summaryrefslogtreecommitdiffstats
path: root/usr.bin
Commit message (Collapse)AuthorAgeFilesLines
* Fix vmstat display problems. The header printout wasn't quite right, andken1999-02-102-13/+10
| | | | | | | | | the display wrapped around. This decreases the default maximum number of disks shown to 2, so things don't wrap around so easily. Also, it fixes the header display issues. Submitted by: Bruce Evans <bde@FreeBSD.ORG>
* Add a prioritization field to the devstat_add_entry() call so thatken1999-02-101-9/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | peripheral drivers can determine where in the devstat(9) list they are inserted. This requires recompilation of libdevstat, systat, vmstat, rpc.rstatd, and any ports that depend on the devstat code, since the size of the devstat structure has changed. The devstat version number has been incremented as well to reflect the change. This sorts devices in the devstat list in "more interesting" to "less interesting" order. So, for instance, da devices are now more important than floppy drives, and so will appear before floppy drives in the default output from systat, iostat, vmstat, etc. The order of devices is, for now, kept in a central table in devicestat.h. If individual drivers were able to make a meaningful decision on what priority they should be at attach time, we could consider splitting the priority information out into the various drivers. For now, though, they have no way of knowing that, so it's easier to put them in an easy to find table. Also, move the checkversion() call in vmstat(8) to a more logical place. Thanks to Bruce and David O'Brien for suggestions, for reviewing this, and for putting up with the long time it has taken me to commit it. Bruce did object somewhat to the central priority table (he would rather the priorities be distributed in each driver), so his objection is duly noted here. Reviewed by: bde, obrien
* Added myself as maintainer.wosch1999-02-093-1/+11
|
* Include discrete ozfod as well as ozfod/zfod percentage.dillon1999-02-081-7/+7
|
* If there are 4 or fewer disk devices, we have room to display additionaldillon1999-02-082-5/+39
| | | | | VM statistics. zfod is moved and %slo-z ( percentage of zero-fills that were slow, i.e. not pre-zero'd ), and number of pages freed per second.
* Make the ipx part of netstat work again.jhay1999-02-061-5/+7
|
* Don't dump core when p_stat is not in the expected range. This isfenner1999-02-061-3/+9
| | | | | | only likely to happen when you have a kernel<>userland mismatch, but it's really annoying when top dumps core and leaves the terminal in a mangled state; it's much nicer to print nicely formatted gibberish.
* Be nice when no swap is configured in systemdillon1999-02-061-1/+11
|
* Make 'top' handle case w/ new swapper where no swap is configureddillon1999-02-061-2/+2
|
* Print relative (mt_fileno, mt_blkno) position, if known.mjacob1999-02-051-1/+58
| | | | Print driver state if not NIL.
* finally document new commandsmjacob1999-02-051-4/+42
|
* Remove the FTP_PASSIVE_MODE "fix"; libftpio handles this.fenner1999-02-051-3/+1
|
* Print usage via fprintf(stderr, ..) instead of errx() to avoid progname prefix.archie1999-02-051-2/+3
| | | | Submitted by: Philippe Charnier <charnier@xp11.frmug.org>
* Warn about collapsing multiple slashes into 1 in ftp URL's.fenner1999-02-032-4/+34
| | | | | | | | | | | Look at the FTP_PASSIVE_MODE environment variable like the man page says. PR: bin/9464 Submitted by: John A. Shue <John.Shue@symmetron.com> Add references to RFC's 1790, 959, 850. PR: doc/6564
* Don't try to parse a colon in a URL as a portfenner1999-02-031-2/+2
| | | | | | | (e.g. http://www.host.name/foo:bar) PR: bin/5072 Submitted by: Takeshi WATANABE <watanabe@komadori.planet.kobe-u.ac.jp>
* Update to the most recent version. Among other things, this also solvesjoerg1999-02-0312-66/+178
| | | | | | | | | | | | | | the function naming problem for complex double function i've recently aksed for in -committers. (The recently committed rev 1.5 of proc.c was actually also part of this update.) Should the mailing lists come to an agreement that f2c better belongs into the ports, this could be done nevertheless. For the time being, we've at least got a current version now. Thanks, Steve! Submitted by: Steve Kargl <sgk@troutmask.apl.washington.edu>
* Merge from NetBSD: cut.1 rev 1.6 to 1.8eivind1999-02-022-21/+28
| | | | | | | cut.c rev 1.9 to 1.13 * Man page internal cleanups * 8-bit characters cast to unsigned for is*() * Misc cleanups for egcs -Wall compatibility
* Bring in use of strsep() to handle bad input better, and clean upeivind1999-02-022-7/+8
| | | | | | | some text. Obtained from: Merge from OpenBSD (cut.1 up to OpenBSD rev 1.3, cut.c up to OpenBSD rev 1.6)
* Merge from NetBSD cut.1 rev 1.6 and cut.c rev 1.9, respectively. Thiseivind1999-02-022-7/+26
| | | | | | makes us conform to IEEE Std1003.2-1992 (``POSIX.2''). Obtained from: NetBSD (but with slight modifications).
* Add -R for .RU domainsache1999-02-022-5/+15
|
* Add new option '-p pattern' for splitting files based on matching lines inarchie1999-02-013-52/+94
| | | | | | the file with a regular expression. Useful for e.g. 'cvs diff' output. Also compile cleanly with -Wall and fix a few style bugs. PR: bin/9405
* Added xref to nologin(5)wosch1999-02-011-1/+2
|
* Update the -d flag to use the new .MIL NIC address (from PR 9802)wollman1999-02-012-10/+23
| | | | | | | and add a -g flag to use the new .GOV NIC. Also convert the SEE ALSO reference into a proper bibliographic one. PR: 9802 (in part)
* Added "SVR4" as an acceptable brandnewton1999-01-301-2/+2
|
* Typo.billf1999-01-281-2/+2
| | | | | PR: docs/9752 Submitted by: horikawa@jp.FreeBSD.org
* Use __XSTRING() from cdefs.h instead of rolling my own.eivind1999-01-251-7/+1
|
* I may have forgotten to upgrade this value, but that will never happeneivind1999-01-231-6/+8
| | | | again. (Fully clone the value of __FreeBSD__ from the compiler.)
