summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
...
* | Some machines have an ESCC. Make sure we build uart(4) with supportmarcel2006-06-121-0/+1
* | Don't invalidate the TLB in pmap_qenter() unless the old mapping was valid.alc2006-06-122-20/+30
* | Need machine/bus.h here tooimp2006-06-121-0/+1
* | Add the model name, obtained from the hw.model sysctl variable.des2006-06-121-2/+12
* | Check in file missed in last commit. It made it into the MFC properlynjl2006-06-121-1/+1
* | MFp4: need machine/bus.h here since we use bus space macros. It used toimp2006-06-121-0/+1
* | Who am I to correct the native speakers... anyway, s/council/counsel/wilko2006-06-121-1/+1
* | Any sufficiently simple directive can be obfuscated beyond reasonwilko2006-06-121-0/+5
* | MFp4:imp2006-06-123-3/+26
* | Add the ability to subset the devices that UART pulls in. This allowsimp2006-06-127-3/+24
* | Add a convenience function rman_init_from_resource for initializingimp2006-06-122-1/+12
* | Better printfimp2006-06-121-1/+1
* | Minor cleanup of CIS parsing.imp2006-06-121-5/+1
* | Better error message when the CIS is a non-standards conforming '0'.imp2006-06-121-1/+3
* | When we can't parse the CIS, note with a warning that the bogus CISimp2006-06-121-5/+2
* | Update release note: KDE 3.5.3.bmah2006-06-122-2/+2
* | Make cm(4) driver MPSAFE.fjoe2006-06-114-234/+164
* | Fix KASSERT conditions in if_deregister_com_alloc().fjoe2006-06-111-2/+2
* | o Finally learn how to spell "privileges".maxim2006-06-112-2/+2
* | o Add missed $start variable in the grep statement back.maxim2006-06-111-1/+1
* | By default, don't disable ACPI during reboot. This appears to hang somenjl2006-06-111-3/+13
* | o Spell "privledges" correctly. Re-style comment.maxim2006-06-112-3/+5
* | o vinum.8 -> gvinum.8 as the former was replaced by the latter.maxim2006-06-111-16/+16
* | Fix display of idle processes, which had been broken since rev. 1.56 ofse2006-06-111-1/+2
* | o Sync usage() with reality.maxim2006-06-111-1/+1
* | o Fix typo.maxim2006-06-111-1/+1
* | The monetary decimal point (mon_decimal_point) for pt_PT.ISO8859-1simon2006-06-111-2/+2
* | Use IP addresses out of "TEST-NET" (for use in documentation andbz2006-06-111-9/+9
* | Specify default path for SHLIBDIR before bsd.own.mk does.akiyama2006-06-111-1/+3
* | Cross-reference src.conf(5).jkoshy2006-06-111-0/+1
* | Remove pmap_pagedaemon_waken and update pmap_get_pv_entry() to match thealc2006-06-111-6/+2
* | Eliminate spl calls.alc2006-06-111-11/+0
* | Implement vnode operations for setting and removing extended attributes.rodrigc2006-06-111-1/+95
* | Restore routines for getting and listing extended attributes whichrodrigc2006-06-111-0/+124
* | Restore changes to spinlock macros before merge.rodrigc2006-06-111-10/+8
* | Remove debugging printfrodrigc2006-06-111-1/+0
* | Add PCI ids for the FC919Xmjacob2006-06-101-0/+8
* | Temporarily disable log recovery until we fix panics.rodrigc2006-06-101-0/+5
* | Logical OR the following flags into the va_mode field:rodrigc2006-06-101-9/+3
* | Move the new flags field to the end of the structure to maintainiedowse2006-06-101-1/+1
* | Call g_vfs_close() if:rodrigc2006-06-101-2/+35
* | Do not call vput() after we call VOP_UNLOCK().rodrigc2006-06-101-1/+1
* | Hold on to firmware images until the interface detaches sinceiedowse2006-06-102-5/+17
* | Keep firmware images on the list until they have been unregisterediedowse2006-06-102-19/+39
* | Be explicit about which chips support jumbo frames.brueffer2006-06-101-1/+2
* | New release notes: i386 boot loader corruption fix, my(4) ALTQbmah2006-06-102-8/+40
* | Move some functions and definitions from uipc_socket2.c to uipc_socket.c:rwatson2006-06-1012-322/+172
* | Fix a typo s/Made/Make. Use .Pp for a line break, it will quiet thetrhodes2006-06-101-2/+2
* | * Ask for a page-aligned page instead of an arbitrary address. This shouldnjl2006-06-101-15/+30
* | Minor tweaks to the resume code. Previous commit reverted alignment backnjl2006-06-101-41/+50
OpenPOWER on IntegriCloud