summaryrefslogtreecommitdiffstats
path: root/sys
Commit message (Expand)AuthorAgeFilesLines
* Use a real malloc type for M_LINKER instead of #defining it as M_TEMP.bde1998-01-011-1/+2
* Use a real malloc type for M_LINKER instead of #defining it as M_TEMP.bde1998-01-011-3/+5
* Moved the SMP declarations of INTREN() and INTRDIS() to the correct header,bde1998-01-015-11/+9
* Fixed missing initialization of mp->mnt_stat. At least vm depends onbde1998-01-016-6/+12
* Explain that MAXMEM maynot be nessicary for detection of >64MB RAM.obrien1997-12-313-15/+24
* A Happy New Year! 1998.wosch1997-12-311-3/+3
* Reviewed by: Amancio Hastyahasty1997-12-312-8/+40
* caddr_t --> void *alex1997-12-312-16/+16
* Convert caddr_t --> void * for sys/mman.h functions.alex1997-12-312-13/+13
* - Accept all models of the HP C1553A tape series as usable tapes. Thisnate1997-12-301-2/+2
* Fix a race condition I introduced.phk1997-12-301-5/+17
* Fixed a missing/misplaced/misstyled prototype.bde1997-12-304-8/+8
* move punchline of joke up to rest of joke. (got moved by useful edits)julian1997-12-301-5/+5
* Fix a include gottcha in the SMP case.phk1997-12-291-2/+2
* Add the vnode interlock back around vref.dyson1997-12-292-2/+18
* Add the vnode interlock back around vget.dyson1997-12-291-8/+2
* Sync with sys/i386/conf/options.i386 revision 1.66.kato1997-12-292-4/+4
* Sync with sys/i386/i386/microtime.s revision up to 1.39.kato1997-12-291-10/+7
* Sync with sys/i386/isa/clock.c revision up to 1.107.kato1997-12-293-144/+114
* Sync with sys/i386/isa/sio.c revision up to 1.193.kato1997-12-292-10/+50
* Sync with sys/i386/i386/userconfig.c revision 1.99.kato1997-12-291-29/+13
* Fixed style bugs in previous commit.bde1997-12-291-3/+3
* If available, use the device's LOGICAL blocksize as reported byjulian1997-12-291-53/+69
* Fix the decl of vfs_ioopt, allow LFS to compile again, fix a minor problemdyson1997-12-296-15/+19
* Lots of improvements, including restructring the caching and managementdyson1997-12-2922-476/+265
* Add back a #include <sys/types.h> so that this header issteve1997-12-282-0/+2
* More cleanup relating to our use of the TSC.phk1997-12-289-240/+164
* wash, sort and put in order various nits from the i586_ctr -> tscphk1997-12-2816-100/+102
* back out previous commitjulian1997-12-281-24/+13
* Merge from sys/i386/i386/microtime.s revision 1.36.kato1997-12-281-14/+11
* Move the sector size check to the right place,julian1997-12-281-14/+25
* Fixed initialization of the divisor latch. We depended on siocnopen()bde1997-12-283-6/+63
* YAMFsio.c (always call ttwwakeup() before returning from comstart()).bde1997-12-283-3/+6
* Always call ttwwakeup() before returning from comstart(). It isn'tbde1997-12-283-3/+6
* Removed unnecessary (and broken) wakeup code in rpstart(). There is nobde1997-12-282-30/+0
* Removed stale comment about printf's deficiencies and rewrote the codebde1997-12-281-29/+13
* Handle "%...p" as "%#...x" instead of "0x%...x". This is a quick fixbde1997-12-281-3/+2
* Unspammed nested include of <sys/malloc.h>. <sys/mbuf.h> hasn'tbde1997-12-281-8/+3
* Restored used include of <sys/malloc.h>. malloc() is not usedbde1997-12-281-21/+22
* Update comment to match updated sb0 line (conflicts keyword no longer neededjkh1997-12-283-12/+3
* Bring back part of rev 1.44 which was commented out by rev 1.58.alex1997-12-271-7/+8
* Unspammed nested include of <vm/vm_zone.h>.bde1997-12-271-3/+1
* Back out previous commit, the so-called "unused code" was most definatelypeter1997-12-272-2/+6
* Unspammed nested include of <vm/vm_zone.h>.bde1997-12-2726-29/+56
* #include "opt_user_ldt.h" so that the #ifdef USER_LDT checks can work, aspeter1997-12-276-6/+12
* Change major number to match the one actually used (whoops!).jkh1997-12-262-2/+2
* Rename "i586_ctr" to "tsc" (both upper and lower case instances).phk1997-12-2622-290/+290
* ename "i586_ctr" to "tsc" (both upper and lower case instances).phk1997-12-265-13/+13
* Reorder to a more conventional if/then/else/endif structure.phk1997-12-261-14/+11
* Fix some breakage that prevented the Plasmon burners from being usedjoerg1997-12-261-67/+66
OpenPOWER on IntegriCloud