summaryrefslogtreecommitdiffstats
path: root/sys
Commit message (Expand)AuthorAgeFilesLines
* chase more of the MIN/MAX mess. *sigh*alfred2003-02-022-0/+4
* Catch more uses of MIN().alfred2003-02-025-12/+0
* remove MIN now that it's a standard kernel definealfred2003-02-022-3/+0
* Consolidate MIN/MAX macros into one place (param.h).alfred2003-02-0224-64/+0
* Correct error message.nyan2003-02-021-1/+1
* Add a bio_disk pointer for use between geom_disk and the device drivers.phk2003-02-022-2/+4
* We don't need sscopen() and sscclose().phk2003-02-021-53/+9
* Export IA32 from opt_ia32.h to assembly so that we can eliminatemarcel2003-02-022-0/+16
* Use hz if stathz is zero. Adopted from sched_4bsd.scottl2003-02-021-1/+3
* - It's more accurate to say that vm_paging_needed() returns TRUEalc2003-02-022-3/+4
* Unlock the mutex in the error case in wi_init. Otherwise we can returnimp2003-02-021-0/+1
* Add device zs to GENERIC on powerpc.benno2003-02-021-0/+1
* Regenerate after fixing duplicate device entries.marcel2003-02-022-12/+5
* Unbreak kernel builds caused by what appears to be a merge conflict.marcel2003-02-021-2/+1
* - Convert vm_pageout()'s tsleep()s to msleep()s with the page queue lock.alc2003-02-021-2/+5
* Regensanpei2003-02-012-14/+49
* Add Genesys Logic productssanpei2003-02-011-0/+6
* Remove special casing for running in the simulator from the kernelmarcel2003-02-0134-451/+1419
* - Remove (some) unnecessary explicit initializations to zero.alc2003-02-011-8/+5
* SSC calls use break immediate 0x80000. 0x80001 only works formarcel2003-02-012-2/+2
* - Convert the tsleep()s in vm_wait() and vm_waitpfault() to msleep()salc2003-02-011-3/+10
* Put replace spaces with tabs in keeping with the rest of the file.joe2003-02-016-6/+6
* add PST to i386 notes.phk2003-02-011-0/+5
* Define new malloc type M_FW and use it.simokawa2003-02-018-76/+81
* Fix some typos in 3 comments.gj2003-02-011-4/+5
* - replace timeout with callout_*.simokawa2003-02-016-53/+51
* Reversion of commit by Davidxu plus fixes since applied.julian2003-02-0150-1679/+1532
* Check status FIFO more closely to report error.simokawa2003-02-011-11/+43
* Eliminate the sc_openmask, ccdopen() and ccdclose() functions, wephk2003-02-013-93/+12
* NO_GEOM cleanup: don't #include <sys/diskslice.h>phk2003-02-011-1/+0
* Under #ifdef DIAGNOSTIC, fill malloc(9) allocations which do not havephk2003-02-011-0/+8
* Under DIAGNOSTIC, only report expensive timeouts if they are more expensivephk2003-02-011-1/+2
* Add basic support for device wiring down to specific (CAM)simokawa2003-02-011-4/+55
* Move configuration of geom/providers into its own function in preparationphk2003-02-011-36/+65
* Build glue for zs_macio.benno2003-02-011-1/+1
* MacIO frontend for the zs driver.benno2003-02-011-0/+296
* - Introduce a flags value into the interrupt handler structure.benno2003-02-012-7/+11
* Sort device list by eui64 in acendent order correctly.simokawa2003-02-011-12/+12
* Move a comment and optimize the frag timeout code a slight bit.silby2003-02-011-3/+3
* Regen.shiba2003-02-011-4/+4
* Allied Telesis WR211PCM(wi) and Corega PCC-T(ed) haveshiba2003-02-011-1/+1
* - add pmap_pagedaemon_waken variablegrehan2003-02-013-141/+288
* Add deviceids for 6105 and 6105M chips. Further changes will be necessarysilby2003-02-014-0/+12
* Switch the if_vr driver from using our generic MII routines over tosilby2003-02-014-0/+186
* Make nirq mean 'number of irqs' and not 'last irq'.benno2003-02-011-5/+5
* Only add one tick per tick to the thread stats, instead of some random number.julian2003-01-312-4/+4
* Remove commented out g_enc_dos_partition(). We won't be needing it.phk2003-01-311-18/+0
* Correct handling of locking for chroot() and chdir() cases: ratherrwatson2003-01-312-14/+16
* Add PCI id for Quatech SSCLP-200/300 lowprofile single-port RS422/485 card.phk2003-01-311-0/+7
* SCSI Changers, SCSI Tapes, and SES devices work just about as well asmjacob2003-01-311-3/+3
OpenPOWER on IntegriCloud