prioritize the event syntax and show following warning: $ perf stat -e 'krava.c//' true event syntax error: 'krava.c//' \___ Cannot find PMU `krava.c'. Missing kernel support? Reported-and-Tested-by: Andi Kleen <ak@linux.intel.com> Signed-off-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Changbin Du <changbin.du@intel.com> Cc: David Ahern <dsahern@gmail.com> Cc: Jin Yao <yao.jin@linux.intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/r/20171013083736.15037-9-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf bpf: Tighten detection of BPF eventsAndi Kleen2017-08-221-4/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | perf stat -e cpu/uops_executed.core,cmask=1/ would be detected as a BPF source event because the .c matches the .c source BPF pattern. v2: Originally I tried to use lex lookahead, but it doesn't seem to work. This now extends the BPF pattern to match longer events, but then does an extra check in the C code to reject BPF matches that do not end with .c/.o/.obj This uses REJECT, which makes the flex scanner slower, but that shouldn't be a big problem for the perf events. Committer testing: # perf trace -e write -e /home/acme/bpf/tracepoint.c cat /etc/passwd > /dev/null 0.000 ( 0.006 ms): cat/18485 write(fd: 1, buf: 0x7f59eebe1000, count: 3494 ) ... 0.006 ( ): raw_syscalls:sys_enter:NR 1 (1, 7f59eebe1000, da6, 22, 7f59eebe0010, 0)) 0.008 ( ): perf_bpf_probe:_write:(ffffffff9626b2c0)) 0.000 ( 0.010 ms): cat/18485 ... [continued]: write()) = 3494 # It continues doing what was expected, i.e. identifying /home/acme/bpf/tracepoint.c as a BPF event and activates the clang machinery to build an eBPF object and then uses sys_bpf() to hook it up to the raw_syscalls:sys_enter tracepoint, etc. Andi forgot to add Wang to the CC list, fix it. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Wang Nan <wangnan0@huawei.com> Link: http://lkml.kernel.org/r/20170811232634.30465-4-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf jevents: Handle events including .c and .oWang Nan2016-10-171-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch helps with Sukadev's vendor event tree where such events can happen. >From Andi Kleen: Any event including a .c/.o/.bpf currently triggers BPF compilation or loading and then an error. This can happen for some Intel vendor events, which cannot be used. This patch fixes this problem by forbidding BPF file patch containing '{', '}' and ',', make sure flex consumes the leading '{', instead of matching it using a BPF file path. Tested result: $ perf stat -e '{unc_p_clockticks,unc_p_power_state_occupancy.cores_c0}' -a -I 1000 invalid or unsupported event: '{unc_p_clockticks,unc_p_power_state_occupancy.cores_c0}' Run 'perf list' for a list of valid events (as expected, interperted as event) $ perf stat -e 'aaa.c' -a -I 1000 ERROR: problems with path aaa.c: No such file or directory (as expected, interpreted as BPF source) $ perf stat -e 'aaa.ccc' -a -I 1000 invalid or unsupported event: 'aaa.ccc' (as expected, interpreted as event) $ perf stat -e '{aaa.c}' -a -I 1000 ERROR: problems with path aaa.c: No such file or directory event syntax error: '{aaa.c}' <SKIP> (as expected, interpreted as BPF source) $ perf stat -e '{cycles,aaa.c}' -a -I 1000 ERROR: problems with path aaa.c: No such file or directory event syntax error: '{cycles,aaa.c}' (as expected, interpreted as BPF source) Signed-off-by: Wang Nan <wangnan0@huawei.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Reported-by: Andi Kleen <ak@linux.intel.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Sukadev Bhattiprolu <sukadev@linux.vnet.ibm.com> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1475900185-37967-1-git-send-email-wangnan0@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add infrastructure for PMU specific configurationMathieu Poirier2016-09-131-0/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | This patch adds PMU driver specific configuration to the parser infrastructure by preceding any term with the '@' letter. As such doing something like: perf record -e some_event/@cfg1,@cfg2=config/ ... will see 'cfg1' and 'cfg2=config' being added to the list of evsel config terms. Token 'cfg1' and 'cfg2=config' are not processed in user space and are meant to be interpreted by the PMU driver. First the lexer/parser are supplemented with the required definitions to recognise the driver specific configuration. From there they are simply added to the list of event terms. The bulk of the work is done in function "parse_events_add_pmu()" where driver config event terms are added to a new list of driver config terms, which in turn spliced with the event's new driver configuration list. Signed-off-by: Mathieu Poirier <mathieu.poirier@linaro.org> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Peter Zijlstra <peterz@infradead.org> Link: http://lkml.kernel.org/r/1473179837-3293-4-git-send-email-mathieu.poirier@linaro.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Enable overwrite settingsWang Nan2016-07-151-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch allows following config terms and option: Globally setting events to overwrite; # perf record --overwrite ... Set specific events to be overwrite or no-overwrite. # perf record --event cycles/overwrite/ ... # perf record --event cycles/no-overwrite/ ... Add missing config terms and update the config term array size because the longest string length has changed. For overwritable events, it automatically selects attr.write_backward since perf requires it to be backward for reading. Test result: # perf record --overwrite -e syscalls:*enter_nanosleep* usleep 1 [ perf record: Woken up 2 times to write data ] [ perf record: Captured and wrote 0.011 MB perf.data (1 samples) ] # perf evlist -v syscalls:sys_enter_nanosleep: type: 2, size: 112, config: 0x134, { sample_period, sample_freq }: 1, sample_type: IP|TID|TIME|CPU|PERIOD|RAW, disabled: 1, inherit: 1, mmap: 1, comm: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1, write_backward: 1 # Tip: use 'perf evlist --trace-fields' to show fields for tracepoint events Signed-off-by: Wang Nan <wangnan0@huawei.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Masami Hiramatsu <mhiramat@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Nilay Vaish <nilayvaish@gmail.com> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1468485287-33422-14-git-send-email-wangnan0@huawei.com Signed-off-by: He Kuang <hekuang@huawei.com> Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf stat: Basic support for TopDown in perf statAndi Kleen2016-06-061-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add basic plumbing for TopDown in perf stat TopDown is intended to replace the frontend cycles idle/ backend cycles idle metrics in standard perf stat output. These metrics are not reliable in many workloads, due to out of order effects. This implements a new --topdown mode in perf stat (similar to --transaction) that measures the pipe line bottlenecks using standardized formulas. The measurement can be all done with 5 counters (one fixed counter) The result are four metrics: FrontendBound, BackendBound, BadSpeculation, Retiring that describe the CPU pipeline behavior on a high level. The full top down methology has many hierarchical