summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* assert(3) is not used here.obrien2006-01-121-1/+0
* Move linux support to the linux section.obrien2006-01-121-1/+1
* Fix broken playback capabilities to prevent impending disaster.ariff2006-01-111-1/+1
* Grab the media from the passed in structure to put it into theambrisko2006-01-111-0/+1
* Creating memory file systems with softupdates enabled is pointless,brooks2006-01-111-1/+1
* Grammar fix.takawata2006-01-111-14/+13
* Be a little more read-only file system friendly when running the Linuxbrooks2006-01-111-1/+6
* o Sort MLINKS.maxim2006-01-111-1/+1
* Ok, I've created a test suite to avoid such regressions. Sorry for the noise.flz2006-01-111-2/+2
* - Fix another bug, it seems sometimes mail is sent to cvs-all but not cvs-ports.flz2006-01-111-4/+5
* - Fix search.flz2006-01-111-5/+5
* Add the RB_NFIND() macro, which is useful for red-black tree searchesjasone2006-01-113-1/+38
* Add ktr(9) hooks to easier tracing of the netgraph item flow throughglebius2006-01-111-2/+36
* I wrote getnetconfig where I meant getnetpath in the previous revision.ceri2006-01-111-2/+2
* Add a mobile phone known to work.takawata2006-01-111-0/+2
* Correct insecure temporary file usage in texindex. [06:01]cperciva2006-01-1111-60/+217
* - Locking fixes. Release lock while chn_intr().ariff2006-01-111-1/+16
* The thr_new sysscall was already in libc, don't generate it.davidxu2006-01-111-1/+0
* Get rid of the bogus IFP2FC() macro and use IFP2FWC(). IFP2FC()brooks2006-01-111-7/+5
* - Remove netcat dependency by using fetch (not sure why i used ncflz2006-01-111-5/+26
* When deregistering a bus, attempt to flush out all outstandingiedowse2006-01-111-8/+111
* The interlock in taskqueue_terminate() is completely wrong for taskqueuesscottl2006-01-111-5/+1
* Significant performance improvements for the if_em driver:scottl2006-01-112-19/+203
* Add references to fhopen, fhstat, getfh, lgetfh and fhstatfs.grog2006-01-103-0/+6
* Don't use the ALLOCNOW flag for tags that will only be used for staticscottl2006-01-101-2/+2
* add nfsclient/, nfs4client/, and rpc/ directories to therees2006-01-101-1/+2
* Correct two trivial grammos.schweikh2006-01-101-2/+2
* Fix sort order.takawata2006-01-101-1/+1
* - Update pretty print of multipath routes to better handle timeout of firstpav2006-01-101-1/+1
* Update usage to reflect the fact that the -d -a now accepts -i <interface>.brooks2006-01-101-1/+1
* - Fix: documentation for -m option was inserted halfway thru the text of -lpav2006-01-101-3/+3
* - Xref mount_reiserfs(8)pav2006-01-101-0/+1
* Hook ufoma(4) page up.takawata2006-01-101-0/+1
* - Add a new MFC script that takes a message-id, a commit mail or a query stri...flz2006-01-102-0/+349
* Disable default write access by not setting the write community string.harti2006-01-101-1/+14
* This commit was generated by cvs2svn to compensate for changes in r154184,harti2006-01-101-9/+19
|\
| * Vendor fix: the routing table can change while we are fetching it fromharti2006-01-101-9/+19
* | This commit was generated by cvs2svn to compensate for changes in r154182,harti2006-01-101-0/+1
|\ \ | |/
| * Vendor fix: initialize the flag field of a newly created node to be 0.harti2006-01-101-0/+1
* | This commit was generated by cvs2svn to compensate for changes in r154180,harti2006-01-102-3/+17
|\ \ | |/
| * Vendor fix: make the default read and write communities NULL. Thisharti2006-01-102-3/+17
* | This commit was generated by cvs2svn to compensate for changes in r154178,harti2006-01-101-3/+4
|\ \ | |/
| * Vendor patch: fix a bug when parsing the include path.harti2006-01-101-3/+4
* | Add a (disabled) configuration line to enable the HOST-RESOURCES MIB.harti2006-01-101-0/+6
* | Move the old BSD4.3 tty compatibility from (!BURN_BRIDGES && COMPAT_43)phk2006-01-1017-38/+24
* | More thorough fixes to enable inverted external amplifier sense flag.ariff2006-01-101-5/+12
* | Add functions and macros and refactor code to make it easier to managescottl2006-01-102-117/+117
* | /etc/crontab is similar enough to parse as correct if you runbrooks2006-01-101-0/+4
* | Mention the -b flag in the SYNOPSIS.brooks2006-01-101-1/+1
* | When we give up on an interface, use the arp(8) command to remove allbrooks2006-01-101-2/+5
OpenPOWER on IntegriCloud