summaryrefslogtreecommitdiffstats
path: root/lib/AST
diff options
context:
space:
mode:
Diffstat (limited to 'lib/AST')
-rw-r--r--lib/AST/ASTContext.cpp106
-rw-r--r--lib/AST/ASTImporter.cpp48
-rw-r--r--lib/AST/Decl.cpp73
-rw-r--r--lib/AST/DeclBase.cpp16
-rw-r--r--lib/AST/DeclCXX.cpp32
-rw-r--r--lib/AST/DeclPrinter.cpp6
-rw-r--r--lib/AST/Expr.cpp13
-rw-r--r--lib/AST/ExprCXX.cpp42
-rw-r--r--lib/AST/ExprConstant.cpp2
-rw-r--r--lib/AST/ItaniumMangle.cpp10
-rw-r--r--lib/AST/NestedNameSpecifier.cpp182
-rw-r--r--lib/AST/RecordLayoutBuilder.cpp93
-rw-r--r--lib/AST/Stmt.cpp4
-rw-r--r--lib/AST/StmtDumper.cpp4
-rw-r--r--lib/AST/TemplateBase.cpp18
15 files changed, 397 insertions, 252 deletions
diff --git a/lib/AST/ASTContext.cpp b/lib/AST/ASTContext.cpp
index 945dfb8..9c24550 100644
--- a/lib/AST/ASTContext.cpp
+++ b/lib/AST/ASTContext.cpp
@@ -205,7 +205,7 @@ ASTContext::ASTContext(const LangOptions& LOpts, SourceManager &SM,
DeclarationNames(*this),
ExternalSource(0), Listener(0), PrintingPolicy(LOpts),
LastSDM(0, 0),
- UniqueBlockByRefTypeID(0), UniqueBlockParmTypeID(0) {
+ UniqueBlockByRefTypeID(0) {
ObjCIdRedefinitionType = QualType();
ObjCClassRedefinitionType = QualType();
ObjCSelRedefinitionType = QualType();
@@ -874,7 +874,7 @@ ASTContext::getTypeInfo(const Type *T) const {
case Type::Auto: {
const AutoType *A = cast<AutoType>(T);
assert(A->isDeduced() && "Cannot request the size of a dependent type");
- return getTypeInfo(cast<AutoType>(T)->getDeducedType().getTypePtr());
+ return getTypeInfo(A->getDeducedType().getTypePtr());
}
case Type::Paren:
@@ -2683,12 +2683,22 @@ QualType ASTContext::getDecltypeType(Expr *e) const {
return QualType(dt, 0);
}
-/// getAutoType - Unlike many "get<Type>" functions, we don't unique
-/// AutoType AST's.
+/// getAutoType - We only unique auto types after they've been deduced.
QualType ASTContext::getAutoType(QualType DeducedType) const {
- AutoType *at = new (*this, TypeAlignment) AutoType(DeducedType);
- Types.push_back(at);
- return QualType(at, 0);
+ void *InsertPos = 0;
+ if (!DeducedType.isNull()) {
+ // Look in the folding set for an existing type.
+ llvm::FoldingSetNodeID ID;
+ AutoType::Profile(ID, DeducedType);
+ if (AutoType *AT = AutoTypes.FindNodeOrInsertPos(ID, InsertPos))
+ return QualType(AT, 0);
+ }
+
+ AutoType *AT = new (*this, TypeAlignment) AutoType(DeducedType);
+ Types.push_back(AT);
+ if (InsertPos)
+ AutoTypes.InsertNode(AT, InsertPos);
+ return QualType(AT, 0);
}
/// getTagDeclType - Return the unique reference to the type for the
@@ -2971,7 +2981,15 @@ ASTContext::getCanonicalNestedNameSpecifier(NestedNameSpecifier *NNS) const {
case NestedNameSpecifier::Namespace:
// A namespace is canonical; build a nested-name-specifier with
// this namespace and no prefix.
- return NestedNameSpecifier::Create(*this, 0, NNS->getAsNamespace());
+ return NestedNameSpecifier::Create(*this, 0,
+ NNS->getAsNamespace()->getOriginalNamespace());
+
+ case NestedNameSpecifier::NamespaceAlias:
+ // A namespace is canonical; build a nested-name-specifier with
+ // this namespace and no prefix.
+ return NestedNameSpecifier::Create(*this, 0,
+ NNS->getAsNamespaceAlias()->getNamespace()
+ ->getOriginalNamespace());
case NestedNameSpecifier::TypeSpec:
case NestedNameSpecifier::TypeSpecWithTemplate: {
@@ -3609,78 +3627,6 @@ ASTContext::BuildByRefType(llvm::StringRef DeclName, QualType Ty) const {
return getPointerType(getTagDeclType(T));
}
-
-QualType ASTContext::getBlockParmType(
- bool BlockHasCopyDispose,
- llvm::SmallVectorImpl<const Expr *> &Layout) const {
-
- // FIXME: Move up
- llvm::SmallString<36> Name;
- llvm::raw_svector_ostream(Name) << "__block_literal_"
- << ++UniqueBlockParmTypeID;
- RecordDecl *T;
- T = CreateRecordDecl(*this, TTK_Struct, TUDecl, SourceLocation(),
- &Idents.get(Name.str()));
- T->startDefinition();
- QualType FieldTypes[] = {
- getPointerType(VoidPtrTy),
- IntTy,
- IntTy,
- getPointerType(VoidPtrTy),
- (BlockHasCopyDispose ?
- getPointerType(getBlockDescriptorExtendedType()) :
- getPointerType(getBlockDescriptorType()))
- };
-
- const char *FieldNames[] = {
- "__isa",
- "__flags",
- "__reserved",
- "__FuncPtr",
- "__descriptor"
- };
-
- for (size_t i = 0; i < 5; ++i) {
- FieldDecl *Field = FieldDecl::Create(*this, T, SourceLocation(),
- &Idents.get(FieldNames[i]),
- FieldTypes[i], /*TInfo=*/0,
- /*BitWidth=*/0, /*Mutable=*/false);
- Field->setAccess(AS_public);
- T->addDecl(Field);
- }
-
- for (unsigned i = 0; i < Layout.size(); ++i) {
- const Expr *E = Layout[i];
-
- QualType FieldType = E->getType();
- IdentifierInfo *FieldName = 0;
- if (isa<CXXThisExpr>(E)) {
- FieldName = &Idents.get("this");
- } else if (const BlockDeclRefExpr *BDRE = dyn_cast<BlockDeclRefExpr>(E)) {
- const ValueDecl *D = BDRE->getDecl();
- FieldName = D->getIdentifier();
- if (BDRE->isByRef())
- FieldType = BuildByRefType(D->getName(), FieldType);
- } else {
- // Padding.
- assert(isa<ConstantArrayType>(FieldType) &&
- isa<DeclRefExpr>(E) &&
- !cast<DeclRefExpr>(E)->getDecl()->getDeclName() &&
- "doesn't match characteristics of padding decl");
- }
-
- FieldDecl *Field = FieldDecl::Create(*this, T, SourceLocation(),
- FieldName, FieldType, /*TInfo=*/0,
- /*BitWidth=*/0, /*Mutable=*/false);
- Field->setAccess(AS_public);
- T->addDecl(Field);
- }
-
- T->completeDefinition();
-
- return getPointerType(getTagDeclType(T));
-}
-
void ASTContext::setObjCFastEnumerationStateType(QualType T) {
const RecordType *Rec = T->getAs<RecordType>();
assert(Rec && "Invalid ObjCFAstEnumerationStateType");
diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp
index 65c0a3b..21f10fb 100644
--- a/lib/AST/ASTImporter.cpp
+++ b/lib/AST/ASTImporter.cpp
@@ -2097,11 +2097,7 @@ Decl *ASTNodeImporter::VisitEnumDecl(EnumDecl *D) {
D->isScoped(), D->isScopedUsingClassTag(),
D->isFixed());
// Import the qualifier, if any.
