summaryrefslogtreecommitdiffstats
path: root/sys/ia64
Commit message (Expand)AuthorAgeFilesLines
* Made the prototypes for pmap_kenter and pmap_kremove MD. These functionsjake2003-03-161-0/+2
* Bah, get it right this time and add sys/lock.h before sys/mutex.h.mux2003-03-141-0/+1
* Oops, add missing includes. Pass me the pointy hat.mux2003-03-141-0/+1
* Grab Giant around calls to contigmalloc() and contigfree() somux2003-03-131-1/+8
* Memory allocated with contigmalloc() should be freed withmux2003-03-131-1/+4
* Fix two rounds of breakages and cleanup. Remove the sccdebug sysctlmarcel2003-03-101-55/+11
* Centralize the devstat handling for all GEOM disk device driversphk2003-03-082-10/+1
* Fix threaded applications on ia64 that are linked dynamicly. We didmarcel2003-03-051-1/+2
* ABI breaker: Move the J_SIGMASK field in the jmpbuf beforemarcel2003-03-051-3/+2
* Replace calls to WITNESS_SLEEP() and witness_list() with equivalent callsjhb2003-03-041-13/+4
* Gigacommit to improve device-driver source compatibility betweenphk2003-03-032-26/+17
* MFi386 revision 1.88alc2003-03-011-3/+0
* Needn't kse.hdavidxu2003-02-271-1/+0
* Change the process flags P_KSES to be P_THREADED.julian2003-02-271-1/+1
* Correctly set BUS_SPACE_MAXSIZE in all the busdma backends.mux2003-02-262-2/+2
* Cleanup of the d_mmap_t interface.mux2003-02-252-8/+3
* Change the console interface to pass a "struct consdev *" instead of aphk2003-02-201-5/+5
* Back out M_* changes, per decision of the TRB.imp2003-02-196-14/+14
* Fix missed patch in last commitjulian2003-02-172-10/+6
* Move a bunch of flags from the KSE to the thread.julian2003-02-173-16/+11
* Define _ALIGNBYTES to be 15. This should have been done right away.marcel2003-02-171-1/+1
* Print two new processor features:marcel2003-02-171-2/+4
* - Split the struct kse into struct upcall and struct kse. struct kse willjeff2003-02-171-1/+1
* - Move ke_sticks, ke_iticks, ke_uticks, ke_uu, ke_su, and ke_iu back intojeff2003-02-171-3/+3
* Remove #include <sys/dkstat.h>phk2003-02-161-1/+0
* Fix misuse of Maxmem in the calculation of the VHPT size. Maxmemmarcel2003-02-151-1/+1
* Fix the style of the SCHED_4BSD commit.obrien2003-02-131-1/+1
* MFi386alc2003-02-131-8/+2
* Implement fpclassify():mike2003-02-082-0/+4
* Fix a problem in bus_dmamap_load_{mbuf,uio} when the first mbuf or the firstharti2003-02-041-11/+16
* Split statclock into statclock and profclock, and made the method for drivingjake2003-02-032-10/+20
* Don't use the 'c' partition for mounting root. A disklabel is verymarcel2003-02-031-2/+1
* Consolidate MIN/MAX macros into one place (param.h).alfred2003-02-021-2/+0
* We don't need sscopen() and sscclose().phk2003-02-021-53/+9
* Export IA32 from opt_ia32.h to assembly so that we can eliminatemarcel2003-02-022-0/+16
* Remove special casing for running in the simulator from the kernelmarcel2003-02-0115-428/+66
* Put replace spaces with tabs in keeping with the rest of the file.joe2003-02-011-1/+1
* Reversion of commit by Davidxu plus fixes since applied.julian2003-02-013-5/+5
* Remove D_CANFREE from sscdisk.c.phk2003-01-301-4/+2
* Unbreak SMP cases for these architectures.julian2003-01-271-1/+1
* Move UPCALL related data structure out of kse, introduce a newdavidxu2003-01-262-4/+4
* - Introduce the SCHED_ULE and SCHED_4BSD options for compile time selectionjeff2003-01-262-0/+2
* Fix pmap_extract so that it doesn't panic if the user typesdfr2003-01-241-3/+10
* Remove M_TRYWAIT/M_WAITOK/M_WAIT. Callers should use 0.alfred2003-01-216-13/+13
* - Add a VM_WAIT in the appropriate cases where vm_page_alloc() fails and flagsjeff2003-01-211-7/+15
* Resolve relative relocations in klds before trying to parse the module'sjake2003-01-211-3/+22
* We need neither <sys/diskslice.h> nor <sys/disklabel.h> here.phk2003-01-201-2/+0
* Don't try to free() map in bus_dmamap_destroy() when it'smux2003-01-181-1/+1
* Merge all the various copies of vm_fault_quick() into a singledillon2003-01-161-16/+0
* Merge all the various copies of vmapbuf() and vunmapbuf() into a singledillon2003-01-151-69/+0
OpenPOWER on IntegriCloud