summaryrefslogtreecommitdiffstats
path: root/share
Commit message (Expand)AuthorAgeFilesLines
* Add MLINK for busdma(9) to bus_dma(9).hmp2003-06-171-0/+1
* Reference the hatm(4) driver man page.harti2003-06-172-0/+2
* The man page for the Fore/Marconi HE155/622 driver.harti2003-06-172-0/+226
* String the timecounter paper into the build.phk2003-06-171-1/+1
* Re-introduction of the matcd Compact Disc drive driver documentation.uhclem2003-06-171-0/+454
* Reference the new natmip(4) man page.harti2003-06-161-1/+1
* Add my timecounter paper from EuroBSDcon2002phk2003-06-1510-0/+6004
* Name a function argument "mbuf", not "buf", if it isyar2003-06-151-2/+2
* Add missing descriptions of macros M_ALIGN and MH_ALIGN.yar2003-06-151-1/+89
* Add more markup to the mbuf(9) manpage. This includes:yar2003-06-151-92/+239
* Use .Va, not .Fa, to refer to structure members.yar2003-06-151-8/+8
* Catch up man page with reality in rc.d/named.mtm2003-06-141-1/+1
* Put on the core hat and back out all of the CSTD= changes. Core willimp2003-06-141-14/+0
* Remove the old xref to kerberos(1), and replace it with an xref totrhodes2003-06-141-1/+1
* Revert to a known-good state. Anyone desiring to experiment with stricterdes2003-06-141-23/+9
* Build/install the PIC version of libgcc (libcc_pic.a) for use by sharedpeter2003-06-131-0/+1
* We cannot use c99 on amd64 either due to lack of alloca(). libc:strptime()peter2003-06-131-2/+3
* - Document the fact that you can specify several DMA operations tomux2003-06-131-15/+28
* Factor out the description of how to configure a CLIP into its ownharti2003-06-134-29/+130
* Remove the documentation of the raw AAL0 access which has been removed.harti2003-06-131-28/+0
* Make the midway driver use the new ATM phy driver. This allows one toharti2003-06-131-1/+8
* Remove paragraph which describes how we might switch our packet queueinghmp2003-06-121-13/+0
* This is a driver for the physical layer chips used in ATM interfaces.harti2003-06-125-1/+442
* Document the fact that one is allowed to sleep while holding an sx lock.harti2003-06-121-0/+2
* Rename the section 'locking considerations' into 'context'.harti2003-06-121-10/+5
* - Add manpages for the gem and hme ethernet drivers. These were obtainedtmm2003-06-104-0/+205
* Add cross-references to pci(4) and pciconf(8).sheldonh2003-06-101-0/+2
* Remove NOSHLIBS, users can get by with NOPIC.obrien2003-06-101-3/+1
* Hook up pci(9) manual page to the build.hmp2003-06-091-1/+6
* Bring in a manual page documenting some important functions of thehmp2003-06-091-0/+240
* Remove duplicate 'of the'.roam2003-06-091-1/+1
* Document the NOLIBPTHREAD and NOLIBTHR knobs.ru2003-06-081-0/+12
* Apply a couple of grammatical improvements.ceri2003-06-081-2/+2
* The .Xr utilitycharnier2003-06-081-6/+9
* Use .Ic instead of .Xr for internal commandscharnier2003-06-081-2/+2
* Remove reference to deprecated xtend(8)charnier2003-06-081-1/+0
* Add or correct section number in .Xrcharnier2003-06-086-23/+23
* The dhcp_program and dhcp_flags variables have to be renamed tomtm2003-06-071-2/+2
* Be C std strict on i386 and amd64 as we can. Be loose on Alpha and ia64.obrien2003-06-071-0/+6
* Move <DT> to the endache2003-06-071-2/+2
* Move punctuation to its proper placeache2003-06-071-13/+16
* <sb> -> <Sb>ache2003-06-072-2/+2
* Fixes to reflect corresponding standardsache2003-06-074-118/+121
* Replace uk_UA.ISO8859-5 by linkache2003-06-072-13/+10
* Fix typo in prev. commitache2003-06-071-1/+1
* Move <DT> to the endache2003-06-074-9/+11
* Add ru_RU.CP1251ache2003-06-074-0/+52
* Replace by links ru_RU.CP866 and ru_RU.ISO8859-5ache2003-06-073-27/+5
* Add ru_RU.CP1251ache2003-06-072-0/+103
* Add ru_RU.CP1251ache2003-06-062-0/+45
OpenPOWER on IntegriCloud