- if (D->getQualifier()) {
- NestedNameSpecifier *NNS = Importer.Import(D->getQualifier());
- SourceRange NNSRange = Importer.Import(D->getQualifierRange());
- D2->setQualifierInfo(NNS, NNSRange);
- }
+ D2->setQualifierInfo(Importer.Import(D->getQualifierLoc()));
D2->setAccess(D->getAccess());
D2->setLexicalDeclContext(LexicalDC);
Importer.Imported(D, D2);
@@ -2225,12 +2221,8 @@ Decl *ASTNodeImporter::VisitRecordDecl(RecordDecl *D) {
Name.getAsIdentifierInfo(),
Importer.Import(D->getTagKeywordLoc()));
}
- // Import the qualifier, if any.
- if (D->getQualifier()) {
- NestedNameSpecifier *NNS = Importer.Import(D->getQualifier());
- SourceRange NNSRange = Importer.Import(D->getQualifierRange());
- D2->setQualifierInfo(NNS, NNSRange);
- }
+
+ D2->setQualifierInfo(Importer.Import(D->getQualifierLoc()));
D2->setLexicalDeclContext(LexicalDC);
LexicalDC->addDecl(D2);
}
@@ -2408,11 +2400,7 @@ Decl *ASTNodeImporter::VisitFunctionDecl(FunctionDecl *D) {
}
// Import the qualifier, if any.
- if (D->getQualifier()) {
- NestedNameSpecifier *NNS = Importer.Import(D->getQualifier());
- SourceRange NNSRange = Importer.Import(D->getQualifierRange());
- ToFunction->setQualifierInfo(NNS, NNSRange);
- }
+ ToFunction->setQualifierInfo(Importer.Import(D->getQualifierLoc()));
ToFunction->setAccess(D->getAccess());
ToFunction->setLexicalDeclContext(LexicalDC);
ToFunction->setVirtualAsWritten(D->isVirtualAsWritten());
@@ -2666,12 +2654,7 @@ Decl *ASTNodeImporter::VisitVarDecl(VarDecl *D) {
Name.getAsIdentifierInfo(), T, TInfo,
D->getStorageClass(),
D->getStorageClassAsWritten());
- // Import the qualifier, if any.
- if (D->getQualifier()) {
- NestedNameSpecifier *NNS = Importer.Import(D->getQualifier());
- SourceRange NNSRange = Importer.Import(D->getQualifierRange());
- ToVar->setQualifierInfo(NNS, NNSRange);
- }
+ ToVar->setQualifierInfo(Importer.Import(D->getQualifierLoc()));
ToVar->setAccess(D->getAccess());
ToVar->setLexicalDeclContext(LexicalDC);
Importer.Imported(D, ToVar);
@@ -3591,14 +3574,7 @@ Decl *ASTNodeImporter::VisitClassTemplateDecl(ClassTemplateDecl *D) {
Name.getAsIdentifierInfo(),
Importer.Import(DTemplated->getTagKeywordLoc()));
D2Templated->setAccess(DTemplated->getAccess());
-
-
- // Import the qualifier, if any.
- if (DTemplated->getQualifier()) {
- NestedNameSpecifier *NNS = Importer.Import(DTemplated->getQualifier());
- SourceRange NNSRange = Importer.Import(DTemplated->getQualifierRange());
- D2Templated->setQualifierInfo(NNS, NNSRange);
- }
+ D2Templated->setQualifierInfo(Importer.Import(DTemplated->getQualifierLoc()));
D2Templated->setLexicalDeclContext(LexicalDC);
// Create the class template declaration itself.
@@ -3703,12 +3679,7 @@ Decl *ASTNodeImporter::VisitClassTemplateSpecializationDecl(
ClassTemplate->AddSpecialization(D2, InsertPos);
// Import the qualifier, if any.
- if (D->getQualifier()) {
- NestedNameSpecifier *NNS = Importer.Import(D->getQualifier());
- SourceRange NNSRange = Importer.Import(D->getQualifierRange());
- D2->setQualifierInfo(NNS, NNSRange);
- }
-
+ D2->setQualifierInfo(Importer.Import(D->getQualifierLoc()));
// Add the specialization to this context.
D2->setLexicalDeclContext(LexicalDC);
@@ -4067,6 +4038,11 @@ NestedNameSpecifier *ASTImporter::Import(NestedNameSpecifier *FromNNS) {
return 0;
}
+NestedNameSpecifierLoc ASTImporter::Import(NestedNameSpecifierLoc FromNNS) {
+ // FIXME: Implement!
+ return NestedNameSpecifierLoc();
+}
+
TemplateName ASTImporter::Import(TemplateName From) {
switch (From.getKind()) {
case TemplateName::Template:
diff --git a/lib/AST/Decl.cpp b/lib/AST/Decl.cpp
index 56db8c7..73fe117 100644
--- a/lib/AST/Decl.cpp
+++ b/lib/AST/Decl.cpp
@@ -266,8 +266,12 @@ static LinkageInfo getLVForNamespaceScopeDecl(const NamedDecl *D, LVFlags F) {
return LinkageInfo::internal();
}
- if (D->isInAnonymousNamespace())
- return LinkageInfo::uniqueExternal();
+ if (D->isInAnonymousNamespace()) {
+ const VarDecl *Var = dyn_cast<VarDecl>(D);
+ const FunctionDecl *Func = dyn_cast<FunctionDecl>(D);
+ if ((!Var || !Var->isExternC()) && (!Func || !Func->isExternC()))
+ return LinkageInfo::uniqueExternal();
+ }
// Set up the defaults.
@@ -704,7 +708,7 @@ static LinkageInfo getLVForDecl(const NamedDecl *D, LVFlags Flags) {
// external linkage.
if (D->getLexicalDeclContext()->isFunctionOrMethod()) {
if (const FunctionDecl *Function = dyn_cast<FunctionDecl>(D)) {
- if (Function->isInAnonymousNamespace())
+ if (Function->isInAnonymousNamespace() && !Function->isExternC())
return LinkageInfo::uniqueExternal();
LinkageInfo LV;
@@ -725,7 +729,7 @@ static LinkageInfo getLVForDecl(const NamedDecl *D, LVFlags Flags) {
if (const VarDecl *Var = dyn_cast<VarDecl>(D))
if (Var->getStorageClass() == SC_Extern ||
Var->getStorageClass() == SC_PrivateExtern) {
- if (Var->isInAnonymousNamespace())
+ if (Var->isInAnonymousNamespace() && !Var->isExternC())
return LinkageInfo::uniqueExternal();
LinkageInfo LV;
@@ -837,8 +841,10 @@ bool NamedDecl::declarationReplaces(NamedDecl *OldD) const {
// UsingDirectiveDecl's are not really NamedDecl's, and all have same name.
