summaryrefslogtreecommitdiffstats
path: root/contrib/llvm/lib/Target/PowerPC
diff options
context:
space:
mode:
Diffstat (limited to 'contrib/llvm/lib/Target/PowerPC')
-rw-r--r--contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.cpp294
-rw-r--r--contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.h69
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCAsmBackend.cpp195
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCELFObjectWriter.cpp277
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCFixupKinds.h54
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.cpp70
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.h35
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCCodeEmitter.cpp239
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.cpp160
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.h68
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.cpp31
-rw-r--r--contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.h43
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPC.h90
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPC.td240
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCAsmPrinter.cpp1126
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCBranchSelector.cpp195
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCCTRLoops.cpp775
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCCallingConv.td144
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCCodeEmitter.cpp271
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.cpp1329
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.h293
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.cpp245
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.h91
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCISelDAGToDAG.cpp1565
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCISelLowering.cpp7554
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCISelLowering.h632
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstr64Bit.td968
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstrAltivec.td828
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstrBuilder.h43
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstrFormats.td1003
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.cpp731
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.h157
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.td1717
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCJITInfo.cpp471
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCJITInfo.h49
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCMCInstLower.cpp194
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.cpp15
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.h162
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCPerfectShuffle.h6586
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.cpp618
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.h90
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.td232
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCRelocations.h56
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCSchedule.td519
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCSchedule440.td663
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleA2.td766
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleE500mc.td265
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleE5500.td309
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleG3.td71
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleG4.td81
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleG4Plus.td88
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCScheduleG5.td109
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.cpp23
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.h31
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCSubtarget.cpp159
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCSubtarget.h200
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.cpp137
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.h100
-rw-r--r--contrib/llvm/lib/Target/PowerPC/PPCTargetTransformInfo.cpp240
-rw-r--r--contrib/llvm/lib/Target/PowerPC/TargetInfo/PowerPCTargetInfo.cpp23
60 files changed, 33789 insertions, 0 deletions
diff --git a/contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.cpp b/contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.cpp
new file mode 100644
index 0000000..bacc108
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.cpp
@@ -0,0 +1,294 @@
+//===-- PPCInstPrinter.cpp - Convert PPC MCInst to assembly syntax --------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This class prints an PPC MCInst to a .s file.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "asm-printer"
+#include "PPCInstPrinter.h"
+#include "MCTargetDesc/PPCMCTargetDesc.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "llvm/MC/MCExpr.h"
+#include "llvm/MC/MCInst.h"
+#include "llvm/MC/MCInstrInfo.h"
+#include "llvm/Support/raw_ostream.h"
+using namespace llvm;
+
+#include "PPCGenAsmWriter.inc"
+
+void PPCInstPrinter::printRegName(raw_ostream &OS, unsigned RegNo) const {
+ OS << getRegisterName(RegNo);
+}
+
+void PPCInstPrinter::printInst(const MCInst *MI, raw_ostream &O,
+ StringRef Annot) {
+ // Check for slwi/srwi mnemonics.
+ if (MI->getOpcode() == PPC::RLWINM) {
+ unsigned char SH = MI->getOperand(2).getImm();
+ unsigned char MB = MI->getOperand(3).getImm();
+ unsigned char ME = MI->getOperand(4).getImm();
+ bool useSubstituteMnemonic = false;
+ if (SH <= 31 && MB == 0 && ME == (31-SH)) {
+ O << "\tslwi "; useSubstituteMnemonic = true;
+ }
+ if (SH <= 31 && MB == (32-SH) && ME == 31) {
+ O << "\tsrwi "; useSubstituteMnemonic = true;
+ SH = 32-SH;
+ }
+ if (useSubstituteMnemonic) {
+ printOperand(MI, 0, O);
+ O << ", ";
+ printOperand(MI, 1, O);
+ O << ", " << (unsigned int)SH;
+
+ printAnnotation(O, Annot);
+ return;
+ }
+ }
+
+ if ((MI->getOpcode() == PPC::OR || MI->getOpcode() == PPC::OR8) &&
+ MI->getOperand(1).getReg() == MI->getOperand(2).getReg()) {
+ O << "\tmr ";
+ printOperand(MI, 0, O);
+ O << ", ";
+ printOperand(MI, 1, O);
+ printAnnotation(O, Annot);
+ return;
+ }
+
+ if (MI->getOpcode() == PPC::RLDICR) {
+ unsigned char SH = MI->getOperand(2).getImm();
+ unsigned char ME = MI->getOperand(3).getImm();
+ // rldicr RA, RS, SH, 63-SH == sldi RA, RS, SH
+ if (63-SH == ME) {
+ O << "\tsldi ";
+ printOperand(MI, 0, O);
+ O << ", ";
+ printOperand(MI, 1, O);
+ O << ", " << (unsigned int)SH;
+ printAnnotation(O, Annot);
+ return;
+ }
+ }
+
+ printInstruction(MI, O);
+ printAnnotation(O, Annot);
+}
+
+
+void PPCInstPrinter::printPredicateOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O,
+ const char *Modifier) {
+ unsigned Code = MI->getOperand(OpNo).getImm();
+
+ if (StringRef(Modifier) == "cc") {
+ switch ((PPC::Predicate)Code) {
+ case PPC::PRED_LT: O << "lt"; return;
+ case PPC::PRED_LE: O << "le"; return;
+ case PPC::PRED_EQ: O << "eq"; return;
+ case PPC::PRED_GE: O << "ge"; return;
+ case PPC::PRED_GT: O << "gt"; return;
+ case PPC::PRED_NE: O << "ne"; return;
+ case PPC::PRED_UN: O << "un"; return;
+ case PPC::PRED_NU: O << "nu"; return;
+ }
+ }
+
+ assert(StringRef(Modifier) == "reg" &&
+ "Need to specify 'cc' or 'reg' as predicate op modifier!");
+ printOperand(MI, OpNo+1, O);
+}
+
+void PPCInstPrinter::printS5ImmOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ int Value = MI->getOperand(OpNo).getImm();
+ Value = SignExtend32<5>(Value);
+ O << (int)Value;
+}
+
+void PPCInstPrinter::printU5ImmOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ unsigned int Value = MI->getOperand(OpNo).getImm();
+ assert(Value <= 31 && "Invalid u5imm argument!");
+ O << (unsigned int)Value;
+}
+
+void PPCInstPrinter::printU6ImmOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ unsigned int Value = MI->getOperand(OpNo).getImm();
+ assert(Value <= 63 && "Invalid u6imm argument!");
+ O << (unsigned int)Value;
+}
+
+void PPCInstPrinter::printS16ImmOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ O << (short)MI->getOperand(OpNo).getImm();
+}
+
+void PPCInstPrinter::printU16ImmOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ O << (unsigned short)MI->getOperand(OpNo).getImm();
+}
+
+void PPCInstPrinter::printS16X4ImmOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ if (MI->getOperand(OpNo).isImm())
+ O << (short)(MI->getOperand(OpNo).getImm()*4);
+ else
+ printOperand(MI, OpNo, O);
+}
+
+void PPCInstPrinter::printBranchOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ if (!MI->getOperand(OpNo).isImm())
+ return printOperand(MI, OpNo, O);
+
+ // Branches can take an immediate operand. This is used by the branch
+ // selection pass to print $+8, an eight byte displacement from the PC.
+ O << "$+";
+ printAbsAddrOperand(MI, OpNo, O);
+}
+
+void PPCInstPrinter::printAbsAddrOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ O << (int)MI->getOperand(OpNo).getImm()*4;
+}
+
+
+void PPCInstPrinter::printcrbitm(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ unsigned CCReg = MI->getOperand(OpNo).getReg();
+ unsigned RegNo;
+ switch (CCReg) {
+ default: llvm_unreachable("Unknown CR register");
+ case PPC::CR0: RegNo = 0; break;
+ case PPC::CR1: RegNo = 1; break;
+ case PPC::CR2: RegNo = 2; break;
+ case PPC::CR3: RegNo = 3; break;
+ case PPC::CR4: RegNo = 4; break;
+ case PPC::CR5: RegNo = 5; break;
+ case PPC::CR6: RegNo = 6; break;
+ case PPC::CR7: RegNo = 7; break;
+ }
+ O << (0x80 >> RegNo);
+}
+
+void PPCInstPrinter::printMemRegImm(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ printSymbolLo(MI, OpNo, O);
+ O << '(';
+ if (MI->getOperand(OpNo+1).getReg() == PPC::R0)
+ O << "0";
+ else
+ printOperand(MI, OpNo+1, O);
+ O << ')';
+}
+
+void PPCInstPrinter::printMemRegImmShifted(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ if (MI->getOperand(OpNo).isImm())
+ printS16X4ImmOperand(MI, OpNo, O);
+ else
+ printSymbolLo(MI, OpNo, O);
+ O << '(';
+
+ if (MI->getOperand(OpNo+1).getReg() == PPC::R0)
+ O << "0";
+ else
+ printOperand(MI, OpNo+1, O);
+ O << ')';
+}
+
+
+void PPCInstPrinter::printMemRegReg(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ // When used as the base register, r0 reads constant zero rather than
+ // the value contained in the register. For this reason, the darwin
+ // assembler requires that we print r0 as 0 (no r) when used as the base.
+ if (MI->getOperand(OpNo).getReg() == PPC::R0)
+ O << "0";
+ else
+ printOperand(MI, OpNo, O);
+ O << ", ";
+ printOperand(MI, OpNo+1, O);
+}
+
+
+
+/// stripRegisterPrefix - This method strips the character prefix from a
+/// register name so that only the number is left. Used by for linux asm.
+static const char *stripRegisterPrefix(const char *RegName) {
+ switch (RegName[0]) {
+ case 'r':
+ case 'f':
+ case 'v': return RegName + 1;
+ case 'c': if (RegName[1] == 'r') return RegName + 2;
+ }
+
+ return RegName;
+}
+
+void PPCInstPrinter::printOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ const MCOperand &Op = MI->getOperand(OpNo);
+ if (Op.isReg()) {
+ const char *RegName = getRegisterName(Op.getReg());
+ // The linux and AIX assembler does not take register prefixes.
+ if (!isDarwinSyntax())
+ RegName = stripRegisterPrefix(RegName);
+
+ O << RegName;
+ return;
+ }
+
+ if (Op.isImm()) {
+ O << Op.getImm();
+ return;
+ }
+
+ assert(Op.isExpr() && "unknown operand kind in printOperand");
+ O << *Op.getExpr();
+}
+
+void PPCInstPrinter::printSymbolLo(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ if (MI->getOperand(OpNo).isImm())
+ return printS16ImmOperand(MI, OpNo, O);
+
+ // FIXME: This is a terrible hack because we can't encode lo16() as an operand
+ // flag of a subtraction. See the FIXME in GetSymbolRef in PPCMCInstLower.
+ if (MI->getOperand(OpNo).isExpr() &&
+ isa<MCBinaryExpr>(MI->getOperand(OpNo).getExpr())) {
+ O << "lo16(";
+ printOperand(MI, OpNo, O);
+ O << ')';
+ } else {
+ printOperand(MI, OpNo, O);
+ }
+}
+
+void PPCInstPrinter::printSymbolHi(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O) {
+ if (MI->getOperand(OpNo).isImm())
+ return printS16ImmOperand(MI, OpNo, O);
+
+ // FIXME: This is a terrible hack because we can't encode lo16() as an operand
+ // flag of a subtraction. See the FIXME in GetSymbolRef in PPCMCInstLower.
+ if (MI->getOperand(OpNo).isExpr() &&
+ isa<MCBinaryExpr>(MI->getOperand(OpNo).getExpr())) {
+ O << "ha16(";
+ printOperand(MI, OpNo, O);
+ O << ')';
+ } else {
+ printOperand(MI, OpNo, O);
+ }
+}
+
+
diff --git a/contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.h b/contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.h
new file mode 100644
index 0000000..8f1e211
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/InstPrinter/PPCInstPrinter.h
@@ -0,0 +1,69 @@
+//===- PPCInstPrinter.h - Convert PPC MCInst to assembly syntax -*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This class prints an PPC MCInst to a .s file.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPCINSTPRINTER_H
+#define PPCINSTPRINTER_H
+
+#include "llvm/MC/MCInstPrinter.h"
+
+namespace llvm {
+
+class MCOperand;
+
+class PPCInstPrinter : public MCInstPrinter {
+ // 0 -> AIX, 1 -> Darwin.
+ unsigned SyntaxVariant;
+public:
+ PPCInstPrinter(const MCAsmInfo &MAI, const MCInstrInfo &MII,
+ const MCRegisterInfo &MRI, unsigned syntaxVariant)
+ : MCInstPrinter(MAI, MII, MRI), SyntaxVariant(syntaxVariant) {}
+
+ bool isDarwinSyntax() const {
+ return SyntaxVariant == 1;
+ }
+
+ virtual void printRegName(raw_ostream &OS, unsigned RegNo) const;
+ virtual void printInst(const MCInst *MI, raw_ostream &O, StringRef Annot);
+
+ // Autogenerated by tblgen.
+ void printInstruction(const MCInst *MI, raw_ostream &O);
+ static const char *getRegisterName(unsigned RegNo);
+
+
+ void printOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printPredicateOperand(const MCInst *MI, unsigned OpNo,
+ raw_ostream &O, const char *Modifier = 0);
+
+
+ void printS5ImmOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printU5ImmOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printU6ImmOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printS16ImmOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printU16ImmOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printS16X4ImmOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printBranchOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printAbsAddrOperand(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+
+ void printcrbitm(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+
+ void printMemRegImm(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printMemRegImmShifted(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printMemRegReg(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+
+ // FIXME: Remove
+ void printSymbolLo(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+ void printSymbolHi(const MCInst *MI, unsigned OpNo, raw_ostream &O);
+};
+} // end namespace llvm
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCAsmBackend.cpp b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCAsmBackend.cpp
new file mode 100644
index 0000000..ec26574
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCAsmBackend.cpp
@@ -0,0 +1,195 @@
+//===-- PPCAsmBackend.cpp - PPC Assembler Backend -------------------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+#include "MCTargetDesc/PPCMCTargetDesc.h"
+#include "MCTargetDesc/PPCFixupKinds.h"
+#include "llvm/MC/MCAsmBackend.h"
+#include "llvm/MC/MCELFObjectWriter.h"
+#include "llvm/MC/MCFixupKindInfo.h"
+#include "llvm/MC/MCMachObjectWriter.h"
+#include "llvm/MC/MCObjectWriter.h"
+#include "llvm/MC/MCSectionMachO.h"
+#include "llvm/MC/MCValue.h"
+#include "llvm/Object/MachOFormat.h"
+#include "llvm/Support/ELF.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/TargetRegistry.h"
+using namespace llvm;
+
+static unsigned adjustFixupValue(unsigned Kind, uint64_t Value) {
+ switch (Kind) {
+ default:
+ llvm_unreachable("Unknown fixup kind!");
+ case FK_Data_1:
+ case FK_Data_2:
+ case FK_Data_4:
+ case FK_Data_8:
+ case PPC::fixup_ppc_tlsreg:
+ case PPC::fixup_ppc_nofixup:
+ return Value;
+ case PPC::fixup_ppc_brcond14:
+ return Value & 0xfffc;
+ case PPC::fixup_ppc_br24:
+ return Value & 0x3fffffc;
+#if 0
+ case PPC::fixup_ppc_hi16:
+ return (Value >> 16) & 0xffff;
+#endif
+ case PPC::fixup_ppc_ha16:
+ return ((Value >> 16) + ((Value & 0x8000) ? 1 : 0)) & 0xffff;
+ case PPC::fixup_ppc_lo16:
+ return Value & 0xffff;
+ case PPC::fixup_ppc_lo16_ds:
+ return Value & 0xfffc;
+ }
+}
+
+namespace {
+class PPCMachObjectWriter : public MCMachObjectTargetWriter {
+public:
+ PPCMachObjectWriter(bool Is64Bit, uint32_t CPUType,
+ uint32_t CPUSubtype)
+ : MCMachObjectTargetWriter(Is64Bit, CPUType, CPUSubtype) {}
+
+ void RecordRelocation(MachObjectWriter *Writer,
+ const MCAssembler &Asm, const MCAsmLayout &Layout,
+ const MCFragment *Fragment, const MCFixup &Fixup,
+ MCValue Target, uint64_t &FixedValue) {
+ llvm_unreachable("Relocation emission for MachO/PPC unimplemented!");
+ }
+};
+
+class PPCAsmBackend : public MCAsmBackend {
+const Target &TheTarget;
+public:
+ PPCAsmBackend(const Target &T) : MCAsmBackend(), TheTarget(T) {}
+
+ unsigned getNumFixupKinds() const { return PPC::NumTargetFixupKinds; }
+
+ const MCFixupKindInfo &getFixupKindInfo(MCFixupKind Kind) const {
+ const static MCFixupKindInfo Infos[PPC::NumTargetFixupKinds] = {
+ // name offset bits flags
+ { "fixup_ppc_br24", 6, 24, MCFixupKindInfo::FKF_IsPCRel },
+ { "fixup_ppc_brcond14", 16, 14, MCFixupKindInfo::FKF_IsPCRel },
+ { "fixup_ppc_lo16", 16, 16, 0 },
+ { "fixup_ppc_ha16", 16, 16, 0 },
+ { "fixup_ppc_lo16_ds", 16, 14, 0 },
+ { "fixup_ppc_tlsreg", 0, 0, 0 },
+ { "fixup_ppc_nofixup", 0, 0, 0 }
+ };
+
+ if (Kind < FirstTargetFixupKind)
+ return MCAsmBackend::getFixupKindInfo(Kind);
+
+ assert(unsigned(Kind - FirstTargetFixupKind) < getNumFixupKinds() &&
+ "Invalid kind!");
+ return Infos[Kind - FirstTargetFixupKind];
+ }
+
+ void applyFixup(const MCFixup &Fixup, char *Data, unsigned DataSize,
+ uint64_t Value) const {
+ Value = adjustFixupValue(Fixup.getKind(), Value);
+ if (!Value) return; // Doesn't change encoding.
+
+ unsigned Offset = Fixup.getOffset();
+
+ // For each byte of the fragment that the fixup touches, mask in the bits
+ // from the fixup value. The Value has been "split up" into the appropriate
+ // bitfields above.
+ for (unsigned i = 0; i != 4; ++i)
+ Data[Offset + i] |= uint8_t((Value >> ((4 - i - 1)*8)) & 0xff);
+ }
+
+ bool mayNeedRelaxation(const MCInst &Inst) const {
+ // FIXME.
+ return false;
+ }
+
+ bool fixupNeedsRelaxation(const MCFixup &Fixup,
+ uint64_t Value,
+ const MCRelaxableFragment *DF,
+ const MCAsmLayout &Layout) const {
+ // FIXME.
+ llvm_unreachable("relaxInstruction() unimplemented");
+ }
+
+
+ void relaxInstruction(const MCInst &Inst, MCInst &Res) const {
+ // FIXME.
+ llvm_unreachable("relaxInstruction() unimplemented");
+ }
+
+ bool writeNopData(uint64_t Count, MCObjectWriter *OW) const {
+ // FIXME: Zero fill for now. That's not right, but at least will get the
+ // section size right.
+ for (uint64_t i = 0; i != Count; ++i)
+ OW->Write8(0);
+ return true;
+ }
+
+ unsigned getPointerSize() const {
+ StringRef Name = TheTarget.getName();
+ if (Name == "ppc64") return 8;
+ assert(Name == "ppc32" && "Unknown target name!");
+ return 4;
+ }
+};
+} // end anonymous namespace
+
+
+// FIXME: This should be in a separate file.
+namespace {
+ class DarwinPPCAsmBackend : public PPCAsmBackend {
+ public:
+ DarwinPPCAsmBackend(const Target &T) : PPCAsmBackend(T) { }
+
+ MCObjectWriter *createObjectWriter(raw_ostream &OS) const {
+ bool is64 = getPointerSize() == 8;
+ return createMachObjectWriter(new PPCMachObjectWriter(
+ /*Is64Bit=*/is64,
+ (is64 ? object::mach::CTM_PowerPC64 :
+ object::mach::CTM_PowerPC),
+ object::mach::CSPPC_ALL),
+ OS, /*IsLittleEndian=*/false);
+ }
+
+ virtual bool doesSectionRequireSymbols(const MCSection &Section) const {
+ return false;
+ }
+ };
+
+ class ELFPPCAsmBackend : public PPCAsmBackend {
+ uint8_t OSABI;
+ public:
+ ELFPPCAsmBackend(const Target &T, uint8_t OSABI) :
+ PPCAsmBackend(T), OSABI(OSABI) { }
+
+
+ MCObjectWriter *createObjectWriter(raw_ostream &OS) const {
+ bool is64 = getPointerSize() == 8;
+ return createPPCELFObjectWriter(OS, is64, OSABI);
+ }
+
+ virtual bool doesSectionRequireSymbols(const MCSection &Section) const {
+ return false;
+ }
+ };
+
+} // end anonymous namespace
+
+
+
+
+MCAsmBackend *llvm::createPPCAsmBackend(const Target &T, StringRef TT, StringRef CPU) {
+ if (Triple(TT).isOSDarwin())
+ return new DarwinPPCAsmBackend(T);
+
+ uint8_t OSABI = MCELFObjectTargetWriter::getOSABI(Triple(TT).getOS());
+ return new ELFPPCAsmBackend(T, OSABI);
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCELFObjectWriter.cpp b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCELFObjectWriter.cpp
new file mode 100644
index 0000000..84e4175
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCELFObjectWriter.cpp
@@ -0,0 +1,277 @@
+//===-- PPCELFObjectWriter.cpp - PPC ELF Writer ---------------------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+#include "MCTargetDesc/PPCMCTargetDesc.h"
+#include "MCTargetDesc/PPCFixupKinds.h"
+#include "llvm/ADT/STLExtras.h"
+#include "llvm/MC/MCELFObjectWriter.h"
+#include "llvm/MC/MCExpr.h"
+#include "llvm/MC/MCValue.h"
+#include "llvm/Support/ErrorHandling.h"
+
+using namespace llvm;
+
+namespace {
+ class PPCELFObjectWriter : public MCELFObjectTargetWriter {
+ public:
+ PPCELFObjectWriter(bool Is64Bit, uint8_t OSABI);
+
+ virtual ~PPCELFObjectWriter();
+ protected:
+ virtual unsigned getRelocTypeInner(const MCValue &Target,
+ const MCFixup &Fixup,
+ bool IsPCRel) const;
+ virtual unsigned GetRelocType(const MCValue &Target, const MCFixup &Fixup,
+ bool IsPCRel, bool IsRelocWithSymbol,
+ int64_t Addend) const;
+ virtual const MCSymbol *undefinedExplicitRelSym(const MCValue &Target,
+ const MCFixup &Fixup,
+ bool IsPCRel) const;
+ virtual void adjustFixupOffset(const MCFixup &Fixup, uint64_t &RelocOffset);
+
+ virtual void sortRelocs(const MCAssembler &Asm,
+ std::vector<ELFRelocationEntry> &Relocs);
+ };
+
+ class PPCELFRelocationEntry : public ELFRelocationEntry {
+ public:
+ PPCELFRelocationEntry(const ELFRelocationEntry &RE);
+ bool operator<(const PPCELFRelocationEntry &RE) const {
+ return (RE.r_offset < r_offset ||
+ (RE.r_offset == r_offset && RE.Type > Type));
+ }
+ };
+}
+
+PPCELFRelocationEntry::PPCELFRelocationEntry(const ELFRelocationEntry &RE)
+ : ELFRelocationEntry(RE.r_offset, RE.Index, RE.Type, RE.Symbol,
+ RE.r_addend, *RE.Fixup) {}
+
+PPCELFObjectWriter::PPCELFObjectWriter(bool Is64Bit, uint8_t OSABI)
+ : MCELFObjectTargetWriter(Is64Bit, OSABI,
+ Is64Bit ? ELF::EM_PPC64 : ELF::EM_PPC,
+ /*HasRelocationAddend*/ true) {}
+
+PPCELFObjectWriter::~PPCELFObjectWriter() {
+}
+
+unsigned PPCELFObjectWriter::getRelocTypeInner(const MCValue &Target,
+ const MCFixup &Fixup,
+ bool IsPCRel) const
+{
+ MCSymbolRefExpr::VariantKind Modifier = Target.isAbsolute() ?
+ MCSymbolRefExpr::VK_None : Target.getSymA()->getKind();
+
+ // determine the type of the relocation
+ unsigned Type;
+ if (IsPCRel) {
+ switch ((unsigned)Fixup.getKind()) {
+ default:
+ llvm_unreachable("Unimplemented");
+ case PPC::fixup_ppc_br24:
+ Type = ELF::R_PPC_REL24;
+ break;
+ case FK_Data_4:
+ case FK_PCRel_4:
+ Type = ELF::R_PPC_REL32;
+ break;
+ case FK_Data_8:
+ case FK_PCRel_8:
+ Type = ELF::R_PPC64_REL64;
+ break;
+ }
+ } else {
+ switch ((unsigned)Fixup.getKind()) {
+ default: llvm_unreachable("invalid fixup kind!");
+ case PPC::fixup_ppc_br24:
+ Type = ELF::R_PPC_ADDR24;
+ break;
+ case PPC::fixup_ppc_brcond14:
+ Type = ELF::R_PPC_ADDR14; // XXX: or BRNTAKEN?_
+ break;
+ case PPC::fixup_ppc_ha16:
+ switch (Modifier) {
+ default: llvm_unreachable("Unsupported Modifier");
+ case MCSymbolRefExpr::VK_PPC_TPREL16_HA:
+ Type = ELF::R_PPC_TPREL16_HA;
+ break;
+ case MCSymbolRefExpr::VK_PPC_DTPREL16_HA:
+ Type = ELF::R_PPC64_DTPREL16_HA;
+ break;
+ case MCSymbolRefExpr::VK_None:
+ Type = ELF::R_PPC_ADDR16_HA;
+ break;
+ case MCSymbolRefExpr::VK_PPC_TOC16_HA:
+ Type = ELF::R_PPC64_TOC16_HA;
+ break;
+ case MCSymbolRefExpr::VK_PPC_GOT_TPREL16_HA:
+ Type = ELF::R_PPC64_GOT_TPREL16_HA;
+ break;
+ case MCSymbolRefExpr::VK_PPC_GOT_TLSGD16_HA:
+ Type = ELF::R_PPC64_GOT_TLSGD16_HA;
+ break;
+ case MCSymbolRefExpr::VK_PPC_GOT_TLSLD16_HA:
+ Type = ELF::R_PPC64_GOT_TLSLD16_HA;
+ break;
+ }
+ break;
+ case PPC::fixup_ppc_lo16:
+ switch (Modifier) {
+ default: llvm_unreachable("Unsupported Modifier");
+ case MCSymbolRefExpr::VK_PPC_TPREL16_LO:
+ Type = ELF::R_PPC_TPREL16_LO;
+ break;
+ case MCSymbolRefExpr::VK_PPC_DTPREL16_LO:
+ Type = ELF::R_PPC64_DTPREL16_LO;
+ break;
+ case MCSymbolRefExpr::VK_None:
+ Type = ELF::R_PPC_ADDR16_LO;
+ break;
+ case MCSymbolRefExpr::VK_PPC_TOC_ENTRY:
+ Type = ELF::R_PPC64_TOC16;
+ break;
+ case MCSymbolRefExpr::VK_PPC_TOC16_LO:
+ Type = ELF::R_PPC64_TOC16_LO;
+ break;
+ case MCSymbolRefExpr::VK_PPC_GOT_TLSGD16_LO:
+ Type = ELF::R_PPC64_GOT_TLSGD16_LO;
+ break;
+ case MCSymbolRefExpr::VK_PPC_GOT_TLSLD16_LO:
+ Type = ELF::R_PPC64_GOT_TLSLD16_LO;
+ break;
+ }
+ break;
+ case PPC::fixup_ppc_lo16_ds:
+ switch (Modifier) {
+ default: llvm_unreachable("Unsupported Modifier");
+ case MCSymbolRefExpr::VK_None:
+ Type = ELF::R_PPC64_ADDR16_DS;
+ break;
+ case MCSymbolRefExpr::VK_PPC_TOC_ENTRY:
+ Type = ELF::R_PPC64_TOC16_DS;
+ break;
+ case MCSymbolRefExpr::VK_PPC_TOC16_LO:
+ Type = ELF::R_PPC64_TOC16_LO_DS;
+ break;
+ case MCSymbolRefExpr::VK_PPC_GOT_TPREL16_LO:
+ Type = ELF::R_PPC64_GOT_TPREL16_LO_DS;
+ break;
+ }
+ break;
+ case PPC::fixup_ppc_tlsreg:
+ Type = ELF::R_PPC64_TLS;
+ break;
+ case PPC::fixup_ppc_nofixup:
+ switch (Modifier) {
+ default: llvm_unreachable("Unsupported Modifier");
+ case MCSymbolRefExpr::VK_PPC_TLSGD:
+ Type = ELF::R_PPC64_TLSGD;
+ break;
+ case MCSymbolRefExpr::VK_PPC_TLSLD:
+ Type = ELF::R_PPC64_TLSLD;
+ break;
+ }
+ break;
+ case FK_Data_8:
+ switch (Modifier) {
+ default: llvm_unreachable("Unsupported Modifier");
+ case MCSymbolRefExpr::VK_PPC_TOC:
+ Type = ELF::R_PPC64_TOC;
+ break;
+ case MCSymbolRefExpr::VK_None:
+ Type = ELF::R_PPC64_ADDR64;
+ break;
+ }
+ break;
+ case FK_Data_4:
+ Type = ELF::R_PPC_ADDR32;
+ break;
+ case FK_Data_2:
+ Type = ELF::R_PPC_ADDR16;
+ break;
+ }
+ }
+ return Type;
+}
+
+unsigned PPCELFObjectWriter::GetRelocType(const MCValue &Target,
+ const MCFixup &Fixup,
+ bool IsPCRel,
+ bool IsRelocWithSymbol,
+ int64_t Addend) const {
+ return getRelocTypeInner(Target, Fixup, IsPCRel);
+}
+
+const MCSymbol *PPCELFObjectWriter::undefinedExplicitRelSym(const MCValue &Target,
+ const MCFixup &Fixup,
+ bool IsPCRel) const {
+ assert(Target.getSymA() && "SymA cannot be 0");
+ const MCSymbol &Symbol = Target.getSymA()->getSymbol().AliasedSymbol();
+
+ unsigned RelocType = getRelocTypeInner(Target, Fixup, IsPCRel);
+
+ // The .odp creation emits a relocation against the symbol ".TOC." which
+ // create a R_PPC64_TOC relocation. However the relocation symbol name
+ // in final object creation should be NULL, since the symbol does not
+ // really exist, it is just the reference to TOC base for the current
+ // object file.
+ bool EmitThisSym = RelocType != ELF::R_PPC64_TOC;
+
+ if (EmitThisSym && !Symbol.isTemporary())
+ return &Symbol;
+ return NULL;
+}
+
+void PPCELFObjectWriter::
+adjustFixupOffset(const MCFixup &Fixup, uint64_t &RelocOffset) {
+ switch ((unsigned)Fixup.getKind()) {
+ case PPC::fixup_ppc_ha16:
+ case PPC::fixup_ppc_lo16:
+ case PPC::fixup_ppc_lo16_ds:
+ RelocOffset += 2;
+ break;
+ default:
+ break;
+ }
+}
+
+// The standard sorter only sorts on the r_offset field, but PowerPC can
+// have multiple relocations at the same offset. Sort secondarily on the
+// relocation type to avoid nondeterminism.
+void PPCELFObjectWriter::sortRelocs(const MCAssembler &Asm,
+ std::vector<ELFRelocationEntry> &Relocs) {
+
+ // Copy to a temporary vector of relocation entries having a different
+ // sort function.
+ std::vector<PPCELFRelocationEntry> TmpRelocs;
+
+ for (std::vector<ELFRelocationEntry>::iterator R = Relocs.begin();
+ R != Relocs.end(); ++R) {
+ TmpRelocs.push_back(PPCELFRelocationEntry(*R));
+ }
+
+ // Sort in place by ascending r_offset and descending r_type.
+ array_pod_sort(TmpRelocs.begin(), TmpRelocs.end());
+
+ // Copy back to the original vector.
+ unsigned I = 0;
+ for (std::vector<PPCELFRelocationEntry>::iterator R = TmpRelocs.begin();
+ R != TmpRelocs.end(); ++R, ++I) {
+ Relocs[I] = ELFRelocationEntry(R->r_offset, R->Index, R->Type,
+ R->Symbol, R->r_addend, *R->Fixup);
+ }
+}
+
+
+MCObjectWriter *llvm::createPPCELFObjectWriter(raw_ostream &OS,
+ bool Is64Bit,
+ uint8_t OSABI) {
+ MCELFObjectTargetWriter *MOTW = new PPCELFObjectWriter(Is64Bit, OSABI);
+ return createELFObjectWriter(MOTW, OS, /*IsLittleEndian=*/false);
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCFixupKinds.h b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCFixupKinds.h
new file mode 100644
index 0000000..86c44f5
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCFixupKinds.h
@@ -0,0 +1,54 @@
+//===-- PPCFixupKinds.h - PPC Specific Fixup Entries ------------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef LLVM_PPC_PPCFIXUPKINDS_H
+#define LLVM_PPC_PPCFIXUPKINDS_H
+
+#include "llvm/MC/MCFixup.h"
+
+#undef PPC
+
+namespace llvm {
+namespace PPC {
+enum Fixups {
+ // fixup_ppc_br24 - 24-bit PC relative relocation for direct branches like 'b'
+ // and 'bl'.
+ fixup_ppc_br24 = FirstTargetFixupKind,
+
+ /// fixup_ppc_brcond14 - 14-bit PC relative relocation for conditional
+ /// branches.
+ fixup_ppc_brcond14,
+
+ /// fixup_ppc_lo16 - A 16-bit fixup corresponding to lo16(_foo) for instrs
+ /// like 'li'.
+ fixup_ppc_lo16,
+
+ /// fixup_ppc_ha16 - A 16-bit fixup corresponding to ha16(_foo) for instrs
+ /// like 'lis'.
+ fixup_ppc_ha16,
+
+ /// fixup_ppc_lo16_ds - A 14-bit fixup corresponding to lo16(_foo) with
+ /// implied 2 zero bits for instrs like 'std'.
+ fixup_ppc_lo16_ds,
+
+ /// fixup_ppc_tlsreg - Insert thread-pointer register number.
+ fixup_ppc_tlsreg,
+
+ /// fixup_ppc_nofixup - Not a true fixup, but ties a symbol to a call
+ /// to __tls_get_addr for the TLS general and local dynamic models.
+ fixup_ppc_nofixup,
+
+ // Marker
+ LastTargetFixupKind,
+ NumTargetFixupKinds = LastTargetFixupKind - FirstTargetFixupKind
+};
+}
+}
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.cpp b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.cpp
new file mode 100644
index 0000000..a25d7fe
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.cpp
@@ -0,0 +1,70 @@
+//===-- PPCMCAsmInfo.cpp - PPC asm properties -----------------------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the declarations of the MCAsmInfoDarwin properties.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCMCAsmInfo.h"
+using namespace llvm;
+
+void PPCMCAsmInfoDarwin::anchor() { }
+
+PPCMCAsmInfoDarwin::PPCMCAsmInfoDarwin(bool is64Bit) {
+ if (is64Bit) {
+ PointerSize = CalleeSaveStackSlotSize = 8;
+ }
+ IsLittleEndian = false;
+
+ PCSymbol = ".";
+ CommentString = ";";
+ ExceptionsType = ExceptionHandling::DwarfCFI;
+
+ if (!is64Bit)
+ Data64bitsDirective = 0; // We can't emit a 64-bit unit in PPC32 mode.
+
+ AssemblerDialect = 1; // New-Style mnemonics.
+ SupportsDebugInformation= true; // Debug information.
+}
+
+void PPCLinuxMCAsmInfo::anchor() { }
+
+PPCLinuxMCAsmInfo::PPCLinuxMCAsmInfo(bool is64Bit) {
+ if (is64Bit) {
+ PointerSize = CalleeSaveStackSlotSize = 8;
+ }
+ IsLittleEndian = false;
+
+ // ".comm align is in bytes but .align is pow-2."
+ AlignmentIsInBytes = false;
+
+ CommentString = "#";
+ GlobalPrefix = "";
+ PrivateGlobalPrefix = ".L";
+ WeakRefDirective = "\t.weak\t";
+
+ // Uses '.section' before '.bss' directive
+ UsesELFSectionDirectiveForBSS = true;
+
+ // Debug Information
+ SupportsDebugInformation = true;
+
+ PCSymbol = ".";
+
+ // Set up DWARF directives
+ HasLEB128 = true; // Target asm supports leb128 directives (little-endian)
+
+ // Exceptions handling
+ ExceptionsType = ExceptionHandling::DwarfCFI;
+
+ ZeroDirective = "\t.space\t";
+ Data64bitsDirective = is64Bit ? "\t.quad\t" : 0;
+ AssemblerDialect = 0; // Old-Style mnemonics.
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.h b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.h
new file mode 100644
index 0000000..7b4ed9f
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCAsmInfo.h
@@ -0,0 +1,35 @@
+//===-- PPCMCAsmInfo.h - PPC asm properties --------------------*- C++ -*--===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the declaration of the MCAsmInfoDarwin class.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPCTARGETASMINFO_H
+#define PPCTARGETASMINFO_H
+
+#include "llvm/MC/MCAsmInfoDarwin.h"
+
+namespace llvm {
+
+ class PPCMCAsmInfoDarwin : public MCAsmInfoDarwin {
+ virtual void anchor();
+ public:
+ explicit PPCMCAsmInfoDarwin(bool is64Bit);
+ };
+
+ class PPCLinuxMCAsmInfo : public MCAsmInfo {
+ virtual void anchor();
+ public:
+ explicit PPCLinuxMCAsmInfo(bool is64Bit);
+ };
+
+} // namespace llvm
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCCodeEmitter.cpp b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCCodeEmitter.cpp
new file mode 100644
index 0000000..2223cd6
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCCodeEmitter.cpp
@@ -0,0 +1,239 @@
+//===-- PPCMCCodeEmitter.cpp - Convert PPC code to machine code -----------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements the PPCMCCodeEmitter class.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "mccodeemitter"
+#include "MCTargetDesc/PPCMCTargetDesc.h"
+#include "MCTargetDesc/PPCFixupKinds.h"
+#include "llvm/ADT/Statistic.h"
+#include "llvm/MC/MCCodeEmitter.h"
+#include "llvm/MC/MCContext.h"
+#include "llvm/MC/MCExpr.h"
+#include "llvm/MC/MCInst.h"
+#include "llvm/MC/MCInstrInfo.h"
+#include "llvm/MC/MCSubtargetInfo.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/raw_ostream.h"
+using namespace llvm;
+
+STATISTIC(MCNumEmitted, "Number of MC instructions emitted");
+
+namespace {
+class PPCMCCodeEmitter : public MCCodeEmitter {
+ PPCMCCodeEmitter(const PPCMCCodeEmitter &) LLVM_DELETED_FUNCTION;
+ void operator=(const PPCMCCodeEmitter &) LLVM_DELETED_FUNCTION;
+
+ const MCSubtargetInfo &STI;
+ const MCContext &CTX;
+ Triple TT;
+
+public:
+ PPCMCCodeEmitter(const MCInstrInfo &mcii, const MCSubtargetInfo &sti,
+ MCContext &ctx)
+ : STI(sti), CTX(ctx), TT(STI.getTargetTriple()) {
+ }
+
+ ~PPCMCCodeEmitter() {}
+
+ unsigned getDirectBrEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned getCondBrEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned getHA16Encoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned getLO16Encoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned getMemRIEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned getMemRIXEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned getTLSRegEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ unsigned get_crbitm_encoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+
+ /// getMachineOpValue - Return binary encoding of operand. If the machine
+ /// operand requires relocation, record the relocation and return zero.
+ unsigned getMachineOpValue(const MCInst &MI,const MCOperand &MO,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+
+ // getBinaryCodeForInstr - TableGen'erated function for getting the
+ // binary encoding for an instruction.
+ uint64_t getBinaryCodeForInstr(const MCInst &MI,
+ SmallVectorImpl<MCFixup> &Fixups) const;
+ void EncodeInstruction(const MCInst &MI, raw_ostream &OS,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ uint64_t Bits = getBinaryCodeForInstr(MI, Fixups);
+
+ // BL8_NOP etc. all have a size of 8 because of the following 'nop'.
+ unsigned Size = 4; // FIXME: Have Desc.getSize() return the correct value!
+ unsigned Opcode = MI.getOpcode();
+ if (Opcode == PPC::BL8_NOP || Opcode == PPC::BLA8_NOP ||
+ Opcode == PPC::BL8_NOP_TLSGD || Opcode == PPC::BL8_NOP_TLSLD)
+ Size = 8;
+
+ // Output the constant in big endian byte order.
+ int ShiftValue = (Size * 8) - 8;
+ for (unsigned i = 0; i != Size; ++i) {
+ OS << (char)(Bits >> ShiftValue);
+ Bits <<= 8;
+ }
+
+ ++MCNumEmitted; // Keep track of the # of mi's emitted.
+ }
+
+};
+
+} // end anonymous namespace
+
+MCCodeEmitter *llvm::createPPCMCCodeEmitter(const MCInstrInfo &MCII,
+ const MCRegisterInfo &MRI,
+ const MCSubtargetInfo &STI,
+ MCContext &Ctx) {
+ return new PPCMCCodeEmitter(MCII, STI, Ctx);
+}
+
+unsigned PPCMCCodeEmitter::
+getDirectBrEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO, Fixups);
+
+ // Add a fixup for the branch target.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_br24));
+
+ // For special TLS calls, add another fixup for the symbol. Apparently
+ // BL8_NOP, BL8_NOP_TLSGD, and BL8_NOP_TLSLD are sufficiently
+ // similar that TblGen will not generate a separate case for the latter
+ // two, so this is the only way to get the extra fixup generated.
+ unsigned Opcode = MI.getOpcode();
+ if (Opcode == PPC::BL8_NOP_TLSGD || Opcode == PPC::BL8_NOP_TLSLD) {
+ const MCOperand &MO2 = MI.getOperand(OpNo+1);
+ Fixups.push_back(MCFixup::Create(0, MO2.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_nofixup));
+ }
+ return 0;
+}
+
+unsigned PPCMCCodeEmitter::getCondBrEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO, Fixups);
+
+ // Add a fixup for the branch target.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_brcond14));
+ return 0;
+}
+
+unsigned PPCMCCodeEmitter::getHA16Encoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO, Fixups);
+
+ // Add a fixup for the branch target.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_ha16));
+ return 0;
+}
+
+unsigned PPCMCCodeEmitter::getLO16Encoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO, Fixups);
+
+ // Add a fixup for the branch target.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_lo16));
+ return 0;
+}
+
+unsigned PPCMCCodeEmitter::getMemRIEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ // Encode (imm, reg) as a memri, which has the low 16-bits as the
+ // displacement and the next 5 bits as the register #.
+ assert(MI.getOperand(OpNo+1).isReg());
+ unsigned RegBits = getMachineOpValue(MI, MI.getOperand(OpNo+1), Fixups) << 16;
+
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isImm())
+ return (getMachineOpValue(MI, MO, Fixups) & 0xFFFF) | RegBits;
+
+ // Add a fixup for the displacement field.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_lo16));
+ return RegBits;
+}
+
+
+unsigned PPCMCCodeEmitter::getMemRIXEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ // Encode (imm, reg) as a memrix, which has the low 14-bits as the
+ // displacement and the next 5 bits as the register #.
+ assert(MI.getOperand(OpNo+1).isReg());
+ unsigned RegBits = getMachineOpValue(MI, MI.getOperand(OpNo+1), Fixups) << 14;
+
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isImm())
+ return (getMachineOpValue(MI, MO, Fixups) & 0x3FFF) | RegBits;
+
+ // Add a fixup for the displacement field.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_lo16_ds));
+ return RegBits;
+}
+
+
+unsigned PPCMCCodeEmitter::getTLSRegEncoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ const MCOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg()) return getMachineOpValue(MI, MO, Fixups);
+
+ // Add a fixup for the TLS register, which simply provides a relocation
+ // hint to the linker that this statement is part of a relocation sequence.
+ // Return the thread-pointer register's encoding.
+ Fixups.push_back(MCFixup::Create(0, MO.getExpr(),
+ (MCFixupKind)PPC::fixup_ppc_tlsreg));
+ return CTX.getRegisterInfo().getEncodingValue(PPC::X13);
+}
+
+unsigned PPCMCCodeEmitter::
+get_crbitm_encoding(const MCInst &MI, unsigned OpNo,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ const MCOperand &MO = MI.getOperand(OpNo);
+ assert((MI.getOpcode() == PPC::MTCRF ||
+ MI.getOpcode() == PPC::MFOCRF ||
+ MI.getOpcode() == PPC::MTCRF8) &&
+ (MO.getReg() >= PPC::CR0 && MO.getReg() <= PPC::CR7));
+ return 0x80 >> CTX.getRegisterInfo().getEncodingValue(MO.getReg());
+}
+
+
+unsigned PPCMCCodeEmitter::
+getMachineOpValue(const MCInst &MI, const MCOperand &MO,
+ SmallVectorImpl<MCFixup> &Fixups) const {
+ if (MO.isReg()) {
+ // MTCRF/MFOCRF should go through get_crbitm_encoding for the CR operand.
+ // The GPR operand should come through here though.
+ assert((MI.getOpcode() != PPC::MTCRF && MI.getOpcode() != PPC::MFOCRF) ||
+ MO.getReg() < PPC::CR0 || MO.getReg() > PPC::CR7);
+ return CTX.getRegisterInfo().getEncodingValue(MO.getReg());
+ }
+
+ assert(MO.isImm() &&
+ "Relocation required in an instruction that we cannot encode!");
+ return MO.getImm();
+}
+
+
+#include "PPCGenMCCodeEmitter.inc"
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.cpp b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.cpp
new file mode 100644
index 0000000..2209f93
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.cpp
@@ -0,0 +1,160 @@
+//===-- PPCMCTargetDesc.cpp - PowerPC Target Descriptions -----------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file provides PowerPC specific target descriptions.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCMCTargetDesc.h"
+#include "InstPrinter/PPCInstPrinter.h"
+#include "PPCMCAsmInfo.h"
+#include "llvm/MC/MCCodeGenInfo.h"
+#include "llvm/MC/MCInstrInfo.h"
+#include "llvm/MC/MCRegisterInfo.h"
+#include "llvm/MC/MCStreamer.h"
+#include "llvm/MC/MCSubtargetInfo.h"
+#include "llvm/MC/MachineLocation.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/TargetRegistry.h"
+
+#define GET_INSTRINFO_MC_DESC
+#include "PPCGenInstrInfo.inc"
+
+#define GET_SUBTARGETINFO_MC_DESC
+#include "PPCGenSubtargetInfo.inc"
+
+#define GET_REGINFO_MC_DESC
+#include "PPCGenRegisterInfo.inc"
+
+using namespace llvm;
+
+static MCInstrInfo *createPPCMCInstrInfo() {
+ MCInstrInfo *X = new MCInstrInfo();
+ InitPPCMCInstrInfo(X);
+ return X;
+}
+
+static MCRegisterInfo *createPPCMCRegisterInfo(StringRef TT) {
+ Triple TheTriple(TT);
+ bool isPPC64 = (TheTriple.getArch() == Triple::ppc64);
+ unsigned Flavour = isPPC64 ? 0 : 1;
+ unsigned RA = isPPC64 ? PPC::LR8 : PPC::LR;
+
+ MCRegisterInfo *X = new MCRegisterInfo();
+ InitPPCMCRegisterInfo(X, RA, Flavour, Flavour);
+ return X;
+}
+
+static MCSubtargetInfo *createPPCMCSubtargetInfo(StringRef TT, StringRef CPU,
+ StringRef FS) {
+ MCSubtargetInfo *X = new MCSubtargetInfo();
+ InitPPCMCSubtargetInfo(X, TT, CPU, FS);
+ return X;
+}
+
+static MCAsmInfo *createPPCMCAsmInfo(const Target &T, StringRef TT) {
+ Triple TheTriple(TT);
+ bool isPPC64 = TheTriple.getArch() == Triple::ppc64;
+
+ MCAsmInfo *MAI;
+ if (TheTriple.isOSDarwin())
+ MAI = new PPCMCAsmInfoDarwin(isPPC64);
+ else
+ MAI = new PPCLinuxMCAsmInfo(isPPC64);
+
+ // Initial state of the frame pointer is R1.
+ MachineLocation Dst(MachineLocation::VirtualFP);
+ MachineLocation Src(isPPC64? PPC::X1 : PPC::R1, 0);
+ MAI->addInitialFrameState(0, Dst, Src);
+
+ return MAI;
+}
+
+static MCCodeGenInfo *createPPCMCCodeGenInfo(StringRef TT, Reloc::Model RM,
+ CodeModel::Model CM,
+ CodeGenOpt::Level OL) {
+ MCCodeGenInfo *X = new MCCodeGenInfo();
+
+ if (RM == Reloc::Default) {
+ Triple T(TT);
+ if (T.isOSDarwin())
+ RM = Reloc::DynamicNoPIC;
+ else
+ RM = Reloc::Static;
+ }
+ if (CM == CodeModel::Default) {
+ Triple T(TT);
+ if (!T.isOSDarwin() && T.getArch() == Triple::ppc64)
+ CM = CodeModel::Medium;
+ }
+ X->InitMCCodeGenInfo(RM, CM, OL);
+ return X;
+}
+
+// This is duplicated code. Refactor this.
+static MCStreamer *createMCStreamer(const Target &T, StringRef TT,
+ MCContext &Ctx, MCAsmBackend &MAB,
+ raw_ostream &OS,
+ MCCodeEmitter *Emitter,
+ bool RelaxAll,
+ bool NoExecStack) {
+ if (Triple(TT).isOSDarwin())
+ return createMachOStreamer(Ctx, MAB, OS, Emitter, RelaxAll);
+
+ return createELFStreamer(Ctx, MAB, OS, Emitter, RelaxAll, NoExecStack);
+}
+
+static MCInstPrinter *createPPCMCInstPrinter(const Target &T,
+ unsigned SyntaxVariant,
+ const MCAsmInfo &MAI,
+ const MCInstrInfo &MII,
+ const MCRegisterInfo &MRI,
+ const MCSubtargetInfo &STI) {
+ return new PPCInstPrinter(MAI, MII, MRI, SyntaxVariant);
+}
+
+extern "C" void LLVMInitializePowerPCTargetMC() {
+ // Register the MC asm info.
+ RegisterMCAsmInfoFn C(ThePPC32Target, createPPCMCAsmInfo);
+ RegisterMCAsmInfoFn D(ThePPC64Target, createPPCMCAsmInfo);
+
+ // Register the MC codegen info.
+ TargetRegistry::RegisterMCCodeGenInfo(ThePPC32Target, createPPCMCCodeGenInfo);
+ TargetRegistry::RegisterMCCodeGenInfo(ThePPC64Target, createPPCMCCodeGenInfo);
+
+ // Register the MC instruction info.
+ TargetRegistry::RegisterMCInstrInfo(ThePPC32Target, createPPCMCInstrInfo);
+ TargetRegistry::RegisterMCInstrInfo(ThePPC64Target, createPPCMCInstrInfo);
+
+ // Register the MC register info.
+ TargetRegistry::RegisterMCRegInfo(ThePPC32Target, createPPCMCRegisterInfo);
+ TargetRegistry::RegisterMCRegInfo(ThePPC64Target, createPPCMCRegisterInfo);
+
+ // Register the MC subtarget info.
+ TargetRegistry::RegisterMCSubtargetInfo(ThePPC32Target,
+ createPPCMCSubtargetInfo);
+ TargetRegistry::RegisterMCSubtargetInfo(ThePPC64Target,
+ createPPCMCSubtargetInfo);
+
+ // Register the MC Code Emitter
+ TargetRegistry::RegisterMCCodeEmitter(ThePPC32Target, createPPCMCCodeEmitter);
+ TargetRegistry::RegisterMCCodeEmitter(ThePPC64Target, createPPCMCCodeEmitter);
+
+ // Register the asm backend.
+ TargetRegistry::RegisterMCAsmBackend(ThePPC32Target, createPPCAsmBackend);
+ TargetRegistry::RegisterMCAsmBackend(ThePPC64Target, createPPCAsmBackend);
+
+ // Register the object streamer.
+ TargetRegistry::RegisterMCObjectStreamer(ThePPC32Target, createMCStreamer);
+ TargetRegistry::RegisterMCObjectStreamer(ThePPC64Target, createMCStreamer);
+
+ // Register the MCInstPrinter.
+ TargetRegistry::RegisterMCInstPrinter(ThePPC32Target, createPPCMCInstPrinter);
+ TargetRegistry::RegisterMCInstPrinter(ThePPC64Target, createPPCMCInstPrinter);
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.h b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.h
new file mode 100644
index 0000000..38a7420
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCMCTargetDesc.h
@@ -0,0 +1,68 @@
+//===-- PPCMCTargetDesc.h - PowerPC Target Descriptions ---------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file provides PowerPC specific target descriptions.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPCMCTARGETDESC_H
+#define PPCMCTARGETDESC_H
+
+// GCC #defines PPC on Linux but we use it as our namespace name
+#undef PPC
+
+#include "llvm/Support/DataTypes.h"
+
+namespace llvm {
+class MCAsmBackend;
+class MCCodeEmitter;
+class MCContext;
+class MCInstrInfo;
+class MCObjectWriter;
+class MCRegisterInfo;
+class MCSubtargetInfo;
+class Target;
+class StringRef;
+class raw_ostream;
+
+extern Target ThePPC32Target;
+extern Target ThePPC64Target;
+
+MCCodeEmitter *createPPCMCCodeEmitter(const MCInstrInfo &MCII,
+ const MCRegisterInfo &MRI,
+ const MCSubtargetInfo &STI,
+ MCContext &Ctx);
+
+MCAsmBackend *createPPCAsmBackend(const Target &T, StringRef TT, StringRef CPU);
+
+/// createPPCELFObjectWriter - Construct an PPC ELF object writer.
+MCObjectWriter *createPPCELFObjectWriter(raw_ostream &OS,
+ bool Is64Bit,
+ uint8_t OSABI);
+} // End llvm namespace
+
+// Generated files will use "namespace PPC". To avoid symbol clash,
+// undefine PPC here. PPC may be predefined on some hosts.
+#undef PPC
+
+// Defines symbolic names for PowerPC registers. This defines a mapping from
+// register name to register number.
+//
+#define GET_REGINFO_ENUM
+#include "PPCGenRegisterInfo.inc"
+
+// Defines symbolic names for the PowerPC instructions.
+//
+#define GET_INSTRINFO_ENUM
+#include "PPCGenInstrInfo.inc"
+
+#define GET_SUBTARGETINFO_ENUM
+#include "PPCGenSubtargetInfo.inc"
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.cpp b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.cpp
new file mode 100644
index 0000000..d84eb9c
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.cpp
@@ -0,0 +1,31 @@
+//===-- PPCPredicates.cpp - PPC Branch Predicate Information --------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements the PowerPC branch predicates.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCPredicates.h"
+#include "llvm/Support/ErrorHandling.h"
+#include <cassert>
+using namespace llvm;
+
+PPC::Predicate PPC::InvertPredicate(PPC::Predicate Opcode) {
+ switch (Opcode) {
+ case PPC::PRED_EQ: return PPC::PRED_NE;
+ case PPC::PRED_NE: return PPC::PRED_EQ;
+ case PPC::PRED_LT: return PPC::PRED_GE;
+ case PPC::PRED_GE: return PPC::PRED_LT;
+ case PPC::PRED_GT: return PPC::PRED_LE;
+ case PPC::PRED_LE: return PPC::PRED_GT;
+ case PPC::PRED_NU: return PPC::PRED_UN;
+ case PPC::PRED_UN: return PPC::PRED_NU;
+ }
+ llvm_unreachable("Unknown PPC branch opcode!");
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.h b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.h
new file mode 100644
index 0000000..ad2b018
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/MCTargetDesc/PPCPredicates.h
@@ -0,0 +1,43 @@
+//===-- PPCPredicates.h - PPC Branch Predicate Information ------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file describes the PowerPC branch predicates.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef LLVM_TARGET_POWERPC_PPCPREDICATES_H
+#define LLVM_TARGET_POWERPC_PPCPREDICATES_H
+
+// GCC #defines PPC on Linux but we use it as our namespace name
+#undef PPC
+
+// Generated files will use "namespace PPC". To avoid symbol clash,
+// undefine PPC here. PPC may be predefined on some hosts.
+#undef PPC
+
+namespace llvm {
+namespace PPC {
+ /// Predicate - These are "(BI << 5) | BO" for various predicates.
+ enum Predicate {
+ PRED_LT = (0 << 5) | 12,
+ PRED_LE = (1 << 5) | 4,
+ PRED_EQ = (2 << 5) | 12,
+ PRED_GE = (0 << 5) | 4,
+ PRED_GT = (1 << 5) | 12,
+ PRED_NE = (2 << 5) | 4,
+ PRED_UN = (3 << 5) | 12,
+ PRED_NU = (3 << 5) | 4
+ };
+
+ /// Invert the specified predicate. != -> ==, < -> >=.
+ Predicate InvertPredicate(Predicate Opcode);
+}
+}
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPC.h b/contrib/llvm/lib/Target/PowerPC/PPC.h
new file mode 100644
index 0000000..446b685
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPC.h
@@ -0,0 +1,90 @@
+//===-- PPC.h - Top-level interface for PowerPC Target ----------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the entry points for global functions defined in the LLVM
+// PowerPC back-end.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef LLVM_TARGET_POWERPC_H
+#define LLVM_TARGET_POWERPC_H
+
+#include "MCTargetDesc/PPCMCTargetDesc.h"
+#include <string>
+
+// GCC #defines PPC on Linux but we use it as our namespace name
+#undef PPC
+
+namespace llvm {
+ class PPCTargetMachine;
+ class FunctionPass;
+ class ImmutablePass;
+ class JITCodeEmitter;
+ class MachineInstr;
+ class AsmPrinter;
+ class MCInst;
+
+ FunctionPass *createPPCCTRLoops();
+ FunctionPass *createPPCBranchSelectionPass();
+ FunctionPass *createPPCISelDag(PPCTargetMachine &TM);
+ FunctionPass *createPPCJITCodeEmitterPass(PPCTargetMachine &TM,
+ JITCodeEmitter &MCE);
+ void LowerPPCMachineInstrToMCInst(const MachineInstr *MI, MCInst &OutMI,
+ AsmPrinter &AP, bool isDarwin);
+
+ /// \brief Creates an PPC-specific Target Transformation Info pass.
+ ImmutablePass *createPPCTargetTransformInfoPass(const PPCTargetMachine *TM);
+
+ namespace PPCII {
+
+ /// Target Operand Flag enum.
+ enum TOF {
+ //===------------------------------------------------------------------===//
+ // PPC Specific MachineOperand flags.
+ MO_NO_FLAG,
+
+ /// MO_DARWIN_STUB - On a symbol operand "FOO", this indicates that the
+ /// reference is actually to the "FOO$stub" symbol. This is used for calls
+ /// and jumps to external functions on Tiger and earlier.
+ MO_DARWIN_STUB = 1,
+
+ /// MO_PIC_FLAG - If this bit is set, the symbol reference is relative to
+ /// the function's picbase, e.g. lo16(symbol-picbase).
+ MO_PIC_FLAG = 2,
+
+ /// MO_NLP_FLAG - If this bit is set, the symbol reference is actually to
+ /// the non_lazy_ptr for the global, e.g. lo16(symbol$non_lazy_ptr-picbase).
+ MO_NLP_FLAG = 4,
+
+ /// MO_NLP_HIDDEN_FLAG - If this bit is set, the symbol reference is to a
+ /// symbol with hidden visibility. This causes a different kind of
+ /// non-lazy-pointer to be generated.
+ MO_NLP_HIDDEN_FLAG = 8,
+
+ /// The next are not flags but distinct values.
+ MO_ACCESS_MASK = 0xf0,
+
+ /// MO_LO16, MO_HA16 - lo16(symbol) and ha16(symbol)
+ MO_LO16 = 1 << 4,
+ MO_HA16 = 2 << 4,
+
+ MO_TPREL16_HA = 3 << 4,
+ MO_TPREL16_LO = 4 << 4,
+
+ /// These values identify relocations on immediates folded
+ /// into memory operations.
+ MO_DTPREL16_LO = 5 << 4,
+ MO_TLSLD16_LO = 6 << 4,
+ MO_TOC16_LO = 7 << 4
+ };
+ } // end namespace PPCII
+
+} // end namespace llvm;
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPC.td b/contrib/llvm/lib/Target/PowerPC/PPC.td
new file mode 100644
index 0000000..3892162
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPC.td
@@ -0,0 +1,240 @@
+//===-- PPC.td - Describe the PowerPC Target Machine -------*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This is the top level entry point for the PowerPC target.
+//
+//===----------------------------------------------------------------------===//
+
+// Get the target-independent interfaces which we are implementing.
+//
+include "llvm/Target/Target.td"
+
+//===----------------------------------------------------------------------===//
+// PowerPC Subtarget features.
+//
+
+//===----------------------------------------------------------------------===//
+// CPU Directives //
+//===----------------------------------------------------------------------===//
+
+def Directive440 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_440", "">;
+def Directive601 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_601", "">;
+def Directive602 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_602", "">;
+def Directive603 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_603", "">;
+def Directive604 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_603", "">;
+def Directive620 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_603", "">;
+def Directive7400: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_7400", "">;
+def Directive750 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_750", "">;
+def Directive970 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_970", "">;
+def Directive32 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_32", "">;
+def Directive64 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_64", "">;
+def DirectiveA2 : SubtargetFeature<"", "DarwinDirective", "PPC::DIR_A2", "">;
+def DirectiveE500mc : SubtargetFeature<"", "DarwinDirective",
+ "PPC::DIR_E500mc", "">;
+def DirectiveE5500 : SubtargetFeature<"", "DarwinDirective",
+ "PPC::DIR_E5500", "">;
+def DirectivePwr3: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR3", "">;
+def DirectivePwr4: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR4", "">;
+def DirectivePwr5: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR5", "">;
+def DirectivePwr5x: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR5X", "">;
+def DirectivePwr6: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR6", "">;
+def DirectivePwr6x: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR6X", "">;
+def DirectivePwr7: SubtargetFeature<"", "DarwinDirective", "PPC::DIR_PWR7", "">;
+
+def Feature64Bit : SubtargetFeature<"64bit","Has64BitSupport", "true",
+ "Enable 64-bit instructions">;
+def Feature64BitRegs : SubtargetFeature<"64bitregs","Use64BitRegs", "true",
+ "Enable 64-bit registers usage for ppc32 [beta]">;
+def FeatureAltivec : SubtargetFeature<"altivec","HasAltivec", "true",
+ "Enable Altivec instructions">;
+def FeatureMFOCRF : SubtargetFeature<"mfocrf","HasMFOCRF", "true",
+ "Enable the MFOCRF instruction">;
+def FeatureFSqrt : SubtargetFeature<"fsqrt","HasFSQRT", "true",
+ "Enable the fsqrt instruction">;
+def FeatureFRE : SubtargetFeature<"fre", "HasFRE", "true",
+ "Enable the fre instruction">;
+def FeatureFRES : SubtargetFeature<"fres", "HasFRES", "true",
+ "Enable the fres instruction">;
+def FeatureFRSQRTE : SubtargetFeature<"frsqrte", "HasFRSQRTE", "true",
+ "Enable the frsqrte instruction">;
+def FeatureFRSQRTES : SubtargetFeature<"frsqrtes", "HasFRSQRTES", "true",
+ "Enable the frsqrtes instruction">;
+def FeatureRecipPrec : SubtargetFeature<"recipprec", "HasRecipPrec", "true",
+ "Assume higher precision reciprocal estimates">;
+def FeatureSTFIWX : SubtargetFeature<"stfiwx","HasSTFIWX", "true",
+ "Enable the stfiwx instruction">;
+def FeatureLFIWAX : SubtargetFeature<"lfiwax","HasLFIWAX", "true",
+ "Enable the lfiwax instruction">;
+def FeatureFPRND : SubtargetFeature<"fprnd", "HasFPRND", "true",
+ "Enable the fri[mnpz] instructions">;
+def FeatureFPCVT : SubtargetFeature<"fpcvt", "HasFPCVT", "true",
+ "Enable fc[ft]* (unsigned and single-precision) and lfiwzx instructions">;
+def FeatureISEL : SubtargetFeature<"isel","HasISEL", "true",
+ "Enable the isel instruction">;
+def FeaturePOPCNTD : SubtargetFeature<"popcntd","HasPOPCNTD", "true",
+ "Enable the popcnt[dw] instructions">;
+def FeatureLDBRX : SubtargetFeature<"ldbrx","HasLDBRX", "true",
+ "Enable the ldbrx instruction">;
+def FeatureBookE : SubtargetFeature<"booke", "IsBookE", "true",
+ "Enable Book E instructions">;
+def FeatureQPX : SubtargetFeature<"qpx","HasQPX", "true",
+ "Enable QPX instructions">;
+
+// Note: Future features to add when support is extended to more
+// recent ISA levels:
+//
+// CMPB p6, p6x, p7 cmpb
+// DFP p6, p6x, p7 decimal floating-point instructions
+// POPCNTB p5 through p7 popcntb and related instructions
+// VSX p7 vector-scalar instruction set
+
+//===----------------------------------------------------------------------===//
+// Register File Description
+//===----------------------------------------------------------------------===//
+
+include "PPCRegisterInfo.td"
+include "PPCSchedule.td"
+include "PPCInstrInfo.td"
+
+//===----------------------------------------------------------------------===//
+// PowerPC processors supported.
+//
+
+def : Processor<"generic", G3Itineraries, [Directive32]>;
+def : Processor<"440", PPC440Itineraries, [Directive440, FeatureISEL,
+ FeatureFRES, FeatureFRSQRTE,
+ FeatureBookE]>;
+def : Processor<"450", PPC440Itineraries, [Directive440, FeatureISEL,
+ FeatureFRES, FeatureFRSQRTE,
+ FeatureBookE]>;
+def : Processor<"601", G3Itineraries, [Directive601]>;
+def : Processor<"602", G3Itineraries, [Directive602]>;
+def : Processor<"603", G3Itineraries, [Directive603,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"603e", G3Itineraries, [Directive603,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"603ev", G3Itineraries, [Directive603,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"604", G3Itineraries, [Directive604,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"604e", G3Itineraries, [Directive604,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"620", G3Itineraries, [Directive620,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"750", G4Itineraries, [Directive750,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"g3", G3Itineraries, [Directive750,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"7400", G4Itineraries, [Directive7400, FeatureAltivec,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"g4", G4Itineraries, [Directive7400, FeatureAltivec,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"7450", G4PlusItineraries, [Directive7400, FeatureAltivec,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : Processor<"g4+", G4PlusItineraries, [Directive7400, FeatureAltivec,
+ FeatureFRES, FeatureFRSQRTE]>;
+def : ProcessorModel<"970", G5Model,
+ [Directive970, FeatureAltivec,
+ FeatureMFOCRF, FeatureFSqrt,
+ FeatureFRES, FeatureFRSQRTE, FeatureSTFIWX,
+ Feature64Bit /*, Feature64BitRegs */]>;
+def : ProcessorModel<"g5", G5Model,
+ [Directive970, FeatureAltivec,
+ FeatureMFOCRF, FeatureFSqrt, FeatureSTFIWX,
+ FeatureFRES, FeatureFRSQRTE,
+ Feature64Bit /*, Feature64BitRegs */]>;
+def : ProcessorModel<"e500mc", PPCE500mcModel,
+ [DirectiveE500mc, FeatureMFOCRF,
+ FeatureSTFIWX, FeatureBookE, FeatureISEL]>;
+def : ProcessorModel<"e5500", PPCE5500Model,
+ [DirectiveE5500, FeatureMFOCRF, Feature64Bit,
+ FeatureSTFIWX, FeatureBookE, FeatureISEL]>;
+def : ProcessorModel<"a2", PPCA2Model,
+ [DirectiveA2, FeatureBookE, FeatureMFOCRF,
+ FeatureFSqrt, FeatureFRE, FeatureFRES,
+ FeatureFRSQRTE, FeatureFRSQRTES, FeatureRecipPrec,
+ FeatureSTFIWX, FeatureLFIWAX,
+ FeatureFPRND, FeatureFPCVT, FeatureISEL,
+ FeaturePOPCNTD, FeatureLDBRX, Feature64Bit
+ /*, Feature64BitRegs */]>;
+def : ProcessorModel<"a2q", PPCA2Model,
+ [DirectiveA2, FeatureBookE, FeatureMFOCRF,
+ FeatureFSqrt, FeatureFRE, FeatureFRES,
+ FeatureFRSQRTE, FeatureFRSQRTES, FeatureRecipPrec,
+ FeatureSTFIWX, FeatureLFIWAX,
+ FeatureFPRND, FeatureFPCVT, FeatureISEL,
+ FeaturePOPCNTD, FeatureLDBRX, Feature64Bit
+ /*, Feature64BitRegs */, FeatureQPX]>;
+def : ProcessorModel<"pwr3", G5Model,
+ [DirectivePwr3, FeatureAltivec,
+ FeatureFRES, FeatureFRSQRTE, FeatureMFOCRF,
+ FeatureSTFIWX, Feature64Bit]>;
+def : ProcessorModel<"pwr4", G5Model,
+ [DirectivePwr4, FeatureAltivec, FeatureMFOCRF,
+ FeatureFSqrt, FeatureFRES, FeatureFRSQRTE,
+ FeatureSTFIWX, Feature64Bit]>;
+def : ProcessorModel<"pwr5", G5Model,
+ [DirectivePwr5, FeatureAltivec, FeatureMFOCRF,
+ FeatureFSqrt, FeatureFRE, FeatureFRES,
+ FeatureFRSQRTE, FeatureFRSQRTES,
+ FeatureSTFIWX, Feature64Bit]>;
+def : ProcessorModel<"pwr5x", G5Model,
+ [DirectivePwr5x, FeatureAltivec, FeatureMFOCRF,
+ FeatureFSqrt, FeatureFRE, FeatureFRES,
+ FeatureFRSQRTE, FeatureFRSQRTES,
+ FeatureSTFIWX, FeatureFPRND, Feature64Bit]>;
+def : ProcessorModel<"pwr6", G5Model,
+ [DirectivePwr6, FeatureAltivec,
+ FeatureMFOCRF, FeatureFSqrt, FeatureFRE,
+ FeatureFRES, FeatureFRSQRTE, FeatureFRSQRTES,
+ FeatureRecipPrec, FeatureSTFIWX, FeatureLFIWAX,
+ FeatureFPRND, Feature64Bit /*, Feature64BitRegs */]>;
+def : ProcessorModel<"pwr6x", G5Model,
+ [DirectivePwr5x, FeatureAltivec, FeatureMFOCRF,
+ FeatureFSqrt, FeatureFRE, FeatureFRES,
+ FeatureFRSQRTE, FeatureFRSQRTES, FeatureRecipPrec,
+ FeatureSTFIWX, FeatureLFIWAX,
+ FeatureFPRND, Feature64Bit]>;
+def : ProcessorModel<"pwr7", G5Model,
+ [DirectivePwr7, FeatureAltivec,
+ FeatureMFOCRF, FeatureFSqrt, FeatureFRE,
+ FeatureFRES, FeatureFRSQRTE, FeatureFRSQRTES,
+ FeatureRecipPrec, FeatureSTFIWX, FeatureLFIWAX,
+ FeatureFPRND, FeatureFPCVT, FeatureISEL,
+ FeaturePOPCNTD, FeatureLDBRX,
+ Feature64Bit /*, Feature64BitRegs */]>;
+def : Processor<"ppc", G3Itineraries, [Directive32]>;
+def : ProcessorModel<"ppc64", G5Model,
+ [Directive64, FeatureAltivec,
+ FeatureMFOCRF, FeatureFSqrt, FeatureFRES,
+ FeatureFRSQRTE, FeatureSTFIWX,
+ Feature64Bit /*, Feature64BitRegs */]>;
+
+
+//===----------------------------------------------------------------------===//
+// Calling Conventions
+//===----------------------------------------------------------------------===//
+
+include "PPCCallingConv.td"
+
+def PPCInstrInfo : InstrInfo {
+ let isLittleEndianEncoding = 1;
+}
+
+def PPCAsmWriter : AsmWriter {
+ string AsmWriterClassName = "InstPrinter";
+ bit isMCAsmWriter = 1;
+}
+
+def PPC : Target {
+ // Information about the instructions.
+ let InstructionSet = PPCInstrInfo;
+
+ let AssemblyWriters = [PPCAsmWriter];
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCAsmPrinter.cpp b/contrib/llvm/lib/Target/PowerPC/PPCAsmPrinter.cpp
new file mode 100644
index 0000000..96a9f0a
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCAsmPrinter.cpp
@@ -0,0 +1,1126 @@
+//===-- PPCAsmPrinter.cpp - Print machine instrs to PowerPC assembly ------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains a printer that converts from our internal representation
+// of machine-dependent LLVM code to PowerPC assembly language. This printer is
+// the output mechanism used by `llc'.
