summaryrefslogtreecommitdiffstats
path: root/share/man/man9/Makefile
Commit message (Expand)AuthorAgeFilesLines
* Add new manpages for:phantom2000-01-071-1/+7
* Man pages for the VFS extended attribute and access control list vnops.rwatson2000-01-051-1/+3
* "Fixed" assorted bitrot. remove_dev() was renamed to destroy_dev().bde1999-12-231-4/+3
* Add the device_get_children(9) man page.n_hibma1999-12-021-1/+2
* Document the make_dev(9) and remove_dev(9) facilities.chris1999-09-251-2/+3
* Document the devtoname(9) kernel interface.chris1999-09-251-2/+2
* More locking clarifications. Add skeleton manual page for VOP_LEASEdillon1999-09-241-1/+1
* Add new manpage device_set_flags.9 and add links fordfr1999-09-121-1/+3
* Add a link for uiomove.9 to uio.9chris1999-09-111-0/+1
* Document VFS changes:alfred1999-09-111-1/+1
* Replace stale references to device_add_child_after(9) withphantom1999-09-041-1/+1
* $Id$ -> $FreeBSD$peter1999-08-281-1/+1
* Add man page for device_quiet and friendsn_hibma1999-06-221-3/+5
* Document the flags and p parameters to VOP_LOCK and VOP_UNLOCK. Also,ghelmer1999-03-171-1/+2
* Removed old scsi section 9 man pages. Only cd.9 has been converted tobde1999-03-061-2/+2
* Fixed bitrot in synopsis (devfs_link was renamed to devfs_makelink).bde1999-03-061-1/+2
* ppbconf.9 removednsouch1999-01-301-2/+2
* Add MLINKS for devstat kernel interfaces.obrien1999-01-091-2/+4
* Add manual page describing kernel buffer management system (i.e.dillon1998-12-221-2/+3
* Add manual page for experimental kernel asleep() and await() routinesdillon1998-12-211-1/+2
* microseq.9: general purpose parallel microcode for ppbus(4)nsouch1998-10-281-3/+3
* Add a manpage for namei().eivind1998-09-271-2/+2
* Add devstat.9.gibbs1998-09-151-2/+3
* Add manpages for the new device framework.dfr1998-09-031-1/+28
* Finish _POSIX_PRIORITY_SCHEDULING. Needs P1003_1B anddufault1998-03-281-1/+2
* Reviewed by: msmith, bde long agodufault1998-03-041-2/+2
* Removed references to the man pages for the obsolete interfacesbde1998-01-161-5/+3
* Sorted lists. Use the same style as most Makefiles for `MLINKS+=' lines.bde1998-01-011-52/+53
* Install devfs_remove_dev.9 and suser.9.bde1998-01-011-4/+4
* Activate the bios.9 manpage.eivind1997-08-121-2/+2
* Document wakeup_one().mpp1997-04-091-2/+2
* Add malloc(9) to document the kernel malloc() and free() routines.mpp1997-03-221-3/+4
* Add vslock(9) to document the vslock() and vsunlock() kernel functions.mpp1997-03-221-2/+4
* Add kernacc(9) that documents the kernacc() and useracc() kernelmpp1997-03-221-2/+3
* Add physio(9).mpp1997-03-221-2/+2
* Add mi_switch.9. It documents the kernel mi_switch() and cpu_switch()mpp1997-03-221-2/+4
* Add resettodr(9).mpp1997-03-221-3/+3
* Add inittodr(9) to document how the system clock is initialized.mpp1997-03-221-4/+4
* Add time(9) to document the kernel time variables. Obtained frommpp1997-03-221-2/+3
* This is the current draft of my filesystem manpages. Some files aredfr1997-03-031-3/+29
* Revert $FreeBSD$ back to $Id$peter1997-02-221-1/+1
* Add boot(9) Obtained from NetBSD w/modifications by me.mpp1997-02-141-1/+2
* Add MD5(9).mpp1997-02-141-1/+2
* Add psignal(9).mpp1997-02-131-2/+4
* Add panic(9).mpp1997-02-131-2/+2
* Various man pages describing the internals of the SCSI subsystem.joerg1997-02-091-3/+3
* Add a man page for the uio handling, after all the recent ramblings injoerg1997-02-021-1/+2
* Make the long-awaited change from $Id$ to $FreeBSD$jkh1997-01-141-1/+1
* Create a new manual page describing how network interfaces andwollman1996-12-171-2/+3
* Add an rtentry(9) page to describe the structure of a routing-tablewollman1996-10-081-2/+2
OpenPOWER on IntegriCloud