// We want to keep it, unless it nominates same namespace.
if (getKind() == Decl::UsingDirective) {
- return cast<UsingDirectiveDecl>(this)->getNominatedNamespace() ==
- cast<UsingDirectiveDecl>(OldD)->getNominatedNamespace();
+ return cast<UsingDirectiveDecl>(this)->getNominatedNamespace()
+ ->getOriginalNamespace() ==
+ cast<UsingDirectiveDecl>(OldD)->getNominatedNamespace()
+ ->getOriginalNamespace();
}
if (const FunctionDecl *FD = dyn_cast<FunctionDecl>(this))
@@ -864,9 +870,13 @@ bool NamedDecl::declarationReplaces(NamedDecl *OldD) const {
return cast<UsingShadowDecl>(this)->getTargetDecl() ==
cast<UsingShadowDecl>(OldD)->getTargetDecl();
- if (isa<UsingDecl>(this) && isa<UsingDecl>(OldD))
- return cast<UsingDecl>(this)->getTargetNestedNameDecl() ==
- cast<UsingDecl>(OldD)->getTargetNestedNameDecl();
+ if (isa<UsingDecl>(this) && isa<UsingDecl>(OldD)) {
+ ASTContext &Context = getASTContext();
+ return Context.getCanonicalNestedNameSpecifier(
+ cast<UsingDecl>(this)->getQualifier()) ==
+ Context.getCanonicalNestedNameSpecifier(
+ cast<UsingDecl>(OldD)->getQualifier());
+ }
// For non-function declarations, if the declarations are of the
// same kind then this must be a redeclaration, or semantic analysis
@@ -927,9 +937,8 @@ SourceLocation DeclaratorDecl::getTypeSpecStartLoc() const {
return SourceLocation();
}
-void DeclaratorDecl::setQualifierInfo(NestedNameSpecifier *Qualifier,
- SourceRange QualifierRange) {
- if (Qualifier) {
+void DeclaratorDecl::setQualifierInfo(NestedNameSpecifierLoc QualifierLoc) {
+ if (QualifierLoc) {
// Make sure the extended decl info is allocated.
if (!hasExtInfo()) {
// Save (non-extended) type source info pointer.
@@ -940,12 +949,10 @@ void DeclaratorDecl::setQualifierInfo(NestedNameSpecifier *Qualifier,
getExtInfo()->TInfo = savedTInfo;
}
// Set qualifier info.
- getExtInfo()->NNS = Qualifier;
- getExtInfo()->NNSRange = QualifierRange;
+ getExtInfo()->QualifierLoc = QualifierLoc;
}
else {
// Here Qualifier == 0, i.e., we are removing the qualifier (if any).
- assert(QualifierRange.isInvalid());
if (hasExtInfo()) {
// Save type source info pointer.
TypeSourceInfo *savedTInfo = getExtInfo()->TInfo;
@@ -967,7 +974,7 @@ QualifierInfo::setTemplateParameterListsInfo(ASTContext &Context,
TemplateParameterList **TPLists) {
assert((NumTPLists == 0 || TPLists != 0) &&
"Empty array of template parameters with positive size!");
- assert((NumTPLists == 0 || NNS) &&
+ assert((NumTPLists == 0 || QualifierLoc) &&
"Nonempty array of template parameters with no qualifier!");
// Free previous template parameters (if any).
@@ -1037,8 +1044,11 @@ bool VarDecl::isExternC() const {
getStorageClass() != SC_Static) ||
(getDeclContext()->isFunctionOrMethod() && hasExternalStorage());
- for (const DeclContext *DC = getDeclContext(); !DC->isTranslationUnit();
- DC = DC->getParent()) {
+ const DeclContext *DC = getDeclContext();
+ if (DC->isFunctionOrMethod())
+ return false;
+
+ for (; !DC->isTranslationUnit(); DC = DC->getParent()) {
if (const LinkageSpecDecl *Linkage = dyn_cast<LinkageSpecDecl>(DC)) {
if (Linkage->getLanguage() == LinkageSpecDecl::lang_c)
return getStorageClass() != SC_Static;
@@ -1046,8 +1056,6 @@ bool VarDecl::isExternC() const {
break;
}
- if (DC->isFunctionOrMethod())
- return false;
}
return false;
@@ -1363,8 +1371,11 @@ bool FunctionDecl::isExternC() const {
if (!Context.getLangOptions().CPlusPlus)
return getStorageClass() != SC_Static && !getAttr<OverloadableAttr>();
- for (const DeclContext *DC = getDeclContext(); !DC->isTranslationUnit();
- DC = DC->getParent()) {
+ const DeclContext *DC = getDeclContext();
+ if (DC->isRecord())
+ return false;
+
+ for (; !DC->isTranslationUnit(); DC = DC->getParent()) {
if (const LinkageSpecDecl *Linkage = dyn_cast<LinkageSpecDecl>(DC)) {
if (Linkage->getLanguage() == LinkageSpecDecl::lang_c)
return getStorageClass() != SC_Static &&
@@ -1372,9 +1383,6 @@ bool FunctionDecl::isExternC() const {
break;
}
-
- if (DC->isRecord())
- break;
}
return isMain();
@@ -2018,19 +2026,16 @@ TagDecl* TagDecl::getDefinition() const {
return 0;
}
-void TagDecl::setQualifierInfo(NestedNameSpecifier *Qualifier,
- SourceRange QualifierRange) {
- if (Qualifier) {
+void TagDecl::setQualifierInfo(NestedNameSpecifierLoc QualifierLoc) {
+ if (QualifierLoc) {
// Make sure the extended qualifier info is allocated.
if (!hasExtInfo())
TypedefDeclOrQualifier = new (getASTContext()) ExtInfo;
// Set qualifier info.
- getExtInfo()->NNS = Qualifier;
- getExtInfo()->NNSRange = QualifierRange;
+ getExtInfo()->QualifierLoc = QualifierLoc;
}
else {
// Here Qualifier == 0, i.e., we are removing the qualifier (if any).
- assert(QualifierRange.isInvalid());
if (hasExtInfo()) {
getASTContext().Deallocate(getExtInfo());
TypedefDeclOrQualifier = (TypedefDecl*) 0;
@@ -2211,8 +2216,10 @@ NamespaceDecl *NamespaceDecl::getNextNamespace() {
}
ImplicitParamDecl *ImplicitParamDecl::Create(ASTContext &C, DeclContext *DC,
- SourceLocation L, IdentifierInfo *Id, QualType T) {
- return new (C) ImplicitParamDecl(ImplicitParam, DC, L, Id, T);
+ SourceLocation loc,
+ IdentifierInfo *name,
+ QualType type) {
+ return new (C) ImplicitParamDecl(DC, loc, name, type);
}
FunctionDecl *FunctionDecl::Create(ASTContext &C, DeclContext *DC,
diff --git a/lib/AST/DeclBase.cpp b/lib/AST/DeclBase.cpp
index be379d5..81df00d 100644
--- a/lib/AST/DeclBase.cpp
+++ b/lib/AST/DeclBase.cpp
@@ -465,6 +465,22 @@ void Decl::CheckAccessDeclContext() const {
#endif
}
+DeclContext *Decl::getNonClosureContext() {
+ DeclContext *DC = getDeclContext();
+
+ // This is basically "while (DC->isClosure()) DC = DC->getParent();"
+ // except that it's significantly more efficient to cast to a known
+ // decl type and call getDeclContext() than to call getParent().