+//
+// Documentation at http://developer.apple.com/documentation/DeveloperTools/
+// Reference/Assembler/ASMIntroduction/chapter_1_section_1.html
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "asmprinter"
+#include "PPC.h"
+#include "InstPrinter/PPCInstPrinter.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "PPCSubtarget.h"
+#include "PPCTargetMachine.h"
+#include "llvm/ADT/MapVector.h"
+#include "llvm/ADT/SmallString.h"
+#include "llvm/ADT/StringExtras.h"
+#include "llvm/Assembly/Writer.h"
+#include "llvm/CodeGen/AsmPrinter.h"
+#include "llvm/CodeGen/MachineFunctionPass.h"
+#include "llvm/CodeGen/MachineInstr.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineModuleInfoImpls.h"
+#include "llvm/CodeGen/TargetLoweringObjectFileImpl.h"
+#include "llvm/DebugInfo.h"
+#include "llvm/IR/Constants.h"
+#include "llvm/IR/DerivedTypes.h"
+#include "llvm/IR/Module.h"
+#include "llvm/MC/MCAsmInfo.h"
+#include "llvm/MC/MCContext.h"
+#include "llvm/MC/MCExpr.h"
+#include "llvm/MC/MCInst.h"
+#include "llvm/MC/MCInstBuilder.h"
+#include "llvm/MC/MCSectionELF.h"
+#include "llvm/MC/MCSectionMachO.h"
+#include "llvm/MC/MCStreamer.h"
+#include "llvm/MC/MCSymbol.h"
+#include "llvm/Support/CommandLine.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Support/ELF.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/MathExtras.h"
+#include "llvm/Support/TargetRegistry.h"
+#include "llvm/Support/raw_ostream.h"
+#include "llvm/Target/Mangler.h"
+#include "llvm/Target/TargetInstrInfo.h"
+#include "llvm/Target/TargetOptions.h"
+#include "llvm/Target/TargetRegisterInfo.h"
+using namespace llvm;
+
+namespace {
+ class PPCAsmPrinter : public AsmPrinter {
+ protected:
+ MapVector<MCSymbol*, MCSymbol*> TOC;
+ const PPCSubtarget &Subtarget;
+ uint64_t TOCLabelID;
+ public:
+ explicit PPCAsmPrinter(TargetMachine &TM, MCStreamer &Streamer)
+ : AsmPrinter(TM, Streamer),
+ Subtarget(TM.getSubtarget<PPCSubtarget>()), TOCLabelID(0) {}
+
+ virtual const char *getPassName() const {
+ return "PowerPC Assembly Printer";
+ }
+
+ MCSymbol *lookUpOrCreateTOCEntry(MCSymbol *Sym);
+
+ virtual void EmitInstruction(const MachineInstr *MI);
+
+ void printOperand(const MachineInstr *MI, unsigned OpNo, raw_ostream &O);
+
+ bool PrintAsmOperand(const MachineInstr *MI, unsigned OpNo,
+ unsigned AsmVariant, const char *ExtraCode,
+ raw_ostream &O);
+ bool PrintAsmMemoryOperand(const MachineInstr *MI, unsigned OpNo,
+ unsigned AsmVariant, const char *ExtraCode,
+ raw_ostream &O);
+
+ MachineLocation getDebugValueLocation(const MachineInstr *MI) const {
+ MachineLocation Location;
+ assert(MI->getNumOperands() == 4 && "Invalid no. of machine operands!");
+ // Frame address. Currently handles register +- offset only.
+ if (MI->getOperand(0).isReg() && MI->getOperand(2).isImm())
+ Location.set(MI->getOperand(0).getReg(), MI->getOperand(2).getImm());
+ else {
+ DEBUG(dbgs() << "DBG_VALUE instruction ignored! " << *MI << "\n");
+ }
+ return Location;
+ }
+ };
+
+ /// PPCLinuxAsmPrinter - PowerPC assembly printer, customized for Linux
+ class PPCLinuxAsmPrinter : public PPCAsmPrinter {
+ public:
+ explicit PPCLinuxAsmPrinter(TargetMachine &TM, MCStreamer &Streamer)
+ : PPCAsmPrinter(TM, Streamer) {}
+
+ virtual const char *getPassName() const {
+ return "Linux PPC Assembly Printer";
+ }
+
+ bool doFinalization(Module &M);
+
+ virtual void EmitFunctionEntryLabel();
+
+ void EmitFunctionBodyEnd();
+ };
+
+ /// PPCDarwinAsmPrinter - PowerPC assembly printer, customized for Darwin/Mac
+ /// OS X
+ class PPCDarwinAsmPrinter : public PPCAsmPrinter {
+ public:
+ explicit PPCDarwinAsmPrinter(TargetMachine &TM, MCStreamer &Streamer)
+ : PPCAsmPrinter(TM, Streamer) {}
+
+ virtual const char *getPassName() const {
+ return "Darwin PPC Assembly Printer";
+ }
+
+ bool doFinalization(Module &M);
+ void EmitStartOfAsmFile(Module &M);
+
+ void EmitFunctionStubs(const MachineModuleInfoMachO::SymbolListTy &Stubs);
+ };
+} // end of anonymous namespace
+
+/// stripRegisterPrefix - This method strips the character prefix from a
+/// register name so that only the number is left. Used by for linux asm.
+static const char *stripRegisterPrefix(const char *RegName) {
+ switch (RegName[0]) {
+ case 'r':
+ case 'f':
+ case 'v': return RegName + 1;
+ case 'c': if (RegName[1] == 'r') return RegName + 2;
+ }
+
+ return RegName;
+}
+
+void PPCAsmPrinter::printOperand(const MachineInstr *MI, unsigned OpNo,
+ raw_ostream &O) {
+ const MachineOperand &MO = MI->getOperand(OpNo);
+
+ switch (MO.getType()) {
+ case MachineOperand::MO_Register: {
+ const char *RegName = PPCInstPrinter::getRegisterName(MO.getReg());
+ // Linux assembler (Others?) does not take register mnemonics.
+ // FIXME - What about special registers used in mfspr/mtspr?
+ if (!Subtarget.isDarwin()) RegName = stripRegisterPrefix(RegName);
+ O << RegName;
+ return;
+ }
+ case MachineOperand::MO_Immediate:
+ O << MO.getImm();
+ return;
+
+ case MachineOperand::MO_MachineBasicBlock:
+ O << *MO.getMBB()->getSymbol();
+ return;
+ case MachineOperand::MO_JumpTableIndex:
+ O << MAI->getPrivateGlobalPrefix() << "JTI" << getFunctionNumber()
+ << '_' << MO.getIndex();
+ // FIXME: PIC relocation model
+ return;
+ case MachineOperand::MO_ConstantPoolIndex:
+ O << MAI->getPrivateGlobalPrefix() << "CPI" << getFunctionNumber()
+ << '_' << MO.getIndex();
+ return;
+ case MachineOperand::MO_BlockAddress:
+ O << *GetBlockAddressSymbol(MO.getBlockAddress());
+ return;
+ case MachineOperand::MO_ExternalSymbol: {
+ // Computing the address of an external symbol, not calling it.
+ if (TM.getRelocationModel() == Reloc::Static) {
+ O << *GetExternalSymbolSymbol(MO.getSymbolName());
+ return;
+ }
+
+ MCSymbol *NLPSym =
+ OutContext.GetOrCreateSymbol(StringRef(MAI->getGlobalPrefix())+
+ MO.getSymbolName()+"$non_lazy_ptr");
+ MachineModuleInfoImpl::StubValueTy &StubSym =
+ MMI->getObjFileInfo<MachineModuleInfoMachO>().getGVStubEntry(NLPSym);
+ if (StubSym.getPointer() == 0)
+ StubSym = MachineModuleInfoImpl::
+ StubValueTy(GetExternalSymbolSymbol(MO.getSymbolName()), true);
+
+ O << *NLPSym;
+ return;
+ }
+ case MachineOperand::MO_GlobalAddress: {
+ // Computing the address of a global symbol, not calling it.
+ const GlobalValue *GV = MO.getGlobal();
+ MCSymbol *SymToPrint;
+
+ // External or weakly linked global variables need non-lazily-resolved stubs
+ if (TM.getRelocationModel() != Reloc::Static &&
+ (GV->isDeclaration() || GV->isWeakForLinker())) {
+ if (!GV->hasHiddenVisibility()) {
+ SymToPrint = GetSymbolWithGlobalValueBase(GV, "$non_lazy_ptr");
+ MachineModuleInfoImpl::StubValueTy &StubSym =
+ MMI->getObjFileInfo<MachineModuleInfoMachO>()
+ .getGVStubEntry(SymToPrint);
+ if (StubSym.getPointer() == 0)
+ StubSym = MachineModuleInfoImpl::
+ StubValueTy(Mang->getSymbol(GV), !GV->hasInternalLinkage());
+ } else if (GV->isDeclaration() || GV->hasCommonLinkage() ||
+ GV->hasAvailableExternallyLinkage()) {
+ SymToPrint = GetSymbolWithGlobalValueBase(GV, "$non_lazy_ptr");
+
+ MachineModuleInfoImpl::StubValueTy &StubSym =
+ MMI->getObjFileInfo<MachineModuleInfoMachO>().
+ getHiddenGVStubEntry(SymToPrint);
+ if (StubSym.getPointer() == 0)
+ StubSym = MachineModuleInfoImpl::
+ StubValueTy(Mang->getSymbol(GV), !GV->hasInternalLinkage());
+ } else {
+ SymToPrint = Mang->getSymbol(GV);
+ }
+ } else {
+ SymToPrint = Mang->getSymbol(GV);
+ }
+
+ O << *SymToPrint;
+
+ printOffset(MO.getOffset(), O);
+ return;
+ }
+
+ default:
+ O << "<unknown operand type: " << MO.getType() << ">";
+ return;
+ }
+}
+
+/// PrintAsmOperand - Print out an operand for an inline asm expression.
+///
+bool PPCAsmPrinter::PrintAsmOperand(const MachineInstr *MI, unsigned OpNo,
+ unsigned AsmVariant,
+ const char *ExtraCode, raw_ostream &O) {
+ // Does this asm operand have a single letter operand modifier?
+ if (ExtraCode && ExtraCode[0]) {
+ if (ExtraCode[1] != 0) return true; // Unknown modifier.
+
+ switch (ExtraCode[0]) {
+ default:
+ // See if this is a generic print operand
+ return AsmPrinter::PrintAsmOperand(MI, OpNo, AsmVariant, ExtraCode, O);
+ case 'c': // Don't print "$" before a global var name or constant.
+ break; // PPC never has a prefix.
+ case 'L': // Write second word of DImode reference.
+ // Verify that this operand has two consecutive registers.
+ if (!MI->getOperand(OpNo).isReg() ||
+ OpNo+1 == MI->getNumOperands() ||
+ !MI->getOperand(OpNo+1).isReg())
+ return true;
+ ++OpNo; // Return the high-part.
+ break;
+ case 'I':
+ // Write 'i' if an integer constant, otherwise nothing. Used to print
+ // addi vs add, etc.
+ if (MI->getOperand(OpNo).isImm())
+ O << "i";
+ return false;
+ }
+ }
+
+ printOperand(MI, OpNo, O);
+ return false;
+}
+
+// At the moment, all inline asm memory operands are a single register.
+// In any case, the output of this routine should always be just one
+// assembler operand.
+
+bool PPCAsmPrinter::PrintAsmMemoryOperand(const MachineInstr *MI, unsigned OpNo,
+ unsigned AsmVariant,
+ const char *ExtraCode,
+ raw_ostream &O) {
+ if (ExtraCode && ExtraCode[0]) {
+ if (ExtraCode[1] != 0) return true; // Unknown modifier.
+
+ switch (ExtraCode[0]) {
+ default: return true; // Unknown modifier.
+ case 'y': // A memory reference for an X-form instruction
+ {
+ const char *RegName = "r0";
+ if (!Subtarget.isDarwin()) RegName = stripRegisterPrefix(RegName);
+ O << RegName << ", ";
+ printOperand(MI, OpNo, O);
+ return false;
+ }
+ }
+ }
+
+ assert(MI->getOperand(OpNo).isReg());
+ O << "0(";
+ printOperand(MI, OpNo, O);
+ O << ")";
+ return false;
+}
+
+
+/// lookUpOrCreateTOCEntry -- Given a symbol, look up whether a TOC entry
+/// exists for it. If not, create one. Then return a symbol that references
+/// the TOC entry.
+MCSymbol *PPCAsmPrinter::lookUpOrCreateTOCEntry(MCSymbol *Sym) {
+
+ MCSymbol *&TOCEntry = TOC[Sym];
+
+ // To avoid name clash check if the name already exists.
+ while (TOCEntry == 0) {
+ if (OutContext.LookupSymbol(Twine(MAI->getPrivateGlobalPrefix()) +
+ "C" + Twine(TOCLabelID++)) == 0) {
+ TOCEntry = GetTempSymbol("C", TOCLabelID);
+ }
+ }
+
+ return TOCEntry;
+}
+
+
+/// EmitInstruction -- Print out a single PowerPC MI in Darwin syntax to
+/// the current output stream.
+///
+void PPCAsmPrinter::EmitInstruction(const MachineInstr *MI) {
+ MCInst TmpInst;
+
+ // Lower multi-instruction pseudo operations.
+ switch (MI->getOpcode()) {
+ default: break;
+ case TargetOpcode::DBG_VALUE: {
+ if (!isVerbose() || !OutStreamer.hasRawTextSupport()) return;
+
+ SmallString<32> Str;
+ raw_svector_ostream O(Str);
+ unsigned NOps = MI->getNumOperands();
+ assert(NOps==4);
+ O << '\t' << MAI->getCommentString() << "DEBUG_VALUE: ";
+ // cast away const; DIetc do not take const operands for some reason.
+ DIVariable V(const_cast<MDNode *>(MI->getOperand(NOps-1).getMetadata()));
+ O << V.getName();
+ O << " <- ";
+ // Frame address. Currently handles register +- offset only.
+ assert(MI->getOperand(0).isReg() && MI->getOperand(1).isImm());
+ O << '['; printOperand(MI, 0, O); O << '+'; printOperand(MI, 1, O);
+ O << ']';
+ O << "+";
+ printOperand(MI, NOps-2, O);
+ OutStreamer.EmitRawText(O.str());
+ return;
+ }
+
+ case PPC::MovePCtoLR:
+ case PPC::MovePCtoLR8: {
+ // Transform %LR = MovePCtoLR
+ // Into this, where the label is the PIC base:
+ // bl L1$pb
+ // L1$pb:
+ MCSymbol *PICBase = MF->getPICBaseSymbol();
+
+ // Emit the 'bl'.
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::BL)
+ // FIXME: We would like an efficient form for this, so we don't have to do
+ // a lot of extra uniquing.
+ .addExpr(MCSymbolRefExpr::Create(PICBase, OutContext)));
+
+ // Emit the label.
+ OutStreamer.EmitLabel(PICBase);
+ return;
+ }
+ case PPC::LDtocJTI:
+ case PPC::LDtocCPT:
+ case PPC::LDtoc: {
+ // Transform %X3 = LDtoc <ga:@min1>, %X2
+ LowerPPCMachineInstrToMCInst(MI, TmpInst, *this, Subtarget.isDarwin());
+
+ // Change the opcode to LD, and the global address operand to be a
+ // reference to the TOC entry we will synthesize later.
+ TmpInst.setOpcode(PPC::LD);
+ const MachineOperand &MO = MI->getOperand(1);
+
+ // Map symbol -> label of TOC entry
+ assert(MO.isGlobal() || MO.isCPI() || MO.isJTI());
+ MCSymbol *MOSymbol = 0;
+ if (MO.isGlobal())
+ MOSymbol = Mang->getSymbol(MO.getGlobal());
+ else if (MO.isCPI())
+ MOSymbol = GetCPISymbol(MO.getIndex());
+ else if (MO.isJTI())
+ MOSymbol = GetJTISymbol(MO.getIndex());
+
+ MCSymbol *TOCEntry = lookUpOrCreateTOCEntry(MOSymbol);
+
+ const MCExpr *Exp =
+ MCSymbolRefExpr::Create(TOCEntry, MCSymbolRefExpr::VK_PPC_TOC_ENTRY,
+ OutContext);
+ TmpInst.getOperand(1) = MCOperand::CreateExpr(Exp);
+ OutStreamer.EmitInstruction(TmpInst);
+ return;
+ }
+
+ case PPC::ADDIStocHA: {
+ // Transform %Xd = ADDIStocHA %X2, <ga:@sym>
+ LowerPPCMachineInstrToMCInst(MI, TmpInst, *this, Subtarget.isDarwin());
+
+ // Change the opcode to ADDIS8. If the global address is external,
+ // has common linkage, is a function address, or is a jump table
+ // address, then generate a TOC entry and reference that. Otherwise
+ // reference the symbol directly.
+ TmpInst.setOpcode(PPC::ADDIS8);
+ const MachineOperand &MO = MI->getOperand(2);
+ assert((MO.isGlobal() || MO.isCPI() || MO.isJTI()) &&
+ "Invalid operand for ADDIStocHA!");
+ MCSymbol *MOSymbol = 0;
+ bool IsExternal = false;
+ bool IsFunction = false;
+ bool IsCommon = false;
+ bool IsAvailExt = false;
+
+ if (MO.isGlobal()) {
+ const GlobalValue *GValue = MO.getGlobal();
+ const GlobalAlias *GAlias = dyn_cast<GlobalAlias>(GValue);
+ const GlobalValue *RealGValue = GAlias ?
+ GAlias->resolveAliasedGlobal(false) : GValue;
+ MOSymbol = Mang->getSymbol(RealGValue);
+ const GlobalVariable *GVar = dyn_cast<GlobalVariable>(RealGValue);
+ IsExternal = GVar && !GVar->hasInitializer();
+ IsCommon = GVar && RealGValue->hasCommonLinkage();
+ IsFunction = !GVar;
+ IsAvailExt = GVar && RealGValue->hasAvailableExternallyLinkage();
+ } else if (MO.isCPI())
+ MOSymbol = GetCPISymbol(MO.getIndex());
+ else if (MO.isJTI())
+ MOSymbol = GetJTISymbol(MO.getIndex());
+
+ if (IsExternal || IsFunction || IsCommon || IsAvailExt || MO.isJTI())
+ MOSymbol = lookUpOrCreateTOCEntry(MOSymbol);
+
+ const MCExpr *Exp =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_TOC16_HA,
+ OutContext);
+ TmpInst.getOperand(2) = MCOperand::CreateExpr(Exp);
+ OutStreamer.EmitInstruction(TmpInst);
+ return;
+ }
+ case PPC::LDtocL: {
+ // Transform %Xd = LDtocL <ga:@sym>, %Xs
+ LowerPPCMachineInstrToMCInst(MI, TmpInst, *this, Subtarget.isDarwin());
+
+ // Change the opcode to LD. If the global address is external, has
+ // common linkage, or is a jump table address, then reference the
+ // associated TOC entry. Otherwise reference the symbol directly.
+ TmpInst.setOpcode(PPC::LD);
+ const MachineOperand &MO = MI->getOperand(1);
+ assert((MO.isGlobal() || MO.isJTI() || MO.isCPI()) &&
+ "Invalid operand for LDtocL!");
+ MCSymbol *MOSymbol = 0;
+
+ if (MO.isJTI())
+ MOSymbol = lookUpOrCreateTOCEntry(GetJTISymbol(MO.getIndex()));
+ else if (MO.isCPI())
+ MOSymbol = GetCPISymbol(MO.getIndex());
+ else if (MO.isGlobal()) {
+ const GlobalValue *GValue = MO.getGlobal();
+ const GlobalAlias *GAlias = dyn_cast<GlobalAlias>(GValue);
+ const GlobalValue *RealGValue = GAlias ?
+ GAlias->resolveAliasedGlobal(false) : GValue;
+ MOSymbol = Mang->getSymbol(RealGValue);
+ const GlobalVariable *GVar = dyn_cast<GlobalVariable>(RealGValue);
+
+ if (!GVar || !GVar->hasInitializer() || RealGValue->hasCommonLinkage() ||
+ RealGValue->hasAvailableExternallyLinkage())
+ MOSymbol = lookUpOrCreateTOCEntry(MOSymbol);
+ }
+
+ const MCExpr *Exp =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_TOC16_LO,
+ OutContext);
+ TmpInst.getOperand(1) = MCOperand::CreateExpr(Exp);
+ OutStreamer.EmitInstruction(TmpInst);
+ return;
+ }
+ case PPC::ADDItocL: {
+ // Transform %Xd = ADDItocL %Xs, <ga:@sym>
+ LowerPPCMachineInstrToMCInst(MI, TmpInst, *this, Subtarget.isDarwin());
+
+ // Change the opcode to ADDI8. If the global address is external, then
+ // generate a TOC entry and reference that. Otherwise reference the
+ // symbol directly.
+ TmpInst.setOpcode(PPC::ADDI8);
+ const MachineOperand &MO = MI->getOperand(2);
+ assert((MO.isGlobal() || MO.isCPI()) && "Invalid operand for ADDItocL");
+ MCSymbol *MOSymbol = 0;
+ bool IsExternal = false;
+ bool IsFunction = false;
+
+ if (MO.isGlobal()) {
+ const GlobalValue *GValue = MO.getGlobal();
+ const GlobalAlias *GAlias = dyn_cast<GlobalAlias>(GValue);
+ const GlobalValue *RealGValue = GAlias ?
+ GAlias->resolveAliasedGlobal(false) : GValue;
+ MOSymbol = Mang->getSymbol(RealGValue);
+ const GlobalVariable *GVar = dyn_cast<GlobalVariable>(RealGValue);
+ IsExternal = GVar && !GVar->hasInitializer();
+ IsFunction = !GVar;
+ } else if (MO.isCPI())
+ MOSymbol = GetCPISymbol(MO.getIndex());
+
+ if (IsFunction || IsExternal)
+ MOSymbol = lookUpOrCreateTOCEntry(MOSymbol);
+
+ const MCExpr *Exp =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_TOC16_LO,
+ OutContext);
+ TmpInst.getOperand(2) = MCOperand::CreateExpr(Exp);
+ OutStreamer.EmitInstruction(TmpInst);
+ return;
+ }
+ case PPC::ADDISgotTprelHA: {
+ // Transform: %Xd = ADDISgotTprelHA %X2, <ga:@sym>
+ // Into: %Xd = ADDIS8 %X2, sym@got@tlsgd@ha
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymGotTprel =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_GOT_TPREL16_HA,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDIS8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(PPC::X2)
+ .addExpr(SymGotTprel));
+ return;
+ }
+ case PPC::LDgotTprelL: {
+ // Transform %Xd = LDgotTprelL <ga:@sym>, %Xs
+ LowerPPCMachineInstrToMCInst(MI, TmpInst, *this, Subtarget.isDarwin());
+
+ // Change the opcode to LD.
+ TmpInst.setOpcode(PPC::LD);
+ const MachineOperand &MO = MI->getOperand(1);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *Exp =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_GOT_TPREL16_LO,
+ OutContext);
+ TmpInst.getOperand(1) = MCOperand::CreateExpr(Exp);
+ OutStreamer.EmitInstruction(TmpInst);
+ return;
+ }
+ case PPC::ADDIStlsgdHA: {
+ // Transform: %Xd = ADDIStlsgdHA %X2, <ga:@sym>
+ // Into: %Xd = ADDIS8 %X2, sym@got@tlsgd@ha
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymGotTlsGD =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_GOT_TLSGD16_HA,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDIS8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(PPC::X2)
+ .addExpr(SymGotTlsGD));
+ return;
+ }
+ case PPC::ADDItlsgdL: {
+ // Transform: %Xd = ADDItlsgdL %Xs, <ga:@sym>
+ // Into: %Xd = ADDI8 %Xs, sym@got@tlsgd@l
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymGotTlsGD =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_GOT_TLSGD16_LO,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDI8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(MI->getOperand(1).getReg())
+ .addExpr(SymGotTlsGD));
+ return;
+ }
+ case PPC::GETtlsADDR: {
+ // Transform: %X3 = GETtlsADDR %X3, <ga:@sym>
+ // Into: BL8_NOP_TLSGD __tls_get_addr(sym@tlsgd)
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+
+ StringRef Name = "__tls_get_addr";
+ MCSymbol *TlsGetAddr = OutContext.GetOrCreateSymbol(Name);
+ const MCSymbolRefExpr *TlsRef =
+ MCSymbolRefExpr::Create(TlsGetAddr, MCSymbolRefExpr::VK_None, OutContext);
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymVar =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_TLSGD,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::BL8_NOP_TLSGD)
+ .addExpr(TlsRef)
+ .addExpr(SymVar));
+ return;
+ }
+ case PPC::ADDIStlsldHA: {
+ // Transform: %Xd = ADDIStlsldHA %X2, <ga:@sym>
+ // Into: %Xd = ADDIS8 %X2, sym@got@tlsld@ha
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymGotTlsLD =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_GOT_TLSLD16_HA,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDIS8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(PPC::X2)
+ .addExpr(SymGotTlsLD));
+ return;
+ }
+ case PPC::ADDItlsldL: {
+ // Transform: %Xd = ADDItlsldL %Xs, <ga:@sym>
+ // Into: %Xd = ADDI8 %Xs, sym@got@tlsld@l
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymGotTlsLD =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_GOT_TLSLD16_LO,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDI8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(MI->getOperand(1).getReg())
+ .addExpr(SymGotTlsLD));
+ return;
+ }
+ case PPC::GETtlsldADDR: {
+ // Transform: %X3 = GETtlsldADDR %X3, <ga:@sym>
+ // Into: BL8_NOP_TLSLD __tls_get_addr(sym@tlsld)
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+
+ StringRef Name = "__tls_get_addr";
+ MCSymbol *TlsGetAddr = OutContext.GetOrCreateSymbol(Name);
+ const MCSymbolRefExpr *TlsRef =
+ MCSymbolRefExpr::Create(TlsGetAddr, MCSymbolRefExpr::VK_None, OutContext);
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymVar =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_TLSLD,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::BL8_NOP_TLSLD)
+ .addExpr(TlsRef)
+ .addExpr(SymVar));
+ return;
+ }
+ case PPC::ADDISdtprelHA: {
+ // Transform: %Xd = ADDISdtprelHA %X3, <ga:@sym>
+ // Into: %Xd = ADDIS8 %X3, sym@dtprel@ha
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymDtprel =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_DTPREL16_HA,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDIS8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(PPC::X3)
+ .addExpr(SymDtprel));
+ return;
+ }
+ case PPC::ADDIdtprelL: {
+ // Transform: %Xd = ADDIdtprelL %Xs, <ga:@sym>
+ // Into: %Xd = ADDI8 %Xs, sym@dtprel@l
+ assert(Subtarget.isPPC64() && "Not supported for 32-bit PowerPC");
+ const MachineOperand &MO = MI->getOperand(2);
+ const GlobalValue *GValue = MO.getGlobal();
+ MCSymbol *MOSymbol = Mang->getSymbol(GValue);
+ const MCExpr *SymDtprel =
+ MCSymbolRefExpr::Create(MOSymbol, MCSymbolRefExpr::VK_PPC_DTPREL16_LO,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDI8)
+ .addReg(MI->getOperand(0).getReg())
+ .addReg(MI->getOperand(1).getReg())
+ .addExpr(SymDtprel));
+ return;
+ }
+ case PPC::MFCRpseud:
+ case PPC::MFCR8pseud:
+ // Transform: %R3 = MFCRpseud %CR7
+ // Into: %R3 = MFCR ;; cr7
+ OutStreamer.AddComment(PPCInstPrinter::
+ getRegisterName(MI->getOperand(1).getReg()));
+ OutStreamer.EmitInstruction(MCInstBuilder(Subtarget.isPPC64() ? PPC::MFCR8 : PPC::MFCR)
+ .addReg(MI->getOperand(0).getReg()));
+ return;
+ case PPC::SYNC:
+ // In Book E sync is called msync, handle this special case here...
+ if (Subtarget.isBookE()) {
+ OutStreamer.EmitRawText(StringRef("\tmsync"));
+ return;
+ }
+ }
+
+ LowerPPCMachineInstrToMCInst(MI, TmpInst, *this, Subtarget.isDarwin());
+ OutStreamer.EmitInstruction(TmpInst);
+}
+
+void PPCLinuxAsmPrinter::EmitFunctionEntryLabel() {
+ if (!Subtarget.isPPC64()) // linux/ppc32 - Normal entry label.
+ return AsmPrinter::EmitFunctionEntryLabel();
+
+ // Emit an official procedure descriptor.
+ const MCSection *Current = OutStreamer.getCurrentSection();
+ const MCSectionELF *Section = OutStreamer.getContext().getELFSection(".opd",
+ ELF::SHT_PROGBITS, ELF::SHF_WRITE | ELF::SHF_ALLOC,
+ SectionKind::getReadOnly());
+ OutStreamer.SwitchSection(Section);
+ OutStreamer.EmitLabel(CurrentFnSym);
+ OutStreamer.EmitValueToAlignment(8);
+ MCSymbol *Symbol1 =
+ OutContext.GetOrCreateSymbol(".L." + Twine(CurrentFnSym->getName()));
+ // Generates a R_PPC64_ADDR64 (from FK_DATA_8) relocation for the function
+ // entry point.
+ OutStreamer.EmitValue(MCSymbolRefExpr::Create(Symbol1, OutContext),
+ 8 /*size*/);
+ MCSymbol *Symbol2 = OutContext.GetOrCreateSymbol(StringRef(".TOC."));
+ // Generates a R_PPC64_TOC relocation for TOC base insertion.
+ OutStreamer.EmitValue(MCSymbolRefExpr::Create(Symbol2,
+ MCSymbolRefExpr::VK_PPC_TOC, OutContext),
+ 8/*size*/);
+ // Emit a null environment pointer.
+ OutStreamer.EmitIntValue(0, 8 /* size */);
+ OutStreamer.SwitchSection(Current);
+
+ MCSymbol *RealFnSym = OutContext.GetOrCreateSymbol(
+ ".L." + Twine(CurrentFnSym->getName()));
+ OutStreamer.EmitLabel(RealFnSym);
+ CurrentFnSymForSize = RealFnSym;
+}
+
+
+bool PPCLinuxAsmPrinter::doFinalization(Module &M) {
+ const DataLayout *TD = TM.getDataLayout();
+
+ bool isPPC64 = TD->getPointerSizeInBits() == 64;
+
+ if (isPPC64 && !TOC.empty()) {
+ const MCSectionELF *Section = OutStreamer.getContext().getELFSection(".toc",
+ ELF::SHT_PROGBITS, ELF::SHF_WRITE | ELF::SHF_ALLOC,
+ SectionKind::getReadOnly());
+ OutStreamer.SwitchSection(Section);
+
+ for (MapVector<MCSymbol*, MCSymbol*>::iterator I = TOC.begin(),
+ E = TOC.end(); I != E; ++I) {
+ OutStreamer.EmitLabel(I->second);
+ MCSymbol *S = OutContext.GetOrCreateSymbol(I->first->getName());
+ OutStreamer.EmitTCEntry(*S);
+ }
+ }
+
+ MachineModuleInfoELF &MMIELF =
+ MMI->getObjFileInfo<MachineModuleInfoELF>();
+
+ MachineModuleInfoELF::SymbolListTy Stubs = MMIELF.GetGVStubList();
+ if (!Stubs.empty()) {
+ OutStreamer.SwitchSection(getObjFileLowering().getDataSection());
+ for (unsigned i = 0, e = Stubs.size(); i != e; ++i) {
+ // L_foo$stub:
+ OutStreamer.EmitLabel(Stubs[i].first);
+ // .long _foo
+ OutStreamer.EmitValue(MCSymbolRefExpr::Create(Stubs[i].second.getPointer(),
+ OutContext),
+ isPPC64 ? 8 : 4/*size*/, 0/*addrspace*/);
+ }
+
+ Stubs.clear();
+ OutStreamer.AddBlankLine();
+ }
+
+ return AsmPrinter::doFinalization(M);
+}
+
+/// EmitFunctionBodyEnd - Print the traceback table before the .size
+/// directive.
+///
+void PPCLinuxAsmPrinter::EmitFunctionBodyEnd() {
+ // Only the 64-bit target requires a traceback table. For now,
+ // we only emit the word of zeroes that GDB requires to find
+ // the end of the function, and zeroes for the eight-byte
+ // mandatory fields.
+ // FIXME: We should fill in the eight-byte mandatory fields as described in
+ // the PPC64 ELF ABI (this is a low-priority item because GDB does not
+ // currently make use of these fields).
+ if (Subtarget.isPPC64()) {
+ OutStreamer.EmitIntValue(0, 4/*size*/);
+ OutStreamer.EmitIntValue(0, 8/*size*/);
+ }
+}
+
+void PPCDarwinAsmPrinter::EmitStartOfAsmFile(Module &M) {
+ static const char *const CPUDirectives[] = {
+ "",
+ "ppc",
+ "ppc440",
+ "ppc601",
+ "ppc602",
+ "ppc603",
+ "ppc7400",
+ "ppc750",
+ "ppc970",
+ "ppcA2",
+ "ppce500mc",
+ "ppce5500",
+ "power3",
+ "power4",
+ "power5",
+ "power5x",
+ "power6",
+ "power6x",
+ "power7",
+ "ppc64"
+ };
+
+ unsigned Directive = Subtarget.getDarwinDirective();
+ if (Subtarget.hasMFOCRF() && Directive < PPC::DIR_970)
+ Directive = PPC::DIR_970;
+ if (Subtarget.hasAltivec() && Directive < PPC::DIR_7400)
+ Directive = PPC::DIR_7400;
+ if (Subtarget.isPPC64() && Directive < PPC::DIR_64)
+ Directive = PPC::DIR_64;
+ assert(Directive <= PPC::DIR_64 && "Directive out of range.");
+
+ // FIXME: This is a total hack, finish mc'izing the PPC backend.
+ if (OutStreamer.hasRawTextSupport()) {
+ assert(Directive < sizeof(CPUDirectives) / sizeof(*CPUDirectives) &&
+ "CPUDirectives[] might not be up-to-date!");
+ OutStreamer.EmitRawText("\t.machine " + Twine(CPUDirectives[Directive]));
+ }
+
+ // Prime text sections so they are adjacent. This reduces the likelihood a
+ // large data or debug section causes a branch to exceed 16M limit.
+ const TargetLoweringObjectFileMachO &TLOFMacho =
+ static_cast<const TargetLoweringObjectFileMachO &>(getObjFileLowering());
+ OutStreamer.SwitchSection(TLOFMacho.getTextCoalSection());
+ if (TM.getRelocationModel() == Reloc::PIC_) {
+ OutStreamer.SwitchSection(
+ OutContext.getMachOSection("__TEXT", "__picsymbolstub1",
+ MCSectionMachO::S_SYMBOL_STUBS |
+ MCSectionMachO::S_ATTR_PURE_INSTRUCTIONS,
+ 32, SectionKind::getText()));
+ } else if (TM.getRelocationModel() == Reloc::DynamicNoPIC) {
+ OutStreamer.SwitchSection(
+ OutContext.getMachOSection("__TEXT","__symbol_stub1",
+ MCSectionMachO::S_SYMBOL_STUBS |
+ MCSectionMachO::S_ATTR_PURE_INSTRUCTIONS,
+ 16, SectionKind::getText()));
+ }
+ OutStreamer.SwitchSection(getObjFileLowering().getTextSection());
+}
+
+static MCSymbol *GetLazyPtr(MCSymbol *Sym, MCContext &Ctx) {
+ // Remove $stub suffix, add $lazy_ptr.
+ StringRef NoStub = Sym->getName().substr(0, Sym->getName().size()-5);
+ return Ctx.GetOrCreateSymbol(NoStub + "$lazy_ptr");
+}
+
+static MCSymbol *GetAnonSym(MCSymbol *Sym, MCContext &Ctx) {
+ // Add $tmp suffix to $stub, yielding $stub$tmp.
+ return Ctx.GetOrCreateSymbol(Sym->getName() + "$tmp");
+}
+
+void PPCDarwinAsmPrinter::
+EmitFunctionStubs(const MachineModuleInfoMachO::SymbolListTy &Stubs) {
+ bool isPPC64 = TM.getDataLayout()->getPointerSizeInBits() == 64;
+
+ const TargetLoweringObjectFileMachO &TLOFMacho =
+ static_cast<const TargetLoweringObjectFileMachO &>(getObjFileLowering());
+
+ // .lazy_symbol_pointer
+ const MCSection *LSPSection = TLOFMacho.getLazySymbolPointerSection();
+
+ // Output stubs for dynamically-linked functions
+ if (TM.getRelocationModel() == Reloc::PIC_) {
+ const MCSection *StubSection =
+ OutContext.getMachOSection("__TEXT", "__picsymbolstub1",
+ MCSectionMachO::S_SYMBOL_STUBS |
+ MCSectionMachO::S_ATTR_PURE_INSTRUCTIONS,
+ 32, SectionKind::getText());
+ for (unsigned i = 0, e = Stubs.size(); i != e; ++i) {
+ OutStreamer.SwitchSection(StubSection);
+ EmitAlignment(4);
+
+ MCSymbol *Stub = Stubs[i].first;
+ MCSymbol *RawSym = Stubs[i].second.getPointer();
+ MCSymbol *LazyPtr = GetLazyPtr(Stub, OutContext);
+ MCSymbol *AnonSymbol = GetAnonSym(Stub, OutContext);
+
+ OutStreamer.EmitLabel(Stub);
+ OutStreamer.EmitSymbolAttribute(RawSym, MCSA_IndirectSymbol);
+
+ const MCExpr *Anon = MCSymbolRefExpr::Create(AnonSymbol, OutContext);
+
+ // mflr r0
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::MFLR).addReg(PPC::R0));
+ // bcl 20, 31, AnonSymbol
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::BCLalways).addExpr(Anon));
+ OutStreamer.EmitLabel(AnonSymbol);
+ // mflr r11
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::MFLR).addReg(PPC::R11));
+ // addis r11, r11, ha16(LazyPtr - AnonSymbol)
+ const MCExpr *Sub =
+ MCBinaryExpr::CreateSub(MCSymbolRefExpr::Create(LazyPtr, OutContext),
+ Anon, OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::ADDIS)
+ .addReg(PPC::R11)
+ .addReg(PPC::R11)
+ .addExpr(Sub));
+ // mtlr r0
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::MTLR).addReg(PPC::R0));
+
+ // ldu r12, lo16(LazyPtr - AnonSymbol)(r11)
+ // lwzu r12, lo16(LazyPtr - AnonSymbol)(r11)
+ OutStreamer.EmitInstruction(MCInstBuilder(isPPC64 ? PPC::LDU : PPC::LWZU)
+ .addReg(PPC::R12)
+ .addExpr(Sub).addExpr(Sub)
+ .addReg(PPC::R11));
+ // mtctr r12
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::MTCTR).addReg(PPC::R12));
+ // bctr
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::BCTR));
+
+ OutStreamer.SwitchSection(LSPSection);
+ OutStreamer.EmitLabel(LazyPtr);
+ OutStreamer.EmitSymbolAttribute(RawSym, MCSA_IndirectSymbol);
+
+ MCSymbol *DyldStubBindingHelper =
+ OutContext.GetOrCreateSymbol(StringRef("dyld_stub_binding_helper"));
+ if (isPPC64) {
+ // .quad dyld_stub_binding_helper
+ OutStreamer.EmitSymbolValue(DyldStubBindingHelper, 8);
+ } else {
+ // .long dyld_stub_binding_helper
+ OutStreamer.EmitSymbolValue(DyldStubBindingHelper, 4);
+ }
+ }
+ OutStreamer.AddBlankLine();
+ return;
+ }
+
+ const MCSection *StubSection =
+ OutContext.getMachOSection("__TEXT","__symbol_stub1",
+ MCSectionMachO::S_SYMBOL_STUBS |
+ MCSectionMachO::S_ATTR_PURE_INSTRUCTIONS,
+ 16, SectionKind::getText());
+ for (unsigned i = 0, e = Stubs.size(); i != e; ++i) {
+ MCSymbol *Stub = Stubs[i].first;
+ MCSymbol *RawSym = Stubs[i].second.getPointer();
+ MCSymbol *LazyPtr = GetLazyPtr(Stub, OutContext);
+
+ OutStreamer.SwitchSection(StubSection);
+ EmitAlignment(4);
+ OutStreamer.EmitLabel(Stub);
+ OutStreamer.EmitSymbolAttribute(RawSym, MCSA_IndirectSymbol);
+ // lis r11, ha16(LazyPtr)
+ const MCExpr *LazyPtrHa16 =
+ MCSymbolRefExpr::Create(LazyPtr, MCSymbolRefExpr::VK_PPC_DARWIN_HA16,
+ OutContext);
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::LIS)
+ .addReg(PPC::R11)
+ .addExpr(LazyPtrHa16));
+
+ const MCExpr *LazyPtrLo16 =
+ MCSymbolRefExpr::Create(LazyPtr, MCSymbolRefExpr::VK_PPC_DARWIN_LO16,
+ OutContext);
+ // ldu r12, lo16(LazyPtr)(r11)
+ // lwzu r12, lo16(LazyPtr)(r11)
+ OutStreamer.EmitInstruction(MCInstBuilder(isPPC64 ? PPC::LDU : PPC::LWZU)
+ .addReg(PPC::R12)
+ .addExpr(LazyPtrLo16).addExpr(LazyPtrLo16)
+ .addReg(PPC::R11));
+
+ // mtctr r12
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::MTCTR).addReg(PPC::R12));
+ // bctr
+ OutStreamer.EmitInstruction(MCInstBuilder(PPC::BCTR));
+
+ OutStreamer.SwitchSection(LSPSection);
+ OutStreamer.EmitLabel(LazyPtr);
+ OutStreamer.EmitSymbolAttribute(RawSym, MCSA_IndirectSymbol);
+
+ MCSymbol *DyldStubBindingHelper =
+ OutContext.GetOrCreateSymbol(StringRef("dyld_stub_binding_helper"));
+ if (isPPC64) {
+ // .quad dyld_stub_binding_helper
+ OutStreamer.EmitSymbolValue(DyldStubBindingHelper, 8);
+ } else {
+ // .long dyld_stub_binding_helper
+ OutStreamer.EmitSymbolValue(DyldStubBindingHelper, 4);
+ }
+ }
+
+ OutStreamer.AddBlankLine();
+}
+
+
+bool PPCDarwinAsmPrinter::doFinalization(Module &M) {
+ bool isPPC64 = TM.getDataLayout()->getPointerSizeInBits() == 64;
+
+ // Darwin/PPC always uses mach-o.
+ const TargetLoweringObjectFileMachO &TLOFMacho =
+ static_cast<const TargetLoweringObjectFileMachO &>(getObjFileLowering());
+ MachineModuleInfoMachO &MMIMacho =
+ MMI->getObjFileInfo<MachineModuleInfoMachO>();
+
+ MachineModuleInfoMachO::SymbolListTy Stubs = MMIMacho.GetFnStubList();
+ if (!Stubs.empty())
+ EmitFunctionStubs(Stubs);
+
+ if (MAI->doesSupportExceptionHandling() && MMI) {
+ // Add the (possibly multiple) personalities to the set of global values.
+ // Only referenced functions get into the Personalities list.
+ const std::vector<const Function*> &Personalities = MMI->getPersonalities();
+ for (std::vector<const Function*>::const_iterator I = Personalities.begin(),
+ E = Personalities.end(); I != E; ++I) {
+ if (*I) {
+ MCSymbol *NLPSym = GetSymbolWithGlobalValueBase(*I, "$non_lazy_ptr");
+ MachineModuleInfoImpl::StubValueTy &StubSym =
+ MMIMacho.getGVStubEntry(NLPSym);
+ StubSym = MachineModuleInfoImpl::StubValueTy(Mang->getSymbol(*I), true);
+ }
+ }
+ }
+
+ // Output stubs for dynamically-linked functions.
+ Stubs = MMIMacho.GetGVStubList();
+
+ // Output macho stubs for external and common global variables.
+ if (!Stubs.empty()) {
+ // Switch with ".non_lazy_symbol_pointer" directive.
+ OutStreamer.SwitchSection(TLOFMacho.getNonLazySymbolPointerSection());
+ EmitAlignment(isPPC64 ? 3 : 2);
+
+ for (unsigned i = 0, e = Stubs.size(); i != e; ++i) {
+ // L_foo$stub:
+ OutStreamer.EmitLabel(Stubs[i].first);
+ // .indirect_symbol _foo
+ MachineModuleInfoImpl::StubValueTy &MCSym = Stubs[i].second;
+ OutStreamer.EmitSymbolAttribute(MCSym.getPointer(), MCSA_IndirectSymbol);
+
+ if (MCSym.getInt())
+ // External to current translation unit.
+ OutStreamer.EmitIntValue(0, isPPC64 ? 8 : 4/*size*/);
+ else
+ // Internal to current translation unit.
+ //
+ // When we place the LSDA into the TEXT section, the type info pointers
+ // need to be indirect and pc-rel. We accomplish this by using NLPs.
+ // However, sometimes the types are local to the file. So we need to
+ // fill in the value for the NLP in those cases.
+ OutStreamer.EmitValue(MCSymbolRefExpr::Create(MCSym.getPointer(),
+ OutContext),
+ isPPC64 ? 8 : 4/*size*/);
+ }
+
+ Stubs.clear();
+ OutStreamer.AddBlankLine();
+ }
+
+ Stubs = MMIMacho.GetHiddenGVStubList();
+ if (!Stubs.empty()) {
+ OutStreamer.SwitchSection(getObjFileLowering().getDataSection());
+ EmitAlignment(isPPC64 ? 3 : 2);
+
+ for (unsigned i = 0, e = Stubs.size(); i != e; ++i) {
+ // L_foo$stub:
+ OutStreamer.EmitLabel(Stubs[i].first);
+ // .long _foo
+ OutStreamer.EmitValue(MCSymbolRefExpr::
+ Create(Stubs[i].second.getPointer(),
+ OutContext),
+ isPPC64 ? 8 : 4/*size*/);
+ }
+
+ Stubs.clear();
+ OutStreamer.AddBlankLine();
+ }
+
+ // Funny Darwin hack: This flag tells the linker that no global symbols
+ // contain code that falls through to other global symbols (e.g. the obvious
+ // implementation of multiple entry points). If this doesn't occur, the
+ // linker can safely perform dead code stripping. Since LLVM never generates
+ // code that does this, it is always safe to set.
+ OutStreamer.EmitAssemblerFlag(MCAF_SubsectionsViaSymbols);
+
+ return AsmPrinter::doFinalization(M);
+}
+
+/// createPPCAsmPrinterPass - Returns a pass that prints the PPC assembly code
+/// for a MachineFunction to the given output stream, in a format that the
+/// Darwin assembler can deal with.
+///
+static AsmPrinter *createPPCAsmPrinterPass(TargetMachine &tm,
+ MCStreamer &Streamer) {
+ const PPCSubtarget *Subtarget = &tm.getSubtarget<PPCSubtarget>();
+
+ if (Subtarget->isDarwin())
+ return new PPCDarwinAsmPrinter(tm, Streamer);
+ return new PPCLinuxAsmPrinter(tm, Streamer);
+}
+
+// Force static initialization.
+extern "C" void LLVMInitializePowerPCAsmPrinter() {
+ TargetRegistry::RegisterAsmPrinter(ThePPC32Target, createPPCAsmPrinterPass);
+ TargetRegistry::RegisterAsmPrinter(ThePPC64Target, createPPCAsmPrinterPass);
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCBranchSelector.cpp b/contrib/llvm/lib/Target/PowerPC/PPCBranchSelector.cpp
new file mode 100644
index 0000000..bd1c378
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCBranchSelector.cpp
@@ -0,0 +1,195 @@
+//===-- PPCBranchSelector.cpp - Emit long conditional branches ------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains a pass that scans a machine function to determine which
+// conditional branches need more than 16 bits of displacement to reach their
+// target basic block. It does this in two passes; a calculation of basic block
+// positions pass, and a branch pseudo op to machine branch opcode pass. This
+// pass should be run last, just before the assembly printer.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "ppc-branch-select"
+#include "PPC.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "PPCInstrBuilder.h"
+#include "PPCInstrInfo.h"
+#include "llvm/ADT/Statistic.h"
+#include "llvm/CodeGen/MachineFunctionPass.h"
+#include "llvm/Support/MathExtras.h"
+#include "llvm/Target/TargetMachine.h"
+using namespace llvm;
+
+STATISTIC(NumExpanded, "Number of branches expanded to long format");
+
+namespace llvm {
+ void initializePPCBSelPass(PassRegistry&);
+}
+
+namespace {
+ struct PPCBSel : public MachineFunctionPass {
+ static char ID;
+ PPCBSel() : MachineFunctionPass(ID) {
+ initializePPCBSelPass(*PassRegistry::getPassRegistry());
+ }
+
+ /// BlockSizes - The sizes of the basic blocks in the function.
+ std::vector<unsigned> BlockSizes;
+
+ virtual bool runOnMachineFunction(MachineFunction &Fn);
+
+ virtual const char *getPassName() const {
+ return "PowerPC Branch Selector";
+ }
+ };
+ char PPCBSel::ID = 0;
+}
+
+INITIALIZE_PASS(PPCBSel, "ppc-branch-select", "PowerPC Branch Selector",
+ false, false)
+
+/// createPPCBranchSelectionPass - returns an instance of the Branch Selection
+/// Pass
+///
+FunctionPass *llvm::createPPCBranchSelectionPass() {
+ return new PPCBSel();
+}
+
+bool PPCBSel::runOnMachineFunction(MachineFunction &Fn) {
+ const PPCInstrInfo *TII =
+ static_cast<const PPCInstrInfo*>(Fn.getTarget().getInstrInfo());
+ // Give the blocks of the function a dense, in-order, numbering.
+ Fn.RenumberBlocks();
+ BlockSizes.resize(Fn.getNumBlockIDs());
+
+ // Measure each MBB and compute a size for the entire function.
+ unsigned FuncSize = 0;
+ for (MachineFunction::iterator MFI = Fn.begin(), E = Fn.end(); MFI != E;
+ ++MFI) {
+ MachineBasicBlock *MBB = MFI;
+
+ unsigned BlockSize = 0;
+ for (MachineBasicBlock::iterator MBBI = MBB->begin(), EE = MBB->end();
+ MBBI != EE; ++MBBI)
+ BlockSize += TII->GetInstSizeInBytes(MBBI);
+
+ BlockSizes[MBB->getNumber()] = BlockSize;
+ FuncSize += BlockSize;
+ }
+
+ // If the entire function is smaller than the displacement of a branch field,
+ // we know we don't need to shrink any branches in this function. This is a
+ // common case.
+ if (FuncSize < (1 << 15)) {
+ BlockSizes.clear();
+ return false;
+ }
+
+ // For each conditional branch, if the offset to its destination is larger
+ // than the offset field allows, transform it into a long branch sequence
+ // like this:
+ // short branch:
+ // bCC MBB
+ // long branch:
+ // b!CC $PC+8
+ // b MBB
+ //
+ bool MadeChange = true;
+ bool EverMadeChange = false;
+ while (MadeChange) {
+ // Iteratively expand branches until we reach a fixed point.
+ MadeChange = false;
+
+ for (MachineFunction::iterator MFI = Fn.begin(), E = Fn.end(); MFI != E;
+ ++MFI) {
+ MachineBasicBlock &MBB = *MFI;
+ unsigned MBBStartOffset = 0;
+ for (MachineBasicBlock::iterator I = MBB.begin(), E = MBB.end();
+ I != E; ++I) {
+ if (I->getOpcode() != PPC::BCC || I->getOperand(2).isImm()) {
+ MBBStartOffset += TII->GetInstSizeInBytes(I);
+ continue;
+ }
+
+ // Determine the offset from the current branch to the destination
+ // block.
+ MachineBasicBlock *Dest = I->getOperand(2).getMBB();
+
+ int BranchSize;
+ if (Dest->getNumber() <= MBB.getNumber()) {
+ // If this is a backwards branch, the delta is the offset from the
+ // start of this block to this branch, plus the sizes of all blocks
+ // from this block to the dest.
+ BranchSize = MBBStartOffset;
+
+ for (unsigned i = Dest->getNumber(), e = MBB.getNumber(); i != e; ++i)
+ BranchSize += BlockSizes[i];
+ } else {
+ // Otherwise, add the size of the blocks between this block and the
+ // dest to the number of bytes left in this block.
+ BranchSize = -MBBStartOffset;
+
+ for (unsigned i = MBB.getNumber(), e = Dest->getNumber(); i != e; ++i)
+ BranchSize += BlockSizes[i];
+ }
+
+ // If this branch is in range, ignore it.
+ if (isInt<16>(BranchSize)) {
+ MBBStartOffset += 4;
+ continue;
+ }
+
+ // Otherwise, we have to expand it to a long branch.
+ MachineInstr *OldBranch = I;
+ DebugLoc dl = OldBranch->getDebugLoc();
+
+ if (I->getOpcode() == PPC::BCC) {
+ // The BCC operands are:
+ // 0. PPC branch predicate
+ // 1. CR register
+ // 2. Target MBB
+ PPC::Predicate Pred = (PPC::Predicate)I->getOperand(0).getImm();
+ unsigned CRReg = I->getOperand(1).getReg();
+
+ // Jump over the uncond branch inst (i.e. $PC+8) on opposite condition.
+ BuildMI(MBB, I, dl, TII->get(PPC::BCC))
+ .addImm(PPC::InvertPredicate(Pred)).addReg(CRReg).addImm(2);
+ } else if (I->getOpcode() == PPC::BDNZ) {
+ BuildMI(MBB, I, dl, TII->get(PPC::BDZ)).addImm(2);
+ } else if (I->getOpcode() == PPC::BDNZ8) {
+ BuildMI(MBB, I, dl, TII->get(PPC::BDZ8)).addImm(2);
+ } else if (I->getOpcode() == PPC::BDZ) {
+ BuildMI(MBB, I, dl, TII->get(PPC::BDNZ)).addImm(2);
+ } else if (I->getOpcode() == PPC::BDZ8) {
+ BuildMI(MBB, I, dl, TII->get(PPC::BDNZ8)).addImm(2);
+ } else {
+ llvm_unreachable("Unhandled branch type!");
+ }
+
+ // Uncond branch to the real destination.
+ I = BuildMI(MBB, I, dl, TII->get(PPC::B)).addMBB(Dest);
+
+ // Remove the old branch from the function.
+ OldBranch->eraseFromParent();
+
+ // Remember that this instruction is 8-bytes, increase the size of the
+ // block by 4, remember to iterate.
+ BlockSizes[MBB.getNumber()] += 4;
+ MBBStartOffset += 8;
+ ++NumExpanded;
+ MadeChange = true;
+ }
+ }
+ EverMadeChange |= MadeChange;
+ }
+
+ BlockSizes.clear();
+ return true;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCCTRLoops.cpp b/contrib/llvm/lib/Target/PowerPC/PPCCTRLoops.cpp
new file mode 100644
index 0000000..81a54d7
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCCTRLoops.cpp
@@ -0,0 +1,775 @@
+//===-- PPCCTRLoops.cpp - Identify and generate CTR loops -----------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This pass identifies loops where we can generate the PPC branch instructions
+// that decrement and test the count register (CTR) (bdnz and friends).
+// This pass is based on the HexagonHardwareLoops pass.
+//
+// The pattern that defines the induction variable can changed depending on
+// prior optimizations. For example, the IndVarSimplify phase run by 'opt'
+// normalizes induction variables, and the Loop Strength Reduction pass
+// run by 'llc' may also make changes to the induction variable.
+// The pattern detected by this phase is due to running Strength Reduction.
+//
+// Criteria for CTR loops:
+// - Countable loops (w/ ind. var for a trip count)
+// - Assumes loops are normalized by IndVarSimplify
+// - Try inner-most loops first
+// - No nested CTR loops.
+// - No function calls in loops.
+//
+// Note: As with unconverted loops, PPCBranchSelector must be run after this
+// pass in order to convert long-displacement jumps into jump pairs.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "ctrloops"
+#include "PPC.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "PPCTargetMachine.h"
+#include "llvm/ADT/DenseMap.h"
+#include "llvm/ADT/Statistic.h"
+#include "llvm/CodeGen/MachineDominators.h"
+#include "llvm/CodeGen/MachineFunction.h"
+#include "llvm/CodeGen/MachineFunctionPass.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineLoopInfo.h"
+#include "llvm/CodeGen/MachineRegisterInfo.h"
+#include "llvm/CodeGen/Passes.h"
+#include "llvm/CodeGen/RegisterScavenging.h"
+#include "llvm/IR/Constants.h"
+#include "llvm/PassSupport.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Support/raw_ostream.h"
+#include "llvm/Target/TargetInstrInfo.h"
+#include <algorithm>
+
+using namespace llvm;
+
+STATISTIC(NumCTRLoops, "Number of loops converted to CTR loops");
+
+namespace llvm {
+ void initializePPCCTRLoopsPass(PassRegistry&);
+}
+
+namespace {
+ class CountValue;
+ struct PPCCTRLoops : public MachineFunctionPass {
+ MachineLoopInfo *MLI;
+ MachineRegisterInfo *MRI;
+ const TargetInstrInfo *TII;
+
+ public:
+ static char ID; // Pass identification, replacement for typeid
+
+ PPCCTRLoops() : MachineFunctionPass(ID) {
+ initializePPCCTRLoopsPass(*PassRegistry::getPassRegistry());
+ }
+
+ virtual bool runOnMachineFunction(MachineFunction &MF);
+
+ const char *getPassName() const { return "PPC CTR Loops"; }
+
+ virtual void getAnalysisUsage(AnalysisUsage &AU) const {
+ AU.setPreservesCFG();
+ AU.addRequired<MachineDominatorTree>();
+ AU.addPreserved<MachineDominatorTree>();
+ AU.addRequired<MachineLoopInfo>();
+ AU.addPreserved<MachineLoopInfo>();
+ MachineFunctionPass::getAnalysisUsage(AU);
+ }
+
+ private:
+ /// getCanonicalInductionVariable - Check to see if the loop has a canonical
+ /// induction variable.
+ /// Should be defined in MachineLoop. Based upon version in class Loop.
+ void getCanonicalInductionVariable(MachineLoop *L,
+ SmallVector<MachineInstr *, 4> &IVars,
+ SmallVector<MachineInstr *, 4> &IOps) const;
+
+ /// getTripCount - Return a loop-invariant LLVM register indicating the
+ /// number of times the loop will be executed. If the trip-count cannot
+ /// be determined, this return null.
+ CountValue *getTripCount(MachineLoop *L,
+ SmallVector<MachineInstr *, 2> &OldInsts) const;
+
+ /// isInductionOperation - Return true if the instruction matches the
+ /// pattern for an opertion that defines an induction variable.
+ bool isInductionOperation(const MachineInstr *MI, unsigned IVReg) const;
+
+ /// isInvalidOperation - Return true if the instruction is not valid within
+ /// a CTR loop.
+ bool isInvalidLoopOperation(const MachineInstr *MI) const;
+
+ /// containsInavlidInstruction - Return true if the loop contains an
+ /// instruction that inhibits using the CTR loop.
+ bool containsInvalidInstruction(MachineLoop *L) const;
+
+ /// converToCTRLoop - Given a loop, check if we can convert it to a
+ /// CTR loop. If so, then perform the conversion and return true.
+ bool convertToCTRLoop(MachineLoop *L);
+
+ /// isDead - Return true if the instruction is now dead.
+ bool isDead(const MachineInstr *MI,
+ SmallVector<MachineInstr *, 1> &DeadPhis) const;
+
+ /// removeIfDead - Remove the instruction if it is now dead.
+ void removeIfDead(MachineInstr *MI);
+ };
+
+ char PPCCTRLoops::ID = 0;
+
+
+ // CountValue class - Abstraction for a trip count of a loop. A
+ // smaller vesrsion of the MachineOperand class without the concerns
+ // of changing the operand representation.
+ class CountValue {
+ public:
+ enum CountValueType {
+ CV_Register,
+ CV_Immediate
+ };
+ private:
+ CountValueType Kind;
+ union Values {
+ unsigned RegNum;
+ int64_t ImmVal;
+ Values(unsigned r) : RegNum(r) {}
+ Values(int64_t i) : ImmVal(i) {}
+ } Contents;
+ bool isNegative;
+
+ public:
+ CountValue(unsigned r, bool neg) : Kind(CV_Register), Contents(r),
+ isNegative(neg) {}
+ explicit CountValue(int64_t i) : Kind(CV_Immediate), Contents(i),
+ isNegative(i < 0) {}
+ CountValueType getType() const { return Kind; }
+ bool isReg() const { return Kind == CV_Register; }
+ bool isImm() const { return Kind == CV_Immediate; }
+ bool isNeg() const { return isNegative; }
+
+ unsigned getReg() const {
+ assert(isReg() && "Wrong CountValue accessor");
+ return Contents.RegNum;
+ }
+ void setReg(unsigned Val) {
+ Contents.RegNum = Val;
+ }
+ int64_t getImm() const {
+ assert(isImm() && "Wrong CountValue accessor");
+ if (isNegative) {
+ return -Contents.ImmVal;
+ }
+ return Contents.ImmVal;
+ }
+ void setImm(int64_t Val) {
+ Contents.ImmVal = Val;
+ }
+
+ void print(raw_ostream &OS, const TargetMachine *TM = 0) const {
+ if (isReg()) { OS << PrintReg(getReg()); }
+ if (isImm()) { OS << getImm(); }
+ }
+ };
+} // end anonymous namespace
+
+INITIALIZE_PASS_BEGIN(PPCCTRLoops, "ppc-ctr-loops", "PowerPC CTR Loops",
+ false, false)
+INITIALIZE_PASS_DEPENDENCY(MachineDominatorTree)
+INITIALIZE_PASS_DEPENDENCY(MachineLoopInfo)
+INITIALIZE_PASS_END(PPCCTRLoops, "ppc-ctr-loops", "PowerPC CTR Loops",
+ false, false)
+
+/// isCompareEquals - Returns true if the instruction is a compare equals
+/// instruction with an immediate operand.
+static bool isCompareEqualsImm(const MachineInstr *MI, bool &SignedCmp,
+ bool &Int64Cmp) {
+ if (MI->getOpcode() == PPC::CMPWI) {
+ SignedCmp = true;
+ Int64Cmp = false;
+ return true;
+ } else if (MI->getOpcode() == PPC::CMPDI) {
+ SignedCmp = true;
+ Int64Cmp = true;
+ return true;
+ } else if (MI->getOpcode() == PPC::CMPLWI) {
+ SignedCmp = false;
+ Int64Cmp = false;
+ return true;
+ } else if (MI->getOpcode() == PPC::CMPLDI) {
+ SignedCmp = false;
+ Int64Cmp = true;
+ return true;
+ }
+
+ return false;
+}
+
+
+/// createPPCCTRLoops - Factory for creating
+/// the CTR loop phase.
+FunctionPass *llvm::createPPCCTRLoops() {
+ return new PPCCTRLoops();
+}
+
+
+bool PPCCTRLoops::runOnMachineFunction(MachineFunction &MF) {
+ DEBUG(dbgs() << "********* PPC CTR Loops *********\n");
+
+ bool Changed = false;
+
+ // get the loop information
+ MLI = &getAnalysis<MachineLoopInfo>();
+ // get the register information
+ MRI = &MF.getRegInfo();
+ // the target specific instructio info.
+ TII = MF.getTarget().getInstrInfo();
+
+ for (MachineLoopInfo::iterator I = MLI->begin(), E = MLI->end();
+ I != E; ++I) {
+ MachineLoop *L = *I;
+ if (!L->getParentLoop()) {
+ Changed |= convertToCTRLoop(L);
+ }
+ }
+
+ return Changed;
+}
+
+/// getCanonicalInductionVariable - Check to see if the loop has a canonical
+/// induction variable. We check for a simple recurrence pattern - an
+/// integer recurrence that decrements by one each time through the loop and
+/// ends at zero. If so, return the phi node that corresponds to it.
+///
+/// Based upon the similar code in LoopInfo except this code is specific to
+/// the machine.
+/// This method assumes that the IndVarSimplify pass has been run by 'opt'.
+///
+void
+PPCCTRLoops::getCanonicalInductionVariable(MachineLoop *L,
+ SmallVector<MachineInstr *, 4> &IVars,
+ SmallVector<MachineInstr *, 4> &IOps) const {
+ MachineBasicBlock *TopMBB = L->getTopBlock();
+ MachineBasicBlock::pred_iterator PI = TopMBB->pred_begin();
+ assert(PI != TopMBB->pred_end() &&
+ "Loop must have more than one incoming edge!");
+ MachineBasicBlock *Backedge = *PI++;
+ if (PI == TopMBB->pred_end()) return; // dead loop
+ MachineBasicBlock *Incoming = *PI++;
+ if (PI != TopMBB->pred_end()) return; // multiple backedges?
+
+ // make sure there is one incoming and one backedge and determine which
+ // is which.
+ if (L->contains(Incoming)) {
+ if (L->contains(Backedge))
+ return;
+ std::swap(Incoming, Backedge);
+ } else if (!L->contains(Backedge))
+ return;
+
+ // Loop over all of the PHI nodes, looking for a canonical induction variable:
+ // - The PHI node is "reg1 = PHI reg2, BB1, reg3, BB2".
+ // - The recurrence comes from the backedge.
+ // - the definition is an induction operatio.n
+ for (MachineBasicBlock::iterator I = TopMBB->begin(), E = TopMBB->end();
+ I != E && I->isPHI(); ++I) {
+ MachineInstr *MPhi = &*I;
+ unsigned DefReg = MPhi->getOperand(0).getReg();
+ for (unsigned i = 1; i != MPhi->getNumOperands(); i += 2) {
+ // Check each operand for the value from the backedge.
+ MachineBasicBlock *MBB = MPhi->getOperand(i+1).getMBB();
+ if (L->contains(MBB)) { // operands comes from the backedge
+ // Check if the definition is an induction operation.
+ MachineInstr *DI = MRI->getVRegDef(MPhi->getOperand(i).getReg());
+ if (isInductionOperation(DI, DefReg)) {
+ IOps.push_back(DI);
+ IVars.push_back(MPhi);
+ }
+ }
+ }
+ }
+ return;
+}
+
+/// getTripCount - Return a loop-invariant LLVM value indicating the
+/// number of times the loop will be executed. The trip count can
+/// be either a register or a constant value. If the trip-count
+/// cannot be determined, this returns null.
+///
+/// We find the trip count from the phi instruction that defines the
+/// induction variable. We follow the links to the CMP instruction
+/// to get the trip count.
+///
+/// Based upon getTripCount in LoopInfo.
+///
+CountValue *PPCCTRLoops::getTripCount(MachineLoop *L,
+ SmallVector<MachineInstr *, 2> &OldInsts) const {
+ MachineBasicBlock *LastMBB = L->getExitingBlock();
+ // Don't generate a CTR loop if the loop has more than one exit.
+ if (LastMBB == 0)
+ return 0;
+
+ MachineBasicBlock::iterator LastI = LastMBB->getFirstTerminator();
+ if (LastI->getOpcode() != PPC::BCC)
+ return 0;
+
+ // We need to make sure that this compare is defining the condition
+ // register actually used by the terminating branch.
+
+ unsigned PredReg = LastI->getOperand(1).getReg();
+ DEBUG(dbgs() << "Examining loop with first terminator: " << *LastI);
+
+ unsigned PredCond = LastI->getOperand(0).getImm();
+ if (PredCond != PPC::PRED_EQ && PredCond != PPC::PRED_NE)
+ return 0;
+
+ // Check that the loop has a induction variable.
+ SmallVector<MachineInstr *, 4> IVars, IOps;
+ getCanonicalInductionVariable(L, IVars, IOps);
+ for (unsigned i = 0; i < IVars.size(); ++i) {
+ MachineInstr *IOp = IOps[i];
+ MachineInstr *IV_Inst = IVars[i];
+
+ // Canonical loops will end with a 'cmpwi/cmpdi cr, IV, Imm',
+ // if Imm is 0, get the count from the PHI opnd
+ // if Imm is -M, than M is the count
+ // Otherwise, Imm is the count
+ MachineOperand *IV_Opnd;
+ const MachineOperand *InitialValue;
+ if (!L->contains(IV_Inst->getOperand(2).getMBB())) {
+ InitialValue = &IV_Inst->getOperand(1);
+ IV_Opnd = &IV_Inst->getOperand(3);
+ } else {
+ InitialValue = &IV_Inst->getOperand(3);
+ IV_Opnd = &IV_Inst->getOperand(1);
+ }
+
+ DEBUG(dbgs() << "Considering:\n");
+ DEBUG(dbgs() << " induction operation: " << *IOp);
+ DEBUG(dbgs() << " induction variable: " << *IV_Inst);
+ DEBUG(dbgs() << " initial value: " << *InitialValue << "\n");
+
+ // Look for the cmp instruction to determine if we
+ // can get a useful trip count. The trip count can
+ // be either a register or an immediate. The location
+ // of the value depends upon the type (reg or imm).
+ for (MachineRegisterInfo::reg_iterator
+ RI = MRI->reg_begin(IV_Opnd->getReg()), RE = MRI->reg_end();
+ RI != RE; ++RI) {
+ IV_Opnd = &RI.getOperand();
+ bool SignedCmp, Int64Cmp;
+ MachineInstr *MI = IV_Opnd->getParent();
+ if (L->contains(MI) && isCompareEqualsImm(MI, SignedCmp, Int64Cmp) &&
+ MI->getOperand(0).getReg() == PredReg) {
+
+ OldInsts.push_back(MI);
+ OldInsts.push_back(IOp);
+
+ DEBUG(dbgs() << " compare: " << *MI);
+
+ const MachineOperand &MO = MI->getOperand(2);
+ assert(MO.isImm() && "IV Cmp Operand should be an immediate");
+
+ int64_t ImmVal;
+ if (SignedCmp)
+ ImmVal = (short) MO.getImm();
+ else
+ ImmVal = MO.getImm();
+
+ const MachineInstr *IV_DefInstr = MRI->getVRegDef(IV_Opnd->getReg());
+ assert(L->contains(IV_DefInstr->getParent()) &&
+ "IV definition should occurs in loop");
+ int64_t iv_value = (short) IV_DefInstr->getOperand(2).getImm();
+
+ assert(InitialValue->isReg() && "Expecting register for init value");
+ unsigned InitialValueReg = InitialValue->getReg();
+
+ MachineInstr *DefInstr = MRI->getVRegDef(InitialValueReg);
+
+ // Here we need to look for an immediate load (an li or lis/ori pair).
+ if (DefInstr && (DefInstr->getOpcode() == PPC::ORI8 ||
+ DefInstr->getOpcode() == PPC::ORI)) {
+ int64_t start = DefInstr->getOperand(2).getImm();
+ MachineInstr *DefInstr2 =
+ MRI->getVRegDef(DefInstr->getOperand(1).getReg());
+ if (DefInstr2 && (DefInstr2->getOpcode() == PPC::LIS8 ||
+ DefInstr2->getOpcode() == PPC::LIS)) {
+ DEBUG(dbgs() << " initial constant: " << *DefInstr);
+ DEBUG(dbgs() << " initial constant: " << *DefInstr2);
+
+ start |= int64_t(short(DefInstr2->getOperand(1).getImm())) << 16;
+
+ int64_t count = ImmVal - start;
+ if ((count % iv_value) != 0) {
+ return 0;
+ }
+
+ OldInsts.push_back(DefInstr);
+ OldInsts.push_back(DefInstr2);
+
+ // count/iv_value, the trip count, should be positive here. If it
+ // is negative, that indicates that the counter will wrap.
+ if (Int64Cmp)
+ return new CountValue(count/iv_value);
+ else
+ return new CountValue(uint32_t(count/iv_value));
+ }
+ } else if (DefInstr && (DefInstr->getOpcode() == PPC::LI8 ||
+ DefInstr->getOpcode() == PPC::LI)) {
+ DEBUG(dbgs() << " initial constant: " << *DefInstr);
+
+ int64_t count = ImmVal -
+ int64_t(short(DefInstr->getOperand(1).getImm()));
+ if ((count % iv_value) != 0) {
+ return 0;
+ }
+
+ OldInsts.push_back(DefInstr);
+
+ if (Int64Cmp)
+ return new CountValue(count/iv_value);
+ else
+ return new CountValue(uint32_t(count/iv_value));
+ } else if (iv_value == 1 || iv_value == -1) {
+ // We can't determine a constant starting value.
+ if (ImmVal == 0) {
+ return new CountValue(InitialValueReg, iv_value > 0);
+ }
+ // FIXME: handle non-zero end value.
+ }
+ // FIXME: handle non-unit increments (we might not want to introduce
+ // division but we can handle some 2^n cases with shifts).
+
+ }
+ }
+ }
+ return 0;
+}
+
+/// isInductionOperation - return true if the operation is matches the
+/// pattern that defines an induction variable:
+/// addi iv, c
+///
+bool
+PPCCTRLoops::isInductionOperation(const MachineInstr *MI,
+ unsigned IVReg) const {
+ return ((MI->getOpcode() == PPC::ADDI || MI->getOpcode() == PPC::ADDI8) &&
+ MI->getOperand(1).isReg() && // could be a frame index instead
+ MI->getOperand(1).getReg() == IVReg);
+}
+
+/// isInvalidOperation - Return true if the operation is invalid within
+/// CTR loop.
+bool
+PPCCTRLoops::isInvalidLoopOperation(const MachineInstr *MI) const {
+
+ // call is not allowed because the callee may use a CTR loop
+ if (MI->getDesc().isCall()) {
+ return true;
+ }
+ // check if the instruction defines a CTR loop register
+ // (this will also catch nested CTR loops)
+ for (unsigned i = 0, e = MI->getNumOperands(); i != e; ++i) {
+ const MachineOperand &MO = MI->getOperand(i);
+ if (MO.isReg() && MO.isDef() &&
+ (MO.getReg() == PPC::CTR || MO.getReg() == PPC::CTR8)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/// containsInvalidInstruction - Return true if the loop contains
+/// an instruction that inhibits the use of the CTR loop function.
