summaryrefslogtreecommitdiffstats
path: root/sys/net
Commit message (Expand)AuthorAgeFilesLines
* In raw and raw-derived socket types, maintain and enforce invariant thatrwatson2006-04-011-19/+7
* Chance protocol switch method pru_detach() so that it returns voidrwatson2006-04-013-30/+24
* Change protocol switch pru_abort() API so that it returns void ratherrwatson2006-04-012-9/+4
* Add IFF_NEEDSGIANT to kernel PPP support. I have no idea why this wasn'trwatson2006-03-301-1/+1
* Assert that the mbuf is not shared to ensure problems like the last commit arethompsa2006-03-261-0/+3
* m_dup () packet not m_copypacket () since we will modify it. For morerik2006-03-231-2/+11
* No direct call to carp_ifdetach() anymore. It is called byglebius2006-03-211-6/+0
* Add kqueue(2) support on if_tap(4) interfaces. While I'm here, replaceemax2006-03-161-60/+153
* Add link status descriptions and related structures for userlandandre2006-03-151-0/+38
* - Fill in the correct rtm_index for RTM_ADD and RTM_CHANGE messages.andre2006-03-152-1/+15
* Don't acquire a lock before calling vlan_unconfig().ru2006-03-091-2/+0
* If we miss the LINK_UP event from the network interface then the bridge portthompsa2006-03-062-13/+11
* Unbreak byte counters when network interfaces are in monitor mode bycsjp2006-03-031-8/+8
* Since we are using random ethernet addresses for the bridge, it is possiblethompsa2006-03-031-6/+21
* Slightly re-worked bpf(4) code associated with bridging: if we have acsjp2006-03-031-10/+26
* Fix up the Bridge Identifier field in the BPDU packet.thompsa2006-02-281-15/+30
* This patch fixes a problem, which exists if you have IPSEC in your kernelwkoszek2006-02-271-0/+2
* Don't to forget to unlock the rwlock on trunk before destroying it.yar2006-02-241-2/+3
* Fix build.glebius2006-02-151-2/+2
* - Introduce ifmedia_baudrate(), which returns correct baudrate of theglebius2006-02-142-2/+82
* Bump the MODULE_VERSION for HEAD, as the vlan(4) API is different inemaste2006-02-101-1/+1
* Avoid frobbing IFF_UP at any cost (which is close toyar2006-02-101-2/+0
* Add a MODULE_VERSION so that other modules (perhaps third-party) canemaste2006-02-091-0/+1
* The code in rn_walktree_from() that checks if we backed up too farqingli2006-02-071-1/+9
* Remove two unnecessary type casts, of which both had a typo inqingli2006-02-071-2/+2
* Properly initialize args structure before passing it to ipfw_chk(): havingoleg2006-02-032-0/+2
* In vlan_config() first call vlan_inithash(), then lock mutex, becauseglebius2006-02-021-4/+6
* define lock.h before rwlock.h for DEBUG_LOCKScsjp2006-02-021-0/+1
* Implement SIOCGIFCONF for 32bit binaries.ps2006-02-022-0/+31
* Use PFIL_HOOKED macros in if_bridge and pass the right argument tocsjp2006-02-021-10/+10
* Somewhat re-factor the read/write locking mechanism associated with the packetcsjp2006-02-022-111/+33
* Fix two bugs with the bridgethompsa2006-01-311-3/+17
* Set IFF_BROADCAST and IFF_MULTICAST on vlan interfaces from theyar2006-01-311-2/+5
* Merge the //depot/user/yar/vlan branch into CVS. It contains some collectiveglebius2006-01-306-130/+480
* Add some initial locking to gif(4). It doesn't covers the whole driver,glebius2006-01-302-25/+22
* Make sure buffers in if_bridge are fully initialized before copyingcperciva2006-01-251-0/+3
* Be consistent in checking ifa->ifa_addr for NULL.yar2006-01-231-1/+1
* Fix stack corruptions on amd64.bz2006-01-211-2/+2
* Return mbuf pointer or NULL from ip_fastforward() as the mbuf pointerandre2006-01-187-8/+8
* Add code that clears certain capabilities from the member interface, these arethompsa2006-01-142-10/+51
* Check the right ifnet pointer to see if if_alloc() failed or not inrwatson2006-01-131-1/+3
* When freeing the chain of if_ef devices on an aborted load, userwatson2006-01-131-2/+2
* Get rid of the bogus IFP2FC() macro and use IFP2FWC(). IFP2FC()brooks2006-01-111-7/+5
* Add a new leaf to the net.link.generic.ifdata.%d sysctl to retrieveharti2006-01-042-1/+19
* Correctly check the filter length. I committed the wrong version.jkim2006-01-031-1/+6
* - Explicitly validate an empty filter to match bpf_filter() comment[1].jkim2006-01-031-1/+1
* Fix a brain-o in the last commit, the conditional was always false.thompsa2006-01-021-1/+1
* Reorganise bridge_rtupdate slightly to reduce duplication.thompsa2006-01-021-3/+2
* Reset the route expiry time on each update rather than always letting them getthompsa2006-01-021-4/+3
* It is better to use time_uptime here since it is monotonic.thompsa2006-01-021-5/+5
OpenPOWER on IntegriCloud