+ do {
+ if (isa<BlockDecl>(DC)) {
+ DC = cast<BlockDecl>(DC)->getDeclContext();
+ continue;
+ }
+ } while (false);
+
+ assert(!DC->isClosure());
+ return DC;
+}
//===----------------------------------------------------------------------===//
// DeclContext Implementation
diff --git a/lib/AST/DeclCXX.cpp b/lib/AST/DeclCXX.cpp
index fba73f5..46768c1 100644
--- a/lib/AST/DeclCXX.cpp
+++ b/lib/AST/DeclCXX.cpp
@@ -1267,15 +1267,14 @@ LinkageSpecDecl *LinkageSpecDecl::Create(ASTContext &C,
UsingDirectiveDecl *UsingDirectiveDecl::Create(ASTContext &C, DeclContext *DC,
SourceLocation L,
SourceLocation NamespaceLoc,
- SourceRange QualifierRange,
- NestedNameSpecifier *Qualifier,
+ NestedNameSpecifierLoc QualifierLoc,
SourceLocation IdentLoc,
NamedDecl *Used,
DeclContext *CommonAncestor) {
if (NamespaceDecl *NS = dyn_cast_or_null<NamespaceDecl>(Used))
Used = NS->getOriginalNamespace();
- return new (C) UsingDirectiveDecl(DC, L, NamespaceLoc, QualifierRange,
- Qualifier, IdentLoc, Used, CommonAncestor);
+ return new (C) UsingDirectiveDecl(DC, L, NamespaceLoc, QualifierLoc,
+ IdentLoc, Used, CommonAncestor);
}
NamespaceDecl *UsingDirectiveDecl::getNominatedNamespace() {
@@ -1289,14 +1288,13 @@ NamespaceAliasDecl *NamespaceAliasDecl::Create(ASTContext &C, DeclContext *DC,
SourceLocation UsingLoc,
SourceLocation AliasLoc,
IdentifierInfo *Alias,
- SourceRange QualifierRange,
- NestedNameSpecifier *Qualifier,
+ NestedNameSpecifierLoc QualifierLoc,
SourceLocation IdentLoc,
NamedDecl *Namespace) {
if (NamespaceDecl *NS = dyn_cast_or_null<NamespaceDecl>(Namespace))
Namespace = NS->getOriginalNamespace();
- return new (C) NamespaceAliasDecl(DC, UsingLoc, AliasLoc, Alias, QualifierRange,
- Qualifier, IdentLoc, Namespace);
+ return new (C) NamespaceAliasDecl(DC, UsingLoc, AliasLoc, Alias,
+ QualifierLoc, IdentLoc, Namespace);
}
UsingDecl *UsingShadowDecl::getUsingDecl() const {
@@ -1337,35 +1335,31 @@ void UsingDecl::removeShadowDecl(UsingShadowDecl *S) {
S->UsingOrNextShadow = this;
}
-UsingDecl *UsingDecl::Create(ASTContext &C, DeclContext *DC,
- SourceRange NNR, SourceLocation UL,
- NestedNameSpecifier* TargetNNS,
+UsingDecl *UsingDecl::Create(ASTContext &C, DeclContext *DC, SourceLocation UL,
+ NestedNameSpecifierLoc QualifierLoc,
const DeclarationNameInfo &NameInfo,
bool IsTypeNameArg) {
- return new (C) UsingDecl(DC, NNR, UL, TargetNNS, NameInfo, IsTypeNameArg);
+ return new (C) UsingDecl(DC, UL, QualifierLoc, NameInfo, IsTypeNameArg);
}
UnresolvedUsingValueDecl *
UnresolvedUsingValueDecl::Create(ASTContext &C, DeclContext *DC,
SourceLocation UsingLoc,
- SourceRange TargetNNR,
- NestedNameSpecifier *TargetNNS,
+ NestedNameSpecifierLoc QualifierLoc,
const DeclarationNameInfo &NameInfo) {
return new (C) UnresolvedUsingValueDecl(DC, C.DependentTy, UsingLoc,
- TargetNNR, TargetNNS, NameInfo);
+ QualifierLoc, NameInfo);
}
UnresolvedUsingTypenameDecl *
UnresolvedUsingTypenameDecl::Create(ASTContext &C, DeclContext *DC,
SourceLocation UsingLoc,
SourceLocation TypenameLoc,
- SourceRange TargetNNR,
- NestedNameSpecifier *TargetNNS,
+ NestedNameSpecifierLoc QualifierLoc,
SourceLocation TargetNameLoc,
DeclarationName TargetName) {
return new (C) UnresolvedUsingTypenameDecl(DC, UsingLoc, TypenameLoc,
- TargetNNR, TargetNNS,
- TargetNameLoc,
+ QualifierLoc, TargetNameLoc,
TargetName.getAsIdentifierInfo());
}
diff --git a/lib/AST/DeclPrinter.cpp b/lib/AST/DeclPrinter.cpp
index 77b4257..c6ae128 100644
--- a/lib/AST/DeclPrinter.cpp
+++ b/lib/AST/DeclPrinter.cpp
@@ -918,20 +918,20 @@ void DeclPrinter::VisitObjCPropertyImplDecl(ObjCPropertyImplDecl *PID) {
void DeclPrinter::VisitUsingDecl(UsingDecl *D) {
Out << "using ";
- D->getTargetNestedNameDecl()->print(Out, Policy);
+ D->getQualifier()->print(Out, Policy);
Out << D;
}
void
DeclPrinter::VisitUnresolvedUsingTypenameDecl(UnresolvedUsingTypenameDecl *D) {
Out << "using typename ";
- D->getTargetNestedNameSpecifier()->print(Out, Policy);
+ D->getQualifier()->print(Out, Policy);
Out << D->getDeclName();
}
void DeclPrinter::VisitUnresolvedUsingValueDecl(UnresolvedUsingValueDecl *D) {
Out << "using ";
- D->getTargetNestedNameSpecifier()->print(Out, Policy);
+ D->getQualifier()->print(Out, Policy);
Out << D->getDeclName();
}
diff --git a/lib/AST/Expr.cpp b/lib/AST/Expr.cpp
index 391b26a..1c1061b 100644
--- a/lib/AST/Expr.cpp
+++ b/lib/AST/Expr.cpp
@@ -836,6 +836,19 @@ QualType CallExpr::getCallReturnType() const {
return FnType->getResultType();
}
+SourceRange CallExpr::getSourceRange() const {
+ if (isa<CXXOperatorCallExpr>(this))
+ return cast<CXXOperatorCallExpr>(this)->getSourceRange();
+
+ SourceLocation begin = getCallee()->getLocStart();
+ if (begin.isInvalid() && getNumArgs() > 0)
+ begin = getArg(0)->getLocStart();
+ SourceLocation end = getRParenLoc();
+ if (end.isInvalid() && getNumArgs() > 0)
+ end = getArg(getNumArgs() - 1)->getLocEnd();
+ return SourceRange(begin, end);
+}
+
OffsetOfExpr *OffsetOfExpr::Create(ASTContext &C, QualType type,
SourceLocation OperatorLoc,
TypeSourceInfo *tsi,
diff --git a/lib/AST/ExprCXX.cpp b/lib/AST/ExprCXX.cpp
index 28ff9fb..4f4a6b4 100644
--- a/lib/AST/ExprCXX.cpp
+++ b/lib/AST/ExprCXX.cpp
@@ -128,10 +128,10 @@ PseudoDestructorTypeStorage::PseudoDestructorTypeStorage(TypeSourceInfo *Info)
}
CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context,
- Expr *Base, bool isArrow, SourceLocation OperatorLoc,
- NestedNameSpecifier *Qualifier, SourceRange QualifierRange,
- TypeSourceInfo *ScopeType, SourceLocation ColonColonLoc,
- SourceLocation TildeLoc, PseudoDestructorTypeStorage DestroyedType)
+ Expr *Base, bool isArrow, SourceLocation OperatorLoc,
+ NestedNameSpecifierLoc QualifierLoc, TypeSourceInfo *ScopeType,
+ SourceLocation ColonColonLoc, SourceLocation TildeLoc,
+ PseudoDestructorTypeStorage DestroyedType)
: Expr(CXXPseudoDestructorExprClass,
Context.getPointerType(Context.getFunctionType(Context.VoidTy, 0, 0,
FunctionProtoType::ExtProtoInfo())),
@@ -142,15 +142,16 @@ CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context,
/*isValueDependent=*/Base->isValueDependent(),
// ContainsUnexpandedParameterPack
(Base->containsUnexpandedParameterPack() ||
- (Qualifier && Qualifier->containsUnexpandedParameterPack()) ||
+ (QualifierLoc &&
+ QualifierLoc.getNestedNameSpecifier()
+ ->containsUnexpandedParameterPack()) ||
(ScopeType &&
ScopeType->getType()->containsUnexpandedParameterPack()) ||
(DestroyedType.getTypeSourceInfo() &&
DestroyedType.getTypeSourceInfo()->getType()
->containsUnexpandedParameterPack()))),
Base(static_cast<Stmt *>(Base)), IsArrow(isArrow),
- OperatorLoc(OperatorLoc), Qualifier(Qualifier),
- QualifierRange(QualifierRange),
+ OperatorLoc(OperatorLoc), QualifierLoc(QualifierLoc),
ScopeType(ScopeType), ColonColonLoc(ColonColonLoc), TildeLoc(TildeLoc),
DestroyedType(DestroyedType) { }
@@ -282,15 +283,16 @@ CXXRecordDecl *OverloadExpr::getNamingClass() const {
// DependentScopeDeclRefExpr
DependentScopeDeclRefExpr::DependentScopeDeclRefExpr(QualType T,
- NestedNameSpecifier *Qualifier,
- SourceRange QualifierRange,