metrics. This implementation only supports level 1 which can be collected without multiplexing. A full implementation of top down on top of perf is available in pmu-tools toplev. (http://github.com/andikleen/pmu-tools) The current version works on Intel Core CPUs starting with Sandy Bridge, and Atom CPUs starting with Silvermont. In principle the generic metrics should be also implementable on other out of order CPUs. TopDown level 1 uses a set of abstracted metrics which are generic to out of order CPU cores (although some CPUs may not implement all of them): topdown-total-slots Available slots in the pipeline topdown-slots-issued Slots issued into the pipeline topdown-slots-retired Slots successfully retired topdown-fetch-bubbles Pipeline gaps in the frontend topdown-recovery-bubbles Pipeline gaps during recovery from misspeculation These metrics then allow to compute four useful metrics: FrontendBound, BackendBound, Retiring, BadSpeculation. Add a new --topdown options to enable events. When --topdown is specified set up events for all topdown events supported by the kernel. Add topdown-* as a special case to the event parser, as is needed for all events containing -. The actual code to compute the metrics is in follow-on patches. v2: Use standard sysctl read function. v3: Move x86 specific code to arch/ v4: Enable --metric-only implicitly for topdown. v5: Add --single-thread option to not force per core mode v6: Fix output order of topdown metrics v7: Allow combining with -d v8: Remove --single-thread again v9: Rename functions, adding arch_ and topdown_. v10: Expand man page and describe TopDown better Paste intro into commit description. Print error when malloc fails. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Link: http://lkml.kernel.org/r/1464119559-17203-1-git-send-email-andi@firstfloor.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Per event max-stack settingsArnaldo Carvalho de Melo2016-05-301-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The tooling counterpart, now it is possible to do: # perf record -e sched:sched_switch/max-stack=10/ -e cycles/call-graph=dwarf,max-stack=4/ -e cpu-cycles/call-graph=dwarf,max-stack=1024/ usleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.052 MB perf.data (5 samples) ] # perf evlist -v sched:sched_switch: type: 2, size: 112, config: 0x110, { sample_period, sample_freq }: 1, sample_type: IP|TID|TIME|CALLCHAIN|CPU|PERIOD|RAW|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1, sample_max_stack: 10 cycles/call-graph=dwarf,max-stack=4/: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|CALLCHAIN|PERIOD|REGS_USER|STACK_USER|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, freq: 1, enable_on_exec: 1, sample_id_all: 1, exclude_guest: 1, exclude_callchain_user: 1, sample_regs_user: 0xff0fff, sample_stack_user: 8192, sample_max_stack: 4 cpu-cycles/call-graph=dwarf,max-stack=1024/: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|CALLCHAIN|PERIOD|REGS_USER|STACK_USER|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, freq: 1, enable_on_exec: 1, sample_id_all: 1, exclude_guest: 1, exclude_callchain_user: 1, sample_regs_user: 0xff0fff, sample_stack_user: 8192, sample_max_stack: 1024 # Tip: use 'perf evlist --trace-fields' to show fields for tracepoint events Using just /max-stack=N/ means /call-graph=fp,max-stack=N/, that should be further configurable by means of some .perfconfig knob. Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Alexander Shishkin <alexander.shishkin@linux.intel.com> Cc: Alexei Starovoitov <ast@kernel.org> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: David Ahern <dsahern@gmail.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Linus Torvalds <torvalds@linux-foundation.org> Cc: Masami Hiramatsu <mhiramat@kernel.org> Cc: Milian Wolff <milian.wolff@kdab.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Stephane Eranian <eranian@google.com> Cc: Thomas Gleixner <tglx@linutronix.de> Cc: Vince Weaver <vincent.weaver@maine.edu> Cc: Wang Nan <wangnan0@huawei.com> Cc: Zefan Li <lizefan@huawei.com> Link: http://lkml.kernel.org/n/tip-kolmn1yo40p7jhswxwrc7rrd@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Introduce bpf-output eventWang Nan2016-02-221-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Commit a43eec304259 ("bpf: introduce bpf_perf_event_output() helper") adds a helper to enable a BPF program to output data to a perf ring buffer through a new type of perf event, PERF_COUNT_SW_BPF_OUTPUT. This patch enables perf to create events of that type. Now a perf user can use the following cmdline to receive output data from BPF programs: # perf record -a -e bpf-output/no-inherit,name=evt/ \ -e ./test_bpf_output.c/map:channel.event=evt/ ls / # perf script perf 1560 [004] 347747.086295: evt: ffffffff811fd201 sys_write ... perf 1560 [004] 347747.086300: evt: ffffffff811fd201 sys_write ... perf 1560 [004] 347747.086315: evt: ffffffff811fd201 sys_write ... ... Test result: # cat test_bpf_output.c /************************ BEGIN **************************/ #include <uapi/linux/bpf.h> struct bpf_map_def { unsigned int type; unsigned int key_size; unsigned int value_size; unsigned int max_entries; }; #define SEC(NAME) __attribute__((section(NAME), used)) static u64 (*ktime_get_ns)(void) = (void *)BPF_FUNC_ktime_get_ns; static int (*trace_printk)(const char *fmt, int fmt_size, ...) = (void *)BPF_FUNC_trace_printk; static int (*get_smp_processor_id)(void) = (void *)BPF_FUNC_get_smp_processor_id; static int (*perf_event_output)(void *, struct bpf_map_def *, int, void *, unsigned long) = (void *)BPF_FUNC_perf_event_output; struct bpf_map_def SEC("maps") channel = { .type = BPF_MAP_TYPE_PERF_EVENT_ARRAY, .key_size = sizeof(int), .value_size = sizeof(u32), .max_entries = __NR_CPUS__, }; SEC("func_write=sys_write") int func_write(void *ctx) { struct { u64 ktime; int cpuid; } __attribute__((packed)) output_data; char error_data[] = "Error: failed to output: %d\n"; output_data.cpuid = get_smp_processor_id(); output_data.ktime = ktime_get_ns(); int err = perf_event_output(ctx, &channel, get_smp_processor_id(), &output_data, sizeof(output_data)); if (err) trace_printk(error_data, sizeof(error_data), err); return 0; } char _license[] SEC("license") = "GPL"; int _version SEC("version") = LINUX_VERSION_CODE; /************************ END ***************************/ # perf record -a -e bpf-output/no-inherit,name=evt/ \ -e ./test_bpf_output.c/map:channel.event=evt/ ls / # perf script | grep ls ls 2242 [003] 347851.557563: evt: ffffffff811fd201 sys_write ... ls 2242 [003] 347851.557571: evt: ffffffff811fd201 sys_write ... Signed-off-by: Wang Nan <wangnan0@huawei.com> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Alexei Starovoitov <ast@kernel.org> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: Cody P Schafer <dev@codyps.