summaryrefslogtreecommitdiffstats
path: root/sbin
Commit message (Collapse)AuthorAgeFilesLines
* Fix bug in mount_mfs whereby mount_mfs would sometimes return beforedillon1999-02-092-5/+39
| | | | | | | the mount is completely active, causing the next few commands attempting to manipulate data on the mount to fail. mount_mfs's parent now tries to wait for the mount point st_dev to change before returning, indicating that the mount has gone active.
* Note that nextboot requires the legacy boot code.rnordier1999-02-052-2/+6
|
* Added mount_ntfs subdirectory.semenu1999-02-031-1/+2
| | | | Reviewed by: David O'Brien <obrien@NUXI.com>
* This commit was generated by cvs2svn to compensate for changes in r43548,semenu1999-02-033-0/+350
|\ | | | | | | which included commits to RCS files with non-trunk default branches.
| * Primary version.semenu1999-02-033-0/+350
| | | | Reviewed by: David O'Brien
* Added xref to nologin(5).wosch1999-02-011-2/+3
|
* Added xref to nologin(8).wosch1999-02-011-1/+2
|
* Correct include pathsgrog1999-01-311-6/+2
| | | | | Remove unnecessary additional CFLAGS Remove BINGRP and BINMODE
* Add MAINTAINERgrog1999-01-301-0/+3
|
* Fix broken command tables (change formatting from tbl to .Bl/.El)grog1999-01-271-145/+32
| | | | | Move the BUGS section to vinum.4: the only bug in vinum.8 was the man page, fixed with this commit.
* Add a -b option as a simple way to rewrite the mbr codernordier1999-01-224-8/+54
| | | | (eg. replacing a boot manager with a standard mbr)
* Fix bug where 'ipfw list' would choke if there were a large number of rules.archie1999-01-221-79/+95
|
* Fix misleading wording in ipfw(8) man page.archie1999-01-211-3/+3
| | | | PR: docs/9603
* Update to reflect major changes in vinum kernel modulegrog1999-01-214-131/+431
|
* Update to reflect changes in kernel lkmgrog1999-01-211-84/+169
|
* Remove -DRAID5 from CFLAGSgrog1999-01-211-2/+2
|
* Clarify the number of network interfaces per physical interface available withmks1999-01-202-7/+10
| | | | | each type of signalling manager and bring the atm command into agreement with the man page.
* nuke dset - it doesn't work in a post-ELF world and abial has somethingjkh1999-01-204-520/+1
| | | | better as a replacement (kget).
* Allow tuning of read-only mounted file system.luoqi1999-01-201-4/+47
| | | | Reviewed by: Bruce Evans <bde@zeta.org.au>
* Re-write of ilmi daemon. Among the major changes, it does not use predefinedmks1999-01-201-1555/+1275
| | | | PDUs and should handle multi-request OIDs on GETs.
* Make some further revisions to the boot documentation.rnordier1999-01-191-28/+16
|
* Properly print devices that do not have attached peripherals.gibbs1999-01-141-3/+6
| | | | Submitted by: Kenneth Merry <ken@FreeBSD.org>
* Don't install vinum(8) sgid.grog1999-01-131-2/+2
| | | | Reported-by: Paul Hart <hart@iserver.com>
* Sort options alphabetically.des1999-01-131-2/+2
|
* Oops, I missed a few more /etc/nologin references yesterday. It appearsasami1999-01-121-6/+6
| | | | | | my check of the tree was incomplete. Sorry guys. Reported by: Ben Smithurst <ben@scientia.demon.co.uk>
* Update to match rev. 1.28 of msdosfs_lookup.c.dt1999-01-113-33/+6
|
* Move nologin from /etc to /var/run. This means one less file that hasasami1999-01-111-5/+5
| | | | | | | | | to be written to /etc. The only essential change is in paths.h, so any third-party software written correctly will pick it up in the next rebuild. Reviewed by: the committers list (actually an old version)
* Clean up option handling a little.des1999-01-102-21/+40
| | | | Add an option for showing sysctl descriptions instead of their values.
* Removed ROOTSLICE_HUNT. The root device is now found better bybde1999-01-094-76/+6
| | | | | | | getvfsent() in most cases. (The main exception is when /etc/fstab still hasn't been converted to use a slice for the root device, the root device is a SCSI device, and the /dev/sd* inode for this device still hasn't been renamed to /dev/da*.)