+ NestedNameSpecifierLoc QualifierLoc,
const DeclarationNameInfo &NameInfo,
const TemplateArgumentListInfo *Args)
: Expr(DependentScopeDeclRefExprClass, T, VK_LValue, OK_Ordinary,
true, true,
(NameInfo.containsUnexpandedParameterPack() ||
- (Qualifier && Qualifier->containsUnexpandedParameterPack()))),
- NameInfo(NameInfo), QualifierRange(QualifierRange), Qualifier(Qualifier),
+ (QualifierLoc &&
+ QualifierLoc.getNestedNameSpecifier()
+ ->containsUnexpandedParameterPack()))),
+ QualifierLoc(QualifierLoc), NameInfo(NameInfo),
HasExplicitTemplateArgs(Args != 0)
{
if (Args) {
@@ -306,16 +308,14 @@ DependentScopeDeclRefExpr::DependentScopeDeclRefExpr(QualType T,
DependentScopeDeclRefExpr *
DependentScopeDeclRefExpr::Create(ASTContext &C,
- NestedNameSpecifier *Qualifier,
- SourceRange QualifierRange,
+ NestedNameSpecifierLoc QualifierLoc,
const DeclarationNameInfo &NameInfo,
const TemplateArgumentListInfo *Args) {
std::size_t size = sizeof(DependentScopeDeclRefExpr);
if (Args)
size += ExplicitTemplateArgumentList::sizeFor(*Args);
void *Mem = C.Allocate(size);
- return new (Mem) DependentScopeDeclRefExpr(C.DependentTy,
- Qualifier, QualifierRange,
+ return new (Mem) DependentScopeDeclRefExpr(C.DependentTy, QualifierLoc,
NameInfo, Args);
}
@@ -328,13 +328,16 @@ DependentScopeDeclRefExpr::CreateEmpty(ASTContext &C,
size += ExplicitTemplateArgumentList::sizeFor(NumTemplateArgs);
void *Mem = C.Allocate(size);
DependentScopeDeclRefExpr *E
- = new (Mem) DependentScopeDeclRefExpr(QualType(), 0, SourceRange(),
+ = new (Mem) DependentScopeDeclRefExpr(QualType(), NestedNameSpecifierLoc(),
DeclarationNameInfo(), 0);
E->HasExplicitTemplateArgs = HasExplicitTemplateArgs;
return E;
}
SourceRange CXXConstructExpr::getSourceRange() const {
+ if (isa<CXXTemporaryObjectExpr>(this))
+ return cast<CXXTemporaryObjectExpr>(this)->getSourceRange();
+
if (ParenRange.isValid())
return SourceRange(Loc, ParenRange.getEnd());
@@ -397,13 +400,6 @@ CXXRecordDecl *CXXMemberCallExpr::getRecordDecl() {
return ThisArg->getType()->getAsCXXRecordDecl();
}
-SourceRange CXXMemberCallExpr::getSourceRange() const {
- SourceLocation LocStart = getCallee()->getLocStart();
- if (LocStart.isInvalid() && getNumArgs() > 0)
- LocStart = getArg(0)->getLocStart();
- return SourceRange(LocStart, getRParenLoc());
-}
-
//===----------------------------------------------------------------------===//
// Named casts
diff --git a/lib/AST/ExprConstant.cpp b/lib/AST/ExprConstant.cpp
index 656bb99..3a5eb66 100644
--- a/lib/AST/ExprConstant.cpp
+++ b/lib/AST/ExprConstant.cpp
@@ -2926,7 +2926,7 @@ static ICEDiag CheckICE(const Expr* E, ASTContext &Ctx) {
Exp->getOpcode() == BO_Rem) {
// Evaluate gives an error for undefined Div/Rem, so make sure
// we don't evaluate one.
- if (LHSResult.Val != 2 && RHSResult.Val != 2) {
+ if (LHSResult.Val == 0 && RHSResult.Val == 0) {
llvm::APSInt REval = Exp->getRHS()->EvaluateAsInt(Ctx);
if (REval == 0)
return ICEDiag(1, E->getLocStart());
diff --git a/lib/AST/ItaniumMangle.cpp b/lib/AST/ItaniumMangle.cpp
index d66c374..939ca7a 100644
--- a/lib/AST/ItaniumMangle.cpp
+++ b/lib/AST/ItaniumMangle.cpp
@@ -606,6 +606,9 @@ void CXXNameMangler::mangleUnresolvedScope(NestedNameSpecifier *Qualifier) {
case NestedNameSpecifier::Namespace:
mangleName(Qualifier->getAsNamespace());
break;
+ case NestedNameSpecifier::NamespaceAlias:
+ mangleName(Qualifier->getAsNamespaceAlias()->getNamespace());
+ break;
case NestedNameSpecifier::TypeSpec:
case NestedNameSpecifier::TypeSpecWithTemplate: {
const Type *QTy = Qualifier->getAsType();
@@ -1647,8 +1650,11 @@ void CXXNameMangler::mangleType(const DecltypeType *T) {
void CXXNameMangler::mangleType(const AutoType *T) {
QualType D = T->getDeducedType();
- assert(!D.isNull() && "can't mangle undeduced auto type");
- mangleType(D);
+ // <builtin-type> ::= Da # dependent auto
+ if (D.isNull())
+ Out << "Da";
+ else
+ mangleType(D);
}
void CXXNameMangler::mangleIntegerLiteral(QualType T,
diff --git a/lib/AST/NestedNameSpecifier.cpp b/lib/AST/NestedNameSpecifier.cpp
index 650321d..6f1ec05 100644
--- a/lib/AST/NestedNameSpecifier.cpp
+++ b/lib/AST/NestedNameSpecifier.cpp
@@ -14,8 +14,10 @@
#include "clang/AST/NestedNameSpecifier.h"
#include "clang/AST/ASTContext.h"
#include "clang/AST/Decl.h"
+#include "clang/AST/DeclCXX.h"
#include "clang/AST/PrettyPrinter.h"
#include "clang/AST/Type.h"
+#include "clang/AST/TypeLoc.h"
#include "llvm/Support/raw_ostream.h"
#include <cassert>
@@ -46,7 +48,7 @@ NestedNameSpecifier::Create(const ASTContext &Context,
NestedNameSpecifier Mockup;
Mockup.Prefix.setPointer(Prefix);
- Mockup.Prefix.setInt(Identifier);
+ Mockup.Prefix.setInt(StoredIdentifier);
Mockup.Specifier = II;
return FindOrInsert(Context, Mockup);
}
@@ -60,19 +62,34 @@ NestedNameSpecifier::Create(const ASTContext &Context,
"Broken nested name specifier");
NestedNameSpecifier Mockup;
Mockup.Prefix.setPointer(Prefix);
- Mockup.Prefix.setInt(Namespace);
+ Mockup.Prefix.setInt(StoredNamespaceOrAlias);
Mockup.Specifier = NS;
return FindOrInsert(Context, Mockup);
}
NestedNameSpecifier *
NestedNameSpecifier::Create(const ASTContext &Context,
+ NestedNameSpecifier *Prefix,
+ NamespaceAliasDecl *Alias) {
+ assert(Alias && "Namespace alias cannot be NULL");
+ assert((!Prefix ||
+ (Prefix->getAsType() == 0 && Prefix->getAsIdentifier() == 0)) &&
+ "Broken nested name specifier");
+ NestedNameSpecifier Mockup;
+ Mockup.Prefix.setPointer(Prefix);
+ Mockup.Prefix.setInt(StoredNamespaceOrAlias);
+ Mockup.Specifier = Alias;
+ return FindOrInsert(Context, Mockup);
+}
+
+NestedNameSpecifier *
+NestedNameSpecifier::Create(const ASTContext &Context,
NestedNameSpecifier *Prefix,
bool Template, const Type *T) {
assert(T && "Type cannot be NULL");
NestedNameSpecifier Mockup;
Mockup.Prefix.setPointer(Prefix);
- Mockup.Prefix.setInt(Template? TypeSpecWithTemplate : TypeSpec);
+ Mockup.Prefix.setInt(Template? StoredTypeSpecWithTemplate : StoredTypeSpec);
Mockup.Specifier = const_cast<Type*>(T);
return FindOrInsert(Context, Mockup);
}
@@ -82,7 +99,7 @@ NestedNameSpecifier::Create(const ASTContext &Context, IdentifierInfo *II) {
assert(II && "Identifier cannot be NULL");
NestedNameSpecifier Mockup;
Mockup.Prefix.setPointer(0);
- Mockup.Prefix.setInt(Identifier);
+ Mockup.Prefix.setInt(StoredIdentifier);
Mockup.Specifier = II;
return FindOrInsert(Context, Mockup);
}
@@ -94,6 +111,47 @@ NestedNameSpecifier::GlobalSpecifier(const ASTContext &Context) {
return Context.GlobalNestedNameSpecifier;
}
+NestedNameSpecifier::SpecifierKind NestedNameSpecifier::getKind() const {
+ if (Specifier == 0)
+ return Global;
+
+ switch (Prefix.getInt()) {
+ case StoredIdentifier:
+ return Identifier;
+
+ case StoredNamespaceOrAlias:
+ return isa<NamespaceDecl>(static_cast<NamedDecl *>(Specifier))? Namespace
+ : NamespaceAlias;
+
+ case StoredTypeSpec:
+ return TypeSpec;
+
+ case StoredTypeSpecWithTemplate:
+ return TypeSpecWithTemplate;
+ }
+
+ return Global;
+}
+
+/// \brief Retrieve the namespace stored in this nested name
+/// specifier.
