summaryrefslogtreecommitdiffstats
path: root/usr.sbin
Commit message (Expand)AuthorAgeFilesLines
...
* Show dependencies in package menu.jkh1999-02-026-24/+111
* Don't allow root to specify non-existent labels onbrian1999-02-022-23/+29
* Reimplement the previous fix (no response to PAP requests)brian1999-02-025-26/+20
* Sigh. Fix capitalization bogon. Who had the pointy hat?wollman1999-02-021-2/+2
* Added xref to nologin(5).wosch1999-02-011-2/+3
* Added xref to nologin(8).wosch1999-02-011-1/+2
* Observe -U flag again, and use it in preference to getlogin(), ifwollman1999-02-011-4/+11
* Man, was I ever smoking crack when I wrote this. Don't free()jkh1999-02-012-16/+12
* If we receive no answer from the server when sending PAPbrian1999-02-015-13/+28
* (1) Make usage() and SYNOPSIS agree with each other.billf1999-01-312-9/+8
* Mention the error when we fail to connect().brian1999-01-311-4/+10
* Consistantly use 'devicename' instead of varying between 'discname' andbillf1999-01-311-3/+3
* 1. Install /boot/loader correctly on boot.flpjkh1999-01-302-2/+6
* o Send a CHAP challenge of 16 random digits when RADIUS isbrian1999-01-292-40/+44
* More support for Alpha installs.jkh1999-01-294-8/+60
* Reflect syslog(8)'s acceptance of either tabs or spaces.billf1999-01-282-10/+2
* Fix nasty bug where getpackagesite() will return an integer if it doesn'tbillf1999-01-281-2/+2
* jkoshy forgot up update the heading date on the man page.wollman1999-01-281-2/+2
* MAINTAINER=brian@FreeBSD.orgbrian1999-01-281-1/+3
* Version 2.0 > 2.1 to reflection RADIUS additions.brian1999-01-281-3/+3
* Initial RADIUS support (using libradius). See the man page forbrian1999-01-2838-193/+982
* Note that the 'owner.group' field is optional in the config file.jkoshy1999-01-271-3/+3
* Write changes out to /etc/rc.conf.site now rather than mucking withjkh1999-01-276-102/+136
* typo - "a follows" -> "as follows"billf1999-01-262-4/+4
* Numbering typo, missed a '0'billf1999-01-261-3/+3
* Automatically load the vn module if it isn't already in the kernel.peter1999-01-261-1/+6
* Update pkg_add's remote package feature to reflect the new structure ofbillf1999-01-251-6/+6
* Don't SEGV when ``set proctitle'' is used in the defaultbrian1999-01-251-4/+10
* Back out a couple of i386 conditionals which aren't needed with the newdfr1999-01-251-12/+4
* Correct a typo and an unparseable sentence.jkoshy1999-01-251-6/+4
* Support 'O MaxHeaderLines=' to override the default header count and linepeter1999-01-241-0/+1
* Add the texinfo'ed docs to the build/install.markm1999-01-233-9/+11
* Remove a workaround for the alpha port using an outdated version of syscons.dfr1999-01-231-6/+1
* A slight bit of code and doco cleanup, but mostly:wollman1999-01-224-72/+284
* Fix formatting bug with [NFS swap] vs /dev/DEVNAMEdillon1999-01-221-3/+3
* Make pstat use new kvm_getswapinfo() libkvm call.dillon1999-01-221-344/+77
* I don't know how this happened since I know I compiled this on my machine.wollman1999-01-211-2/+2
* Merge changes from vendor branch (tzcode1999a), plus the following additionalwollman1999-01-217-269/+305
* This commit was generated by cvs2svn to compensate for changes in r42994,wollman1999-01-211-0/+269
|\
| * First stage in giving zic/zdump its own version of private.h so that theywollman1999-01-211-0/+269
* | Remove two files replaced with HTML by vendor.wollman1999-01-212-152/+0
* | This commit was generated by cvs2svn to compensate for changes in r42991,wollman1999-01-214-40/+479
|\ \ | |/
| * Updated timezone compiler from Arthur Olson.wollman1999-01-2110-112/+973
* | Update pstat -s to handle both old and new swapper.dillon1999-01-212-76/+290
* | Fix raw timestamps (zero-pad usecs)fenner1999-01-201-2/+4
* | Recurse when we've switched state via LoginDone(). If we'vebrian1999-01-201-2/+2
* | Replace old SAVE_USERCONFIG code with a customized version of Andrzej'sjkh1999-01-208-10/+128
* | Remove obsolete dset code. It's an ELF/3-stage boot world now and therejkh1999-01-204-146/+4
* | Merge conflicts from 3.9-beta3+IOS12. The conflicts were huge; cvs'sfenner1999-01-2023-1861/+4167
* | This commit was generated by cvs2svn to compensate for changes in r42888,fenner1999-01-204-0/+413
|\ \
OpenPOWER on IntegriCloud