+///
+bool PPCCTRLoops::containsInvalidInstruction(MachineLoop *L) const {
+ const std::vector<MachineBasicBlock*> Blocks = L->getBlocks();
+ for (unsigned i = 0, e = Blocks.size(); i != e; ++i) {
+ MachineBasicBlock *MBB = Blocks[i];
+ for (MachineBasicBlock::iterator
+ MII = MBB->begin(), E = MBB->end(); MII != E; ++MII) {
+ const MachineInstr *MI = &*MII;
+ if (isInvalidLoopOperation(MI)) {
+ return true;
+ }
+ }
+ }
+ return false;
+}
+
+/// isDead returns true if the instruction is dead
+/// (this was essentially copied from DeadMachineInstructionElim::isDead, but
+/// with special cases for inline asm, physical registers and instructions with
+/// side effects removed)
+bool PPCCTRLoops::isDead(const MachineInstr *MI,
+ SmallVector<MachineInstr *, 1> &DeadPhis) const {
+ // Examine each operand.
+ for (unsigned i = 0, e = MI->getNumOperands(); i != e; ++i) {
+ const MachineOperand &MO = MI->getOperand(i);
+ if (MO.isReg() && MO.isDef()) {
+ unsigned Reg = MO.getReg();
+ if (!MRI->use_nodbg_empty(Reg)) {
+ // This instruction has users, but if the only user is the phi node for
+ // the parent block, and the only use of that phi node is this
+ // instruction, then this instruction is dead: both it (and the phi
+ // node) can be removed.
+ MachineRegisterInfo::use_iterator I = MRI->use_begin(Reg);
+ if (llvm::next(I) == MRI->use_end() &&
+ I.getOperand().getParent()->isPHI()) {
+ MachineInstr *OnePhi = I.getOperand().getParent();
+
+ for (unsigned j = 0, f = OnePhi->getNumOperands(); j != f; ++j) {
+ const MachineOperand &OPO = OnePhi->getOperand(j);
+ if (OPO.isReg() && OPO.isDef()) {
+ unsigned OPReg = OPO.getReg();
+
+ MachineRegisterInfo::use_iterator nextJ;
+ for (MachineRegisterInfo::use_iterator J = MRI->use_begin(OPReg),
+ E = MRI->use_end(); J!=E; J=nextJ) {
+ nextJ = llvm::next(J);
+ MachineOperand& Use = J.getOperand();
+ MachineInstr *UseMI = Use.getParent();
+
+ if (MI != UseMI) {
+ // The phi node has a user that is not MI, bail...
+ return false;
+ }
+ }
+ }
+ }
+
+ DeadPhis.push_back(OnePhi);
+ } else {
+ // This def has a non-debug use. Don't delete the instruction!
+ return false;
+ }
+ }
+ }
+ }
+
+ // If there are no defs with uses, the instruction is dead.
+ return true;
+}
+
+void PPCCTRLoops::removeIfDead(MachineInstr *MI) {
+ // This procedure was essentially copied from DeadMachineInstructionElim
+
+ SmallVector<MachineInstr *, 1> DeadPhis;
+ if (isDead(MI, DeadPhis)) {
+ DEBUG(dbgs() << "CTR looping will remove: " << *MI);
+
+ // It is possible that some DBG_VALUE instructions refer to this
+ // instruction. Examine each def operand for such references;
+ // if found, mark the DBG_VALUE as undef (but don't delete it).
+ for (unsigned i = 0, e = MI->getNumOperands(); i != e; ++i) {
+ const MachineOperand &MO = MI->getOperand(i);
+ if (!MO.isReg() || !MO.isDef())
+ continue;
+ unsigned Reg = MO.getReg();
+ MachineRegisterInfo::use_iterator nextI;
+ for (MachineRegisterInfo::use_iterator I = MRI->use_begin(Reg),
+ E = MRI->use_end(); I!=E; I=nextI) {
+ nextI = llvm::next(I); // I is invalidated by the setReg
+ MachineOperand& Use = I.getOperand();
+ MachineInstr *UseMI = Use.getParent();
+ if (UseMI==MI)
+ continue;
+ if (Use.isDebug()) // this might also be a instr -> phi -> instr case
+ // which can also be removed.
+ UseMI->getOperand(0).setReg(0U);
+ }
+ }
+
+ MI->eraseFromParent();
+ for (unsigned i = 0; i < DeadPhis.size(); ++i) {
+ DeadPhis[i]->eraseFromParent();
+ }
+ }
+}
+
+/// converToCTRLoop - check if the loop is a candidate for
+/// converting to a CTR loop. If so, then perform the
+/// transformation.
+///
+/// This function works on innermost loops first. A loop can
+/// be converted if it is a counting loop; either a register
+/// value or an immediate.
+///
+/// The code makes several assumptions about the representation
+/// of the loop in llvm.
+bool PPCCTRLoops::convertToCTRLoop(MachineLoop *L) {
+ bool Changed = false;
+ // Process nested loops first.
+ for (MachineLoop::iterator I = L->begin(), E = L->end(); I != E; ++I) {
+ Changed |= convertToCTRLoop(*I);
+ }
+ // If a nested loop has been converted, then we can't convert this loop.
+ if (Changed) {
+ return Changed;
+ }
+
+ SmallVector<MachineInstr *, 2> OldInsts;
+ // Are we able to determine the trip count for the loop?
+ CountValue *TripCount = getTripCount(L, OldInsts);
+ if (TripCount == 0) {
+ DEBUG(dbgs() << "failed to get trip count!\n");
+ return false;
+ }
+
+ if (TripCount->isImm()) {
+ DEBUG(dbgs() << "constant trip count: " << TripCount->getImm() << "\n");
+
+ // FIXME: We currently can't form 64-bit constants
+ // (including 32-bit unsigned constants)
+ if (!isInt<32>(TripCount->getImm()))
+ return false;
+ }
+
+ // Does the loop contain any invalid instructions?
+ if (containsInvalidInstruction(L)) {
+ return false;
+ }
+ MachineBasicBlock *Preheader = L->getLoopPreheader();
+ // No preheader means there's not place for the loop instr.
+ if (Preheader == 0) {
+ return false;
+ }
+ MachineBasicBlock::iterator InsertPos = Preheader->getFirstTerminator();
+
+ DebugLoc dl;
+ if (InsertPos != Preheader->end())
+ dl = InsertPos->getDebugLoc();
+
+ MachineBasicBlock *LastMBB = L->getExitingBlock();
+ // Don't generate CTR loop if the loop has more than one exit.
+ if (LastMBB == 0) {
+ return false;
+ }
+ MachineBasicBlock::iterator LastI = LastMBB->getFirstTerminator();
+
+ // Determine the loop start.
+ MachineBasicBlock *LoopStart = L->getTopBlock();
+ if (L->getLoopLatch() != LastMBB) {
+ // When the exit and latch are not the same, use the latch block as the
+ // start.
+ // The loop start address is used only after the 1st iteration, and the loop
+ // latch may contains instrs. that need to be executed after the 1st iter.
+ LoopStart = L->getLoopLatch();
+ // Make sure the latch is a successor of the exit, otherwise it won't work.
+ if (!LastMBB->isSuccessor(LoopStart)) {
+ return false;
+ }
+ }
+
+ // Convert the loop to a CTR loop
+ DEBUG(dbgs() << "Change to CTR loop at "; L->dump());
+
+ MachineFunction *MF = LastMBB->getParent();
+ const PPCSubtarget &Subtarget = MF->getTarget().getSubtarget<PPCSubtarget>();
+ bool isPPC64 = Subtarget.isPPC64();
+
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+ const TargetRegisterClass *G8RC = &PPC::G8RCRegClass;
+ const TargetRegisterClass *RC = isPPC64 ? G8RC : GPRC;
+
+ unsigned CountReg;
+ if (TripCount->isReg()) {
+ // Create a copy of the loop count register.
+ const TargetRegisterClass *SrcRC =
+ MF->getRegInfo().getRegClass(TripCount->getReg());
+ CountReg = MF->getRegInfo().createVirtualRegister(RC);
+ unsigned CopyOp = (isPPC64 && GPRC->hasSubClassEq(SrcRC)) ?
+ (unsigned) PPC::EXTSW_32_64 :
+ (unsigned) TargetOpcode::COPY;
+ BuildMI(*Preheader, InsertPos, dl,
+ TII->get(CopyOp), CountReg).addReg(TripCount->getReg());
+ if (TripCount->isNeg()) {
+ unsigned CountReg1 = CountReg;
+ CountReg = MF->getRegInfo().createVirtualRegister(RC);
+ BuildMI(*Preheader, InsertPos, dl,
+ TII->get(isPPC64 ? PPC::NEG8 : PPC::NEG),
+ CountReg).addReg(CountReg1);
+ }
+ } else {
+ assert(TripCount->isImm() && "Expecting immedate vaule for trip count");
+ // Put the trip count in a register for transfer into the count register.
+
+ int64_t CountImm = TripCount->getImm();
+ if (TripCount->isNeg())
+ CountImm = -CountImm;
+
+ CountReg = MF->getRegInfo().createVirtualRegister(RC);
+ if (abs64(CountImm) > 0x7FFF) {
+ BuildMI(*Preheader, InsertPos, dl,
+ TII->get(isPPC64 ? PPC::LIS8 : PPC::LIS),
+ CountReg).addImm((CountImm >> 16) & 0xFFFF);
+ unsigned CountReg1 = CountReg;
+ CountReg = MF->getRegInfo().createVirtualRegister(RC);
+ BuildMI(*Preheader, InsertPos, dl,
+ TII->get(isPPC64 ? PPC::ORI8 : PPC::ORI),
+ CountReg).addReg(CountReg1).addImm(CountImm & 0xFFFF);
+ } else {
+ BuildMI(*Preheader, InsertPos, dl,
+ TII->get(isPPC64 ? PPC::LI8 : PPC::LI),
+ CountReg).addImm(CountImm);
+ }
+ }
+
+ // Add the mtctr instruction to the beginning of the loop.
+ BuildMI(*Preheader, InsertPos, dl,
+ TII->get(isPPC64 ? PPC::MTCTR8 : PPC::MTCTR)).addReg(CountReg,
+ TripCount->isImm() ? RegState::Kill : 0);
+
+ // Make sure the loop start always has a reference in the CFG. We need to
+ // create a BlockAddress operand to get this mechanism to work both the
+ // MachineBasicBlock and BasicBlock objects need the flag set.
+ LoopStart->setHasAddressTaken();
+ // This line is needed to set the hasAddressTaken flag on the BasicBlock
+ // object
+ BlockAddress::get(const_cast<BasicBlock *>(LoopStart->getBasicBlock()));
+
+ // Replace the loop branch with a bdnz instruction.
+ dl = LastI->getDebugLoc();
+ const std::vector<MachineBasicBlock*> Blocks = L->getBlocks();
+ for (unsigned i = 0, e = Blocks.size(); i != e; ++i) {
+ MachineBasicBlock *MBB = Blocks[i];
+ if (MBB != Preheader)
+ MBB->addLiveIn(isPPC64 ? PPC::CTR8 : PPC::CTR);
+ }
+
+ // The loop ends with either:
+ // - a conditional branch followed by an unconditional branch, or
+ // - a conditional branch to the loop start.
+ assert(LastI->getOpcode() == PPC::BCC &&
+ "loop end must start with a BCC instruction");
+ // Either the BCC branches to the beginning of the loop, or it
+ // branches out of the loop and there is an unconditional branch
+ // to the start of the loop.
+ MachineBasicBlock *BranchTarget = LastI->getOperand(2).getMBB();
+ BuildMI(*LastMBB, LastI, dl,
+ TII->get((BranchTarget == LoopStart) ?
+ (isPPC64 ? PPC::BDNZ8 : PPC::BDNZ) :
+ (isPPC64 ? PPC::BDZ8 : PPC::BDZ))).addMBB(BranchTarget);
+
+ // Conditional branch; just delete it.
+ DEBUG(dbgs() << "Removing old branch: " << *LastI);
+ LastMBB->erase(LastI);
+
+ delete TripCount;
+
+ // The induction operation (add) and the comparison (cmpwi) may now be
+ // unneeded. If these are unneeded, then remove them.
+ for (unsigned i = 0; i < OldInsts.size(); ++i)
+ removeIfDead(OldInsts[i]);
+
+ ++NumCTRLoops;
+ return true;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCCallingConv.td b/contrib/llvm/lib/Target/PowerPC/PPCCallingConv.td
new file mode 100644
index 0000000..c8a29a3
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCCallingConv.td
@@ -0,0 +1,144 @@
+//===- PPCCallingConv.td - Calling Conventions for PowerPC -*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This describes the calling conventions for the PowerPC 32- and 64-bit
+// architectures.
+//
+//===----------------------------------------------------------------------===//
+
+/// CCIfSubtarget - Match if the current subtarget has a feature F.
+class CCIfSubtarget<string F, CCAction A>
+ : CCIf<!strconcat("State.getTarget().getSubtarget<PPCSubtarget>().", F), A>;
+
+//===----------------------------------------------------------------------===//
+// Return Value Calling Convention
+//===----------------------------------------------------------------------===//
+
+// Return-value convention for PowerPC
+def RetCC_PPC : CallingConv<[
+ // On PPC64, integer return values are always promoted to i64
+ CCIfType<[i32], CCIfSubtarget<"isPPC64()", CCPromoteToType<i64>>>,
+
+ CCIfType<[i32], CCAssignToReg<[R3, R4, R5, R6, R7, R8, R9, R10]>>,
+ CCIfType<[i64], CCAssignToReg<[X3, X4, X5, X6]>>,
+ CCIfType<[i128], CCAssignToReg<[X3, X4, X5, X6]>>,
+
+ CCIfType<[f32], CCAssignToReg<[F1, F2]>>,
+ CCIfType<[f64], CCAssignToReg<[F1, F2, F3, F4]>>,
+
+ // Vector types are always returned in V2.
+ CCIfType<[v16i8, v8i16, v4i32, v4f32], CCAssignToReg<[V2]>>
+]>;
+
+
+//===----------------------------------------------------------------------===//
+// PowerPC System V Release 4 32-bit ABI
+//===----------------------------------------------------------------------===//
+
+def CC_PPC32_SVR4_Common : CallingConv<[
+ // The ABI requires i64 to be passed in two adjacent registers with the first
+ // register having an odd register number.
+ CCIfType<[i32], CCIfSplit<CCCustom<"CC_PPC32_SVR4_Custom_AlignArgRegs">>>,
+
+ // The first 8 integer arguments are passed in integer registers.
+ CCIfType<[i32], CCAssignToReg<[R3, R4, R5, R6, R7, R8, R9, R10]>>,
+
+ // Make sure the i64 words from a long double are either both passed in
+ // registers or both passed on the stack.
+ CCIfType<[f64], CCIfSplit<CCCustom<"CC_PPC32_SVR4_Custom_AlignFPArgRegs">>>,
+
+ // FP values are passed in F1 - F8.
+ CCIfType<[f32, f64], CCAssignToReg<[F1, F2, F3, F4, F5, F6, F7, F8]>>,
+
+ // Split arguments have an alignment of 8 bytes on the stack.
+ CCIfType<[i32], CCIfSplit<CCAssignToStack<4, 8>>>,
+
+ CCIfType<[i32], CCAssignToStack<4, 4>>,
+
+ // Floats are stored in double precision format, thus they have the same
+ // alignment and size as doubles.
+ CCIfType<[f32,f64], CCAssignToStack<8, 8>>,
+
+ // Vectors get 16-byte stack slots that are 16-byte aligned.
+ CCIfType<[v16i8, v8i16, v4i32, v4f32], CCAssignToStack<16, 16>>
+]>;
+
+// This calling convention puts vector arguments always on the stack. It is used
+// to assign vector arguments which belong to the variable portion of the
+// parameter list of a variable argument function.
+def CC_PPC32_SVR4_VarArg : CallingConv<[
+ CCDelegateTo<CC_PPC32_SVR4_Common>
+]>;
+
+// In contrast to CC_PPC32_SVR4_VarArg, this calling convention first tries to
+// put vector arguments in vector registers before putting them on the stack.
+def CC_PPC32_SVR4 : CallingConv<[
+ // The first 12 Vector arguments are passed in AltiVec registers.
+ CCIfType<[v16i8, v8i16, v4i32, v4f32],
+ CCAssignToReg<[V2, V3, V4, V5, V6, V7, V8, V9, V10, V11, V12, V13]>>,
+
+ CCDelegateTo<CC_PPC32_SVR4_Common>
+]>;
+
+// Helper "calling convention" to handle aggregate by value arguments.
+// Aggregate by value arguments are always placed in the local variable space
+// of the caller. This calling convention is only used to assign those stack
+// offsets in the callers stack frame.
+//
+// Still, the address of the aggregate copy in the callers stack frame is passed
+// in a GPR (or in the parameter list area if all GPRs are allocated) from the
+// caller to the callee. The location for the address argument is assigned by
+// the CC_PPC32_SVR4 calling convention.
+//
+// The only purpose of CC_PPC32_SVR4_Custom_Dummy is to skip arguments which are
+// not passed by value.
+
+def CC_PPC32_SVR4_ByVal : CallingConv<[
+ CCIfByVal<CCPassByVal<4, 4>>,
+
+ CCCustom<"CC_PPC32_SVR4_Custom_Dummy">
+]>;
+
+def CSR_Darwin32 : CalleeSavedRegs<(add R13, R14, R15, R16, R17, R18, R19, R20,
+ R21, R22, R23, R24, R25, R26, R27, R28,
+ R29, R30, R31, F14, F15, F16, F17, F18,
+ F19, F20, F21, F22, F23, F24, F25, F26,
+ F27, F28, F29, F30, F31, CR2, CR3, CR4,
+ V20, V21, V22, V23, V24, V25, V26, V27,
+ V28, V29, V30, V31)>;
+
+def CSR_SVR432 : CalleeSavedRegs<(add R14, R15, R16, R17, R18, R19, R20, VRSAVE,
+ R21, R22, R23, R24, R25, R26, R27, R28,
+ R29, R30, R31, F14, F15, F16, F17, F18,
+ F19, F20, F21, F22, F23, F24, F25, F26,
+ F27, F28, F29, F30, F31, CR2, CR3, CR4,
+ V20, V21, V22, V23, V24, V25, V26, V27,
+ V28, V29, V30, V31)>;
+
+def CSR_Darwin64 : CalleeSavedRegs<(add X13, X14, X15, X16, X17, X18, X19, X20,
+ X21, X22, X23, X24, X25, X26, X27, X28,
+ X29, X30, X31, F14, F15, F16, F17, F18,
+ F19, F20, F21, F22, F23, F24, F25, F26,
+ F27, F28, F29, F30, F31, CR2, CR3, CR4,
+ V20, V21, V22, V23, V24, V25, V26, V27,
+ V28, V29, V30, V31)>;
+
+def CSR_SVR464 : CalleeSavedRegs<(add X14, X15, X16, X17, X18, X19, X20, VRSAVE,
+ X21, X22, X23, X24, X25, X26, X27, X28,
+ X29, X30, X31, F14, F15, F16, F17, F18,
+ F19, F20, F21, F22, F23, F24, F25, F26,
+ F27, F28, F29, F30, F31, CR2, CR3, CR4,
+ V20, V21, V22, V23, V24, V25, V26, V27,
+ V28, V29, V30, V31)>;
+
+def CSR_NoRegs : CalleeSavedRegs<(add VRSAVE)>;
+def CSR_NoRegs_Darwin : CalleeSavedRegs<(add)>;
+
+def CSR_NoRegs_Altivec : CalleeSavedRegs<(add (sequence "V%u", 0, 31), VRSAVE)>;
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCCodeEmitter.cpp b/contrib/llvm/lib/Target/PowerPC/PPCCodeEmitter.cpp
new file mode 100644
index 0000000..6478718
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCCodeEmitter.cpp
@@ -0,0 +1,271 @@
+//===-- PPCCodeEmitter.cpp - JIT Code Emitter for PowerPC -----------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the PowerPC 32-bit CodeEmitter and associated machinery to
+// JIT-compile bitcode to native PowerPC.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPC.h"
+#include "PPCRelocations.h"
+#include "PPCTargetMachine.h"
+#include "llvm/CodeGen/JITCodeEmitter.h"
+#include "llvm/CodeGen/MachineFunctionPass.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineModuleInfo.h"
+#include "llvm/IR/Module.h"
+#include "llvm/PassManager.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/raw_ostream.h"
+#include "llvm/Target/TargetOptions.h"
+using namespace llvm;
+
+namespace {
+ class PPCCodeEmitter : public MachineFunctionPass {
+ TargetMachine &TM;
+ JITCodeEmitter &MCE;
+ MachineModuleInfo *MMI;
+
+ void getAnalysisUsage(AnalysisUsage &AU) const {
+ AU.addRequired<MachineModuleInfo>();
+ MachineFunctionPass::getAnalysisUsage(AU);
+ }
+
+ static char ID;
+
+ /// MovePCtoLROffset - When/if we see a MovePCtoLR instruction, we record
+ /// its address in the function into this pointer.
+ void *MovePCtoLROffset;
+ public:
+
+ PPCCodeEmitter(TargetMachine &tm, JITCodeEmitter &mce)
+ : MachineFunctionPass(ID), TM(tm), MCE(mce) {}
+
+ /// getBinaryCodeForInstr - This function, generated by the
+ /// CodeEmitterGenerator using TableGen, produces the binary encoding for
+ /// machine instructions.
+ uint64_t getBinaryCodeForInstr(const MachineInstr &MI) const;
+
+
+ MachineRelocation GetRelocation(const MachineOperand &MO,
+ unsigned RelocID) const;
+
+ /// getMachineOpValue - evaluates the MachineOperand of a given MachineInstr
+ unsigned getMachineOpValue(const MachineInstr &MI,
+ const MachineOperand &MO) const;
+
+ unsigned get_crbitm_encoding(const MachineInstr &MI, unsigned OpNo) const;
+ unsigned getDirectBrEncoding(const MachineInstr &MI, unsigned OpNo) const;
+ unsigned getCondBrEncoding(const MachineInstr &MI, unsigned OpNo) const;
+
+ unsigned getHA16Encoding(const MachineInstr &MI, unsigned OpNo) const;
+ unsigned getLO16Encoding(const MachineInstr &MI, unsigned OpNo) const;
+ unsigned getMemRIEncoding(const MachineInstr &MI, unsigned OpNo) const;
+ unsigned getMemRIXEncoding(const MachineInstr &MI, unsigned OpNo) const;
+ unsigned getTLSRegEncoding(const MachineInstr &MI, unsigned OpNo) const;
+
+ const char *getPassName() const { return "PowerPC Machine Code Emitter"; }
+
+ /// runOnMachineFunction - emits the given MachineFunction to memory
+ ///
+ bool runOnMachineFunction(MachineFunction &MF);
+
+ /// emitBasicBlock - emits the given MachineBasicBlock to memory
+ ///
+ void emitBasicBlock(MachineBasicBlock &MBB);
+ };
+}
+
+char PPCCodeEmitter::ID = 0;
+
+/// createPPCCodeEmitterPass - Return a pass that emits the collected PPC code
+/// to the specified MCE object.
+FunctionPass *llvm::createPPCJITCodeEmitterPass(PPCTargetMachine &TM,
+ JITCodeEmitter &JCE) {
+ return new PPCCodeEmitter(TM, JCE);
+}
+
+bool PPCCodeEmitter::runOnMachineFunction(MachineFunction &MF) {
+ assert((MF.getTarget().getRelocationModel() != Reloc::Default ||
+ MF.getTarget().getRelocationModel() != Reloc::Static) &&
+ "JIT relocation model must be set to static or default!");
+
+ MMI = &getAnalysis<MachineModuleInfo>();
+ MCE.setModuleInfo(MMI);
+ do {
+ MovePCtoLROffset = 0;
+ MCE.startFunction(MF);
+ for (MachineFunction::iterator BB = MF.begin(), E = MF.end(); BB != E; ++BB)
+ emitBasicBlock(*BB);
+ } while (MCE.finishFunction(MF));
+
+ return false;
+}
+
+void PPCCodeEmitter::emitBasicBlock(MachineBasicBlock &MBB) {
+ MCE.StartMachineBasicBlock(&MBB);
+
+ for (MachineBasicBlock::iterator I = MBB.begin(), E = MBB.end(); I != E; ++I){
+ const MachineInstr &MI = *I;
+ MCE.processDebugLoc(MI.getDebugLoc(), true);
+ switch (MI.getOpcode()) {
+ default:
+ MCE.emitWordBE(getBinaryCodeForInstr(MI));
+ break;
+ case TargetOpcode::PROLOG_LABEL:
+ case TargetOpcode::EH_LABEL:
+ MCE.emitLabel(MI.getOperand(0).getMCSymbol());
+ break;
+ case TargetOpcode::IMPLICIT_DEF:
+ case TargetOpcode::KILL:
+ break; // pseudo opcode, no side effects
+ case PPC::MovePCtoLR:
+ case PPC::MovePCtoLR8:
+ assert(TM.getRelocationModel() == Reloc::PIC_);
+ MovePCtoLROffset = (void*)MCE.getCurrentPCValue();
+ MCE.emitWordBE(0x48000005); // bl 1
+ break;
+ }
+ MCE.processDebugLoc(MI.getDebugLoc(), false);
+ }
+}
+
+unsigned PPCCodeEmitter::get_crbitm_encoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ assert((MI.getOpcode() == PPC::MTCRF || MI.getOpcode() == PPC::MTCRF8 ||
+ MI.getOpcode() == PPC::MFOCRF) &&
+ (MO.getReg() >= PPC::CR0 && MO.getReg() <= PPC::CR7));
+ return 0x80 >> TM.getRegisterInfo()->getEncodingValue(MO.getReg());
+}
+
+MachineRelocation PPCCodeEmitter::GetRelocation(const MachineOperand &MO,
+ unsigned RelocID) const {
+ // If in PIC mode, we need to encode the negated address of the
+ // 'movepctolr' into the unrelocated field. After relocation, we'll have
+ // &gv-&movepctolr-4 in the imm field. Once &movepctolr is added to the imm
+ // field, we get &gv. This doesn't happen for branch relocations, which are
+ // always implicitly pc relative.
+ intptr_t Cst = 0;
+ if (TM.getRelocationModel() == Reloc::PIC_) {
+ assert(MovePCtoLROffset && "MovePCtoLR not seen yet?");
+ Cst = -(intptr_t)MovePCtoLROffset - 4;
+ }
+
+ if (MO.isGlobal())
+ return MachineRelocation::getGV(MCE.getCurrentPCOffset(), RelocID,
+ const_cast<GlobalValue *>(MO.getGlobal()),
+ Cst, isa<Function>(MO.getGlobal()));
+ if (MO.isSymbol())
+ return MachineRelocation::getExtSym(MCE.getCurrentPCOffset(),
+ RelocID, MO.getSymbolName(), Cst);
+ if (MO.isCPI())
+ return MachineRelocation::getConstPool(MCE.getCurrentPCOffset(),
+ RelocID, MO.getIndex(), Cst);
+
+ if (MO.isMBB())
+ return MachineRelocation::getBB(MCE.getCurrentPCOffset(),
+ RelocID, MO.getMBB());
+
+ assert(MO.isJTI());
+ return MachineRelocation::getJumpTable(MCE.getCurrentPCOffset(),
+ RelocID, MO.getIndex(), Cst);
+}
+
+unsigned PPCCodeEmitter::getDirectBrEncoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO);
+
+ MCE.addRelocation(GetRelocation(MO, PPC::reloc_pcrel_bx));
+ return 0;
+}
+
+unsigned PPCCodeEmitter::getCondBrEncoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ MCE.addRelocation(GetRelocation(MO, PPC::reloc_pcrel_bcx));
+ return 0;
+}
+
+unsigned PPCCodeEmitter::getHA16Encoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO);
+
+ MCE.addRelocation(GetRelocation(MO, PPC::reloc_absolute_high));
+ return 0;
+}
+
+unsigned PPCCodeEmitter::getLO16Encoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ if (MO.isReg() || MO.isImm()) return getMachineOpValue(MI, MO);
+
+ MCE.addRelocation(GetRelocation(MO, PPC::reloc_absolute_low));
+ return 0;
+}
+
+unsigned PPCCodeEmitter::getMemRIEncoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ // Encode (imm, reg) as a memri, which has the low 16-bits as the
+ // displacement and the next 5 bits as the register #.
+ assert(MI.getOperand(OpNo+1).isReg());
+ unsigned RegBits = getMachineOpValue(MI, MI.getOperand(OpNo+1)) << 16;
+
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ if (MO.isImm())
+ return (getMachineOpValue(MI, MO) & 0xFFFF) | RegBits;
+
+ // Add a fixup for the displacement field.
+ MCE.addRelocation(GetRelocation(MO, PPC::reloc_absolute_low));
+ return RegBits;
+}
+
+unsigned PPCCodeEmitter::getMemRIXEncoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ // Encode (imm, reg) as a memrix, which has the low 14-bits as the
+ // displacement and the next 5 bits as the register #.
+ assert(MI.getOperand(OpNo+1).isReg());
+ unsigned RegBits = getMachineOpValue(MI, MI.getOperand(OpNo+1)) << 14;
+
+ const MachineOperand &MO = MI.getOperand(OpNo);
+ if (MO.isImm())
+ return (getMachineOpValue(MI, MO) & 0x3FFF) | RegBits;
+
+ MCE.addRelocation(GetRelocation(MO, PPC::reloc_absolute_low_ix));
+ return RegBits;
+}
+
+
+unsigned PPCCodeEmitter::getTLSRegEncoding(const MachineInstr &MI,
+ unsigned OpNo) const {
+ llvm_unreachable("TLS not supported on the old JIT.");
+ return 0;
+}
+
+
+unsigned PPCCodeEmitter::getMachineOpValue(const MachineInstr &MI,
+ const MachineOperand &MO) const {
+
+ if (MO.isReg()) {
+ // MTCRF/MFOCRF should go through get_crbitm_encoding for the CR operand.
+ // The GPR operand should come through here though.
+ assert((MI.getOpcode() != PPC::MTCRF && MI.getOpcode() != PPC::MTCRF8 &&
+ MI.getOpcode() != PPC::MFOCRF) ||
+ MO.getReg() < PPC::CR0 || MO.getReg() > PPC::CR7);
+ return TM.getRegisterInfo()->getEncodingValue(MO.getReg());
+ }
+
+ assert(MO.isImm() &&
+ "Relocation required in an instruction that we cannot encode!");
+ return MO.getImm();
+}
+
+#include "PPCGenCodeEmitter.inc"
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.cpp b/contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.cpp
new file mode 100644
index 0000000..3244b90
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.cpp
@@ -0,0 +1,1329 @@
+//===-- PPCFrameLowering.cpp - PPC Frame Information ----------------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the PPC implementation of TargetFrameLowering class.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCFrameLowering.h"
+#include "PPCInstrBuilder.h"
+#include "PPCInstrInfo.h"
+#include "PPCMachineFunctionInfo.h"
+#include "llvm/CodeGen/MachineFrameInfo.h"
+#include "llvm/CodeGen/MachineFunction.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineModuleInfo.h"
+#include "llvm/CodeGen/MachineRegisterInfo.h"
+#include "llvm/CodeGen/RegisterScavenging.h"
+#include "llvm/IR/Function.h"
+#include "llvm/Target/TargetOptions.h"
+
+using namespace llvm;
+
+// FIXME This disables some code that aligns the stack to a boundary bigger than
+// the default (16 bytes on Darwin) when there is a stack local of greater
+// alignment. This does not currently work, because the delta between old and
+// new stack pointers is added to offsets that reference incoming parameters
+// after the prolog is generated, and the code that does that doesn't handle a
+// variable delta. You don't want to do that anyway; a better approach is to
+// reserve another register that retains to the incoming stack pointer, and
+// reference parameters relative to that.
+#define ALIGN_STACK 0
+
+
+/// VRRegNo - Map from a numbered VR register to its enum value.
+///
+static const uint16_t VRRegNo[] = {
+ PPC::V0 , PPC::V1 , PPC::V2 , PPC::V3 , PPC::V4 , PPC::V5 , PPC::V6 , PPC::V7 ,
+ PPC::V8 , PPC::V9 , PPC::V10, PPC::V11, PPC::V12, PPC::V13, PPC::V14, PPC::V15,
+ PPC::V16, PPC::V17, PPC::V18, PPC::V19, PPC::V20, PPC::V21, PPC::V22, PPC::V23,
+ PPC::V24, PPC::V25, PPC::V26, PPC::V27, PPC::V28, PPC::V29, PPC::V30, PPC::V31
+};
+
+/// RemoveVRSaveCode - We have found that this function does not need any code
+/// to manipulate the VRSAVE register, even though it uses vector registers.
+/// This can happen when the only registers used are known to be live in or out
+/// of the function. Remove all of the VRSAVE related code from the function.
+/// FIXME: The removal of the code results in a compile failure at -O0 when the
+/// function contains a function call, as the GPR containing original VRSAVE
+/// contents is spilled and reloaded around the call. Without the prolog code,
+/// the spill instruction refers to an undefined register. This code needs
+/// to account for all uses of that GPR.
+static void RemoveVRSaveCode(MachineInstr *MI) {
+ MachineBasicBlock *Entry = MI->getParent();
+ MachineFunction *MF = Entry->getParent();
+
+ // We know that the MTVRSAVE instruction immediately follows MI. Remove it.
+ MachineBasicBlock::iterator MBBI = MI;
+ ++MBBI;
+ assert(MBBI != Entry->end() && MBBI->getOpcode() == PPC::MTVRSAVE);
+ MBBI->eraseFromParent();
+
+ bool RemovedAllMTVRSAVEs = true;
+ // See if we can find and remove the MTVRSAVE instruction from all of the
+ // epilog blocks.
+ for (MachineFunction::iterator I = MF->begin(), E = MF->end(); I != E; ++I) {
+ // If last instruction is a return instruction, add an epilogue
+ if (!I->empty() && I->back().isReturn()) {
+ bool FoundIt = false;
+ for (MBBI = I->end(); MBBI != I->begin(); ) {
+ --MBBI;
+ if (MBBI->getOpcode() == PPC::MTVRSAVE) {
+ MBBI->eraseFromParent(); // remove it.
+ FoundIt = true;
+ break;
+ }
+ }
+ RemovedAllMTVRSAVEs &= FoundIt;
+ }
+ }
+
+ // If we found and removed all MTVRSAVE instructions, remove the read of
+ // VRSAVE as well.
+ if (RemovedAllMTVRSAVEs) {
+ MBBI = MI;
+ assert(MBBI != Entry->begin() && "UPDATE_VRSAVE is first instr in block?");
+ --MBBI;
+ assert(MBBI->getOpcode() == PPC::MFVRSAVE && "VRSAVE instrs wandered?");
+ MBBI->eraseFromParent();
+ }
+
+ // Finally, nuke the UPDATE_VRSAVE.
+ MI->eraseFromParent();
+}
+
+// HandleVRSaveUpdate - MI is the UPDATE_VRSAVE instruction introduced by the
+// instruction selector. Based on the vector registers that have been used,
+// transform this into the appropriate ORI instruction.
+static void HandleVRSaveUpdate(MachineInstr *MI, const TargetInstrInfo &TII) {
+ MachineFunction *MF = MI->getParent()->getParent();
+ const TargetRegisterInfo *TRI = MF->getTarget().getRegisterInfo();
+ DebugLoc dl = MI->getDebugLoc();
+
+ unsigned UsedRegMask = 0;
+ for (unsigned i = 0; i != 32; ++i)
+ if (MF->getRegInfo().isPhysRegUsed(VRRegNo[i]))
+ UsedRegMask |= 1 << (31-i);
+
+ // Live in and live out values already must be in the mask, so don't bother
+ // marking them.
+ for (MachineRegisterInfo::livein_iterator
+ I = MF->getRegInfo().livein_begin(),
+ E = MF->getRegInfo().livein_end(); I != E; ++I) {
+ unsigned RegNo = TRI->getEncodingValue(I->first);
+ if (VRRegNo[RegNo] == I->first) // If this really is a vector reg.
+ UsedRegMask &= ~(1 << (31-RegNo)); // Doesn't need to be marked.
+ }
+
+ // Live out registers appear as use operands on return instructions.
+ for (MachineFunction::const_iterator BI = MF->begin(), BE = MF->end();
+ UsedRegMask != 0 && BI != BE; ++BI) {
+ const MachineBasicBlock &MBB = *BI;
+ if (MBB.empty() || !MBB.back().isReturn())
+ continue;
+ const MachineInstr &Ret = MBB.back();
+ for (unsigned I = 0, E = Ret.getNumOperands(); I != E; ++I) {
+ const MachineOperand &MO = Ret.getOperand(I);
+ if (!MO.isReg() || !PPC::VRRCRegClass.contains(MO.getReg()))
+ continue;
+ unsigned RegNo = TRI->getEncodingValue(MO.getReg());
+ UsedRegMask &= ~(1 << (31-RegNo));
+ }
+ }
+
+ // If no registers are used, turn this into a copy.
+ if (UsedRegMask == 0) {
+ // Remove all VRSAVE code.
+ RemoveVRSaveCode(MI);
+ return;
+ }
+
+ unsigned SrcReg = MI->getOperand(1).getReg();
+ unsigned DstReg = MI->getOperand(0).getReg();
+
+ if ((UsedRegMask & 0xFFFF) == UsedRegMask) {
+ if (DstReg != SrcReg)
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORI), DstReg)
+ .addReg(SrcReg)
+ .addImm(UsedRegMask);
+ else
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORI), DstReg)
+ .addReg(SrcReg, RegState::Kill)
+ .addImm(UsedRegMask);
+ } else if ((UsedRegMask & 0xFFFF0000) == UsedRegMask) {
+ if (DstReg != SrcReg)
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORIS), DstReg)
+ .addReg(SrcReg)
+ .addImm(UsedRegMask >> 16);
+ else
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORIS), DstReg)
+ .addReg(SrcReg, RegState::Kill)
+ .addImm(UsedRegMask >> 16);
+ } else {
+ if (DstReg != SrcReg)
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORIS), DstReg)
+ .addReg(SrcReg)
+ .addImm(UsedRegMask >> 16);
+ else
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORIS), DstReg)
+ .addReg(SrcReg, RegState::Kill)
+ .addImm(UsedRegMask >> 16);
+
+ BuildMI(*MI->getParent(), MI, dl, TII.get(PPC::ORI), DstReg)
+ .addReg(DstReg, RegState::Kill)
+ .addImm(UsedRegMask & 0xFFFF);
+ }
+
+ // Remove the old UPDATE_VRSAVE instruction.
+ MI->eraseFromParent();
+}
+
+static bool spillsCR(const MachineFunction &MF) {
+ const PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ return FuncInfo->isCRSpilled();
+}
+
+static bool spillsVRSAVE(const MachineFunction &MF) {
+ const PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ return FuncInfo->isVRSAVESpilled();
+}
+
+static bool hasSpills(const MachineFunction &MF) {
+ const PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ return FuncInfo->hasSpills();
+}
+
+static bool hasNonRISpills(const MachineFunction &MF) {
+ const PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ return FuncInfo->hasNonRISpills();
+}
+
+/// determineFrameLayout - Determine the size of the frame and maximum call
+/// frame size.
+unsigned PPCFrameLowering::determineFrameLayout(MachineFunction &MF,
+ bool UpdateMF,
+ bool UseEstimate) const {
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+
+ // Get the number of bytes to allocate from the FrameInfo
+ unsigned FrameSize =
+ UseEstimate ? MFI->estimateStackSize(MF) : MFI->getStackSize();
+
+ // Get the alignments provided by the target, and the maximum alignment
+ // (if any) of the fixed frame objects.
+ unsigned MaxAlign = MFI->getMaxAlignment();
+ unsigned TargetAlign = getStackAlignment();
+ unsigned AlignMask = TargetAlign - 1; //
+
+ // If we are a leaf function, and use up to 224 bytes of stack space,
+ // don't have a frame pointer, calls, or dynamic alloca then we do not need
+ // to adjust the stack pointer (we fit in the Red Zone). For 64-bit
+ // SVR4, we also require a stack frame if we need to spill the CR,
+ // since this spill area is addressed relative to the stack pointer.
+ // The 32-bit SVR4 ABI has no Red Zone. However, it can still generate
+ // stackless code if all local vars are reg-allocated.
+ bool DisableRedZone = MF.getFunction()->getAttributes().
+ hasAttribute(AttributeSet::FunctionIndex, Attribute::NoRedZone);
+ if (!DisableRedZone &&
+ (Subtarget.isPPC64() || // 32-bit SVR4, no stack-
+ !Subtarget.isSVR4ABI() || // allocated locals.
+ FrameSize == 0) &&
+ FrameSize <= 224 && // Fits in red zone.
+ !MFI->hasVarSizedObjects() && // No dynamic alloca.
+ !MFI->adjustsStack() && // No calls.
+ !(Subtarget.isPPC64() && // No 64-bit SVR4 CRsave.
+ Subtarget.isSVR4ABI()
+ && spillsCR(MF)) &&
+ (!ALIGN_STACK || MaxAlign <= TargetAlign)) { // No special alignment.
+ // No need for frame
+ if (UpdateMF)
+ MFI->setStackSize(0);
+ return 0;
+ }
+
+ // Get the maximum call frame size of all the calls.
+ unsigned maxCallFrameSize = MFI->getMaxCallFrameSize();
+
+ // Maximum call frame needs to be at least big enough for linkage and 8 args.
+ unsigned minCallFrameSize = getMinCallFrameSize(Subtarget.isPPC64(),
+ Subtarget.isDarwinABI());
+ maxCallFrameSize = std::max(maxCallFrameSize, minCallFrameSize);
+
+ // If we have dynamic alloca then maxCallFrameSize needs to be aligned so
+ // that allocations will be aligned.
+ if (MFI->hasVarSizedObjects())
+ maxCallFrameSize = (maxCallFrameSize + AlignMask) & ~AlignMask;
+
+ // Update maximum call frame size.
+ if (UpdateMF)
+ MFI->setMaxCallFrameSize(maxCallFrameSize);
+
+ // Include call frame size in total.
+ FrameSize += maxCallFrameSize;
+
+ // Make sure the frame is aligned.
+ FrameSize = (FrameSize + AlignMask) & ~AlignMask;
+
+ // Update frame info.
+ if (UpdateMF)
+ MFI->setStackSize(FrameSize);
+
+ return FrameSize;
+}
+
+// hasFP - Return true if the specified function actually has a dedicated frame
+// pointer register.
+bool PPCFrameLowering::hasFP(const MachineFunction &MF) const {
+ const MachineFrameInfo *MFI = MF.getFrameInfo();
+ // FIXME: This is pretty much broken by design: hasFP() might be called really
+ // early, before the stack layout was calculated and thus hasFP() might return
+ // true or false here depending on the time of call.
+ return (MFI->getStackSize()) && needsFP(MF);
+}
+
+// needsFP - Return true if the specified function should have a dedicated frame
+// pointer register. This is true if the function has variable sized allocas or
+// if frame pointer elimination is disabled.
+bool PPCFrameLowering::needsFP(const MachineFunction &MF) const {
+ const MachineFrameInfo *MFI = MF.getFrameInfo();
+
+ // Naked functions have no stack frame pushed, so we don't have a frame
+ // pointer.
+ if (MF.getFunction()->getAttributes().hasAttribute(AttributeSet::FunctionIndex,
+ Attribute::Naked))
+ return false;
+
+ return MF.getTarget().Options.DisableFramePointerElim(MF) ||
+ MFI->hasVarSizedObjects() ||
+ (MF.getTarget().Options.GuaranteedTailCallOpt &&
+ MF.getInfo<PPCFunctionInfo>()->hasFastCall());
+}
+
+void PPCFrameLowering::replaceFPWithRealFP(MachineFunction &MF) const {
+ bool is31 = needsFP(MF);
+ unsigned FPReg = is31 ? PPC::R31 : PPC::R1;
+ unsigned FP8Reg = is31 ? PPC::X31 : PPC::X1;
+
+ for (MachineFunction::iterator BI = MF.begin(), BE = MF.end();
+ BI != BE; ++BI)
+ for (MachineBasicBlock::iterator MBBI = BI->end(); MBBI != BI->begin(); ) {
+ --MBBI;
+ for (unsigned I = 0, E = MBBI->getNumOperands(); I != E; ++I) {
+ MachineOperand &MO = MBBI->getOperand(I);
+ if (!MO.isReg())
+ continue;
+
+ switch (MO.getReg()) {
+ case PPC::FP:
+ MO.setReg(FPReg);
+ break;
+ case PPC::FP8:
+ MO.setReg(FP8Reg);
+ break;
+ }
+ }
+ }
+}
+
+void PPCFrameLowering::emitPrologue(MachineFunction &MF) const {
+ MachineBasicBlock &MBB = MF.front(); // Prolog goes in entry BB
+ MachineBasicBlock::iterator MBBI = MBB.begin();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ const PPCInstrInfo &TII =
+ *static_cast<const PPCInstrInfo*>(MF.getTarget().getInstrInfo());
+
+ MachineModuleInfo &MMI = MF.getMMI();
+ DebugLoc dl;
+ bool needsFrameMoves = MMI.hasDebugInfo() ||
+ MF.getFunction()->needsUnwindTableEntry();
+
+ // Prepare for frame info.
+ MCSymbol *FrameLabel = 0;
+
+ // Scan the prolog, looking for an UPDATE_VRSAVE instruction. If we find it,
+ // process it.
+ if (!Subtarget.isSVR4ABI())
+ for (unsigned i = 0; MBBI != MBB.end(); ++i, ++MBBI) {
+ if (MBBI->getOpcode() == PPC::UPDATE_VRSAVE) {
+ HandleVRSaveUpdate(MBBI, TII);
+ break;
+ }
+ }
+
+ // Move MBBI back to the beginning of the function.
+ MBBI = MBB.begin();
+
+ // Work out frame sizes.
+ unsigned FrameSize = determineFrameLayout(MF);
+ int NegFrameSize = -FrameSize;
+
+ if (MFI->isFrameAddressTaken())
+ replaceFPWithRealFP(MF);
+
+ // Get processor type.
+ bool isPPC64 = Subtarget.isPPC64();
+ // Get operating system
+ bool isDarwinABI = Subtarget.isDarwinABI();
+ // Check if the link register (LR) must be saved.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ bool MustSaveLR = FI->mustSaveLR();
+ // Do we have a frame pointer for this function?
+ bool HasFP = hasFP(MF);
+
+ int LROffset = PPCFrameLowering::getReturnSaveOffset(isPPC64, isDarwinABI);
+
+ int FPOffset = 0;
+ if (HasFP) {
+ if (Subtarget.isSVR4ABI()) {
+ MachineFrameInfo *FFI = MF.getFrameInfo();
+ int FPIndex = FI->getFramePointerSaveIndex();
+ assert(FPIndex && "No Frame Pointer Save Slot!");
+ FPOffset = FFI->getObjectOffset(FPIndex);
+ } else {
+ FPOffset = PPCFrameLowering::getFramePointerSaveOffset(isPPC64, isDarwinABI);
+ }
+ }
+
+ if (isPPC64) {
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::MFLR8), PPC::X0);
+
+ if (HasFP)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STD))
+ .addReg(PPC::X31)
+ .addImm(FPOffset/4)
+ .addReg(PPC::X1);
+
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STD))
+ .addReg(PPC::X0)
+ .addImm(LROffset / 4)
+ .addReg(PPC::X1);
+ } else {
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::MFLR), PPC::R0);
+
+ if (HasFP)
+ // FIXME: On PPC32 SVR4, FPOffset is negative and access to negative
+ // offsets of R1 is not allowed.
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STW))
+ .addReg(PPC::R31)
+ .addImm(FPOffset)
+ .addReg(PPC::R1);
+
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STW))
+ .addReg(PPC::R0)
+ .addImm(LROffset)
+ .addReg(PPC::R1);
+ }
+
+ // Skip if a leaf routine.
+ if (!FrameSize) return;
+
+ // Get stack alignments.
+ unsigned TargetAlign = getStackAlignment();
+ unsigned MaxAlign = MFI->getMaxAlignment();
+
+ // Adjust stack pointer: r1 += NegFrameSize.
+ // If there is a preferred stack alignment, align R1 now
+ if (!isPPC64) {
+ // PPC32.
+ if (ALIGN_STACK && MaxAlign > TargetAlign) {
+ assert(isPowerOf2_32(MaxAlign) && isInt<16>(MaxAlign) &&
+ "Invalid alignment!");
+ assert(isInt<16>(NegFrameSize) && "Unhandled stack size and alignment!");
+
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::RLWINM), PPC::R0)
+ .addReg(PPC::R1)
+ .addImm(0)
+ .addImm(32 - Log2_32(MaxAlign))
+ .addImm(31);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::SUBFIC) ,PPC::R0)
+ .addReg(PPC::R0, RegState::Kill)
+ .addImm(NegFrameSize);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STWUX), PPC::R1)
+ .addReg(PPC::R1, RegState::Kill)
+ .addReg(PPC::R1)
+ .addReg(PPC::R0);
+ } else if (isInt<16>(NegFrameSize)) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STWU), PPC::R1)
+ .addReg(PPC::R1)
+ .addImm(NegFrameSize)
+ .addReg(PPC::R1);
+ } else {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LIS), PPC::R0)
+ .addImm(NegFrameSize >> 16);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ORI), PPC::R0)
+ .addReg(PPC::R0, RegState::Kill)
+ .addImm(NegFrameSize & 0xFFFF);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STWUX), PPC::R1)
+ .addReg(PPC::R1, RegState::Kill)
+ .addReg(PPC::R1)
+ .addReg(PPC::R0);
+ }
+ } else { // PPC64.
+ if (ALIGN_STACK && MaxAlign > TargetAlign) {
+ assert(isPowerOf2_32(MaxAlign) && isInt<16>(MaxAlign) &&
+ "Invalid alignment!");
+ assert(isInt<16>(NegFrameSize) && "Unhandled stack size and alignment!");
+
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::RLDICL), PPC::X0)
+ .addReg(PPC::X1)
+ .addImm(0)
+ .addImm(64 - Log2_32(MaxAlign));
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::SUBFIC8), PPC::X0)
+ .addReg(PPC::X0)
+ .addImm(NegFrameSize);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STDUX), PPC::X1)
+ .addReg(PPC::X1, RegState::Kill)
+ .addReg(PPC::X1)
+ .addReg(PPC::X0);
+ } else if (isInt<16>(NegFrameSize)) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STDU), PPC::X1)
+ .addReg(PPC::X1)
+ .addImm(NegFrameSize / 4)
+ .addReg(PPC::X1);
+ } else {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LIS8), PPC::X0)
+ .addImm(NegFrameSize >> 16);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ORI8), PPC::X0)
+ .addReg(PPC::X0, RegState::Kill)
+ .addImm(NegFrameSize & 0xFFFF);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::STDUX), PPC::X1)
+ .addReg(PPC::X1, RegState::Kill)
+ .addReg(PPC::X1)
+ .addReg(PPC::X0);
+ }
+ }
+
+ std::vector<MachineMove> &Moves = MMI.getFrameMoves();
+
+ // Add the "machine moves" for the instructions we generated above, but in
+ // reverse order.
+ if (needsFrameMoves) {
+ // Mark effective beginning of when frame pointer becomes valid.
+ FrameLabel = MMI.getContext().CreateTempSymbol();
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::PROLOG_LABEL)).addSym(FrameLabel);
+
+ // Show update of SP.
+ if (NegFrameSize) {
+ MachineLocation SPDst(MachineLocation::VirtualFP);
+ MachineLocation SPSrc(MachineLocation::VirtualFP, NegFrameSize);
+ Moves.push_back(MachineMove(FrameLabel, SPDst, SPSrc));
+ } else {
+ MachineLocation SP(isPPC64 ? PPC::X31 : PPC::R31);
+ Moves.push_back(MachineMove(FrameLabel, SP, SP));
+ }
+
+ if (HasFP) {
+ MachineLocation FPDst(MachineLocation::VirtualFP, FPOffset);
+ MachineLocation FPSrc(isPPC64 ? PPC::X31 : PPC::R31);
+ Moves.push_back(MachineMove(FrameLabel, FPDst, FPSrc));
+ }
+
+ if (MustSaveLR) {
+ MachineLocation LRDst(MachineLocation::VirtualFP, LROffset);
+ MachineLocation LRSrc(isPPC64 ? PPC::LR8 : PPC::LR);
+ Moves.push_back(MachineMove(FrameLabel, LRDst, LRSrc));
+ }
+ }
+
+ MCSymbol *ReadyLabel = 0;
+
+ // If there is a frame pointer, copy R1 into R31
+ if (HasFP) {
+ if (!isPPC64) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::OR), PPC::R31)
+ .addReg(PPC::R1)
+ .addReg(PPC::R1);
+ } else {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::OR8), PPC::X31)
+ .addReg(PPC::X1)
+ .addReg(PPC::X1);
+ }
+
+ if (needsFrameMoves) {
+ ReadyLabel = MMI.getContext().CreateTempSymbol();
+
+ // Mark effective beginning of when frame pointer is ready.
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::PROLOG_LABEL)).addSym(ReadyLabel);
+
+ MachineLocation FPDst(HasFP ? (isPPC64 ? PPC::X31 : PPC::R31) :
+ (isPPC64 ? PPC::X1 : PPC::R1));
+ MachineLocation FPSrc(MachineLocation::VirtualFP);
+ Moves.push_back(MachineMove(ReadyLabel, FPDst, FPSrc));
+ }
+ }
+
+ if (needsFrameMoves) {
+ MCSymbol *Label = HasFP ? ReadyLabel : FrameLabel;
+
+ // Add callee saved registers to move list.
+ const std::vector<CalleeSavedInfo> &CSI = MFI->getCalleeSavedInfo();
+ for (unsigned I = 0, E = CSI.size(); I != E; ++I) {
+ unsigned Reg = CSI[I].getReg();
+ if (Reg == PPC::LR || Reg == PPC::LR8 || Reg == PPC::RM) continue;
+
+ // This is a bit of a hack: CR2LT, CR2GT, CR2EQ and CR2UN are just
+ // subregisters of CR2. We just need to emit a move of CR2.
+ if (PPC::CRBITRCRegClass.contains(Reg))
+ continue;
+
+ // For SVR4, don't emit a move for the CR spill slot if we haven't
+ // spilled CRs.
+ if (Subtarget.isSVR4ABI()
+ && (PPC::CR2 <= Reg && Reg <= PPC::CR4)
+ && !spillsCR(MF))
+ continue;
+
+ // For 64-bit SVR4 when we have spilled CRs, the spill location
+ // is SP+8, not a frame-relative slot.
+ if (Subtarget.isSVR4ABI()
+ && Subtarget.isPPC64()
+ && (PPC::CR2 <= Reg && Reg <= PPC::CR4)) {
+ MachineLocation CSDst(PPC::X1, 8);
+ MachineLocation CSSrc(PPC::CR2);
+ Moves.push_back(MachineMove(Label, CSDst, CSSrc));
+ continue;
+ }
+
+ int Offset = MFI->getObjectOffset(CSI[I].getFrameIdx());
+ MachineLocation CSDst(MachineLocation::VirtualFP, Offset);
+ MachineLocation CSSrc(Reg);
+ Moves.push_back(MachineMove(Label, CSDst, CSSrc));
+ }
+ }
+}
+
+void PPCFrameLowering::emitEpilogue(MachineFunction &MF,
+ MachineBasicBlock &MBB) const {
+ MachineBasicBlock::iterator MBBI = MBB.getLastNonDebugInstr();
+ assert(MBBI != MBB.end() && "Returning block has no terminator");
+ const PPCInstrInfo &TII =
+ *static_cast<const PPCInstrInfo*>(MF.getTarget().getInstrInfo());
+
+ unsigned RetOpcode = MBBI->getOpcode();
+ DebugLoc dl;
+
+ assert((RetOpcode == PPC::BLR ||
+ RetOpcode == PPC::TCRETURNri ||
+ RetOpcode == PPC::TCRETURNdi ||
+ RetOpcode == PPC::TCRETURNai ||
+ RetOpcode == PPC::TCRETURNri8 ||
+ RetOpcode == PPC::TCRETURNdi8 ||
+ RetOpcode == PPC::TCRETURNai8) &&
+ "Can only insert epilog into returning blocks");
+
+ // Get alignment info so we know how to restore r1
+ const MachineFrameInfo *MFI = MF.getFrameInfo();
+ unsigned TargetAlign = getStackAlignment();
+ unsigned MaxAlign = MFI->getMaxAlignment();
+
+ // Get the number of bytes allocated from the FrameInfo.
+ int FrameSize = MFI->getStackSize();
+
+ // Get processor type.
+ bool isPPC64 = Subtarget.isPPC64();
+ // Get operating system
+ bool isDarwinABI = Subtarget.isDarwinABI();
+ // Check if the link register (LR) has been saved.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ bool MustSaveLR = FI->mustSaveLR();
+ // Do we have a frame pointer for this function?
+ bool HasFP = hasFP(MF);
+
+ int LROffset = PPCFrameLowering::getReturnSaveOffset(isPPC64, isDarwinABI);
+
+ int FPOffset = 0;
+ if (HasFP) {
+ if (Subtarget.isSVR4ABI()) {
+ MachineFrameInfo *FFI = MF.getFrameInfo();
+ int FPIndex = FI->getFramePointerSaveIndex();
+ assert(FPIndex && "No Frame Pointer Save Slot!");
+ FPOffset = FFI->getObjectOffset(FPIndex);
+ } else {
+ FPOffset = PPCFrameLowering::getFramePointerSaveOffset(isPPC64, isDarwinABI);
+ }
+ }
+
+ bool UsesTCRet = RetOpcode == PPC::TCRETURNri ||
+ RetOpcode == PPC::TCRETURNdi ||
+ RetOpcode == PPC::TCRETURNai ||
+ RetOpcode == PPC::TCRETURNri8 ||
+ RetOpcode == PPC::TCRETURNdi8 ||
+ RetOpcode == PPC::TCRETURNai8;
+
+ if (UsesTCRet) {
+ int MaxTCRetDelta = FI->getTailCallSPDelta();
+ MachineOperand &StackAdjust = MBBI->getOperand(1);
+ assert(StackAdjust.isImm() && "Expecting immediate value.");
+ // Adjust stack pointer.
+ int StackAdj = StackAdjust.getImm();
+ int Delta = StackAdj - MaxTCRetDelta;
+ assert((Delta >= 0) && "Delta must be positive");
+ if (MaxTCRetDelta>0)
+ FrameSize += (StackAdj +Delta);
+ else
+ FrameSize += StackAdj;
+ }
+
+ if (FrameSize) {
+ // The loaded (or persistent) stack pointer value is offset by the 'stwu'
+ // on entry to the function. Add this offset back now.
+ if (!isPPC64) {
+ // If this function contained a fastcc call and GuaranteedTailCallOpt is
+ // enabled (=> hasFastCall()==true) the fastcc call might contain a tail
+ // call which invalidates the stack pointer value in SP(0). So we use the
+ // value of R31 in this case.
+ if (FI->hasFastCall() && isInt<16>(FrameSize)) {
+ assert(hasFP(MF) && "Expecting a valid the frame pointer.");
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ADDI), PPC::R1)
+ .addReg(PPC::R31).addImm(FrameSize);
+ } else if(FI->hasFastCall()) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LIS), PPC::R0)
+ .addImm(FrameSize >> 16);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ORI), PPC::R0)
+ .addReg(PPC::R0, RegState::Kill)
+ .addImm(FrameSize & 0xFFFF);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ADD4))
+ .addReg(PPC::R1)
+ .addReg(PPC::R31)
+ .addReg(PPC::R0);
+ } else if (isInt<16>(FrameSize) &&
+ (!ALIGN_STACK || TargetAlign >= MaxAlign) &&
+ !MFI->hasVarSizedObjects()) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ADDI), PPC::R1)
+ .addReg(PPC::R1).addImm(FrameSize);
+ } else {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LWZ),PPC::R1)
+ .addImm(0).addReg(PPC::R1);
+ }
+ } else {
+ if (FI->hasFastCall() && isInt<16>(FrameSize)) {
+ assert(hasFP(MF) && "Expecting a valid the frame pointer.");
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ADDI8), PPC::X1)
+ .addReg(PPC::X31).addImm(FrameSize);
+ } else if(FI->hasFastCall()) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LIS8), PPC::X0)
+ .addImm(FrameSize >> 16);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ORI8), PPC::X0)
+ .addReg(PPC::X0, RegState::Kill)
+ .addImm(FrameSize & 0xFFFF);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ADD8))
+ .addReg(PPC::X1)
+ .addReg(PPC::X31)
+ .addReg(PPC::X0);
+ } else if (isInt<16>(FrameSize) && TargetAlign >= MaxAlign &&
+ !MFI->hasVarSizedObjects()) {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::ADDI8), PPC::X1)
+ .addReg(PPC::X1).addImm(FrameSize);
+ } else {
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LD), PPC::X1)
+ .addImm(0).addReg(PPC::X1);
+ }
+ }
+ }
+
+ if (isPPC64) {
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LD), PPC::X0)
+ .addImm(LROffset/4).addReg(PPC::X1);
+
+ if (HasFP)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LD), PPC::X31)
+ .addImm(FPOffset/4).addReg(PPC::X1);
+
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::MTLR8)).addReg(PPC::X0);
+ } else {
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LWZ), PPC::R0)
+ .addImm(LROffset).addReg(PPC::R1);
+
+ if (HasFP)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::LWZ), PPC::R31)
+ .addImm(FPOffset).addReg(PPC::R1);
+
+ if (MustSaveLR)
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::MTLR)).addReg(PPC::R0);
+ }
+
+ // Callee pop calling convention. Pop parameter/linkage area. Used for tail
+ // call optimization
+ if (MF.getTarget().Options.GuaranteedTailCallOpt && RetOpcode == PPC::BLR &&
+ MF.getFunction()->getCallingConv() == CallingConv::Fast) {
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ unsigned CallerAllocatedAmt = FI->getMinReservedArea();
+ unsigned StackReg = isPPC64 ? PPC::X1 : PPC::R1;
+ unsigned FPReg = isPPC64 ? PPC::X31 : PPC::R31;
+ unsigned TmpReg = isPPC64 ? PPC::X0 : PPC::R0;
+ unsigned ADDIInstr = isPPC64 ? PPC::ADDI8 : PPC::ADDI;
+ unsigned ADDInstr = isPPC64 ? PPC::ADD8 : PPC::ADD4;
+ unsigned LISInstr = isPPC64 ? PPC::LIS8 : PPC::LIS;
+ unsigned ORIInstr = isPPC64 ? PPC::ORI8 : PPC::ORI;
+
+ if (CallerAllocatedAmt && isInt<16>(CallerAllocatedAmt)) {
+ BuildMI(MBB, MBBI, dl, TII.get(ADDIInstr), StackReg)
+ .addReg(StackReg).addImm(CallerAllocatedAmt);
+ } else {
+ BuildMI(MBB, MBBI, dl, TII.get(LISInstr), TmpReg)
+ .addImm(CallerAllocatedAmt >> 16);
+ BuildMI(MBB, MBBI, dl, TII.get(ORIInstr), TmpReg)
+ .addReg(TmpReg, RegState::Kill)
+ .addImm(CallerAllocatedAmt & 0xFFFF);
+ BuildMI(MBB, MBBI, dl, TII.get(ADDInstr))
+ .addReg(StackReg)
+ .addReg(FPReg)
+ .addReg(TmpReg);
+ }
+ } else if (RetOpcode == PPC::TCRETURNdi) {
+ MBBI = MBB.getLastNonDebugInstr();
+ MachineOperand &JumpTarget = MBBI->getOperand(0);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::TAILB)).
+ addGlobalAddress(JumpTarget.getGlobal(), JumpTarget.getOffset());
+ } else if (RetOpcode == PPC::TCRETURNri) {
+ MBBI = MBB.getLastNonDebugInstr();
+ assert(MBBI->getOperand(0).isReg() && "Expecting register operand.");
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::TAILBCTR));
+ } else if (RetOpcode == PPC::TCRETURNai) {
+ MBBI = MBB.getLastNonDebugInstr();
+ MachineOperand &JumpTarget = MBBI->getOperand(0);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::TAILBA)).addImm(JumpTarget.getImm());
+ } else if (RetOpcode == PPC::TCRETURNdi8) {
+ MBBI = MBB.getLastNonDebugInstr();
+ MachineOperand &JumpTarget = MBBI->getOperand(0);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::TAILB8)).
+ addGlobalAddress(JumpTarget.getGlobal(), JumpTarget.getOffset());
+ } else if (RetOpcode == PPC::TCRETURNri8) {
+ MBBI = MBB.getLastNonDebugInstr();
+ assert(MBBI->getOperand(0).isReg() && "Expecting register operand.");
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::TAILBCTR8));
+ } else if (RetOpcode == PPC::TCRETURNai8) {
+ MBBI = MBB.getLastNonDebugInstr();
+ MachineOperand &JumpTarget = MBBI->getOperand(0);
+ BuildMI(MBB, MBBI, dl, TII.get(PPC::TAILBA8)).addImm(JumpTarget.getImm());
+ }
+}
+
+/// MustSaveLR - Return true if this function requires that we save the LR
+/// register onto the stack in the prolog and restore it in the epilog of the
+/// function.
+static bool MustSaveLR(const MachineFunction &MF, unsigned LR) {
+ const PPCFunctionInfo *MFI = MF.getInfo<PPCFunctionInfo>();
+
+ // We need a save/restore of LR if there is any def of LR (which is
+ // defined by calls, including the PIC setup sequence), or if there is
+ // some use of the LR stack slot (e.g. for builtin_return_address).
+ // (LR comes in 32 and 64 bit versions.)
+ MachineRegisterInfo::def_iterator RI = MF.getRegInfo().def_begin(LR);
+ return RI !=MF.getRegInfo().def_end() || MFI->isLRStoreRequired();
+}
+
+void
+PPCFrameLowering::processFunctionBeforeCalleeSavedScan(MachineFunction &MF,
+ RegScavenger *) const {
+ const TargetRegisterInfo *RegInfo = MF.getTarget().getRegisterInfo();
+
+ // Save and clear the LR state.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ unsigned LR = RegInfo->getRARegister();
+ FI->setMustSaveLR(MustSaveLR(MF, LR));
+ MachineRegisterInfo &MRI = MF.getRegInfo();
+ MRI.setPhysRegUnused(LR);
+
+ // Save R31 if necessary
+ int FPSI = FI->getFramePointerSaveIndex();
+ bool isPPC64 = Subtarget.isPPC64();
+ bool isDarwinABI = Subtarget.isDarwinABI();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+
+ // If the frame pointer save index hasn't been defined yet.
+ if (!FPSI && needsFP(MF)) {
+ // Find out what the fix offset of the frame pointer save area.
+ int FPOffset = getFramePointerSaveOffset(isPPC64, isDarwinABI);
+ // Allocate the frame index for frame pointer save area.
+ FPSI = MFI->CreateFixedObject(isPPC64? 8 : 4, FPOffset, true);
+ // Save the result.
+ FI->setFramePointerSaveIndex(FPSI);
+ }
+
+ // Reserve stack space to move the linkage area to in case of a tail call.
+ int TCSPDelta = 0;
+ if (MF.getTarget().Options.GuaranteedTailCallOpt &&
+ (TCSPDelta = FI->getTailCallSPDelta()) < 0) {
+ MFI->CreateFixedObject(-1 * TCSPDelta, TCSPDelta, true);
+ }
+
+ // For 32-bit SVR4, allocate the nonvolatile CR spill slot iff the
+ // function uses CR 2, 3, or 4.
+ if (!isPPC64 && !isDarwinABI &&
+ (MRI.isPhysRegUsed(PPC::CR2) ||
+ MRI.isPhysRegUsed(PPC::CR3) ||
+ MRI.isPhysRegUsed(PPC::CR4))) {
+ int FrameIdx = MFI->CreateFixedObject((uint64_t)4, (int64_t)-4, true);
+ FI->setCRSpillFrameIndex(FrameIdx);
+ }
+}
+
+void PPCFrameLowering::processFunctionBeforeFrameFinalized(MachineFunction &MF,
+ RegScavenger *RS) const {
+ // Early exit if not using the SVR4 ABI.
+ if (!Subtarget.isSVR4ABI()) {
+ addScavengingSpillSlot(MF, RS);
+ return;
+ }
+
+ // Get callee saved register information.
+ MachineFrameInfo *FFI = MF.getFrameInfo();
+ const std::vector<CalleeSavedInfo> &CSI = FFI->getCalleeSavedInfo();
+
+ // Early exit if no callee saved registers are modified!
+ if (CSI.empty() && !needsFP(MF)) {
+ addScavengingSpillSlot(MF, RS);
+ return;
+ }
+
+ unsigned MinGPR = PPC::R31;
+ unsigned MinG8R = PPC::X31;
+ unsigned MinFPR = PPC::F31;
+ unsigned MinVR = PPC::V31;
+
+ bool HasGPSaveArea = false;
+ bool HasG8SaveArea = false;
+ bool HasFPSaveArea = false;
+ bool HasVRSAVESaveArea = false;
+ bool HasVRSaveArea = false;
+
+ SmallVector<CalleeSavedInfo, 18> GPRegs;
+ SmallVector<CalleeSavedInfo, 18> G8Regs;
+ SmallVector<CalleeSavedInfo, 18> FPRegs;
+ SmallVector<CalleeSavedInfo, 18> VRegs;
+
+ for (unsigned i = 0, e = CSI.size(); i != e; ++i) {
+ unsigned Reg = CSI[i].getReg();
+ if (PPC::GPRCRegClass.contains(Reg)) {
+ HasGPSaveArea = true;
+
+ GPRegs.push_back(CSI[i]);
+
+ if (Reg < MinGPR) {
+ MinGPR = Reg;
+ }
+ } else if (PPC::G8RCRegClass.contains(Reg)) {
+ HasG8SaveArea = true;
+
+ G8Regs.push_back(CSI[i]);
+
+ if (Reg < MinG8R) {
+ MinG8R = Reg;
+ }
+ } else if (PPC::F8RCRegClass.contains(Reg)) {
+ HasFPSaveArea = true;
+
+ FPRegs.push_back(CSI[i]);
+
+ if (Reg < MinFPR) {
+ MinFPR = Reg;
+ }
+ } else if (PPC::CRBITRCRegClass.contains(Reg) ||
+ PPC::CRRCRegClass.contains(Reg)) {
+ ; // do nothing, as we already know whether CRs are spilled
+ } else if (PPC::VRSAVERCRegClass.contains(Reg)) {
+ HasVRSAVESaveArea = true;
+ } else if (PPC::VRRCRegClass.contains(Reg)) {
+ HasVRSaveArea = true;
+
+ VRegs.push_back(CSI[i]);
+
+ if (Reg < MinVR) {
+ MinVR = Reg;
+ }
+ } else {
+ llvm_unreachable("Unknown RegisterClass!");
+ }
+ }
+
+ PPCFunctionInfo *PFI = MF.getInfo<PPCFunctionInfo>();
+ const TargetRegisterInfo *TRI = MF.getTarget().getRegisterInfo();
+
+ int64_t LowerBound = 0;
+
+ // Take into account stack space reserved for tail calls.
+ int TCSPDelta = 0;
+ if (MF.getTarget().Options.GuaranteedTailCallOpt &&
+ (TCSPDelta = PFI->getTailCallSPDelta()) < 0) {
+ LowerBound = TCSPDelta;
+ }
+
+ // The Floating-point register save area is right below the back chain word
+ // of the previous stack frame.
+ if (HasFPSaveArea) {
+ for (unsigned i = 0, e = FPRegs.size(); i != e; ++i) {
+ int FI = FPRegs[i].getFrameIdx();
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+
+ LowerBound -= (31 - TRI->getEncodingValue(MinFPR) + 1) * 8;
+ }
+
+ // Check whether the frame pointer register is allocated. If so, make sure it
+ // is spilled to the correct offset.
+ if (needsFP(MF)) {
+ HasGPSaveArea = true;
+
+ int FI = PFI->getFramePointerSaveIndex();
+ assert(FI && "No Frame Pointer Save Slot!");
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+
+ // General register save area starts right below the Floating-point
+ // register save area.
+ if (HasGPSaveArea || HasG8SaveArea) {
+ // Move general register save area spill slots down, taking into account
+ // the size of the Floating-point register save area.
+ for (unsigned i = 0, e = GPRegs.size(); i != e; ++i) {
+ int FI = GPRegs[i].getFrameIdx();
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+
+ // Move general register save area spill slots down, taking into account
+ // the size of the Floating-point register save area.
+ for (unsigned i = 0, e = G8Regs.size(); i != e; ++i) {
+ int FI = G8Regs[i].getFrameIdx();
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+
+ unsigned MinReg =
+ std::min<unsigned>(TRI->getEncodingValue(MinGPR),
+ TRI->getEncodingValue(MinG8R));
+
+ if (Subtarget.isPPC64()) {
+ LowerBound -= (31 - MinReg + 1) * 8;
+ } else {
+ LowerBound -= (31 - MinReg + 1) * 4;
+ }
+ }
+
+ // For 32-bit only, the CR save area is below the general register
+ // save area. For 64-bit SVR4, the CR save area is addressed relative
+ // to the stack pointer and hence does not need an adjustment here.
+ // Only CR2 (the first nonvolatile spilled) has an associated frame
+ // index so that we have a single uniform save area.
+ if (spillsCR(MF) && !(Subtarget.isPPC64() && Subtarget.isSVR4ABI())) {
+ // Adjust the frame index of the CR spill slot.
+ for (unsigned i = 0, e = CSI.size(); i != e; ++i) {
+ unsigned Reg = CSI[i].getReg();
+
+ if ((Subtarget.isSVR4ABI() && Reg == PPC::CR2)
+ // Leave Darwin logic as-is.
+ || (!Subtarget.isSVR4ABI() &&
+ (PPC::CRBITRCRegClass.contains(Reg) ||
+ PPC::CRRCRegClass.contains(Reg)))) {
+ int FI = CSI[i].getFrameIdx();
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+ }
+
+ LowerBound -= 4; // The CR save area is always 4 bytes long.
+ }
+
+ if (HasVRSAVESaveArea) {
+ // FIXME SVR4: Is it actually possible to have multiple elements in CSI
+ // which have the VRSAVE register class?
+ // Adjust the frame index of the VRSAVE spill slot.
