summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* Remove use of kern.conf_dir sysctl. conf_dir is left as a localdillon1999-01-261-2/+2
* Remove sysctl's from rc.conf, there seems to be a concensus thatdillon1999-01-261-7/+4
* Ripped out EDITOR=ee with extreme prejudice.dg1999-01-261-3/+3
* Move reading of rc.conf sooner as requested by Greg. I'm a tad nervouspeter1999-01-261-9/+8
* The vinum setup tool automatically loads the vinum module if it's needed,peter1999-01-261-7/+2
* Check if the intpm controller is configured first before stoppingpeter1999-01-261-2/+7
* Automatically load the vn module if it isn't already in the kernel.peter1999-01-261-1/+6
* 1. Properly chflags libraries before moving (otherwise they don't).jkh1999-01-262-1/+82
* Add support for the USR3031 PNP modem. Also fix a minor typo since I wassteve1999-01-261-2/+3
* Move bsd.port.*mk to under ${PORTSDIR}/Mk (already repository copied).asami1999-01-264-2446/+8
* o Add info about Julian's Linux Threads checkin (one of theseimp1999-01-261-2/+13
* Mostly remove the VM_STACK OPTION.julian1999-01-2614-33/+116
* Enable Linux threads support by default.julian1999-01-2614-237/+29
* Fix a couple of further bugs: missing argument to sprintf() andrnordier1999-01-251-3/+3
* Update pkg_add's remote package feature to reflect the new structure ofbillf1999-01-251-6/+6
* Terminate commit for the Intel PIIX4 SMBus support. Already committed filesnsouch1999-01-257-10/+25
* Intel PIIX4 Power Management Unit for smbus(4).nsouch1999-01-251-0/+63
* Add kern.conf_dir sysctl. This is a R+W string used to specify thedillon1999-01-251-1/+6
* Commit first rc.diskless startup plus modifications to rc.conf and Makefiledillon1999-01-253-5/+136
* Finish up /etc/rc adjustments to handle diskless read-only-root booting.dillon1999-01-251-21/+42
* Port NetBSD's 19990120-accept bug fix. This works around the race conditionfenner1999-01-254-8/+21
* Don't free the socket address if soaccept() / pru_accept() doesn'tfenner1999-01-251-2/+3
* Identify the TI1250 PCMCIA/CardBus bridge. It seems that it's compatibletorstenb1999-01-254-4/+10
* Sync with sys/i386/conf/Makefile.i386 revision 1.137.kato1999-01-252-2/+6
* Use __XSTRING() from cdefs.h instead of rolling my own.eivind1999-01-251-7/+1
* Correctly record the end of the a.out symbol table. In practice, arnordier1999-01-251-3/+3
* Don't SEGV when ``set proctitle'' is used in the defaultbrian1999-01-251-4/+10
* Back out a couple of i386 conditionals which aren't needed with the newdfr1999-01-251-12/+4
* Don't try to call SYSUNINIT functions if there was a link error.dfr1999-01-255-6/+22
* Link everything against libcrypt. ELF builds complain without it.markm1999-01-2518-63/+80
* Correct a typo and an unparseable sentence.jkoshy1999-01-251-6/+4
* Play with MFS size a little.jkh1999-01-251-2/+3
* Introduce rc script for BOOTP 'diskless' boot. Well, not quite disklessdillon1999-01-251-1/+12
* Force the order of the setdefs* so that make -jN doesn't build thepeter1999-01-253-3/+9
* Fix swap radix tree dump formatting ( pstat -ss ), it was printing thedillon1999-01-251-4/+4
* NO_LKM is no longer an option. LKM support is an option itself.peter1999-01-254-17/+4
* gethostbyname2() was broken for lookups via NIS on FreeBSD/alphagallatin1999-01-251-4/+7
* Fix an aout-to-elf upgrade failure. Don't let the kernel Makefilepeter1999-01-251-2/+3
* SMBus support for the Intel PIIX4 power management unit. See smbus(4),nsouch1999-01-242-0/+866
* 'Nother place where libcrypt needs to be linked.markm1999-01-241-3/+3
* Replace a bunch of "ln foo bar"'s with "ln -f foo bar".markm1999-01-242-84/+84
* More libcrypt backout.markm1999-01-241-8/+2
* Fix logic surrounding the noconn option.obrien1999-01-241-5/+9
* Under ELF, this must be linked against libcrypt.markm1999-01-241-3/+3
* Support 'O MaxHeaderLines=' to override the default header count and linepeter1999-01-242-0/+2
* Fix symlinking. Without the -f "force" option, the wrong versionmarkm1999-01-242-9/+9
* Merge changes from vendor branch into our versionpeter1999-01-242-0/+8
* This commit was generated by cvs2svn to compensate for changes in r43148,peter1999-01-244-1/+72
|\
| * Check the patch obtained from sendmail.org for the header denial-of-servicepeter1999-01-246-1/+80
* | Drop outdated FreeBSD version number from test script.rnordier1999-01-241-1/+1
OpenPOWER on IntegriCloud