+NamespaceDecl *NestedNameSpecifier::getAsNamespace() const {
+ if (Prefix.getInt() == StoredNamespaceOrAlias)
+ return dyn_cast<NamespaceDecl>(static_cast<NamedDecl *>(Specifier));
+
+ return 0;
+}
+
+/// \brief Retrieve the namespace alias stored in this nested name
+/// specifier.
+NamespaceAliasDecl *NestedNameSpecifier::getAsNamespaceAlias() const {
+ if (Prefix.getInt() == StoredNamespaceOrAlias)
+ return dyn_cast<NamespaceAliasDecl>(static_cast<NamedDecl *>(Specifier));
+
+ return 0;
+}
+
+
/// \brief Whether this nested name specifier refers to a dependent
/// type or not.
bool NestedNameSpecifier::isDependent() const {
@@ -103,6 +161,7 @@ bool NestedNameSpecifier::isDependent() const {
return true;
case Namespace:
+ case NamespaceAlias:
case Global:
return false;
@@ -121,6 +180,7 @@ bool NestedNameSpecifier::containsUnexpandedParameterPack() const {
return getPrefix() && getPrefix()->containsUnexpandedParameterPack();
case Namespace:
+ case NamespaceAlias:
case Global:
return false;
@@ -147,7 +207,11 @@ NestedNameSpecifier::print(llvm::raw_ostream &OS,
break;
case Namespace:
- OS << getAsNamespace()->getIdentifier()->getName();
+ OS << getAsNamespace()->getName();
+ break;
+
+ case NamespaceAlias:
+ OS << getAsNamespaceAlias()->getName();
break;
case Global:
@@ -199,3 +263,111 @@ NestedNameSpecifier::print(llvm::raw_ostream &OS,
void NestedNameSpecifier::dump(const LangOptions &LO) {
print(llvm::errs(), PrintingPolicy(LO));
}
+
+unsigned
+NestedNameSpecifierLoc::getLocalDataLength(NestedNameSpecifier *Qualifier) {
+ assert(Qualifier && "Expected a non-NULL qualifier");
+
+ // Location of the trailing '::'.
+ unsigned Length = sizeof(unsigned);
+
+ switch (Qualifier->getKind()) {
+ case NestedNameSpecifier::Global:
+ // Nothing more to add.
+ break;
+
+ case NestedNameSpecifier::Identifier:
+ case NestedNameSpecifier::Namespace:
+ case NestedNameSpecifier::NamespaceAlias:
+ // The location of the identifier or namespace name.
+ Length += sizeof(unsigned);
+ break;
+
+ case NestedNameSpecifier::TypeSpecWithTemplate:
+ case NestedNameSpecifier::TypeSpec:
+ // The "void*" that points at the TypeLoc data.
+ // Note: the 'template' keyword is part of the TypeLoc.
+ Length += sizeof(void *);
+ break;
+ }
+
+ return Length;
+}
+
+unsigned
+NestedNameSpecifierLoc::getDataLength(NestedNameSpecifier *Qualifier) {
+ unsigned Length = 0;
+ for (; Qualifier; Qualifier = Qualifier->getPrefix())
+ Length += getLocalDataLength(Qualifier);
+ return Length;
+}
+
+namespace {
+ /// \brief Load a (possibly unaligned) source location from a given address
+ /// and offset.
+ SourceLocation LoadSourceLocation(void *Data, unsigned Offset) {
+ unsigned Raw;
+ memcpy(&Raw, static_cast<char *>(Data) + Offset, sizeof(unsigned));
+ return SourceLocation::getFromRawEncoding(Raw);
+ }
+
+ /// \brief Load a (possibly unaligned) pointer from a given address and
+ /// offset.
+ void *LoadPointer(void *Data, unsigned Offset) {
+ void *Result;
+ memcpy(&Result, static_cast<char *>(Data) + Offset, sizeof(void*));
+ return Result;
+ }
+}
+
+SourceRange NestedNameSpecifierLoc::getSourceRange() const {
+ if (!Qualifier)
+ return SourceRange();
+
+ NestedNameSpecifierLoc First = *this;
+ while (NestedNameSpecifierLoc Prefix = First.getPrefix())
+ First = Prefix;
+
+ return SourceRange(First.getLocalSourceRange().getBegin(),
+ getLocalSourceRange().getEnd());
+}
+
+SourceRange NestedNameSpecifierLoc::getLocalSourceRange() const {
+ if (!Qualifier)
+ return SourceRange();
+
+ unsigned Offset = getDataLength(Qualifier->getPrefix());
+ switch (Qualifier->getKind()) {
+ case NestedNameSpecifier::Global:
+ return LoadSourceLocation(Data, Offset);
+
+ case NestedNameSpecifier::Identifier:
+ case NestedNameSpecifier::Namespace:
+ case NestedNameSpecifier::NamespaceAlias:
+ return SourceRange(LoadSourceLocation(Data, Offset),
+ LoadSourceLocation(Data, Offset + sizeof(unsigned)));
+
+ case NestedNameSpecifier::TypeSpecWithTemplate:
+ case NestedNameSpecifier::TypeSpec: {
+ // The "void*" that points at the TypeLoc data.
+ // Note: the 'template' keyword is part of the TypeLoc.
+ void *TypeData = LoadPointer(Data, Offset);
+ TypeLoc TL(Qualifier->getAsType(), TypeData);
+ return SourceRange(TL.getBeginLoc(),
+ LoadSourceLocation(Data, Offset + sizeof(void*)));
+ }
+ }
+
+ return SourceRange();
+}
+
+TypeLoc NestedNameSpecifierLoc::getTypeLoc() const {
+ assert((Qualifier->getKind() == NestedNameSpecifier::TypeSpec ||
+ Qualifier->getKind() == NestedNameSpecifier::TypeSpecWithTemplate) &&
+ "Nested-name-specifier location is not a type");
+
+ // The "void*" that points at the TypeLoc data.
