summaryrefslogtreecommitdiffstats
path: root/sys
Commit message (Expand)AuthorAgeFilesLines
* Split the global timezone structure into two integer fields tophk2003-02-0316-40/+40
* Remove unintended growth of bt848_card_signature.orion2003-02-031-1/+1
* Split statclock into statclock and profclock, and made the method for drivingjake2003-02-0334-254/+389
* Add IPv6 support for Linuxlator.ume2003-02-034-90/+379
* Break out the bind and connect syscalls to intend to make callingume2003-02-032-15/+44
* Add config glue to add an optional GEOM_VOL to add optional volume support.gordon2003-02-033-0/+3
* Correct a comment. GEOM modules do not create /dev entries. They creategordon2003-02-031-2/+2
* Add the GEOM module that makes volume labels useful. A kernel compiled withgordon2003-02-031-0/+146
* No need to lock Giant around call to nanosleep1() in nanosleep().tjr2003-02-031-2/+0
* Avoid zero padding when feeding read channels. chn_rdfeed has no wayorion2003-02-031-0/+4
* Avoid holding Giant across copyout() in gettimeofday() and getitimer().tjr2003-02-031-4/+4
* Add CanBe power management controller support.nyan2003-02-0311-2/+813
* Park & Miller PRNG can be safely initialized with any value but 0 and stuckache2003-02-031-2/+4
* Remove unnecessary M_NOWAIT.simokawa2003-02-032-8/+7
* Use vaccess() instead of rolling our own access checks. This fixes a bugtjr2003-02-031-12/+6
* Add missing 'static'.simokawa2003-02-031-2/+2
* - Take malloc type as an argument in fw_xfer_alloc().simokawa2003-02-037-41/+52
* Make the variable types, the sysctl macros and the sysctl handler forharti2003-02-032-10/+10
* - Make some context switches conditional on SCHED_STRICT_RESCHED. This mayjeff2003-02-031-62/+146
* Remove mono encodings from vchan format and mixer description. Fixesorion2003-02-031-2/+0
* - Stop abusing oncpu for our cpu binding. Define a scheduler local elementjeff2003-02-031-11/+14
* Print ac97 name/id on normal boot.orion2003-02-031-6/+9
* Don't use the 'c' partition for mounting root. A disklabel is verymarcel2003-02-031-2/+1
* - Make allpmaps static.alc2003-02-032-6/+8
* Some small enhancmentsambrisko2003-02-022-64/+70
* Add the TCP flags to the log message whenever log_in_vain is 1, notcjc2003-02-022-16/+6
* Set si_drv1 to our softc for all the six dev_t's we create for a serial port.phk2003-02-021-0/+2
* Tweak the definition of the EV_SET macro so that it evaluates eachnectar2003-02-021-1/+2
* A minor stylistic change to make it more clear to lint-like tools.phk2003-02-021-2/+2
* Add BCTV3/PCI entry.orion2003-02-023-67/+95
* chase more of the MIN/MAX mess. *sigh*alfred2003-02-022-0/+4
* Catch more uses of MIN().alfred2003-02-025-12/+0
* remove MIN now that it's a standard kernel definealfred2003-02-022-3/+0
* Consolidate MIN/MAX macros into one place (param.h).alfred2003-02-0224-64/+0
* Correct error message.nyan2003-02-021-1/+1
* Add a bio_disk pointer for use between geom_disk and the device drivers.phk2003-02-022-2/+4
* We don't need sscopen() and sscclose().phk2003-02-021-53/+9
* Export IA32 from opt_ia32.h to assembly so that we can eliminatemarcel2003-02-022-0/+16
* Use hz if stathz is zero. Adopted from sched_4bsd.scottl2003-02-021-1/+3
* - It's more accurate to say that vm_paging_needed() returns TRUEalc2003-02-022-3/+4
* Unlock the mutex in the error case in wi_init. Otherwise we can returnimp2003-02-021-0/+1
* Add device zs to GENERIC on powerpc.benno2003-02-021-0/+1
* Regenerate after fixing duplicate device entries.marcel2003-02-022-12/+5
* Unbreak kernel builds caused by what appears to be a merge conflict.marcel2003-02-021-2/+1
* - Convert vm_pageout()'s tsleep()s to msleep()s with the page queue lock.alc2003-02-021-2/+5
* Regensanpei2003-02-012-14/+49
* Add Genesys Logic productssanpei2003-02-011-0/+6
* Remove special casing for running in the simulator from the kernelmarcel2003-02-0134-451/+1419
* - Remove (some) unnecessary explicit initializations to zero.alc2003-02-011-8/+5
* SSC calls use break immediate 0x80000. 0x80001 only works formarcel2003-02-012-2/+2
OpenPOWER on IntegriCloud