summaryrefslogtreecommitdiffstats
path: root/sys
Commit message (Expand)AuthorAgeFilesLines
* More cleanup relating to our use of the TSC.phk1997-12-289-240/+164
* wash, sort and put in order various nits from the i586_ctr -> tscphk1997-12-2816-100/+102
* back out previous commitjulian1997-12-281-24/+13
* Merge from sys/i386/i386/microtime.s revision 1.36.kato1997-12-281-14/+11
* Move the sector size check to the right place,julian1997-12-281-14/+25
* Fixed initialization of the divisor latch. We depended on siocnopen()bde1997-12-283-6/+63
* YAMFsio.c (always call ttwwakeup() before returning from comstart()).bde1997-12-283-3/+6
* Always call ttwwakeup() before returning from comstart(). It isn'tbde1997-12-283-3/+6
* Removed unnecessary (and broken) wakeup code in rpstart(). There is nobde1997-12-282-30/+0
* Removed stale comment about printf's deficiencies and rewrote the codebde1997-12-281-29/+13
* Handle "%...p" as "%#...x" instead of "0x%...x". This is a quick fixbde1997-12-281-3/+2
* Unspammed nested include of <sys/malloc.h>. <sys/mbuf.h> hasn'tbde1997-12-281-8/+3
* Restored used include of <sys/malloc.h>. malloc() is not usedbde1997-12-281-21/+22
* Update comment to match updated sb0 line (conflicts keyword no longer neededjkh1997-12-283-12/+3
* Bring back part of rev 1.44 which was commented out by rev 1.58.alex1997-12-271-7/+8
* Unspammed nested include of <vm/vm_zone.h>.bde1997-12-271-3/+1
* Back out previous commit, the so-called "unused code" was most definatelypeter1997-12-272-2/+6
* Unspammed nested include of <vm/vm_zone.h>.bde1997-12-2726-29/+56
* #include "opt_user_ldt.h" so that the #ifdef USER_LDT checks can work, aspeter1997-12-276-6/+12
* Change major number to match the one actually used (whoops!).jkh1997-12-262-2/+2
* Rename "i586_ctr" to "tsc" (both upper and lower case instances).phk1997-12-2622-290/+290
* ename "i586_ctr" to "tsc" (both upper and lower case instances).phk1997-12-265-13/+13
* Reorder to a more conventional if/then/else/endif structure.phk1997-12-261-14/+11
* Fix some breakage that prevented the Plasmon burners from being usedjoerg1997-12-261-67/+66
* The ioopt code is still buggy, but wasn't fully disabled.dyson1997-12-251-2/+3
* Make kern.ncpu reports the number of detected processors when runninggpalmer1997-12-251-1/+8
* The spl fixes in in_setsockaddr and in_setpeeraddr that were meant todg1997-12-251-11/+17
* Support running with inadequate swap space. Additionally, the codedyson1997-12-242-8/+16
* - Add prototype for adjust_timeout_calltodo().nate1997-12-241-1/+5
* Add a PARITITON arg to SCSI_MKFIXED, and use it tobrian1997-12-232-5/+10
* This patch causes the "calltodo" timer list to be decremented by the amountnate1997-12-235-7/+236
* Document `flags' for the psm driver.yokota1997-12-233-3/+33
* Removed unnecessary setting of 'error' -- binding to a privileged portalex1997-12-231-2/+2
* Improve my copyright.dyson1997-12-221-11/+4
* Improve my copyright.dyson1997-12-221-9/+2
* Correct my previous fix for the UPAGES problem.dyson1997-12-222-10/+6
* Hopefully fix the problem with the TLB not being updated correctly.dyson1997-12-222-10/+14
* Properly clean out the SI_MOUNTEDON flag iff the mount attempt failsjoerg1997-12-212-2/+4
* Moved some declarations from <sys/socket.h> to the correct places, andbde1997-12-214-11/+15
* I added vfs_ioopt prematurely, disabled.dyson1997-12-211-2/+2
* Duplicate the entry for the Plasmon CD-R device, so both possibilitiesjoerg1997-12-201-4/+7
* Protect against a null pointer dereferencation in the case of anjoerg1997-12-201-1/+12
* Add a copyright and license notice, on Jordan's request.sef1997-12-201-1/+33
* Remove bogus #ifdef INET - SLIP doesn't compile without INET.eivind1997-12-201-3/+1
* Make the class code checks in function pci_cfgcheck less strict.se1997-12-206-12/+12
* Clear the p_stops field on change of user/group id, unless the correctsef1997-12-206-27/+58
* Sync with sys/i386/conf/Makefile.i386 revision 1.106.kato1997-12-202-6/+8
* Ifdefed some conditionally used declarations.bde1997-12-202-2/+6
* Removed a stray semicolon.bde1997-12-201-2/+1
* Added a used include.bde1997-12-204-24/+36
OpenPOWER on IntegriCloud