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Kirill Smelkov <kirr@nexedi.com> Cc: Li Zefan <lizefan@huawei.com> Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1456132275-98875-11-git-send-email-wangnan0@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Enable indices setting syntax for BPF mapWang Nan2016-02-221-1/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch introduces a new syntax to perf event parser: # perf record -e './test_bpf_map_3.c/map:channel.value[0,1,2,3...5]=101/' usleep 2 By utilizing the basic facilities in bpf-loader.c which allow setting different slots in a BPF map separately, the newly introduced syntax allows perf to control specific elements in a BPF map. Test result: # cat ./test_bpf_map_3.c /************************ BEGIN **************************/ #include <uapi/linux/bpf.h> #define SEC(NAME) __attribute__((section(NAME), used)) struct bpf_map_def { unsigned int type; unsigned int key_size; unsigned int value_size; unsigned int max_entries; }; static void *(*map_lookup_elem)(struct bpf_map_def *, void *) = (void *)BPF_FUNC_map_lookup_elem; static int (*trace_printk)(const char *fmt, int fmt_size, ...) = (void *)BPF_FUNC_trace_printk; struct bpf_map_def SEC("maps") channel = { .type = BPF_MAP_TYPE_ARRAY, .key_size = sizeof(int), .value_size = sizeof(unsigned char), .max_entries = 100, }; SEC("func=hrtimer_nanosleep rqtp->tv_nsec") int func(void *ctx, int err, long nsec) { char fmt[] = "%ld\n"; long usec = nsec * 0x10624dd3 >> 38; // nsec / 1000 int key = (int)usec; unsigned char *pval = map_lookup_elem(&channel, &key); if (!pval) return 0; trace_printk(fmt, sizeof(fmt), (unsigned char)*pval); return 0; } char _license[] SEC("license") = "GPL"; int _version SEC("version") = LINUX_VERSION_CODE; /************************* END ***************************/ Normal case: # echo "" > /sys/kernel/debug/tracing/trace # ./perf record -e './test_bpf_map_3.c/map:channel.value[0,1,2,3...5]=101/' usleep 2 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.012 MB perf.data ] # cat /sys/kernel/debug/tracing/trace | grep usleep usleep-405 [004] d... 2745423.547822: : 101 # ./perf record -e './test_bpf_map_3.c/map:channel.value[0...9,20...29]=102,map:channel.value[10...19]=103/' usleep 3 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.012 MB perf.data ] # ./perf record -e './test_bpf_map_3.c/map:channel.value[0...9,20...29]=102,map:channel.value[10...19]=103/' usleep 15 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.012 MB perf.data ] # cat /sys/kernel/debug/tracing/trace | grep usleep usleep-405 [004] d... 2745423.547822: : 101 usleep-655 [006] d... 2745434.122814: : 102 usleep-904 [006] d... 2745439.916264: : 103 # ./perf record -e './test_bpf_map_3.c/map:channel.value[all]=104/' usleep 99 # cat /sys/kernel/debug/tracing/trace | grep usleep usleep-405 [004] d... 2745423.547822: : 101 usleep-655 [006] d... 2745434.122814: : 102 usleep-904 [006] d... 2745439.916264: : 103 usleep-1537 [003] d... 2745538.053737: : 104 Error case: # ./perf record -e './test_bpf_map_3.c/map:channel.value[10...1000]=104/' usleep 99 event syntax error: '..annel.value[10...1000]=104/' \___ Index too large Hint: Valid config terms: map:[<arraymap>].value<indices>=[value] map:[<eventmap>].event<indices>=[event] where <indices> is something like [0,3...5] or [all] (add -v to see detail) Run 'perf list' for a list of valid events Usage: perf record [<options>] [<command>] or: perf record [<options>] -- <command> [<options>] -e, --event <event> event selector. use 'perf list' to list available events Signed-off-by: Wang Nan <wangnan0@huawei.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Alexei Starovoitov <ast@kernel.org> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: Cody P Schafer <dev@codyps.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com> Cc: Kirill Smelkov <kirr@nexedi.com> Cc: Li Zefan <lizefan@huawei.com> Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1456132275-98875-9-git-send-email-wangnan0@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Enable BPF object configure syntaxWang Nan2016-02-221-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch adds the final step for BPF map configuration. A new syntax is appended into parser so user can config BPF objects through '/' '/' enclosed config terms. After this patch, following syntax is available: # perf record -e ./test_bpf_map_1.c/map:channel.value=10/ ... It would takes effect after appling following commits. Test result: # cat ./test_bpf_map_1.c /************************ BEGIN **************************/ #include <uapi/linux/bpf.h> #define SEC(NAME) __attribute__((section(NAME), used)) struct bpf_map_def { unsigned int type; unsigned int key_size; unsigned int value_size; unsigned int max_entries; }; static void *(*map_lookup_elem)(struct bpf_map_def *, void *) = (void *)BPF_FUNC_map_lookup_elem; static int (*trace_printk)(const char *fmt, int fmt_size, ...) = (void *)BPF_FUNC_trace_printk; struct bpf_map_def SEC("maps") channel = { .type = BPF_MAP_TYPE_ARRAY, .key_size = sizeof(int), .value_size = sizeof(int), .max_entries = 1, }; SEC("func=sys_nanosleep") int func(void *ctx) { int key = 0; char fmt[] = "%d\n"; int *pval = map_lookup_elem(&channel, &key); if (!pval) return 0; trace_printk(fmt, sizeof(fmt), *pval); return 0; } char _license[] SEC("license") = "GPL"; int _version SEC("version") = LINUX_VERSION_CODE; /************************* END ***************************/ - Normal case: # ./perf record -e './test_bpf_map_1.c/map:channel.value=10/' usleep 10 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.012 MB perf.data ] - Error case: # ./perf record -e './test_bpf_map_1.c/map:channel.value/' usleep 10 event syntax error: '..ps:channel:value/' \___ Config value not set (missing '=') Hint: Valid config term: map:[<arraymap>]:value=[value] (add -v to see detail) Run 'perf list' for a list of valid events Usage: perf record [<options>] [<command>] or: perf record [<options>] -- <command> [<options>] -e, --event <event> event selector. use 'perf list' to list available events # ./perf record -e './test_bpf_map_1.c/xmap:channel.value=10/' usleep 10 event syntax error: '..pf_map_1.c/xmap:channel.value=10/' \___ Invalid object config option [SNIP] # ./perf record -e './test_bpf_map_1.c/map:xchannel.value=10/' usleep 10 event syntax error: '..p_1.c/map:xchannel.value=10/' \___ Target map not exist [SNIP] # ./perf record -e './test_bpf_map_1.c/map:channel.xvalue=10/' usleep 10 event syntax error: '..ps:channel.xvalue=10/' \___ Invalid object map config option [SNIP] # ./perf record -e './test_bpf_map_1.c/map:channel.value=x10/' usleep 10 event syntax error: '..nnel.value=x10/' \___ Incorrect value type for map [SNIP] Change BPF_MAP_TYPE_ARRAY to '1' in test_bpf_map_1.c: # ./perf record -e './test_bpf_map_1.c/map:channel.value=10/' usleep 10 event syntax error: '..ps:channel.value=10/' \___ Can't use this config term to this type of map Hint: Valid config term: map:[<arraymap>].value=[value] (add -v to see detail) Signed-off-by: Wang Nan <wangnan0@huawei.com> [for parser part] Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Alexei Starovoitov <ast@kernel.org> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: Cody P Schafer <dev@codyps.