* __FreeBSD__ is also used here.jhay1999-01-231-1/+3
| | | | | Forgotten by: Lots of people. Pointed out by: make world.
* Back out the new crypt(3) stuff untill we can go through an independantmarkm1999-01-232-154/+31
| | | | "make world" to make sure everything works properly.
* Added support for multiple hash formats, and new salt generation code.brandon1999-01-222-31/+154
| | | | | | | | | It selects which hash format to use by checking /etc/auth.conf for auth_default. Leaving auth_default disabled will give the current behaviour (use the same format as is currently used in the password, or if a new password default to what crypt likes best--des if it exists). Now you can set it to one of: des, best, md5 or sha1. best is a synonym for sha1, currently.
* Use the new variable NEED_LIBNAMES instead of includingjdp1999-01-221-2/+2
| | | | <bsd.libnames.mk> explicitly.
* Force <bsd.libnames.mk> to be included, regardless of the objectjdp1999-01-221-1/+2
| | | | | format. This fixes the undefined symbols when building login for a.out.
* Make top use new kvm_getswapinfo() call.dillon1999-01-221-144/+19
|
* Fix labeling bugdillon1999-01-221-1/+3
|
* Make systat -swap use new kvm_swapinfo() functiondillon1999-01-221-137/+57
|
* Euro support, part 2.imp1999-01-216-2/+345
| | | | | | | | | This should be merged into RELENG_3 and a similar patch may be needed for RELENG_2_2, should that deemed necessary. Make world succeeded with these patches in my tree. Submitted by: "Kaleb S. KEITHLEY" <kaleb@ics.com>
* Allow login to be linked statically even when PAM is used, sincejdp1999-01-201-4/+2
| | | | there is now a static version of libpam.
* Add support for accessing ports. This was done to access parallelimp1999-01-201-4/+19
| | | | | | ports, but should work for others as well. Submitted by: Parag Patel <parag@cgt.com>
* Add a compile knob to avoid using PAM code (login will use standard Unixabial1999-01-192-4/+22
| | | | | | | authentication only). This comes handy when you're tight on space. Submitted by: mostly John Baldwin <jobaldwi@vt.edu> Reviewed by: John D. Polstra <jdp@polstra.com>
* Replace 'long int' with 'int' for Alpha.simokawa1999-01-191-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This change should have no effect on i386. Pointed out by: Steve Kargl <sgk@troutmask.apl.washington.edu> Quote from http://www.netlib.org/f2c/readme: NOTE: f2c.h defines several types, e.g., real, integer, doublereal. The definitions in f2c.h are suitable for most machines, but if your machine has sizeof(double) > 2*sizeof(long), you may need to adjust f2c.h appropriately. f2c assumes sizeof(doublecomplex) = 2*sizeof(doublereal) sizeof(doublereal) = sizeof(complex) sizeof(doublereal) = 2*sizeof(real) sizeof(real) = sizeof(integer) sizeof(real) = sizeof(logical) sizeof(real) = 2*sizeof(shortint) EQUIVALENCEs may not be translated correctly if these assumptions are violated. On machines, such as those using a DEC Alpha processor, on which sizeof(short) == 2, sizeof(int) == sizeof(float) == 4, and sizeof(long) == sizeof(double) == 8, it suffices to modify f2c.h by removing the first occurrence of "long " on each line containing "long ", e.g., by issuing the commands mv f2c.h f2c.h0 sed 's/long //' f2c.h0 >f2c.h On such machines, one can enable INTEGER*8 by uncommenting the typedef of longint in f2c.h, so it reads typedef long longint; by compiling libI77 with -DAllow_TYQUAD, and by adjusting libF77/makefile as described in libF77/README.
* Fixed breakage of `make checkdpadd' in previous commit.bde1999-01-191-4/+4
| | | | | | | | | | Didn't fix related bogotification from moving the definitions of DPADD and LDADD to here. Setting these variables in a top-level directory gives bogus dependencies in library subdirectories. E.g., there is a dependency on `foo.so..' where the double dots separate null shared library version numbers. Set BINDIR properly by inheriting it from ../Makefile.inc.
* "19%02", tm.year -> "%d", tm.year+1900danny1999-01-181-2/+2
|
* Allow two digit years 1969-2068danny1999-01-181-3/+6
|
* Fix "make world" breakage because MT_RTABLE was still referenced here.roberto1999-01-181-1/+3
|
* Update to Global-3.42.simokawa1999-01-186-30/+28
|
* Don't use ip_mrtproto to determine whether multicast routing is infenner1999-01-183-83/+32
| | | | | | | | the kernel; this was left over from the earlier protocol-dependent kernel multicast routing code. Learn how to handle the malloc'd multicast routing table (instead of expecting it to be in mbufs)
* Fix logic error in RFC 850 kluge.wollman1999-01-151-3/+4
|
* For RFC 850 dates received in HTTP responses, implement the century pivotwollman1999-01-152-4/+48
| | | | described in RFC 2068. Include a reference to same in the manual page.
* Typo.jmz1999-01-152-4/+4
|
* Allocate aligned memory according to sizeof(char *).simokawa1999-01-131-2/+2
| | | | | Approved by: jkh Obtained from: NetBSD
OpenPOWER on IntegriCloud