* - Format corrections for troff outputgrog1999-01-091-14/+78
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Comment out the description of the unimplemented replace command - Explain in even stronger language that resetconfig is not for everyday use Motivated by: Marko Schütz <marko@ki.informatik.uni-frankfurt.de> - Correct the description of the start command (no longer used to start vinum, just specific objects) Motivated by: dg - Remove .TH N commands, which conflict badly with the doc macros, causing strange headings in nroff output and endless loops in troff. The current version produces warning messages with some screen sizes, and will be fixed when I have time. Bug-report: docs/9328 (nroff) Reported-by: joerg (troff) - Add gotcha info for the setupstate keyword and the use of label and resetconfig. - Add bug entry for the warning messages introduced by fixing docs/9328. - Add references to web pages on Vinum
* Make a start on revising the boot documentation.rnordier1999-01-061-17/+46
|
* Allow PINGing from any address on multihomed hostsimp1999-01-062-12/+46
| | | | | | | | | In the words of the submitter: "The patch below allows to ping from any address on the multihomed host. The man page is also updated, the text was cutted from traceroute(8)." Submitted by: Ruslan Ermilov PR: 6832
* Complete change from DEBUG to VINUMDEBUG. Now it still builds whengrog1999-01-062-4/+4
| | | | VINUMDEBUG is set as well.
* Complete previous commit: change debug macro from DEBUG to VINUMDEBUGgrog1999-01-061-5/+7
| | | | Reported by: dg
* Fix problems compiling without -DVINUMDEBUGgrog1999-01-061-3/+7
| | | | Reported by: dg
* Clean up some more residual /usr/mdec references. I left all thejkh1999-01-031-2/+2
| | | | | extra rbootd/boot rom cruft pointing at /usr/mdec since it either doesn't exist or doesn't work anyway, so who cares? :)
* Update for boot block location change.jkh1999-01-022-4/+4
|
* Here is a patch to make mountd work.dfr1998-12-291-21/+21
| | | | | | | | | It just replace u_long with u_int32_t and shouldn't affect on i386. Without this patch, - unaligned accesses occur - permission denied randomly Submitted by: Hidetoshi Shimokawa <simokawa@sat.t.u-tokyo.ac.jp>
* Tweaks as a result of having vinum statically buildable in a kernel.peter1998-12-284-10/+10
|
* Reenable vinum after repository copy.sos1998-12-282-6/+6
| | | | Forgotten by: Peter.
* Temporaryly disable vinum, awaiting repository copy of misplaced files.sos1998-12-271-3/+3
|
* Remove coredump when running "ipfw pipe" without more arguments.luigi1998-12-271-1/+4
| | | | PR: 8937
* - Correct alphabetical order of commandsgrog1998-12-271-36/+125
| | | | | | | | | | | | | | - Describe subdisk attachment in more detail - Describe new 'makedev' command - Correct use of 'partition' and 'slice' - Describe 'setupstate' keyword - Include performance guidelines for striped plexes - Correct numerical values in examples - Add examples for disklabel(8) - Clarify problems creating Vinum drives on inappropriate partitions Prodded by: NAGANUMA Yasuhiro <y_naga@carat.rim.or.jp> (slices and partitions)
* User reports that using mount_null destroyed his filesystem, I replyjkh1998-12-226-6/+66
| | | | | that nullfs really doesn't work, he askes why this isn't noted for the "dangerous" filesystems, I go "hmmm."
* Bad Dog! No Biscuit! *Never* commit without testing- even if it wasmjacob1998-12-201-3/+3
| | | | "just a printf formatting change"....
* add Bus and Device Reset commandsmjacob1998-12-202-27/+47
|
* Look for boot blocks in new default location.jkh1998-12-176-72/+36
|
* Mention affect of securelevel 3 and higher on attempts to change filter lists.ghelmer1998-12-161-0/+6
| | | | Prompted by: PR docs/7785
* Mention securelevel 3 as affecting ipfw and dummynet. Generalize commentghelmer1998-12-161-2/+11
| | | | | about fdisk and securelevel 2. PR: docs/7785
* Fix two possible non-exploitable buffer overflows.imp1998-12-161-3/+5
| | | | Thanks to: A friend at Sun auditing dump/restore for Solaris.
OpenPOWER on IntegriCloud