+ unsigned Offset = getDataLength(Qualifier->getPrefix());
+ void *TypeData = LoadPointer(Data, Offset);
+ return TypeLoc(Qualifier->getAsType(), TypeData);
+}
diff --git a/lib/AST/RecordLayoutBuilder.cpp b/lib/AST/RecordLayoutBuilder.cpp
index cf14eba..4ed031f 100644
--- a/lib/AST/RecordLayoutBuilder.cpp
+++ b/lib/AST/RecordLayoutBuilder.cpp
@@ -698,6 +698,25 @@ protected:
DiagnosticBuilder Diag(SourceLocation Loc, unsigned DiagID);
+ CharUnits getSize() const {
+ assert(Size % Context.getCharWidth() == 0);
+ return Context.toCharUnitsFromBits(Size);
+ }
+ uint64_t getSizeInBits() const { return Size; }
+
+ void setSize(CharUnits NewSize) { Size = Context.toBits(NewSize); }
+ void setSize(uint64_t NewSize) { Size = NewSize; }
+
+ CharUnits getDataSize() const {
+ assert(DataSize % Context.getCharWidth() == 0);
+ return Context.toCharUnitsFromBits(DataSize);
+ }
+ uint64_t getDataSizeInBits() const { return DataSize; }
+
+ void setDataSize(CharUnits NewSize) { DataSize = Context.toBits(NewSize); }
+ void setDataSize(uint64_t NewSize) { DataSize = NewSize; }
+
+
RecordLayoutBuilder(const RecordLayoutBuilder&); // DO NOT IMPLEMENT
void operator=(const RecordLayoutBuilder&); // DO NOT IMPLEMENT
public:
@@ -796,8 +815,8 @@ void RecordLayoutBuilder::DeterminePrimaryBase(const CXXRecordDecl *RD) {
assert(DataSize == 0 && "Vtable pointer must be at offset zero!");
// Update the size.
- Size += GetVirtualPointersSize(RD);
- DataSize = Size;
+ setSize(getSizeInBits() + GetVirtualPointersSize(RD));
+ setDataSize(getSizeInBits());
CharUnits UnpackedBaseAlign =
Context.toCharUnitsFromBits(Context.Target.getPointerAlign(0));
@@ -1090,7 +1109,7 @@ CharUnits RecordLayoutBuilder::LayoutBase(const BaseSubobjectInfo *Base) {
if (Base->Class->isEmpty() &&
EmptySubobjects->CanPlaceBaseAtOffset(Base, CharUnits::Zero())) {
uint64_t RecordSizeInBits = Context.toBits(Layout.getSize());
- Size = std::max(Size, RecordSizeInBits);
+ setSize(std::max(getSizeInBits(), RecordSizeInBits));
return CharUnits::Zero();
}
@@ -1106,7 +1125,7 @@ CharUnits RecordLayoutBuilder::LayoutBase(const BaseSubobjectInfo *Base) {
// Round up the current record size to the base's alignment boundary.
uint64_t Offset =
- llvm::RoundUpToAlignment(DataSize, Context.toBits(BaseAlign));
+ llvm::RoundUpToAlignment(getDataSizeInBits(), Context.toBits(BaseAlign));
// Try to place the base.
while (!EmptySubobjects->CanPlaceBaseAtOffset(Base,
@@ -1115,11 +1134,12 @@ CharUnits RecordLayoutBuilder::LayoutBase(const BaseSubobjectInfo *Base) {
if (!Base->Class->isEmpty()) {
// Update the data size.
- DataSize = Offset + Context.toBits(Layout.getNonVirtualSize());
+ setDataSize(Offset + Context.toBits(Layout.getNonVirtualSize()));
- Size = std::max(Size, DataSize);
+ setSize(std::max(getSizeInBits(), getDataSizeInBits()));
} else
- Size = std::max(Size, Offset + Context.toBits(Layout.getSize()));
+ setSize(std::max(getSizeInBits(),
+ Offset + Context.toBits(Layout.getSize())));
// Remember max struct/class alignment.
UpdateAlignment(BaseAlign, UnpackedBaseAlign);
@@ -1167,7 +1187,8 @@ void RecordLayoutBuilder::Layout(const CXXRecordDecl *RD) {
LayoutFields(RD);
- NonVirtualSize = Context.toCharUnitsFromBits(Size);
+ // FIXME: Size isn't always an exact multiple of the char width. Round up?
+ NonVirtualSize = Context.toCharUnitsFromBits(getSizeInBits());
NonVirtualAlignment = Alignment;
// Lay out the virtual bases and add the primary virtual base offsets.
@@ -1211,8 +1232,8 @@ void RecordLayoutBuilder::Layout(const ObjCInterfaceDecl *D) {
// We start laying out ivars not at the end of the superclass
// structure, but at the next byte following the last field.
- Size = Context.toBits(SL.getDataSize());
- DataSize = Size;
+ setSize(SL.getDataSize());
+ setDataSize(getSizeInBits());
}
InitializeLayout(D);
@@ -1270,20 +1291,20 @@ void RecordLayoutBuilder::LayoutWideBitField(uint64_t FieldSize,
UnfilledBitsInLastByte = 0;
uint64_t FieldOffset;
- uint64_t UnpaddedFieldOffset = DataSize - UnfilledBitsInLastByte;
+ uint64_t UnpaddedFieldOffset = getDataSizeInBits() - UnfilledBitsInLastByte;
if (IsUnion) {
- DataSize = std::max(DataSize, FieldSize);
+ setDataSize(std::max(getDataSizeInBits(), FieldSize));
FieldOffset = 0;
} else {
// The bitfield is allocated starting at the next offset aligned appropriately
// for T', with length n bits.
- FieldOffset = llvm::RoundUpToAlignment(DataSize, TypeAlign);
+ FieldOffset = llvm::RoundUpToAlignment(getDataSizeInBits(), TypeAlign);
uint64_t NewSizeInBits = FieldOffset + FieldSize;
- DataSize = llvm::RoundUpToAlignment(NewSizeInBits, 8);
- UnfilledBitsInLastByte = DataSize - NewSizeInBits;
+ setDataSize(llvm::RoundUpToAlignment(NewSizeInBits, 8));
+ UnfilledBitsInLastByte = getDataSizeInBits() - NewSizeInBits;
}
// Place this field at the current location.
@@ -1293,7 +1314,7 @@ void RecordLayoutBuilder::LayoutWideBitField(uint64_t FieldSize,
TypeAlign, FieldPacked, D);
// Update the size.
- Size = std::max(Size, DataSize);
+ setSize(std::max(getSizeInBits(), getDataSizeInBits()));
// Remember max struct/class alignment.
UpdateAlignment(Context.toCharUnitsFromBits(TypeAlign));
@@ -1301,7 +1322,7 @@ void RecordLayoutBuilder::LayoutWideBitField(uint64_t FieldSize,
void RecordLayoutBuilder::LayoutBitField(const FieldDecl *D) {
bool FieldPacked = Packed || D->hasAttr<PackedAttr>();
- uint64_t UnpaddedFieldOffset = DataSize - UnfilledBitsInLastByte;
+ uint64_t UnpaddedFieldOffset = getDataSizeInBits() - UnfilledBitsInLastByte;
uint64_t FieldOffset = IsUnion ? 0 : UnpaddedFieldOffset;
uint64_t FieldSize = D->getBitWidth()->EvaluateAsInt(Context).getZExtValue();
@@ -1355,16 +1376,16 @@ void RecordLayoutBuilder::LayoutBitField(const FieldDecl *D) {
// Update DataSize to include the last byte containing (part of) the bitfield.
if (IsUnion) {
// FIXME: I think FieldSize should be TypeSize here.