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com> Cc: Kirill Smelkov <kirr@nexedi.com> Cc: Li Zefan <lizefan@huawei.com> Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1456132275-98875-5-git-send-email-wangnan0@huawei.com Signed-off-by: He Kuang <hekuang@huawei.com> Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Create config_term_names arrayWang Nan2016-02-191-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | config_term_names[] is introduced for future commits which will be able to retrieve the config name through the config term. Utilize this array in parse_events_formats_error_string() so the missing '{,no-}inherit' terms are added. Signed-off-by: Wang Nan <wangnan0@huawei.com> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Alexei Starovoitov <ast@kernel.org> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: Cody P Schafer <dev@codyps.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jeremie Galarneau <jeremie.galarneau@efficios.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Kirill Smelkov <kirr@nexedi.com> Cc: Li Zefan <lizefan@huawei.com> Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1455882283-79592-10-git-send-email-wangnan0@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Compile scriptlets to BPF objects when passing '.c' to --eventWang Nan2015-10-291-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch provides infrastructure for passing source files to --event directly using: # perf record --event bpf-file.c command This patch does following works: 1) Allow passing '.c' file to '--event'. parse_events_load_bpf() is expanded to allow caller tell it whether the passed file is source file or object. 2) llvm__compile_bpf() is called to compile the '.c' file, the result is saved into memory. Use bpf_object__open_buffer() to load the in-memory object. Introduces a bpf-script-example.c so we can manually test it: # perf record --clang-opt "-DLINUX_VERSION_CODE=0x40200" --event ./bpf-script-example.c sleep 1 Note that '--clang-opt' must put before '--event'. Futher patches will merge it into a testcase so can be tested automatically. Signed-off-by: Wang Nan <wangnan0@huawei.com> Acked-by: Alexei Starovoitov <ast@plumgrid.com> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: Daniel Borkmann <daniel@iogearbox.net> Cc: David Ahern <dsahern@gmail.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Kaixu Xia <xiakaixu@huawei.com> Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1444826502-49291-10-git-send-email-wangnan0@huawei.com Signed-off-by: He Kuang <hekuang@huawei.com> Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Enable passing bpf object file to --eventWang Nan2015-10-281-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By introducing new rules in tools/perf/util/parse-events.[ly], this patch enables 'perf record --event bpf_file.o' to select events by an eBPF object file. It calls parse_events_load_bpf() to load that file, which uses bpf__prepare_load() and finally calls bpf_object__open() for the object files. After applying this patch, commands like: # perf record --event foo.o sleep become possible. However, at this point it is unable to link any useful things onto the evsel list because the creating of probe points and BPF program attaching have not been implemented. Before real events are possible to be extracted, to avoid perf report error because of empty evsel list, this patch link a dummy evsel. The dummy event related code will be removed when probing and extracting code is ready. Commiter notes: Using it: $ ls -la foo.o ls: cannot access foo.o: No such file or directory $ perf record --event foo.o sleep libbpf: failed to open foo.o: No such file or directory event syntax error: 'foo.o' \___ BPF object file 'foo.o' is invalid (add -v to see detail) Run 'perf list' for a list of valid events Usage: perf record [<options>] [<command>] or: perf record [<options>] -- <command> [<options>] -e, --event <event> event selector. use 'perf list' to list available events $ $ file /tmp/build/perf/perf.o /tmp/build/perf/perf.o: ELF 64-bit LSB relocatable, x86-64, version 1 (SYSV), not stripped $ perf record --event /tmp/build/perf/perf.o sleep libbpf: /tmp/build/perf/perf.o is not an eBPF object file event syntax error: '/tmp/build/perf/perf.o' \___ BPF object file '/tmp/build/perf/perf.o' is invalid (add -v to see detail) Run 'perf list' for a list of valid events Usage: perf record [<options>] [<command>] or: perf record [<options>] -- <command> [<options>] -e, --event <event> event selector. use 'perf list' to list available events $ $ file /tmp/foo.o /tmp/foo.o: ELF 64-bit LSB relocatable, no machine, version 1 (SYSV), not stripped $ perf record --event /tmp/foo.o sleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.013 MB perf.data ] $ perf evlist /tmp/foo.o $ perf evlist -v /tmp/foo.o: type: 1, size: 112, config: 0x9, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|PERIOD, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1 $ So, type 1 is PERF_TYPE_SOFTWARE, config 0x9 is PERF_COUNT_SW_DUMMY, ok. $ perf report --stdio Error: The perf.data file has no samples! # To display the perf.data header info, please use --header/--header-only options. # $ Signed-off-by: Wang Nan <wangnan0@huawei.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Alexei Starovoitov <ast@plumgrid.com> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: Daniel Borkmann <daniel@iogearbox.net> Cc: David Ahern <dsahern@gmail.com> Cc: He Kuang <hekuang@huawei.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Kaixu Xia <xiakaixu@huawei.com> Cc: Masami Hiramatsu <masami.hiramatsu.pt@hitachi.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1444826502-49291-4-git-send-email-wangnan0@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Enable pre-event inherit setting by config termsWang Nan2015-10-281-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patch allows perf record setting event's attr.inherit bit by config terms like: # perf record -e cycles/no-inherit/ ... # perf record -e cycles/inherit/ ... So user can control inherit bit for each event separately. In following example, a.out fork()s in main then do some complex CPU intensive computations in both of its children. Basic result with and without inherit: # perf record -e cycles -e instructions ./a.out [ perf record: Woken up 9 times to write data ] [ perf record: Captured and wrote 2.205 MB perf.data (47920 samples) ] # perf report --stdio # ... # Samples: 23K of event 'cycles' # Event count (approx.): 23641752891 ... # Samples: 24K of event 'instructions' # Event count (approx.): 30428312415 # perf record -i -e cycles -e instructions ./a.out [ perf record: Woken up 5 times to write data ] [ perf record: Captured and wrote 1.111 MB perf.data (24019 samples) ] ... # Samples: 12K of event 'cycles' # Event count (approx.): 11699501775 ... # Samples: 12K of event 'instructions' # Event count (approx.): 15058023559 Cancel inherit for one event when globally enable: # perf record -e cycles/no-inherit/ -e instructions ./a.out [ perf record: Woken up 7 times to write data ] [ perf record: Captured and wrote 1.660 MB perf.data (36004 samples) ] ... # Samples: 12K of event 'cycles/no-inherit/' # Event count (approx.): 11895759282 ... # Samples: 24K of event 'instructions' # Event count (approx.): 30668000441 Enable inherit for one event when globally disable: # perf record -i -e cycles/inherit/ -e instructions ./a.out [ perf record: Woken up 7 times to write data ] [ perf record: Captured and wrote 1.654 MB perf.data (35868 samples) ] ... # Samples: 23K of event 'cycles/inherit/' # Event count (approx.): 23285400229 ... # Samples: 11K of event 