+ for (unsigned i = 0, e = CSI.size(); i != e; ++i) {
+ unsigned Reg = CSI[i].getReg();
+
+ if (PPC::VRSAVERCRegClass.contains(Reg)) {
+ int FI = CSI[i].getFrameIdx();
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+ }
+
+ LowerBound -= 4; // The VRSAVE save area is always 4 bytes long.
+ }
+
+ if (HasVRSaveArea) {
+ // Insert alignment padding, we need 16-byte alignment.
+ LowerBound = (LowerBound - 15) & ~(15);
+
+ for (unsigned i = 0, e = VRegs.size(); i != e; ++i) {
+ int FI = VRegs[i].getFrameIdx();
+
+ FFI->setObjectOffset(FI, LowerBound + FFI->getObjectOffset(FI));
+ }
+ }
+
+ addScavengingSpillSlot(MF, RS);
+}
+
+void
+PPCFrameLowering::addScavengingSpillSlot(MachineFunction &MF,
+ RegScavenger *RS) const {
+ // Reserve a slot closest to SP or frame pointer if we have a dynalloc or
+ // a large stack, which will require scavenging a register to materialize a
+ // large offset.
+
+ // We need to have a scavenger spill slot for spills if the frame size is
+ // large. In case there is no free register for large-offset addressing,
+ // this slot is used for the necessary emergency spill. Also, we need the
+ // slot for dynamic stack allocations.
+
+ // The scavenger might be invoked if the frame offset does not fit into
+ // the 16-bit immediate. We don't know the complete frame size here
+ // because we've not yet computed callee-saved register spills or the
+ // needed alignment padding.
+ unsigned StackSize = determineFrameLayout(MF, false, true);
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ if (MFI->hasVarSizedObjects() || spillsCR(MF) || spillsVRSAVE(MF) ||
+ hasNonRISpills(MF) || (hasSpills(MF) && !isInt<16>(StackSize))) {
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+ const TargetRegisterClass *G8RC = &PPC::G8RCRegClass;
+ const TargetRegisterClass *RC = Subtarget.isPPC64() ? G8RC : GPRC;
+ RS->addScavengingFrameIndex(MFI->CreateStackObject(RC->getSize(),
+ RC->getAlignment(),
+ false));
+
+ // These kinds of spills might need two registers.
+ if (spillsCR(MF) || spillsVRSAVE(MF))
+ RS->addScavengingFrameIndex(MFI->CreateStackObject(RC->getSize(),
+ RC->getAlignment(),
+ false));
+
+ }
+}
+
+bool
+PPCFrameLowering::spillCalleeSavedRegisters(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI,
+ const std::vector<CalleeSavedInfo> &CSI,
+ const TargetRegisterInfo *TRI) const {
+
+ // Currently, this function only handles SVR4 32- and 64-bit ABIs.
+ // Return false otherwise to maintain pre-existing behavior.
+ if (!Subtarget.isSVR4ABI())
+ return false;
+
+ MachineFunction *MF = MBB.getParent();
+ const PPCInstrInfo &TII =
+ *static_cast<const PPCInstrInfo*>(MF->getTarget().getInstrInfo());
+ DebugLoc DL;
+ bool CRSpilled = false;
+
+ for (unsigned i = 0, e = CSI.size(); i != e; ++i) {
+ unsigned Reg = CSI[i].getReg();
+ // CR2 through CR4 are the nonvolatile CR fields.
+ bool IsCRField = PPC::CR2 <= Reg && Reg <= PPC::CR4;
+
+ if (CRSpilled && IsCRField)
+ continue;
+
+ // Add the callee-saved register as live-in; it's killed at the spill.
+ MBB.addLiveIn(Reg);
+
+ // Insert the spill to the stack frame.
+ if (IsCRField) {
+ CRSpilled = true;
+ // The first time we see a CR field, store the whole CR into the
+ // save slot via GPR12 (available in the prolog for 32- and 64-bit).
+ if (Subtarget.isPPC64()) {
+ // 64-bit: SP+8
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(PPC::MFCR8), PPC::X12));
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(PPC::STW8))
+ .addReg(PPC::X12,
+ getKillRegState(true))
+ .addImm(8)
+ .addReg(PPC::X1));
+ } else {
+ // 32-bit: FP-relative. Note that we made sure CR2-CR4 all have
+ // the same frame index in PPCRegisterInfo::hasReservedSpillSlot.
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(PPC::MFCR), PPC::R12));
+ MBB.insert(MI, addFrameReference(BuildMI(*MF, DL, TII.get(PPC::STW))
+ .addReg(PPC::R12,
+ getKillRegState(true)),
+ CSI[i].getFrameIdx()));
+ }
+
+ // Record that we spill the CR in this function.
+ PPCFunctionInfo *FuncInfo = MF->getInfo<PPCFunctionInfo>();
+ FuncInfo->setSpillsCR();
+ } else {
+ const TargetRegisterClass *RC = TRI->getMinimalPhysRegClass(Reg);
+ TII.storeRegToStackSlot(MBB, MI, Reg, true,
+ CSI[i].getFrameIdx(), RC, TRI);
+ }
+ }
+ return true;
+}
+
+static void
+restoreCRs(bool isPPC64, bool CR2Spilled, bool CR3Spilled, bool CR4Spilled,
+ MachineBasicBlock &MBB, MachineBasicBlock::iterator MI,
+ const std::vector<CalleeSavedInfo> &CSI, unsigned CSIIndex) {
+
+ MachineFunction *MF = MBB.getParent();
+ const PPCInstrInfo &TII =
+ *static_cast<const PPCInstrInfo*>(MF->getTarget().getInstrInfo());
+ DebugLoc DL;
+ unsigned RestoreOp, MoveReg;
+
+ if (isPPC64) {
+ // 64-bit: SP+8
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(PPC::LWZ8), PPC::X12)
+ .addImm(8)
+ .addReg(PPC::X1));
+ RestoreOp = PPC::MTCRF8;
+ MoveReg = PPC::X12;
+ } else {
+ // 32-bit: FP-relative
+ MBB.insert(MI, addFrameReference(BuildMI(*MF, DL, TII.get(PPC::LWZ),
+ PPC::R12),
+ CSI[CSIIndex].getFrameIdx()));
+ RestoreOp = PPC::MTCRF;
+ MoveReg = PPC::R12;
+ }
+
+ if (CR2Spilled)
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(RestoreOp), PPC::CR2)
+ .addReg(MoveReg, getKillRegState(!CR3Spilled && !CR4Spilled)));
+
+ if (CR3Spilled)
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(RestoreOp), PPC::CR3)
+ .addReg(MoveReg, getKillRegState(!CR4Spilled)));
+
+ if (CR4Spilled)
+ MBB.insert(MI, BuildMI(*MF, DL, TII.get(RestoreOp), PPC::CR4)
+ .addReg(MoveReg, getKillRegState(true)));
+}
+
+void PPCFrameLowering::
+eliminateCallFramePseudoInstr(MachineFunction &MF, MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator I) const {
+ const PPCInstrInfo &TII =
+ *static_cast<const PPCInstrInfo*>(MF.getTarget().getInstrInfo());
+ if (MF.getTarget().Options.GuaranteedTailCallOpt &&
+ I->getOpcode() == PPC::ADJCALLSTACKUP) {
+ // Add (actually subtract) back the amount the callee popped on return.
+ if (int CalleeAmt = I->getOperand(1).getImm()) {
+ bool is64Bit = Subtarget.isPPC64();
+ CalleeAmt *= -1;
+ unsigned StackReg = is64Bit ? PPC::X1 : PPC::R1;
+ unsigned TmpReg = is64Bit ? PPC::X0 : PPC::R0;
+ unsigned ADDIInstr = is64Bit ? PPC::ADDI8 : PPC::ADDI;
+ unsigned ADDInstr = is64Bit ? PPC::ADD8 : PPC::ADD4;
+ unsigned LISInstr = is64Bit ? PPC::LIS8 : PPC::LIS;
+ unsigned ORIInstr = is64Bit ? PPC::ORI8 : PPC::ORI;
+ MachineInstr *MI = I;
+ DebugLoc dl = MI->getDebugLoc();
+
+ if (isInt<16>(CalleeAmt)) {
+ BuildMI(MBB, I, dl, TII.get(ADDIInstr), StackReg)
+ .addReg(StackReg, RegState::Kill)
+ .addImm(CalleeAmt);
+ } else {
+ MachineBasicBlock::iterator MBBI = I;
+ BuildMI(MBB, MBBI, dl, TII.get(LISInstr), TmpReg)
+ .addImm(CalleeAmt >> 16);
+ BuildMI(MBB, MBBI, dl, TII.get(ORIInstr), TmpReg)
+ .addReg(TmpReg, RegState::Kill)
+ .addImm(CalleeAmt & 0xFFFF);
+ BuildMI(MBB, MBBI, dl, TII.get(ADDInstr), StackReg)
+ .addReg(StackReg, RegState::Kill)
+ .addReg(TmpReg);
+ }
+ }
+ }
+ // Simply discard ADJCALLSTACKDOWN, ADJCALLSTACKUP instructions.
+ MBB.erase(I);
+}
+
+bool
+PPCFrameLowering::restoreCalleeSavedRegisters(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI,
+ const std::vector<CalleeSavedInfo> &CSI,
+ const TargetRegisterInfo *TRI) const {
+
+ // Currently, this function only handles SVR4 32- and 64-bit ABIs.
+ // Return false otherwise to maintain pre-existing behavior.
+ if (!Subtarget.isSVR4ABI())
+ return false;
+
+ MachineFunction *MF = MBB.getParent();
+ const PPCInstrInfo &TII =
+ *static_cast<const PPCInstrInfo*>(MF->getTarget().getInstrInfo());
+ bool CR2Spilled = false;
+ bool CR3Spilled = false;
+ bool CR4Spilled = false;
+ unsigned CSIIndex = 0;
+
+ // Initialize insertion-point logic; we will be restoring in reverse
+ // order of spill.
+ MachineBasicBlock::iterator I = MI, BeforeI = I;
+ bool AtStart = I == MBB.begin();
+
+ if (!AtStart)
+ --BeforeI;
+
+ for (unsigned i = 0, e = CSI.size(); i != e; ++i) {
+ unsigned Reg = CSI[i].getReg();
+
+ if (Reg == PPC::CR2) {
+ CR2Spilled = true;
+ // The spill slot is associated only with CR2, which is the
+ // first nonvolatile spilled. Save it here.
+ CSIIndex = i;
+ continue;
+ } else if (Reg == PPC::CR3) {
+ CR3Spilled = true;
+ continue;
+ } else if (Reg == PPC::CR4) {
+ CR4Spilled = true;
+ continue;
+ } else {
+ // When we first encounter a non-CR register after seeing at
+ // least one CR register, restore all spilled CRs together.
+ if ((CR2Spilled || CR3Spilled || CR4Spilled)
+ && !(PPC::CR2 <= Reg && Reg <= PPC::CR4)) {
+ restoreCRs(Subtarget.isPPC64(), CR2Spilled, CR3Spilled, CR4Spilled,
+ MBB, I, CSI, CSIIndex);
+ CR2Spilled = CR3Spilled = CR4Spilled = false;
+ }
+
+ // Default behavior for non-CR saves.
+ const TargetRegisterClass *RC = TRI->getMinimalPhysRegClass(Reg);
+ TII.loadRegFromStackSlot(MBB, I, Reg, CSI[i].getFrameIdx(),
+ RC, TRI);
+ assert(I != MBB.begin() &&
+ "loadRegFromStackSlot didn't insert any code!");
+ }
+
+ // Insert in reverse order.
+ if (AtStart)
+ I = MBB.begin();
+ else {
+ I = BeforeI;
+ ++I;
+ }
+ }
+
+ // If we haven't yet spilled the CRs, do so now.
+ if (CR2Spilled || CR3Spilled || CR4Spilled)
+ restoreCRs(Subtarget.isPPC64(), CR2Spilled, CR3Spilled, CR4Spilled,
+ MBB, I, CSI, CSIIndex);
+
+ return true;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.h b/contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.h
new file mode 100644
index 0000000..6f5f936
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCFrameLowering.h
@@ -0,0 +1,293 @@
+//===-- PPCFrameLowering.h - Define frame lowering for PowerPC --*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPC_FRAMEINFO_H
+#define POWERPC_FRAMEINFO_H
+
+#include "PPC.h"
+#include "PPCSubtarget.h"
+#include "llvm/ADT/STLExtras.h"
+#include "llvm/Target/TargetFrameLowering.h"
+#include "llvm/Target/TargetMachine.h"
+
+namespace llvm {
+ class PPCSubtarget;
+
+class PPCFrameLowering: public TargetFrameLowering {
+ const PPCSubtarget &Subtarget;
+
+public:
+ PPCFrameLowering(const PPCSubtarget &sti)
+ : TargetFrameLowering(TargetFrameLowering::StackGrowsDown,
+ (sti.hasQPX() || sti.isBGQ()) ? 32 : 16, 0),
+ Subtarget(sti) {
+ }
+
+ unsigned determineFrameLayout(MachineFunction &MF,
+ bool UpdateMF = true,
+ bool UseEstimate = false) const;
+
+ /// emitProlog/emitEpilog - These methods insert prolog and epilog code into
+ /// the function.
+ void emitPrologue(MachineFunction &MF) const;
+ void emitEpilogue(MachineFunction &MF, MachineBasicBlock &MBB) const;
+
+ bool hasFP(const MachineFunction &MF) const;
+ bool needsFP(const MachineFunction &MF) const;
+ void replaceFPWithRealFP(MachineFunction &MF) const;
+
+ void processFunctionBeforeCalleeSavedScan(MachineFunction &MF,
+ RegScavenger *RS = NULL) const;
+ void processFunctionBeforeFrameFinalized(MachineFunction &MF,
+ RegScavenger *RS = NULL) const;
+ void addScavengingSpillSlot(MachineFunction &MF, RegScavenger *RS) const;
+
+ bool spillCalleeSavedRegisters(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI,
+ const std::vector<CalleeSavedInfo> &CSI,
+ const TargetRegisterInfo *TRI) const;
+
+ void eliminateCallFramePseudoInstr(MachineFunction &MF,
+ MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator I) const;
+
+ bool restoreCalleeSavedRegisters(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI,
+ const std::vector<CalleeSavedInfo> &CSI,
+ const TargetRegisterInfo *TRI) const;
+
+ /// targetHandlesStackFrameRounding - Returns true if the target is
+ /// responsible for rounding up the stack frame (probably at emitPrologue
+ /// time).
+ bool targetHandlesStackFrameRounding() const { return true; }
+
+ /// getReturnSaveOffset - Return the previous frame offset to save the
+ /// return address.
+ static unsigned getReturnSaveOffset(bool isPPC64, bool isDarwinABI) {
+ if (isDarwinABI)
+ return isPPC64 ? 16 : 8;
+ // SVR4 ABI:
+ return isPPC64 ? 16 : 4;
+ }
+
+ /// getFramePointerSaveOffset - Return the previous frame offset to save the
+ /// frame pointer.
+ static unsigned getFramePointerSaveOffset(bool isPPC64, bool isDarwinABI) {
+ // For the Darwin ABI:
+ // We cannot use the TOC save slot (offset +20) in the PowerPC linkage area
+ // for saving the frame pointer (if needed.) While the published ABI has
+ // not used this slot since at least MacOSX 10.2, there is older code
+ // around that does use it, and that needs to continue to work.
+ if (isDarwinABI)
+ return isPPC64 ? -8U : -4U;
+
+ // SVR4 ABI: First slot in the general register save area.
+ return isPPC64 ? -8U : -4U;
+ }
+
+ /// getLinkageSize - Return the size of the PowerPC ABI linkage area.
+ ///
+ static unsigned getLinkageSize(bool isPPC64, bool isDarwinABI) {
+ if (isDarwinABI || isPPC64)
+ return 6 * (isPPC64 ? 8 : 4);
+
+ // SVR4 ABI:
+ return 8;
+ }
+
+ /// getMinCallArgumentsSize - Return the size of the minium PowerPC ABI
+ /// argument area.
+ static unsigned getMinCallArgumentsSize(bool isPPC64, bool isDarwinABI) {
+ // For the Darwin ABI / 64-bit SVR4 ABI:
+ // The prolog code of the callee may store up to 8 GPR argument registers to
+ // the stack, allowing va_start to index over them in memory if its varargs.
+ // Because we cannot tell if this is needed on the caller side, we have to
+ // conservatively assume that it is needed. As such, make sure we have at
+ // least enough stack space for the caller to store the 8 GPRs.
+ if (isDarwinABI || isPPC64)
+ return 8 * (isPPC64 ? 8 : 4);
+
+ // 32-bit SVR4 ABI:
+ // There is no default stack allocated for the 8 first GPR arguments.
+ return 0;
+ }
+
+ /// getMinCallFrameSize - Return the minimum size a call frame can be using
+ /// the PowerPC ABI.
+ static unsigned getMinCallFrameSize(bool isPPC64, bool isDarwinABI) {
+ // The call frame needs to be at least big enough for linkage and 8 args.
+ return getLinkageSize(isPPC64, isDarwinABI) +
+ getMinCallArgumentsSize(isPPC64, isDarwinABI);
+ }
+
+ // With the SVR4 ABI, callee-saved registers have fixed offsets on the stack.
+ const SpillSlot *
+ getCalleeSavedSpillSlots(unsigned &NumEntries) const {
+ if (Subtarget.isDarwinABI()) {
+ NumEntries = 1;
+ if (Subtarget.isPPC64()) {
+ static const SpillSlot darwin64Offsets = {PPC::X31, -8};
+ return &darwin64Offsets;
+ } else {
+ static const SpillSlot darwinOffsets = {PPC::R31, -4};
+ return &darwinOffsets;
+ }
+ }
+
+ // Early exit if not using the SVR4 ABI.
+ if (!Subtarget.isSVR4ABI()) {
+ NumEntries = 0;
+ return 0;
+ }
+
+ // Note that the offsets here overlap, but this is fixed up in
+ // processFunctionBeforeFrameFinalized.
+
+ static const SpillSlot Offsets[] = {
+ // Floating-point register save area offsets.
+ {PPC::F31, -8},
+ {PPC::F30, -16},
+ {PPC::F29, -24},
+ {PPC::F28, -32},
+ {PPC::F27, -40},
+ {PPC::F26, -48},
+ {PPC::F25, -56},
+ {PPC::F24, -64},
+ {PPC::F23, -72},
+ {PPC::F22, -80},
+ {PPC::F21, -88},
+ {PPC::F20, -96},
+ {PPC::F19, -104},
+ {PPC::F18, -112},
+ {PPC::F17, -120},
+ {PPC::F16, -128},
+ {PPC::F15, -136},
+ {PPC::F14, -144},
+
+ // General register save area offsets.
+ {PPC::R31, -4},
+ {PPC::R30, -8},
+ {PPC::R29, -12},
+ {PPC::R28, -16},
+ {PPC::R27, -20},
+ {PPC::R26, -24},
+ {PPC::R25, -28},
+ {PPC::R24, -32},
+ {PPC::R23, -36},
+ {PPC::R22, -40},
+ {PPC::R21, -44},
+ {PPC::R20, -48},
+ {PPC::R19, -52},
+ {PPC::R18, -56},
+ {PPC::R17, -60},
+ {PPC::R16, -64},
+ {PPC::R15, -68},
+ {PPC::R14, -72},
+
+ // CR save area offset. We map each of the nonvolatile CR fields
+ // to the slot for CR2, which is the first of the nonvolatile CR
+ // fields to be assigned, so that we only allocate one save slot.
+ // See PPCRegisterInfo::hasReservedSpillSlot() for more information.
+ {PPC::CR2, -4},
+
+ // VRSAVE save area offset.
+ {PPC::VRSAVE, -4},
+
+ // Vector register save area
+ {PPC::V31, -16},
+ {PPC::V30, -32},
+ {PPC::V29, -48},
+ {PPC::V28, -64},
+ {PPC::V27, -80},
+ {PPC::V26, -96},
+ {PPC::V25, -112},
+ {PPC::V24, -128},
+ {PPC::V23, -144},
+ {PPC::V22, -160},
+ {PPC::V21, -176},
+ {PPC::V20, -192}
+ };
+
+ static const SpillSlot Offsets64[] = {
+ // Floating-point register save area offsets.
+ {PPC::F31, -8},
+ {PPC::F30, -16},
+ {PPC::F29, -24},
+ {PPC::F28, -32},
+ {PPC::F27, -40},
+ {PPC::F26, -48},
+ {PPC::F25, -56},
+ {PPC::F24, -64},
+ {PPC::F23, -72},
+ {PPC::F22, -80},
+ {PPC::F21, -88},
+ {PPC::F20, -96},
+ {PPC::F19, -104},
+ {PPC::F18, -112},
+ {PPC::F17, -120},
+ {PPC::F16, -128},
+ {PPC::F15, -136},
+ {PPC::F14, -144},
+
+ // General register save area offsets.
+ {PPC::X31, -8},
+ {PPC::X30, -16},
+ {PPC::X29, -24},
+ {PPC::X28, -32},
+ {PPC::X27, -40},
+ {PPC::X26, -48},
+ {PPC::X25, -56},
+ {PPC::X24, -64},
+ {PPC::X23, -72},
+ {PPC::X22, -80},
+ {PPC::X21, -88},
+ {PPC::X20, -96},
+ {PPC::X19, -104},
+ {PPC::X18, -112},
+ {PPC::X17, -120},
+ {PPC::X16, -128},
+ {PPC::X15, -136},
+ {PPC::X14, -144},
+
+ // VRSAVE save area offset.
+ {PPC::VRSAVE, -4},
+
+ // Vector register save area
+ {PPC::V31, -16},
+ {PPC::V30, -32},
+ {PPC::V29, -48},
+ {PPC::V28, -64},
+ {PPC::V27, -80},
+ {PPC::V26, -96},
+ {PPC::V25, -112},
+ {PPC::V24, -128},
+ {PPC::V23, -144},
+ {PPC::V22, -160},
+ {PPC::V21, -176},
+ {PPC::V20, -192}
+ };
+
+ if (Subtarget.isPPC64()) {
+ NumEntries = array_lengthof(Offsets64);
+
+ return Offsets64;
+ } else {
+ NumEntries = array_lengthof(Offsets);
+
+ return Offsets;
+ }
+ }
+};
+
+} // End llvm namespace
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.cpp b/contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.cpp
new file mode 100644
index 0000000..4bf1e33
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.cpp
@@ -0,0 +1,245 @@
+//===-- PPCHazardRecognizers.cpp - PowerPC Hazard Recognizer Impls --------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements hazard recognizers for scheduling on PowerPC processors.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "pre-RA-sched"
+#include "PPCHazardRecognizers.h"
+#include "PPC.h"
+#include "PPCInstrInfo.h"
+#include "llvm/CodeGen/ScheduleDAG.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/raw_ostream.h"
+using namespace llvm;
+
+//===----------------------------------------------------------------------===//
+// PowerPC Scoreboard Hazard Recognizer
+void PPCScoreboardHazardRecognizer::EmitInstruction(SUnit *SU) {
+ const MCInstrDesc *MCID = DAG->getInstrDesc(SU);
+ if (!MCID)
+ // This is a PPC pseudo-instruction.
+ return;
+
+ ScoreboardHazardRecognizer::EmitInstruction(SU);
+}
+
+ScheduleHazardRecognizer::HazardType
+PPCScoreboardHazardRecognizer::getHazardType(SUnit *SU, int Stalls) {
+ return ScoreboardHazardRecognizer::getHazardType(SU, Stalls);
+}
+
+void PPCScoreboardHazardRecognizer::AdvanceCycle() {
+ ScoreboardHazardRecognizer::AdvanceCycle();
+}
+
+void PPCScoreboardHazardRecognizer::Reset() {
+ ScoreboardHazardRecognizer::Reset();
+}
+
+//===----------------------------------------------------------------------===//
+// PowerPC 970 Hazard Recognizer
+//
+// This models the dispatch group formation of the PPC970 processor. Dispatch
+// groups are bundles of up to five instructions that can contain various mixes
+// of instructions. The PPC970 can dispatch a peak of 4 non-branch and one
+// branch instruction per-cycle.
+//
+// There are a number of restrictions to dispatch group formation: some
+// instructions can only be issued in the first slot of a dispatch group, & some
+// instructions fill an entire dispatch group. Additionally, only branches can
+// issue in the 5th (last) slot.
+//
+// Finally, there are a number of "structural" hazards on the PPC970. These
+// conditions cause large performance penalties due to misprediction, recovery,
+// and replay logic that has to happen. These cases include setting a CTR and
+// branching through it in the same dispatch group, and storing to an address,
+// then loading from the same address within a dispatch group. To avoid these
+// conditions, we insert no-op instructions when appropriate.
+//
+// FIXME: This is missing some significant cases:
+// 1. Modeling of microcoded instructions.
+// 2. Handling of serialized operations.
+// 3. Handling of the esoteric cases in "Resource-based Instruction Grouping".
+//
+
+PPCHazardRecognizer970::PPCHazardRecognizer970(const TargetInstrInfo &tii)
+ : TII(tii) {
+ EndDispatchGroup();
+}
+
+void PPCHazardRecognizer970::EndDispatchGroup() {
+ DEBUG(errs() << "=== Start of dispatch group\n");
+ NumIssued = 0;
+
+ // Structural hazard info.
+ HasCTRSet = false;
+ NumStores = 0;
+}
+
+
+PPCII::PPC970_Unit
+PPCHazardRecognizer970::GetInstrType(unsigned Opcode,
+ bool &isFirst, bool &isSingle,
+ bool &isCracked,
+ bool &isLoad, bool &isStore) {
+ const MCInstrDesc &MCID = TII.get(Opcode);
+
+ isLoad = MCID.mayLoad();
+ isStore = MCID.mayStore();
+
+ uint64_t TSFlags = MCID.TSFlags;
+
+ isFirst = TSFlags & PPCII::PPC970_First;
+ isSingle = TSFlags & PPCII::PPC970_Single;
+ isCracked = TSFlags & PPCII::PPC970_Cracked;
+ return (PPCII::PPC970_Unit)(TSFlags & PPCII::PPC970_Mask);
+}
+
+/// isLoadOfStoredAddress - If we have a load from the previously stored pointer
+/// as indicated by StorePtr1/StorePtr2/StoreSize, return true.
+bool PPCHazardRecognizer970::
+isLoadOfStoredAddress(uint64_t LoadSize, int64_t LoadOffset,
+ const Value *LoadValue) const {
+ for (unsigned i = 0, e = NumStores; i != e; ++i) {
+ // Handle exact and commuted addresses.
+ if (LoadValue == StoreValue[i] && LoadOffset == StoreOffset[i])
+ return true;
+
+ // Okay, we don't have an exact match, if this is an indexed offset, see if
+ // we have overlap (which happens during fp->int conversion for example).
+ if (StoreValue[i] == LoadValue) {
+ // Okay the base pointers match, so we have [c1+r] vs [c2+r]. Check
+ // to see if the load and store actually overlap.
+ if (StoreOffset[i] < LoadOffset) {
+ if (int64_t(StoreOffset[i]+StoreSize[i]) > LoadOffset) return true;
+ } else {
+ if (int64_t(LoadOffset+LoadSize) > StoreOffset[i]) return true;
+ }
+ }
+ }
+ return false;
+}
+
+/// getHazardType - We return hazard for any non-branch instruction that would
+/// terminate the dispatch group. We turn NoopHazard for any
+/// instructions that wouldn't terminate the dispatch group that would cause a
+/// pipeline flush.
+ScheduleHazardRecognizer::HazardType PPCHazardRecognizer970::
+getHazardType(SUnit *SU, int Stalls) {
+ assert(Stalls == 0 && "PPC hazards don't support scoreboard lookahead");
+
+ MachineInstr *MI = SU->getInstr();
+
+ if (MI->isDebugValue())
+ return NoHazard;
+
+ unsigned Opcode = MI->getOpcode();
+ bool isFirst, isSingle, isCracked, isLoad, isStore;
+ PPCII::PPC970_Unit InstrType =
+ GetInstrType(Opcode, isFirst, isSingle, isCracked,
+ isLoad, isStore);
+ if (InstrType == PPCII::PPC970_Pseudo) return NoHazard;
+
+ // We can only issue a PPC970_First/PPC970_Single instruction (such as
+ // crand/mtspr/etc) if this is the first cycle of the dispatch group.
+ if (NumIssued != 0 && (isFirst || isSingle))
+ return Hazard;
+
+ // If this instruction is cracked into two ops by the decoder, we know that
+ // it is not a branch and that it cannot issue if 3 other instructions are
+ // already in the dispatch group.
+ if (isCracked && NumIssued > 2)
+ return Hazard;
+
+ switch (InstrType) {
+ default: llvm_unreachable("Unknown instruction type!");
+ case PPCII::PPC970_FXU:
+ case PPCII::PPC970_LSU:
+ case PPCII::PPC970_FPU:
+ case PPCII::PPC970_VALU:
+ case PPCII::PPC970_VPERM:
+ // We can only issue a branch as the last instruction in a group.
+ if (NumIssued == 4) return Hazard;
+ break;
+ case PPCII::PPC970_CRU:
+ // We can only issue a CR instruction in the first two slots.
+ if (NumIssued >= 2) return Hazard;
+ break;
+ case PPCII::PPC970_BRU:
+ break;
+ }
+
+ // Do not allow MTCTR and BCTRL to be in the same dispatch group.
+ if (HasCTRSet && Opcode == PPC::BCTRL)
+ return NoopHazard;
+
+ // If this is a load following a store, make sure it's not to the same or
+ // overlapping address.
+ if (isLoad && NumStores && !MI->memoperands_empty()) {
+ MachineMemOperand *MO = *MI->memoperands_begin();
+ if (isLoadOfStoredAddress(MO->getSize(),
+ MO->getOffset(), MO->getValue()))
+ return NoopHazard;
+ }
+
+ return NoHazard;
+}
+
+void PPCHazardRecognizer970::EmitInstruction(SUnit *SU) {
+ MachineInstr *MI = SU->getInstr();
+
+ if (MI->isDebugValue())
+ return;
+
+ unsigned Opcode = MI->getOpcode();
+ bool isFirst, isSingle, isCracked, isLoad, isStore;
+ PPCII::PPC970_Unit InstrType =
+ GetInstrType(Opcode, isFirst, isSingle, isCracked,
+ isLoad, isStore);
+ if (InstrType == PPCII::PPC970_Pseudo) return;
+
+ // Update structural hazard information.
+ if (Opcode == PPC::MTCTR || Opcode == PPC::MTCTR8) HasCTRSet = true;
+
+ // Track the address stored to.
+ if (isStore && NumStores < 4 && !MI->memoperands_empty()) {
+ MachineMemOperand *MO = *MI->memoperands_begin();
+ StoreSize[NumStores] = MO->getSize();
+ StoreOffset[NumStores] = MO->getOffset();
+ StoreValue[NumStores] = MO->getValue();
+ ++NumStores;
+ }
+
+ if (InstrType == PPCII::PPC970_BRU || isSingle)
+ NumIssued = 4; // Terminate a d-group.
+ ++NumIssued;
+
+ // If this instruction is cracked into two ops by the decoder, remember that
+ // we issued two pieces.
+ if (isCracked)
+ ++NumIssued;
+
+ if (NumIssued == 5)
+ EndDispatchGroup();
+}
+
+void PPCHazardRecognizer970::AdvanceCycle() {
+ assert(NumIssued < 5 && "Illegal dispatch group!");
+ ++NumIssued;
+ if (NumIssued == 5)
+ EndDispatchGroup();
+}
+
+void PPCHazardRecognizer970::Reset() {
+ EndDispatchGroup();
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.h b/contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.h
new file mode 100644
index 0000000..55b45d0
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCHazardRecognizers.h
@@ -0,0 +1,91 @@
+//===-- PPCHazardRecognizers.h - PowerPC Hazard Recognizers -----*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines hazard recognizers for scheduling on PowerPC processors.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPCHAZRECS_H
+#define PPCHAZRECS_H
+
+#include "PPCInstrInfo.h"
+#include "llvm/CodeGen/ScheduleHazardRecognizer.h"
+#include "llvm/CodeGen/ScoreboardHazardRecognizer.h"
+#include "llvm/CodeGen/SelectionDAGNodes.h"
+
+namespace llvm {
+
+/// PPCScoreboardHazardRecognizer - This class implements a scoreboard-based
+/// hazard recognizer for generic PPC processors.
+class PPCScoreboardHazardRecognizer : public ScoreboardHazardRecognizer {
+ const ScheduleDAG *DAG;
+public:
+ PPCScoreboardHazardRecognizer(const InstrItineraryData *ItinData,
+ const ScheduleDAG *DAG_) :
+ ScoreboardHazardRecognizer(ItinData, DAG_), DAG(DAG_) {}
+
+ virtual HazardType getHazardType(SUnit *SU, int Stalls);
+ virtual void EmitInstruction(SUnit *SU);
+ virtual void AdvanceCycle();
+ virtual void Reset();
+};
+
+/// PPCHazardRecognizer970 - This class defines a finite state automata that
+/// models the dispatch logic on the PowerPC 970 (aka G5) processor. This
+/// promotes good dispatch group formation and implements noop insertion to
+/// avoid structural hazards that cause significant performance penalties (e.g.
+/// setting the CTR register then branching through it within a dispatch group),
+/// or storing then loading from the same address within a dispatch group.
+class PPCHazardRecognizer970 : public ScheduleHazardRecognizer {
+ const TargetInstrInfo &TII;
+
+ unsigned NumIssued; // Number of insts issued, including advanced cycles.
+
+ // Various things that can cause a structural hazard.
+
+ // HasCTRSet - If the CTR register is set in this group, disallow BCTRL.
+ bool HasCTRSet;
+
+ // StoredPtr - Keep track of the address of any store. If we see a load from
+ // the same address (or one that aliases it), disallow the store. We can have
+ // up to four stores in one dispatch group, hence we track up to 4.
+ //
+ // This is null if we haven't seen a store yet. We keep track of both
+ // operands of the store here, since we support [r+r] and [r+i] addressing.
+ const Value *StoreValue[4];
+ int64_t StoreOffset[4];
+ uint64_t StoreSize[4];
+ unsigned NumStores;
+
+public:
+ PPCHazardRecognizer970(const TargetInstrInfo &TII);
+ virtual HazardType getHazardType(SUnit *SU, int Stalls);
+ virtual void EmitInstruction(SUnit *SU);
+ virtual void AdvanceCycle();
+ virtual void Reset();
+
+private:
+ /// EndDispatchGroup - Called when we are finishing a new dispatch group.
+ ///
+ void EndDispatchGroup();
+
+ /// GetInstrType - Classify the specified powerpc opcode according to its
+ /// pipeline.
+ PPCII::PPC970_Unit GetInstrType(unsigned Opcode,
+ bool &isFirst, bool &isSingle,bool &isCracked,
+ bool &isLoad, bool &isStore);
+
+ bool isLoadOfStoredAddress(uint64_t LoadSize, int64_t LoadOffset,
+ const Value *LoadValue) const;
+};
+
+} // end namespace llvm
+
+#endif
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCISelDAGToDAG.cpp b/contrib/llvm/lib/Target/PowerPC/PPCISelDAGToDAG.cpp
new file mode 100644
index 0000000..95efc11
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCISelDAGToDAG.cpp
@@ -0,0 +1,1565 @@
+//===-- PPCISelDAGToDAG.cpp - PPC --pattern matching inst selector --------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines a pattern matching instruction selector for PowerPC,
+// converting from a legalized dag to a PPC dag.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "ppc-codegen"
+#include "PPC.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "PPCTargetMachine.h"
+#include "llvm/CodeGen/MachineFunction.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineRegisterInfo.h"
+#include "llvm/CodeGen/SelectionDAG.h"
+#include "llvm/CodeGen/SelectionDAGISel.h"
+#include "llvm/IR/Constants.h"
+#include "llvm/IR/Function.h"
+#include "llvm/IR/GlobalAlias.h"
+#include "llvm/IR/GlobalValue.h"
+#include "llvm/IR/GlobalVariable.h"
+#include "llvm/IR/Intrinsics.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/MathExtras.h"
+#include "llvm/Support/raw_ostream.h"
+#include "llvm/Target/TargetOptions.h"
+using namespace llvm;
+
+namespace llvm {
+ void initializePPCDAGToDAGISelPass(PassRegistry&);
+}
+
+namespace {
+ //===--------------------------------------------------------------------===//
+ /// PPCDAGToDAGISel - PPC specific code to select PPC machine
+ /// instructions for SelectionDAG operations.
+ ///
+ class PPCDAGToDAGISel : public SelectionDAGISel {
+ const PPCTargetMachine &TM;
+ const PPCTargetLowering &PPCLowering;
+ const PPCSubtarget &PPCSubTarget;
+ unsigned GlobalBaseReg;
+ public:
+ explicit PPCDAGToDAGISel(PPCTargetMachine &tm)
+ : SelectionDAGISel(tm), TM(tm),
+ PPCLowering(*TM.getTargetLowering()),
+ PPCSubTarget(*TM.getSubtargetImpl()) {
+ initializePPCDAGToDAGISelPass(*PassRegistry::getPassRegistry());
+ }
+
+ virtual bool runOnMachineFunction(MachineFunction &MF) {
+ // Make sure we re-emit a set of the global base reg if necessary
+ GlobalBaseReg = 0;
+ SelectionDAGISel::runOnMachineFunction(MF);
+
+ if (!PPCSubTarget.isSVR4ABI())
+ InsertVRSaveCode(MF);
+
+ return true;
+ }
+
+ virtual void PostprocessISelDAG();
+
+ /// getI32Imm - Return a target constant with the specified value, of type
+ /// i32.
+ inline SDValue getI32Imm(unsigned Imm) {
+ return CurDAG->getTargetConstant(Imm, MVT::i32);
+ }
+
+ /// getI64Imm - Return a target constant with the specified value, of type
+ /// i64.
+ inline SDValue getI64Imm(uint64_t Imm) {
+ return CurDAG->getTargetConstant(Imm, MVT::i64);
+ }
+
+ /// getSmallIPtrImm - Return a target constant of pointer type.
+ inline SDValue getSmallIPtrImm(unsigned Imm) {
+ return CurDAG->getTargetConstant(Imm, PPCLowering.getPointerTy());
+ }
+
+ /// isRunOfOnes - Returns true iff Val consists of one contiguous run of 1s
+ /// with any number of 0s on either side. The 1s are allowed to wrap from
+ /// LSB to MSB, so 0x000FFF0, 0x0000FFFF, and 0xFF0000FF are all runs.
+ /// 0x0F0F0000 is not, since all 1s are not contiguous.
+ static bool isRunOfOnes(unsigned Val, unsigned &MB, unsigned &ME);
+
+
+ /// isRotateAndMask - Returns true if Mask and Shift can be folded into a
+ /// rotate and mask opcode and mask operation.
+ static bool isRotateAndMask(SDNode *N, unsigned Mask, bool isShiftMask,
+ unsigned &SH, unsigned &MB, unsigned &ME);
+
+ /// getGlobalBaseReg - insert code into the entry mbb to materialize the PIC
+ /// base register. Return the virtual register that holds this value.
+ SDNode *getGlobalBaseReg();
+
+ // Select - Convert the specified operand from a target-independent to a
+ // target-specific node if it hasn't already been changed.
+ SDNode *Select(SDNode *N);
+
+ SDNode *SelectBitfieldInsert(SDNode *N);
+
+ /// SelectCC - Select a comparison of the specified values with the
+ /// specified condition code, returning the CR# of the expression.
+ SDValue SelectCC(SDValue LHS, SDValue RHS, ISD::CondCode CC, DebugLoc dl);
+
+ /// SelectAddrImm - Returns true if the address N can be represented by
+ /// a base register plus a signed 16-bit displacement [r+imm].
+ bool SelectAddrImm(SDValue N, SDValue &Disp,
+ SDValue &Base) {
+ return PPCLowering.SelectAddressRegImm(N, Disp, Base, *CurDAG);
+ }
+
+ /// SelectAddrImmOffs - Return true if the operand is valid for a preinc
+ /// immediate field. Note that the operand at this point is already the
+ /// result of a prior SelectAddressRegImm call.
+ bool SelectAddrImmOffs(SDValue N, SDValue &Out) const {
+ if (N.getOpcode() == ISD::TargetConstant ||
+ N.getOpcode() == ISD::TargetGlobalAddress) {
+ Out = N;
+ return true;
+ }
+
+ return false;
+ }
+
+ /// SelectAddrIdx - Given the specified addressed, check to see if it can be
+ /// represented as an indexed [r+r] operation. Returns false if it can
+ /// be represented by [r+imm], which are preferred.
+ bool SelectAddrIdx(SDValue N, SDValue &Base, SDValue &Index) {
+ return PPCLowering.SelectAddressRegReg(N, Base, Index, *CurDAG);
+ }
+
+ /// SelectAddrIdxOnly - Given the specified addressed, force it to be
+ /// represented as an indexed [r+r] operation.
+ bool SelectAddrIdxOnly(SDValue N, SDValue &Base, SDValue &Index) {
+ return PPCLowering.SelectAddressRegRegOnly(N, Base, Index, *CurDAG);
+ }
+
+ /// SelectAddrImmShift - Returns true if the address N can be represented by
+ /// a base register plus a signed 14-bit displacement [r+imm*4]. Suitable
+ /// for use by STD and friends.
+ bool SelectAddrImmShift(SDValue N, SDValue &Disp, SDValue &Base) {
+ return PPCLowering.SelectAddressRegImmShift(N, Disp, Base, *CurDAG);
+ }
+
+ // Select an address into a single register.
+ bool SelectAddr(SDValue N, SDValue &Base) {
+ Base = N;
+ return true;
+ }
+
+ /// SelectInlineAsmMemoryOperand - Implement addressing mode selection for
+ /// inline asm expressions. It is always correct to compute the value into
+ /// a register. The case of adding a (possibly relocatable) constant to a
+ /// register can be improved, but it is wrong to substitute Reg+Reg for
+ /// Reg in an asm, because the load or store opcode would have to change.
+ virtual bool SelectInlineAsmMemoryOperand(const SDValue &Op,
+ char ConstraintCode,
+ std::vector<SDValue> &OutOps) {
+ OutOps.push_back(Op);
+ return false;
+ }
+
+ void InsertVRSaveCode(MachineFunction &MF);
+
+ virtual const char *getPassName() const {
+ return "PowerPC DAG->DAG Pattern Instruction Selection";
+ }
+
+// Include the pieces autogenerated from the target description.
+#include "PPCGenDAGISel.inc"
+
+private:
+ SDNode *SelectSETCC(SDNode *N);
+ };
+}
+
+/// InsertVRSaveCode - Once the entire function has been instruction selected,
+/// all virtual registers are created and all machine instructions are built,
+/// check to see if we need to save/restore VRSAVE. If so, do it.
+void PPCDAGToDAGISel::InsertVRSaveCode(MachineFunction &Fn) {
+ // Check to see if this function uses vector registers, which means we have to
+ // save and restore the VRSAVE register and update it with the regs we use.
+ //
+ // In this case, there will be virtual registers of vector type created
+ // by the scheduler. Detect them now.
+ bool HasVectorVReg = false;
+ for (unsigned i = 0, e = RegInfo->getNumVirtRegs(); i != e; ++i) {
+ unsigned Reg = TargetRegisterInfo::index2VirtReg(i);
+ if (RegInfo->getRegClass(Reg) == &PPC::VRRCRegClass) {
+ HasVectorVReg = true;
+ break;
+ }
+ }
+ if (!HasVectorVReg) return; // nothing to do.
+
+ // If we have a vector register, we want to emit code into the entry and exit
+ // blocks to save and restore the VRSAVE register. We do this here (instead
+ // of marking all vector instructions as clobbering VRSAVE) for two reasons:
+ //
+ // 1. This (trivially) reduces the load on the register allocator, by not
+ // having to represent the live range of the VRSAVE register.
+ // 2. This (more significantly) allows us to create a temporary virtual
+ // register to hold the saved VRSAVE value, allowing this temporary to be
+ // register allocated, instead of forcing it to be spilled to the stack.
+
+ // Create two vregs - one to hold the VRSAVE register that is live-in to the
+ // function and one for the value after having bits or'd into it.
+ unsigned InVRSAVE = RegInfo->createVirtualRegister(&PPC::GPRCRegClass);
+ unsigned UpdatedVRSAVE = RegInfo->createVirtualRegister(&PPC::GPRCRegClass);
+
+ const TargetInstrInfo &TII = *TM.getInstrInfo();
+ MachineBasicBlock &EntryBB = *Fn.begin();
+ DebugLoc dl;
+ // Emit the following code into the entry block:
+ // InVRSAVE = MFVRSAVE
+ // UpdatedVRSAVE = UPDATE_VRSAVE InVRSAVE
+ // MTVRSAVE UpdatedVRSAVE
+ MachineBasicBlock::iterator IP = EntryBB.begin(); // Insert Point
+ BuildMI(EntryBB, IP, dl, TII.get(PPC::MFVRSAVE), InVRSAVE);
+ BuildMI(EntryBB, IP, dl, TII.get(PPC::UPDATE_VRSAVE),
+ UpdatedVRSAVE).addReg(InVRSAVE);
+ BuildMI(EntryBB, IP, dl, TII.get(PPC::MTVRSAVE)).addReg(UpdatedVRSAVE);
+
+ // Find all return blocks, outputting a restore in each epilog.
+ for (MachineFunction::iterator BB = Fn.begin(), E = Fn.end(); BB != E; ++BB) {
+ if (!BB->empty() && BB->back().isReturn()) {
+ IP = BB->end(); --IP;
+
+ // Skip over all terminator instructions, which are part of the return
+ // sequence.
+ MachineBasicBlock::iterator I2 = IP;
+ while (I2 != BB->begin() && (--I2)->isTerminator())
+ IP = I2;
+
+ // Emit: MTVRSAVE InVRSave
+ BuildMI(*BB, IP, dl, TII.get(PPC::MTVRSAVE)).addReg(InVRSAVE);
+ }
+ }
+}
+
+
+/// getGlobalBaseReg - Output the instructions required to put the
+/// base address to use for accessing globals into a register.
+///
+SDNode *PPCDAGToDAGISel::getGlobalBaseReg() {
+ if (!GlobalBaseReg) {
+ const TargetInstrInfo &TII = *TM.getInstrInfo();
+ // Insert the set of GlobalBaseReg into the first MBB of the function
+ MachineBasicBlock &FirstMBB = MF->front();
+ MachineBasicBlock::iterator MBBI = FirstMBB.begin();
+ DebugLoc dl;
+
+ if (PPCLowering.getPointerTy() == MVT::i32) {
+ GlobalBaseReg = RegInfo->createVirtualRegister(&PPC::GPRCRegClass);
+ BuildMI(FirstMBB, MBBI, dl, TII.get(PPC::MovePCtoLR));
+ BuildMI(FirstMBB, MBBI, dl, TII.get(PPC::MFLR), GlobalBaseReg);
+ } else {
+ GlobalBaseReg = RegInfo->createVirtualRegister(&PPC::G8RCRegClass);
+ BuildMI(FirstMBB, MBBI, dl, TII.get(PPC::MovePCtoLR8));
+ BuildMI(FirstMBB, MBBI, dl, TII.get(PPC::MFLR8), GlobalBaseReg);
+ }
+ }
+ return CurDAG->getRegister(GlobalBaseReg,
+ PPCLowering.getPointerTy()).getNode();
+}
+
+/// isIntS16Immediate - This method tests to see if the node is either a 32-bit
+/// or 64-bit immediate, and if the value can be accurately represented as a
+/// sign extension from a 16-bit value. If so, this returns true and the
+/// immediate.
+static bool isIntS16Immediate(SDNode *N, short &Imm) {
+ if (N->getOpcode() != ISD::Constant)
+ return false;
+
+ Imm = (short)cast<ConstantSDNode>(N)->getZExtValue();
+ if (N->getValueType(0) == MVT::i32)
+ return Imm == (int32_t)cast<ConstantSDNode>(N)->getZExtValue();
+ else
+ return Imm == (int64_t)cast<ConstantSDNode>(N)->getZExtValue();
+}
+
+static bool isIntS16Immediate(SDValue Op, short &Imm) {
+ return isIntS16Immediate(Op.getNode(), Imm);
+}
+
+
+/// isInt32Immediate - This method tests to see if the node is a 32-bit constant
+/// operand. If so Imm will receive the 32-bit value.
+static bool isInt32Immediate(SDNode *N, unsigned &Imm) {
+ if (N->getOpcode() == ISD::Constant && N->getValueType(0) == MVT::i32) {
+ Imm = cast<ConstantSDNode>(N)->getZExtValue();
+ return true;
+ }
+ return false;
+}
+
+/// isInt64Immediate - This method tests to see if the node is a 64-bit constant
+/// operand. If so Imm will receive the 64-bit value.
+static bool isInt64Immediate(SDNode *N, uint64_t &Imm) {
+ if (N->getOpcode() == ISD::Constant && N->getValueType(0) == MVT::i64) {
+ Imm = cast<ConstantSDNode>(N)->getZExtValue();
+ return true;
+ }
+ return false;
+}
+
+// isInt32Immediate - This method tests to see if a constant operand.
+// If so Imm will receive the 32 bit value.
+static bool isInt32Immediate(SDValue N, unsigned &Imm) {
+ return isInt32Immediate(N.getNode(), Imm);
+}
+
+
+// isOpcWithIntImmediate - This method tests to see if the node is a specific
+// opcode and that it has a immediate integer right operand.
+// If so Imm will receive the 32 bit value.
+static bool isOpcWithIntImmediate(SDNode *N, unsigned Opc, unsigned& Imm) {
+ return N->getOpcode() == Opc
+ && isInt32Immediate(N->getOperand(1).getNode(), Imm);
+}
+
+bool PPCDAGToDAGISel::isRunOfOnes(unsigned Val, unsigned &MB, unsigned &ME) {
+ if (isShiftedMask_32(Val)) {
+ // look for the first non-zero bit
+ MB = CountLeadingZeros_32(Val);
+ // look for the first zero bit after the run of ones
+ ME = CountLeadingZeros_32((Val - 1) ^ Val);
+ return true;
+ } else {
+ Val = ~Val; // invert mask
+ if (isShiftedMask_32(Val)) {
+ // effectively look for the first zero bit
+ ME = CountLeadingZeros_32(Val) - 1;
+ // effectively look for the first one bit after the run of zeros
+ MB = CountLeadingZeros_32((Val - 1) ^ Val) + 1;
+ return true;
+ }
+ }
+ // no run present
+ return false;
+}
+
+bool PPCDAGToDAGISel::isRotateAndMask(SDNode *N, unsigned Mask,
+ bool isShiftMask, unsigned &SH,
+ unsigned &MB, unsigned &ME) {
+ // Don't even go down this path for i64, since different logic will be
+ // necessary for rldicl/rldicr/rldimi.
+ if (N->getValueType(0) != MVT::i32)
+ return false;
+
+ unsigned Shift = 32;
+ unsigned Indeterminant = ~0; // bit mask marking indeterminant results
+ unsigned Opcode = N->getOpcode();
+ if (N->getNumOperands() != 2 ||
+ !isInt32Immediate(N->getOperand(1).getNode(), Shift) || (Shift > 31))
+ return false;
+
+ if (Opcode == ISD::SHL) {
+ // apply shift left to mask if it comes first
+ if (isShiftMask) Mask = Mask << Shift;
+ // determine which bits are made indeterminant by shift
+ Indeterminant = ~(0xFFFFFFFFu << Shift);
+ } else if (Opcode == ISD::SRL) {
+ // apply shift right to mask if it comes first
+ if (isShiftMask) Mask = Mask >> Shift;
+ // determine which bits are made indeterminant by shift
+ Indeterminant = ~(0xFFFFFFFFu >> Shift);
+ // adjust for the left rotate
+ Shift = 32 - Shift;
+ } else if (Opcode == ISD::ROTL) {
+ Indeterminant = 0;
+ } else {
+ return false;
+ }
+
+ // if the mask doesn't intersect any Indeterminant bits
+ if (Mask && !(Mask & Indeterminant)) {
+ SH = Shift & 31;
+ // make sure the mask is still a mask (wrap arounds may not be)
+ return isRunOfOnes(Mask, MB, ME);
+ }
+ return false;
+}
+
+/// SelectBitfieldInsert - turn an or of two masked values into
+/// the rotate left word immediate then mask insert (rlwimi) instruction.
+SDNode *PPCDAGToDAGISel::SelectBitfieldInsert(SDNode *N) {
+ SDValue Op0 = N->getOperand(0);
+ SDValue Op1 = N->getOperand(1);
+ DebugLoc dl = N->getDebugLoc();
+
+ APInt LKZ, LKO, RKZ, RKO;
+ CurDAG->ComputeMaskedBits(Op0, LKZ, LKO);
+ CurDAG->ComputeMaskedBits(Op1, RKZ, RKO);
+
+ unsigned TargetMask = LKZ.getZExtValue();
+ unsigned InsertMask = RKZ.getZExtValue();
+
+ if ((TargetMask | InsertMask) == 0xFFFFFFFF) {
+ unsigned Op0Opc = Op0.getOpcode();
+ unsigned Op1Opc = Op1.getOpcode();
+ unsigned Value, SH = 0;
+ TargetMask = ~TargetMask;
+ InsertMask = ~InsertMask;
+
+ // If the LHS has a foldable shift and the RHS does not, then swap it to the
+ // RHS so that we can fold the shift into the insert.
+ if (Op0Opc == ISD::AND && Op1Opc == ISD::AND) {
+ if (Op0.getOperand(0).getOpcode() == ISD::SHL ||
+ Op0.getOperand(0).getOpcode() == ISD::SRL) {
+ if (Op1.getOperand(0).getOpcode() != ISD::SHL &&
+ Op1.getOperand(0).getOpcode() != ISD::SRL) {
+ std::swap(Op0, Op1);
+ std::swap(Op0Opc, Op1Opc);
+ std::swap(TargetMask, InsertMask);
+ }
+ }
+ } else if (Op0Opc == ISD::SHL || Op0Opc == ISD::SRL) {
+ if (Op1Opc == ISD::AND && Op1.getOperand(0).getOpcode() != ISD::SHL &&
+ Op1.getOperand(0).getOpcode() != ISD::SRL) {
+ std::swap(Op0, Op1);
+ std::swap(Op0Opc, Op1Opc);
+ std::swap(TargetMask, InsertMask);
+ }
+ }
+
+ unsigned MB, ME;
+ if (InsertMask && isRunOfOnes(InsertMask, MB, ME)) {
+ SDValue Tmp1, Tmp2;
+
+ if ((Op1Opc == ISD::SHL || Op1Opc == ISD::SRL) &&
+ isInt32Immediate(Op1.getOperand(1), Value)) {
+ Op1 = Op1.getOperand(0);
+ SH = (Op1Opc == ISD::SHL) ? Value : 32 - Value;
+ }
+ if (Op1Opc == ISD::AND) {
+ unsigned SHOpc = Op1.getOperand(0).getOpcode();
+ if ((SHOpc == ISD::SHL || SHOpc == ISD::SRL) &&
+ isInt32Immediate(Op1.getOperand(0).getOperand(1), Value)) {
+ Op1 = Op1.getOperand(0).getOperand(0);
+ SH = (SHOpc == ISD::SHL) ? Value : 32 - Value;
+ } else {
+ Op1 = Op1.getOperand(0);
+ }
+ }
+
+ SH &= 31;
+ SDValue Ops[] = { Op0, Op1, getI32Imm(SH), getI32Imm(MB),
+ getI32Imm(ME) };
+ return CurDAG->getMachineNode(PPC::RLWIMI, dl, MVT::i32, Ops, 5);
+ }
+ }
+ return 0;
+}
+
+/// SelectCC - Select a comparison of the specified values with the specified
+/// condition code, returning the CR# of the expression.
+SDValue PPCDAGToDAGISel::SelectCC(SDValue LHS, SDValue RHS,
+ ISD::CondCode CC, DebugLoc dl) {
+ // Always select the LHS.
+ unsigned Opc;
+
+ if (LHS.getValueType() == MVT::i32) {
+ unsigned Imm;
+ if (CC == ISD::SETEQ || CC == ISD::SETNE) {
+ if (isInt32Immediate(RHS, Imm)) {
+ // SETEQ/SETNE comparison with 16-bit immediate, fold it.
+ if (isUInt<16>(Imm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPLWI, dl, MVT::i32, LHS,
+ getI32Imm(Imm & 0xFFFF)), 0);
+ // If this is a 16-bit signed immediate, fold it.
+ if (isInt<16>((int)Imm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPWI, dl, MVT::i32, LHS,
+ getI32Imm(Imm & 0xFFFF)), 0);
+
+ // For non-equality comparisons, the default code would materialize the
+ // constant, then compare against it, like this:
+ // lis r2, 4660
+ // ori r2, r2, 22136
+ // cmpw cr0, r3, r2
+ // Since we are just comparing for equality, we can emit this instead:
+ // xoris r0,r3,0x1234
+ // cmplwi cr0,r0,0x5678
+ // beq cr0,L6
+ SDValue Xor(CurDAG->getMachineNode(PPC::XORIS, dl, MVT::i32, LHS,
+ getI32Imm(Imm >> 16)), 0);
+ return SDValue(CurDAG->getMachineNode(PPC::CMPLWI, dl, MVT::i32, Xor,
+ getI32Imm(Imm & 0xFFFF)), 0);
+ }
+ Opc = PPC::CMPLW;
+ } else if (ISD::isUnsignedIntSetCC(CC)) {
+ if (isInt32Immediate(RHS, Imm) && isUInt<16>(Imm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPLWI, dl, MVT::i32, LHS,
+ getI32Imm(Imm & 0xFFFF)), 0);
+ Opc = PPC::CMPLW;
+ } else {
+ short SImm;
+ if (isIntS16Immediate(RHS, SImm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPWI, dl, MVT::i32, LHS,
+ getI32Imm((int)SImm & 0xFFFF)),
+ 0);
+ Opc = PPC::CMPW;
+ }
+ } else if (LHS.getValueType() == MVT::i64) {
+ uint64_t Imm;
+ if (CC == ISD::SETEQ || CC == ISD::SETNE) {
+ if (isInt64Immediate(RHS.getNode(), Imm)) {
+ // SETEQ/SETNE comparison with 16-bit immediate, fold it.
+ if (isUInt<16>(Imm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPLDI, dl, MVT::i64, LHS,
+ getI32Imm(Imm & 0xFFFF)), 0);
+ // If this is a 16-bit signed immediate, fold it.
+ if (isInt<16>(Imm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPDI, dl, MVT::i64, LHS,
+ getI32Imm(Imm & 0xFFFF)), 0);
+
+ // For non-equality comparisons, the default code would materialize the
+ // constant, then compare against it, like this:
+ // lis r2, 4660
+ // ori r2, r2, 22136
+ // cmpd cr0, r3, r2
+ // Since we are just comparing for equality, we can emit this instead:
+ // xoris r0,r3,0x1234
+ // cmpldi cr0,r0,0x5678
+ // beq cr0,L6
+ if (isUInt<32>(Imm)) {
+ SDValue Xor(CurDAG->getMachineNode(PPC::XORIS8, dl, MVT::i64, LHS,
+ getI64Imm(Imm >> 16)), 0);
+ return SDValue(CurDAG->getMachineNode(PPC::CMPLDI, dl, MVT::i64, Xor,
+ getI64Imm(Imm & 0xFFFF)), 0);
+ }
+ }
+ Opc = PPC::CMPLD;
+ } else if (ISD::isUnsignedIntSetCC(CC)) {
+ if (isInt64Immediate(RHS.getNode(), Imm) && isUInt<16>(Imm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPLDI, dl, MVT::i64, LHS,
+ getI64Imm(Imm & 0xFFFF)), 0);
+ Opc = PPC::CMPLD;
+ } else {
+ short SImm;
+ if (isIntS16Immediate(RHS, SImm))
+ return SDValue(CurDAG->getMachineNode(PPC::CMPDI, dl, MVT::i64, LHS,
+ getI64Imm(SImm & 0xFFFF)),
+ 0);
+ Opc = PPC::CMPD;
+ }
+ } else if (LHS.getValueType() == MVT::f32) {
+ Opc = PPC::FCMPUS;
+ } else {
+ assert(LHS.getValueType() == MVT::f64 && "Unknown vt!");
+ Opc = PPC::FCMPUD;
+ }
+ return SDValue(CurDAG->getMachineNode(Opc, dl, MVT::i32, LHS, RHS), 0);
+}
+
+static PPC::Predicate getPredicateForSetCC(ISD::CondCode CC) {
+ switch (CC) {
+ case ISD::SETUEQ:
+ case ISD::SETONE:
+ case ISD::SETOLE:
+ case ISD::SETOGE:
+ llvm_unreachable("Should be lowered by legalize!");
+ default: llvm_unreachable("Unknown condition!");
+ case ISD::SETOEQ:
+ case ISD::SETEQ: return PPC::PRED_EQ;
+ case ISD::SETUNE:
+ case ISD::SETNE: return PPC::PRED_NE;
+ case ISD::SETOLT:
+ case ISD::SETLT: return PPC::PRED_LT;
+ case ISD::SETULE:
+ case ISD::SETLE: return PPC::PRED_LE;
+ case ISD::SETOGT:
+ case ISD::SETGT: return PPC::PRED_GT;
+ case ISD::SETUGE:
+ case ISD::SETGE: return PPC::PRED_GE;
+ case ISD::SETO: return PPC::PRED_NU;
+ case ISD::SETUO: return PPC::PRED_UN;
+ // These two are invalid for floating point. Assume we have int.
+ case ISD::SETULT: return PPC::PRED_LT;
+ case ISD::SETUGT: return PPC::PRED_GT;
+ }
+}
+
+/// getCRIdxForSetCC - Return the index of the condition register field
+/// associated with the SetCC condition, and whether or not the field is
+/// treated as inverted. That is, lt = 0; ge = 0 inverted.
+///
+/// If this returns with Other != -1, then the returned comparison is an or of
+/// two simpler comparisons. In this case, Invert is guaranteed to be false.
+static unsigned getCRIdxForSetCC(ISD::CondCode CC, bool &Invert, int &Other) {
+ Invert = false;
+ Other = -1;
+ switch (CC) {
+ default: llvm_unreachable("Unknown condition!");
+ case ISD::SETOLT:
+ case ISD::SETLT: return 0; // Bit #0 = SETOLT
+ case ISD::SETOGT:
+ case ISD::SETGT: return 1; // Bit #1 = SETOGT
+ case ISD::SETOEQ:
+ case ISD::SETEQ: return 2; // Bit #2 = SETOEQ
+ case ISD::SETUO: return 3; // Bit #3 = SETUO
+ case ISD::SETUGE:
+ case ISD::SETGE: Invert = true; return 0; // !Bit #0 = SETUGE
+ case ISD::SETULE:
+ case ISD::SETLE: Invert = true; return 1; // !Bit #1 = SETULE
+ case ISD::SETUNE:
+ case ISD::SETNE: Invert = true; return 2; // !Bit #2 = SETUNE
+ case ISD::SETO: Invert = true; return 3; // !Bit #3 = SETO
+ case ISD::SETUEQ:
+ case ISD::SETOGE:
+ case ISD::SETOLE:
+ case ISD::SETONE:
+ llvm_unreachable("Invalid branch code: should be expanded by legalize");
+ // These are invalid for floating point. Assume integer.
+ case ISD::SETULT: return 0;
+ case ISD::SETUGT: return 1;
+ }
+}
+
+// getVCmpInst: return the vector compare instruction for the specified
+// vector type and condition code. Since this is for altivec specific code,
+// only support the altivec types (v16i8, v8i16, v4i32, and v4f32).
+static unsigned int getVCmpInst(MVT::SimpleValueType VecVT, ISD::CondCode CC) {
+ switch (CC) {
+ case ISD::SETEQ:
+ case ISD::SETUEQ:
+ case ISD::SETNE:
+ case ISD::SETUNE:
+ if (VecVT == MVT::v16i8)
+ return PPC::VCMPEQUB;
+ else if (VecVT == MVT::v8i16)
+ return PPC::VCMPEQUH;
+ else if (VecVT == MVT::v4i32)
+ return PPC::VCMPEQUW;
+ // v4f32 != v4f32 could be translate to unordered not equal
+ else if (VecVT == MVT::v4f32)
+ return PPC::VCMPEQFP;
+ break;
+ case ISD::SETLT:
+ case ISD::SETGT:
+ case ISD::SETLE:
+ case ISD::SETGE:
+ if (VecVT == MVT::v16i8)
+ return PPC::VCMPGTSB;
+ else if (VecVT == MVT::v8i16)
+ return PPC::VCMPGTSH;
+ else if (VecVT == MVT::v4i32)
+ return PPC::VCMPGTSW;
+ else if (VecVT == MVT::v4f32)
+ return PPC::VCMPGTFP;
+ break;
+ case ISD::SETULT:
+ case ISD::SETUGT:
+ case ISD::SETUGE:
+ case ISD::SETULE:
+ if (VecVT == MVT::v16i8)
+ return PPC::VCMPGTUB;
+ else if (VecVT == MVT::v8i16)
+ return PPC::VCMPGTUH;
+ else if (VecVT == MVT::v4i32)
+ return PPC::VCMPGTUW;
+ break;
+ case ISD::SETOEQ:
+ if (VecVT == MVT::v4f32)
+ return PPC::VCMPEQFP;
+ break;
+ case ISD::SETOLT:
+ case ISD::SETOGT:
+ case ISD::SETOLE:
+ if (VecVT == MVT::v4f32)
+ return PPC::VCMPGTFP;
+ break;
+ case ISD::SETOGE:
+ if (VecVT == MVT::v4f32)
+ return PPC::VCMPGEFP;
+ break;
+ default:
+ break;
+ }
+ llvm_unreachable("Invalid integer vector compare condition");
+}
+
+// getVCmpEQInst: return the equal compare instruction for the specified vector
+// type. Since this is for altivec specific code, only support the altivec
+// types (v16i8, v8i16, v4i32, and v4f32).
+static unsigned int getVCmpEQInst(MVT::SimpleValueType VecVT) {
+ switch (VecVT) {
+ case MVT::v16i8:
+ return PPC::VCMPEQUB;
+ case MVT::v8i16:
+ return PPC::VCMPEQUH;
+ case MVT::v4i32:
+ return PPC::VCMPEQUW;
+ case MVT::v4f32:
+ return PPC::VCMPEQFP;
+ default:
+ llvm_unreachable("Invalid integer vector compare condition");
+ }
+}
+
+
+SDNode *PPCDAGToDAGISel::SelectSETCC(SDNode *N) {
+ DebugLoc dl = N->getDebugLoc();
+ unsigned Imm;
+ ISD::CondCode CC = cast<CondCodeSDNode>(N->getOperand(2))->get();
+ EVT PtrVT = CurDAG->getTargetLoweringInfo().getPointerTy();
+ bool isPPC64 = (PtrVT == MVT::i64);
+
+ if (isInt32Immediate(N->getOperand(1), Imm)) {
+ // We can codegen setcc op, imm very efficiently compared to a brcond.
+ // Check for those cases here.
+ // setcc op, 0
+ if (Imm == 0) {
+ SDValue Op = N->getOperand(0);
+ switch (CC) {
+ default: break;
+ case ISD::SETEQ: {
+ Op = SDValue(CurDAG->getMachineNode(PPC::CNTLZW, dl, MVT::i32, Op), 0);
+ SDValue Ops[] = { Op, getI32Imm(27), getI32Imm(5), getI32Imm(31) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+ case ISD::SETNE: {
+ if (isPPC64) break;
+ SDValue AD =
+ SDValue(CurDAG->getMachineNode(PPC::ADDIC, dl, MVT::i32, MVT::Glue,
+ Op, getI32Imm(~0U)), 0);
+ return CurDAG->SelectNodeTo(N, PPC::SUBFE, MVT::i32, AD, Op,
+ AD.getValue(1));
+ }
+ case ISD::SETLT: {
+ SDValue Ops[] = { Op, getI32Imm(1), getI32Imm(31), getI32Imm(31) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+ case ISD::SETGT: {
+ SDValue T =
+ SDValue(CurDAG->getMachineNode(PPC::NEG, dl, MVT::i32, Op), 0);
+ T = SDValue(CurDAG->getMachineNode(PPC::ANDC, dl, MVT::i32, T, Op), 0);
+ SDValue Ops[] = { T, getI32Imm(1), getI32Imm(31), getI32Imm(31) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+ }
+ } else if (Imm == ~0U) { // setcc op, -1
+ SDValue Op = N->getOperand(0);
+ switch (CC) {
+ default: break;
+ case ISD::SETEQ:
+ if (isPPC64) break;
+ Op = SDValue(CurDAG->getMachineNode(PPC::ADDIC, dl, MVT::i32, MVT::Glue,
+ Op, getI32Imm(1)), 0);
+ return CurDAG->SelectNodeTo(N, PPC::ADDZE, MVT::i32,
+ SDValue(CurDAG->getMachineNode(PPC::LI, dl,
+ MVT::i32,
+ getI32Imm(0)), 0),
+ Op.getValue(1));
+ case ISD::SETNE: {
+ if (isPPC64) break;
+ Op = SDValue(CurDAG->getMachineNode(PPC::NOR, dl, MVT::i32, Op, Op), 0);
+ SDNode *AD = CurDAG->getMachineNode(PPC::ADDIC, dl, MVT::i32, MVT::Glue,
+ Op, getI32Imm(~0U));
+ return CurDAG->SelectNodeTo(N, PPC::SUBFE, MVT::i32, SDValue(AD, 0),
+ Op, SDValue(AD, 1));
+ }
+ case ISD::SETLT: {
+ SDValue AD = SDValue(CurDAG->getMachineNode(PPC::ADDI, dl, MVT::i32, Op,
+ getI32Imm(1)), 0);
+ SDValue AN = SDValue(CurDAG->getMachineNode(PPC::AND, dl, MVT::i32, AD,
+ Op), 0);
+ SDValue Ops[] = { AN, getI32Imm(1), getI32Imm(31), getI32Imm(31) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+ case ISD::SETGT: {
+ SDValue Ops[] = { Op, getI32Imm(1), getI32Imm(31), getI32Imm(31) };
+ Op = SDValue(CurDAG->getMachineNode(PPC::RLWINM, dl, MVT::i32, Ops, 4),
+ 0);
+ return CurDAG->SelectNodeTo(N, PPC::XORI, MVT::i32, Op,
+ getI32Imm(1));
+ }
+ }
+ }
+ }
+
+ SDValue LHS = N->getOperand(0);
+ SDValue RHS = N->getOperand(1);
+
+ // Altivec Vector compare instructions do not set any CR register by default and
+ // vector compare operations return the same type as the operands.
+ if (LHS.getValueType().isVector()) {
+ EVT VecVT = LHS.getValueType();
+ MVT::SimpleValueType VT = VecVT.getSimpleVT().SimpleTy;
+ unsigned int VCmpInst = getVCmpInst(VT, CC);
+
+ switch (CC) {
+ case ISD::SETEQ:
+ case ISD::SETOEQ:
+ case ISD::SETUEQ:
+ return CurDAG->SelectNodeTo(N, VCmpInst, VecVT, LHS, RHS);
+ case ISD::SETNE:
+ case ISD::SETONE:
+ case ISD::SETUNE: {
+ SDValue VCmp(CurDAG->getMachineNode(VCmpInst, dl, VecVT, LHS, RHS), 0);
+ return CurDAG->SelectNodeTo(N, PPC::VNOR, VecVT, VCmp, VCmp);
+ }
+ case ISD::SETLT:
+ case ISD::SETOLT:
+ case ISD::SETULT:
+ return CurDAG->SelectNodeTo(N, VCmpInst, VecVT, RHS, LHS);
+ case ISD::SETGT:
+ case ISD::SETOGT:
+ case ISD::SETUGT:
+ return CurDAG->SelectNodeTo(N, VCmpInst, VecVT, LHS, RHS);
+ case ISD::SETGE:
+ case ISD::SETOGE:
+ case ISD::SETUGE: {
+ // Small optimization: Altivec provides a 'Vector Compare Greater Than
+ // or Equal To' instruction (vcmpgefp), so in this case there is no
+ // need for extra logic for the equal compare.
+ if (VecVT.getSimpleVT().isFloatingPoint()) {
+ return CurDAG->SelectNodeTo(N, VCmpInst, VecVT, LHS, RHS);
+ } else {
+ SDValue VCmpGT(CurDAG->getMachineNode(VCmpInst, dl, VecVT, LHS, RHS), 0);
+ unsigned int VCmpEQInst = getVCmpEQInst(VT);
+ SDValue VCmpEQ(CurDAG->getMachineNode(VCmpEQInst, dl, VecVT, LHS, RHS), 0);
+ return CurDAG->SelectNodeTo(N, PPC::VOR, VecVT, VCmpGT, VCmpEQ);
+ }
+ }
+ case ISD::SETLE:
+ case ISD::SETOLE:
+ case ISD::SETULE: {
+ SDValue VCmpLE(CurDAG->getMachineNode(VCmpInst, dl, VecVT, RHS, LHS), 0);
+ unsigned int VCmpEQInst = getVCmpEQInst(VT);
+ SDValue VCmpEQ(CurDAG->getMachineNode(VCmpEQInst, dl, VecVT, LHS, RHS), 0);
+ return CurDAG->SelectNodeTo(N, PPC::VOR, VecVT, VCmpLE, VCmpEQ);
+ }
+ default:
+ llvm_unreachable("Invalid vector compare type: should be expanded by legalize");
+ }
+ }
+
+ bool Inv;
+ int OtherCondIdx;
+ unsigned Idx = getCRIdxForSetCC(CC, Inv, OtherCondIdx);
+ SDValue CCReg = SelectCC(LHS, RHS, CC, dl);
+ SDValue IntCR;
+
+ // Force the ccreg into CR7.
