summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* - Fix issue when X-FreeBSD-CVS-Branch is not HEAD.flz2006-01-131-1/+5
* XXX a comment in uipc_usrreq.c that requires updating.rwatson2006-01-131-0/+2
* When sending export datagram from interrupt thread, use NG_QUEUEglebius2006-01-121-15/+15
* Provide additional macros for sending netgraph items, which allowglebius2006-01-121-9/+17
* - Print also node ID in ktr(9) messages. [1]glebius2006-01-121-29/+33
* Skip format flags, when parsing ktr_desc.glebius2006-01-121-1/+7
* * fix bst.status. We mark some bits, but forgot to reset all of thembruno2006-01-121-16/+17
* Do not force queueing on peer hooks. This was important only forglebius2006-01-121-14/+0
* Include the bridge interface itself in the special arp handling.thompsa2006-01-121-1/+1
* Remove old debugging leftover.glebius2006-01-122-11/+1
* Belated __FreeBSD_version bump for improvements to the Linux ldconfigbrooks2006-01-121-1/+1
* Mark appropriate commands with NGM_READONLY and NGM_HASREPLY andglebius2006-01-121-7/+7
* Novel idea, don't print a string if it is NULL!alfred2006-01-121-1/+2
* In the splnet(9) times netgraph(4) was synchronous and if a messageglebius2006-01-122-18/+48
* Fix a bitwise logic error in posix_memalign().jasone2006-01-121-2/+2
* Remove releases now found in Groff sources.ru2006-01-121-4/+0
* Pull up from the FSF branch.ru2006-01-121-1/+19
* This commit was generated by cvs2svn to compensate for changes in r154258,ru2006-01-121-4/+6
|\
| * Merge support for new BSD releases from upstream:ru2006-01-122-5/+25
| * Removed files not present in v1.19.2 import.ru2005-10-2062-21518/+0
* | In moduledir_readhints() cast the value returned by sizeof() to ssize_tmarius2006-01-121-1/+2
* | - The inline asm in this file uses output operands before all inputmarius2006-01-121-5/+5
* | Fix wording in last commit.glebius2006-01-121-1/+1
* | Use posix_memalign() in valloc() rather than making assumptions aboutjasone2006-01-122-20/+20
* | Use posix_memalign() rather than assuming that malloc() provides adequatejasone2006-01-121-5/+7
* | Expose the posix_memalign() prototype, now that the function is implementedjasone2006-01-121-1/+1
* | Fix build without -DNDEBUG.harti2006-01-123-7/+7
* | In preparation for a new malloc implementation:jasone2006-01-129-82/+186
* | Build shared library on behalf of bsnmpd.ru2006-01-121-1/+0
* | assert(3) is not used here.obrien2006-01-121-1/+0
* | Move linux support to the linux section.obrien2006-01-121-1/+1
* | Fix broken playback capabilities to prevent impending disaster.ariff2006-01-111-1/+1
* | Grab the media from the passed in structure to put it into theambrisko2006-01-111-0/+1
* | Creating memory file systems with softupdates enabled is pointless,brooks2006-01-111-1/+1
* | Grammar fix.takawata2006-01-111-14/+13
* | Be a little more read-only file system friendly when running the Linuxbrooks2006-01-111-1/+6
* | o Sort MLINKS.maxim2006-01-111-1/+1
* | Ok, I've created a test suite to avoid such regressions. Sorry for the noise.flz2006-01-111-2/+2
* | - Fix another bug, it seems sometimes mail is sent to cvs-all but not cvs-ports.flz2006-01-111-4/+5
* | - Fix search.flz2006-01-111-5/+5
* | Add the RB_NFIND() macro, which is useful for red-black tree searchesjasone2006-01-113-1/+38
* | Add ktr(9) hooks to easier tracing of the netgraph item flow throughglebius2006-01-111-2/+36
* | I wrote getnetconfig where I meant getnetpath in the previous revision.ceri2006-01-111-2/+2
* | Add a mobile phone known to work.takawata2006-01-111-0/+2
* | Correct insecure temporary file usage in texindex. [06:01]cperciva2006-01-1111-60/+217
* | - Locking fixes. Release lock while chn_intr().ariff2006-01-111-1/+16
* | The thr_new sysscall was already in libc, don't generate it.davidxu2006-01-111-1/+0
* | Get rid of the bogus IFP2FC() macro and use IFP2FWC(). IFP2FC()brooks2006-01-111-7/+5
* | - Remove netcat dependency by using fetch (not sure why i used ncflz2006-01-111-5/+26
* | When deregistering a bus, attempt to flush out all outstandingiedowse2006-01-111-8/+111
OpenPOWER on IntegriCloud