'instructions' # Event count (approx.): 14969050259 Committer note: One can check if the bit was set, in addition to seeing the result in the perf.data file size as above by doing one of: # perf record -e cycles -e instructions -a usleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.911 MB perf.data (63 samples) ] # perf evlist -v cycles: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1 instructions: size: 112, config: 0x1, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, inherit: 1, freq: 1, sample_id_all: 1, exclude_guest: 1 # So, the inherit bit was set in both, now, if we disable it globally using --no-inherit: # perf record --no-inherit -e cycles -e instructions -a usleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.910 MB perf.data (56 samples) ] # perf evlist -v cycles: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, mmap: 1, comm: 1, freq: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1 instructions: size: 112, config: 0x1, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, freq: 1, sample_id_all: 1, exclude_guest: 1 No inherit bit set, then disabling it and setting just on the cycles event: # perf record --no-inherit -e cycles/inherit/ -e instructions -a usleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.909 MB perf.data (48 samples) ] # perf evlist -v cycles/inherit/: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1 instructions: size: 112, config: 0x1, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|ID|CPU|PERIOD, read_format: ID, disabled: 1, freq: 1, sample_id_all: 1, exclude_guest: 1 # We can see it as well in by using a more verbose level of debug messages in the tool that sets up the perf_event_attr, 'perf record' in this case: [root@zoo ~]# perf record -vv --no-inherit -e cycles/inherit/ -e instructions -a usleep 1 ------------------------------------------------------------ perf_event_attr: size 112 { sample_period, sample_freq } 4000 sample_type IP|TID|TIME|ID|CPU|PERIOD read_format ID disabled 1 inherit 1 mmap 1 comm 1 freq 1 task 1 sample_id_all 1 exclude_guest 1 mmap2 1 comm_exec 1 ------------------------------------------------------------ sys_perf_event_open: pid -1 cpu 0 group_fd -1 flags 0x8 sys_perf_event_open: pid -1 cpu 1 group_fd -1 flags 0x8 sys_perf_event_open: pid -1 cpu 2 group_fd -1 flags 0x8 sys_perf_event_open: pid -1 cpu 3 group_fd -1 flags 0x8 ------------------------------------------------------------ perf_event_attr: size 112 config 0x1 { sample_period, sample_freq } 4000 sample_type IP|TID|TIME|ID|CPU|PERIOD read_format ID disabled 1 freq 1 sample_id_all 1 exclude_guest 1 ------------------------------------------------------------ sys_perf_event_open: pid -1 cpu 0 group_fd -1 flags 0x8 <SNIP> Signed-off-by: Wang Nan <wangnan0@huawei.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Alexei Starovoitov <ast@plumgrid.com> Cc: Brendan Gregg <brendan.d.gregg@gmail.com> Cc: David S. Miller <davem@davemloft.net> Cc: Li Zefan <lizefan@huawei.com> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Zefan Li <lizefan@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1446029705-199659-2-git-send-email-wangnan0@huawei.com [ s/u64/bool/ for the perf_evsel_config_term inherit field - jolsa] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Introduce 'P' modifier to request max precisionJiri Olsa2015-10-051-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The 'P' will cause the event to get maximum possible detected precise level. Following record: $ perf record -e cycles:P ... will detect maximum precise level for 'cycles' event and use it. Commiter note: Testing it: $ perf record -e cycles:P usleep 1 [ perf record: Woken up 1 times to write data ] [ perf record: Captured and wrote 0.013 MB perf.data (9 samples) ] $ perf evlist cycles:P $ perf evlist -v cycles:P: size: 112, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|PERIOD, disabled: 1, inherit: 1, mmap: 1, comm: 1, freq: 1, enable_on_exec: 1, task: 1, precise_ip: 2, sample_id_all: 1, mmap2: 1, comm_exec: 1 $ Signed-off-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: David Ahern <dsahern@gmail.com> Cc: Don Zickus <dzickus@redhat.com> Cc: Kan Liang <kan.liang@intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1444068369-20978-6-git-send-email-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Show proper error message for wrong terms of hw/sw eventsHe Kuang2015-09-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Show proper error message and show valid terms when wrong config terms is specified for hw/sw type perf events. This patch makes the original error format function formats_error_string() more generic, which only outputs the static config terms for hw/sw perf events, and prepends pmu formats for pmu events. Before this patch: $ perf record -e 'cpu-clock/freqx=200/' -a sleep 1 invalid or unsupported event: 'cpu-clock/freqx=200/' Run 'perf list' for a list of valid events usage: perf record [<options>] [<command>] or: perf record [<options>] -- <command> [<options>] -e, --event <event> event selector. use 'perf list' to list available events After this patch: $ perf record -e 'cpu-clock/freqx=200/' -a sleep 1 event syntax error: 'cpu-clock/freqx=200/' \___ unknown term valid terms: config,config1,config2,name,period,freq,branch_type,time,call-graph,stack-size Run 'perf list' for a list of valid events usage: perf record [<options>] [<command>] or: perf record [<options>] -- <command> [<options>] -e, --event <event> event selector. use 'perf list' to list available events Signed-off-by: He Kuang <hekuang@huawei.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Adrian Hunter <adrian.hunter@intel.com> Cc: Kan Liang <kan.liang@intel.com> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Wang Nan <wangnan0@huawei.com> Cc: pi3orama@163.com Link: http://lkml.kernel.org/r/1443412336-120050-2-git-send-email-hekuang@huawei.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf callchain: Per-event type selection supportKan Liang2015-08-121-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This patchkit adds the ability to set callgraph mode (fp, dwarf, lbr) per event. This in term can reduce sampling overhead and the size of the perf.data. Here is an example. perf record -e 'cpu/cpu-cycles,period=1000,call-graph=fp,time=1/,cpu/instructions,call-graph=lbr/' sleep 1 perf evlist -v cpu/cpu-cycles,period=1000,call-graph=fp,time=1/: type: 4, size: 112, config: 0x3c, { sample_period, sample_freq }: 1000, sample_type: IP|TID|TIME|CALLCHAIN|PERIOD|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, mmap: 1, comm: 1, enable_on_exec: 1, task: 1, sample_id_all: 1, exclude_guest: 1, mmap2: 1, comm_exec: 1 cpu/instructions,call-graph=lbr/: type: 4, size: 112, config: 0xc0, { sample_period, sample_freq }: 4000, sample_type: IP|TID|TIME|CALLCHAIN|PERIOD|BRANCH_STACK|IDENTIFIER, read_format: ID, disabled: 1, inherit: 1, freq: 1, enable_on_exec: 1, sample_id_all: 1, exclude_guest: 1 Signed-off-by: Kan Liang <kan.liang@intel.com> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Jiri Olsa <jolsa@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Link: http://lkml.kernel.org/r/1439289050-40510-1-git-send-email-kan.liang@intel.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf record: Support per-event freq termNamhyung Kim2015-08-101-0/+1
