summaryrefslogtreecommitdiffstats
path: root/share
Commit message (Expand)AuthorAgeFilesLines
* Hiten's patchset for section four manpages, slightly edited by me.ru2003-06-2860-792/+1294
* Punctuation.ru2003-06-281-1/+1
* correct bus-isicty of D-Link cardssam2003-06-281-2/+2
* Add reference to CAM.simokawa2003-06-281-1/+2
* Add documentation for watchdogd_enable setting.smkelly2003-06-281-0/+9
* typosam2003-06-261-2/+2
* - Add a software watchdog facility.smkelly2003-06-262-0/+78
* Be consistent about the use of ${LDFLAGS} for the internal rules. Somepeter2003-06-261-10/+10
* 'options atm' should actually read 'device atm'.harti2003-06-252-2/+2
* This is the man page for the netgraph ATM node.harti2003-06-252-0/+354
* Backout part of my previous commit dealing with bus_dmasync_op_tmux2003-06-251-1/+6
* Replace lat-amer.kbd with two keyboardsache2003-06-234-4/+122
* attach Atheros manual pages to the buildsam2003-06-231-0/+2
* manual page for the Atheros Hardware Access Layer modulesam2003-06-231-0/+90
* ath driver manual pagesam2003-06-231-0/+314
* MASTER_SITE_OVERRIDE can list several sites.ru2003-06-231-1/+1
* This is a driver for Fore PCA200E cards that uses busdma and works onharti2003-06-234-0/+110
* Misc fixes from originatorache2003-06-231-10/+35
* add verbage on various failure cases to match the /dev/pci interface.jmg2003-06-231-6/+15
* Update the description of the Netgear MA401 to say Prism-II/2.5;silby2003-06-201-1/+1
* German keymap with dead keys.murray2003-06-193-1/+147
* Add US syscons keymap w/ accents.murray2003-06-193-1/+146
* Add MLINK for busdma(9) to bus_dma(9).hmp2003-06-171-0/+1
* Reference the hatm(4) driver man page.harti2003-06-172-0/+2
* The man page for the Fore/Marconi HE155/622 driver.harti2003-06-172-0/+226
* String the timecounter paper into the build.phk2003-06-171-1/+1
* Re-introduction of the matcd Compact Disc drive driver documentation.uhclem2003-06-171-0/+454
* Reference the new natmip(4) man page.harti2003-06-161-1/+1
* Add my timecounter paper from EuroBSDcon2002phk2003-06-1510-0/+6004
* Name a function argument "mbuf", not "buf", if it isyar2003-06-151-2/+2
* Add missing descriptions of macros M_ALIGN and MH_ALIGN.yar2003-06-151-1/+89
* Add more markup to the mbuf(9) manpage. This includes:yar2003-06-151-92/+239
* Use .Va, not .Fa, to refer to structure members.yar2003-06-151-8/+8
* Catch up man page with reality in rc.d/named.mtm2003-06-141-1/+1
* Put on the core hat and back out all of the CSTD= changes. Core willimp2003-06-141-14/+0
* Remove the old xref to kerberos(1), and replace it with an xref totrhodes2003-06-141-1/+1
* Revert to a known-good state. Anyone desiring to experiment with stricterdes2003-06-141-23/+9
* Build/install the PIC version of libgcc (libcc_pic.a) for use by sharedpeter2003-06-131-0/+1
* We cannot use c99 on amd64 either due to lack of alloca(). libc:strptime()peter2003-06-131-2/+3
* - Document the fact that you can specify several DMA operations tomux2003-06-131-15/+28
* Factor out the description of how to configure a CLIP into its ownharti2003-06-134-29/+130
* Remove the documentation of the raw AAL0 access which has been removed.harti2003-06-131-28/+0
* Make the midway driver use the new ATM phy driver. This allows one toharti2003-06-131-1/+8
* Remove paragraph which describes how we might switch our packet queueinghmp2003-06-121-13/+0
* This is a driver for the physical layer chips used in ATM interfaces.harti2003-06-125-1/+442
* Document the fact that one is allowed to sleep while holding an sx lock.harti2003-06-121-0/+2
* Rename the section 'locking considerations' into 'context'.harti2003-06-121-10/+5
* - Add manpages for the gem and hme ethernet drivers. These were obtainedtmm2003-06-104-0/+205
* Add cross-references to pci(4) and pciconf(8).sheldonh2003-06-101-0/+2
* Remove NOSHLIBS, users can get by with NOPIC.obrien2003-06-101-3/+1
OpenPOWER on IntegriCloud