summaryrefslogtreecommitdiffstats
path: root/sys/i386
Commit message (Expand)AuthorAgeFilesLines
* Define integer types added by POSIX.1g. We already had int8_t, int16_t,alex1998-01-081-1/+4
* Added accent (dead) key support to syscons and kbdcontrol.yokota1998-01-073-7/+393
* documentation changes.jamil1998-01-061-4/+5
* Make our v_usecount vnode reference count work identically to thedyson1998-01-061-1/+2
* sigh....forgot to update the DEBUG printfjmb1998-01-051-3/+3
* length argument to truncate() in linux emulationjmb1998-01-051-1/+2
* AMD calls the PR166 and PR200, models 2 and 3 respectively.obrien1998-01-031-3/+3
* Update AMD URL for CPU recognition docs.obrien1998-01-031-2/+3
* Fix typo. Option `CPU_SUSP_HLT' didn't work on Cyrix 486DX box.kato1998-01-031-3/+3
* Don't try to call into BIOS32 handlers outside the normal ROMmsmith1998-01-011-2/+2
* Fixed cosmetic bugs:bde1998-01-011-34/+32
* Removed unused #includes.bde1998-01-011-5/+0
* Moved the SMP declarations of INTREN() and INTRDIS() to the correct header,bde1998-01-012-4/+4
* Explain that MAXMEM maynot be nessicary for detection of >64MB RAM.obrien1997-12-312-10/+16
* Fix a race condition I introduced.phk1997-12-301-5/+17
* Fix a include gottcha in the SMP case.phk1997-12-291-2/+2
* Add back a #include <sys/types.h> so that this header issteve1997-12-281-0/+1
* More cleanup relating to our use of the TSC.phk1997-12-285-107/+73
* wash, sort and put in order various nits from the i586_ctr -> tscphk1997-12-288-47/+47
* Fixed initialization of the divisor latch. We depended on siocnopen()bde1997-12-281-2/+21
* YAMFsio.c (always call ttwwakeup() before returning from comstart()).bde1997-12-281-1/+2
* Always call ttwwakeup() before returning from comstart(). It isn'tbde1997-12-281-1/+2
* Removed unnecessary (and broken) wakeup code in rpstart(). There is nobde1997-12-281-15/+0
* Removed stale comment about printf's deficiencies and rewrote the codebde1997-12-281-29/+13
* Update comment to match updated sb0 line (conflicts keyword no longer neededjkh1997-12-282-8/+2
* Back out previous commit, the so-called "unused code" was most definatelypeter1997-12-271-1/+3
* Unspammed nested include of <vm/vm_zone.h>.bde1997-12-271-1/+2
* #include "opt_user_ldt.h" so that the #ifdef USER_LDT checks can work, aspeter1997-12-272-2/+4
* Change major number to match the one actually used (whoops!).jkh1997-12-261-1/+1
* Rename "i586_ctr" to "tsc" (both upper and lower case instances).phk1997-12-269-93/+93
* ename "i586_ctr" to "tsc" (both upper and lower case instances).phk1997-12-263-8/+8
* Reorder to a more conventional if/then/else/endif structure.phk1997-12-261-14/+11
* This patch causes the "calltodo" timer list to be decremented by the amountnate1997-12-232-4/+32
* Document `flags' for the psm driver.yokota1997-12-232-2/+22
* Correct my previous fix for the UPAGES problem.dyson1997-12-221-5/+3
* Hopefully fix the problem with the TLB not being updated correctly.dyson1997-12-221-5/+7
* Make the class code checks in function pci_cfgcheck less strict.se1997-12-204-8/+8
* Augment $PATH to ensure searching of /sbin and /usr/sbin for sysctlbde1997-12-181-3/+4
* Add missing references to Xcpuast, get_isrlock and checkstate_probed_cpuspeter1997-12-181-1/+4
* Regenerate (fix argument of linux_nice).kato1997-12-173-4/+4
* I should not edit linux_prot.h directly. Fix the argument of linux_nice.kato1997-12-171-2/+2
* Make hidden COMPAT_43 dependencies explict. Options in headers is aeivind1997-12-162-1/+5
* Make COMPAT_43 and COMPAT_SUNOS new-style options.eivind1997-12-168-9/+28
* Throw options IPX, IPXIP and IPTUNNEL into opt_ipx.h.eivind1997-12-158-8/+16
* As described by the submitter:msmith1997-12-152-1/+70
* Add support for low resolution SMP kernel profiling.tegge1997-12-1510-16/+78
* Don't forward hardclock or statclock to stopped cpus. Disable forwardingtegge1997-12-153-30/+51
* As described by the submitter:msmith1997-12-141-2/+147
* After one of my analysis passes to evaluate methods for SMP TLB mgmt, Idyson1997-12-145-14/+93
* Add needed #include.tegge1997-12-123-3/+12
OpenPOWER on IntegriCloud