+ SDValue CR7Reg = CurDAG->getRegister(PPC::CR7, MVT::i32);
+
+ SDValue InFlag(0, 0); // Null incoming flag value.
+ CCReg = CurDAG->getCopyToReg(CurDAG->getEntryNode(), dl, CR7Reg, CCReg,
+ InFlag).getValue(1);
+
+ if (PPCSubTarget.hasMFOCRF() && OtherCondIdx == -1)
+ IntCR = SDValue(CurDAG->getMachineNode(PPC::MFOCRF, dl, MVT::i32, CR7Reg,
+ CCReg), 0);
+ else
+ IntCR = SDValue(CurDAG->getMachineNode(PPC::MFCRpseud, dl, MVT::i32,
+ CR7Reg, CCReg), 0);
+
+ SDValue Ops[] = { IntCR, getI32Imm((32-(3-Idx)) & 31),
+ getI32Imm(31), getI32Imm(31) };
+ if (OtherCondIdx == -1 && !Inv)
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+
+ // Get the specified bit.
+ SDValue Tmp =
+ SDValue(CurDAG->getMachineNode(PPC::RLWINM, dl, MVT::i32, Ops, 4), 0);
+ if (Inv) {
+ assert(OtherCondIdx == -1 && "Can't have split plus negation");
+ return CurDAG->SelectNodeTo(N, PPC::XORI, MVT::i32, Tmp, getI32Imm(1));
+ }
+
+ // Otherwise, we have to turn an operation like SETONE -> SETOLT | SETOGT.
+ // We already got the bit for the first part of the comparison (e.g. SETULE).
+
+ // Get the other bit of the comparison.
+ Ops[1] = getI32Imm((32-(3-OtherCondIdx)) & 31);
+ SDValue OtherCond =
+ SDValue(CurDAG->getMachineNode(PPC::RLWINM, dl, MVT::i32, Ops, 4), 0);
+
+ return CurDAG->SelectNodeTo(N, PPC::OR, MVT::i32, Tmp, OtherCond);
+}
+
+
+// Select - Convert the specified operand from a target-independent to a
+// target-specific node if it hasn't already been changed.
+SDNode *PPCDAGToDAGISel::Select(SDNode *N) {
+ DebugLoc dl = N->getDebugLoc();
+ if (N->isMachineOpcode())
+ return NULL; // Already selected.
+
+ switch (N->getOpcode()) {
+ default: break;
+
+ case ISD::Constant: {
+ if (N->getValueType(0) == MVT::i64) {
+ // Get 64 bit value.
+ int64_t Imm = cast<ConstantSDNode>(N)->getZExtValue();
+ // Assume no remaining bits.
+ unsigned Remainder = 0;
+ // Assume no shift required.
+ unsigned Shift = 0;
+
+ // If it can't be represented as a 32 bit value.
+ if (!isInt<32>(Imm)) {
+ Shift = CountTrailingZeros_64(Imm);
+ int64_t ImmSh = static_cast<uint64_t>(Imm) >> Shift;
+
+ // If the shifted value fits 32 bits.
+ if (isInt<32>(ImmSh)) {
+ // Go with the shifted value.
+ Imm = ImmSh;
+ } else {
+ // Still stuck with a 64 bit value.
+ Remainder = Imm;
+ Shift = 32;
+ Imm >>= 32;
+ }
+ }
+
+ // Intermediate operand.
+ SDNode *Result;
+
+ // Handle first 32 bits.
+ unsigned Lo = Imm & 0xFFFF;
+ unsigned Hi = (Imm >> 16) & 0xFFFF;
+
+ // Simple value.
+ if (isInt<16>(Imm)) {
+ // Just the Lo bits.
+ Result = CurDAG->getMachineNode(PPC::LI8, dl, MVT::i64, getI32Imm(Lo));
+ } else if (Lo) {
+ // Handle the Hi bits.
+ unsigned OpC = Hi ? PPC::LIS8 : PPC::LI8;
+ Result = CurDAG->getMachineNode(OpC, dl, MVT::i64, getI32Imm(Hi));
+ // And Lo bits.
+ Result = CurDAG->getMachineNode(PPC::ORI8, dl, MVT::i64,
+ SDValue(Result, 0), getI32Imm(Lo));
+ } else {
+ // Just the Hi bits.
+ Result = CurDAG->getMachineNode(PPC::LIS8, dl, MVT::i64, getI32Imm(Hi));
+ }
+
+ // If no shift, we're done.
+ if (!Shift) return Result;
+
+ // Shift for next step if the upper 32-bits were not zero.
+ if (Imm) {
+ Result = CurDAG->getMachineNode(PPC::RLDICR, dl, MVT::i64,
+ SDValue(Result, 0),
+ getI32Imm(Shift),
+ getI32Imm(63 - Shift));
+ }
+
+ // Add in the last bits as required.
+ if ((Hi = (Remainder >> 16) & 0xFFFF)) {
+ Result = CurDAG->getMachineNode(PPC::ORIS8, dl, MVT::i64,
+ SDValue(Result, 0), getI32Imm(Hi));
+ }
+ if ((Lo = Remainder & 0xFFFF)) {
+ Result = CurDAG->getMachineNode(PPC::ORI8, dl, MVT::i64,
+ SDValue(Result, 0), getI32Imm(Lo));
+ }
+
+ return Result;
+ }
+ break;
+ }
+
+ case ISD::SETCC:
+ return SelectSETCC(N);
+ case PPCISD::GlobalBaseReg:
+ return getGlobalBaseReg();
+
+ case ISD::FrameIndex: {
+ int FI = cast<FrameIndexSDNode>(N)->getIndex();
+ SDValue TFI = CurDAG->getTargetFrameIndex(FI, N->getValueType(0));
+ unsigned Opc = N->getValueType(0) == MVT::i32 ? PPC::ADDI : PPC::ADDI8;
+ if (N->hasOneUse())
+ return CurDAG->SelectNodeTo(N, Opc, N->getValueType(0), TFI,
+ getSmallIPtrImm(0));
+ return CurDAG->getMachineNode(Opc, dl, N->getValueType(0), TFI,
+ getSmallIPtrImm(0));
+ }
+
+ case PPCISD::MFCR: {
+ SDValue InFlag = N->getOperand(1);
+ // Use MFOCRF if supported.
+ if (PPCSubTarget.hasMFOCRF())
+ return CurDAG->getMachineNode(PPC::MFOCRF, dl, MVT::i32,
+ N->getOperand(0), InFlag);
+ else
+ return CurDAG->getMachineNode(PPC::MFCRpseud, dl, MVT::i32,
+ N->getOperand(0), InFlag);
+ }
+
+ case ISD::SDIV: {
+ // FIXME: since this depends on the setting of the carry flag from the srawi
+ // we should really be making notes about that for the scheduler.
+ // FIXME: It sure would be nice if we could cheaply recognize the
+ // srl/add/sra pattern the dag combiner will generate for this as
+ // sra/addze rather than having to handle sdiv ourselves. oh well.
+ unsigned Imm;
+ if (isInt32Immediate(N->getOperand(1), Imm)) {
+ SDValue N0 = N->getOperand(0);
+ if ((signed)Imm > 0 && isPowerOf2_32(Imm)) {
+ SDNode *Op =
+ CurDAG->getMachineNode(PPC::SRAWI, dl, MVT::i32, MVT::Glue,
+ N0, getI32Imm(Log2_32(Imm)));
+ return CurDAG->SelectNodeTo(N, PPC::ADDZE, MVT::i32,
+ SDValue(Op, 0), SDValue(Op, 1));
+ } else if ((signed)Imm < 0 && isPowerOf2_32(-Imm)) {
+ SDNode *Op =
+ CurDAG->getMachineNode(PPC::SRAWI, dl, MVT::i32, MVT::Glue,
+ N0, getI32Imm(Log2_32(-Imm)));
+ SDValue PT =
+ SDValue(CurDAG->getMachineNode(PPC::ADDZE, dl, MVT::i32,
+ SDValue(Op, 0), SDValue(Op, 1)),
+ 0);
+ return CurDAG->SelectNodeTo(N, PPC::NEG, MVT::i32, PT);
+ }
+ }
+
+ // Other cases are autogenerated.
+ break;
+ }
+
+ case ISD::LOAD: {
+ // Handle preincrement loads.
+ LoadSDNode *LD = cast<LoadSDNode>(N);
+ EVT LoadedVT = LD->getMemoryVT();
+
+ // Normal loads are handled by code generated from the .td file.
+ if (LD->getAddressingMode() != ISD::PRE_INC)
+ break;
+
+ SDValue Offset = LD->getOffset();
+ if (Offset.getOpcode() == ISD::TargetConstant ||
+ Offset.getOpcode() == ISD::TargetGlobalAddress) {
+
+ unsigned Opcode;
+ bool isSExt = LD->getExtensionType() == ISD::SEXTLOAD;
+ if (LD->getValueType(0) != MVT::i64) {
+ // Handle PPC32 integer and normal FP loads.
+ assert((!isSExt || LoadedVT == MVT::i16) && "Invalid sext update load");
+ switch (LoadedVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Invalid PPC load type!");
+ case MVT::f64: Opcode = PPC::LFDU; break;
+ case MVT::f32: Opcode = PPC::LFSU; break;
+ case MVT::i32: Opcode = PPC::LWZU; break;
+ case MVT::i16: Opcode = isSExt ? PPC::LHAU : PPC::LHZU; break;
+ case MVT::i1:
+ case MVT::i8: Opcode = PPC::LBZU; break;
+ }
+ } else {
+ assert(LD->getValueType(0) == MVT::i64 && "Unknown load result type!");
+ assert((!isSExt || LoadedVT == MVT::i16) && "Invalid sext update load");
+ switch (LoadedVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Invalid PPC load type!");
+ case MVT::i64: Opcode = PPC::LDU; break;
+ case MVT::i32: Opcode = PPC::LWZU8; break;
+ case MVT::i16: Opcode = isSExt ? PPC::LHAU8 : PPC::LHZU8; break;
+ case MVT::i1:
+ case MVT::i8: Opcode = PPC::LBZU8; break;
+ }
+ }
+
+ SDValue Chain = LD->getChain();
+ SDValue Base = LD->getBasePtr();
+ SDValue Ops[] = { Offset, Base, Chain };
+ return CurDAG->getMachineNode(Opcode, dl, LD->getValueType(0),
+ PPCLowering.getPointerTy(),
+ MVT::Other, Ops, 3);
+ } else {
+ unsigned Opcode;
+ bool isSExt = LD->getExtensionType() == ISD::SEXTLOAD;
+ if (LD->getValueType(0) != MVT::i64) {
+ // Handle PPC32 integer and normal FP loads.
+ assert((!isSExt || LoadedVT == MVT::i16) && "Invalid sext update load");
+ switch (LoadedVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Invalid PPC load type!");
+ case MVT::f64: Opcode = PPC::LFDUX; break;
+ case MVT::f32: Opcode = PPC::LFSUX; break;
+ case MVT::i32: Opcode = PPC::LWZUX; break;
+ case MVT::i16: Opcode = isSExt ? PPC::LHAUX : PPC::LHZUX; break;
+ case MVT::i1:
+ case MVT::i8: Opcode = PPC::LBZUX; break;
+ }
+ } else {
+ assert(LD->getValueType(0) == MVT::i64 && "Unknown load result type!");
+ assert((!isSExt || LoadedVT == MVT::i16 || LoadedVT == MVT::i32) &&
+ "Invalid sext update load");
+ switch (LoadedVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Invalid PPC load type!");
+ case MVT::i64: Opcode = PPC::LDUX; break;
+ case MVT::i32: Opcode = isSExt ? PPC::LWAUX : PPC::LWZUX8; break;
+ case MVT::i16: Opcode = isSExt ? PPC::LHAUX8 : PPC::LHZUX8; break;
+ case MVT::i1:
+ case MVT::i8: Opcode = PPC::LBZUX8; break;
+ }
+ }
+
+ SDValue Chain = LD->getChain();
+ SDValue Base = LD->getBasePtr();
+ SDValue Ops[] = { Base, Offset, Chain };
+ return CurDAG->getMachineNode(Opcode, dl, LD->getValueType(0),
+ PPCLowering.getPointerTy(),
+ MVT::Other, Ops, 3);
+ }
+ }
+
+ case ISD::AND: {
+ unsigned Imm, Imm2, SH, MB, ME;
+ uint64_t Imm64;
+
+ // If this is an and of a value rotated between 0 and 31 bits and then and'd
+ // with a mask, emit rlwinm
+ if (isInt32Immediate(N->getOperand(1), Imm) &&
+ isRotateAndMask(N->getOperand(0).getNode(), Imm, false, SH, MB, ME)) {
+ SDValue Val = N->getOperand(0).getOperand(0);
+ SDValue Ops[] = { Val, getI32Imm(SH), getI32Imm(MB), getI32Imm(ME) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+ // If this is just a masked value where the input is not handled above, and
+ // is not a rotate-left (handled by a pattern in the .td file), emit rlwinm
+ if (isInt32Immediate(N->getOperand(1), Imm) &&
+ isRunOfOnes(Imm, MB, ME) &&
+ N->getOperand(0).getOpcode() != ISD::ROTL) {
+ SDValue Val = N->getOperand(0);
+ SDValue Ops[] = { Val, getI32Imm(0), getI32Imm(MB), getI32Imm(ME) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+ // If this is a 64-bit zero-extension mask, emit rldicl.
+ if (isInt64Immediate(N->getOperand(1).getNode(), Imm64) &&
+ isMask_64(Imm64)) {
+ SDValue Val = N->getOperand(0);
+ MB = 64 - CountTrailingOnes_64(Imm64);
+ SDValue Ops[] = { Val, getI32Imm(0), getI32Imm(MB) };
+ return CurDAG->SelectNodeTo(N, PPC::RLDICL, MVT::i64, Ops, 3);
+ }
+ // AND X, 0 -> 0, not "rlwinm 32".
+ if (isInt32Immediate(N->getOperand(1), Imm) && (Imm == 0)) {
+ ReplaceUses(SDValue(N, 0), N->getOperand(1));
+ return NULL;
+ }
+ // ISD::OR doesn't get all the bitfield insertion fun.
+ // (and (or x, c1), c2) where isRunOfOnes(~(c1^c2)) is a bitfield insert
+ if (isInt32Immediate(N->getOperand(1), Imm) &&
+ N->getOperand(0).getOpcode() == ISD::OR &&
+ isInt32Immediate(N->getOperand(0).getOperand(1), Imm2)) {
+ unsigned MB, ME;
+ Imm = ~(Imm^Imm2);
+ if (isRunOfOnes(Imm, MB, ME)) {
+ SDValue Ops[] = { N->getOperand(0).getOperand(0),
+ N->getOperand(0).getOperand(1),
+ getI32Imm(0), getI32Imm(MB),getI32Imm(ME) };
+ return CurDAG->getMachineNode(PPC::RLWIMI, dl, MVT::i32, Ops, 5);
+ }
+ }
+
+ // Other cases are autogenerated.
+ break;
+ }
+ case ISD::OR:
+ if (N->getValueType(0) == MVT::i32)
+ if (SDNode *I = SelectBitfieldInsert(N))
+ return I;
+
+ // Other cases are autogenerated.
+ break;
+ case ISD::SHL: {
+ unsigned Imm, SH, MB, ME;
+ if (isOpcWithIntImmediate(N->getOperand(0).getNode(), ISD::AND, Imm) &&
+ isRotateAndMask(N, Imm, true, SH, MB, ME)) {
+ SDValue Ops[] = { N->getOperand(0).getOperand(0),
+ getI32Imm(SH), getI32Imm(MB), getI32Imm(ME) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+
+ // Other cases are autogenerated.
+ break;
+ }
+ case ISD::SRL: {
+ unsigned Imm, SH, MB, ME;
+ if (isOpcWithIntImmediate(N->getOperand(0).getNode(), ISD::AND, Imm) &&
+ isRotateAndMask(N, Imm, true, SH, MB, ME)) {
+ SDValue Ops[] = { N->getOperand(0).getOperand(0),
+ getI32Imm(SH), getI32Imm(MB), getI32Imm(ME) };
+ return CurDAG->SelectNodeTo(N, PPC::RLWINM, MVT::i32, Ops, 4);
+ }
+
+ // Other cases are autogenerated.
+ break;
+ }
+ case ISD::SELECT_CC: {
+ ISD::CondCode CC = cast<CondCodeSDNode>(N->getOperand(4))->get();
+ EVT PtrVT = CurDAG->getTargetLoweringInfo().getPointerTy();
+ bool isPPC64 = (PtrVT == MVT::i64);
+
+ // Handle the setcc cases here. select_cc lhs, 0, 1, 0, cc
+ if (!isPPC64)
+ if (ConstantSDNode *N1C = dyn_cast<ConstantSDNode>(N->getOperand(1)))
+ if (ConstantSDNode *N2C = dyn_cast<ConstantSDNode>(N->getOperand(2)))
+ if (ConstantSDNode *N3C = dyn_cast<ConstantSDNode>(N->getOperand(3)))
+ if (N1C->isNullValue() && N3C->isNullValue() &&
+ N2C->getZExtValue() == 1ULL && CC == ISD::SETNE &&
+ // FIXME: Implement this optzn for PPC64.
+ N->getValueType(0) == MVT::i32) {
+ SDNode *Tmp =
+ CurDAG->getMachineNode(PPC::ADDIC, dl, MVT::i32, MVT::Glue,
+ N->getOperand(0), getI32Imm(~0U));
+ return CurDAG->SelectNodeTo(N, PPC::SUBFE, MVT::i32,
+ SDValue(Tmp, 0), N->getOperand(0),
+ SDValue(Tmp, 1));
+ }
+
+ SDValue CCReg = SelectCC(N->getOperand(0), N->getOperand(1), CC, dl);
+ unsigned BROpc = getPredicateForSetCC(CC);
+
+ unsigned SelectCCOp;
+ if (N->getValueType(0) == MVT::i32)
+ SelectCCOp = PPC::SELECT_CC_I4;
+ else if (N->getValueType(0) == MVT::i64)
+ SelectCCOp = PPC::SELECT_CC_I8;
+ else if (N->getValueType(0) == MVT::f32)
+ SelectCCOp = PPC::SELECT_CC_F4;
+ else if (N->getValueType(0) == MVT::f64)
+ SelectCCOp = PPC::SELECT_CC_F8;
+ else
+ SelectCCOp = PPC::SELECT_CC_VRRC;
+
+ SDValue Ops[] = { CCReg, N->getOperand(2), N->getOperand(3),
+ getI32Imm(BROpc) };
+ return CurDAG->SelectNodeTo(N, SelectCCOp, N->getValueType(0), Ops, 4);
+ }
+ case PPCISD::COND_BRANCH: {
+ // Op #0 is the Chain.
+ // Op #1 is the PPC::PRED_* number.
+ // Op #2 is the CR#
+ // Op #3 is the Dest MBB
+ // Op #4 is the Flag.
+ // Prevent PPC::PRED_* from being selected into LI.
+ SDValue Pred =
+ getI32Imm(cast<ConstantSDNode>(N->getOperand(1))->getZExtValue());
+ SDValue Ops[] = { Pred, N->getOperand(2), N->getOperand(3),
+ N->getOperand(0), N->getOperand(4) };
+ return CurDAG->SelectNodeTo(N, PPC::BCC, MVT::Other, Ops, 5);
+ }
+ case ISD::BR_CC: {
+ ISD::CondCode CC = cast<CondCodeSDNode>(N->getOperand(1))->get();
+ SDValue CondCode = SelectCC(N->getOperand(2), N->getOperand(3), CC, dl);
+ SDValue Ops[] = { getI32Imm(getPredicateForSetCC(CC)), CondCode,
+ N->getOperand(4), N->getOperand(0) };
+ return CurDAG->SelectNodeTo(N, PPC::BCC, MVT::Other, Ops, 4);
+ }
+ case ISD::BRIND: {
+ // FIXME: Should custom lower this.
+ SDValue Chain = N->getOperand(0);
+ SDValue Target = N->getOperand(1);
+ unsigned Opc = Target.getValueType() == MVT::i32 ? PPC::MTCTR : PPC::MTCTR8;
+ unsigned Reg = Target.getValueType() == MVT::i32 ? PPC::BCTR : PPC::BCTR8;
+ Chain = SDValue(CurDAG->getMachineNode(Opc, dl, MVT::Glue, Target,
+ Chain), 0);
+ return CurDAG->SelectNodeTo(N, Reg, MVT::Other, Chain);
+ }
+ case PPCISD::TOC_ENTRY: {
+ assert (PPCSubTarget.isPPC64() && "Only supported for 64-bit ABI");
+
+ // For medium and large code model, we generate two instructions as
+ // described below. Otherwise we allow SelectCodeCommon to handle this,
+ // selecting one of LDtoc, LDtocJTI, and LDtocCPT.
+ CodeModel::Model CModel = TM.getCodeModel();
+ if (CModel != CodeModel::Medium && CModel != CodeModel::Large)
+ break;
+
+ // The first source operand is a TargetGlobalAddress or a
+ // TargetJumpTable. If it is an externally defined symbol, a symbol
+ // with common linkage, a function address, or a jump table address,
+ // or if we are generating code for large code model, we generate:
+ // LDtocL(<ga:@sym>, ADDIStocHA(%X2, <ga:@sym>))
+ // Otherwise we generate:
+ // ADDItocL(ADDIStocHA(%X2, <ga:@sym>), <ga:@sym>)
+ SDValue GA = N->getOperand(0);
+ SDValue TOCbase = N->getOperand(1);
+ SDNode *Tmp = CurDAG->getMachineNode(PPC::ADDIStocHA, dl, MVT::i64,
+ TOCbase, GA);
+
+ if (isa<JumpTableSDNode>(GA) || CModel == CodeModel::Large)
+ return CurDAG->getMachineNode(PPC::LDtocL, dl, MVT::i64, GA,
+ SDValue(Tmp, 0));
+
+ if (GlobalAddressSDNode *G = dyn_cast<GlobalAddressSDNode>(GA)) {
+ const GlobalValue *GValue = G->getGlobal();
+ const GlobalAlias *GAlias = dyn_cast<GlobalAlias>(GValue);
+ const GlobalValue *RealGValue = GAlias ?
+ GAlias->resolveAliasedGlobal(false) : GValue;
+ const GlobalVariable *GVar = dyn_cast<GlobalVariable>(RealGValue);
+ assert((GVar || isa<Function>(RealGValue)) &&
+ "Unexpected global value subclass!");
+
+ // An external variable is one without an initializer. For these,
+ // for variables with common linkage, and for Functions, generate
+ // the LDtocL form.
+ if (!GVar || !GVar->hasInitializer() || RealGValue->hasCommonLinkage() ||
+ RealGValue->hasAvailableExternallyLinkage())
+ return CurDAG->getMachineNode(PPC::LDtocL, dl, MVT::i64, GA,
+ SDValue(Tmp, 0));
+ }
+
+ return CurDAG->getMachineNode(PPC::ADDItocL, dl, MVT::i64,
+ SDValue(Tmp, 0), GA);
+ }
+ case PPCISD::VADD_SPLAT: {
+ // This expands into one of three sequences, depending on whether
+ // the first operand is odd or even, positive or negative.
+ assert(isa<ConstantSDNode>(N->getOperand(0)) &&
+ isa<ConstantSDNode>(N->getOperand(1)) &&
+ "Invalid operand on VADD_SPLAT!");
+
+ int Elt = N->getConstantOperandVal(0);
+ int EltSize = N->getConstantOperandVal(1);
+ unsigned Opc1, Opc2, Opc3;
+ EVT VT;
+
+ if (EltSize == 1) {
+ Opc1 = PPC::VSPLTISB;
+ Opc2 = PPC::VADDUBM;
+ Opc3 = PPC::VSUBUBM;
+ VT = MVT::v16i8;
+ } else if (EltSize == 2) {
+ Opc1 = PPC::VSPLTISH;
+ Opc2 = PPC::VADDUHM;
+ Opc3 = PPC::VSUBUHM;
+ VT = MVT::v8i16;
+ } else {
+ assert(EltSize == 4 && "Invalid element size on VADD_SPLAT!");
+ Opc1 = PPC::VSPLTISW;
+ Opc2 = PPC::VADDUWM;
+ Opc3 = PPC::VSUBUWM;
+ VT = MVT::v4i32;
+ }
+
+ if ((Elt & 1) == 0) {
+ // Elt is even, in the range [-32,-18] + [16,30].
+ //
+ // Convert: VADD_SPLAT elt, size
+ // Into: tmp = VSPLTIS[BHW] elt
+ // VADDU[BHW]M tmp, tmp
+ // Where: [BHW] = B for size = 1, H for size = 2, W for size = 4
+ SDValue EltVal = getI32Imm(Elt >> 1);
+ SDNode *Tmp = CurDAG->getMachineNode(Opc1, dl, VT, EltVal);
+ SDValue TmpVal = SDValue(Tmp, 0);
+ return CurDAG->getMachineNode(Opc2, dl, VT, TmpVal, TmpVal);
+
+ } else if (Elt > 0) {
+ // Elt is odd and positive, in the range [17,31].
+ //
+ // Convert: VADD_SPLAT elt, size
+ // Into: tmp1 = VSPLTIS[BHW] elt-16
+ // tmp2 = VSPLTIS[BHW] -16
+ // VSUBU[BHW]M tmp1, tmp2
+ SDValue EltVal = getI32Imm(Elt - 16);
+ SDNode *Tmp1 = CurDAG->getMachineNode(Opc1, dl, VT, EltVal);
+ EltVal = getI32Imm(-16);
+ SDNode *Tmp2 = CurDAG->getMachineNode(Opc1, dl, VT, EltVal);
+ return CurDAG->getMachineNode(Opc3, dl, VT, SDValue(Tmp1, 0),
+ SDValue(Tmp2, 0));
+
+ } else {
+ // Elt is odd and negative, in the range [-31,-17].
+ //
+ // Convert: VADD_SPLAT elt, size
+ // Into: tmp1 = VSPLTIS[BHW] elt+16
+ // tmp2 = VSPLTIS[BHW] -16
+ // VADDU[BHW]M tmp1, tmp2
+ SDValue EltVal = getI32Imm(Elt + 16);
+ SDNode *Tmp1 = CurDAG->getMachineNode(Opc1, dl, VT, EltVal);
+ EltVal = getI32Imm(-16);
+ SDNode *Tmp2 = CurDAG->getMachineNode(Opc1, dl, VT, EltVal);
+ return CurDAG->getMachineNode(Opc2, dl, VT, SDValue(Tmp1, 0),
+ SDValue(Tmp2, 0));
+ }
+ }
+ }
+
+ return SelectCode(N);
+}
+
+/// PostProcessISelDAG - Perform some late peephole optimizations
+/// on the DAG representation.
+void PPCDAGToDAGISel::PostprocessISelDAG() {
+
+ // Skip peepholes at -O0.
+ if (TM.getOptLevel() == CodeGenOpt::None)
+ return;
+
+ // These optimizations are currently supported only for 64-bit SVR4.
+ if (PPCSubTarget.isDarwin() || !PPCSubTarget.isPPC64())
+ return;
+
+ SelectionDAG::allnodes_iterator Position(CurDAG->getRoot().getNode());
+ ++Position;
+
+ while (Position != CurDAG->allnodes_begin()) {
+ SDNode *N = --Position;
+ // Skip dead nodes and any non-machine opcodes.
+ if (N->use_empty() || !N->isMachineOpcode())
+ continue;
+
+ unsigned FirstOp;
+ unsigned StorageOpcode = N->getMachineOpcode();
+
+ switch (StorageOpcode) {
+ default: continue;
+
+ case PPC::LBZ:
+ case PPC::LBZ8:
+ case PPC::LD:
+ case PPC::LFD:
+ case PPC::LFS:
+ case PPC::LHA:
+ case PPC::LHA8:
+ case PPC::LHZ:
+ case PPC::LHZ8:
+ case PPC::LWA:
+ case PPC::LWZ:
+ case PPC::LWZ8:
+ FirstOp = 0;
+ break;
+
+ case PPC::STB:
+ case PPC::STB8:
+ case PPC::STD:
+ case PPC::STFD:
+ case PPC::STFS:
+ case PPC::STH:
+ case PPC::STH8:
+ case PPC::STW:
+ case PPC::STW8:
+ FirstOp = 1;
+ break;
+ }
+
+ // If this is a load or store with a zero offset, we may be able to
+ // fold an add-immediate into the memory operation.
+ if (!isa<ConstantSDNode>(N->getOperand(FirstOp)) ||
+ N->getConstantOperandVal(FirstOp) != 0)
+ continue;
+
+ SDValue Base = N->getOperand(FirstOp + 1);
+ if (!Base.isMachineOpcode())
+ continue;
+
+ unsigned Flags = 0;
+ bool ReplaceFlags = true;
+
+ // When the feeding operation is an add-immediate of some sort,
+ // determine whether we need to add relocation information to the
+ // target flags on the immediate operand when we fold it into the
+ // load instruction.
+ //
+ // For something like ADDItocL, the relocation information is
+ // inferred from the opcode; when we process it in the AsmPrinter,
+ // we add the necessary relocation there. A load, though, can receive
+ // relocation from various flavors of ADDIxxx, so we need to carry
+ // the relocation information in the target flags.
+ switch (Base.getMachineOpcode()) {
+ default: continue;
+
+ case PPC::ADDI8:
+ case PPC::ADDI:
+ // In some cases (such as TLS) the relocation information
+ // is already in place on the operand, so copying the operand
+ // is sufficient.
+ ReplaceFlags = false;
+ // For these cases, the immediate may not be divisible by 4, in
+ // which case the fold is illegal for DS-form instructions. (The
+ // other cases provide aligned addresses and are always safe.)
+ if ((StorageOpcode == PPC::LWA ||
+ StorageOpcode == PPC::LD ||
+ StorageOpcode == PPC::STD) &&
+ (!isa<ConstantSDNode>(Base.getOperand(1)) ||
+ Base.getConstantOperandVal(1) % 4 != 0))
+ continue;
+ break;
+ case PPC::ADDIdtprelL:
+ Flags = PPCII::MO_DTPREL16_LO;
+ break;
+ case PPC::ADDItlsldL:
+ Flags = PPCII::MO_TLSLD16_LO;
+ break;
+ case PPC::ADDItocL:
+ Flags = PPCII::MO_TOC16_LO;
+ break;
+ }
+
+ // We found an opportunity. Reverse the operands from the add
+ // immediate and substitute them into the load or store. If
+ // needed, update the target flags for the immediate operand to
+ // reflect the necessary relocation information.
+ DEBUG(dbgs() << "Folding add-immediate into mem-op:\nBase: ");
+ DEBUG(Base->dump(CurDAG));
+ DEBUG(dbgs() << "\nN: ");
+ DEBUG(N->dump(CurDAG));
+ DEBUG(dbgs() << "\n");
+
+ SDValue ImmOpnd = Base.getOperand(1);
+
+ // If the relocation information isn't already present on the
+ // immediate operand, add it now.
+ if (ReplaceFlags) {
+ if (GlobalAddressSDNode *GA = dyn_cast<GlobalAddressSDNode>(ImmOpnd)) {
+ DebugLoc dl = GA->getDebugLoc();
+ const GlobalValue *GV = GA->getGlobal();
+ ImmOpnd = CurDAG->getTargetGlobalAddress(GV, dl, MVT::i64, 0, Flags);
+ } else if (ConstantPoolSDNode *CP =
+ dyn_cast<ConstantPoolSDNode>(ImmOpnd)) {
+ const Constant *C = CP->getConstVal();
+ ImmOpnd = CurDAG->getTargetConstantPool(C, MVT::i64,
+ CP->getAlignment(),
+ 0, Flags);
+ }
+ }
+
+ if (FirstOp == 1) // Store
+ (void)CurDAG->UpdateNodeOperands(N, N->getOperand(0), ImmOpnd,
+ Base.getOperand(0), N->getOperand(3));
+ else // Load
+ (void)CurDAG->UpdateNodeOperands(N, ImmOpnd, Base.getOperand(0),
+ N->getOperand(2));
+
+ // The add-immediate may now be dead, in which case remove it.
+ if (Base.getNode()->use_empty())
+ CurDAG->RemoveDeadNode(Base.getNode());
+ }
+}
+
+
+/// createPPCISelDag - This pass converts a legalized DAG into a
+/// PowerPC-specific DAG, ready for instruction scheduling.
+///
+FunctionPass *llvm::createPPCISelDag(PPCTargetMachine &TM) {
+ return new PPCDAGToDAGISel(TM);
+}
+
+static void initializePassOnce(PassRegistry &Registry) {
+ const char *Name = "PowerPC DAG->DAG Pattern Instruction Selection";
+ PassInfo *PI = new PassInfo(Name, "ppc-codegen", &SelectionDAGISel::ID, 0,
+ false, false);
+ Registry.registerPass(*PI, true);
+}
+
+void llvm::initializePPCDAGToDAGISelPass(PassRegistry &Registry) {
+ CALL_ONCE_INITIALIZATION(initializePassOnce);
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCISelLowering.cpp b/contrib/llvm/lib/Target/PowerPC/PPCISelLowering.cpp
new file mode 100644
index 0000000..16fc8a0
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCISelLowering.cpp
@@ -0,0 +1,7554 @@
+//===-- PPCISelLowering.cpp - PPC DAG Lowering Implementation -------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements the PPCISelLowering class.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCISelLowering.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "PPCMachineFunctionInfo.h"
+#include "PPCPerfectShuffle.h"
+#include "PPCTargetMachine.h"
+#include "llvm/ADT/STLExtras.h"
+#include "llvm/CodeGen/CallingConvLower.h"
+#include "llvm/CodeGen/MachineFrameInfo.h"
+#include "llvm/CodeGen/MachineFunction.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineRegisterInfo.h"
+#include "llvm/CodeGen/SelectionDAG.h"
+#include "llvm/CodeGen/TargetLoweringObjectFileImpl.h"
+#include "llvm/IR/CallingConv.h"
+#include "llvm/IR/Constants.h"
+#include "llvm/IR/DerivedTypes.h"
+#include "llvm/IR/Function.h"
+#include "llvm/IR/Intrinsics.h"
+#include "llvm/Support/CommandLine.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/MathExtras.h"
+#include "llvm/Support/raw_ostream.h"
+#include "llvm/Target/TargetOptions.h"
+using namespace llvm;
+
+static bool CC_PPC32_SVR4_Custom_Dummy(unsigned &ValNo, MVT &ValVT, MVT &LocVT,
+ CCValAssign::LocInfo &LocInfo,
+ ISD::ArgFlagsTy &ArgFlags,
+ CCState &State);
+static bool CC_PPC32_SVR4_Custom_AlignArgRegs(unsigned &ValNo, MVT &ValVT,
+ MVT &LocVT,
+ CCValAssign::LocInfo &LocInfo,
+ ISD::ArgFlagsTy &ArgFlags,
+ CCState &State);
+static bool CC_PPC32_SVR4_Custom_AlignFPArgRegs(unsigned &ValNo, MVT &ValVT,
+ MVT &LocVT,
+ CCValAssign::LocInfo &LocInfo,
+ ISD::ArgFlagsTy &ArgFlags,
+ CCState &State);
+
+static cl::opt<bool> DisablePPCPreinc("disable-ppc-preinc",
+cl::desc("disable preincrement load/store generation on PPC"), cl::Hidden);
+
+static cl::opt<bool> DisableILPPref("disable-ppc-ilp-pref",
+cl::desc("disable setting the node scheduling preference to ILP on PPC"), cl::Hidden);
+
+static cl::opt<bool> DisablePPCUnaligned("disable-ppc-unaligned",
+cl::desc("disable unaligned load/store generation on PPC"), cl::Hidden);
+
+static TargetLoweringObjectFile *CreateTLOF(const PPCTargetMachine &TM) {
+ if (TM.getSubtargetImpl()->isDarwin())
+ return new TargetLoweringObjectFileMachO();
+
+ return new TargetLoweringObjectFileELF();
+}
+
+PPCTargetLowering::PPCTargetLowering(PPCTargetMachine &TM)
+ : TargetLowering(TM, CreateTLOF(TM)), PPCSubTarget(*TM.getSubtargetImpl()) {
+ const PPCSubtarget *Subtarget = &TM.getSubtarget<PPCSubtarget>();
+ PPCRegInfo = TM.getRegisterInfo();
+
+ setPow2DivIsCheap();
+
+ // Use _setjmp/_longjmp instead of setjmp/longjmp.
+ setUseUnderscoreSetJmp(true);
+ setUseUnderscoreLongJmp(true);
+
+ // On PPC32/64, arguments smaller than 4/8 bytes are extended, so all
+ // arguments are at least 4/8 bytes aligned.
+ bool isPPC64 = Subtarget->isPPC64();
+ setMinStackArgumentAlignment(isPPC64 ? 8:4);
+
+ // Set up the register classes.
+ addRegisterClass(MVT::i32, &PPC::GPRCRegClass);
+ addRegisterClass(MVT::f32, &PPC::F4RCRegClass);
+ addRegisterClass(MVT::f64, &PPC::F8RCRegClass);
+
+ // PowerPC has an i16 but no i8 (or i1) SEXTLOAD
+ setLoadExtAction(ISD::SEXTLOAD, MVT::i1, Promote);
+ setLoadExtAction(ISD::SEXTLOAD, MVT::i8, Expand);
+
+ setTruncStoreAction(MVT::f64, MVT::f32, Expand);
+
+ // PowerPC has pre-inc load and store's.
+ setIndexedLoadAction(ISD::PRE_INC, MVT::i1, Legal);
+ setIndexedLoadAction(ISD::PRE_INC, MVT::i8, Legal);
+ setIndexedLoadAction(ISD::PRE_INC, MVT::i16, Legal);
+ setIndexedLoadAction(ISD::PRE_INC, MVT::i32, Legal);
+ setIndexedLoadAction(ISD::PRE_INC, MVT::i64, Legal);
+ setIndexedStoreAction(ISD::PRE_INC, MVT::i1, Legal);
+ setIndexedStoreAction(ISD::PRE_INC, MVT::i8, Legal);
+ setIndexedStoreAction(ISD::PRE_INC, MVT::i16, Legal);
+ setIndexedStoreAction(ISD::PRE_INC, MVT::i32, Legal);
+ setIndexedStoreAction(ISD::PRE_INC, MVT::i64, Legal);
+
+ // This is used in the ppcf128->int sequence. Note it has different semantics
+ // from FP_ROUND: that rounds to nearest, this rounds to zero.
+ setOperationAction(ISD::FP_ROUND_INREG, MVT::ppcf128, Custom);
+
+ // We do not currently implement these libm ops for PowerPC.
+ setOperationAction(ISD::FFLOOR, MVT::ppcf128, Expand);
+ setOperationAction(ISD::FCEIL, MVT::ppcf128, Expand);
+ setOperationAction(ISD::FTRUNC, MVT::ppcf128, Expand);
+ setOperationAction(ISD::FRINT, MVT::ppcf128, Expand);
+ setOperationAction(ISD::FNEARBYINT, MVT::ppcf128, Expand);
+ setOperationAction(ISD::FREM, MVT::ppcf128, Expand);
+
+ // PowerPC has no SREM/UREM instructions
+ setOperationAction(ISD::SREM, MVT::i32, Expand);
+ setOperationAction(ISD::UREM, MVT::i32, Expand);
+ setOperationAction(ISD::SREM, MVT::i64, Expand);
+ setOperationAction(ISD::UREM, MVT::i64, Expand);
+
+ // Don't use SMUL_LOHI/UMUL_LOHI or SDIVREM/UDIVREM to lower SREM/UREM.
+ setOperationAction(ISD::UMUL_LOHI, MVT::i32, Expand);
+ setOperationAction(ISD::SMUL_LOHI, MVT::i32, Expand);
+ setOperationAction(ISD::UMUL_LOHI, MVT::i64, Expand);
+ setOperationAction(ISD::SMUL_LOHI, MVT::i64, Expand);
+ setOperationAction(ISD::UDIVREM, MVT::i32, Expand);
+ setOperationAction(ISD::SDIVREM, MVT::i32, Expand);
+ setOperationAction(ISD::UDIVREM, MVT::i64, Expand);
+ setOperationAction(ISD::SDIVREM, MVT::i64, Expand);
+
+ // We don't support sin/cos/sqrt/fmod/pow
+ setOperationAction(ISD::FSIN , MVT::f64, Expand);
+ setOperationAction(ISD::FCOS , MVT::f64, Expand);
+ setOperationAction(ISD::FSINCOS, MVT::f64, Expand);
+ setOperationAction(ISD::FREM , MVT::f64, Expand);
+ setOperationAction(ISD::FPOW , MVT::f64, Expand);
+ setOperationAction(ISD::FMA , MVT::f64, Legal);
+ setOperationAction(ISD::FSIN , MVT::f32, Expand);
+ setOperationAction(ISD::FCOS , MVT::f32, Expand);
+ setOperationAction(ISD::FSINCOS, MVT::f32, Expand);
+ setOperationAction(ISD::FREM , MVT::f32, Expand);
+ setOperationAction(ISD::FPOW , MVT::f32, Expand);
+ setOperationAction(ISD::FMA , MVT::f32, Legal);
+
+ setOperationAction(ISD::FLT_ROUNDS_, MVT::i32, Custom);
+
+ // If we're enabling GP optimizations, use hardware square root
+ if (!Subtarget->hasFSQRT() &&
+ !(TM.Options.UnsafeFPMath &&
+ Subtarget->hasFRSQRTE() && Subtarget->hasFRE()))
+ setOperationAction(ISD::FSQRT, MVT::f64, Expand);
+
+ if (!Subtarget->hasFSQRT() &&
+ !(TM.Options.UnsafeFPMath &&
+ Subtarget->hasFRSQRTES() && Subtarget->hasFRES()))
+ setOperationAction(ISD::FSQRT, MVT::f32, Expand);
+
+ setOperationAction(ISD::FCOPYSIGN, MVT::f64, Expand);
+ setOperationAction(ISD::FCOPYSIGN, MVT::f32, Expand);
+
+ if (Subtarget->hasFPRND()) {
+ setOperationAction(ISD::FFLOOR, MVT::f64, Legal);
+ setOperationAction(ISD::FCEIL, MVT::f64, Legal);
+ setOperationAction(ISD::FTRUNC, MVT::f64, Legal);
+
+ setOperationAction(ISD::FFLOOR, MVT::f32, Legal);
+ setOperationAction(ISD::FCEIL, MVT::f32, Legal);
+ setOperationAction(ISD::FTRUNC, MVT::f32, Legal);
+
+ // frin does not implement "ties to even." Thus, this is safe only in
+ // fast-math mode.
+ if (TM.Options.UnsafeFPMath) {
+ setOperationAction(ISD::FNEARBYINT, MVT::f64, Legal);
+ setOperationAction(ISD::FNEARBYINT, MVT::f32, Legal);
+
+ // These need to set FE_INEXACT, and use a custom inserter.
+ setOperationAction(ISD::FRINT, MVT::f64, Legal);
+ setOperationAction(ISD::FRINT, MVT::f32, Legal);
+ }
+ }
+
+ // PowerPC does not have BSWAP, CTPOP or CTTZ
+ setOperationAction(ISD::BSWAP, MVT::i32 , Expand);
+ setOperationAction(ISD::CTTZ , MVT::i32 , Expand);
+ setOperationAction(ISD::CTTZ_ZERO_UNDEF, MVT::i32, Expand);
+ setOperationAction(ISD::CTLZ_ZERO_UNDEF, MVT::i32, Expand);
+ setOperationAction(ISD::BSWAP, MVT::i64 , Expand);
+ setOperationAction(ISD::CTTZ , MVT::i64 , Expand);
+ setOperationAction(ISD::CTTZ_ZERO_UNDEF, MVT::i64, Expand);
+ setOperationAction(ISD::CTLZ_ZERO_UNDEF, MVT::i64, Expand);
+
+ if (Subtarget->hasPOPCNTD()) {
+ setOperationAction(ISD::CTPOP, MVT::i32 , Legal);
+ setOperationAction(ISD::CTPOP, MVT::i64 , Legal);
+ } else {
+ setOperationAction(ISD::CTPOP, MVT::i32 , Expand);
+ setOperationAction(ISD::CTPOP, MVT::i64 , Expand);
+ }
+
+ // PowerPC does not have ROTR
+ setOperationAction(ISD::ROTR, MVT::i32 , Expand);
+ setOperationAction(ISD::ROTR, MVT::i64 , Expand);
+
+ // PowerPC does not have Select
+ setOperationAction(ISD::SELECT, MVT::i32, Expand);
+ setOperationAction(ISD::SELECT, MVT::i64, Expand);
+ setOperationAction(ISD::SELECT, MVT::f32, Expand);
+ setOperationAction(ISD::SELECT, MVT::f64, Expand);
+
+ // PowerPC wants to turn select_cc of FP into fsel when possible.
+ setOperationAction(ISD::SELECT_CC, MVT::f32, Custom);
+ setOperationAction(ISD::SELECT_CC, MVT::f64, Custom);
+
+ // PowerPC wants to optimize integer setcc a bit
+ setOperationAction(ISD::SETCC, MVT::i32, Custom);
+
+ // PowerPC does not have BRCOND which requires SetCC
+ setOperationAction(ISD::BRCOND, MVT::Other, Expand);
+
+ setOperationAction(ISD::BR_JT, MVT::Other, Expand);
+
+ // PowerPC turns FP_TO_SINT into FCTIWZ and some load/stores.
+ setOperationAction(ISD::FP_TO_SINT, MVT::i32, Custom);
+
+ // PowerPC does not have [U|S]INT_TO_FP
+ setOperationAction(ISD::SINT_TO_FP, MVT::i32, Expand);
+ setOperationAction(ISD::UINT_TO_FP, MVT::i32, Expand);
+
+ setOperationAction(ISD::BITCAST, MVT::f32, Expand);
+ setOperationAction(ISD::BITCAST, MVT::i32, Expand);
+ setOperationAction(ISD::BITCAST, MVT::i64, Expand);
+ setOperationAction(ISD::BITCAST, MVT::f64, Expand);
+
+ // We cannot sextinreg(i1). Expand to shifts.
+ setOperationAction(ISD::SIGN_EXTEND_INREG, MVT::i1, Expand);
+
+ setOperationAction(ISD::EXCEPTIONADDR, MVT::i64, Expand);
+ setOperationAction(ISD::EHSELECTION, MVT::i64, Expand);
+ setOperationAction(ISD::EXCEPTIONADDR, MVT::i32, Expand);
+ setOperationAction(ISD::EHSELECTION, MVT::i32, Expand);
+
+ // NOTE: EH_SJLJ_SETJMP/_LONGJMP supported here is NOT intended to support
+ // SjLj exception handling but a light-weight setjmp/longjmp replacement to
+ // support continuation, user-level threading, and etc.. As a result, no
+ // other SjLj exception interfaces are implemented and please don't build
+ // your own exception handling based on them.
+ // LLVM/Clang supports zero-cost DWARF exception handling.
+ setOperationAction(ISD::EH_SJLJ_SETJMP, MVT::i32, Custom);
+ setOperationAction(ISD::EH_SJLJ_LONGJMP, MVT::Other, Custom);
+
+ // We want to legalize GlobalAddress and ConstantPool nodes into the
+ // appropriate instructions to materialize the address.
+ setOperationAction(ISD::GlobalAddress, MVT::i32, Custom);
+ setOperationAction(ISD::GlobalTLSAddress, MVT::i32, Custom);
+ setOperationAction(ISD::BlockAddress, MVT::i32, Custom);
+ setOperationAction(ISD::ConstantPool, MVT::i32, Custom);
+ setOperationAction(ISD::JumpTable, MVT::i32, Custom);
+ setOperationAction(ISD::GlobalAddress, MVT::i64, Custom);
+ setOperationAction(ISD::GlobalTLSAddress, MVT::i64, Custom);
+ setOperationAction(ISD::BlockAddress, MVT::i64, Custom);
+ setOperationAction(ISD::ConstantPool, MVT::i64, Custom);
+ setOperationAction(ISD::JumpTable, MVT::i64, Custom);
+
+ // TRAP is legal.
+ setOperationAction(ISD::TRAP, MVT::Other, Legal);
+
+ // TRAMPOLINE is custom lowered.
+ setOperationAction(ISD::INIT_TRAMPOLINE, MVT::Other, Custom);
+ setOperationAction(ISD::ADJUST_TRAMPOLINE, MVT::Other, Custom);
+
+ // VASTART needs to be custom lowered to use the VarArgsFrameIndex
+ setOperationAction(ISD::VASTART , MVT::Other, Custom);
+
+ if (Subtarget->isSVR4ABI()) {
+ if (isPPC64) {
+ // VAARG always uses double-word chunks, so promote anything smaller.
+ setOperationAction(ISD::VAARG, MVT::i1, Promote);
+ AddPromotedToType (ISD::VAARG, MVT::i1, MVT::i64);
+ setOperationAction(ISD::VAARG, MVT::i8, Promote);
+ AddPromotedToType (ISD::VAARG, MVT::i8, MVT::i64);
+ setOperationAction(ISD::VAARG, MVT::i16, Promote);
+ AddPromotedToType (ISD::VAARG, MVT::i16, MVT::i64);
+ setOperationAction(ISD::VAARG, MVT::i32, Promote);
+ AddPromotedToType (ISD::VAARG, MVT::i32, MVT::i64);
+ setOperationAction(ISD::VAARG, MVT::Other, Expand);
+ } else {
+ // VAARG is custom lowered with the 32-bit SVR4 ABI.
+ setOperationAction(ISD::VAARG, MVT::Other, Custom);
+ setOperationAction(ISD::VAARG, MVT::i64, Custom);
+ }
+ } else
+ setOperationAction(ISD::VAARG, MVT::Other, Expand);
+
+ // Use the default implementation.
+ setOperationAction(ISD::VACOPY , MVT::Other, Expand);
+ setOperationAction(ISD::VAEND , MVT::Other, Expand);
+ setOperationAction(ISD::STACKSAVE , MVT::Other, Expand);
+ setOperationAction(ISD::STACKRESTORE , MVT::Other, Custom);
+ setOperationAction(ISD::DYNAMIC_STACKALLOC, MVT::i32 , Custom);
+ setOperationAction(ISD::DYNAMIC_STACKALLOC, MVT::i64 , Custom);
+
+ // We want to custom lower some of our intrinsics.
+ setOperationAction(ISD::INTRINSIC_WO_CHAIN, MVT::Other, Custom);
+
+ // Comparisons that require checking two conditions.
+ setCondCodeAction(ISD::SETULT, MVT::f32, Expand);
+ setCondCodeAction(ISD::SETULT, MVT::f64, Expand);
+ setCondCodeAction(ISD::SETUGT, MVT::f32, Expand);
+ setCondCodeAction(ISD::SETUGT, MVT::f64, Expand);
+ setCondCodeAction(ISD::SETUEQ, MVT::f32, Expand);
+ setCondCodeAction(ISD::SETUEQ, MVT::f64, Expand);
+ setCondCodeAction(ISD::SETOGE, MVT::f32, Expand);
+ setCondCodeAction(ISD::SETOGE, MVT::f64, Expand);
+ setCondCodeAction(ISD::SETOLE, MVT::f32, Expand);
+ setCondCodeAction(ISD::SETOLE, MVT::f64, Expand);
+ setCondCodeAction(ISD::SETONE, MVT::f32, Expand);
+ setCondCodeAction(ISD::SETONE, MVT::f64, Expand);
+
+ if (Subtarget->has64BitSupport()) {
+ // They also have instructions for converting between i64 and fp.
+ setOperationAction(ISD::FP_TO_SINT, MVT::i64, Custom);
+ setOperationAction(ISD::FP_TO_UINT, MVT::i64, Expand);
+ setOperationAction(ISD::SINT_TO_FP, MVT::i64, Custom);
+ setOperationAction(ISD::UINT_TO_FP, MVT::i64, Expand);
+ // This is just the low 32 bits of a (signed) fp->i64 conversion.
+ // We cannot do this with Promote because i64 is not a legal type.
+ setOperationAction(ISD::FP_TO_UINT, MVT::i32, Custom);
+
+ if (PPCSubTarget.hasLFIWAX() || Subtarget->isPPC64())
+ setOperationAction(ISD::SINT_TO_FP, MVT::i32, Custom);
+ } else {
+ // PowerPC does not have FP_TO_UINT on 32-bit implementations.
+ setOperationAction(ISD::FP_TO_UINT, MVT::i32, Expand);
+ }
+
+ // With the instructions enabled under FPCVT, we can do everything.
+ if (PPCSubTarget.hasFPCVT()) {
+ if (Subtarget->has64BitSupport()) {
+ setOperationAction(ISD::FP_TO_SINT, MVT::i64, Custom);
+ setOperationAction(ISD::FP_TO_UINT, MVT::i64, Custom);
+ setOperationAction(ISD::SINT_TO_FP, MVT::i64, Custom);
+ setOperationAction(ISD::UINT_TO_FP, MVT::i64, Custom);
+ }
+
+ setOperationAction(ISD::FP_TO_SINT, MVT::i32, Custom);
+ setOperationAction(ISD::FP_TO_UINT, MVT::i32, Custom);
+ setOperationAction(ISD::SINT_TO_FP, MVT::i32, Custom);
+ setOperationAction(ISD::UINT_TO_FP, MVT::i32, Custom);
+ }
+
+ if (Subtarget->use64BitRegs()) {
+ // 64-bit PowerPC implementations can support i64 types directly
+ addRegisterClass(MVT::i64, &PPC::G8RCRegClass);
+ // BUILD_PAIR can't be handled natively, and should be expanded to shl/or
+ setOperationAction(ISD::BUILD_PAIR, MVT::i64, Expand);
+ // 64-bit PowerPC wants to expand i128 shifts itself.
+ setOperationAction(ISD::SHL_PARTS, MVT::i64, Custom);
+ setOperationAction(ISD::SRA_PARTS, MVT::i64, Custom);
+ setOperationAction(ISD::SRL_PARTS, MVT::i64, Custom);
+ } else {
+ // 32-bit PowerPC wants to expand i64 shifts itself.
+ setOperationAction(ISD::SHL_PARTS, MVT::i32, Custom);
+ setOperationAction(ISD::SRA_PARTS, MVT::i32, Custom);
+ setOperationAction(ISD::SRL_PARTS, MVT::i32, Custom);
+ }
+
+ if (Subtarget->hasAltivec()) {
+ // First set operation action for all vector types to expand. Then we
+ // will selectively turn on ones that can be effectively codegen'd.
+ for (unsigned i = (unsigned)MVT::FIRST_VECTOR_VALUETYPE;
+ i <= (unsigned)MVT::LAST_VECTOR_VALUETYPE; ++i) {
+ MVT::SimpleValueType VT = (MVT::SimpleValueType)i;
+
+ // add/sub are legal for all supported vector VT's.
+ setOperationAction(ISD::ADD , VT, Legal);
+ setOperationAction(ISD::SUB , VT, Legal);
+
+ // We promote all shuffles to v16i8.
+ setOperationAction(ISD::VECTOR_SHUFFLE, VT, Promote);
+ AddPromotedToType (ISD::VECTOR_SHUFFLE, VT, MVT::v16i8);
+
+ // We promote all non-typed operations to v4i32.
+ setOperationAction(ISD::AND , VT, Promote);
+ AddPromotedToType (ISD::AND , VT, MVT::v4i32);
+ setOperationAction(ISD::OR , VT, Promote);
+ AddPromotedToType (ISD::OR , VT, MVT::v4i32);
+ setOperationAction(ISD::XOR , VT, Promote);
+ AddPromotedToType (ISD::XOR , VT, MVT::v4i32);
+ setOperationAction(ISD::LOAD , VT, Promote);
+ AddPromotedToType (ISD::LOAD , VT, MVT::v4i32);
+ setOperationAction(ISD::SELECT, VT, Promote);
+ AddPromotedToType (ISD::SELECT, VT, MVT::v4i32);
+ setOperationAction(ISD::STORE, VT, Promote);
+ AddPromotedToType (ISD::STORE, VT, MVT::v4i32);
+
+ // No other operations are legal.
+ setOperationAction(ISD::MUL , VT, Expand);
+ setOperationAction(ISD::SDIV, VT, Expand);
+ setOperationAction(ISD::SREM, VT, Expand);
+ setOperationAction(ISD::UDIV, VT, Expand);
+ setOperationAction(ISD::UREM, VT, Expand);
+ setOperationAction(ISD::FDIV, VT, Expand);
+ setOperationAction(ISD::FNEG, VT, Expand);
+ setOperationAction(ISD::FSQRT, VT, Expand);
+ setOperationAction(ISD::FLOG, VT, Expand);
+ setOperationAction(ISD::FLOG10, VT, Expand);
+ setOperationAction(ISD::FLOG2, VT, Expand);
+ setOperationAction(ISD::FEXP, VT, Expand);
+ setOperationAction(ISD::FEXP2, VT, Expand);
+ setOperationAction(ISD::FSIN, VT, Expand);
+ setOperationAction(ISD::FCOS, VT, Expand);
+ setOperationAction(ISD::FABS, VT, Expand);
+ setOperationAction(ISD::FPOWI, VT, Expand);
+ setOperationAction(ISD::FFLOOR, VT, Expand);
+ setOperationAction(ISD::FCEIL, VT, Expand);
+ setOperationAction(ISD::FTRUNC, VT, Expand);
+ setOperationAction(ISD::FRINT, VT, Expand);
+ setOperationAction(ISD::FNEARBYINT, VT, Expand);
+ setOperationAction(ISD::EXTRACT_VECTOR_ELT, VT, Expand);
+ setOperationAction(ISD::INSERT_VECTOR_ELT, VT, Expand);
+ setOperationAction(ISD::BUILD_VECTOR, VT, Expand);
+ setOperationAction(ISD::UMUL_LOHI, VT, Expand);
+ setOperationAction(ISD::SMUL_LOHI, VT, Expand);
+ setOperationAction(ISD::UDIVREM, VT, Expand);
+ setOperationAction(ISD::SDIVREM, VT, Expand);
+ setOperationAction(ISD::SCALAR_TO_VECTOR, VT, Expand);
+ setOperationAction(ISD::FPOW, VT, Expand);
+ setOperationAction(ISD::CTPOP, VT, Expand);
+ setOperationAction(ISD::CTLZ, VT, Expand);
+ setOperationAction(ISD::CTLZ_ZERO_UNDEF, VT, Expand);
+ setOperationAction(ISD::CTTZ, VT, Expand);
+ setOperationAction(ISD::CTTZ_ZERO_UNDEF, VT, Expand);
+ setOperationAction(ISD::VSELECT, VT, Expand);
+ setOperationAction(ISD::SIGN_EXTEND_INREG, VT, Expand);
+
+ for (unsigned j = (unsigned)MVT::FIRST_VECTOR_VALUETYPE;
+ j <= (unsigned)MVT::LAST_VECTOR_VALUETYPE; ++j) {
+ MVT::SimpleValueType InnerVT = (MVT::SimpleValueType)j;
+ setTruncStoreAction(VT, InnerVT, Expand);
+ }
+ setLoadExtAction(ISD::SEXTLOAD, VT, Expand);
+ setLoadExtAction(ISD::ZEXTLOAD, VT, Expand);
+ setLoadExtAction(ISD::EXTLOAD, VT, Expand);
+ }
+
+ // We can custom expand all VECTOR_SHUFFLEs to VPERM, others we can handle
+ // with merges, splats, etc.
+ setOperationAction(ISD::VECTOR_SHUFFLE, MVT::v16i8, Custom);
+
+ setOperationAction(ISD::AND , MVT::v4i32, Legal);
+ setOperationAction(ISD::OR , MVT::v4i32, Legal);
+ setOperationAction(ISD::XOR , MVT::v4i32, Legal);
+ setOperationAction(ISD::LOAD , MVT::v4i32, Legal);
+ setOperationAction(ISD::SELECT, MVT::v4i32, Expand);
+ setOperationAction(ISD::STORE , MVT::v4i32, Legal);
+ setOperationAction(ISD::FP_TO_SINT, MVT::v4i32, Legal);
+ setOperationAction(ISD::FP_TO_UINT, MVT::v4i32, Legal);
+ setOperationAction(ISD::SINT_TO_FP, MVT::v4i32, Legal);
+ setOperationAction(ISD::UINT_TO_FP, MVT::v4i32, Legal);
+ setOperationAction(ISD::FFLOOR, MVT::v4f32, Legal);
+ setOperationAction(ISD::FCEIL, MVT::v4f32, Legal);
+ setOperationAction(ISD::FTRUNC, MVT::v4f32, Legal);
+ setOperationAction(ISD::FNEARBYINT, MVT::v4f32, Legal);
+
+ addRegisterClass(MVT::v4f32, &PPC::VRRCRegClass);
+ addRegisterClass(MVT::v4i32, &PPC::VRRCRegClass);
+ addRegisterClass(MVT::v8i16, &PPC::VRRCRegClass);
+ addRegisterClass(MVT::v16i8, &PPC::VRRCRegClass);
+
+ setOperationAction(ISD::MUL, MVT::v4f32, Legal);
+ setOperationAction(ISD::FMA, MVT::v4f32, Legal);
+
+ if (TM.Options.UnsafeFPMath) {
+ setOperationAction(ISD::FDIV, MVT::v4f32, Legal);
+ setOperationAction(ISD::FSQRT, MVT::v4f32, Legal);
+ }
+
+ setOperationAction(ISD::MUL, MVT::v4i32, Custom);
+ setOperationAction(ISD::MUL, MVT::v8i16, Custom);
+ setOperationAction(ISD::MUL, MVT::v16i8, Custom);
+
+ setOperationAction(ISD::SCALAR_TO_VECTOR, MVT::v4f32, Custom);
+ setOperationAction(ISD::SCALAR_TO_VECTOR, MVT::v4i32, Custom);
+
+ setOperationAction(ISD::BUILD_VECTOR, MVT::v16i8, Custom);
+ setOperationAction(ISD::BUILD_VECTOR, MVT::v8i16, Custom);
+ setOperationAction(ISD::BUILD_VECTOR, MVT::v4i32, Custom);
+ setOperationAction(ISD::BUILD_VECTOR, MVT::v4f32, Custom);
+
+ // Altivec does not contain unordered floating-point compare instructions
+ setCondCodeAction(ISD::SETUO, MVT::v4f32, Expand);
+ setCondCodeAction(ISD::SETUEQ, MVT::v4f32, Expand);
+ setCondCodeAction(ISD::SETUGT, MVT::v4f32, Expand);
+ setCondCodeAction(ISD::SETUGE, MVT::v4f32, Expand);
+ setCondCodeAction(ISD::SETULT, MVT::v4f32, Expand);
+ setCondCodeAction(ISD::SETULE, MVT::v4f32, Expand);
+ }
+
+ if (Subtarget->has64BitSupport()) {
+ setOperationAction(ISD::PREFETCH, MVT::Other, Legal);
+ setOperationAction(ISD::READCYCLECOUNTER, MVT::i64, Legal);
+ }
+
+ setOperationAction(ISD::ATOMIC_LOAD, MVT::i32, Expand);
+ setOperationAction(ISD::ATOMIC_STORE, MVT::i32, Expand);
+ setOperationAction(ISD::ATOMIC_LOAD, MVT::i64, Expand);
+ setOperationAction(ISD::ATOMIC_STORE, MVT::i64, Expand);
+
+ setBooleanContents(ZeroOrOneBooleanContent);
+ setBooleanVectorContents(ZeroOrOneBooleanContent); // FIXME: Is this correct?
+
+ if (isPPC64) {
+ setStackPointerRegisterToSaveRestore(PPC::X1);
+ setExceptionPointerRegister(PPC::X3);
+ setExceptionSelectorRegister(PPC::X4);
+ } else {
+ setStackPointerRegisterToSaveRestore(PPC::R1);
+ setExceptionPointerRegister(PPC::R3);
+ setExceptionSelectorRegister(PPC::R4);
+ }
+
+ // We have target-specific dag combine patterns for the following nodes:
+ setTargetDAGCombine(ISD::SINT_TO_FP);
+ setTargetDAGCombine(ISD::STORE);
+ setTargetDAGCombine(ISD::BR_CC);
+ setTargetDAGCombine(ISD::BSWAP);
+
+ // Use reciprocal estimates.
+ if (TM.Options.UnsafeFPMath) {
+ setTargetDAGCombine(ISD::FDIV);
+ setTargetDAGCombine(ISD::FSQRT);
+ }
+
+ // Darwin long double math library functions have $LDBL128 appended.
+ if (Subtarget->isDarwin()) {
+ setLibcallName(RTLIB::COS_PPCF128, "cosl$LDBL128");
+ setLibcallName(RTLIB::POW_PPCF128, "powl$LDBL128");
+ setLibcallName(RTLIB::REM_PPCF128, "fmodl$LDBL128");
+ setLibcallName(RTLIB::SIN_PPCF128, "sinl$LDBL128");
+ setLibcallName(RTLIB::SQRT_PPCF128, "sqrtl$LDBL128");
+ setLibcallName(RTLIB::LOG_PPCF128, "logl$LDBL128");
+ setLibcallName(RTLIB::LOG2_PPCF128, "log2l$LDBL128");
+ setLibcallName(RTLIB::LOG10_PPCF128, "log10l$LDBL128");
+ setLibcallName(RTLIB::EXP_PPCF128, "expl$LDBL128");
+ setLibcallName(RTLIB::EXP2_PPCF128, "exp2l$LDBL128");
+ }
+
+ setMinFunctionAlignment(2);
+ if (PPCSubTarget.isDarwin())
+ setPrefFunctionAlignment(4);
+
+ if (isPPC64 && Subtarget->isJITCodeModel())
+ // Temporary workaround for the inability of PPC64 JIT to handle jump
+ // tables.
+ setSupportJumpTables(false);
+
+ setInsertFencesForAtomic(true);
+
+ setSchedulingPreference(Sched::Hybrid);
+
+ computeRegisterProperties();
+
+ // The Freescale cores does better with aggressive inlining of memcpy and
+ // friends. Gcc uses same threshold of 128 bytes (= 32 word stores).
+ if (Subtarget->getDarwinDirective() == PPC::DIR_E500mc ||
+ Subtarget->getDarwinDirective() == PPC::DIR_E5500) {
+ MaxStoresPerMemset = 32;
+ MaxStoresPerMemsetOptSize = 16;
+ MaxStoresPerMemcpy = 32;
+ MaxStoresPerMemcpyOptSize = 8;
+ MaxStoresPerMemmove = 32;
+ MaxStoresPerMemmoveOptSize = 8;
+
+ setPrefFunctionAlignment(4);
+ }
+}
+
+/// getByValTypeAlignment - Return the desired alignment for ByVal aggregate
+/// function arguments in the caller parameter area.
+unsigned PPCTargetLowering::getByValTypeAlignment(Type *Ty) const {
+ const TargetMachine &TM = getTargetMachine();
+ // Darwin passes everything on 4 byte boundary.
+ if (TM.getSubtarget<PPCSubtarget>().isDarwin())
+ return 4;
+
+ // 16byte and wider vectors are passed on 16byte boundary.
+ if (VectorType *VTy = dyn_cast<VectorType>(Ty))
+ if (VTy->getBitWidth() >= 128)
+ return 16;
+
+ // The rest is 8 on PPC64 and 4 on PPC32 boundary.
+ if (PPCSubTarget.isPPC64())
+ return 8;
+
+ return 4;
+}
+
+const char *PPCTargetLowering::getTargetNodeName(unsigned Opcode) const {
+ switch (Opcode) {
+ default: return 0;
+ case PPCISD::FSEL: return "PPCISD::FSEL";
+ case PPCISD::FCFID: return "PPCISD::FCFID";
+ case PPCISD::FCTIDZ: return "PPCISD::FCTIDZ";
+ case PPCISD::FCTIWZ: return "PPCISD::FCTIWZ";
+ case PPCISD::FRE: return "PPCISD::FRE";
+ case PPCISD::FRSQRTE: return "PPCISD::FRSQRTE";
+ case PPCISD::STFIWX: return "PPCISD::STFIWX";
+ case PPCISD::VMADDFP: return "PPCISD::VMADDFP";
+ case PPCISD::VNMSUBFP: return "PPCISD::VNMSUBFP";
+ case PPCISD::VPERM: return "PPCISD::VPERM";
+ case PPCISD::Hi: return "PPCISD::Hi";
+ case PPCISD::Lo: return "PPCISD::Lo";
+ case PPCISD::TOC_ENTRY: return "PPCISD::TOC_ENTRY";
+ case PPCISD::TOC_RESTORE: return "PPCISD::TOC_RESTORE";
+ case PPCISD::LOAD: return "PPCISD::LOAD";
+ case PPCISD::LOAD_TOC: return "PPCISD::LOAD_TOC";
+ case PPCISD::DYNALLOC: return "PPCISD::DYNALLOC";
+ case PPCISD::GlobalBaseReg: return "PPCISD::GlobalBaseReg";
+ case PPCISD::SRL: return "PPCISD::SRL";
+ case PPCISD::SRA: return "PPCISD::SRA";
+ case PPCISD::SHL: return "PPCISD::SHL";
+ case PPCISD::CALL: return "PPCISD::CALL";
+ case PPCISD::CALL_NOP: return "PPCISD::CALL_NOP";
+ case PPCISD::MTCTR: return "PPCISD::MTCTR";
+ case PPCISD::BCTRL: return "PPCISD::BCTRL";
+ case PPCISD::RET_FLAG: return "PPCISD::RET_FLAG";
+ case PPCISD::EH_SJLJ_SETJMP: return "PPCISD::EH_SJLJ_SETJMP";
+ case PPCISD::EH_SJLJ_LONGJMP: return "PPCISD::EH_SJLJ_LONGJMP";
+ case PPCISD::MFCR: return "PPCISD::MFCR";
+ case PPCISD::VCMP: return "PPCISD::VCMP";
+ case PPCISD::VCMPo: return "PPCISD::VCMPo";
+ case PPCISD::LBRX: return "PPCISD::LBRX";
+ case PPCISD::STBRX: return "PPCISD::STBRX";
+ case PPCISD::LARX: return "PPCISD::LARX";
+ case PPCISD::STCX: return "PPCISD::STCX";
+ case PPCISD::COND_BRANCH: return "PPCISD::COND_BRANCH";
+ case PPCISD::MFFS: return "PPCISD::MFFS";
+ case PPCISD::FADDRTZ: return "PPCISD::FADDRTZ";
+ case PPCISD::TC_RETURN: return "PPCISD::TC_RETURN";
+ case PPCISD::CR6SET: return "PPCISD::CR6SET";
+ case PPCISD::CR6UNSET: return "PPCISD::CR6UNSET";
+ case PPCISD::ADDIS_TOC_HA: return "PPCISD::ADDIS_TOC_HA";
+ case PPCISD::LD_TOC_L: return "PPCISD::LD_TOC_L";
+ case PPCISD::ADDI_TOC_L: return "PPCISD::ADDI_TOC_L";
+ case PPCISD::ADDIS_GOT_TPREL_HA: return "PPCISD::ADDIS_GOT_TPREL_HA";
+ case PPCISD::LD_GOT_TPREL_L: return "PPCISD::LD_GOT_TPREL_L";
+ case PPCISD::ADD_TLS: return "PPCISD::ADD_TLS";
+ case PPCISD::ADDIS_TLSGD_HA: return "PPCISD::ADDIS_TLSGD_HA";
+ case PPCISD::ADDI_TLSGD_L: return "PPCISD::ADDI_TLSGD_L";
+ case PPCISD::GET_TLS_ADDR: return "PPCISD::GET_TLS_ADDR";
+ case PPCISD::ADDIS_TLSLD_HA: return "PPCISD::ADDIS_TLSLD_HA";
+ case PPCISD::ADDI_TLSLD_L: return "PPCISD::ADDI_TLSLD_L";
+ case PPCISD::GET_TLSLD_ADDR: return "PPCISD::GET_TLSLD_ADDR";
+ case PPCISD::ADDIS_DTPREL_HA: return "PPCISD::ADDIS_DTPREL_HA";
+ case PPCISD::ADDI_DTPREL_L: return "PPCISD::ADDI_DTPREL_L";
+ case PPCISD::VADD_SPLAT: return "PPCISD::VADD_SPLAT";
+ }
+}
+
+EVT PPCTargetLowering::getSetCCResultType(EVT VT) const {
+ if (!VT.isVector())
+ return MVT::i32;
+ return VT.changeVectorElementTypeToInteger();
+}
+
+//===----------------------------------------------------------------------===//
+// Node matching predicates, for use by the tblgen matching code.
+//===----------------------------------------------------------------------===//
+
+/// isFloatingPointZero - Return true if this is 0.0 or -0.0.
+static bool isFloatingPointZero(SDValue Op) {
+ if (ConstantFPSDNode *CFP = dyn_cast<ConstantFPSDNode>(Op))
+ return CFP->getValueAPF().isZero();
+ else if (ISD::isEXTLoad(Op.getNode()) || ISD::isNON_EXTLoad(Op.getNode())) {
+ // Maybe this has already been legalized into the constant pool?
+ if (ConstantPoolSDNode *CP = dyn_cast<ConstantPoolSDNode>(Op.getOperand(1)))
+ if (const ConstantFP *CFP = dyn_cast<ConstantFP>(CP->getConstVal()))
+ return CFP->getValueAPF().isZero();
+ }
+ return false;
+}
+
+/// isConstantOrUndef - Op is either an undef node or a ConstantSDNode. Return
+/// true if Op is undef or if it matches the specified value.
+static bool isConstantOrUndef(int Op, int Val) {
+ return Op < 0 || Op == Val;
+}
+
+/// isVPKUHUMShuffleMask - Return true if this is the shuffle mask for a
+/// VPKUHUM instruction.