| | | | | | | | | | | | | | Now perf can set per-event value of time and (sampling) period. But I guess most users like me just want to set frequency rather than period. So add the 'freq' term in the event parser. Signed-off-by: Namhyung Kim <namhyung@kernel.org> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: David Ahern <dsahern@gmail.com> Cc: Kan Liang <kan.liang@intel.com> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1439102724-14079-1-git-send-email-namhyung@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Per-event time supportKan Liang2015-08-051-0/+1
| | | | | | | | | | | | | | | | | This patchkit adds the ability to turn off time stamps per event. One usaful case for partial time is to work with per-event callgraph to enable "PEBS threshold > 1" (https://lkml.org/lkml/2015/5/10/196), which can significantly reduce the sampling overhead. The event samples with time stamps off will not be ordered. Signed-off-by: Kan Liang <kan.liang@intel.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Cc: Andi Kleen <ak@linux.intel.com> Cc: Namhyung Kim <namhyung@kernel.org> Link: http://lkml.kernel.org/r/1438677022-34296-2-git-send-email-kan.liang@intel.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Allow events with dotAndi Kleen2015-06-231-3/+2
| | | | | | | | | | | | | | | | | | | | | The Intel events use a dot to separate event name and unit mask. Allow dot in names in the scanner, and remove special handling of dot as EOF. Also remove the hack in jevents to replace dot with underscore. This way dotted events can be specified directly by the user. I'm not fully sure this change to the scanner is correct (what was the dot special case good for?), but I haven't found anything that breaks with it so far at least. Signed-off-by: Andi Kleen <ak@linux.intel.com> Acked-by: Jiri Olsa <jolsa@redhat.com> Acked-by: Namhyung Kim <namhyung@kernel.org> Cc: Madhavan Srinivasan <maddy@linux.vnet.ibm.com> Cc: Michael Ellerman <mpe@ellerman.id.au> Cc: linuxppc-dev@lists.ozlabs.org Link: http://lkml.kernel.org/r/1433921123-25327-8-git-send-email-sukadev@linux.vnet.ibm.com Signed-off-by: Sukadev Bhattiprolu <sukadev@linux.vnet.ibm.com> Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add term support for parse_events_errorJiri Olsa2015-04-291-0/+4
| | | | | | | | | | | | | | | | | | | | Allowing event's term processing to report back error, like: $ perf record -e 'cpu/even=0x1/' ls event syntax error: 'cpu/even=0x1/' \___ unknown term valid terms: pc,any,inv,edge,cmask,event,in_tx,ldlat,umask,in_tx_cp,offcore_rsp,config,config1,config2,name,period,branch_type Signed-off-by: Jiri Olsa <jolsa@kernel.org> Tested-by: Arnaldo Carvalho de Melo <acme@redhat.com> Cc: David Ahern <dsahern@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1429729824-13932-7-git-send-email-jolsa@kernel.org [ Renamed 'error' variables to 'err', not to clash with util.h error() ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add flex support for parse_events_errorJiri Olsa2015-04-291-4/+33
| | | | | | | | | | | | | | | | | Allowing flex parser to report back event parsing error, like: $ perf record -e cycles,cache-mises ls event syntax error: '..es,cache-mises' \___ parser error ... Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: David Ahern <dsahern@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1429729824-13932-3-git-send-email-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add 'I' event modifier for exclude_idle bitJiri Olsa2015-04-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | Adding 'I' event modifier to have complete set of modifiers for perf_event_attr:exclude_* bits. Any event specified with 'I' modifier will have the perf_event_attr:exclude_idle bit set. $ perf record -e cycles:I -vv ls 2>&1 | grep exclude_idle exclude_hv 0 exclude_idle 1 Adding automated tests. Signed-off-by: Jiri Olsa <jolsa@kernel.org> Cc: Andi Kleen <andi@firstfloor.org> Cc: David Ahern <dsahern@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: William Cohen <wcohen@redhat.com> Link: http://lkml.kernel.org/r/1428441919-23099-2-git-send-email-jolsa@kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: allow user to specify hardware breakpoint bp_lenJacob Shin2014-12-031-0/+1
| | | | | | | | | | | | | | | | | | | | | Currently bp_len is given a default value of 4. Allow user to override it: $ perf stat -e mem:0x1000/8 ^ bp_len If no value is given, it will default to 4 as it did before. Signed-off-by: Jacob Shin <jacob.w.shin@gmail.com> Signed-off-by: Suravee Suthikulpanit <suravee.suthikulpanit@amd.com> Acked-by: Jiri Olsa <jolsa@kernel.org> Reviewed-by: Oleg Nesterov <oleg@redhat.com> Cc: Arnaldo Carvalho de Melo <acme@ghostprotocols.net> Cc: Ingo Molnar <mingo@kernel.org> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Peter Zijlstra <peterz@infradead.org> Cc: xiakaixu <xiakaixu@huawei.com> Signed-off-by: Frederic Weisbecker <fweisbec@gmail.com>
* perf tools: Add support to new style format of kernel PMU eventKan Liang2014-10-151-1/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Add new rules for kernel PMU event. Currently, the patch only want to handle the PMU event name as "a-b" and "a". event_pmu: PE_KERNEL_PMU_EVENT sep_dc | PE_PMU_EVENT_PRE '-' PE_PMU_EVENT_SUF sep_dc PE_KERNEL_PMU_EVENT token is for cycles-ct/cycles-t/mem-loads/mem-stores. The prefix cycles is mixed up with cpu-cycles. loads and stores are mixed up with cache event So they have to be hardcode in lex. PE_PMU_EVENT_PRE and PE_PMU_EVENT_SUF tokens are for other PMU events. The lex looks generic identifier up in the table and return the matched token. If there is no match, generic PE_NAME token will be return. Using the rules, kernel PMU event could use new style format without // so you can use: perf record -e mem-loads ... instead of: perf record -e cpu/mem-loads/ Signed-off-by: Kan Liang <kan.liang@intel.com> Acked-by: Jiri Olsa <jolsa@redhat.com> Cc: Andi Kleen <ak@linux.intel.com> Cc: Jiri Olsa <jolsa@redhat.com> Link: http://lkml.kernel.org/r/1412694532-23391-4-git-send-email-kan.liang@intel.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Move start conditions to start of the flex fileJiri Olsa2013-10-111-31/+32
| | | | | | | | | | | | | | | | | | | | | Moving start conditions to start of the flex file so it's clear what the INITIAL condition rules are. Plus adding default rule for INITIAL condition. This prevents default space to be printed for events like: $ ./perf stat -e "cycles " kill 2>/dev/null $ ^^^^^^^^ Signed-off-by: Jiri Olsa <jolsa@redhat.com> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1380299398-10839-1-git-send-email-jolsa@redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add support for PERF_COUNT_SW_DUMMYAdrian Hunter2013-09-021-0/+1
