summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
...
* Add directory structure of diskless examplesdillon1999-01-261-1/+11
* typo - "a follows" -> "as follows"billf1999-01-262-4/+4
* Numbering typo, missed a '0'billf1999-01-261-3/+3
* Compile the linux module with the same flags as the kernel.julian1999-01-261-2/+2
* Create overrideable MFS filesystem sizes and do a bit of cleanup.dillon1999-01-261-10/+35
* Diskless and templating configuration examplesdillon1999-01-2619-0/+722
* Fix typo by rewriting sentence.wollman1999-01-261-8/+10
* OK, now the boot floppies work again. Also collapse some commonjkh1999-01-261-22/+5
* When selecting the correct EEPROM offset to use for probing the stationwpaul1999-01-261-3/+3
* 1. Adjust fs sizes to get floppies back under control.jkh1999-01-266-21/+66
* NO_LKM is deprecatedjkh1999-01-265-5/+0
* s/wcd/acd/jkh1999-01-264-4/+4
* Allow /etc/rc.conf.site as well as /etc/rc.conf.local (and add rc_conf_filesjkh1999-01-261-6/+7
* Added descriptions on new flags introduced in psm.c rev.1.57.yokota1999-01-262-2/+76
* Oops, one line was accidentally commented out in the previous commit.yokota1999-01-262-6/+2
* Pull down the splash screen when someone is about to read from theyokota1999-01-261-7/+2
* Frob the upgrade target to be a bit more inclusive. This appears tojkh1999-01-262-78/+39
* Ok, people didn't like kern.conf_dir. Poof, backed out.dillon1999-01-261-6/+1
* Remove use of kern.conf_dir sysctl. conf_dir is left as a localdillon1999-01-261-2/+2
* Remove sysctl's from rc.conf, there seems to be a concensus thatdillon1999-01-261-7/+4
* Ripped out EDITOR=ee with extreme prejudice.dg1999-01-261-3/+3
* Move reading of rc.conf sooner as requested by Greg. I'm a tad nervouspeter1999-01-261-9/+8
* The vinum setup tool automatically loads the vinum module if it's needed,peter1999-01-261-7/+2
* Check if the intpm controller is configured first before stoppingpeter1999-01-261-2/+7
* Automatically load the vn module if it isn't already in the kernel.peter1999-01-261-1/+6
* 1. Properly chflags libraries before moving (otherwise they don't).jkh1999-01-262-1/+82
* Add support for the USR3031 PNP modem. Also fix a minor typo since I wassteve1999-01-261-2/+3
* Move bsd.port.*mk to under ${PORTSDIR}/Mk (already repository copied).asami1999-01-264-2446/+8
* o Add info about Julian's Linux Threads checkin (one of theseimp1999-01-261-2/+13
* Mostly remove the VM_STACK OPTION.julian1999-01-2614-33/+116
* Enable Linux threads support by default.julian1999-01-2614-237/+29
* Fix a couple of further bugs: missing argument to sprintf() andrnordier1999-01-251-3/+3
* Update pkg_add's remote package feature to reflect the new structure ofbillf1999-01-251-6/+6
* Terminate commit for the Intel PIIX4 SMBus support. Already committed filesnsouch1999-01-257-10/+25
* Intel PIIX4 Power Management Unit for smbus(4).nsouch1999-01-251-0/+63
* Add kern.conf_dir sysctl. This is a R+W string used to specify thedillon1999-01-251-1/+6
* Commit first rc.diskless startup plus modifications to rc.conf and Makefiledillon1999-01-253-5/+136
* Finish up /etc/rc adjustments to handle diskless read-only-root booting.dillon1999-01-251-21/+42
* Port NetBSD's 19990120-accept bug fix. This works around the race conditionfenner1999-01-254-8/+21
* Don't free the socket address if soaccept() / pru_accept() doesn'tfenner1999-01-251-2/+3
* Identify the TI1250 PCMCIA/CardBus bridge. It seems that it's compatibletorstenb1999-01-254-4/+10
* Sync with sys/i386/conf/Makefile.i386 revision 1.137.kato1999-01-252-2/+6
* Use __XSTRING() from cdefs.h instead of rolling my own.eivind1999-01-251-7/+1
* Correctly record the end of the a.out symbol table. In practice, arnordier1999-01-251-3/+3
* Don't SEGV when ``set proctitle'' is used in the defaultbrian1999-01-251-4/+10
* Back out a couple of i386 conditionals which aren't needed with the newdfr1999-01-251-12/+4
* Don't try to call SYSUNINIT functions if there was a link error.dfr1999-01-255-6/+22
* Link everything against libcrypt. ELF builds complain without it.markm1999-01-2518-63/+80
* Correct a typo and an unparseable sentence.jkoshy1999-01-251-6/+4
* Play with MFS size a little.jkh1999-01-251-2/+3
OpenPOWER on IntegriCloud