+bool PPC::isVPKUHUMShuffleMask(ShuffleVectorSDNode *N, bool isUnary) {
+ if (!isUnary) {
+ for (unsigned i = 0; i != 16; ++i)
+ if (!isConstantOrUndef(N->getMaskElt(i), i*2+1))
+ return false;
+ } else {
+ for (unsigned i = 0; i != 8; ++i)
+ if (!isConstantOrUndef(N->getMaskElt(i), i*2+1) ||
+ !isConstantOrUndef(N->getMaskElt(i+8), i*2+1))
+ return false;
+ }
+ return true;
+}
+
+/// isVPKUWUMShuffleMask - Return true if this is the shuffle mask for a
+/// VPKUWUM instruction.
+bool PPC::isVPKUWUMShuffleMask(ShuffleVectorSDNode *N, bool isUnary) {
+ if (!isUnary) {
+ for (unsigned i = 0; i != 16; i += 2)
+ if (!isConstantOrUndef(N->getMaskElt(i ), i*2+2) ||
+ !isConstantOrUndef(N->getMaskElt(i+1), i*2+3))
+ return false;
+ } else {
+ for (unsigned i = 0; i != 8; i += 2)
+ if (!isConstantOrUndef(N->getMaskElt(i ), i*2+2) ||
+ !isConstantOrUndef(N->getMaskElt(i+1), i*2+3) ||
+ !isConstantOrUndef(N->getMaskElt(i+8), i*2+2) ||
+ !isConstantOrUndef(N->getMaskElt(i+9), i*2+3))
+ return false;
+ }
+ return true;
+}
+
+/// isVMerge - Common function, used to match vmrg* shuffles.
+///
+static bool isVMerge(ShuffleVectorSDNode *N, unsigned UnitSize,
+ unsigned LHSStart, unsigned RHSStart) {
+ assert(N->getValueType(0) == MVT::v16i8 &&
+ "PPC only supports shuffles by bytes!");
+ assert((UnitSize == 1 || UnitSize == 2 || UnitSize == 4) &&
+ "Unsupported merge size!");
+
+ for (unsigned i = 0; i != 8/UnitSize; ++i) // Step over units
+ for (unsigned j = 0; j != UnitSize; ++j) { // Step over bytes within unit
+ if (!isConstantOrUndef(N->getMaskElt(i*UnitSize*2+j),
+ LHSStart+j+i*UnitSize) ||
+ !isConstantOrUndef(N->getMaskElt(i*UnitSize*2+UnitSize+j),
+ RHSStart+j+i*UnitSize))
+ return false;
+ }
+ return true;
+}
+
+/// isVMRGLShuffleMask - Return true if this is a shuffle mask suitable for
+/// a VRGL* instruction with the specified unit size (1,2 or 4 bytes).
+bool PPC::isVMRGLShuffleMask(ShuffleVectorSDNode *N, unsigned UnitSize,
+ bool isUnary) {
+ if (!isUnary)
+ return isVMerge(N, UnitSize, 8, 24);
+ return isVMerge(N, UnitSize, 8, 8);
+}
+
+/// isVMRGHShuffleMask - Return true if this is a shuffle mask suitable for
+/// a VRGH* instruction with the specified unit size (1,2 or 4 bytes).
+bool PPC::isVMRGHShuffleMask(ShuffleVectorSDNode *N, unsigned UnitSize,
+ bool isUnary) {
+ if (!isUnary)
+ return isVMerge(N, UnitSize, 0, 16);
+ return isVMerge(N, UnitSize, 0, 0);
+}
+
+
+/// isVSLDOIShuffleMask - If this is a vsldoi shuffle mask, return the shift
+/// amount, otherwise return -1.
+int PPC::isVSLDOIShuffleMask(SDNode *N, bool isUnary) {
+ assert(N->getValueType(0) == MVT::v16i8 &&
+ "PPC only supports shuffles by bytes!");
+
+ ShuffleVectorSDNode *SVOp = cast<ShuffleVectorSDNode>(N);
+
+ // Find the first non-undef value in the shuffle mask.
+ unsigned i;
+ for (i = 0; i != 16 && SVOp->getMaskElt(i) < 0; ++i)
+ /*search*/;
+
+ if (i == 16) return -1; // all undef.
+
+ // Otherwise, check to see if the rest of the elements are consecutively
+ // numbered from this value.
+ unsigned ShiftAmt = SVOp->getMaskElt(i);
+ if (ShiftAmt < i) return -1;
+ ShiftAmt -= i;
+
+ if (!isUnary) {
+ // Check the rest of the elements to see if they are consecutive.
+ for (++i; i != 16; ++i)
+ if (!isConstantOrUndef(SVOp->getMaskElt(i), ShiftAmt+i))
+ return -1;
+ } else {
+ // Check the rest of the elements to see if they are consecutive.
+ for (++i; i != 16; ++i)
+ if (!isConstantOrUndef(SVOp->getMaskElt(i), (ShiftAmt+i) & 15))
+ return -1;
+ }
+ return ShiftAmt;
+}
+
+/// isSplatShuffleMask - Return true if the specified VECTOR_SHUFFLE operand
+/// specifies a splat of a single element that is suitable for input to
+/// VSPLTB/VSPLTH/VSPLTW.
+bool PPC::isSplatShuffleMask(ShuffleVectorSDNode *N, unsigned EltSize) {
+ assert(N->getValueType(0) == MVT::v16i8 &&
+ (EltSize == 1 || EltSize == 2 || EltSize == 4));
+
+ // This is a splat operation if each element of the permute is the same, and
+ // if the value doesn't reference the second vector.
+ unsigned ElementBase = N->getMaskElt(0);
+
+ // FIXME: Handle UNDEF elements too!
+ if (ElementBase >= 16)
+ return false;
+
+ // Check that the indices are consecutive, in the case of a multi-byte element
+ // splatted with a v16i8 mask.
+ for (unsigned i = 1; i != EltSize; ++i)
+ if (N->getMaskElt(i) < 0 || N->getMaskElt(i) != (int)(i+ElementBase))
+ return false;
+
+ for (unsigned i = EltSize, e = 16; i != e; i += EltSize) {
+ if (N->getMaskElt(i) < 0) continue;
+ for (unsigned j = 0; j != EltSize; ++j)
+ if (N->getMaskElt(i+j) != N->getMaskElt(j))
+ return false;
+ }
+ return true;
+}
+
+/// isAllNegativeZeroVector - Returns true if all elements of build_vector
+/// are -0.0.
+bool PPC::isAllNegativeZeroVector(SDNode *N) {
+ BuildVectorSDNode *BV = cast<BuildVectorSDNode>(N);
+
+ APInt APVal, APUndef;
+ unsigned BitSize;
+ bool HasAnyUndefs;
+
+ if (BV->isConstantSplat(APVal, APUndef, BitSize, HasAnyUndefs, 32, true))
+ if (ConstantFPSDNode *CFP = dyn_cast<ConstantFPSDNode>(N->getOperand(0)))
+ return CFP->getValueAPF().isNegZero();
+
+ return false;
+}
+
+/// getVSPLTImmediate - Return the appropriate VSPLT* immediate to splat the
+/// specified isSplatShuffleMask VECTOR_SHUFFLE mask.
+unsigned PPC::getVSPLTImmediate(SDNode *N, unsigned EltSize) {
+ ShuffleVectorSDNode *SVOp = cast<ShuffleVectorSDNode>(N);
+ assert(isSplatShuffleMask(SVOp, EltSize));
+ return SVOp->getMaskElt(0) / EltSize;
+}
+
+/// get_VSPLTI_elt - If this is a build_vector of constants which can be formed
+/// by using a vspltis[bhw] instruction of the specified element size, return
+/// the constant being splatted. The ByteSize field indicates the number of
+/// bytes of each element [124] -> [bhw].
+SDValue PPC::get_VSPLTI_elt(SDNode *N, unsigned ByteSize, SelectionDAG &DAG) {
+ SDValue OpVal(0, 0);
+
+ // If ByteSize of the splat is bigger than the element size of the
+ // build_vector, then we have a case where we are checking for a splat where
+ // multiple elements of the buildvector are folded together into a single
+ // logical element of the splat (e.g. "vsplish 1" to splat {0,1}*8).
+ unsigned EltSize = 16/N->getNumOperands();
+ if (EltSize < ByteSize) {
+ unsigned Multiple = ByteSize/EltSize; // Number of BV entries per spltval.
+ SDValue UniquedVals[4];
+ assert(Multiple > 1 && Multiple <= 4 && "How can this happen?");
+
+ // See if all of the elements in the buildvector agree across.
+ for (unsigned i = 0, e = N->getNumOperands(); i != e; ++i) {
+ if (N->getOperand(i).getOpcode() == ISD::UNDEF) continue;
+ // If the element isn't a constant, bail fully out.
+ if (!isa<ConstantSDNode>(N->getOperand(i))) return SDValue();
+
+
+ if (UniquedVals[i&(Multiple-1)].getNode() == 0)
+ UniquedVals[i&(Multiple-1)] = N->getOperand(i);
+ else if (UniquedVals[i&(Multiple-1)] != N->getOperand(i))
+ return SDValue(); // no match.
+ }
+
+ // Okay, if we reached this point, UniquedVals[0..Multiple-1] contains
+ // either constant or undef values that are identical for each chunk. See
+ // if these chunks can form into a larger vspltis*.
+
+ // Check to see if all of the leading entries are either 0 or -1. If
+ // neither, then this won't fit into the immediate field.
+ bool LeadingZero = true;
+ bool LeadingOnes = true;
+ for (unsigned i = 0; i != Multiple-1; ++i) {
+ if (UniquedVals[i].getNode() == 0) continue; // Must have been undefs.
+
+ LeadingZero &= cast<ConstantSDNode>(UniquedVals[i])->isNullValue();
+ LeadingOnes &= cast<ConstantSDNode>(UniquedVals[i])->isAllOnesValue();
+ }
+ // Finally, check the least significant entry.
+ if (LeadingZero) {
+ if (UniquedVals[Multiple-1].getNode() == 0)
+ return DAG.getTargetConstant(0, MVT::i32); // 0,0,0,undef
+ int Val = cast<ConstantSDNode>(UniquedVals[Multiple-1])->getZExtValue();
+ if (Val < 16)
+ return DAG.getTargetConstant(Val, MVT::i32); // 0,0,0,4 -> vspltisw(4)
+ }
+ if (LeadingOnes) {
+ if (UniquedVals[Multiple-1].getNode() == 0)
+ return DAG.getTargetConstant(~0U, MVT::i32); // -1,-1,-1,undef
+ int Val =cast<ConstantSDNode>(UniquedVals[Multiple-1])->getSExtValue();
+ if (Val >= -16) // -1,-1,-1,-2 -> vspltisw(-2)
+ return DAG.getTargetConstant(Val, MVT::i32);
+ }
+
+ return SDValue();
+ }
+
+ // Check to see if this buildvec has a single non-undef value in its elements.
+ for (unsigned i = 0, e = N->getNumOperands(); i != e; ++i) {
+ if (N->getOperand(i).getOpcode() == ISD::UNDEF) continue;
+ if (OpVal.getNode() == 0)
+ OpVal = N->getOperand(i);
+ else if (OpVal != N->getOperand(i))
+ return SDValue();
+ }
+
+ if (OpVal.getNode() == 0) return SDValue(); // All UNDEF: use implicit def.
+
+ unsigned ValSizeInBytes = EltSize;
+ uint64_t Value = 0;
+ if (ConstantSDNode *CN = dyn_cast<ConstantSDNode>(OpVal)) {
+ Value = CN->getZExtValue();
+ } else if (ConstantFPSDNode *CN = dyn_cast<ConstantFPSDNode>(OpVal)) {
+ assert(CN->getValueType(0) == MVT::f32 && "Only one legal FP vector type!");
+ Value = FloatToBits(CN->getValueAPF().convertToFloat());
+ }
+
+ // If the splat value is larger than the element value, then we can never do
+ // this splat. The only case that we could fit the replicated bits into our
+ // immediate field for would be zero, and we prefer to use vxor for it.
+ if (ValSizeInBytes < ByteSize) return SDValue();
+
+ // If the element value is larger than the splat value, cut it in half and
+ // check to see if the two halves are equal. Continue doing this until we
+ // get to ByteSize. This allows us to handle 0x01010101 as 0x01.
+ while (ValSizeInBytes > ByteSize) {
+ ValSizeInBytes >>= 1;
+
+ // If the top half equals the bottom half, we're still ok.
+ if (((Value >> (ValSizeInBytes*8)) & ((1 << (8*ValSizeInBytes))-1)) !=
+ (Value & ((1 << (8*ValSizeInBytes))-1)))
+ return SDValue();
+ }
+
+ // Properly sign extend the value.
+ int MaskVal = SignExtend32(Value, ByteSize * 8);
+
+ // If this is zero, don't match, zero matches ISD::isBuildVectorAllZeros.
+ if (MaskVal == 0) return SDValue();
+
+ // Finally, if this value fits in a 5 bit sext field, return it
+ if (SignExtend32<5>(MaskVal) == MaskVal)
+ return DAG.getTargetConstant(MaskVal, MVT::i32);
+ return SDValue();
+}
+
+//===----------------------------------------------------------------------===//
+// Addressing Mode Selection
+//===----------------------------------------------------------------------===//
+
+/// isIntS16Immediate - This method tests to see if the node is either a 32-bit
+/// or 64-bit immediate, and if the value can be accurately represented as a
+/// sign extension from a 16-bit value. If so, this returns true and the
+/// immediate.
+static bool isIntS16Immediate(SDNode *N, short &Imm) {
+ if (N->getOpcode() != ISD::Constant)
+ return false;
+
+ Imm = (short)cast<ConstantSDNode>(N)->getZExtValue();
+ if (N->getValueType(0) == MVT::i32)
+ return Imm == (int32_t)cast<ConstantSDNode>(N)->getZExtValue();
+ else
+ return Imm == (int64_t)cast<ConstantSDNode>(N)->getZExtValue();
+}
+static bool isIntS16Immediate(SDValue Op, short &Imm) {
+ return isIntS16Immediate(Op.getNode(), Imm);
+}
+
+
+/// SelectAddressRegReg - Given the specified addressed, check to see if it
+/// can be represented as an indexed [r+r] operation. Returns false if it
+/// can be more efficiently represented with [r+imm].
+bool PPCTargetLowering::SelectAddressRegReg(SDValue N, SDValue &Base,
+ SDValue &Index,
+ SelectionDAG &DAG) const {
+ short imm = 0;
+ if (N.getOpcode() == ISD::ADD) {
+ if (isIntS16Immediate(N.getOperand(1), imm))
+ return false; // r+i
+ if (N.getOperand(1).getOpcode() == PPCISD::Lo)
+ return false; // r+i
+
+ Base = N.getOperand(0);
+ Index = N.getOperand(1);
+ return true;
+ } else if (N.getOpcode() == ISD::OR) {
+ if (isIntS16Immediate(N.getOperand(1), imm))
+ return false; // r+i can fold it if we can.
+
+ // If this is an or of disjoint bitfields, we can codegen this as an add
+ // (for better address arithmetic) if the LHS and RHS of the OR are provably
+ // disjoint.
+ APInt LHSKnownZero, LHSKnownOne;
+ APInt RHSKnownZero, RHSKnownOne;
+ DAG.ComputeMaskedBits(N.getOperand(0),
+ LHSKnownZero, LHSKnownOne);
+
+ if (LHSKnownZero.getBoolValue()) {
+ DAG.ComputeMaskedBits(N.getOperand(1),
+ RHSKnownZero, RHSKnownOne);
+ // If all of the bits are known zero on the LHS or RHS, the add won't
+ // carry.
+ if (~(LHSKnownZero | RHSKnownZero) == 0) {
+ Base = N.getOperand(0);
+ Index = N.getOperand(1);
+ return true;
+ }
+ }
+ }
+
+ return false;
+}
+
+/// Returns true if the address N can be represented by a base register plus
+/// a signed 16-bit displacement [r+imm], and if it is not better
+/// represented as reg+reg.
+bool PPCTargetLowering::SelectAddressRegImm(SDValue N, SDValue &Disp,
+ SDValue &Base,
+ SelectionDAG &DAG) const {
+ // FIXME dl should come from parent load or store, not from address
+ DebugLoc dl = N.getDebugLoc();
+ // If this can be more profitably realized as r+r, fail.
+ if (SelectAddressRegReg(N, Disp, Base, DAG))
+ return false;
+
+ if (N.getOpcode() == ISD::ADD) {
+ short imm = 0;
+ if (isIntS16Immediate(N.getOperand(1), imm)) {
+ Disp = DAG.getTargetConstant((int)imm & 0xFFFF, MVT::i32);
+ if (FrameIndexSDNode *FI = dyn_cast<FrameIndexSDNode>(N.getOperand(0))) {
+ Base = DAG.getTargetFrameIndex(FI->getIndex(), N.getValueType());
+ } else {
+ Base = N.getOperand(0);
+ }
+ return true; // [r+i]
+ } else if (N.getOperand(1).getOpcode() == PPCISD::Lo) {
+ // Match LOAD (ADD (X, Lo(G))).
+ assert(!cast<ConstantSDNode>(N.getOperand(1).getOperand(1))->getZExtValue()
+ && "Cannot handle constant offsets yet!");
+ Disp = N.getOperand(1).getOperand(0); // The global address.
+ assert(Disp.getOpcode() == ISD::TargetGlobalAddress ||
+ Disp.getOpcode() == ISD::TargetGlobalTLSAddress ||
+ Disp.getOpcode() == ISD::TargetConstantPool ||
+ Disp.getOpcode() == ISD::TargetJumpTable);
+ Base = N.getOperand(0);
+ return true; // [&g+r]
+ }
+ } else if (N.getOpcode() == ISD::OR) {
+ short imm = 0;
+ if (isIntS16Immediate(N.getOperand(1), imm)) {
+ // If this is an or of disjoint bitfields, we can codegen this as an add
+ // (for better address arithmetic) if the LHS and RHS of the OR are
+ // provably disjoint.
+ APInt LHSKnownZero, LHSKnownOne;
+ DAG.ComputeMaskedBits(N.getOperand(0), LHSKnownZero, LHSKnownOne);
+
+ if ((LHSKnownZero.getZExtValue()|~(uint64_t)imm) == ~0ULL) {
+ // If all of the bits are known zero on the LHS or RHS, the add won't
+ // carry.
+ Base = N.getOperand(0);
+ Disp = DAG.getTargetConstant((int)imm & 0xFFFF, MVT::i32);
+ return true;
+ }
+ }
+ } else if (ConstantSDNode *CN = dyn_cast<ConstantSDNode>(N)) {
+ // Loading from a constant address.
+
+ // If this address fits entirely in a 16-bit sext immediate field, codegen
+ // this as "d, 0"
+ short Imm;
+ if (isIntS16Immediate(CN, Imm)) {
+ Disp = DAG.getTargetConstant(Imm, CN->getValueType(0));
+ Base = DAG.getRegister(PPCSubTarget.isPPC64() ? PPC::ZERO8 : PPC::ZERO,
+ CN->getValueType(0));
+ return true;
+ }
+
+ // Handle 32-bit sext immediates with LIS + addr mode.
+ if (CN->getValueType(0) == MVT::i32 ||
+ (int64_t)CN->getZExtValue() == (int)CN->getZExtValue()) {
+ int Addr = (int)CN->getZExtValue();
+
+ // Otherwise, break this down into an LIS + disp.
+ Disp = DAG.getTargetConstant((short)Addr, MVT::i32);
+
+ Base = DAG.getTargetConstant((Addr - (signed short)Addr) >> 16, MVT::i32);
+ unsigned Opc = CN->getValueType(0) == MVT::i32 ? PPC::LIS : PPC::LIS8;
+ Base = SDValue(DAG.getMachineNode(Opc, dl, CN->getValueType(0), Base), 0);
+ return true;
+ }
+ }
+
+ Disp = DAG.getTargetConstant(0, getPointerTy());
+ if (FrameIndexSDNode *FI = dyn_cast<FrameIndexSDNode>(N))
+ Base = DAG.getTargetFrameIndex(FI->getIndex(), N.getValueType());
+ else
+ Base = N;
+ return true; // [r+0]
+}
+
+/// SelectAddressRegRegOnly - Given the specified addressed, force it to be
+/// represented as an indexed [r+r] operation.
+bool PPCTargetLowering::SelectAddressRegRegOnly(SDValue N, SDValue &Base,
+ SDValue &Index,
+ SelectionDAG &DAG) const {
+ // Check to see if we can easily represent this as an [r+r] address. This
+ // will fail if it thinks that the address is more profitably represented as
+ // reg+imm, e.g. where imm = 0.
+ if (SelectAddressRegReg(N, Base, Index, DAG))
+ return true;
+
+ // If the operand is an addition, always emit this as [r+r], since this is
+ // better (for code size, and execution, as the memop does the add for free)
+ // than emitting an explicit add.
+ if (N.getOpcode() == ISD::ADD) {
+ Base = N.getOperand(0);
+ Index = N.getOperand(1);
+ return true;
+ }
+
+ // Otherwise, do it the hard way, using R0 as the base register.
+ Base = DAG.getRegister(PPCSubTarget.isPPC64() ? PPC::ZERO8 : PPC::ZERO,
+ N.getValueType());
+ Index = N;
+ return true;
+}
+
+/// SelectAddressRegImmShift - Returns true if the address N can be
+/// represented by a base register plus a signed 14-bit displacement
+/// [r+imm*4]. Suitable for use by STD and friends.
+bool PPCTargetLowering::SelectAddressRegImmShift(SDValue N, SDValue &Disp,
+ SDValue &Base,
+ SelectionDAG &DAG) const {
+ // FIXME dl should come from the parent load or store, not the address
+ DebugLoc dl = N.getDebugLoc();
+ // If this can be more profitably realized as r+r, fail.
+ if (SelectAddressRegReg(N, Disp, Base, DAG))
+ return false;
+
+ if (N.getOpcode() == ISD::ADD) {
+ short imm = 0;
+ if (isIntS16Immediate(N.getOperand(1), imm) && (imm & 3) == 0) {
+ Disp = DAG.getTargetConstant(((int)imm & 0xFFFF) >> 2, MVT::i32);
+ if (FrameIndexSDNode *FI = dyn_cast<FrameIndexSDNode>(N.getOperand(0))) {
+ Base = DAG.getTargetFrameIndex(FI->getIndex(), N.getValueType());
+ } else {
+ Base = N.getOperand(0);
+ }
+ return true; // [r+i]
+ } else if (N.getOperand(1).getOpcode() == PPCISD::Lo) {
+ // Match LOAD (ADD (X, Lo(G))).
+ assert(!cast<ConstantSDNode>(N.getOperand(1).getOperand(1))->getZExtValue()
+ && "Cannot handle constant offsets yet!");
+ Disp = N.getOperand(1).getOperand(0); // The global address.
+ assert(Disp.getOpcode() == ISD::TargetGlobalAddress ||
+ Disp.getOpcode() == ISD::TargetConstantPool ||
+ Disp.getOpcode() == ISD::TargetJumpTable);
+ Base = N.getOperand(0);
+ return true; // [&g+r]
+ }
+ } else if (N.getOpcode() == ISD::OR) {
+ short imm = 0;
+ if (isIntS16Immediate(N.getOperand(1), imm) && (imm & 3) == 0) {
+ // If this is an or of disjoint bitfields, we can codegen this as an add
+ // (for better address arithmetic) if the LHS and RHS of the OR are
+ // provably disjoint.
+ APInt LHSKnownZero, LHSKnownOne;
+ DAG.ComputeMaskedBits(N.getOperand(0), LHSKnownZero, LHSKnownOne);
+ if ((LHSKnownZero.getZExtValue()|~(uint64_t)imm) == ~0ULL) {
+ // If all of the bits are known zero on the LHS or RHS, the add won't
+ // carry.
+ Base = N.getOperand(0);
+ Disp = DAG.getTargetConstant(((int)imm & 0xFFFF) >> 2, MVT::i32);
+ return true;
+ }
+ }
+ } else if (ConstantSDNode *CN = dyn_cast<ConstantSDNode>(N)) {
+ // Loading from a constant address. Verify low two bits are clear.
+ if ((CN->getZExtValue() & 3) == 0) {
+ // If this address fits entirely in a 14-bit sext immediate field, codegen
+ // this as "d, 0"
+ short Imm;
+ if (isIntS16Immediate(CN, Imm)) {
+ Disp = DAG.getTargetConstant((unsigned short)Imm >> 2, getPointerTy());
+ Base = DAG.getRegister(PPCSubTarget.isPPC64() ? PPC::ZERO8 : PPC::ZERO,
+ CN->getValueType(0));
+ return true;
+ }
+
+ // Fold the low-part of 32-bit absolute addresses into addr mode.
+ if (CN->getValueType(0) == MVT::i32 ||
+ (int64_t)CN->getZExtValue() == (int)CN->getZExtValue()) {
+ int Addr = (int)CN->getZExtValue();
+
+ // Otherwise, break this down into an LIS + disp.
+ Disp = DAG.getTargetConstant((short)Addr >> 2, MVT::i32);
+ Base = DAG.getTargetConstant((Addr-(signed short)Addr) >> 16, MVT::i32);
+ unsigned Opc = CN->getValueType(0) == MVT::i32 ? PPC::LIS : PPC::LIS8;
+ Base = SDValue(DAG.getMachineNode(Opc, dl, CN->getValueType(0), Base),0);
+ return true;
+ }
+ }
+ }
+
+ Disp = DAG.getTargetConstant(0, getPointerTy());
+ if (FrameIndexSDNode *FI = dyn_cast<FrameIndexSDNode>(N))
+ Base = DAG.getTargetFrameIndex(FI->getIndex(), N.getValueType());
+ else
+ Base = N;
+ return true; // [r+0]
+}
+
+
+/// getPreIndexedAddressParts - returns true by value, base pointer and
+/// offset pointer and addressing mode by reference if the node's address
+/// can be legally represented as pre-indexed load / store address.
+bool PPCTargetLowering::getPreIndexedAddressParts(SDNode *N, SDValue &Base,
+ SDValue &Offset,
+ ISD::MemIndexedMode &AM,
+ SelectionDAG &DAG) const {
+ if (DisablePPCPreinc) return false;
+
+ bool isLoad = true;
+ SDValue Ptr;
+ EVT VT;
+ unsigned Alignment;
+ if (LoadSDNode *LD = dyn_cast<LoadSDNode>(N)) {
+ Ptr = LD->getBasePtr();
+ VT = LD->getMemoryVT();
+ Alignment = LD->getAlignment();
+ } else if (StoreSDNode *ST = dyn_cast<StoreSDNode>(N)) {
+ Ptr = ST->getBasePtr();
+ VT = ST->getMemoryVT();
+ Alignment = ST->getAlignment();
+ isLoad = false;
+ } else
+ return false;
+
+ // PowerPC doesn't have preinc load/store instructions for vectors.
+ if (VT.isVector())
+ return false;
+
+ if (SelectAddressRegReg(Ptr, Base, Offset, DAG)) {
+
+ // Common code will reject creating a pre-inc form if the base pointer
+ // is a frame index, or if N is a store and the base pointer is either
+ // the same as or a predecessor of the value being stored. Check for
+ // those situations here, and try with swapped Base/Offset instead.
+ bool Swap = false;
+
+ if (isa<FrameIndexSDNode>(Base) || isa<RegisterSDNode>(Base))
+ Swap = true;
+ else if (!isLoad) {
+ SDValue Val = cast<StoreSDNode>(N)->getValue();
+ if (Val == Base || Base.getNode()->isPredecessorOf(Val.getNode()))
+ Swap = true;
+ }
+
+ if (Swap)
+ std::swap(Base, Offset);
+
+ AM = ISD::PRE_INC;
+ return true;
+ }
+
+ // LDU/STU use reg+imm*4, others use reg+imm.
+ if (VT != MVT::i64) {
+ // reg + imm
+ if (!SelectAddressRegImm(Ptr, Offset, Base, DAG))
+ return false;
+ } else {
+ // LDU/STU need an address with at least 4-byte alignment.
+ if (Alignment < 4)
+ return false;
+
+ // reg + imm * 4.
+ if (!SelectAddressRegImmShift(Ptr, Offset, Base, DAG))
+ return false;
+ }
+
+ if (LoadSDNode *LD = dyn_cast<LoadSDNode>(N)) {
+ // PPC64 doesn't have lwau, but it does have lwaux. Reject preinc load of
+ // sext i32 to i64 when addr mode is r+i.
+ if (LD->getValueType(0) == MVT::i64 && LD->getMemoryVT() == MVT::i32 &&
+ LD->getExtensionType() == ISD::SEXTLOAD &&
+ isa<ConstantSDNode>(Offset))
+ return false;
+ }
+
+ AM = ISD::PRE_INC;
+ return true;
+}
+
+//===----------------------------------------------------------------------===//
+// LowerOperation implementation
+//===----------------------------------------------------------------------===//
+
+/// GetLabelAccessInfo - Return true if we should reference labels using a
+/// PICBase, set the HiOpFlags and LoOpFlags to the target MO flags.
+static bool GetLabelAccessInfo(const TargetMachine &TM, unsigned &HiOpFlags,
+ unsigned &LoOpFlags, const GlobalValue *GV = 0) {
+ HiOpFlags = PPCII::MO_HA16;
+ LoOpFlags = PPCII::MO_LO16;
+
+ // Don't use the pic base if not in PIC relocation model. Or if we are on a
+ // non-darwin platform. We don't support PIC on other platforms yet.
+ bool isPIC = TM.getRelocationModel() == Reloc::PIC_ &&
+ TM.getSubtarget<PPCSubtarget>().isDarwin();
+ if (isPIC) {
+ HiOpFlags |= PPCII::MO_PIC_FLAG;
+ LoOpFlags |= PPCII::MO_PIC_FLAG;
+ }
+
+ // If this is a reference to a global value that requires a non-lazy-ptr, make
+ // sure that instruction lowering adds it.
+ if (GV && TM.getSubtarget<PPCSubtarget>().hasLazyResolverStub(GV, TM)) {
+ HiOpFlags |= PPCII::MO_NLP_FLAG;
+ LoOpFlags |= PPCII::MO_NLP_FLAG;
+
+ if (GV->hasHiddenVisibility()) {
+ HiOpFlags |= PPCII::MO_NLP_HIDDEN_FLAG;
+ LoOpFlags |= PPCII::MO_NLP_HIDDEN_FLAG;
+ }
+ }
+
+ return isPIC;
+}
+
+static SDValue LowerLabelRef(SDValue HiPart, SDValue LoPart, bool isPIC,
+ SelectionDAG &DAG) {
+ EVT PtrVT = HiPart.getValueType();
+ SDValue Zero = DAG.getConstant(0, PtrVT);
+ DebugLoc DL = HiPart.getDebugLoc();
+
+ SDValue Hi = DAG.getNode(PPCISD::Hi, DL, PtrVT, HiPart, Zero);
+ SDValue Lo = DAG.getNode(PPCISD::Lo, DL, PtrVT, LoPart, Zero);
+
+ // With PIC, the first instruction is actually "GR+hi(&G)".
+ if (isPIC)
+ Hi = DAG.getNode(ISD::ADD, DL, PtrVT,
+ DAG.getNode(PPCISD::GlobalBaseReg, DL, PtrVT), Hi);
+
+ // Generate non-pic code that has direct accesses to the constant pool.
+ // The address of the global is just (hi(&g)+lo(&g)).
+ return DAG.getNode(ISD::ADD, DL, PtrVT, Hi, Lo);
+}
+
+SDValue PPCTargetLowering::LowerConstantPool(SDValue Op,
+ SelectionDAG &DAG) const {
+ EVT PtrVT = Op.getValueType();
+ ConstantPoolSDNode *CP = cast<ConstantPoolSDNode>(Op);
+ const Constant *C = CP->getConstVal();
+
+ // 64-bit SVR4 ABI code is always position-independent.
+ // The actual address of the GlobalValue is stored in the TOC.
+ if (PPCSubTarget.isSVR4ABI() && PPCSubTarget.isPPC64()) {
+ SDValue GA = DAG.getTargetConstantPool(C, PtrVT, CP->getAlignment(), 0);
+ return DAG.getNode(PPCISD::TOC_ENTRY, CP->getDebugLoc(), MVT::i64, GA,
+ DAG.getRegister(PPC::X2, MVT::i64));
+ }
+
+ unsigned MOHiFlag, MOLoFlag;
+ bool isPIC = GetLabelAccessInfo(DAG.getTarget(), MOHiFlag, MOLoFlag);
+ SDValue CPIHi =
+ DAG.getTargetConstantPool(C, PtrVT, CP->getAlignment(), 0, MOHiFlag);
+ SDValue CPILo =
+ DAG.getTargetConstantPool(C, PtrVT, CP->getAlignment(), 0, MOLoFlag);
+ return LowerLabelRef(CPIHi, CPILo, isPIC, DAG);
+}
+
+SDValue PPCTargetLowering::LowerJumpTable(SDValue Op, SelectionDAG &DAG) const {
+ EVT PtrVT = Op.getValueType();
+ JumpTableSDNode *JT = cast<JumpTableSDNode>(Op);
+
+ // 64-bit SVR4 ABI code is always position-independent.
+ // The actual address of the GlobalValue is stored in the TOC.
+ if (PPCSubTarget.isSVR4ABI() && PPCSubTarget.isPPC64()) {
+ SDValue GA = DAG.getTargetJumpTable(JT->getIndex(), PtrVT);
+ return DAG.getNode(PPCISD::TOC_ENTRY, JT->getDebugLoc(), MVT::i64, GA,
+ DAG.getRegister(PPC::X2, MVT::i64));
+ }
+
+ unsigned MOHiFlag, MOLoFlag;
+ bool isPIC = GetLabelAccessInfo(DAG.getTarget(), MOHiFlag, MOLoFlag);
+ SDValue JTIHi = DAG.getTargetJumpTable(JT->getIndex(), PtrVT, MOHiFlag);
+ SDValue JTILo = DAG.getTargetJumpTable(JT->getIndex(), PtrVT, MOLoFlag);
+ return LowerLabelRef(JTIHi, JTILo, isPIC, DAG);
+}
+
+SDValue PPCTargetLowering::LowerBlockAddress(SDValue Op,
+ SelectionDAG &DAG) const {
+ EVT PtrVT = Op.getValueType();
+
+ const BlockAddress *BA = cast<BlockAddressSDNode>(Op)->getBlockAddress();
+
+ unsigned MOHiFlag, MOLoFlag;
+ bool isPIC = GetLabelAccessInfo(DAG.getTarget(), MOHiFlag, MOLoFlag);
+ SDValue TgtBAHi = DAG.getTargetBlockAddress(BA, PtrVT, 0, MOHiFlag);
+ SDValue TgtBALo = DAG.getTargetBlockAddress(BA, PtrVT, 0, MOLoFlag);
+ return LowerLabelRef(TgtBAHi, TgtBALo, isPIC, DAG);
+}
+
+SDValue PPCTargetLowering::LowerGlobalTLSAddress(SDValue Op,
+ SelectionDAG &DAG) const {
+
+ GlobalAddressSDNode *GA = cast<GlobalAddressSDNode>(Op);
+ DebugLoc dl = GA->getDebugLoc();
+ const GlobalValue *GV = GA->getGlobal();
+ EVT PtrVT = getPointerTy();
+ bool is64bit = PPCSubTarget.isPPC64();
+
+ TLSModel::Model Model = getTargetMachine().getTLSModel(GV);
+
+ if (Model == TLSModel::LocalExec) {
+ SDValue TGAHi = DAG.getTargetGlobalAddress(GV, dl, PtrVT, 0,
+ PPCII::MO_TPREL16_HA);
+ SDValue TGALo = DAG.getTargetGlobalAddress(GV, dl, PtrVT, 0,
+ PPCII::MO_TPREL16_LO);
+ SDValue TLSReg = DAG.getRegister(is64bit ? PPC::X13 : PPC::R2,
+ is64bit ? MVT::i64 : MVT::i32);
+ SDValue Hi = DAG.getNode(PPCISD::Hi, dl, PtrVT, TGAHi, TLSReg);
+ return DAG.getNode(PPCISD::Lo, dl, PtrVT, TGALo, Hi);
+ }
+
+ if (!is64bit)
+ llvm_unreachable("only local-exec is currently supported for ppc32");
+
+ if (Model == TLSModel::InitialExec) {
+ SDValue TGA = DAG.getTargetGlobalAddress(GV, dl, PtrVT, 0, 0);
+ SDValue GOTReg = DAG.getRegister(PPC::X2, MVT::i64);
+ SDValue TPOffsetHi = DAG.getNode(PPCISD::ADDIS_GOT_TPREL_HA, dl,
+ PtrVT, GOTReg, TGA);
+ SDValue TPOffset = DAG.getNode(PPCISD::LD_GOT_TPREL_L, dl,
+ PtrVT, TGA, TPOffsetHi);
+ return DAG.getNode(PPCISD::ADD_TLS, dl, PtrVT, TPOffset, TGA);
+ }
+
+ if (Model == TLSModel::GeneralDynamic) {
+ SDValue TGA = DAG.getTargetGlobalAddress(GV, dl, PtrVT, 0, 0);
+ SDValue GOTReg = DAG.getRegister(PPC::X2, MVT::i64);
+ SDValue GOTEntryHi = DAG.getNode(PPCISD::ADDIS_TLSGD_HA, dl, PtrVT,
+ GOTReg, TGA);
+ SDValue GOTEntry = DAG.getNode(PPCISD::ADDI_TLSGD_L, dl, PtrVT,
+ GOTEntryHi, TGA);
+
+ // We need a chain node, and don't have one handy. The underlying
+ // call has no side effects, so using the function entry node
+ // suffices.
+ SDValue Chain = DAG.getEntryNode();
+ Chain = DAG.getCopyToReg(Chain, dl, PPC::X3, GOTEntry);
+ SDValue ParmReg = DAG.getRegister(PPC::X3, MVT::i64);
+ SDValue TLSAddr = DAG.getNode(PPCISD::GET_TLS_ADDR, dl,
+ PtrVT, ParmReg, TGA);
+ // The return value from GET_TLS_ADDR really is in X3 already, but
+ // some hacks are needed here to tie everything together. The extra
+ // copies dissolve during subsequent transforms.
+ Chain = DAG.getCopyToReg(Chain, dl, PPC::X3, TLSAddr);
+ return DAG.getCopyFromReg(Chain, dl, PPC::X3, PtrVT);
+ }
+
+ if (Model == TLSModel::LocalDynamic) {
+ SDValue TGA = DAG.getTargetGlobalAddress(GV, dl, PtrVT, 0, 0);
+ SDValue GOTReg = DAG.getRegister(PPC::X2, MVT::i64);
+ SDValue GOTEntryHi = DAG.getNode(PPCISD::ADDIS_TLSLD_HA, dl, PtrVT,
+ GOTReg, TGA);
+ SDValue GOTEntry = DAG.getNode(PPCISD::ADDI_TLSLD_L, dl, PtrVT,
+ GOTEntryHi, TGA);
+
+ // We need a chain node, and don't have one handy. The underlying
+ // call has no side effects, so using the function entry node
+ // suffices.
+ SDValue Chain = DAG.getEntryNode();
+ Chain = DAG.getCopyToReg(Chain, dl, PPC::X3, GOTEntry);
+ SDValue ParmReg = DAG.getRegister(PPC::X3, MVT::i64);
+ SDValue TLSAddr = DAG.getNode(PPCISD::GET_TLSLD_ADDR, dl,
+ PtrVT, ParmReg, TGA);
+ // The return value from GET_TLSLD_ADDR really is in X3 already, but
+ // some hacks are needed here to tie everything together. The extra
+ // copies dissolve during subsequent transforms.
+ Chain = DAG.getCopyToReg(Chain, dl, PPC::X3, TLSAddr);
+ SDValue DtvOffsetHi = DAG.getNode(PPCISD::ADDIS_DTPREL_HA, dl, PtrVT,
+ Chain, ParmReg, TGA);
+ return DAG.getNode(PPCISD::ADDI_DTPREL_L, dl, PtrVT, DtvOffsetHi, TGA);
+ }
+
+ llvm_unreachable("Unknown TLS model!");
+}
+
+SDValue PPCTargetLowering::LowerGlobalAddress(SDValue Op,
+ SelectionDAG &DAG) const {
+ EVT PtrVT = Op.getValueType();
+ GlobalAddressSDNode *GSDN = cast<GlobalAddressSDNode>(Op);
+ DebugLoc DL = GSDN->getDebugLoc();
+ const GlobalValue *GV = GSDN->getGlobal();
+
+ // 64-bit SVR4 ABI code is always position-independent.
+ // The actual address of the GlobalValue is stored in the TOC.
+ if (PPCSubTarget.isSVR4ABI() && PPCSubTarget.isPPC64()) {
+ SDValue GA = DAG.getTargetGlobalAddress(GV, DL, PtrVT, GSDN->getOffset());
+ return DAG.getNode(PPCISD::TOC_ENTRY, DL, MVT::i64, GA,
+ DAG.getRegister(PPC::X2, MVT::i64));
+ }
+
+ unsigned MOHiFlag, MOLoFlag;
+ bool isPIC = GetLabelAccessInfo(DAG.getTarget(), MOHiFlag, MOLoFlag, GV);
+
+ SDValue GAHi =
+ DAG.getTargetGlobalAddress(GV, DL, PtrVT, GSDN->getOffset(), MOHiFlag);
+ SDValue GALo =
+ DAG.getTargetGlobalAddress(GV, DL, PtrVT, GSDN->getOffset(), MOLoFlag);
+
+ SDValue Ptr = LowerLabelRef(GAHi, GALo, isPIC, DAG);
+
+ // If the global reference is actually to a non-lazy-pointer, we have to do an
+ // extra load to get the address of the global.
+ if (MOHiFlag & PPCII::MO_NLP_FLAG)
+ Ptr = DAG.getLoad(PtrVT, DL, DAG.getEntryNode(), Ptr, MachinePointerInfo(),
+ false, false, false, 0);
+ return Ptr;
+}
+
+SDValue PPCTargetLowering::LowerSETCC(SDValue Op, SelectionDAG &DAG) const {
+ ISD::CondCode CC = cast<CondCodeSDNode>(Op.getOperand(2))->get();
+ DebugLoc dl = Op.getDebugLoc();
+
+ // If we're comparing for equality to zero, expose the fact that this is
+ // implented as a ctlz/srl pair on ppc, so that the dag combiner can
+ // fold the new nodes.
+ if (ConstantSDNode *C = dyn_cast<ConstantSDNode>(Op.getOperand(1))) {
+ if (C->isNullValue() && CC == ISD::SETEQ) {
+ EVT VT = Op.getOperand(0).getValueType();
+ SDValue Zext = Op.getOperand(0);
+ if (VT.bitsLT(MVT::i32)) {
+ VT = MVT::i32;
+ Zext = DAG.getNode(ISD::ZERO_EXTEND, dl, VT, Op.getOperand(0));
+ }
+ unsigned Log2b = Log2_32(VT.getSizeInBits());
+ SDValue Clz = DAG.getNode(ISD::CTLZ, dl, VT, Zext);
+ SDValue Scc = DAG.getNode(ISD::SRL, dl, VT, Clz,
+ DAG.getConstant(Log2b, MVT::i32));
+ return DAG.getNode(ISD::TRUNCATE, dl, MVT::i32, Scc);
+ }
+ // Leave comparisons against 0 and -1 alone for now, since they're usually
+ // optimized. FIXME: revisit this when we can custom lower all setcc
+ // optimizations.
+ if (C->isAllOnesValue() || C->isNullValue())
+ return SDValue();
+ }
+
+ // If we have an integer seteq/setne, turn it into a compare against zero
+ // by xor'ing the rhs with the lhs, which is faster than setting a
+ // condition register, reading it back out, and masking the correct bit. The
+ // normal approach here uses sub to do this instead of xor. Using xor exposes
+ // the result to other bit-twiddling opportunities.
+ EVT LHSVT = Op.getOperand(0).getValueType();
+ if (LHSVT.isInteger() && (CC == ISD::SETEQ || CC == ISD::SETNE)) {
+ EVT VT = Op.getValueType();
+ SDValue Sub = DAG.getNode(ISD::XOR, dl, LHSVT, Op.getOperand(0),
+ Op.getOperand(1));
+ return DAG.getSetCC(dl, VT, Sub, DAG.getConstant(0, LHSVT), CC);
+ }
+ return SDValue();
+}
+
+SDValue PPCTargetLowering::LowerVAARG(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const {
+ SDNode *Node = Op.getNode();
+ EVT VT = Node->getValueType(0);
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ SDValue InChain = Node->getOperand(0);
+ SDValue VAListPtr = Node->getOperand(1);
+ const Value *SV = cast<SrcValueSDNode>(Node->getOperand(2))->getValue();
+ DebugLoc dl = Node->getDebugLoc();
+
+ assert(!Subtarget.isPPC64() && "LowerVAARG is PPC32 only");
+
+ // gpr_index
+ SDValue GprIndex = DAG.getExtLoad(ISD::ZEXTLOAD, dl, MVT::i32, InChain,
+ VAListPtr, MachinePointerInfo(SV), MVT::i8,
+ false, false, 0);
+ InChain = GprIndex.getValue(1);
+
+ if (VT == MVT::i64) {
+ // Check if GprIndex is even
+ SDValue GprAnd = DAG.getNode(ISD::AND, dl, MVT::i32, GprIndex,
+ DAG.getConstant(1, MVT::i32));
+ SDValue CC64 = DAG.getSetCC(dl, MVT::i32, GprAnd,
+ DAG.getConstant(0, MVT::i32), ISD::SETNE);
+ SDValue GprIndexPlusOne = DAG.getNode(ISD::ADD, dl, MVT::i32, GprIndex,
+ DAG.getConstant(1, MVT::i32));
+ // Align GprIndex to be even if it isn't
+ GprIndex = DAG.getNode(ISD::SELECT, dl, MVT::i32, CC64, GprIndexPlusOne,
+ GprIndex);
+ }
+
+ // fpr index is 1 byte after gpr
+ SDValue FprPtr = DAG.getNode(ISD::ADD, dl, PtrVT, VAListPtr,
+ DAG.getConstant(1, MVT::i32));
+
+ // fpr
+ SDValue FprIndex = DAG.getExtLoad(ISD::ZEXTLOAD, dl, MVT::i32, InChain,
+ FprPtr, MachinePointerInfo(SV), MVT::i8,
+ false, false, 0);
+ InChain = FprIndex.getValue(1);
+
+ SDValue RegSaveAreaPtr = DAG.getNode(ISD::ADD, dl, PtrVT, VAListPtr,
+ DAG.getConstant(8, MVT::i32));
+
+ SDValue OverflowAreaPtr = DAG.getNode(ISD::ADD, dl, PtrVT, VAListPtr,
+ DAG.getConstant(4, MVT::i32));
+
+ // areas
+ SDValue OverflowArea = DAG.getLoad(MVT::i32, dl, InChain, OverflowAreaPtr,
+ MachinePointerInfo(), false, false,
+ false, 0);
+ InChain = OverflowArea.getValue(1);
+
+ SDValue RegSaveArea = DAG.getLoad(MVT::i32, dl, InChain, RegSaveAreaPtr,
+ MachinePointerInfo(), false, false,
+ false, 0);
+ InChain = RegSaveArea.getValue(1);
+
+ // select overflow_area if index > 8
+ SDValue CC = DAG.getSetCC(dl, MVT::i32, VT.isInteger() ? GprIndex : FprIndex,
+ DAG.getConstant(8, MVT::i32), ISD::SETLT);
+
+ // adjustment constant gpr_index * 4/8
+ SDValue RegConstant = DAG.getNode(ISD::MUL, dl, MVT::i32,
+ VT.isInteger() ? GprIndex : FprIndex,
+ DAG.getConstant(VT.isInteger() ? 4 : 8,
+ MVT::i32));
+
+ // OurReg = RegSaveArea + RegConstant
+ SDValue OurReg = DAG.getNode(ISD::ADD, dl, PtrVT, RegSaveArea,
+ RegConstant);
+
+ // Floating types are 32 bytes into RegSaveArea
+ if (VT.isFloatingPoint())
+ OurReg = DAG.getNode(ISD::ADD, dl, PtrVT, OurReg,
+ DAG.getConstant(32, MVT::i32));
+
+ // increase {f,g}pr_index by 1 (or 2 if VT is i64)
+ SDValue IndexPlus1 = DAG.getNode(ISD::ADD, dl, MVT::i32,
+ VT.isInteger() ? GprIndex : FprIndex,
+ DAG.getConstant(VT == MVT::i64 ? 2 : 1,
+ MVT::i32));
+
+ InChain = DAG.getTruncStore(InChain, dl, IndexPlus1,
+ VT.isInteger() ? VAListPtr : FprPtr,
+ MachinePointerInfo(SV),
+ MVT::i8, false, false, 0);
+
+ // determine if we should load from reg_save_area or overflow_area
+ SDValue Result = DAG.getNode(ISD::SELECT, dl, PtrVT, CC, OurReg, OverflowArea);
+
+ // increase overflow_area by 4/8 if gpr/fpr > 8
+ SDValue OverflowAreaPlusN = DAG.getNode(ISD::ADD, dl, PtrVT, OverflowArea,
+ DAG.getConstant(VT.isInteger() ? 4 : 8,
+ MVT::i32));
+
+ OverflowArea = DAG.getNode(ISD::SELECT, dl, MVT::i32, CC, OverflowArea,
+ OverflowAreaPlusN);
+
+ InChain = DAG.getTruncStore(InChain, dl, OverflowArea,
+ OverflowAreaPtr,
+ MachinePointerInfo(),
+ MVT::i32, false, false, 0);
+
+ return DAG.getLoad(VT, dl, InChain, Result, MachinePointerInfo(),
+ false, false, false, 0);
+}
+
+SDValue PPCTargetLowering::LowerADJUST_TRAMPOLINE(SDValue Op,
+ SelectionDAG &DAG) const {
+ return Op.getOperand(0);
+}
+
+SDValue PPCTargetLowering::LowerINIT_TRAMPOLINE(SDValue Op,
+ SelectionDAG &DAG) const {
+ SDValue Chain = Op.getOperand(0);
+ SDValue Trmp = Op.getOperand(1); // trampoline
+ SDValue FPtr = Op.getOperand(2); // nested function
+ SDValue Nest = Op.getOperand(3); // 'nest' parameter value
+ DebugLoc dl = Op.getDebugLoc();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ bool isPPC64 = (PtrVT == MVT::i64);
+ Type *IntPtrTy =
+ DAG.getTargetLoweringInfo().getDataLayout()->getIntPtrType(
+ *DAG.getContext());
+
+ TargetLowering::ArgListTy Args;
+ TargetLowering::ArgListEntry Entry;
+
+ Entry.Ty = IntPtrTy;
+ Entry.Node = Trmp; Args.push_back(Entry);
+
+ // TrampSize == (isPPC64 ? 48 : 40);
+ Entry.Node = DAG.getConstant(isPPC64 ? 48 : 40,
+ isPPC64 ? MVT::i64 : MVT::i32);
+ Args.push_back(Entry);
+
+ Entry.Node = FPtr; Args.push_back(Entry);
+ Entry.Node = Nest; Args.push_back(Entry);
+
+ // Lower to a call to __trampoline_setup(Trmp, TrampSize, FPtr, ctx_reg)
+ TargetLowering::CallLoweringInfo CLI(Chain,
+ Type::getVoidTy(*DAG.getContext()),
+ false, false, false, false, 0,
+ CallingConv::C,
+ /*isTailCall=*/false,
+ /*doesNotRet=*/false,
+ /*isReturnValueUsed=*/true,
+ DAG.getExternalSymbol("__trampoline_setup", PtrVT),
+ Args, DAG, dl);
+ std::pair<SDValue, SDValue> CallResult = LowerCallTo(CLI);
+
+ return CallResult.second;
+}
+
+SDValue PPCTargetLowering::LowerVASTART(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const {
+ MachineFunction &MF = DAG.getMachineFunction();
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+
+ DebugLoc dl = Op.getDebugLoc();
+
+ if (Subtarget.isDarwinABI() || Subtarget.isPPC64()) {
+ // vastart just stores the address of the VarArgsFrameIndex slot into the
+ // memory location argument.
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ SDValue FR = DAG.getFrameIndex(FuncInfo->getVarArgsFrameIndex(), PtrVT);
+ const Value *SV = cast<SrcValueSDNode>(Op.getOperand(2))->getValue();
+ return DAG.getStore(Op.getOperand(0), dl, FR, Op.getOperand(1),
+ MachinePointerInfo(SV),
+ false, false, 0);
+ }
+
+ // For the 32-bit SVR4 ABI we follow the layout of the va_list struct.
+ // We suppose the given va_list is already allocated.
+ //
+ // typedef struct {
+ // char gpr; /* index into the array of 8 GPRs
+ // * stored in the register save area
+ // * gpr=0 corresponds to r3,
+ // * gpr=1 to r4, etc.
+ // */
+ // char fpr; /* index into the array of 8 FPRs
+ // * stored in the register save area
+ // * fpr=0 corresponds to f1,
+ // * fpr=1 to f2, etc.
+ // */
+ // char *overflow_arg_area;
+ // /* location on stack that holds
+ // * the next overflow argument
+ // */
+ // char *reg_save_area;
+ // /* where r3:r10 and f1:f8 (if saved)
+ // * are stored
+ // */
+ // } va_list[1];
+
+
+ SDValue ArgGPR = DAG.getConstant(FuncInfo->getVarArgsNumGPR(), MVT::i32);
+ SDValue ArgFPR = DAG.getConstant(FuncInfo->getVarArgsNumFPR(), MVT::i32);
+
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+
+ SDValue StackOffsetFI = DAG.getFrameIndex(FuncInfo->getVarArgsStackOffset(),
+ PtrVT);
+ SDValue FR = DAG.getFrameIndex(FuncInfo->getVarArgsFrameIndex(),
+ PtrVT);
+
+ uint64_t FrameOffset = PtrVT.getSizeInBits()/8;
+ SDValue ConstFrameOffset = DAG.getConstant(FrameOffset, PtrVT);
+
+ uint64_t StackOffset = PtrVT.getSizeInBits()/8 - 1;
+ SDValue ConstStackOffset = DAG.getConstant(StackOffset, PtrVT);
+
+ uint64_t FPROffset = 1;
+ SDValue ConstFPROffset = DAG.getConstant(FPROffset, PtrVT);
+
+ const Value *SV = cast<SrcValueSDNode>(Op.getOperand(2))->getValue();
+
+ // Store first byte : number of int regs
+ SDValue firstStore = DAG.getTruncStore(Op.getOperand(0), dl, ArgGPR,
+ Op.getOperand(1),
+ MachinePointerInfo(SV),
+ MVT::i8, false, false, 0);
+ uint64_t nextOffset = FPROffset;
+ SDValue nextPtr = DAG.getNode(ISD::ADD, dl, PtrVT, Op.getOperand(1),
+ ConstFPROffset);
+
+ // Store second byte : number of float regs
+ SDValue secondStore =
+ DAG.getTruncStore(firstStore, dl, ArgFPR, nextPtr,
+ MachinePointerInfo(SV, nextOffset), MVT::i8,
+ false, false, 0);
+ nextOffset += StackOffset;
+ nextPtr = DAG.getNode(ISD::ADD, dl, PtrVT, nextPtr, ConstStackOffset);
+
+ // Store second word : arguments given on stack
+ SDValue thirdStore =
+ DAG.getStore(secondStore, dl, StackOffsetFI, nextPtr,
+ MachinePointerInfo(SV, nextOffset),
+ false, false, 0);
+ nextOffset += FrameOffset;
+ nextPtr = DAG.getNode(ISD::ADD, dl, PtrVT, nextPtr, ConstFrameOffset);
+
+ // Store third word : arguments given in registers
+ return DAG.getStore(thirdStore, dl, FR, nextPtr,
+ MachinePointerInfo(SV, nextOffset),
+ false, false, 0);
+
+}
+
+#include "PPCGenCallingConv.inc"
+
+static bool CC_PPC32_SVR4_Custom_Dummy(unsigned &ValNo, MVT &ValVT, MVT &LocVT,
+ CCValAssign::LocInfo &LocInfo,
+ ISD::ArgFlagsTy &ArgFlags,
+ CCState &State) {
+ return true;
+}
+
+static bool CC_PPC32_SVR4_Custom_AlignArgRegs(unsigned &ValNo, MVT &ValVT,
+ MVT &LocVT,
+ CCValAssign::LocInfo &LocInfo,
+ ISD::ArgFlagsTy &ArgFlags,
+ CCState &State) {
+ static const uint16_t ArgRegs[] = {
+ PPC::R3, PPC::R4, PPC::R5, PPC::R6,
+ PPC::R7, PPC::R8, PPC::R9, PPC::R10,
+ };
+ const unsigned NumArgRegs = array_lengthof(ArgRegs);
+
+ unsigned RegNum = State.getFirstUnallocated(ArgRegs, NumArgRegs);
+
+ // Skip one register if the first unallocated register has an even register
+ // number and there are still argument registers available which have not been
+ // allocated yet. RegNum is actually an index into ArgRegs, which means we
+ // need to skip a register if RegNum is odd.
+ if (RegNum != NumArgRegs && RegNum % 2 == 1) {
+ State.AllocateReg(ArgRegs[RegNum]);
+ }
+
+ // Always return false here, as this function only makes sure that the first
+ // unallocated register has an odd register number and does not actually
+ // allocate a register for the current argument.
+ return false;
+}
+
+static bool CC_PPC32_SVR4_Custom_AlignFPArgRegs(unsigned &ValNo, MVT &ValVT,
+ MVT &LocVT,
+ CCValAssign::LocInfo &LocInfo,
+ ISD::ArgFlagsTy &ArgFlags,
+ CCState &State) {
+ static const uint16_t ArgRegs[] = {
+ PPC::F1, PPC::F2, PPC::F3, PPC::F4, PPC::F5, PPC::F6, PPC::F7,
+ PPC::F8
+ };
+
+ const unsigned NumArgRegs = array_lengthof(ArgRegs);
+
+ unsigned RegNum = State.getFirstUnallocated(ArgRegs, NumArgRegs);
+
+ // If there is only one Floating-point register left we need to put both f64
+ // values of a split ppc_fp128 value on the stack.
+ if (RegNum != NumArgRegs && ArgRegs[RegNum] == PPC::F8) {
+ State.AllocateReg(ArgRegs[RegNum]);
+ }
+
+ // Always return false here, as this function only makes sure that the two f64
+ // values a ppc_fp128 value is split into are both passed in registers or both
+ // passed on the stack and does not actually allocate a register for the
+ // current argument.
+ return false;
+}
+
+/// GetFPR - Get the set of FP registers that should be allocated for arguments,
+/// on Darwin.
+static const uint16_t *GetFPR() {
+ static const uint16_t FPR[] = {
+ PPC::F1, PPC::F2, PPC::F3, PPC::F4, PPC::F5, PPC::F6, PPC::F7,
+ PPC::F8, PPC::F9, PPC::F10, PPC::F11, PPC::F12, PPC::F13
+ };
+
+ return FPR;
+}
+
+/// CalculateStackSlotSize - Calculates the size reserved for this argument on
+/// the stack.
+static unsigned CalculateStackSlotSize(EVT ArgVT, ISD::ArgFlagsTy Flags,
+ unsigned PtrByteSize) {
+ unsigned ArgSize = ArgVT.getSizeInBits()/8;
+ if (Flags.isByVal())
+ ArgSize = Flags.getByValSize();
+ ArgSize = ((ArgSize + PtrByteSize - 1)/PtrByteSize) * PtrByteSize;
+
+ return ArgSize;
+}
+
+SDValue
+PPCTargetLowering::LowerFormalArguments(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg>
+ &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals)
+ const {
+ if (PPCSubTarget.isSVR4ABI()) {
+ if (PPCSubTarget.isPPC64())
+ return LowerFormalArguments_64SVR4(Chain, CallConv, isVarArg, Ins,
+ dl, DAG, InVals);
+ else
+ return LowerFormalArguments_32SVR4(Chain, CallConv, isVarArg, Ins,
+ dl, DAG, InVals);
+ } else {
+ return LowerFormalArguments_Darwin(Chain, CallConv, isVarArg, Ins,
+ dl, DAG, InVals);
+ }
+}
+
+SDValue
+PPCTargetLowering::LowerFormalArguments_32SVR4(
+ SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg>
+ &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+
+ // 32-bit SVR4 ABI Stack Frame Layout:
+ // +-----------------------------------+
+ // +--> | Back chain |
+ // | +-----------------------------------+
+ // | | Floating-point register save area |
+ // | +-----------------------------------+
+ // | | General register save area |
+ // | +-----------------------------------+
+ // | | CR save word |
+ // | +-----------------------------------+
+ // | | VRSAVE save word |
+ // | +-----------------------------------+
+ // | | Alignment padding |
+ // | +-----------------------------------+
+ // | | Vector register save area |
+ // | +-----------------------------------+
+ // | | Local variable space |
+ // | +-----------------------------------+
+ // | | Parameter list area |
+ // | +-----------------------------------+
+ // | | LR save word |
+ // | +-----------------------------------+
+ // SP--> +--- | Back chain |
+ // +-----------------------------------+
+ //
+ // Specifications:
+ // System V Application Binary Interface PowerPC Processor Supplement
+ // AltiVec Technology Programming Interface Manual
+
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ // Potential tail calls could cause overwriting of argument stack slots.
+ bool isImmutable = !(getTargetMachine().Options.GuaranteedTailCallOpt &&
+ (CallConv == CallingConv::Fast));
+ unsigned PtrByteSize = 4;
+
+ // Assign locations to all of the incoming arguments.
+ SmallVector<CCValAssign, 16> ArgLocs;
+ CCState CCInfo(CallConv, isVarArg, DAG.getMachineFunction(),
+ getTargetMachine(), ArgLocs, *DAG.getContext());
+
+ // Reserve space for the linkage area on the stack.
+ CCInfo.AllocateStack(PPCFrameLowering::getLinkageSize(false, false), PtrByteSize);
+
+ CCInfo.AnalyzeFormalArguments(Ins, CC_PPC32_SVR4);
+
+ for (unsigned i = 0, e = ArgLocs.size(); i != e; ++i) {
+ CCValAssign &VA = ArgLocs[i];
+
+ // Arguments stored in registers.
+ if (VA.isRegLoc()) {
+ const TargetRegisterClass *RC;
+ EVT ValVT = VA.getValVT();
+
+ switch (ValVT.getSimpleVT().SimpleTy) {
+ default:
+ llvm_unreachable("ValVT not supported by formal arguments Lowering");
+ case MVT::i32:
+ RC = &PPC::GPRCRegClass;
+ break;
+ case MVT::f32:
+ RC = &PPC::F4RCRegClass;
+ break;
+ case MVT::f64:
+ RC = &PPC::F8RCRegClass;
+ break;
+ case MVT::v16i8:
+ case MVT::v8i16:
+ case MVT::v4i32:
+ case MVT::v4f32:
+ RC = &PPC::VRRCRegClass;
+ break;
+ }
+
+ // Transform the arguments stored in physical registers into virtual ones.
+ unsigned Reg = MF.addLiveIn(VA.getLocReg(), RC);
+ SDValue ArgValue = DAG.getCopyFromReg(Chain, dl, Reg, ValVT);
+
+ InVals.push_back(ArgValue);
+ } else {
+ // Argument stored in memory.
+ assert(VA.isMemLoc());
+
+ unsigned ArgSize = VA.getLocVT().getSizeInBits() / 8;
+ int FI = MFI->CreateFixedObject(ArgSize, VA.getLocMemOffset(),
+ isImmutable);
+
+ // Create load nodes to retrieve arguments from the stack.
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ InVals.push_back(DAG.getLoad(VA.getValVT(), dl, Chain, FIN,
+ MachinePointerInfo(),
+ false, false, false, 0));
+ }
+ }
+
+ // Assign locations to all of the incoming aggregate by value arguments.
+ // Aggregates passed by value are stored in the local variable space of the
+ // caller's stack frame, right above the parameter list area.
+ SmallVector<CCValAssign, 16> ByValArgLocs;
+ CCState CCByValInfo(CallConv, isVarArg, DAG.getMachineFunction(),
+ getTargetMachine(), ByValArgLocs, *DAG.getContext());
+
+ // Reserve stack space for the allocations in CCInfo.
+ CCByValInfo.AllocateStack(CCInfo.getNextStackOffset(), PtrByteSize);
+
+ CCByValInfo.AnalyzeFormalArguments(Ins, CC_PPC32_SVR4_ByVal);
+
+ // Area that is at least reserved in the caller of this function.
+ unsigned MinReservedArea = CCByValInfo.getNextStackOffset();
+
+ // Set the size that is at least reserved in caller of this function. Tail
+ // call optimized function's reserved stack space needs to be aligned so that
+ // taking the difference between two stack areas will result in an aligned
+ // stack.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+
+ MinReservedArea =
+ std::max(MinReservedArea,
+ PPCFrameLowering::getMinCallFrameSize(false, false));
+
+ unsigned TargetAlign = DAG.getMachineFunction().getTarget().getFrameLowering()->
+ getStackAlignment();
+ unsigned AlignMask = TargetAlign-1;
+ MinReservedArea = (MinReservedArea + AlignMask) & ~AlignMask;
+
+ FI->setMinReservedArea(MinReservedArea);
+
+ SmallVector<SDValue, 8> MemOps;
+
+ // If the function takes variable number of arguments, make a frame index for
+ // the start of the first vararg value... for expansion of llvm.va_start.
+ if (isVarArg) {
+ static const uint16_t GPArgRegs[] = {
+ PPC::R3, PPC::R4, PPC::R5, PPC::R6,
+ PPC::R7, PPC::R8, PPC::R9, PPC::R10,
+ };
+ const unsigned NumGPArgRegs = array_lengthof(GPArgRegs);
+
+ static const uint16_t FPArgRegs[] = {
+ PPC::F1, PPC::F2, PPC::F3, PPC::F4, PPC::F5, PPC::F6, PPC::F7,
+ PPC::F8
+ };
+ const unsigned NumFPArgRegs = array_lengthof(FPArgRegs);
+
+ FuncInfo->setVarArgsNumGPR(CCInfo.getFirstUnallocated(GPArgRegs,
+ NumGPArgRegs));
+ FuncInfo->setVarArgsNumFPR(CCInfo.getFirstUnallocated(FPArgRegs,
+ NumFPArgRegs));
+
+ // Make room for NumGPArgRegs and NumFPArgRegs.
+ int Depth = NumGPArgRegs * PtrVT.getSizeInBits()/8 +
+ NumFPArgRegs * EVT(MVT::f64).getSizeInBits()/8;
+
+ FuncInfo->setVarArgsStackOffset(
+ MFI->CreateFixedObject(PtrVT.getSizeInBits()/8,
+ CCInfo.getNextStackOffset(), true));
+
+ FuncInfo->setVarArgsFrameIndex(MFI->CreateStackObject(Depth, 8, false));
+ SDValue FIN = DAG.getFrameIndex(FuncInfo->getVarArgsFrameIndex(), PtrVT);
+
+ // The fixed integer arguments of a variadic function are stored to the
+ // VarArgsFrameIndex on the stack so that they may be loaded by deferencing
+ // the result of va_next.
+ for (unsigned GPRIndex = 0; GPRIndex != NumGPArgRegs; ++GPRIndex) {
+ // Get an existing live-in vreg, or add a new one.
+ unsigned VReg = MF.getRegInfo().getLiveInVirtReg(GPArgRegs[GPRIndex]);
+ if (!VReg)
+ VReg = MF.addLiveIn(GPArgRegs[GPRIndex], &PPC::GPRCRegClass);
+
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ SDValue Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(), false, false, 0);
+ MemOps.push_back(Store);
+ // Increment the address by four for the next argument to store
+ SDValue PtrOff = DAG.getConstant(PtrVT.getSizeInBits()/8, PtrVT);
+ FIN = DAG.getNode(ISD::ADD, dl, PtrOff.getValueType(), FIN, PtrOff);
+ }
+
+ // FIXME 32-bit SVR4: We only need to save FP argument registers if CR bit 6
+ // is set.
+ // The double arguments are stored to the VarArgsFrameIndex
+ // on the stack.
+ for (unsigned FPRIndex = 0; FPRIndex != NumFPArgRegs; ++FPRIndex) {
+ // Get an existing live-in vreg, or add a new one.
+ unsigned VReg = MF.getRegInfo().getLiveInVirtReg(FPArgRegs[FPRIndex]);
+ if (!VReg)
+ VReg = MF.addLiveIn(FPArgRegs[FPRIndex], &PPC::F8RCRegClass);
+
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, MVT::f64);
+ SDValue Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(), false, false, 0);
+ MemOps.push_back(Store);
+ // Increment the address by eight for the next argument to store
+ SDValue PtrOff = DAG.getConstant(EVT(MVT::f64).getSizeInBits()/8,
+ PtrVT);
+ FIN = DAG.getNode(ISD::ADD, dl, PtrOff.getValueType(), FIN, PtrOff);
+ }
+ }
+
+ if (!MemOps.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl,
+ MVT::Other, &MemOps[0], MemOps.size());
+
+ return Chain;
+}
+
+// PPC64 passes i8, i16, and i32 values in i64 registers. Promote
+// value to MVT::i64 and then truncate to the correct register size.
+SDValue
+PPCTargetLowering::extendArgForPPC64(ISD::ArgFlagsTy Flags, EVT ObjectVT,
+ SelectionDAG &DAG, SDValue ArgVal,
+ DebugLoc dl) const {
+ if (Flags.isSExt())
+ ArgVal = DAG.getNode(ISD::AssertSext, dl, MVT::i64, ArgVal,
+ DAG.getValueType(ObjectVT));
+ else if (Flags.isZExt())
+ ArgVal = DAG.getNode(ISD::AssertZext, dl, MVT::i64, ArgVal,
+ DAG.getValueType(ObjectVT));
+
+ return DAG.getNode(ISD::TRUNCATE, dl, MVT::i32, ArgVal);
+}
+
+// Set the size that is at least reserved in caller of this function. Tail
+// call optimized functions' reserved stack space needs to be aligned so that
+// taking the difference between two stack areas will result in an aligned
+// stack.
+void
+PPCTargetLowering::setMinReservedArea(MachineFunction &MF, SelectionDAG &DAG,
+ unsigned nAltivecParamsAtEnd,
+ unsigned MinReservedArea,
+ bool isPPC64) const {
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ // Add the Altivec parameters at the end, if needed.
+ if (nAltivecParamsAtEnd) {
+ MinReservedArea = ((MinReservedArea+15)/16)*16;
+ MinReservedArea += 16*nAltivecParamsAtEnd;
+ }
+ MinReservedArea =
+ std::max(MinReservedArea,
+ PPCFrameLowering::getMinCallFrameSize(isPPC64, true));
+ unsigned TargetAlign
+ = DAG.getMachineFunction().getTarget().getFrameLowering()->
+ getStackAlignment();
+ unsigned AlignMask = TargetAlign-1;
+ MinReservedArea = (MinReservedArea + AlignMask) & ~AlignMask;
+ FI->setMinReservedArea(MinReservedArea);
+}
+
+SDValue
+PPCTargetLowering::LowerFormalArguments_64SVR4(
+ SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg>
+ &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+ // TODO: add description of PPC stack frame format, or at least some docs.
+ //
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ // Potential tail calls could cause overwriting of argument stack slots.
+ bool isImmutable = !(getTargetMachine().Options.GuaranteedTailCallOpt &&
+ (CallConv == CallingConv::Fast));
+ unsigned PtrByteSize = 8;
+
+ unsigned ArgOffset = PPCFrameLowering::getLinkageSize(true, true);
+ // Area that is at least reserved in caller of this function.
+ unsigned MinReservedArea = ArgOffset;
+
+ static const uint16_t GPR[] = {
+ PPC::X3, PPC::X4, PPC::X5, PPC::X6,
+ PPC::X7, PPC::X8, PPC::X9, PPC::X10,
+ };
+
+ static const uint16_t *FPR = GetFPR();
+
+ static const uint16_t VR[] = {
+ PPC::V2, PPC::V3, PPC::V4, PPC::V5, PPC::V6, PPC::V7, PPC::V8,
+ PPC::V9, PPC::V10, PPC::V11, PPC::V12, PPC::V13
+ };
+
+ const unsigned Num_GPR_Regs = array_lengthof(GPR);
+ const unsigned Num_FPR_Regs = 13;
+ const unsigned Num_VR_Regs = array_lengthof(VR);
+
+ unsigned GPR_idx = 0, FPR_idx = 0, VR_idx = 0;
+
+ // Add DAG nodes to load the arguments or copy them out of registers. On
+ // entry to a function on PPC, the arguments start after the linkage area,
+ // although the first ones are often in registers.
+
+ SmallVector<SDValue, 8> MemOps;
+ unsigned nAltivecParamsAtEnd = 0;
+ Function::const_arg_iterator FuncArg = MF.getFunction()->arg_begin();
+ unsigned CurArgIdx = 0;
+ for (unsigned ArgNo = 0, e = Ins.size(); ArgNo != e; ++ArgNo) {
+ SDValue ArgVal;
+ bool needsLoad = false;
+ EVT ObjectVT = Ins[ArgNo].VT;
+ unsigned ObjSize = ObjectVT.getSizeInBits()/8;
+ unsigned ArgSize = ObjSize;
+ ISD::ArgFlagsTy Flags = Ins[ArgNo].Flags;
+ std::advance(FuncArg, Ins[ArgNo].OrigArgIndex - CurArgIdx);
+ CurArgIdx = Ins[ArgNo].OrigArgIndex;
+
+ unsigned CurArgOffset = ArgOffset;
+
+ // Varargs or 64 bit Altivec parameters are padded to a 16 byte boundary.
+ if (ObjectVT==MVT::v4f32 || ObjectVT==MVT::v4i32 ||
+ ObjectVT==MVT::v8i16 || ObjectVT==MVT::v16i8) {
+ if (isVarArg) {
+ MinReservedArea = ((MinReservedArea+15)/16)*16;
+ MinReservedArea += CalculateStackSlotSize(ObjectVT,
+ Flags,
+ PtrByteSize);
+ } else
+ nAltivecParamsAtEnd++;
+ } else
+ // Calculate min reserved area.