| | | | | | | | | | | | | | | | | | | Add support for the new dummy software event PERF_COUNT_SW_DUMMY. Signed-off-by: Adrian Hunter <adrian.hunter@intel.com> Acked-by: Jiri Olsa <jolsa@redhat.com> Tested-by: Jiri Olsa <jolsa@redhat.com> Cc: David Ahern <dsahern@gmail.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@redhat.com> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Mike Galbraith <efault@gmx.de> Cc: Namhyung Kim <namhyung@gmail.com> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Stephane Eranian <eranian@google.com> Link: http://lkml.kernel.org/r/1377975053-3811-3-git-send-email-adrian.hunter@intel.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add support for pinned modifierMichael Ellerman2013-08-071-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit adds support for a new modifier "D", which requests that the event, or group of events, be pinned to the PMU. The "p" modifier is already taken for precise, and "P" may be used in future to mean "fully precise". So we use "D", which stands for pinneD - and looks like a padlock, or if you're using the ":D" syntax perf smiles at you. This is an oft-requested feature from our HW folks, who want to be able to run a large number of events, but also want 100% accurate results for instructions per cycle. Comparison of results with and without pinning: $ perf stat -e '{cycles,instructions}:D' -e cycles,instructions,... 79,590,480,683 cycles # 0.000 GHz 166,123,716,524 instructions # 2.09 insns per cycle # 0.11 stalled cycles per insn 79,352,134,463 cycles # 0.000 GHz [11.11%] 165,178,301,818 instructions # 2.08 insns per cycle # 0.11 stalled cycles per insn [11.13%] As you can see although perf does a very good job of scaling the values in the non-pinned case, there is some small discrepancy. The patch is fairly straight forward, the one detail is that we need to make sure we only request pinning for the group leader when we have a group. Signed-off-by: Michael Ellerman <michael@ellerman.id.au> Acked-by: Namhyung Kim <namhyung@kernel.org> Acked-by: Jiri Olsa <jolsa@redhat.com> Tested-by: Jiri Olsa <jolsa@redhat.com> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1375795686-4226-1-git-send-email-michael@ellerman.id.au [ Use perf_evsel__is_group_leader instead of open coded equivalent, as suggested by Jiri Olsa ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add 'S' event/group modifier to read sample valueJiri Olsa2013-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adding 'S' event/group modifier to specify that the event value/s are read by PERF_SAMPLE_READ sample type processing, instead of the period value offered by lower layers. There's additional behaviour change for 'S' modifier being specified on event group: Currently all the events within a group makes samples. If user now specifies 'S' within group modifier, only the leader will trigger samples. The rest of events in the group will have sampling disabled. And same as for single events, values of all events within the group (including leader) are read by PERF_SAMPLE_READ sample type processing. Following example will create event group with cycles and cache-misses events, setting the cycles as group leader and the only event to actually sample. Both cycles and cache-misses event period values are read by PERF_SAMPLE_READ sample type processing with PERF_FORMAT_GROUP read format. Example: $ perf record -e '{cycles,cache-misses}:S' ls ... $ perf report --group --show-total-period --stdio ... # Samples: 36 of event 'anon group { cycles, cache-misses }' # Event count (approx.): 12585593 # # Overhead Period Command Shared Object Symbol # .............. .............. ....... ................. .......................... # 19.92% 1.20% 2505936 31 ls [kernel.kallsyms] [k] mark_held_locks 13.74% 0.47% 1729327 12 ls [kernel.kallsyms] [k] sched_clock_local 13.64% 23.72% 1716147 612 ls ld-2.14.90.so [.] check_match.10805 13.12% 23.22% 1650778 599 ls libc-2.14.90.so [.] _nl_intern_locale_data 11.24% 29.19% 1414554 753 ls [kernel.kallsyms] [k] sched_clock_cpu 8.50% 0.35% 1070150 9 ls [kernel.kallsyms] [k] check_chain_key ... Signed-off-by: Jiri Olsa <jolsa@redhat.com> Acked-by: Namhyung Kim <namhyung@kernel.org> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/n/tip-iyoinu3axi11mymwnh2b7fxj@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add basic event modifier sanity checkJiri Olsa2012-11-141-1/+1
| | | | | | | | | | | | | | | | | | | | | | | Updating event parser to allow any non zero string containing [ukhpGH] characters for event modifier. The modifier sanity is checked later in parse-event object logic. The check validates modifier to contain only one instance of any modifier (apart from 'p') present. v2: - added length check suggested Namhyung Kim Signed-off-by: Jiri Olsa <jolsa@redhat.com> Acked-by: Namhyung Kim <namhyung@kernel.org> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20121113143258.GA2481@krava.brq.redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add arbitary aliases and support names with -Andi Kleen2012-11-081-0/+2
| | | | | | | | | | | | | | | | - Add missing scanner symbol for arbitrary aliases inside the config region. - looks nicer than _, so allow - in the event names. Used for various of the arch perfmon and Haswell events. Signed-off-by: Andi Kleen <ak@linux.intel.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Namhyung Kim <namhyung.kim@lge.com> Cc: Peter Zijlstra <peterz@infradead.org> Link: http://lkml.kernel.org/r/1352123463-7346-6-git-send-email-eranian@google.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Use __maybe_used for unused variablesIrina Tirdea2012-09-111-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | perf defines both __used and __unused variables to use for marking unused variables. The variable __used is defined to __attribute__((__unused__)), which contradicts the kernel definition to __attribute__((__used__)) for new gcc versions. On Android, __used is also defined in system headers and this leads to warnings like: warning: '__used__' attribute ignored __unused is not defined in the kernel and is not a standard definition. If __unused is included everywhere instead of __used, this leads to conflicts with glibc headers, since glibc has a variables with this name in its headers. The best approach is to use __maybe_unused, the definition used in the kernel for __attribute__((unused)). In this way there is only one definition in perf sources (instead of 2 definitions that point to the same thing: __used and __unused) and it works on both Linux and Android. This patch simply replaces all instances of __used and __unused with __maybe_unused. Signed-off-by: Irina Tirdea <irina.tirdea@intel.com> Acked-by: Pekka Enberg <penberg@kernel.org> Cc: David Ahern <dsahern@gmail.com> Cc: Ingo Molnar <mingo@redhat.com> Cc: Namhyung Kim <namhyung.kim@lge.com> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Steven Rostedt <rostedt@goodmis.org> Link: http://lkml.kernel.org/r/1347315303-29906-7-git-send-email-irina.tirdea@intel.com [ committer note: fixed up conflict with a116e05 in builtin-sched.c ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Catch event names from command lineRobert Richter2012-08-221-10/+40