- DataSize = std::max(DataSize, FieldSize);
+ setDataSize(std::max(getDataSizeInBits(), FieldSize));
} else {
uint64_t NewSizeInBits = FieldOffset + FieldSize;
- DataSize = llvm::RoundUpToAlignment(NewSizeInBits, 8);
- UnfilledBitsInLastByte = DataSize - NewSizeInBits;
+ setDataSize(llvm::RoundUpToAlignment(NewSizeInBits, 8));
+ UnfilledBitsInLastByte = getDataSizeInBits() - NewSizeInBits;
}
// Update the size.
- Size = std::max(Size, DataSize);
+ setSize(std::max(getSizeInBits(), getDataSizeInBits()));
// Remember max struct/class alignment.
UpdateAlignment(Context.toCharUnitsFromBits(FieldAlign),
@@ -1377,14 +1398,14 @@ void RecordLayoutBuilder::LayoutField(const FieldDecl *D) {
return;
}
- uint64_t UnpaddedFieldOffset = DataSize - UnfilledBitsInLastByte;
+ uint64_t UnpaddedFieldOffset = getDataSizeInBits() - UnfilledBitsInLastByte;
// Reset the unfilled bits.
UnfilledBitsInLastByte = 0;
bool FieldPacked = Packed || D->hasAttr<PackedAttr>();
CharUnits FieldOffset =
- IsUnion ? CharUnits::Zero() : Context.toCharUnitsFromBits(DataSize);
+ IsUnion ? CharUnits::Zero() : getDataSize();
CharUnits FieldSize;
CharUnits FieldAlign;
@@ -1464,12 +1485,12 @@ void RecordLayoutBuilder::LayoutField(const FieldDecl *D) {
// Reserve space for this field.
uint64_t FieldSizeInBits = Context.toBits(FieldSize);
if (IsUnion)
- Size = std::max(Size, FieldSizeInBits);
+ setSize(std::max(getSizeInBits(), FieldSizeInBits));
else
- Size = Context.toBits(FieldOffset) + FieldSizeInBits;
+ setSize(Context.toBits(FieldOffset) + FieldSizeInBits);
// Update the data size.
- DataSize = Size;
+ setDataSize(getSizeInBits());
// Remember max struct/class alignment.
UpdateAlignment(FieldAlign, UnpackedFieldAlign);
@@ -1477,29 +1498,30 @@ void RecordLayoutBuilder::LayoutField(const FieldDecl *D) {
void RecordLayoutBuilder::FinishLayout(const NamedDecl *D) {
// In C++, records cannot be of size 0.
- if (Context.getLangOptions().CPlusPlus && Size == 0) {
+ if (Context.getLangOptions().CPlusPlus && getSizeInBits() == 0) {
if (const CXXRecordDecl *RD = dyn_cast<CXXRecordDecl>(D)) {
// Compatibility with gcc requires a class (pod or non-pod)
// which is not empty but of size 0; such as having fields of
// array of zero-length, remains of Size 0
if (RD->isEmpty())
- Size = 8;
+ setSize(8);
}
else
- Size = 8;
+ setSize(8);
}
// Finally, round the size of the record up to the alignment of the
// record itself.
- uint64_t UnpaddedSize = Size - UnfilledBitsInLastByte;
+ uint64_t UnpaddedSize = getSizeInBits() - UnfilledBitsInLastByte;
uint64_t UnpackedSize =
- llvm::RoundUpToAlignment(Size, Context.toBits(UnpackedAlignment));
- Size = llvm::RoundUpToAlignment(Size, Context.toBits(Alignment));
+ llvm::RoundUpToAlignment(getSizeInBits(),
+ Context.toBits(UnpackedAlignment));
+ setSize(llvm::RoundUpToAlignment(getSizeInBits(), Context.toBits(Alignment)));
unsigned CharBitNum = Context.Target.getCharWidth();
if (const RecordDecl *RD = dyn_cast<RecordDecl>(D)) {
// Warn if padding was introduced to the struct/class/union.
- if (Size > UnpaddedSize) {
- unsigned PadSize = Size - UnpaddedSize;
+ if (getSizeInBits() > UnpaddedSize) {
+ unsigned PadSize = getSizeInBits() - UnpaddedSize;
bool InBits = true;
if (PadSize % CharBitNum == 0) {
PadSize = PadSize / CharBitNum;
@@ -1513,7 +1535,8 @@ void RecordLayoutBuilder::FinishLayout(const NamedDecl *D) {
// Warn if we packed it unnecessarily. If the alignment is 1 byte don't
// bother since there won't be alignment issues.
- if (Packed && UnpackedAlignment > CharUnits::One() && Size == UnpackedSize)
+ if (Packed && UnpackedAlignment > CharUnits::One() &&
+ getSizeInBits() == UnpackedSize)
Diag(D->getLocation(), diag::warn_unnecessary_packed)
<< Context.getTypeDeclType(RD);
}
diff --git a/lib/AST/Stmt.cpp b/lib/AST/Stmt.cpp
index 7e73f02..8a80275 100644
--- a/lib/AST/Stmt.cpp
+++ b/lib/AST/Stmt.cpp
@@ -218,6 +218,10 @@ unsigned AsmStmt::getNumPlusOperands() const {
Expr *AsmStmt::getInputExpr(unsigned i) {
return cast<Expr>(Exprs[i + NumOutputs]);
}
+void AsmStmt::setInputExpr(unsigned i, Expr *E) {
+ Exprs[i + NumOutputs] = E;
+}
+
/// getInputConstraint - Return the specified input constraint. Unlike output
/// constraints, these can be empty.
diff --git a/lib/AST/StmtDumper.cpp b/lib/AST/StmtDumper.cpp
index 846bd4c..5c7dbb3 100644
--- a/lib/AST/StmtDumper.cpp
+++ b/lib/AST/StmtDumper.cpp
@@ -279,8 +279,8 @@ void StmtDumper::DumpDeclarator(Decl *D) {
// print using decl (e.g. "using std::string;")
const char *tn = UD->isTypeName() ? "typename " : "";
OS << '"' << UD->getDeclKindName() << tn;
- UD->getTargetNestedNameDecl()->print(OS,
- PrintingPolicy(UD->getASTContext().getLangOptions()));
+ UD->getQualifier()->print(OS,
+ PrintingPolicy(UD->getASTContext().getLangOptions()));
OS << ";\"";
} else if (LabelDecl *LD = dyn_cast<LabelDecl>(D)) {
OS << "label " << LD->getNameAsString();
diff --git a/lib/AST/TemplateBase.cpp b/lib/AST/TemplateBase.cpp
index 5ab5f46..1764f4a 100644
--- a/lib/AST/TemplateBase.cpp
+++ b/lib/AST/TemplateBase.cpp
@@ -24,8 +24,6 @@
#include "llvm/ADT/FoldingSet.h"
#include <algorithm>
#include <cctype>
-#include <iomanip>
-#include <sstream>
using namespace clang;
@@ -42,17 +40,11 @@ static void printIntegral(const TemplateArgument &TemplArg,
if (T->isBooleanType()) {
Out << (Val->getBoolValue() ? "true" : "false");
} else if (T->isCharType()) {
- char Ch = Val->getSExtValue();
- if (std::isprint(Ch)) {
- Out << "'";
- if (Ch == '\'' || Ch == '\\')
- Out << '\\';
- Out << Ch << "'";
- } else {
- std::ostringstream Str;
- Str << std::setw(2) << std::setfill('0') << std::hex << (int)Ch;
- Out << "'\\x" << Str.str() << "'";
- }
+ const unsigned char Ch = Val->getZExtValue();
+ const std::string Str(1, Ch);
+ Out << ((Ch == '\'') ? "'\\" : "'");
+ Out.write_escaped(Str, /*UseHexEscapes=*/ true);
+ Out << "'";
} else {
Out << Val->toString(10);
}
OpenPOWER on IntegriCloud