+ MinReservedArea += CalculateStackSlotSize(Ins[ArgNo].VT,
+ Flags,
+ PtrByteSize);
+
+ // FIXME the codegen can be much improved in some cases.
+ // We do not have to keep everything in memory.
+ if (Flags.isByVal()) {
+ // ObjSize is the true size, ArgSize rounded up to multiple of registers.
+ ObjSize = Flags.getByValSize();
+ ArgSize = ((ObjSize + PtrByteSize - 1)/PtrByteSize) * PtrByteSize;
+ // Empty aggregate parameters do not take up registers. Examples:
+ // struct { } a;
+ // union { } b;
+ // int c[0];
+ // etc. However, we have to provide a place-holder in InVals, so
+ // pretend we have an 8-byte item at the current address for that
+ // purpose.
+ if (!ObjSize) {
+ int FI = MFI->CreateFixedObject(PtrByteSize, ArgOffset, true);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ InVals.push_back(FIN);
+ continue;
+ }
+ // All aggregates smaller than 8 bytes must be passed right-justified.
+ if (ObjSize < PtrByteSize)
+ CurArgOffset = CurArgOffset + (PtrByteSize - ObjSize);
+ // The value of the object is its address.
+ int FI = MFI->CreateFixedObject(ObjSize, CurArgOffset, true);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ InVals.push_back(FIN);
+
+ if (ObjSize < 8) {
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ SDValue Store;
+
+ if (ObjSize==1 || ObjSize==2 || ObjSize==4) {
+ EVT ObjType = (ObjSize == 1 ? MVT::i8 :
+ (ObjSize == 2 ? MVT::i16 : MVT::i32));
+ Store = DAG.getTruncStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(FuncArg, CurArgOffset),
+ ObjType, false, false, 0);
+ } else {
+ // For sizes that don't fit a truncating store (3, 5, 6, 7),
+ // store the whole register as-is to the parameter save area
+ // slot. The address of the parameter was already calculated
+ // above (InVals.push_back(FIN)) to be the right-justified
+ // offset within the slot. For this store, we need a new
+ // frame index that points at the beginning of the slot.
+ int FI = MFI->CreateFixedObject(PtrByteSize, ArgOffset, true);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(FuncArg, ArgOffset),
+ false, false, 0);
+ }
+
+ MemOps.push_back(Store);
+ ++GPR_idx;
+ }
+ // Whether we copied from a register or not, advance the offset
+ // into the parameter save area by a full doubleword.
+ ArgOffset += PtrByteSize;
+ continue;
+ }
+
+ for (unsigned j = 0; j < ArgSize; j += PtrByteSize) {
+ // Store whatever pieces of the object are in registers
+ // to memory. ArgOffset will be the address of the beginning
+ // of the object.
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg;
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ int FI = MFI->CreateFixedObject(PtrByteSize, ArgOffset, true);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ SDValue Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(FuncArg, ArgOffset),
+ false, false, 0);
+ MemOps.push_back(Store);
+ ++GPR_idx;
+ ArgOffset += PtrByteSize;
+ } else {
+ ArgOffset += ArgSize - j;
+ break;
+ }
+ }
+ continue;
+ }
+
+ switch (ObjectVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Unhandled argument type!");
+ case MVT::i32:
+ case MVT::i64:
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, MVT::i64);
+
+ if (ObjectVT == MVT::i32)
+ // PPC64 passes i8, i16, and i32 values in i64 registers. Promote
+ // value to MVT::i64 and then truncate to the correct register size.
+ ArgVal = extendArgForPPC64(Flags, ObjectVT, DAG, ArgVal, dl);
+
+ ++GPR_idx;
+ } else {
+ needsLoad = true;
+ ArgSize = PtrByteSize;
+ }
+ ArgOffset += 8;
+ break;
+
+ case MVT::f32:
+ case MVT::f64:
+ // Every 8 bytes of argument space consumes one of the GPRs available for
+ // argument passing.
+ if (GPR_idx != Num_GPR_Regs) {
+ ++GPR_idx;
+ }
+ if (FPR_idx != Num_FPR_Regs) {
+ unsigned VReg;
+
+ if (ObjectVT == MVT::f32)
+ VReg = MF.addLiveIn(FPR[FPR_idx], &PPC::F4RCRegClass);
+ else
+ VReg = MF.addLiveIn(FPR[FPR_idx], &PPC::F8RCRegClass);
+
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, ObjectVT);
+ ++FPR_idx;
+ } else {
+ needsLoad = true;
+ ArgSize = PtrByteSize;
+ }
+
+ ArgOffset += 8;
+ break;
+ case MVT::v4f32:
+ case MVT::v4i32:
+ case MVT::v8i16:
+ case MVT::v16i8:
+ // Note that vector arguments in registers don't reserve stack space,
+ // except in varargs functions.
+ if (VR_idx != Num_VR_Regs) {
+ unsigned VReg = MF.addLiveIn(VR[VR_idx], &PPC::VRRCRegClass);
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, ObjectVT);
+ if (isVarArg) {
+ while ((ArgOffset % 16) != 0) {
+ ArgOffset += PtrByteSize;
+ if (GPR_idx != Num_GPR_Regs)
+ GPR_idx++;
+ }
+ ArgOffset += 16;
+ GPR_idx = std::min(GPR_idx+4, Num_GPR_Regs); // FIXME correct for ppc64?
+ }
+ ++VR_idx;
+ } else {
+ // Vectors are aligned.
+ ArgOffset = ((ArgOffset+15)/16)*16;
+ CurArgOffset = ArgOffset;
+ ArgOffset += 16;
+ needsLoad = true;
+ }
+ break;
+ }
+
+ // We need to load the argument to a virtual register if we determined
+ // above that we ran out of physical registers of the appropriate type.
+ if (needsLoad) {
+ int FI = MFI->CreateFixedObject(ObjSize,
+ CurArgOffset + (ArgSize - ObjSize),
+ isImmutable);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ ArgVal = DAG.getLoad(ObjectVT, dl, Chain, FIN, MachinePointerInfo(),
+ false, false, false, 0);
+ }
+
+ InVals.push_back(ArgVal);
+ }
+
+ // Set the size that is at least reserved in caller of this function. Tail
+ // call optimized functions' reserved stack space needs to be aligned so that
+ // taking the difference between two stack areas will result in an aligned
+ // stack.
+ setMinReservedArea(MF, DAG, nAltivecParamsAtEnd, MinReservedArea, true);
+
+ // If the function takes variable number of arguments, make a frame index for
+ // the start of the first vararg value... for expansion of llvm.va_start.
+ if (isVarArg) {
+ int Depth = ArgOffset;
+
+ FuncInfo->setVarArgsFrameIndex(
+ MFI->CreateFixedObject(PtrByteSize, Depth, true));
+ SDValue FIN = DAG.getFrameIndex(FuncInfo->getVarArgsFrameIndex(), PtrVT);
+
+ // If this function is vararg, store any remaining integer argument regs
+ // to their spots on the stack so that they may be loaded by deferencing the
+ // result of va_next.
+ for (; GPR_idx != Num_GPR_Regs; ++GPR_idx) {
+ unsigned VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ SDValue Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(), false, false, 0);
+ MemOps.push_back(Store);
+ // Increment the address by four for the next argument to store
+ SDValue PtrOff = DAG.getConstant(PtrByteSize, PtrVT);
+ FIN = DAG.getNode(ISD::ADD, dl, PtrOff.getValueType(), FIN, PtrOff);
+ }
+ }
+
+ if (!MemOps.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl,
+ MVT::Other, &MemOps[0], MemOps.size());
+
+ return Chain;
+}
+
+SDValue
+PPCTargetLowering::LowerFormalArguments_Darwin(
+ SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg>
+ &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+ // TODO: add description of PPC stack frame format, or at least some docs.
+ //
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ bool isPPC64 = PtrVT == MVT::i64;
+ // Potential tail calls could cause overwriting of argument stack slots.
+ bool isImmutable = !(getTargetMachine().Options.GuaranteedTailCallOpt &&
+ (CallConv == CallingConv::Fast));
+ unsigned PtrByteSize = isPPC64 ? 8 : 4;
+
+ unsigned ArgOffset = PPCFrameLowering::getLinkageSize(isPPC64, true);
+ // Area that is at least reserved in caller of this function.
+ unsigned MinReservedArea = ArgOffset;
+
+ static const uint16_t GPR_32[] = { // 32-bit registers.
+ PPC::R3, PPC::R4, PPC::R5, PPC::R6,
+ PPC::R7, PPC::R8, PPC::R9, PPC::R10,
+ };
+ static const uint16_t GPR_64[] = { // 64-bit registers.
+ PPC::X3, PPC::X4, PPC::X5, PPC::X6,
+ PPC::X7, PPC::X8, PPC::X9, PPC::X10,
+ };
+
+ static const uint16_t *FPR = GetFPR();
+
+ static const uint16_t VR[] = {
+ PPC::V2, PPC::V3, PPC::V4, PPC::V5, PPC::V6, PPC::V7, PPC::V8,
+ PPC::V9, PPC::V10, PPC::V11, PPC::V12, PPC::V13
+ };
+
+ const unsigned Num_GPR_Regs = array_lengthof(GPR_32);
+ const unsigned Num_FPR_Regs = 13;
+ const unsigned Num_VR_Regs = array_lengthof( VR);
+
+ unsigned GPR_idx = 0, FPR_idx = 0, VR_idx = 0;
+
+ const uint16_t *GPR = isPPC64 ? GPR_64 : GPR_32;
+
+ // In 32-bit non-varargs functions, the stack space for vectors is after the
+ // stack space for non-vectors. We do not use this space unless we have
+ // too many vectors to fit in registers, something that only occurs in
+ // constructed examples:), but we have to walk the arglist to figure
+ // that out...for the pathological case, compute VecArgOffset as the
+ // start of the vector parameter area. Computing VecArgOffset is the
+ // entire point of the following loop.
+ unsigned VecArgOffset = ArgOffset;
+ if (!isVarArg && !isPPC64) {
+ for (unsigned ArgNo = 0, e = Ins.size(); ArgNo != e;
+ ++ArgNo) {
+ EVT ObjectVT = Ins[ArgNo].VT;
+ ISD::ArgFlagsTy Flags = Ins[ArgNo].Flags;
+
+ if (Flags.isByVal()) {
+ // ObjSize is the true size, ArgSize rounded up to multiple of regs.
+ unsigned ObjSize = Flags.getByValSize();
+ unsigned ArgSize =
+ ((ObjSize + PtrByteSize - 1)/PtrByteSize) * PtrByteSize;
+ VecArgOffset += ArgSize;
+ continue;
+ }
+
+ switch(ObjectVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Unhandled argument type!");
+ case MVT::i32:
+ case MVT::f32:
+ VecArgOffset += 4;
+ break;
+ case MVT::i64: // PPC64
+ case MVT::f64:
+ // FIXME: We are guaranteed to be !isPPC64 at this point.
+ // Does MVT::i64 apply?
+ VecArgOffset += 8;
+ break;
+ case MVT::v4f32:
+ case MVT::v4i32:
+ case MVT::v8i16:
+ case MVT::v16i8:
+ // Nothing to do, we're only looking at Nonvector args here.
+ break;
+ }
+ }
+ }
+ // We've found where the vector parameter area in memory is. Skip the
+ // first 12 parameters; these don't use that memory.
+ VecArgOffset = ((VecArgOffset+15)/16)*16;
+ VecArgOffset += 12*16;
+
+ // Add DAG nodes to load the arguments or copy them out of registers. On
+ // entry to a function on PPC, the arguments start after the linkage area,
+ // although the first ones are often in registers.
+
+ SmallVector<SDValue, 8> MemOps;
+ unsigned nAltivecParamsAtEnd = 0;
+ // FIXME: FuncArg and Ins[ArgNo] must reference the same argument.
+ // When passing anonymous aggregates, this is currently not true.
+ // See LowerFormalArguments_64SVR4 for a fix.
+ Function::const_arg_iterator FuncArg = MF.getFunction()->arg_begin();
+ for (unsigned ArgNo = 0, e = Ins.size(); ArgNo != e; ++ArgNo, ++FuncArg) {
+ SDValue ArgVal;
+ bool needsLoad = false;
+ EVT ObjectVT = Ins[ArgNo].VT;
+ unsigned ObjSize = ObjectVT.getSizeInBits()/8;
+ unsigned ArgSize = ObjSize;
+ ISD::ArgFlagsTy Flags = Ins[ArgNo].Flags;
+
+ unsigned CurArgOffset = ArgOffset;
+
+ // Varargs or 64 bit Altivec parameters are padded to a 16 byte boundary.
+ if (ObjectVT==MVT::v4f32 || ObjectVT==MVT::v4i32 ||
+ ObjectVT==MVT::v8i16 || ObjectVT==MVT::v16i8) {
+ if (isVarArg || isPPC64) {
+ MinReservedArea = ((MinReservedArea+15)/16)*16;
+ MinReservedArea += CalculateStackSlotSize(ObjectVT,
+ Flags,
+ PtrByteSize);
+ } else nAltivecParamsAtEnd++;
+ } else
+ // Calculate min reserved area.
+ MinReservedArea += CalculateStackSlotSize(Ins[ArgNo].VT,
+ Flags,
+ PtrByteSize);
+
+ // FIXME the codegen can be much improved in some cases.
+ // We do not have to keep everything in memory.
+ if (Flags.isByVal()) {
+ // ObjSize is the true size, ArgSize rounded up to multiple of registers.
+ ObjSize = Flags.getByValSize();
+ ArgSize = ((ObjSize + PtrByteSize - 1)/PtrByteSize) * PtrByteSize;
+ // Objects of size 1 and 2 are right justified, everything else is
+ // left justified. This means the memory address is adjusted forwards.
+ if (ObjSize==1 || ObjSize==2) {
+ CurArgOffset = CurArgOffset + (4 - ObjSize);
+ }
+ // The value of the object is its address.
+ int FI = MFI->CreateFixedObject(ObjSize, CurArgOffset, true);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ InVals.push_back(FIN);
+ if (ObjSize==1 || ObjSize==2) {
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg;
+ if (isPPC64)
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ else
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::GPRCRegClass);
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ EVT ObjType = ObjSize == 1 ? MVT::i8 : MVT::i16;
+ SDValue Store = DAG.getTruncStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(FuncArg,
+ CurArgOffset),
+ ObjType, false, false, 0);
+ MemOps.push_back(Store);
+ ++GPR_idx;
+ }
+
+ ArgOffset += PtrByteSize;
+
+ continue;
+ }
+ for (unsigned j = 0; j < ArgSize; j += PtrByteSize) {
+ // Store whatever pieces of the object are in registers
+ // to memory. ArgOffset will be the address of the beginning
+ // of the object.
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg;
+ if (isPPC64)
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ else
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::GPRCRegClass);
+ int FI = MFI->CreateFixedObject(PtrByteSize, ArgOffset, true);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ SDValue Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(FuncArg, ArgOffset),
+ false, false, 0);
+ MemOps.push_back(Store);
+ ++GPR_idx;
+ ArgOffset += PtrByteSize;
+ } else {
+ ArgOffset += ArgSize - (ArgOffset-CurArgOffset);
+ break;
+ }
+ }
+ continue;
+ }
+
+ switch (ObjectVT.getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Unhandled argument type!");
+ case MVT::i32:
+ if (!isPPC64) {
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::GPRCRegClass);
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, MVT::i32);
+ ++GPR_idx;
+ } else {
+ needsLoad = true;
+ ArgSize = PtrByteSize;
+ }
+ // All int arguments reserve stack space in the Darwin ABI.
+ ArgOffset += PtrByteSize;
+ break;
+ }
+ // FALLTHROUGH
+ case MVT::i64: // PPC64
+ if (GPR_idx != Num_GPR_Regs) {
+ unsigned VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, MVT::i64);
+
+ if (ObjectVT == MVT::i32)
+ // PPC64 passes i8, i16, and i32 values in i64 registers. Promote
+ // value to MVT::i64 and then truncate to the correct register size.
+ ArgVal = extendArgForPPC64(Flags, ObjectVT, DAG, ArgVal, dl);
+
+ ++GPR_idx;
+ } else {
+ needsLoad = true;
+ ArgSize = PtrByteSize;
+ }
+ // All int arguments reserve stack space in the Darwin ABI.
+ ArgOffset += 8;
+ break;
+
+ case MVT::f32:
+ case MVT::f64:
+ // Every 4 bytes of argument space consumes one of the GPRs available for
+ // argument passing.
+ if (GPR_idx != Num_GPR_Regs) {
+ ++GPR_idx;
+ if (ObjSize == 8 && GPR_idx != Num_GPR_Regs && !isPPC64)
+ ++GPR_idx;
+ }
+ if (FPR_idx != Num_FPR_Regs) {
+ unsigned VReg;
+
+ if (ObjectVT == MVT::f32)
+ VReg = MF.addLiveIn(FPR[FPR_idx], &PPC::F4RCRegClass);
+ else
+ VReg = MF.addLiveIn(FPR[FPR_idx], &PPC::F8RCRegClass);
+
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, ObjectVT);
+ ++FPR_idx;
+ } else {
+ needsLoad = true;
+ }
+
+ // All FP arguments reserve stack space in the Darwin ABI.
+ ArgOffset += isPPC64 ? 8 : ObjSize;
+ break;
+ case MVT::v4f32:
+ case MVT::v4i32:
+ case MVT::v8i16:
+ case MVT::v16i8:
+ // Note that vector arguments in registers don't reserve stack space,
+ // except in varargs functions.
+ if (VR_idx != Num_VR_Regs) {
+ unsigned VReg = MF.addLiveIn(VR[VR_idx], &PPC::VRRCRegClass);
+ ArgVal = DAG.getCopyFromReg(Chain, dl, VReg, ObjectVT);
+ if (isVarArg) {
+ while ((ArgOffset % 16) != 0) {
+ ArgOffset += PtrByteSize;
+ if (GPR_idx != Num_GPR_Regs)
+ GPR_idx++;
+ }
+ ArgOffset += 16;
+ GPR_idx = std::min(GPR_idx+4, Num_GPR_Regs); // FIXME correct for ppc64?
+ }
+ ++VR_idx;
+ } else {
+ if (!isVarArg && !isPPC64) {
+ // Vectors go after all the nonvectors.
+ CurArgOffset = VecArgOffset;
+ VecArgOffset += 16;
+ } else {
+ // Vectors are aligned.
+ ArgOffset = ((ArgOffset+15)/16)*16;
+ CurArgOffset = ArgOffset;
+ ArgOffset += 16;
+ }
+ needsLoad = true;
+ }
+ break;
+ }
+
+ // We need to load the argument to a virtual register if we determined above
+ // that we ran out of physical registers of the appropriate type.
+ if (needsLoad) {
+ int FI = MFI->CreateFixedObject(ObjSize,
+ CurArgOffset + (ArgSize - ObjSize),
+ isImmutable);
+ SDValue FIN = DAG.getFrameIndex(FI, PtrVT);
+ ArgVal = DAG.getLoad(ObjectVT, dl, Chain, FIN, MachinePointerInfo(),
+ false, false, false, 0);
+ }
+
+ InVals.push_back(ArgVal);
+ }
+
+ // Set the size that is at least reserved in caller of this function. Tail
+ // call optimized functions' reserved stack space needs to be aligned so that
+ // taking the difference between two stack areas will result in an aligned
+ // stack.
+ setMinReservedArea(MF, DAG, nAltivecParamsAtEnd, MinReservedArea, isPPC64);
+
+ // If the function takes variable number of arguments, make a frame index for
+ // the start of the first vararg value... for expansion of llvm.va_start.
+ if (isVarArg) {
+ int Depth = ArgOffset;
+
+ FuncInfo->setVarArgsFrameIndex(
+ MFI->CreateFixedObject(PtrVT.getSizeInBits()/8,
+ Depth, true));
+ SDValue FIN = DAG.getFrameIndex(FuncInfo->getVarArgsFrameIndex(), PtrVT);
+
+ // If this function is vararg, store any remaining integer argument regs
+ // to their spots on the stack so that they may be loaded by deferencing the
+ // result of va_next.
+ for (; GPR_idx != Num_GPR_Regs; ++GPR_idx) {
+ unsigned VReg;
+
+ if (isPPC64)
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::G8RCRegClass);
+ else
+ VReg = MF.addLiveIn(GPR[GPR_idx], &PPC::GPRCRegClass);
+
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, VReg, PtrVT);
+ SDValue Store = DAG.getStore(Val.getValue(1), dl, Val, FIN,
+ MachinePointerInfo(), false, false, 0);
+ MemOps.push_back(Store);
+ // Increment the address by four for the next argument to store
+ SDValue PtrOff = DAG.getConstant(PtrVT.getSizeInBits()/8, PtrVT);
+ FIN = DAG.getNode(ISD::ADD, dl, PtrOff.getValueType(), FIN, PtrOff);
+ }
+ }
+
+ if (!MemOps.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl,
+ MVT::Other, &MemOps[0], MemOps.size());
+
+ return Chain;
+}
+
+/// CalculateParameterAndLinkageAreaSize - Get the size of the parameter plus
+/// linkage area for the Darwin ABI, or the 64-bit SVR4 ABI.
+static unsigned
+CalculateParameterAndLinkageAreaSize(SelectionDAG &DAG,
+ bool isPPC64,
+ bool isVarArg,
+ unsigned CC,
+ const SmallVectorImpl<ISD::OutputArg>
+ &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ unsigned &nAltivecParamsAtEnd) {
+ // Count how many bytes are to be pushed on the stack, including the linkage
+ // area, and parameter passing area. We start with 24/48 bytes, which is
+ // prereserved space for [SP][CR][LR][3 x unused].
+ unsigned NumBytes = PPCFrameLowering::getLinkageSize(isPPC64, true);
+ unsigned NumOps = Outs.size();
+ unsigned PtrByteSize = isPPC64 ? 8 : 4;
+
+ // Add up all the space actually used.
+ // In 32-bit non-varargs calls, Altivec parameters all go at the end; usually
+ // they all go in registers, but we must reserve stack space for them for
+ // possible use by the caller. In varargs or 64-bit calls, parameters are
+ // assigned stack space in order, with padding so Altivec parameters are
+ // 16-byte aligned.
+ nAltivecParamsAtEnd = 0;
+ for (unsigned i = 0; i != NumOps; ++i) {
+ ISD::ArgFlagsTy Flags = Outs[i].Flags;
+ EVT ArgVT = Outs[i].VT;
+ // Varargs Altivec parameters are padded to a 16 byte boundary.
+ if (ArgVT==MVT::v4f32 || ArgVT==MVT::v4i32 ||
+ ArgVT==MVT::v8i16 || ArgVT==MVT::v16i8) {
+ if (!isVarArg && !isPPC64) {
+ // Non-varargs Altivec parameters go after all the non-Altivec
+ // parameters; handle those later so we know how much padding we need.
+ nAltivecParamsAtEnd++;
+ continue;
+ }
+ // Varargs and 64-bit Altivec parameters are padded to 16 byte boundary.
+ NumBytes = ((NumBytes+15)/16)*16;
+ }
+ NumBytes += CalculateStackSlotSize(ArgVT, Flags, PtrByteSize);
+ }
+
+ // Allow for Altivec parameters at the end, if needed.
+ if (nAltivecParamsAtEnd) {
+ NumBytes = ((NumBytes+15)/16)*16;
+ NumBytes += 16*nAltivecParamsAtEnd;
+ }
+
+ // The prolog code of the callee may store up to 8 GPR argument registers to
+ // the stack, allowing va_start to index over them in memory if its varargs.
+ // Because we cannot tell if this is needed on the caller side, we have to
+ // conservatively assume that it is needed. As such, make sure we have at
+ // least enough stack space for the caller to store the 8 GPRs.
+ NumBytes = std::max(NumBytes,
+ PPCFrameLowering::getMinCallFrameSize(isPPC64, true));
+
+ // Tail call needs the stack to be aligned.
+ if (CC == CallingConv::Fast && DAG.getTarget().Options.GuaranteedTailCallOpt){
+ unsigned TargetAlign = DAG.getMachineFunction().getTarget().
+ getFrameLowering()->getStackAlignment();
+ unsigned AlignMask = TargetAlign-1;
+ NumBytes = (NumBytes + AlignMask) & ~AlignMask;
+ }
+
+ return NumBytes;
+}
+
+/// CalculateTailCallSPDiff - Get the amount the stack pointer has to be
+/// adjusted to accommodate the arguments for the tailcall.
+static int CalculateTailCallSPDiff(SelectionDAG& DAG, bool isTailCall,
+ unsigned ParamSize) {
+
+ if (!isTailCall) return 0;
+
+ PPCFunctionInfo *FI = DAG.getMachineFunction().getInfo<PPCFunctionInfo>();
+ unsigned CallerMinReservedArea = FI->getMinReservedArea();
+ int SPDiff = (int)CallerMinReservedArea - (int)ParamSize;
+ // Remember only if the new adjustement is bigger.
+ if (SPDiff < FI->getTailCallSPDelta())
+ FI->setTailCallSPDelta(SPDiff);
+
+ return SPDiff;
+}
+
+/// IsEligibleForTailCallOptimization - Check whether the call is eligible
+/// for tail call optimization. Targets which want to do tail call
+/// optimization should implement this function.
+bool
+PPCTargetLowering::IsEligibleForTailCallOptimization(SDValue Callee,
+ CallingConv::ID CalleeCC,
+ bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ SelectionDAG& DAG) const {
+ if (!getTargetMachine().Options.GuaranteedTailCallOpt)
+ return false;
+
+ // Variable argument functions are not supported.
+ if (isVarArg)
+ return false;
+
+ MachineFunction &MF = DAG.getMachineFunction();
+ CallingConv::ID CallerCC = MF.getFunction()->getCallingConv();
+ if (CalleeCC == CallingConv::Fast && CallerCC == CalleeCC) {
+ // Functions containing by val parameters are not supported.
+ for (unsigned i = 0; i != Ins.size(); i++) {
+ ISD::ArgFlagsTy Flags = Ins[i].Flags;
+ if (Flags.isByVal()) return false;
+ }
+
+ // Non PIC/GOT tail calls are supported.
+ if (getTargetMachine().getRelocationModel() != Reloc::PIC_)
+ return true;
+
+ // At the moment we can only do local tail calls (in same module, hidden
+ // or protected) if we are generating PIC.
+ if (GlobalAddressSDNode *G = dyn_cast<GlobalAddressSDNode>(Callee))
+ return G->getGlobal()->hasHiddenVisibility()
+ || G->getGlobal()->hasProtectedVisibility();
+ }
+
+ return false;
+}
+
+/// isCallCompatibleAddress - Return the immediate to use if the specified
+/// 32-bit value is representable in the immediate field of a BxA instruction.
+static SDNode *isBLACompatibleAddress(SDValue Op, SelectionDAG &DAG) {
+ ConstantSDNode *C = dyn_cast<ConstantSDNode>(Op);
+ if (!C) return 0;
+
+ int Addr = C->getZExtValue();
+ if ((Addr & 3) != 0 || // Low 2 bits are implicitly zero.
+ SignExtend32<26>(Addr) != Addr)
+ return 0; // Top 6 bits have to be sext of immediate.
+
+ return DAG.getConstant((int)C->getZExtValue() >> 2,
+ DAG.getTargetLoweringInfo().getPointerTy()).getNode();
+}
+
+namespace {
+
+struct TailCallArgumentInfo {
+ SDValue Arg;
+ SDValue FrameIdxOp;
+ int FrameIdx;
+
+ TailCallArgumentInfo() : FrameIdx(0) {}
+};
+
+}
+
+/// StoreTailCallArgumentsToStackSlot - Stores arguments to their stack slot.
+static void
+StoreTailCallArgumentsToStackSlot(SelectionDAG &DAG,
+ SDValue Chain,
+ const SmallVector<TailCallArgumentInfo, 8> &TailCallArgs,
+ SmallVector<SDValue, 8> &MemOpChains,
+ DebugLoc dl) {
+ for (unsigned i = 0, e = TailCallArgs.size(); i != e; ++i) {
+ SDValue Arg = TailCallArgs[i].Arg;
+ SDValue FIN = TailCallArgs[i].FrameIdxOp;
+ int FI = TailCallArgs[i].FrameIdx;
+ // Store relative to framepointer.
+ MemOpChains.push_back(DAG.getStore(Chain, dl, Arg, FIN,
+ MachinePointerInfo::getFixedStack(FI),
+ false, false, 0));
+ }
+}
+
+/// EmitTailCallStoreFPAndRetAddr - Move the frame pointer and return address to
+/// the appropriate stack slot for the tail call optimized function call.
+static SDValue EmitTailCallStoreFPAndRetAddr(SelectionDAG &DAG,
+ MachineFunction &MF,
+ SDValue Chain,
+ SDValue OldRetAddr,
+ SDValue OldFP,
+ int SPDiff,
+ bool isPPC64,
+ bool isDarwinABI,
+ DebugLoc dl) {
+ if (SPDiff) {
+ // Calculate the new stack slot for the return address.
+ int SlotSize = isPPC64 ? 8 : 4;
+ int NewRetAddrLoc = SPDiff + PPCFrameLowering::getReturnSaveOffset(isPPC64,
+ isDarwinABI);
+ int NewRetAddr = MF.getFrameInfo()->CreateFixedObject(SlotSize,
+ NewRetAddrLoc, true);
+ EVT VT = isPPC64 ? MVT::i64 : MVT::i32;
+ SDValue NewRetAddrFrIdx = DAG.getFrameIndex(NewRetAddr, VT);
+ Chain = DAG.getStore(Chain, dl, OldRetAddr, NewRetAddrFrIdx,
+ MachinePointerInfo::getFixedStack(NewRetAddr),
+ false, false, 0);
+
+ // When using the 32/64-bit SVR4 ABI there is no need to move the FP stack
+ // slot as the FP is never overwritten.
+ if (isDarwinABI) {
+ int NewFPLoc =
+ SPDiff + PPCFrameLowering::getFramePointerSaveOffset(isPPC64, isDarwinABI);
+ int NewFPIdx = MF.getFrameInfo()->CreateFixedObject(SlotSize, NewFPLoc,
+ true);
+ SDValue NewFramePtrIdx = DAG.getFrameIndex(NewFPIdx, VT);
+ Chain = DAG.getStore(Chain, dl, OldFP, NewFramePtrIdx,
+ MachinePointerInfo::getFixedStack(NewFPIdx),
+ false, false, 0);
+ }
+ }
+ return Chain;
+}
+
+/// CalculateTailCallArgDest - Remember Argument for later processing. Calculate
+/// the position of the argument.
+static void
+CalculateTailCallArgDest(SelectionDAG &DAG, MachineFunction &MF, bool isPPC64,
+ SDValue Arg, int SPDiff, unsigned ArgOffset,
+ SmallVector<TailCallArgumentInfo, 8>& TailCallArguments) {
+ int Offset = ArgOffset + SPDiff;
+ uint32_t OpSize = (Arg.getValueType().getSizeInBits()+7)/8;
+ int FI = MF.getFrameInfo()->CreateFixedObject(OpSize, Offset, true);
+ EVT VT = isPPC64 ? MVT::i64 : MVT::i32;
+ SDValue FIN = DAG.getFrameIndex(FI, VT);
+ TailCallArgumentInfo Info;
+ Info.Arg = Arg;
+ Info.FrameIdxOp = FIN;
+ Info.FrameIdx = FI;
+ TailCallArguments.push_back(Info);
+}
+
+/// EmitTCFPAndRetAddrLoad - Emit load from frame pointer and return address
+/// stack slot. Returns the chain as result and the loaded frame pointers in
+/// LROpOut/FPOpout. Used when tail calling.
+SDValue PPCTargetLowering::EmitTailCallLoadFPAndRetAddr(SelectionDAG & DAG,
+ int SPDiff,
+ SDValue Chain,
+ SDValue &LROpOut,
+ SDValue &FPOpOut,
+ bool isDarwinABI,
+ DebugLoc dl) const {
+ if (SPDiff) {
+ // Load the LR and FP stack slot for later adjusting.
+ EVT VT = PPCSubTarget.isPPC64() ? MVT::i64 : MVT::i32;
+ LROpOut = getReturnAddrFrameIndex(DAG);
+ LROpOut = DAG.getLoad(VT, dl, Chain, LROpOut, MachinePointerInfo(),
+ false, false, false, 0);
+ Chain = SDValue(LROpOut.getNode(), 1);
+
+ // When using the 32/64-bit SVR4 ABI there is no need to load the FP stack
+ // slot as the FP is never overwritten.
+ if (isDarwinABI) {
+ FPOpOut = getFramePointerFrameIndex(DAG);
+ FPOpOut = DAG.getLoad(VT, dl, Chain, FPOpOut, MachinePointerInfo(),
+ false, false, false, 0);
+ Chain = SDValue(FPOpOut.getNode(), 1);
+ }
+ }
+ return Chain;
+}
+
+/// CreateCopyOfByValArgument - Make a copy of an aggregate at address specified
+/// by "Src" to address "Dst" of size "Size". Alignment information is
+/// specified by the specific parameter attribute. The copy will be passed as
+/// a byval function parameter.
+/// Sometimes what we are copying is the end of a larger object, the part that
+/// does not fit in registers.
+static SDValue
+CreateCopyOfByValArgument(SDValue Src, SDValue Dst, SDValue Chain,
+ ISD::ArgFlagsTy Flags, SelectionDAG &DAG,
+ DebugLoc dl) {
+ SDValue SizeNode = DAG.getConstant(Flags.getByValSize(), MVT::i32);
+ return DAG.getMemcpy(Chain, dl, Dst, Src, SizeNode, Flags.getByValAlign(),
+ false, false, MachinePointerInfo(0),
+ MachinePointerInfo(0));
+}
+
+/// LowerMemOpCallTo - Store the argument to the stack or remember it in case of
+/// tail calls.
+static void
+LowerMemOpCallTo(SelectionDAG &DAG, MachineFunction &MF, SDValue Chain,
+ SDValue Arg, SDValue PtrOff, int SPDiff,
+ unsigned ArgOffset, bool isPPC64, bool isTailCall,
+ bool isVector, SmallVector<SDValue, 8> &MemOpChains,
+ SmallVector<TailCallArgumentInfo, 8> &TailCallArguments,
+ DebugLoc dl) {
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ if (!isTailCall) {
+ if (isVector) {
+ SDValue StackPtr;
+ if (isPPC64)
+ StackPtr = DAG.getRegister(PPC::X1, MVT::i64);
+ else
+ StackPtr = DAG.getRegister(PPC::R1, MVT::i32);
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, StackPtr,
+ DAG.getConstant(ArgOffset, PtrVT));
+ }
+ MemOpChains.push_back(DAG.getStore(Chain, dl, Arg, PtrOff,
+ MachinePointerInfo(), false, false, 0));
+ // Calculate and remember argument location.
+ } else CalculateTailCallArgDest(DAG, MF, isPPC64, Arg, SPDiff, ArgOffset,
+ TailCallArguments);
+}
+
+static
+void PrepareTailCall(SelectionDAG &DAG, SDValue &InFlag, SDValue &Chain,
+ DebugLoc dl, bool isPPC64, int SPDiff, unsigned NumBytes,
+ SDValue LROp, SDValue FPOp, bool isDarwinABI,
+ SmallVector<TailCallArgumentInfo, 8> &TailCallArguments) {
+ MachineFunction &MF = DAG.getMachineFunction();
+
+ // Emit a sequence of copyto/copyfrom virtual registers for arguments that
+ // might overwrite each other in case of tail call optimization.
+ SmallVector<SDValue, 8> MemOpChains2;
+ // Do not flag preceding copytoreg stuff together with the following stuff.
+ InFlag = SDValue();
+ StoreTailCallArgumentsToStackSlot(DAG, Chain, TailCallArguments,
+ MemOpChains2, dl);
+ if (!MemOpChains2.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl, MVT::Other,
+ &MemOpChains2[0], MemOpChains2.size());
+
+ // Store the return address to the appropriate stack slot.
+ Chain = EmitTailCallStoreFPAndRetAddr(DAG, MF, Chain, LROp, FPOp, SPDiff,
+ isPPC64, isDarwinABI, dl);
+
+ // Emit callseq_end just before tailcall node.
+ Chain = DAG.getCALLSEQ_END(Chain, DAG.getIntPtrConstant(NumBytes, true),
+ DAG.getIntPtrConstant(0, true), InFlag);
+ InFlag = Chain.getValue(1);
+}
+
+static
+unsigned PrepareCall(SelectionDAG &DAG, SDValue &Callee, SDValue &InFlag,
+ SDValue &Chain, DebugLoc dl, int SPDiff, bool isTailCall,
+ SmallVector<std::pair<unsigned, SDValue>, 8> &RegsToPass,
+ SmallVector<SDValue, 8> &Ops, std::vector<EVT> &NodeTys,
+ const PPCSubtarget &PPCSubTarget) {
+
+ bool isPPC64 = PPCSubTarget.isPPC64();
+ bool isSVR4ABI = PPCSubTarget.isSVR4ABI();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ NodeTys.push_back(MVT::Other); // Returns a chain
+ NodeTys.push_back(MVT::Glue); // Returns a flag for retval copy to use.
+
+ unsigned CallOpc = PPCISD::CALL;
+
+ bool needIndirectCall = true;
+ if (SDNode *Dest = isBLACompatibleAddress(Callee, DAG)) {
+ // If this is an absolute destination address, use the munged value.
+ Callee = SDValue(Dest, 0);
+ needIndirectCall = false;
+ }
+
+ if (GlobalAddressSDNode *G = dyn_cast<GlobalAddressSDNode>(Callee)) {
+ // XXX Work around for http://llvm.org/bugs/show_bug.cgi?id=5201
+ // Use indirect calls for ALL functions calls in JIT mode, since the
+ // far-call stubs may be outside relocation limits for a BL instruction.
+ if (!DAG.getTarget().getSubtarget<PPCSubtarget>().isJITCodeModel()) {
+ unsigned OpFlags = 0;
+ if (DAG.getTarget().getRelocationModel() != Reloc::Static &&
+ (PPCSubTarget.getTargetTriple().isMacOSX() &&
+ PPCSubTarget.getTargetTriple().isMacOSXVersionLT(10, 5)) &&
+ (G->getGlobal()->isDeclaration() ||
+ G->getGlobal()->isWeakForLinker())) {
+ // PC-relative references to external symbols should go through $stub,
+ // unless we're building with the leopard linker or later, which
+ // automatically synthesizes these stubs.
+ OpFlags = PPCII::MO_DARWIN_STUB;
+ }
+
+ // If the callee is a GlobalAddress/ExternalSymbol node (quite common,
+ // every direct call is) turn it into a TargetGlobalAddress /
+ // TargetExternalSymbol node so that legalize doesn't hack it.
+ Callee = DAG.getTargetGlobalAddress(G->getGlobal(), dl,
+ Callee.getValueType(),
+ 0, OpFlags);
+ needIndirectCall = false;
+ }
+ }
+
+ if (ExternalSymbolSDNode *S = dyn_cast<ExternalSymbolSDNode>(Callee)) {
+ unsigned char OpFlags = 0;
+
+ if (DAG.getTarget().getRelocationModel() != Reloc::Static &&
+ (PPCSubTarget.getTargetTriple().isMacOSX() &&
+ PPCSubTarget.getTargetTriple().isMacOSXVersionLT(10, 5))) {
+ // PC-relative references to external symbols should go through $stub,
+ // unless we're building with the leopard linker or later, which
+ // automatically synthesizes these stubs.
+ OpFlags = PPCII::MO_DARWIN_STUB;
+ }
+
+ Callee = DAG.getTargetExternalSymbol(S->getSymbol(), Callee.getValueType(),
+ OpFlags);
+ needIndirectCall = false;
+ }
+
+ if (needIndirectCall) {
+ // Otherwise, this is an indirect call. We have to use a MTCTR/BCTRL pair
+ // to do the call, we can't use PPCISD::CALL.
+ SDValue MTCTROps[] = {Chain, Callee, InFlag};
+
+ if (isSVR4ABI && isPPC64) {
+ // Function pointers in the 64-bit SVR4 ABI do not point to the function
+ // entry point, but to the function descriptor (the function entry point
+ // address is part of the function descriptor though).
+ // The function descriptor is a three doubleword structure with the
+ // following fields: function entry point, TOC base address and
+ // environment pointer.
+ // Thus for a call through a function pointer, the following actions need
+ // to be performed:
+ // 1. Save the TOC of the caller in the TOC save area of its stack
+ // frame (this is done in LowerCall_Darwin() or LowerCall_64SVR4()).
+ // 2. Load the address of the function entry point from the function
+ // descriptor.
+ // 3. Load the TOC of the callee from the function descriptor into r2.
+ // 4. Load the environment pointer from the function descriptor into
+ // r11.
+ // 5. Branch to the function entry point address.
+ // 6. On return of the callee, the TOC of the caller needs to be
+ // restored (this is done in FinishCall()).
+ //
+ // All those operations are flagged together to ensure that no other
+ // operations can be scheduled in between. E.g. without flagging the
+ // operations together, a TOC access in the caller could be scheduled
+ // between the load of the callee TOC and the branch to the callee, which
+ // results in the TOC access going through the TOC of the callee instead
+ // of going through the TOC of the caller, which leads to incorrect code.
+
+ // Load the address of the function entry point from the function
+ // descriptor.
+ SDVTList VTs = DAG.getVTList(MVT::i64, MVT::Other, MVT::Glue);
+ SDValue LoadFuncPtr = DAG.getNode(PPCISD::LOAD, dl, VTs, MTCTROps,
+ InFlag.getNode() ? 3 : 2);
+ Chain = LoadFuncPtr.getValue(1);
+ InFlag = LoadFuncPtr.getValue(2);
+
+ // Load environment pointer into r11.
+ // Offset of the environment pointer within the function descriptor.
+ SDValue PtrOff = DAG.getIntPtrConstant(16);
+
+ SDValue AddPtr = DAG.getNode(ISD::ADD, dl, MVT::i64, Callee, PtrOff);
+ SDValue LoadEnvPtr = DAG.getNode(PPCISD::LOAD, dl, VTs, Chain, AddPtr,
+ InFlag);
+ Chain = LoadEnvPtr.getValue(1);
+ InFlag = LoadEnvPtr.getValue(2);
+
+ SDValue EnvVal = DAG.getCopyToReg(Chain, dl, PPC::X11, LoadEnvPtr,
+ InFlag);
+ Chain = EnvVal.getValue(0);
+ InFlag = EnvVal.getValue(1);
+
+ // Load TOC of the callee into r2. We are using a target-specific load
+ // with r2 hard coded, because the result of a target-independent load
+ // would never go directly into r2, since r2 is a reserved register (which
+ // prevents the register allocator from allocating it), resulting in an
+ // additional register being allocated and an unnecessary move instruction
+ // being generated.
+ VTs = DAG.getVTList(MVT::Other, MVT::Glue);
+ SDValue LoadTOCPtr = DAG.getNode(PPCISD::LOAD_TOC, dl, VTs, Chain,
+ Callee, InFlag);
+ Chain = LoadTOCPtr.getValue(0);
+ InFlag = LoadTOCPtr.getValue(1);
+
+ MTCTROps[0] = Chain;
+ MTCTROps[1] = LoadFuncPtr;
+ MTCTROps[2] = InFlag;
+ }
+
+ Chain = DAG.getNode(PPCISD::MTCTR, dl, NodeTys, MTCTROps,
+ 2 + (InFlag.getNode() != 0));
+ InFlag = Chain.getValue(1);
+
+ NodeTys.clear();
+ NodeTys.push_back(MVT::Other);
+ NodeTys.push_back(MVT::Glue);
+ Ops.push_back(Chain);
+ CallOpc = PPCISD::BCTRL;
+ Callee.setNode(0);
+ // Add use of X11 (holding environment pointer)
+ if (isSVR4ABI && isPPC64)
+ Ops.push_back(DAG.getRegister(PPC::X11, PtrVT));
+ // Add CTR register as callee so a bctr can be emitted later.
+ if (isTailCall)
+ Ops.push_back(DAG.getRegister(isPPC64 ? PPC::CTR8 : PPC::CTR, PtrVT));
+ }
+
+ // If this is a direct call, pass the chain and the callee.
+ if (Callee.getNode()) {
+ Ops.push_back(Chain);
+ Ops.push_back(Callee);
+ }
+ // If this is a tail call add stack pointer delta.
+ if (isTailCall)
+ Ops.push_back(DAG.getConstant(SPDiff, MVT::i32));
+
+ // Add argument registers to the end of the list so that they are known live
+ // into the call.
+ for (unsigned i = 0, e = RegsToPass.size(); i != e; ++i)
+ Ops.push_back(DAG.getRegister(RegsToPass[i].first,
+ RegsToPass[i].second.getValueType()));
+
+ return CallOpc;
+}
+
+static
+bool isLocalCall(const SDValue &Callee)
+{
+ if (GlobalAddressSDNode *G = dyn_cast<GlobalAddressSDNode>(Callee))
+ return !G->getGlobal()->isDeclaration() &&
+ !G->getGlobal()->isWeakForLinker();
+ return false;
+}
+
+SDValue
+PPCTargetLowering::LowerCallResult(SDValue Chain, SDValue InFlag,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+
+ SmallVector<CCValAssign, 16> RVLocs;
+ CCState CCRetInfo(CallConv, isVarArg, DAG.getMachineFunction(),
+ getTargetMachine(), RVLocs, *DAG.getContext());
+ CCRetInfo.AnalyzeCallResult(Ins, RetCC_PPC);
+
+ // Copy all of the result registers out of their specified physreg.
+ for (unsigned i = 0, e = RVLocs.size(); i != e; ++i) {
+ CCValAssign &VA = RVLocs[i];
+ assert(VA.isRegLoc() && "Can only return in registers!");
+
+ SDValue Val = DAG.getCopyFromReg(Chain, dl,
+ VA.getLocReg(), VA.getLocVT(), InFlag);
+ Chain = Val.getValue(1);
+ InFlag = Val.getValue(2);
+
+ switch (VA.getLocInfo()) {
+ default: llvm_unreachable("Unknown loc info!");
+ case CCValAssign::Full: break;
+ case CCValAssign::AExt:
+ Val = DAG.getNode(ISD::TRUNCATE, dl, VA.getValVT(), Val);
+ break;
+ case CCValAssign::ZExt:
+ Val = DAG.getNode(ISD::AssertZext, dl, VA.getLocVT(), Val,
+ DAG.getValueType(VA.getValVT()));
+ Val = DAG.getNode(ISD::TRUNCATE, dl, VA.getValVT(), Val);
+ break;
+ case CCValAssign::SExt:
+ Val = DAG.getNode(ISD::AssertSext, dl, VA.getLocVT(), Val,
+ DAG.getValueType(VA.getValVT()));
+ Val = DAG.getNode(ISD::TRUNCATE, dl, VA.getValVT(), Val);
+ break;
+ }
+
+ InVals.push_back(Val);
+ }
+
+ return Chain;
+}
+
+SDValue
+PPCTargetLowering::FinishCall(CallingConv::ID CallConv, DebugLoc dl,
+ bool isTailCall, bool isVarArg,
+ SelectionDAG &DAG,
+ SmallVector<std::pair<unsigned, SDValue>, 8>
+ &RegsToPass,
+ SDValue InFlag, SDValue Chain,
+ SDValue &Callee,
+ int SPDiff, unsigned NumBytes,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ SmallVectorImpl<SDValue> &InVals) const {
+ std::vector<EVT> NodeTys;
+ SmallVector<SDValue, 8> Ops;
+ unsigned CallOpc = PrepareCall(DAG, Callee, InFlag, Chain, dl, SPDiff,
+ isTailCall, RegsToPass, Ops, NodeTys,
+ PPCSubTarget);
+
+ // Add implicit use of CR bit 6 for 32-bit SVR4 vararg calls
+ if (isVarArg && PPCSubTarget.isSVR4ABI() && !PPCSubTarget.isPPC64())
+ Ops.push_back(DAG.getRegister(PPC::CR1EQ, MVT::i32));
+
+ // When performing tail call optimization the callee pops its arguments off
+ // the stack. Account for this here so these bytes can be pushed back on in
+ // PPCFrameLowering::eliminateCallFramePseudoInstr.
+ int BytesCalleePops =
+ (CallConv == CallingConv::Fast &&
+ getTargetMachine().Options.GuaranteedTailCallOpt) ? NumBytes : 0;
+
+ // Add a register mask operand representing the call-preserved registers.
+ const TargetRegisterInfo *TRI = getTargetMachine().getRegisterInfo();
+ const uint32_t *Mask = TRI->getCallPreservedMask(CallConv);
+ assert(Mask && "Missing call preserved mask for calling convention");
+ Ops.push_back(DAG.getRegisterMask(Mask));
+
+ if (InFlag.getNode())
+ Ops.push_back(InFlag);
+
+ // Emit tail call.
+ if (isTailCall) {
+ assert(((Callee.getOpcode() == ISD::Register &&
+ cast<RegisterSDNode>(Callee)->getReg() == PPC::CTR) ||
+ Callee.getOpcode() == ISD::TargetExternalSymbol ||
+ Callee.getOpcode() == ISD::TargetGlobalAddress ||
+ isa<ConstantSDNode>(Callee)) &&
+ "Expecting an global address, external symbol, absolute value or register");
+
+ return DAG.getNode(PPCISD::TC_RETURN, dl, MVT::Other, &Ops[0], Ops.size());
+ }
+
+ // Add a NOP immediately after the branch instruction when using the 64-bit
+ // SVR4 ABI. At link time, if caller and callee are in a different module and
+ // thus have a different TOC, the call will be replaced with a call to a stub
+ // function which saves the current TOC, loads the TOC of the callee and
+ // branches to the callee. The NOP will be replaced with a load instruction
+ // which restores the TOC of the caller from the TOC save slot of the current
+ // stack frame. If caller and callee belong to the same module (and have the
+ // same TOC), the NOP will remain unchanged.
+
+ bool needsTOCRestore = false;
+ if (!isTailCall && PPCSubTarget.isSVR4ABI()&& PPCSubTarget.isPPC64()) {
+ if (CallOpc == PPCISD::BCTRL) {
+ // This is a call through a function pointer.
+ // Restore the caller TOC from the save area into R2.
+ // See PrepareCall() for more information about calls through function
+ // pointers in the 64-bit SVR4 ABI.
+ // We are using a target-specific load with r2 hard coded, because the
+ // result of a target-independent load would never go directly into r2,
+ // since r2 is a reserved register (which prevents the register allocator
+ // from allocating it), resulting in an additional register being
+ // allocated and an unnecessary move instruction being generated.
+ needsTOCRestore = true;
+ } else if ((CallOpc == PPCISD::CALL) && !isLocalCall(Callee)) {
+ // Otherwise insert NOP for non-local calls.
+ CallOpc = PPCISD::CALL_NOP;
+ }
+ }
+
+ Chain = DAG.getNode(CallOpc, dl, NodeTys, &Ops[0], Ops.size());
+ InFlag = Chain.getValue(1);
+
+ if (needsTOCRestore) {
+ SDVTList VTs = DAG.getVTList(MVT::Other, MVT::Glue);
+ Chain = DAG.getNode(PPCISD::TOC_RESTORE, dl, VTs, Chain, InFlag);
+ InFlag = Chain.getValue(1);
+ }
+
+ Chain = DAG.getCALLSEQ_END(Chain, DAG.getIntPtrConstant(NumBytes, true),
+ DAG.getIntPtrConstant(BytesCalleePops, true),
+ InFlag);
+ if (!Ins.empty())
+ InFlag = Chain.getValue(1);
+
+ return LowerCallResult(Chain, InFlag, CallConv, isVarArg,
+ Ins, dl, DAG, InVals);
+}
+
+SDValue
+PPCTargetLowering::LowerCall(TargetLowering::CallLoweringInfo &CLI,
+ SmallVectorImpl<SDValue> &InVals) const {
+ SelectionDAG &DAG = CLI.DAG;
+ DebugLoc &dl = CLI.DL;
+ SmallVector<ISD::OutputArg, 32> &Outs = CLI.Outs;
+ SmallVector<SDValue, 32> &OutVals = CLI.OutVals;
+ SmallVector<ISD::InputArg, 32> &Ins = CLI.Ins;
+ SDValue Chain = CLI.Chain;
+ SDValue Callee = CLI.Callee;
+ bool &isTailCall = CLI.IsTailCall;
+ CallingConv::ID CallConv = CLI.CallConv;
+ bool isVarArg = CLI.IsVarArg;
+
+ if (isTailCall)
+ isTailCall = IsEligibleForTailCallOptimization(Callee, CallConv, isVarArg,
+ Ins, DAG);
+
+ if (PPCSubTarget.isSVR4ABI()) {
+ if (PPCSubTarget.isPPC64())
+ return LowerCall_64SVR4(Chain, Callee, CallConv, isVarArg,
+ isTailCall, Outs, OutVals, Ins,
+ dl, DAG, InVals);
+ else
+ return LowerCall_32SVR4(Chain, Callee, CallConv, isVarArg,
+ isTailCall, Outs, OutVals, Ins,
+ dl, DAG, InVals);
+ }
+
+ return LowerCall_Darwin(Chain, Callee, CallConv, isVarArg,
+ isTailCall, Outs, OutVals, Ins,
+ dl, DAG, InVals);
+}
+
+SDValue
+PPCTargetLowering::LowerCall_32SVR4(SDValue Chain, SDValue Callee,
+ CallingConv::ID CallConv, bool isVarArg,
+ bool isTailCall,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+ // See PPCTargetLowering::LowerFormalArguments_32SVR4() for a description
+ // of the 32-bit SVR4 ABI stack frame layout.
+
+ assert((CallConv == CallingConv::C ||
+ CallConv == CallingConv::Fast) && "Unknown calling convention!");
+
+ unsigned PtrByteSize = 4;
+
+ MachineFunction &MF = DAG.getMachineFunction();
+
+ // Mark this function as potentially containing a function that contains a
+ // tail call. As a consequence the frame pointer will be used for dynamicalloc
+ // and restoring the callers stack pointer in this functions epilog. This is
+ // done because by tail calling the called function might overwrite the value
+ // in this function's (MF) stack pointer stack slot 0(SP).
+ if (getTargetMachine().Options.GuaranteedTailCallOpt &&
+ CallConv == CallingConv::Fast)
+ MF.getInfo<PPCFunctionInfo>()->setHasFastCall();
+
+ // Count how many bytes are to be pushed on the stack, including the linkage
+ // area, parameter list area and the part of the local variable space which
+ // contains copies of aggregates which are passed by value.
+
+ // Assign locations to all of the outgoing arguments.
+ SmallVector<CCValAssign, 16> ArgLocs;
+ CCState CCInfo(CallConv, isVarArg, DAG.getMachineFunction(),
+ getTargetMachine(), ArgLocs, *DAG.getContext());
+
+ // Reserve space for the linkage area on the stack.
+ CCInfo.AllocateStack(PPCFrameLowering::getLinkageSize(false, false), PtrByteSize);
+
+ if (isVarArg) {
+ // Handle fixed and variable vector arguments differently.
+ // Fixed vector arguments go into registers as long as registers are
+ // available. Variable vector arguments always go into memory.
+ unsigned NumArgs = Outs.size();
+
+ for (unsigned i = 0; i != NumArgs; ++i) {
+ MVT ArgVT = Outs[i].VT;
+ ISD::ArgFlagsTy ArgFlags = Outs[i].Flags;
+ bool Result;
+
+ if (Outs[i].IsFixed) {
+ Result = CC_PPC32_SVR4(i, ArgVT, ArgVT, CCValAssign::Full, ArgFlags,
+ CCInfo);
+ } else {
+ Result = CC_PPC32_SVR4_VarArg(i, ArgVT, ArgVT, CCValAssign::Full,
+ ArgFlags, CCInfo);
+ }
+
+ if (Result) {
+#ifndef NDEBUG
+ errs() << "Call operand #" << i << " has unhandled type "
+ << EVT(ArgVT).getEVTString() << "\n";
+#endif
+ llvm_unreachable(0);
+ }
+ }
+ } else {
+ // All arguments are treated the same.
+ CCInfo.AnalyzeCallOperands(Outs, CC_PPC32_SVR4);
+ }
+
+ // Assign locations to all of the outgoing aggregate by value arguments.
+ SmallVector<CCValAssign, 16> ByValArgLocs;
+ CCState CCByValInfo(CallConv, isVarArg, DAG.getMachineFunction(),
+ getTargetMachine(), ByValArgLocs, *DAG.getContext());
+
+ // Reserve stack space for the allocations in CCInfo.
+ CCByValInfo.AllocateStack(CCInfo.getNextStackOffset(), PtrByteSize);
+
+ CCByValInfo.AnalyzeCallOperands(Outs, CC_PPC32_SVR4_ByVal);
+
+ // Size of the linkage area, parameter list area and the part of the local
+ // space variable where copies of aggregates which are passed by value are
+ // stored.
+ unsigned NumBytes = CCByValInfo.getNextStackOffset();
+
+ // Calculate by how many bytes the stack has to be adjusted in case of tail
+ // call optimization.
+ int SPDiff = CalculateTailCallSPDiff(DAG, isTailCall, NumBytes);
+
+ // Adjust the stack pointer for the new arguments...
+ // These operations are automatically eliminated by the prolog/epilog pass
+ Chain = DAG.getCALLSEQ_START(Chain, DAG.getIntPtrConstant(NumBytes, true));
+ SDValue CallSeqStart = Chain;
+
+ // Load the return address and frame pointer so it can be moved somewhere else
+ // later.
+ SDValue LROp, FPOp;
+ Chain = EmitTailCallLoadFPAndRetAddr(DAG, SPDiff, Chain, LROp, FPOp, false,
+ dl);
+
+ // Set up a copy of the stack pointer for use loading and storing any
+ // arguments that may not fit in the registers available for argument
+ // passing.
+ SDValue StackPtr = DAG.getRegister(PPC::R1, MVT::i32);
+
+ SmallVector<std::pair<unsigned, SDValue>, 8> RegsToPass;
+ SmallVector<TailCallArgumentInfo, 8> TailCallArguments;
+ SmallVector<SDValue, 8> MemOpChains;
+
+ bool seenFloatArg = false;
+ // Walk the register/memloc assignments, inserting copies/loads.
+ for (unsigned i = 0, j = 0, e = ArgLocs.size();
+ i != e;
+ ++i) {
+ CCValAssign &VA = ArgLocs[i];
+ SDValue Arg = OutVals[i];
+ ISD::ArgFlagsTy Flags = Outs[i].Flags;
+
+ if (Flags.isByVal()) {
+ // Argument is an aggregate which is passed by value, thus we need to
+ // create a copy of it in the local variable space of the current stack
+ // frame (which is the stack frame of the caller) and pass the address of
+ // this copy to the callee.
+ assert((j < ByValArgLocs.size()) && "Index out of bounds!");
+ CCValAssign &ByValVA = ByValArgLocs[j++];
+ assert((VA.getValNo() == ByValVA.getValNo()) && "ValNo mismatch!");
+
+ // Memory reserved in the local variable space of the callers stack frame.
+ unsigned LocMemOffset = ByValVA.getLocMemOffset();
+
+ SDValue PtrOff = DAG.getIntPtrConstant(LocMemOffset);
+ PtrOff = DAG.getNode(ISD::ADD, dl, getPointerTy(), StackPtr, PtrOff);
+
+ // Create a copy of the argument in the local area of the current
+ // stack frame.
+ SDValue MemcpyCall =
+ CreateCopyOfByValArgument(Arg, PtrOff,
+ CallSeqStart.getNode()->getOperand(0),
+ Flags, DAG, dl);
+
+ // This must go outside the CALLSEQ_START..END.
+ SDValue NewCallSeqStart = DAG.getCALLSEQ_START(MemcpyCall,
+ CallSeqStart.getNode()->getOperand(1));
+ DAG.ReplaceAllUsesWith(CallSeqStart.getNode(),
+ NewCallSeqStart.getNode());
+ Chain = CallSeqStart = NewCallSeqStart;
+
+ // Pass the address of the aggregate copy on the stack either in a
+ // physical register or in the parameter list area of the current stack
+ // frame to the callee.
+ Arg = PtrOff;
+ }
+
+ if (VA.isRegLoc()) {
+ seenFloatArg |= VA.getLocVT().isFloatingPoint();
+ // Put argument in a physical register.
+ RegsToPass.push_back(std::make_pair(VA.getLocReg(), Arg));
+ } else {
+ // Put argument in the parameter list area of the current stack frame.
+ assert(VA.isMemLoc());
+ unsigned LocMemOffset = VA.getLocMemOffset();
+
+ if (!isTailCall) {
+ SDValue PtrOff = DAG.getIntPtrConstant(LocMemOffset);
+ PtrOff = DAG.getNode(ISD::ADD, dl, getPointerTy(), StackPtr, PtrOff);
+
+ MemOpChains.push_back(DAG.getStore(Chain, dl, Arg, PtrOff,
+ MachinePointerInfo(),
+ false, false, 0));
+ } else {
+ // Calculate and remember argument location.
+ CalculateTailCallArgDest(DAG, MF, false, Arg, SPDiff, LocMemOffset,
+ TailCallArguments);
+ }
+ }
+ }
+
+ if (!MemOpChains.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl, MVT::Other,
+ &MemOpChains[0], MemOpChains.size());
+
+ // Build a sequence of copy-to-reg nodes chained together with token chain
+ // and flag operands which copy the outgoing args into the appropriate regs.
+ SDValue InFlag;
+ for (unsigned i = 0, e = RegsToPass.size(); i != e; ++i) {
+ Chain = DAG.getCopyToReg(Chain, dl, RegsToPass[i].first,
+ RegsToPass[i].second, InFlag);
+ InFlag = Chain.getValue(1);
+ }
+
+ // Set CR bit 6 to true if this is a vararg call with floating args passed in
+ // registers.
+ if (isVarArg) {
+ SDVTList VTs = DAG.getVTList(MVT::Other, MVT::Glue);
+ SDValue Ops[] = { Chain, InFlag };
+
+ Chain = DAG.getNode(seenFloatArg ? PPCISD::CR6SET : PPCISD::CR6UNSET,
+ dl, VTs, Ops, InFlag.getNode() ? 2 : 1);
+
+ InFlag = Chain.getValue(1);
+ }
+
+ if (isTailCall)
+ PrepareTailCall(DAG, InFlag, Chain, dl, false, SPDiff, NumBytes, LROp, FPOp,
+ false, TailCallArguments);
+
+ return FinishCall(CallConv, dl, isTailCall, isVarArg, DAG,
+ RegsToPass, InFlag, Chain, Callee, SPDiff, NumBytes,
+ Ins, InVals);
+}
+
+// Copy an argument into memory, being careful to do this outside the
+// call sequence for the call to which the argument belongs.
+SDValue
+PPCTargetLowering::createMemcpyOutsideCallSeq(SDValue Arg, SDValue PtrOff,
+ SDValue CallSeqStart,
+ ISD::ArgFlagsTy Flags,
+ SelectionDAG &DAG,
+ DebugLoc dl) const {
+ SDValue MemcpyCall = CreateCopyOfByValArgument(Arg, PtrOff,
+ CallSeqStart.getNode()->getOperand(0),
+ Flags, DAG, dl);
+ // The MEMCPY must go outside the CALLSEQ_START..END.
+ SDValue NewCallSeqStart = DAG.getCALLSEQ_START(MemcpyCall,
+ CallSeqStart.getNode()->getOperand(1));
+ DAG.ReplaceAllUsesWith(CallSeqStart.getNode(),
+ NewCallSeqStart.getNode());
+ return NewCallSeqStart;
+}
+
+SDValue
+PPCTargetLowering::LowerCall_64SVR4(SDValue Chain, SDValue Callee,
+ CallingConv::ID CallConv, bool isVarArg,
+ bool isTailCall,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+
+ unsigned NumOps = Outs.size();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ unsigned PtrByteSize = 8;
+
+ MachineFunction &MF = DAG.getMachineFunction();
+
+ // Mark this function as potentially containing a function that contains a
+ // tail call. As a consequence the frame pointer will be used for dynamicalloc
+ // and restoring the callers stack pointer in this functions epilog. This is
+ // done because by tail calling the called function might overwrite the value
+ // in this function's (MF) stack pointer stack slot 0(SP).
+ if (getTargetMachine().Options.GuaranteedTailCallOpt &&
+ CallConv == CallingConv::Fast)
+ MF.getInfo<PPCFunctionInfo>()->setHasFastCall();
+
+ unsigned nAltivecParamsAtEnd = 0;
+
+ // Count how many bytes are to be pushed on the stack, including the linkage
+ // area, and parameter passing area. We start with at least 48 bytes, which
+ // is reserved space for [SP][CR][LR][3 x unused].
+ // NOTE: For PPC64, nAltivecParamsAtEnd always remains zero as a result
+ // of this call.
+ unsigned NumBytes =
+ CalculateParameterAndLinkageAreaSize(DAG, true, isVarArg, CallConv,
+ Outs, OutVals, nAltivecParamsAtEnd);
+
+ // Calculate by how many bytes the stack has to be adjusted in case of tail
+ // call optimization.
+ int SPDiff = CalculateTailCallSPDiff(DAG, isTailCall, NumBytes);
+
+ // To protect arguments on the stack from being clobbered in a tail call,
+ // force all the loads to happen before doing any other lowering.
+ if (isTailCall)
+ Chain = DAG.getStackArgumentTokenFactor(Chain);
+
+ // Adjust the stack pointer for the new arguments...
+ // These operations are automatically eliminated by the prolog/epilog pass
+ Chain = DAG.getCALLSEQ_START(Chain, DAG.getIntPtrConstant(NumBytes, true));
+ SDValue CallSeqStart = Chain;
+
+ // Load the return address and frame pointer so it can be move somewhere else
+ // later.
+ SDValue LROp, FPOp;
+ Chain = EmitTailCallLoadFPAndRetAddr(DAG, SPDiff, Chain, LROp, FPOp, true,
+ dl);
+
+ // Set up a copy of the stack pointer for use loading and storing any
+ // arguments that may not fit in the registers available for argument
+ // passing.
+ SDValue StackPtr = DAG.getRegister(PPC::X1, MVT::i64);
+
+ // Figure out which arguments are going to go in registers, and which in
+ // memory. Also, if this is a vararg function, floating point operations
+ // must be stored to our stack, and loaded into integer regs as well, if
+ // any integer regs are available for argument passing.
+ unsigned ArgOffset = PPCFrameLowering::getLinkageSize(true, true);
+ unsigned GPR_idx = 0, FPR_idx = 0, VR_idx = 0;
+
+ static const uint16_t GPR[] = {
+ PPC::X3, PPC::X4, PPC::X5, PPC::X6,
+ PPC::X7, PPC::X8, PPC::X9, PPC::X10,
+ };
+ static const uint16_t *FPR = GetFPR();
+
+ static const uint16_t VR[] = {
+ PPC::V2, PPC::V3, PPC::V4, PPC::V5, PPC::V6, PPC::V7, PPC::V8,
+ PPC::V9, PPC::V10, PPC::V11, PPC::V12, PPC::V13
+ };
+ const unsigned NumGPRs = array_lengthof(GPR);
+ const unsigned NumFPRs = 13;
+ const unsigned NumVRs = array_lengthof(VR);
+
+ SmallVector<std::pair<unsigned, SDValue>, 8> RegsToPass;
+ SmallVector<TailCallArgumentInfo, 8> TailCallArguments;
+
+ SmallVector<SDValue, 8> MemOpChains;
+ for (unsigned i = 0; i != NumOps; ++i) {
+ SDValue Arg = OutVals[i];
+ ISD::ArgFlagsTy Flags = Outs[i].Flags;
+
+ // PtrOff will be used to store the current argument to the stack if a
+ // register cannot be found for it.
+ SDValue PtrOff;
+
+ PtrOff = DAG.getConstant(ArgOffset, StackPtr.getValueType());
+
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, StackPtr, PtrOff);
+
+ // Promote integers to 64-bit values.
+ if (Arg.getValueType() == MVT::i32) {
+ // FIXME: Should this use ANY_EXTEND if neither sext nor zext?
+ unsigned ExtOp = Flags.isSExt() ? ISD::SIGN_EXTEND : ISD::ZERO_EXTEND;
+ Arg = DAG.getNode(ExtOp, dl, MVT::i64, Arg);
+ }
+
+ // FIXME memcpy is used way more than necessary. Correctness first.
+ // Note: "by value" is code for passing a structure by value, not
+ // basic types.
+ if (Flags.isByVal()) {
+ // Note: Size includes alignment padding, so
+ // struct x { short a; char b; }
+ // will have Size = 4. With #pragma pack(1), it will have Size = 3.
+ // These are the proper values we need for right-justifying the
+ // aggregate in a parameter register.
+ unsigned Size = Flags.getByValSize();
+
+ // An empty aggregate parameter takes up no storage and no
+ // registers.
+ if (Size == 0)
+ continue;
+
+ // All aggregates smaller than 8 bytes must be passed right-justified.
+ if (Size==1 || Size==2 || Size==4) {
+ EVT VT = (Size==1) ? MVT::i8 : ((Size==2) ? MVT::i16 : MVT::i32);
+ if (GPR_idx != NumGPRs) {
+ SDValue Load = DAG.getExtLoad(ISD::EXTLOAD, dl, PtrVT, Chain, Arg,
+ MachinePointerInfo(), VT,
+ false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+
+ ArgOffset += PtrByteSize;
+ continue;
+ }
+ }
+
+ if (GPR_idx == NumGPRs && Size < 8) {
+ SDValue Const = DAG.getConstant(PtrByteSize - Size,
+ PtrOff.getValueType());
+ SDValue AddPtr = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff, Const);
+ Chain = CallSeqStart = createMemcpyOutsideCallSeq(Arg, AddPtr,
+ CallSeqStart,
+ Flags, DAG, dl);
+ ArgOffset += PtrByteSize;
+ continue;
+ }
+ // Copy entire object into memory. There are cases where gcc-generated
+ // code assumes it is there, even if it could be put entirely into
+ // registers. (This is not what the doc says.)
+
+ // FIXME: The above statement is likely due to a misunderstanding of the
+ // documents. All arguments must be copied into the parameter area BY
+ // THE CALLEE in the event that the callee takes the address of any
+ // formal argument. That has not yet been implemented. However, it is
+ // reasonable to use the stack area as a staging area for the register
+ // load.
+
+ // Skip this for small aggregates, as we will use the same slot for a
+ // right-justified copy, below.
+ if (Size >= 8)
+ Chain = CallSeqStart = createMemcpyOutsideCallSeq(Arg, PtrOff,
+ CallSeqStart,
+ Flags, DAG, dl);
+
+ // When a register is available, pass a small aggregate right-justified.
+ if (Size < 8 && GPR_idx != NumGPRs) {
+ // The easiest way to get this right-justified in a register
+ // is to copy the structure into the rightmost portion of a
+ // local variable slot, then load the whole slot into the
+ // register.
+ // FIXME: The memcpy seems to produce pretty awful code for
+ // small aggregates, particularly for packed ones.
+ // FIXME: It would be preferable to use the slot in the
+ // parameter save area instead of a new local variable.
+ SDValue Const = DAG.getConstant(8 - Size, PtrOff.getValueType());
+ SDValue AddPtr = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff, Const);
+ Chain = CallSeqStart = createMemcpyOutsideCallSeq(Arg, AddPtr,
+ CallSeqStart,
+ Flags, DAG, dl);
+
+ // Load the slot into the register.
+ SDValue Load = DAG.getLoad(PtrVT, dl, Chain, PtrOff,
+ MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+
+ // Done with this argument.
+ ArgOffset += PtrByteSize;
+ continue;
+ }
+
+ // For aggregates larger than PtrByteSize, copy the pieces of the
+ // object that fit into registers from the parameter save area.
+ for (unsigned j=0; j<Size; j+=PtrByteSize) {
+ SDValue Const = DAG.getConstant(j, PtrOff.getValueType());
+ SDValue AddArg = DAG.getNode(ISD::ADD, dl, PtrVT, Arg, Const);
+ if (GPR_idx != NumGPRs) {
+ SDValue Load = DAG.getLoad(PtrVT, dl, Chain, AddArg,
+ MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ ArgOffset += PtrByteSize;
+ } else {
+ ArgOffset += ((Size - j + PtrByteSize-1)/PtrByteSize)*PtrByteSize;
+ break;
+ }
+ }
+ continue;
+ }
+
+ switch (Arg.getValueType().getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Unexpected ValueType for argument!");
+ case MVT::i32:
+ case MVT::i64:
+ if (GPR_idx != NumGPRs) {
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Arg));
+ } else {
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ true, isTailCall, false, MemOpChains,
+ TailCallArguments, dl);
+ }
+ ArgOffset += PtrByteSize;
+ break;
+ case MVT::f32:
+ case MVT::f64:
+ if (FPR_idx != NumFPRs) {
+ RegsToPass.push_back(std::make_pair(FPR[FPR_idx++], Arg));
+
+ if (isVarArg) {
+ // A single float or an aggregate containing only a single float
+ // must be passed right-justified in the stack doubleword, and
+ // in the GPR, if one is available.
+ SDValue StoreOff;
+ if (Arg.getValueType().getSimpleVT().SimpleTy == MVT::f32) {
+ SDValue ConstFour = DAG.getConstant(4, PtrOff.getValueType());
+ StoreOff = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff, ConstFour);
+ } else
+ StoreOff = PtrOff;
+
+ SDValue Store = DAG.getStore(Chain, dl, Arg, StoreOff,
+ MachinePointerInfo(), false, false, 0);
+ MemOpChains.push_back(Store);
+
+ // Float varargs are always shadowed in available integer registers
+ if (GPR_idx != NumGPRs) {
+ SDValue Load = DAG.getLoad(PtrVT, dl, Store, PtrOff,
+ MachinePointerInfo(), false, false,
+ false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ }
+ } else if (GPR_idx != NumGPRs)
+ // If we have any FPRs remaining, we may also have GPRs remaining.