| | | | | | | | | | | | | | | | | | | | | | | Use command line string provided by the -e option to name events. This way we get unique events names that also support pmu event syntax (<pmu_name>/<config>/<modifier>). No need to reconstruct the name anymore from its attributes. We use the event_desc of the header to store the name in the perf.data header. Thus it is also available for perf report. Implemented by putting the parser in different states to parse events or configs. And since event names are now generated from the command line specification. Update event names in test cases accordingly. Signed-off-by: Robert Richter <robert.richter@amd.com> Cc: Ingo Molnar <mingo@kernel.org> Cc: Jiri Olsa <jolsa@redhat.com> Cc: Peter Zijlstra <peterz@infradead.org> Link: http://lkml.kernel.org/r/1345144224-27280-6-git-send-email-robert.richter@amd.com [ committer note: Folded patch fixing 'perf test' failure reported by Jiri Olsa ] Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add support to parse event group syntaxJiri Olsa2012-08-141-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adding scanner/parser bits to parse event groups. The grammar for group is: groups: groups ',' group | group group: group_name '{' events '}' group_mod group_name: name | empty group_mod: ':' group_mods | empty group_mods: event_mod It's possible to use standard event modifier as a modifier for group. It'll be used as an update to existing event modifiers. It's necessary to use quoting ("'\) when specifying group on command line, since {} characters are interpreted by most of the shells. It is now possible to specify groups in event syntax like: '{cycles,faults}' - anonymous group 'group1{cycles,faults} - group with name 'group1' '{cycles,faults}:k - anonymous group with event modifier 'k' '{cpu-clock,task-clock},{minor-faults,major-faults}' - two anonymous groups The grouping functionality itself is coming shortly. Reviewed-by: Namhyung Kim <namhyung@kernel.org> Signed-off-by: Jiri Olsa <jolsa@redhat.com> Acked-by: Peter Zijlstra <peterz@infradead.org> Cc: Andi Kleen <andi@firstfloor.org> Cc: Arnaldo Carvalho de Melo <acme@ghostprotocols.net> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Thomas Gleixner <tglx@linutronix.de> Cc: Ulrich Drepper <drepper@gmail.com> Link: http://lkml.kernel.org/n/tip-p4j8bnvo879uokum4k4zk5q6@git.kernel.org Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Fix parsing of 64 bit raw config value for 32 bitRobert Richter2012-08-081-2/+2
| | | | | | | | | | | | | perf record fails on 32 bit with: invalid or unsupported event: 'r40000F7E0' Fixing this by parsing 64 bit num values. Signed-off-by: Robert Richter <robert.richter@amd.com> Cc: Ingo Molnar <mingo@kernel.org> Link: http://lkml.kernel.org/r/1344361396-7237-4-git-send-email-robert.richter@amd.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Split out PE_VALUE_SYM parsing token to SW and HW tokensJiri Olsa2012-07-051-1/+1
| | | | | | | | | | | | | | | | | | Spliting PE_VALUE_SYM token to PE_VALUE_SYM_HW and PE_VALUE_SYM_SW tokens to separate hardware and software symbols. This will be useful in upcomming patch where we want to be able to parse out only hardware events. Signed-off-by: Jiri Olsa <jolsa@redhat.com> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Stephane Eranian <eranian@google.com> Link: http://lkml.kernel.org/r/1341352848-11833-6-git-send-email-jolsa@redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Add empty rule for new line in event syntax parsingJiri Olsa2012-07-051-0/+1
| | | | | | | | | | | | | | | | | | The flex generator prints out each input character that is ignored by lex rules. Since the alias processing, we can have '\n' characters on input. We need to assign empty rule to it, so it's not printed out. Signed-off-by: Jiri Olsa <jolsa@redhat.com> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Cc: Stephane Eranian <eranian@google.com> Link: http://lkml.kernel.org/r/1341352848-11833-2-git-send-email-jolsa@redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Fix hw breakpoint's type modifier parsingJiri Olsa2012-06-291-1/+1
| | | | | | | | | | | | | | | | | Fixing the hw breakpoint's type modifier parsing to allow all possible combinations of 'rwx' characters. Adding automated tests to the parsing test suite. Reported-by: Jovi Zhang <bookjovi@gmail.com> Original-patch-by: Namhyung Kim <namhyung@kernel.org> Signed-off-by: Jiri Olsa <jolsa@redhat.com> Cc: Jovi Zhang <bookjovi@gmail.com> Cc: Namhyung Kim <namhyung@kernel.org> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/20120629072254.GA940@krava.brq.redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf/tool: Add support to reuse event grammar to parse out termsJiri Olsa2012-06-181-0/+13
| | | | | | | | | | | | | | | | | | | | | | | | We want to reuse the event grammar for parsing aliased terms. The obvious reason is we dont need to add new code when there's already support for this in event grammar. Doing this by adding terms and event start entries into event parse grammar. The grammar forks on the begining based on the starting token, which is supplied via bison interface into the lexer. The lexer then returns the starting token as the first token, thus making the grammar switch accordingly. Currently 2 starting tokens/grammars are supported: PE_START_TERMS, PE_START_EVENTS The PE_START_TERMS related grammar uses 'event_config' part of the grammar for term parsing. Signed-off-by: Jiri Olsa <jolsa@redhat.com> Signed-off-by: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1339741902-8449-12-git-send-email-zheng.z.yan@intel.com Signed-off-by: Ingo Molnar <mingo@kernel.org>
* perf/tool: Make the event parser re-entrantZheng Yan2012-06-181-49/+67
| | | | | | | | | | | | | Make the event parser reentrant by creating separate scanner for each parsing. The scanner is passed to the bison as and argument to the lexer. Signed-off-by: Zheng Yan <zheng.z.yan@intel.com> [ Cleaned up the patch. ] Signed-off-by: Jiri Olsa <jolsa@redhat.com> Signed-off-by: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1339741902-8449-11-git-send-email-zheng.z.yan@intel.com Signed-off-by: Ingo Molnar <mingo@kernel.org>
* perf tools: Add hardcoded name term for pmu eventsJiri Olsa2012-05-221-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adding a new hardcoded term 'name' allowing to specify a name for the pmu event. The term is defined along with standard pmu terms. If no 'name' term is given, the event name follows following template: "raw 0x<perf_event_attr::config>" running: perf stat -e cpu/config=1,name=krava1/u ls will produce following output: ... Performance counter stats for 'ls': 0 krava1 ... running: perf stat -e cpu/config=1/u ls will produce following output: ... Performance counter stats for 'ls': 0 raw 0x1 ... Signed-off-by: Jiri Olsa <jolsa@redhat.com> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1337584373-2741-6-git-send-email-jolsa@redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
* perf tools: Separate 'mem:' event scanner bitsJiri Olsa2012-05-221-2/+23
| | | | | | | | | | | | | | | | | | Separating 'mem:' scanner processing, so we can parse out modifier specifically and dont clash with other rules. This is just precaution for the future, so we dont need to worry about the rules clashing where we need to parse out any sub-rule of global rules. Signed-off-by: Jiri Olsa <jolsa@redhat.com> Cc: Corey Ashford <cjashfor@linux.vnet.ibm.com> Cc: Frederic Weisbecker <fweisbec@gmail.com> Cc: Ingo Molnar <mingo@elte.hu> Cc: Paul Mackerras <paulus@samba.org> Cc: Peter Zijlstra <a.p.zijlstra@chello.nl> Link: http://lkml.kernel.org/r/1337584373-2741-5-git-send-email-jolsa@redhat.com Signed-off-by: Arnaldo Carvalho de Melo <acme@redhat.com>
OpenPOWER on IntegriCloud