+ ++GPR_idx;
+ } else {
+ // Single-precision floating-point values are mapped to the
+ // second (rightmost) word of the stack doubleword.
+ if (Arg.getValueType() == MVT::f32) {
+ SDValue ConstFour = DAG.getConstant(4, PtrOff.getValueType());
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff, ConstFour);
+ }
+
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ true, isTailCall, false, MemOpChains,
+ TailCallArguments, dl);
+ }
+ ArgOffset += 8;
+ break;
+ case MVT::v4f32:
+ case MVT::v4i32:
+ case MVT::v8i16:
+ case MVT::v16i8:
+ if (isVarArg) {
+ // These go aligned on the stack, or in the corresponding R registers
+ // when within range. The Darwin PPC ABI doc claims they also go in
+ // V registers; in fact gcc does this only for arguments that are
+ // prototyped, not for those that match the ... We do it for all
+ // arguments, seems to work.
+ while (ArgOffset % 16 !=0) {
+ ArgOffset += PtrByteSize;
+ if (GPR_idx != NumGPRs)
+ GPR_idx++;
+ }
+ // We could elide this store in the case where the object fits
+ // entirely in R registers. Maybe later.
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, StackPtr,
+ DAG.getConstant(ArgOffset, PtrVT));
+ SDValue Store = DAG.getStore(Chain, dl, Arg, PtrOff,
+ MachinePointerInfo(), false, false, 0);
+ MemOpChains.push_back(Store);
+ if (VR_idx != NumVRs) {
+ SDValue Load = DAG.getLoad(MVT::v4f32, dl, Store, PtrOff,
+ MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(VR[VR_idx++], Load));
+ }
+ ArgOffset += 16;
+ for (unsigned i=0; i<16; i+=PtrByteSize) {
+ if (GPR_idx == NumGPRs)
+ break;
+ SDValue Ix = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff,
+ DAG.getConstant(i, PtrVT));
+ SDValue Load = DAG.getLoad(PtrVT, dl, Store, Ix, MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ }
+ break;
+ }
+
+ // Non-varargs Altivec params generally go in registers, but have
+ // stack space allocated at the end.
+ if (VR_idx != NumVRs) {
+ // Doesn't have GPR space allocated.
+ RegsToPass.push_back(std::make_pair(VR[VR_idx++], Arg));
+ } else {
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ true, isTailCall, true, MemOpChains,
+ TailCallArguments, dl);
+ ArgOffset += 16;
+ }
+ break;
+ }
+ }
+
+ if (!MemOpChains.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl, MVT::Other,
+ &MemOpChains[0], MemOpChains.size());
+
+ // Check if this is an indirect call (MTCTR/BCTRL).
+ // See PrepareCall() for more information about calls through function
+ // pointers in the 64-bit SVR4 ABI.
+ if (!isTailCall &&
+ !dyn_cast<GlobalAddressSDNode>(Callee) &&
+ !dyn_cast<ExternalSymbolSDNode>(Callee) &&
+ !isBLACompatibleAddress(Callee, DAG)) {
+ // Load r2 into a virtual register and store it to the TOC save area.
+ SDValue Val = DAG.getCopyFromReg(Chain, dl, PPC::X2, MVT::i64);
+ // TOC save area offset.
+ SDValue PtrOff = DAG.getIntPtrConstant(40);
+ SDValue AddPtr = DAG.getNode(ISD::ADD, dl, PtrVT, StackPtr, PtrOff);
+ Chain = DAG.getStore(Val.getValue(1), dl, Val, AddPtr, MachinePointerInfo(),
+ false, false, 0);
+ // R12 must contain the address of an indirect callee. This does not
+ // mean the MTCTR instruction must use R12; it's easier to model this
+ // as an extra parameter, so do that.
+ RegsToPass.push_back(std::make_pair((unsigned)PPC::X12, Callee));
+ }
+
+ // Build a sequence of copy-to-reg nodes chained together with token chain
+ // and flag operands which copy the outgoing args into the appropriate regs.
+ SDValue InFlag;
+ for (unsigned i = 0, e = RegsToPass.size(); i != e; ++i) {
+ Chain = DAG.getCopyToReg(Chain, dl, RegsToPass[i].first,
+ RegsToPass[i].second, InFlag);
+ InFlag = Chain.getValue(1);
+ }
+
+ if (isTailCall)
+ PrepareTailCall(DAG, InFlag, Chain, dl, true, SPDiff, NumBytes, LROp,
+ FPOp, true, TailCallArguments);
+
+ return FinishCall(CallConv, dl, isTailCall, isVarArg, DAG,
+ RegsToPass, InFlag, Chain, Callee, SPDiff, NumBytes,
+ Ins, InVals);
+}
+
+SDValue
+PPCTargetLowering::LowerCall_Darwin(SDValue Chain, SDValue Callee,
+ CallingConv::ID CallConv, bool isVarArg,
+ bool isTailCall,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const {
+
+ unsigned NumOps = Outs.size();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ bool isPPC64 = PtrVT == MVT::i64;
+ unsigned PtrByteSize = isPPC64 ? 8 : 4;
+
+ MachineFunction &MF = DAG.getMachineFunction();
+
+ // Mark this function as potentially containing a function that contains a
+ // tail call. As a consequence the frame pointer will be used for dynamicalloc
+ // and restoring the callers stack pointer in this functions epilog. This is
+ // done because by tail calling the called function might overwrite the value
+ // in this function's (MF) stack pointer stack slot 0(SP).
+ if (getTargetMachine().Options.GuaranteedTailCallOpt &&
+ CallConv == CallingConv::Fast)
+ MF.getInfo<PPCFunctionInfo>()->setHasFastCall();
+
+ unsigned nAltivecParamsAtEnd = 0;
+
+ // Count how many bytes are to be pushed on the stack, including the linkage
+ // area, and parameter passing area. We start with 24/48 bytes, which is
+ // prereserved space for [SP][CR][LR][3 x unused].
+ unsigned NumBytes =
+ CalculateParameterAndLinkageAreaSize(DAG, isPPC64, isVarArg, CallConv,
+ Outs, OutVals,
+ nAltivecParamsAtEnd);
+
+ // Calculate by how many bytes the stack has to be adjusted in case of tail
+ // call optimization.
+ int SPDiff = CalculateTailCallSPDiff(DAG, isTailCall, NumBytes);
+
+ // To protect arguments on the stack from being clobbered in a tail call,
+ // force all the loads to happen before doing any other lowering.
+ if (isTailCall)
+ Chain = DAG.getStackArgumentTokenFactor(Chain);
+
+ // Adjust the stack pointer for the new arguments...
+ // These operations are automatically eliminated by the prolog/epilog pass
+ Chain = DAG.getCALLSEQ_START(Chain, DAG.getIntPtrConstant(NumBytes, true));
+ SDValue CallSeqStart = Chain;
+
+ // Load the return address and frame pointer so it can be move somewhere else
+ // later.
+ SDValue LROp, FPOp;
+ Chain = EmitTailCallLoadFPAndRetAddr(DAG, SPDiff, Chain, LROp, FPOp, true,
+ dl);
+
+ // Set up a copy of the stack pointer for use loading and storing any
+ // arguments that may not fit in the registers available for argument
+ // passing.
+ SDValue StackPtr;
+ if (isPPC64)
+ StackPtr = DAG.getRegister(PPC::X1, MVT::i64);
+ else
+ StackPtr = DAG.getRegister(PPC::R1, MVT::i32);
+
+ // Figure out which arguments are going to go in registers, and which in
+ // memory. Also, if this is a vararg function, floating point operations
+ // must be stored to our stack, and loaded into integer regs as well, if
+ // any integer regs are available for argument passing.
+ unsigned ArgOffset = PPCFrameLowering::getLinkageSize(isPPC64, true);
+ unsigned GPR_idx = 0, FPR_idx = 0, VR_idx = 0;
+
+ static const uint16_t GPR_32[] = { // 32-bit registers.
+ PPC::R3, PPC::R4, PPC::R5, PPC::R6,
+ PPC::R7, PPC::R8, PPC::R9, PPC::R10,
+ };
+ static const uint16_t GPR_64[] = { // 64-bit registers.
+ PPC::X3, PPC::X4, PPC::X5, PPC::X6,
+ PPC::X7, PPC::X8, PPC::X9, PPC::X10,
+ };
+ static const uint16_t *FPR = GetFPR();
+
+ static const uint16_t VR[] = {
+ PPC::V2, PPC::V3, PPC::V4, PPC::V5, PPC::V6, PPC::V7, PPC::V8,
+ PPC::V9, PPC::V10, PPC::V11, PPC::V12, PPC::V13
+ };
+ const unsigned NumGPRs = array_lengthof(GPR_32);
+ const unsigned NumFPRs = 13;
+ const unsigned NumVRs = array_lengthof(VR);
+
+ const uint16_t *GPR = isPPC64 ? GPR_64 : GPR_32;
+
+ SmallVector<std::pair<unsigned, SDValue>, 8> RegsToPass;
+ SmallVector<TailCallArgumentInfo, 8> TailCallArguments;
+
+ SmallVector<SDValue, 8> MemOpChains;
+ for (unsigned i = 0; i != NumOps; ++i) {
+ SDValue Arg = OutVals[i];
+ ISD::ArgFlagsTy Flags = Outs[i].Flags;
+
+ // PtrOff will be used to store the current argument to the stack if a
+ // register cannot be found for it.
+ SDValue PtrOff;
+
+ PtrOff = DAG.getConstant(ArgOffset, StackPtr.getValueType());
+
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, StackPtr, PtrOff);
+
+ // On PPC64, promote integers to 64-bit values.
+ if (isPPC64 && Arg.getValueType() == MVT::i32) {
+ // FIXME: Should this use ANY_EXTEND if neither sext nor zext?
+ unsigned ExtOp = Flags.isSExt() ? ISD::SIGN_EXTEND : ISD::ZERO_EXTEND;
+ Arg = DAG.getNode(ExtOp, dl, MVT::i64, Arg);
+ }
+
+ // FIXME memcpy is used way more than necessary. Correctness first.
+ // Note: "by value" is code for passing a structure by value, not
+ // basic types.
+ if (Flags.isByVal()) {
+ unsigned Size = Flags.getByValSize();
+ // Very small objects are passed right-justified. Everything else is
+ // passed left-justified.
+ if (Size==1 || Size==2) {
+ EVT VT = (Size==1) ? MVT::i8 : MVT::i16;
+ if (GPR_idx != NumGPRs) {
+ SDValue Load = DAG.getExtLoad(ISD::EXTLOAD, dl, PtrVT, Chain, Arg,
+ MachinePointerInfo(), VT,
+ false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+
+ ArgOffset += PtrByteSize;
+ } else {
+ SDValue Const = DAG.getConstant(PtrByteSize - Size,
+ PtrOff.getValueType());
+ SDValue AddPtr = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff, Const);
+ Chain = CallSeqStart = createMemcpyOutsideCallSeq(Arg, AddPtr,
+ CallSeqStart,
+ Flags, DAG, dl);
+ ArgOffset += PtrByteSize;
+ }
+ continue;
+ }
+ // Copy entire object into memory. There are cases where gcc-generated
+ // code assumes it is there, even if it could be put entirely into
+ // registers. (This is not what the doc says.)
+ Chain = CallSeqStart = createMemcpyOutsideCallSeq(Arg, PtrOff,
+ CallSeqStart,
+ Flags, DAG, dl);
+
+ // For small aggregates (Darwin only) and aggregates >= PtrByteSize,
+ // copy the pieces of the object that fit into registers from the
+ // parameter save area.
+ for (unsigned j=0; j<Size; j+=PtrByteSize) {
+ SDValue Const = DAG.getConstant(j, PtrOff.getValueType());
+ SDValue AddArg = DAG.getNode(ISD::ADD, dl, PtrVT, Arg, Const);
+ if (GPR_idx != NumGPRs) {
+ SDValue Load = DAG.getLoad(PtrVT, dl, Chain, AddArg,
+ MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ ArgOffset += PtrByteSize;
+ } else {
+ ArgOffset += ((Size - j + PtrByteSize-1)/PtrByteSize)*PtrByteSize;
+ break;
+ }
+ }
+ continue;
+ }
+
+ switch (Arg.getValueType().getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Unexpected ValueType for argument!");
+ case MVT::i32:
+ case MVT::i64:
+ if (GPR_idx != NumGPRs) {
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Arg));
+ } else {
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ isPPC64, isTailCall, false, MemOpChains,
+ TailCallArguments, dl);
+ }
+ ArgOffset += PtrByteSize;
+ break;
+ case MVT::f32:
+ case MVT::f64:
+ if (FPR_idx != NumFPRs) {
+ RegsToPass.push_back(std::make_pair(FPR[FPR_idx++], Arg));
+
+ if (isVarArg) {
+ SDValue Store = DAG.getStore(Chain, dl, Arg, PtrOff,
+ MachinePointerInfo(), false, false, 0);
+ MemOpChains.push_back(Store);
+
+ // Float varargs are always shadowed in available integer registers
+ if (GPR_idx != NumGPRs) {
+ SDValue Load = DAG.getLoad(PtrVT, dl, Store, PtrOff,
+ MachinePointerInfo(), false, false,
+ false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ }
+ if (GPR_idx != NumGPRs && Arg.getValueType() == MVT::f64 && !isPPC64){
+ SDValue ConstFour = DAG.getConstant(4, PtrOff.getValueType());
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff, ConstFour);
+ SDValue Load = DAG.getLoad(PtrVT, dl, Store, PtrOff,
+ MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ }
+ } else {
+ // If we have any FPRs remaining, we may also have GPRs remaining.
+ // Args passed in FPRs consume either 1 (f32) or 2 (f64) available
+ // GPRs.
+ if (GPR_idx != NumGPRs)
+ ++GPR_idx;
+ if (GPR_idx != NumGPRs && Arg.getValueType() == MVT::f64 &&
+ !isPPC64) // PPC64 has 64-bit GPR's obviously :)
+ ++GPR_idx;
+ }
+ } else
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ isPPC64, isTailCall, false, MemOpChains,
+ TailCallArguments, dl);
+ if (isPPC64)
+ ArgOffset += 8;
+ else
+ ArgOffset += Arg.getValueType() == MVT::f32 ? 4 : 8;
+ break;
+ case MVT::v4f32:
+ case MVT::v4i32:
+ case MVT::v8i16:
+ case MVT::v16i8:
+ if (isVarArg) {
+ // These go aligned on the stack, or in the corresponding R registers
+ // when within range. The Darwin PPC ABI doc claims they also go in
+ // V registers; in fact gcc does this only for arguments that are
+ // prototyped, not for those that match the ... We do it for all
+ // arguments, seems to work.
+ while (ArgOffset % 16 !=0) {
+ ArgOffset += PtrByteSize;
+ if (GPR_idx != NumGPRs)
+ GPR_idx++;
+ }
+ // We could elide this store in the case where the object fits
+ // entirely in R registers. Maybe later.
+ PtrOff = DAG.getNode(ISD::ADD, dl, PtrVT, StackPtr,
+ DAG.getConstant(ArgOffset, PtrVT));
+ SDValue Store = DAG.getStore(Chain, dl, Arg, PtrOff,
+ MachinePointerInfo(), false, false, 0);
+ MemOpChains.push_back(Store);
+ if (VR_idx != NumVRs) {
+ SDValue Load = DAG.getLoad(MVT::v4f32, dl, Store, PtrOff,
+ MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(VR[VR_idx++], Load));
+ }
+ ArgOffset += 16;
+ for (unsigned i=0; i<16; i+=PtrByteSize) {
+ if (GPR_idx == NumGPRs)
+ break;
+ SDValue Ix = DAG.getNode(ISD::ADD, dl, PtrVT, PtrOff,
+ DAG.getConstant(i, PtrVT));
+ SDValue Load = DAG.getLoad(PtrVT, dl, Store, Ix, MachinePointerInfo(),
+ false, false, false, 0);
+ MemOpChains.push_back(Load.getValue(1));
+ RegsToPass.push_back(std::make_pair(GPR[GPR_idx++], Load));
+ }
+ break;
+ }
+
+ // Non-varargs Altivec params generally go in registers, but have
+ // stack space allocated at the end.
+ if (VR_idx != NumVRs) {
+ // Doesn't have GPR space allocated.
+ RegsToPass.push_back(std::make_pair(VR[VR_idx++], Arg));
+ } else if (nAltivecParamsAtEnd==0) {
+ // We are emitting Altivec params in order.
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ isPPC64, isTailCall, true, MemOpChains,
+ TailCallArguments, dl);
+ ArgOffset += 16;
+ }
+ break;
+ }
+ }
+ // If all Altivec parameters fit in registers, as they usually do,
+ // they get stack space following the non-Altivec parameters. We
+ // don't track this here because nobody below needs it.
+ // If there are more Altivec parameters than fit in registers emit
+ // the stores here.
+ if (!isVarArg && nAltivecParamsAtEnd > NumVRs) {
+ unsigned j = 0;
+ // Offset is aligned; skip 1st 12 params which go in V registers.
+ ArgOffset = ((ArgOffset+15)/16)*16;
+ ArgOffset += 12*16;
+ for (unsigned i = 0; i != NumOps; ++i) {
+ SDValue Arg = OutVals[i];
+ EVT ArgType = Outs[i].VT;
+ if (ArgType==MVT::v4f32 || ArgType==MVT::v4i32 ||
+ ArgType==MVT::v8i16 || ArgType==MVT::v16i8) {
+ if (++j > NumVRs) {
+ SDValue PtrOff;
+ // We are emitting Altivec params in order.
+ LowerMemOpCallTo(DAG, MF, Chain, Arg, PtrOff, SPDiff, ArgOffset,
+ isPPC64, isTailCall, true, MemOpChains,
+ TailCallArguments, dl);
+ ArgOffset += 16;
+ }
+ }
+ }
+ }
+
+ if (!MemOpChains.empty())
+ Chain = DAG.getNode(ISD::TokenFactor, dl, MVT::Other,
+ &MemOpChains[0], MemOpChains.size());
+
+ // On Darwin, R12 must contain the address of an indirect callee. This does
+ // not mean the MTCTR instruction must use R12; it's easier to model this as
+ // an extra parameter, so do that.
+ if (!isTailCall &&
+ !dyn_cast<GlobalAddressSDNode>(Callee) &&
+ !dyn_cast<ExternalSymbolSDNode>(Callee) &&
+ !isBLACompatibleAddress(Callee, DAG))
+ RegsToPass.push_back(std::make_pair((unsigned)(isPPC64 ? PPC::X12 :
+ PPC::R12), Callee));
+
+ // Build a sequence of copy-to-reg nodes chained together with token chain
+ // and flag operands which copy the outgoing args into the appropriate regs.
+ SDValue InFlag;
+ for (unsigned i = 0, e = RegsToPass.size(); i != e; ++i) {
+ Chain = DAG.getCopyToReg(Chain, dl, RegsToPass[i].first,
+ RegsToPass[i].second, InFlag);
+ InFlag = Chain.getValue(1);
+ }
+
+ if (isTailCall)
+ PrepareTailCall(DAG, InFlag, Chain, dl, isPPC64, SPDiff, NumBytes, LROp,
+ FPOp, true, TailCallArguments);
+
+ return FinishCall(CallConv, dl, isTailCall, isVarArg, DAG,
+ RegsToPass, InFlag, Chain, Callee, SPDiff, NumBytes,
+ Ins, InVals);
+}
+
+bool
+PPCTargetLowering::CanLowerReturn(CallingConv::ID CallConv,
+ MachineFunction &MF, bool isVarArg,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ LLVMContext &Context) const {
+ SmallVector<CCValAssign, 16> RVLocs;
+ CCState CCInfo(CallConv, isVarArg, MF, getTargetMachine(),
+ RVLocs, Context);
+ return CCInfo.CheckReturn(Outs, RetCC_PPC);
+}
+
+SDValue
+PPCTargetLowering::LowerReturn(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ DebugLoc dl, SelectionDAG &DAG) const {
+
+ SmallVector<CCValAssign, 16> RVLocs;
+ CCState CCInfo(CallConv, isVarArg, DAG.getMachineFunction(),
+ getTargetMachine(), RVLocs, *DAG.getContext());
+ CCInfo.AnalyzeReturn(Outs, RetCC_PPC);
+
+ SDValue Flag;
+ SmallVector<SDValue, 4> RetOps(1, Chain);
+
+ // Copy the result values into the output registers.
+ for (unsigned i = 0; i != RVLocs.size(); ++i) {
+ CCValAssign &VA = RVLocs[i];
+ assert(VA.isRegLoc() && "Can only return in registers!");
+
+ SDValue Arg = OutVals[i];
+
+ switch (VA.getLocInfo()) {
+ default: llvm_unreachable("Unknown loc info!");
+ case CCValAssign::Full: break;
+ case CCValAssign::AExt:
+ Arg = DAG.getNode(ISD::ANY_EXTEND, dl, VA.getLocVT(), Arg);
+ break;
+ case CCValAssign::ZExt:
+ Arg = DAG.getNode(ISD::ZERO_EXTEND, dl, VA.getLocVT(), Arg);
+ break;
+ case CCValAssign::SExt:
+ Arg = DAG.getNode(ISD::SIGN_EXTEND, dl, VA.getLocVT(), Arg);
+ break;
+ }
+
+ Chain = DAG.getCopyToReg(Chain, dl, VA.getLocReg(), Arg, Flag);
+ Flag = Chain.getValue(1);
+ RetOps.push_back(DAG.getRegister(VA.getLocReg(), VA.getLocVT()));
+ }
+
+ RetOps[0] = Chain; // Update chain.
+
+ // Add the flag if we have it.
+ if (Flag.getNode())
+ RetOps.push_back(Flag);
+
+ return DAG.getNode(PPCISD::RET_FLAG, dl, MVT::Other,
+ &RetOps[0], RetOps.size());
+}
+
+SDValue PPCTargetLowering::LowerSTACKRESTORE(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const {
+ // When we pop the dynamic allocation we need to restore the SP link.
+ DebugLoc dl = Op.getDebugLoc();
+
+ // Get the corect type for pointers.
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+
+ // Construct the stack pointer operand.
+ bool isPPC64 = Subtarget.isPPC64();
+ unsigned SP = isPPC64 ? PPC::X1 : PPC::R1;
+ SDValue StackPtr = DAG.getRegister(SP, PtrVT);
+
+ // Get the operands for the STACKRESTORE.
+ SDValue Chain = Op.getOperand(0);
+ SDValue SaveSP = Op.getOperand(1);
+
+ // Load the old link SP.
+ SDValue LoadLinkSP = DAG.getLoad(PtrVT, dl, Chain, StackPtr,
+ MachinePointerInfo(),
+ false, false, false, 0);
+
+ // Restore the stack pointer.
+ Chain = DAG.getCopyToReg(LoadLinkSP.getValue(1), dl, SP, SaveSP);
+
+ // Store the old link SP.
+ return DAG.getStore(Chain, dl, LoadLinkSP, StackPtr, MachinePointerInfo(),
+ false, false, 0);
+}
+
+
+
+SDValue
+PPCTargetLowering::getReturnAddrFrameIndex(SelectionDAG & DAG) const {
+ MachineFunction &MF = DAG.getMachineFunction();
+ bool isPPC64 = PPCSubTarget.isPPC64();
+ bool isDarwinABI = PPCSubTarget.isDarwinABI();
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+
+ // Get current frame pointer save index. The users of this index will be
+ // primarily DYNALLOC instructions.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ int RASI = FI->getReturnAddrSaveIndex();
+
+ // If the frame pointer save index hasn't been defined yet.
+ if (!RASI) {
+ // Find out what the fix offset of the frame pointer save area.
+ int LROffset = PPCFrameLowering::getReturnSaveOffset(isPPC64, isDarwinABI);
+ // Allocate the frame index for frame pointer save area.
+ RASI = MF.getFrameInfo()->CreateFixedObject(isPPC64? 8 : 4, LROffset, true);
+ // Save the result.
+ FI->setReturnAddrSaveIndex(RASI);
+ }
+ return DAG.getFrameIndex(RASI, PtrVT);
+}
+
+SDValue
+PPCTargetLowering::getFramePointerFrameIndex(SelectionDAG & DAG) const {
+ MachineFunction &MF = DAG.getMachineFunction();
+ bool isPPC64 = PPCSubTarget.isPPC64();
+ bool isDarwinABI = PPCSubTarget.isDarwinABI();
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+
+ // Get current frame pointer save index. The users of this index will be
+ // primarily DYNALLOC instructions.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ int FPSI = FI->getFramePointerSaveIndex();
+
+ // If the frame pointer save index hasn't been defined yet.
+ if (!FPSI) {
+ // Find out what the fix offset of the frame pointer save area.
+ int FPOffset = PPCFrameLowering::getFramePointerSaveOffset(isPPC64,
+ isDarwinABI);
+
+ // Allocate the frame index for frame pointer save area.
+ FPSI = MF.getFrameInfo()->CreateFixedObject(isPPC64? 8 : 4, FPOffset, true);
+ // Save the result.
+ FI->setFramePointerSaveIndex(FPSI);
+ }
+ return DAG.getFrameIndex(FPSI, PtrVT);
+}
+
+SDValue PPCTargetLowering::LowerDYNAMIC_STACKALLOC(SDValue Op,
+ SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const {
+ // Get the inputs.
+ SDValue Chain = Op.getOperand(0);
+ SDValue Size = Op.getOperand(1);
+ DebugLoc dl = Op.getDebugLoc();
+
+ // Get the corect type for pointers.
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ // Negate the size.
+ SDValue NegSize = DAG.getNode(ISD::SUB, dl, PtrVT,
+ DAG.getConstant(0, PtrVT), Size);
+ // Construct a node for the frame pointer save index.
+ SDValue FPSIdx = getFramePointerFrameIndex(DAG);
+ // Build a DYNALLOC node.
+ SDValue Ops[3] = { Chain, NegSize, FPSIdx };
+ SDVTList VTs = DAG.getVTList(PtrVT, MVT::Other);
+ return DAG.getNode(PPCISD::DYNALLOC, dl, VTs, Ops, 3);
+}
+
+SDValue PPCTargetLowering::lowerEH_SJLJ_SETJMP(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc DL = Op.getDebugLoc();
+ return DAG.getNode(PPCISD::EH_SJLJ_SETJMP, DL,
+ DAG.getVTList(MVT::i32, MVT::Other),
+ Op.getOperand(0), Op.getOperand(1));
+}
+
+SDValue PPCTargetLowering::lowerEH_SJLJ_LONGJMP(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc DL = Op.getDebugLoc();
+ return DAG.getNode(PPCISD::EH_SJLJ_LONGJMP, DL, MVT::Other,
+ Op.getOperand(0), Op.getOperand(1));
+}
+
+/// LowerSELECT_CC - Lower floating point select_cc's into fsel instruction when
+/// possible.
+SDValue PPCTargetLowering::LowerSELECT_CC(SDValue Op, SelectionDAG &DAG) const {
+ // Not FP? Not a fsel.
+ if (!Op.getOperand(0).getValueType().isFloatingPoint() ||
+ !Op.getOperand(2).getValueType().isFloatingPoint())
+ return Op;
+
+ ISD::CondCode CC = cast<CondCodeSDNode>(Op.getOperand(4))->get();
+
+ // Cannot handle SETEQ/SETNE.
+ if (CC == ISD::SETEQ || CC == ISD::SETNE) return Op;
+
+ EVT ResVT = Op.getValueType();
+ EVT CmpVT = Op.getOperand(0).getValueType();
+ SDValue LHS = Op.getOperand(0), RHS = Op.getOperand(1);
+ SDValue TV = Op.getOperand(2), FV = Op.getOperand(3);
+ DebugLoc dl = Op.getDebugLoc();
+
+ // If the RHS of the comparison is a 0.0, we don't need to do the
+ // subtraction at all.
+ if (isFloatingPointZero(RHS))
+ switch (CC) {
+ default: break; // SETUO etc aren't handled by fsel.
+ case ISD::SETULT:
+ case ISD::SETLT:
+ std::swap(TV, FV); // fsel is natively setge, swap operands for setlt
+ case ISD::SETOGE:
+ case ISD::SETGE:
+ if (LHS.getValueType() == MVT::f32) // Comparison is always 64-bits
+ LHS = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, LHS);
+ return DAG.getNode(PPCISD::FSEL, dl, ResVT, LHS, TV, FV);
+ case ISD::SETUGT:
+ case ISD::SETGT:
+ std::swap(TV, FV); // fsel is natively setge, swap operands for setlt
+ case ISD::SETOLE:
+ case ISD::SETLE:
+ if (LHS.getValueType() == MVT::f32) // Comparison is always 64-bits
+ LHS = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, LHS);
+ return DAG.getNode(PPCISD::FSEL, dl, ResVT,
+ DAG.getNode(ISD::FNEG, dl, MVT::f64, LHS), TV, FV);
+ }
+
+ SDValue Cmp;
+ switch (CC) {
+ default: break; // SETUO etc aren't handled by fsel.
+ case ISD::SETULT:
+ case ISD::SETLT:
+ Cmp = DAG.getNode(ISD::FSUB, dl, CmpVT, LHS, RHS);
+ if (Cmp.getValueType() == MVT::f32) // Comparison is always 64-bits
+ Cmp = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Cmp);
+ return DAG.getNode(PPCISD::FSEL, dl, ResVT, Cmp, FV, TV);
+ case ISD::SETOGE:
+ case ISD::SETGE:
+ Cmp = DAG.getNode(ISD::FSUB, dl, CmpVT, LHS, RHS);
+ if (Cmp.getValueType() == MVT::f32) // Comparison is always 64-bits
+ Cmp = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Cmp);
+ return DAG.getNode(PPCISD::FSEL, dl, ResVT, Cmp, TV, FV);
+ case ISD::SETUGT:
+ case ISD::SETGT:
+ Cmp = DAG.getNode(ISD::FSUB, dl, CmpVT, RHS, LHS);
+ if (Cmp.getValueType() == MVT::f32) // Comparison is always 64-bits
+ Cmp = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Cmp);
+ return DAG.getNode(PPCISD::FSEL, dl, ResVT, Cmp, FV, TV);
+ case ISD::SETOLE:
+ case ISD::SETLE:
+ Cmp = DAG.getNode(ISD::FSUB, dl, CmpVT, RHS, LHS);
+ if (Cmp.getValueType() == MVT::f32) // Comparison is always 64-bits
+ Cmp = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Cmp);
+ return DAG.getNode(PPCISD::FSEL, dl, ResVT, Cmp, TV, FV);
+ }
+ return Op;
+}
+
+// FIXME: Split this code up when LegalizeDAGTypes lands.
+SDValue PPCTargetLowering::LowerFP_TO_INT(SDValue Op, SelectionDAG &DAG,
+ DebugLoc dl) const {
+ assert(Op.getOperand(0).getValueType().isFloatingPoint());
+ SDValue Src = Op.getOperand(0);
+ if (Src.getValueType() == MVT::f32)
+ Src = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Src);
+
+ SDValue Tmp;
+ switch (Op.getValueType().getSimpleVT().SimpleTy) {
+ default: llvm_unreachable("Unhandled FP_TO_INT type in custom expander!");
+ case MVT::i32:
+ Tmp = DAG.getNode(Op.getOpcode()==ISD::FP_TO_SINT ? PPCISD::FCTIWZ :
+ (PPCSubTarget.hasFPCVT() ? PPCISD::FCTIWUZ :
+ PPCISD::FCTIDZ),
+ dl, MVT::f64, Src);
+ break;
+ case MVT::i64:
+ assert((Op.getOpcode() == ISD::FP_TO_SINT || PPCSubTarget.hasFPCVT()) &&
+ "i64 FP_TO_UINT is supported only with FPCVT");
+ Tmp = DAG.getNode(Op.getOpcode()==ISD::FP_TO_SINT ? PPCISD::FCTIDZ :
+ PPCISD::FCTIDUZ,
+ dl, MVT::f64, Src);
+ break;
+ }
+
+ // Convert the FP value to an int value through memory.
+ bool i32Stack = Op.getValueType() == MVT::i32 && PPCSubTarget.hasSTFIWX() &&
+ (Op.getOpcode() == ISD::FP_TO_SINT || PPCSubTarget.hasFPCVT());
+ SDValue FIPtr = DAG.CreateStackTemporary(i32Stack ? MVT::i32 : MVT::f64);
+ int FI = cast<FrameIndexSDNode>(FIPtr)->getIndex();
+ MachinePointerInfo MPI = MachinePointerInfo::getFixedStack(FI);
+
+ // Emit a store to the stack slot.
+ SDValue Chain;
+ if (i32Stack) {
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineMemOperand *MMO =
+ MF.getMachineMemOperand(MPI, MachineMemOperand::MOStore, 4, 4);
+ SDValue Ops[] = { DAG.getEntryNode(), Tmp, FIPtr };
+ Chain = DAG.getMemIntrinsicNode(PPCISD::STFIWX, dl,
+ DAG.getVTList(MVT::Other), Ops, array_lengthof(Ops),
+ MVT::i32, MMO);
+ } else
+ Chain = DAG.getStore(DAG.getEntryNode(), dl, Tmp, FIPtr,
+ MPI, false, false, 0);
+
+ // Result is a load from the stack slot. If loading 4 bytes, make sure to
+ // add in a bias.
+ if (Op.getValueType() == MVT::i32 && !i32Stack) {
+ FIPtr = DAG.getNode(ISD::ADD, dl, FIPtr.getValueType(), FIPtr,
+ DAG.getConstant(4, FIPtr.getValueType()));
+ MPI = MachinePointerInfo();
+ }
+
+ return DAG.getLoad(Op.getValueType(), dl, Chain, FIPtr, MPI,
+ false, false, false, 0);
+}
+
+SDValue PPCTargetLowering::LowerINT_TO_FP(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ // Don't handle ppc_fp128 here; let it be lowered to a libcall.
+ if (Op.getValueType() != MVT::f32 && Op.getValueType() != MVT::f64)
+ return SDValue();
+
+ assert((Op.getOpcode() == ISD::SINT_TO_FP || PPCSubTarget.hasFPCVT()) &&
+ "UINT_TO_FP is supported only with FPCVT");
+
+ // If we have FCFIDS, then use it when converting to single-precision.
+ // Otherwise, convert to double-precision and then round.
+ unsigned FCFOp = (PPCSubTarget.hasFPCVT() && Op.getValueType() == MVT::f32) ?
+ (Op.getOpcode() == ISD::UINT_TO_FP ?
+ PPCISD::FCFIDUS : PPCISD::FCFIDS) :
+ (Op.getOpcode() == ISD::UINT_TO_FP ?
+ PPCISD::FCFIDU : PPCISD::FCFID);
+ MVT FCFTy = (PPCSubTarget.hasFPCVT() && Op.getValueType() == MVT::f32) ?
+ MVT::f32 : MVT::f64;
+
+ if (Op.getOperand(0).getValueType() == MVT::i64) {
+ SDValue SINT = Op.getOperand(0);
+ // When converting to single-precision, we actually need to convert
+ // to double-precision first and then round to single-precision.
+ // To avoid double-rounding effects during that operation, we have
+ // to prepare the input operand. Bits that might be truncated when
+ // converting to double-precision are replaced by a bit that won't
+ // be lost at this stage, but is below the single-precision rounding
+ // position.
+ //
+ // However, if -enable-unsafe-fp-math is in effect, accept double
+ // rounding to avoid the extra overhead.
+ if (Op.getValueType() == MVT::f32 &&
+ !PPCSubTarget.hasFPCVT() &&
+ !DAG.getTarget().Options.UnsafeFPMath) {
+
+ // Twiddle input to make sure the low 11 bits are zero. (If this
+ // is the case, we are guaranteed the value will fit into the 53 bit
+ // mantissa of an IEEE double-precision value without rounding.)
+ // If any of those low 11 bits were not zero originally, make sure
+ // bit 12 (value 2048) is set instead, so that the final rounding
+ // to single-precision gets the correct result.
+ SDValue Round = DAG.getNode(ISD::AND, dl, MVT::i64,
+ SINT, DAG.getConstant(2047, MVT::i64));
+ Round = DAG.getNode(ISD::ADD, dl, MVT::i64,
+ Round, DAG.getConstant(2047, MVT::i64));
+ Round = DAG.getNode(ISD::OR, dl, MVT::i64, Round, SINT);
+ Round = DAG.getNode(ISD::AND, dl, MVT::i64,
+ Round, DAG.getConstant(-2048, MVT::i64));
+
+ // However, we cannot use that value unconditionally: if the magnitude
+ // of the input value is small, the bit-twiddling we did above might
+ // end up visibly changing the output. Fortunately, in that case, we
+ // don't need to twiddle bits since the original input will convert
+ // exactly to double-precision floating-point already. Therefore,
+ // construct a conditional to use the original value if the top 11
+ // bits are all sign-bit copies, and use the rounded value computed
+ // above otherwise.
+ SDValue Cond = DAG.getNode(ISD::SRA, dl, MVT::i64,
+ SINT, DAG.getConstant(53, MVT::i32));
+ Cond = DAG.getNode(ISD::ADD, dl, MVT::i64,
+ Cond, DAG.getConstant(1, MVT::i64));
+ Cond = DAG.getSetCC(dl, MVT::i32,
+ Cond, DAG.getConstant(1, MVT::i64), ISD::SETUGT);
+
+ SINT = DAG.getNode(ISD::SELECT, dl, MVT::i64, Cond, Round, SINT);
+ }
+
+ SDValue Bits = DAG.getNode(ISD::BITCAST, dl, MVT::f64, SINT);
+ SDValue FP = DAG.getNode(FCFOp, dl, FCFTy, Bits);
+
+ if (Op.getValueType() == MVT::f32 && !PPCSubTarget.hasFPCVT())
+ FP = DAG.getNode(ISD::FP_ROUND, dl,
+ MVT::f32, FP, DAG.getIntPtrConstant(0));
+ return FP;
+ }
+
+ assert(Op.getOperand(0).getValueType() == MVT::i32 &&
+ "Unhandled INT_TO_FP type in custom expander!");
+ // Since we only generate this in 64-bit mode, we can take advantage of
+ // 64-bit registers. In particular, sign extend the input value into the
+ // 64-bit register with extsw, store the WHOLE 64-bit value into the stack
+ // then lfd it and fcfid it.
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineFrameInfo *FrameInfo = MF.getFrameInfo();
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+
+ SDValue Ld;
+ if (PPCSubTarget.hasLFIWAX() || PPCSubTarget.hasFPCVT()) {
+ int FrameIdx = FrameInfo->CreateStackObject(4, 4, false);
+ SDValue FIdx = DAG.getFrameIndex(FrameIdx, PtrVT);
+
+ SDValue Store = DAG.getStore(DAG.getEntryNode(), dl, Op.getOperand(0), FIdx,
+ MachinePointerInfo::getFixedStack(FrameIdx),
+ false, false, 0);
+
+ assert(cast<StoreSDNode>(Store)->getMemoryVT() == MVT::i32 &&
+ "Expected an i32 store");
+ MachineMemOperand *MMO =
+ MF.getMachineMemOperand(MachinePointerInfo::getFixedStack(FrameIdx),
+ MachineMemOperand::MOLoad, 4, 4);
+ SDValue Ops[] = { Store, FIdx };
+ Ld = DAG.getMemIntrinsicNode(Op.getOpcode() == ISD::UINT_TO_FP ?
+ PPCISD::LFIWZX : PPCISD::LFIWAX,
+ dl, DAG.getVTList(MVT::f64, MVT::Other),
+ Ops, 2, MVT::i32, MMO);
+ } else {
+ assert(PPCSubTarget.isPPC64() &&
+ "i32->FP without LFIWAX supported only on PPC64");
+
+ int FrameIdx = FrameInfo->CreateStackObject(8, 8, false);
+ SDValue FIdx = DAG.getFrameIndex(FrameIdx, PtrVT);
+
+ SDValue Ext64 = DAG.getNode(ISD::SIGN_EXTEND, dl, MVT::i64,
+ Op.getOperand(0));
+
+ // STD the extended value into the stack slot.
+ SDValue Store = DAG.getStore(DAG.getEntryNode(), dl, Ext64, FIdx,
+ MachinePointerInfo::getFixedStack(FrameIdx),
+ false, false, 0);
+
+ // Load the value as a double.
+ Ld = DAG.getLoad(MVT::f64, dl, Store, FIdx,
+ MachinePointerInfo::getFixedStack(FrameIdx),
+ false, false, false, 0);
+ }
+
+ // FCFID it and return it.
+ SDValue FP = DAG.getNode(FCFOp, dl, FCFTy, Ld);
+ if (Op.getValueType() == MVT::f32 && !PPCSubTarget.hasFPCVT())
+ FP = DAG.getNode(ISD::FP_ROUND, dl, MVT::f32, FP, DAG.getIntPtrConstant(0));
+ return FP;
+}
+
+SDValue PPCTargetLowering::LowerFLT_ROUNDS_(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ /*
+ The rounding mode is in bits 30:31 of FPSR, and has the following
+ settings:
+ 00 Round to nearest
+ 01 Round to 0
+ 10 Round to +inf
+ 11 Round to -inf
+
+ FLT_ROUNDS, on the other hand, expects the following:
+ -1 Undefined
+ 0 Round to 0
+ 1 Round to nearest
+ 2 Round to +inf
+ 3 Round to -inf
+
+ To perform the conversion, we do:
+ ((FPSCR & 0x3) ^ ((~FPSCR & 0x3) >> 1))
+ */
+
+ MachineFunction &MF = DAG.getMachineFunction();
+ EVT VT = Op.getValueType();
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ SDValue MFFSreg, InFlag;
+
+ // Save FP Control Word to register
+ EVT NodeTys[] = {
+ MVT::f64, // return register
+ MVT::Glue // unused in this context
+ };
+ SDValue Chain = DAG.getNode(PPCISD::MFFS, dl, NodeTys, &InFlag, 0);
+
+ // Save FP register to stack slot
+ int SSFI = MF.getFrameInfo()->CreateStackObject(8, 8, false);
+ SDValue StackSlot = DAG.getFrameIndex(SSFI, PtrVT);
+ SDValue Store = DAG.getStore(DAG.getEntryNode(), dl, Chain,
+ StackSlot, MachinePointerInfo(), false, false,0);
+
+ // Load FP Control Word from low 32 bits of stack slot.
+ SDValue Four = DAG.getConstant(4, PtrVT);
+ SDValue Addr = DAG.getNode(ISD::ADD, dl, PtrVT, StackSlot, Four);
+ SDValue CWD = DAG.getLoad(MVT::i32, dl, Store, Addr, MachinePointerInfo(),
+ false, false, false, 0);
+
+ // Transform as necessary
+ SDValue CWD1 =
+ DAG.getNode(ISD::AND, dl, MVT::i32,
+ CWD, DAG.getConstant(3, MVT::i32));
+ SDValue CWD2 =
+ DAG.getNode(ISD::SRL, dl, MVT::i32,
+ DAG.getNode(ISD::AND, dl, MVT::i32,
+ DAG.getNode(ISD::XOR, dl, MVT::i32,
+ CWD, DAG.getConstant(3, MVT::i32)),
+ DAG.getConstant(3, MVT::i32)),
+ DAG.getConstant(1, MVT::i32));
+
+ SDValue RetVal =
+ DAG.getNode(ISD::XOR, dl, MVT::i32, CWD1, CWD2);
+
+ return DAG.getNode((VT.getSizeInBits() < 16 ?
+ ISD::TRUNCATE : ISD::ZERO_EXTEND), dl, VT, RetVal);
+}
+
+SDValue PPCTargetLowering::LowerSHL_PARTS(SDValue Op, SelectionDAG &DAG) const {
+ EVT VT = Op.getValueType();
+ unsigned BitWidth = VT.getSizeInBits();
+ DebugLoc dl = Op.getDebugLoc();
+ assert(Op.getNumOperands() == 3 &&
+ VT == Op.getOperand(1).getValueType() &&
+ "Unexpected SHL!");
+
+ // Expand into a bunch of logical ops. Note that these ops
+ // depend on the PPC behavior for oversized shift amounts.
+ SDValue Lo = Op.getOperand(0);
+ SDValue Hi = Op.getOperand(1);
+ SDValue Amt = Op.getOperand(2);
+ EVT AmtVT = Amt.getValueType();
+
+ SDValue Tmp1 = DAG.getNode(ISD::SUB, dl, AmtVT,
+ DAG.getConstant(BitWidth, AmtVT), Amt);
+ SDValue Tmp2 = DAG.getNode(PPCISD::SHL, dl, VT, Hi, Amt);
+ SDValue Tmp3 = DAG.getNode(PPCISD::SRL, dl, VT, Lo, Tmp1);
+ SDValue Tmp4 = DAG.getNode(ISD::OR , dl, VT, Tmp2, Tmp3);
+ SDValue Tmp5 = DAG.getNode(ISD::ADD, dl, AmtVT, Amt,
+ DAG.getConstant(-BitWidth, AmtVT));
+ SDValue Tmp6 = DAG.getNode(PPCISD::SHL, dl, VT, Lo, Tmp5);
+ SDValue OutHi = DAG.getNode(ISD::OR, dl, VT, Tmp4, Tmp6);
+ SDValue OutLo = DAG.getNode(PPCISD::SHL, dl, VT, Lo, Amt);
+ SDValue OutOps[] = { OutLo, OutHi };
+ return DAG.getMergeValues(OutOps, 2, dl);
+}
+
+SDValue PPCTargetLowering::LowerSRL_PARTS(SDValue Op, SelectionDAG &DAG) const {
+ EVT VT = Op.getValueType();
+ DebugLoc dl = Op.getDebugLoc();
+ unsigned BitWidth = VT.getSizeInBits();
+ assert(Op.getNumOperands() == 3 &&
+ VT == Op.getOperand(1).getValueType() &&
+ "Unexpected SRL!");
+
+ // Expand into a bunch of logical ops. Note that these ops
+ // depend on the PPC behavior for oversized shift amounts.
+ SDValue Lo = Op.getOperand(0);
+ SDValue Hi = Op.getOperand(1);
+ SDValue Amt = Op.getOperand(2);
+ EVT AmtVT = Amt.getValueType();
+
+ SDValue Tmp1 = DAG.getNode(ISD::SUB, dl, AmtVT,
+ DAG.getConstant(BitWidth, AmtVT), Amt);
+ SDValue Tmp2 = DAG.getNode(PPCISD::SRL, dl, VT, Lo, Amt);
+ SDValue Tmp3 = DAG.getNode(PPCISD::SHL, dl, VT, Hi, Tmp1);
+ SDValue Tmp4 = DAG.getNode(ISD::OR, dl, VT, Tmp2, Tmp3);
+ SDValue Tmp5 = DAG.getNode(ISD::ADD, dl, AmtVT, Amt,
+ DAG.getConstant(-BitWidth, AmtVT));
+ SDValue Tmp6 = DAG.getNode(PPCISD::SRL, dl, VT, Hi, Tmp5);
+ SDValue OutLo = DAG.getNode(ISD::OR, dl, VT, Tmp4, Tmp6);
+ SDValue OutHi = DAG.getNode(PPCISD::SRL, dl, VT, Hi, Amt);
+ SDValue OutOps[] = { OutLo, OutHi };
+ return DAG.getMergeValues(OutOps, 2, dl);
+}
+
+SDValue PPCTargetLowering::LowerSRA_PARTS(SDValue Op, SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ EVT VT = Op.getValueType();
+ unsigned BitWidth = VT.getSizeInBits();
+ assert(Op.getNumOperands() == 3 &&
+ VT == Op.getOperand(1).getValueType() &&
+ "Unexpected SRA!");
+
+ // Expand into a bunch of logical ops, followed by a select_cc.
+ SDValue Lo = Op.getOperand(0);
+ SDValue Hi = Op.getOperand(1);
+ SDValue Amt = Op.getOperand(2);
+ EVT AmtVT = Amt.getValueType();
+
+ SDValue Tmp1 = DAG.getNode(ISD::SUB, dl, AmtVT,
+ DAG.getConstant(BitWidth, AmtVT), Amt);
+ SDValue Tmp2 = DAG.getNode(PPCISD::SRL, dl, VT, Lo, Amt);
+ SDValue Tmp3 = DAG.getNode(PPCISD::SHL, dl, VT, Hi, Tmp1);
+ SDValue Tmp4 = DAG.getNode(ISD::OR, dl, VT, Tmp2, Tmp3);
+ SDValue Tmp5 = DAG.getNode(ISD::ADD, dl, AmtVT, Amt,
+ DAG.getConstant(-BitWidth, AmtVT));
+ SDValue Tmp6 = DAG.getNode(PPCISD::SRA, dl, VT, Hi, Tmp5);
+ SDValue OutHi = DAG.getNode(PPCISD::SRA, dl, VT, Hi, Amt);
+ SDValue OutLo = DAG.getSelectCC(dl, Tmp5, DAG.getConstant(0, AmtVT),
+ Tmp4, Tmp6, ISD::SETLE);
+ SDValue OutOps[] = { OutLo, OutHi };
+ return DAG.getMergeValues(OutOps, 2, dl);
+}
+
+//===----------------------------------------------------------------------===//
+// Vector related lowering.
+//
+
+/// BuildSplatI - Build a canonical splati of Val with an element size of
+/// SplatSize. Cast the result to VT.
+static SDValue BuildSplatI(int Val, unsigned SplatSize, EVT VT,
+ SelectionDAG &DAG, DebugLoc dl) {
+ assert(Val >= -16 && Val <= 15 && "vsplti is out of range!");
+
+ static const EVT VTys[] = { // canonical VT to use for each size.
+ MVT::v16i8, MVT::v8i16, MVT::Other, MVT::v4i32
+ };
+
+ EVT ReqVT = VT != MVT::Other ? VT : VTys[SplatSize-1];
+
+ // Force vspltis[hw] -1 to vspltisb -1 to canonicalize.
+ if (Val == -1)
+ SplatSize = 1;
+
+ EVT CanonicalVT = VTys[SplatSize-1];
+
+ // Build a canonical splat for this value.
+ SDValue Elt = DAG.getConstant(Val, MVT::i32);
+ SmallVector<SDValue, 8> Ops;
+ Ops.assign(CanonicalVT.getVectorNumElements(), Elt);
+ SDValue Res = DAG.getNode(ISD::BUILD_VECTOR, dl, CanonicalVT,
+ &Ops[0], Ops.size());
+ return DAG.getNode(ISD::BITCAST, dl, ReqVT, Res);
+}
+
+/// BuildIntrinsicOp - Return a binary operator intrinsic node with the
+/// specified intrinsic ID.
+static SDValue BuildIntrinsicOp(unsigned IID, SDValue LHS, SDValue RHS,
+ SelectionDAG &DAG, DebugLoc dl,
+ EVT DestVT = MVT::Other) {
+ if (DestVT == MVT::Other) DestVT = LHS.getValueType();
+ return DAG.getNode(ISD::INTRINSIC_WO_CHAIN, dl, DestVT,
+ DAG.getConstant(IID, MVT::i32), LHS, RHS);
+}
+
+/// BuildIntrinsicOp - Return a ternary operator intrinsic node with the
+/// specified intrinsic ID.
+static SDValue BuildIntrinsicOp(unsigned IID, SDValue Op0, SDValue Op1,
+ SDValue Op2, SelectionDAG &DAG,
+ DebugLoc dl, EVT DestVT = MVT::Other) {
+ if (DestVT == MVT::Other) DestVT = Op0.getValueType();
+ return DAG.getNode(ISD::INTRINSIC_WO_CHAIN, dl, DestVT,
+ DAG.getConstant(IID, MVT::i32), Op0, Op1, Op2);
+}
+
+
+/// BuildVSLDOI - Return a VECTOR_SHUFFLE that is a vsldoi of the specified
+/// amount. The result has the specified value type.
+static SDValue BuildVSLDOI(SDValue LHS, SDValue RHS, unsigned Amt,
+ EVT VT, SelectionDAG &DAG, DebugLoc dl) {
+ // Force LHS/RHS to be the right type.
+ LHS = DAG.getNode(ISD::BITCAST, dl, MVT::v16i8, LHS);
+ RHS = DAG.getNode(ISD::BITCAST, dl, MVT::v16i8, RHS);
+
+ int Ops[16];
+ for (unsigned i = 0; i != 16; ++i)
+ Ops[i] = i + Amt;
+ SDValue T = DAG.getVectorShuffle(MVT::v16i8, dl, LHS, RHS, Ops);
+ return DAG.getNode(ISD::BITCAST, dl, VT, T);
+}
+
+// If this is a case we can't handle, return null and let the default
+// expansion code take care of it. If we CAN select this case, and if it
+// selects to a single instruction, return Op. Otherwise, if we can codegen
+// this case more efficiently than a constant pool load, lower it to the
+// sequence of ops that should be used.
+SDValue PPCTargetLowering::LowerBUILD_VECTOR(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ BuildVectorSDNode *BVN = dyn_cast<BuildVectorSDNode>(Op.getNode());
+ assert(BVN != 0 && "Expected a BuildVectorSDNode in LowerBUILD_VECTOR");
+
+ // Check if this is a splat of a constant value.
+ APInt APSplatBits, APSplatUndef;
+ unsigned SplatBitSize;
+ bool HasAnyUndefs;
+ if (! BVN->isConstantSplat(APSplatBits, APSplatUndef, SplatBitSize,
+ HasAnyUndefs, 0, true) || SplatBitSize > 32)
+ return SDValue();
+
+ unsigned SplatBits = APSplatBits.getZExtValue();
+ unsigned SplatUndef = APSplatUndef.getZExtValue();
+ unsigned SplatSize = SplatBitSize / 8;
+
+ // First, handle single instruction cases.
+
+ // All zeros?
+ if (SplatBits == 0) {
+ // Canonicalize all zero vectors to be v4i32.
+ if (Op.getValueType() != MVT::v4i32 || HasAnyUndefs) {
+ SDValue Z = DAG.getConstant(0, MVT::i32);
+ Z = DAG.getNode(ISD::BUILD_VECTOR, dl, MVT::v4i32, Z, Z, Z, Z);
+ Op = DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Z);
+ }
+ return Op;
+ }
+
+ // If the sign extended value is in the range [-16,15], use VSPLTI[bhw].
+ int32_t SextVal= (int32_t(SplatBits << (32-SplatBitSize)) >>
+ (32-SplatBitSize));
+ if (SextVal >= -16 && SextVal <= 15)
+ return BuildSplatI(SextVal, SplatSize, Op.getValueType(), DAG, dl);
+
+
+ // Two instruction sequences.
+
+ // If this value is in the range [-32,30] and is even, use:
+ // VSPLTI[bhw](val/2) + VSPLTI[bhw](val/2)
+ // If this value is in the range [17,31] and is odd, use:
+ // VSPLTI[bhw](val-16) - VSPLTI[bhw](-16)
+ // If this value is in the range [-31,-17] and is odd, use:
+ // VSPLTI[bhw](val+16) + VSPLTI[bhw](-16)
+ // Note the last two are three-instruction sequences.
+ if (SextVal >= -32 && SextVal <= 31) {
+ // To avoid having these optimizations undone by constant folding,
+ // we convert to a pseudo that will be expanded later into one of
+ // the above forms.
+ SDValue Elt = DAG.getConstant(SextVal, MVT::i32);
+ EVT VT = Op.getValueType();
+ int Size = VT == MVT::v16i8 ? 1 : (VT == MVT::v8i16 ? 2 : 4);
+ SDValue EltSize = DAG.getConstant(Size, MVT::i32);
+ return DAG.getNode(PPCISD::VADD_SPLAT, dl, VT, Elt, EltSize);
+ }
+
+ // If this is 0x8000_0000 x 4, turn into vspltisw + vslw. If it is
+ // 0x7FFF_FFFF x 4, turn it into not(0x8000_0000). This is important
+ // for fneg/fabs.
+ if (SplatSize == 4 && SplatBits == (0x7FFFFFFF&~SplatUndef)) {
+ // Make -1 and vspltisw -1:
+ SDValue OnesV = BuildSplatI(-1, 4, MVT::v4i32, DAG, dl);
+
+ // Make the VSLW intrinsic, computing 0x8000_0000.
+ SDValue Res = BuildIntrinsicOp(Intrinsic::ppc_altivec_vslw, OnesV,
+ OnesV, DAG, dl);
+
+ // xor by OnesV to invert it.
+ Res = DAG.getNode(ISD::XOR, dl, MVT::v4i32, Res, OnesV);
+ return DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Res);
+ }
+
+ // Check to see if this is a wide variety of vsplti*, binop self cases.
+ static const signed char SplatCsts[] = {
+ -1, 1, -2, 2, -3, 3, -4, 4, -5, 5, -6, 6, -7, 7,
+ -8, 8, -9, 9, -10, 10, -11, 11, -12, 12, -13, 13, 14, -14, 15, -15, -16
+ };
+
+ for (unsigned idx = 0; idx < array_lengthof(SplatCsts); ++idx) {
+ // Indirect through the SplatCsts array so that we favor 'vsplti -1' for
+ // cases which are ambiguous (e.g. formation of 0x8000_0000). 'vsplti -1'
+ int i = SplatCsts[idx];
+
+ // Figure out what shift amount will be used by altivec if shifted by i in
+ // this splat size.
+ unsigned TypeShiftAmt = i & (SplatBitSize-1);
+
+ // vsplti + shl self.
+ if (SextVal == (int)((unsigned)i << TypeShiftAmt)) {
+ SDValue Res = BuildSplatI(i, SplatSize, MVT::Other, DAG, dl);
+ static const unsigned IIDs[] = { // Intrinsic to use for each size.
+ Intrinsic::ppc_altivec_vslb, Intrinsic::ppc_altivec_vslh, 0,
+ Intrinsic::ppc_altivec_vslw
+ };
+ Res = BuildIntrinsicOp(IIDs[SplatSize-1], Res, Res, DAG, dl);
+ return DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Res);
+ }
+
+ // vsplti + srl self.
+ if (SextVal == (int)((unsigned)i >> TypeShiftAmt)) {
+ SDValue Res = BuildSplatI(i, SplatSize, MVT::Other, DAG, dl);
+ static const unsigned IIDs[] = { // Intrinsic to use for each size.
+ Intrinsic::ppc_altivec_vsrb, Intrinsic::ppc_altivec_vsrh, 0,
+ Intrinsic::ppc_altivec_vsrw
+ };
+ Res = BuildIntrinsicOp(IIDs[SplatSize-1], Res, Res, DAG, dl);
+ return DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Res);
+ }
+
+ // vsplti + sra self.
+ if (SextVal == (int)((unsigned)i >> TypeShiftAmt)) {
+ SDValue Res = BuildSplatI(i, SplatSize, MVT::Other, DAG, dl);
+ static const unsigned IIDs[] = { // Intrinsic to use for each size.
+ Intrinsic::ppc_altivec_vsrab, Intrinsic::ppc_altivec_vsrah, 0,
+ Intrinsic::ppc_altivec_vsraw
+ };
+ Res = BuildIntrinsicOp(IIDs[SplatSize-1], Res, Res, DAG, dl);
+ return DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Res);
+ }
+
+ // vsplti + rol self.
+ if (SextVal == (int)(((unsigned)i << TypeShiftAmt) |
+ ((unsigned)i >> (SplatBitSize-TypeShiftAmt)))) {
+ SDValue Res = BuildSplatI(i, SplatSize, MVT::Other, DAG, dl);
+ static const unsigned IIDs[] = { // Intrinsic to use for each size.
+ Intrinsic::ppc_altivec_vrlb, Intrinsic::ppc_altivec_vrlh, 0,
+ Intrinsic::ppc_altivec_vrlw
+ };
+ Res = BuildIntrinsicOp(IIDs[SplatSize-1], Res, Res, DAG, dl);
+ return DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Res);
+ }
+
+ // t = vsplti c, result = vsldoi t, t, 1
+ if (SextVal == (int)(((unsigned)i << 8) | (i < 0 ? 0xFF : 0))) {
+ SDValue T = BuildSplatI(i, SplatSize, MVT::v16i8, DAG, dl);
+ return BuildVSLDOI(T, T, 1, Op.getValueType(), DAG, dl);
+ }
+ // t = vsplti c, result = vsldoi t, t, 2
+ if (SextVal == (int)(((unsigned)i << 16) | (i < 0 ? 0xFFFF : 0))) {
+ SDValue T = BuildSplatI(i, SplatSize, MVT::v16i8, DAG, dl);
+ return BuildVSLDOI(T, T, 2, Op.getValueType(), DAG, dl);
+ }
+ // t = vsplti c, result = vsldoi t, t, 3
+ if (SextVal == (int)(((unsigned)i << 24) | (i < 0 ? 0xFFFFFF : 0))) {
+ SDValue T = BuildSplatI(i, SplatSize, MVT::v16i8, DAG, dl);
+ return BuildVSLDOI(T, T, 3, Op.getValueType(), DAG, dl);
+ }
+ }
+
+ return SDValue();
+}
+
+/// GeneratePerfectShuffle - Given an entry in the perfect-shuffle table, emit
+/// the specified operations to build the shuffle.
+static SDValue GeneratePerfectShuffle(unsigned PFEntry, SDValue LHS,
+ SDValue RHS, SelectionDAG &DAG,
+ DebugLoc dl) {
+ unsigned OpNum = (PFEntry >> 26) & 0x0F;
+ unsigned LHSID = (PFEntry >> 13) & ((1 << 13)-1);
+ unsigned RHSID = (PFEntry >> 0) & ((1 << 13)-1);
+
+ enum {
+ OP_COPY = 0, // Copy, used for things like <u,u,u,3> to say it is <0,1,2,3>
+ OP_VMRGHW,
+ OP_VMRGLW,
+ OP_VSPLTISW0,
+ OP_VSPLTISW1,
+ OP_VSPLTISW2,
+ OP_VSPLTISW3,
+ OP_VSLDOI4,
+ OP_VSLDOI8,
+ OP_VSLDOI12
+ };
+
+ if (OpNum == OP_COPY) {
+ if (LHSID == (1*9+2)*9+3) return LHS;
+ assert(LHSID == ((4*9+5)*9+6)*9+7 && "Illegal OP_COPY!");
+ return RHS;
+ }
+
+ SDValue OpLHS, OpRHS;
+ OpLHS = GeneratePerfectShuffle(PerfectShuffleTable[LHSID], LHS, RHS, DAG, dl);
+ OpRHS = GeneratePerfectShuffle(PerfectShuffleTable[RHSID], LHS, RHS, DAG, dl);
+
+ int ShufIdxs[16];
+ switch (OpNum) {
+ default: llvm_unreachable("Unknown i32 permute!");
+ case OP_VMRGHW:
+ ShufIdxs[ 0] = 0; ShufIdxs[ 1] = 1; ShufIdxs[ 2] = 2; ShufIdxs[ 3] = 3;
+ ShufIdxs[ 4] = 16; ShufIdxs[ 5] = 17; ShufIdxs[ 6] = 18; ShufIdxs[ 7] = 19;
+ ShufIdxs[ 8] = 4; ShufIdxs[ 9] = 5; ShufIdxs[10] = 6; ShufIdxs[11] = 7;
+ ShufIdxs[12] = 20; ShufIdxs[13] = 21; ShufIdxs[14] = 22; ShufIdxs[15] = 23;
+ break;
+ case OP_VMRGLW:
+ ShufIdxs[ 0] = 8; ShufIdxs[ 1] = 9; ShufIdxs[ 2] = 10; ShufIdxs[ 3] = 11;
+ ShufIdxs[ 4] = 24; ShufIdxs[ 5] = 25; ShufIdxs[ 6] = 26; ShufIdxs[ 7] = 27;
+ ShufIdxs[ 8] = 12; ShufIdxs[ 9] = 13; ShufIdxs[10] = 14; ShufIdxs[11] = 15;
+ ShufIdxs[12] = 28; ShufIdxs[13] = 29; ShufIdxs[14] = 30; ShufIdxs[15] = 31;
+ break;
+ case OP_VSPLTISW0:
+ for (unsigned i = 0; i != 16; ++i)
+ ShufIdxs[i] = (i&3)+0;
+ break;
+ case OP_VSPLTISW1:
+ for (unsigned i = 0; i != 16; ++i)
+ ShufIdxs[i] = (i&3)+4;
+ break;
+ case OP_VSPLTISW2:
+ for (unsigned i = 0; i != 16; ++i)
+ ShufIdxs[i] = (i&3)+8;
+ break;
+ case OP_VSPLTISW3:
+ for (unsigned i = 0; i != 16; ++i)
+ ShufIdxs[i] = (i&3)+12;
+ break;
+ case OP_VSLDOI4:
+ return BuildVSLDOI(OpLHS, OpRHS, 4, OpLHS.getValueType(), DAG, dl);
+ case OP_VSLDOI8:
+ return BuildVSLDOI(OpLHS, OpRHS, 8, OpLHS.getValueType(), DAG, dl);
+ case OP_VSLDOI12:
+ return BuildVSLDOI(OpLHS, OpRHS, 12, OpLHS.getValueType(), DAG, dl);
+ }
+ EVT VT = OpLHS.getValueType();
+ OpLHS = DAG.getNode(ISD::BITCAST, dl, MVT::v16i8, OpLHS);
+ OpRHS = DAG.getNode(ISD::BITCAST, dl, MVT::v16i8, OpRHS);
+ SDValue T = DAG.getVectorShuffle(MVT::v16i8, dl, OpLHS, OpRHS, ShufIdxs);
+ return DAG.getNode(ISD::BITCAST, dl, VT, T);
+}
+
+/// LowerVECTOR_SHUFFLE - Return the code we lower for VECTOR_SHUFFLE. If this
+/// is a shuffle we can handle in a single instruction, return it. Otherwise,
+/// return the code it can be lowered into. Worst case, it can always be
+/// lowered into a vperm.
+SDValue PPCTargetLowering::LowerVECTOR_SHUFFLE(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ SDValue V1 = Op.getOperand(0);
+ SDValue V2 = Op.getOperand(1);
+ ShuffleVectorSDNode *SVOp = cast<ShuffleVectorSDNode>(Op);
+ EVT VT = Op.getValueType();
+
+ // Cases that are handled by instructions that take permute immediates
+ // (such as vsplt*) should be left as VECTOR_SHUFFLE nodes so they can be
+ // selected by the instruction selector.
+ if (V2.getOpcode() == ISD::UNDEF) {
+ if (PPC::isSplatShuffleMask(SVOp, 1) ||
+ PPC::isSplatShuffleMask(SVOp, 2) ||
+ PPC::isSplatShuffleMask(SVOp, 4) ||
+ PPC::isVPKUWUMShuffleMask(SVOp, true) ||
+ PPC::isVPKUHUMShuffleMask(SVOp, true) ||
+ PPC::isVSLDOIShuffleMask(SVOp, true) != -1 ||
+ PPC::isVMRGLShuffleMask(SVOp, 1, true) ||
+ PPC::isVMRGLShuffleMask(SVOp, 2, true) ||
+ PPC::isVMRGLShuffleMask(SVOp, 4, true) ||
+ PPC::isVMRGHShuffleMask(SVOp, 1, true) ||
+ PPC::isVMRGHShuffleMask(SVOp, 2, true) ||
+ PPC::isVMRGHShuffleMask(SVOp, 4, true)) {
+ return Op;
+ }
+ }
+
+ // Altivec has a variety of "shuffle immediates" that take two vector inputs
+ // and produce a fixed permutation. If any of these match, do not lower to
+ // VPERM.
+ if (PPC::isVPKUWUMShuffleMask(SVOp, false) ||
+ PPC::isVPKUHUMShuffleMask(SVOp, false) ||
+ PPC::isVSLDOIShuffleMask(SVOp, false) != -1 ||
+ PPC::isVMRGLShuffleMask(SVOp, 1, false) ||
+ PPC::isVMRGLShuffleMask(SVOp, 2, false) ||
+ PPC::isVMRGLShuffleMask(SVOp, 4, false) ||
+ PPC::isVMRGHShuffleMask(SVOp, 1, false) ||
+ PPC::isVMRGHShuffleMask(SVOp, 2, false) ||
+ PPC::isVMRGHShuffleMask(SVOp, 4, false))
+ return Op;
+
+ // Check to see if this is a shuffle of 4-byte values. If so, we can use our
+ // perfect shuffle table to emit an optimal matching sequence.
+ ArrayRef<int> PermMask = SVOp->getMask();
+
+ unsigned PFIndexes[4];
+ bool isFourElementShuffle = true;
+ for (unsigned i = 0; i != 4 && isFourElementShuffle; ++i) { // Element number
+ unsigned EltNo = 8; // Start out undef.
+ for (unsigned j = 0; j != 4; ++j) { // Intra-element byte.
+ if (PermMask[i*4+j] < 0)
+ continue; // Undef, ignore it.
+
+ unsigned ByteSource = PermMask[i*4+j];
+ if ((ByteSource & 3) != j) {
+ isFourElementShuffle = false;
+ break;
+ }
+
+ if (EltNo == 8) {
+ EltNo = ByteSource/4;
+ } else if (EltNo != ByteSource/4) {
+ isFourElementShuffle = false;
+ break;
+ }
+ }
+ PFIndexes[i] = EltNo;
+ }
+
+ // If this shuffle can be expressed as a shuffle of 4-byte elements, use the
+ // perfect shuffle vector to determine if it is cost effective to do this as
+ // discrete instructions, or whether we should use a vperm.
+ if (isFourElementShuffle) {
+ // Compute the index in the perfect shuffle table.
+ unsigned PFTableIndex =
+ PFIndexes[0]*9*9*9+PFIndexes[1]*9*9+PFIndexes[2]*9+PFIndexes[3];
+
+ unsigned PFEntry = PerfectShuffleTable[PFTableIndex];
+ unsigned Cost = (PFEntry >> 30);
+
+ // Determining when to avoid vperm is tricky. Many things affect the cost
+ // of vperm, particularly how many times the perm mask needs to be computed.
+ // For example, if the perm mask can be hoisted out of a loop or is already
+ // used (perhaps because there are multiple permutes with the same shuffle
+ // mask?) the vperm has a cost of 1. OTOH, hoisting the permute mask out of
+ // the loop requires an extra register.
+ //
+ // As a compromise, we only emit discrete instructions if the shuffle can be
+ // generated in 3 or fewer operations. When we have loop information
+ // available, if this block is within a loop, we should avoid using vperm
+ // for 3-operation perms and use a constant pool load instead.
+ if (Cost < 3)
+ return GeneratePerfectShuffle(PFEntry, V1, V2, DAG, dl);
+ }
+
+ // Lower this to a VPERM(V1, V2, V3) expression, where V3 is a constant
+ // vector that will get spilled to the constant pool.
+ if (V2.getOpcode() == ISD::UNDEF) V2 = V1;
+
+ // The SHUFFLE_VECTOR mask is almost exactly what we want for vperm, except
+ // that it is in input element units, not in bytes. Convert now.
+ EVT EltVT = V1.getValueType().getVectorElementType();
+ unsigned BytesPerElement = EltVT.getSizeInBits()/8;
+
+ SmallVector<SDValue, 16> ResultMask;
+ for (unsigned i = 0, e = VT.getVectorNumElements(); i != e; ++i) {
+ unsigned SrcElt = PermMask[i] < 0 ? 0 : PermMask[i];
+
+ for (unsigned j = 0; j != BytesPerElement; ++j)
+ ResultMask.push_back(DAG.getConstant(SrcElt*BytesPerElement+j,
+ MVT::i32));
+ }
+
+ SDValue VPermMask = DAG.getNode(ISD::BUILD_VECTOR, dl, MVT::v16i8,
+ &ResultMask[0], ResultMask.size());
+ return DAG.getNode(PPCISD::VPERM, dl, V1.getValueType(), V1, V2, VPermMask);
+}
+
+/// getAltivecCompareInfo - Given an intrinsic, return false if it is not an
+/// altivec comparison. If it is, return true and fill in Opc/isDot with
+/// information about the intrinsic.
+static bool getAltivecCompareInfo(SDValue Intrin, int &CompareOpc,
+ bool &isDot) {
+ unsigned IntrinsicID =
+ cast<ConstantSDNode>(Intrin.getOperand(0))->getZExtValue();
+ CompareOpc = -1;
+ isDot = false;
+ switch (IntrinsicID) {
+ default: return false;
+ // Comparison predicates.
+ case Intrinsic::ppc_altivec_vcmpbfp_p: CompareOpc = 966; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpeqfp_p: CompareOpc = 198; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpequb_p: CompareOpc = 6; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpequh_p: CompareOpc = 70; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpequw_p: CompareOpc = 134; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgefp_p: CompareOpc = 454; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtfp_p: CompareOpc = 710; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtsb_p: CompareOpc = 774; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtsh_p: CompareOpc = 838; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtsw_p: CompareOpc = 902; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtub_p: CompareOpc = 518; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtuh_p: CompareOpc = 582; isDot = 1; break;
+ case Intrinsic::ppc_altivec_vcmpgtuw_p: CompareOpc = 646; isDot = 1; break;
+
+ // Normal Comparisons.
+ case Intrinsic::ppc_altivec_vcmpbfp: CompareOpc = 966; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpeqfp: CompareOpc = 198; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpequb: CompareOpc = 6; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpequh: CompareOpc = 70; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpequw: CompareOpc = 134; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgefp: CompareOpc = 454; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtfp: CompareOpc = 710; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtsb: CompareOpc = 774; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtsh: CompareOpc = 838; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtsw: CompareOpc = 902; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtub: CompareOpc = 518; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtuh: CompareOpc = 582; isDot = 0; break;
+ case Intrinsic::ppc_altivec_vcmpgtuw: CompareOpc = 646; isDot = 0; break;
+ }
+ return true;
+}
+
+/// LowerINTRINSIC_WO_CHAIN - If this is an intrinsic that we want to custom
+/// lower, do it, otherwise return null.
+SDValue PPCTargetLowering::LowerINTRINSIC_WO_CHAIN(SDValue Op,
+ SelectionDAG &DAG) const {
+ // If this is a lowered altivec predicate compare, CompareOpc is set to the
+ // opcode number of the comparison.
+ DebugLoc dl = Op.getDebugLoc();
+ int CompareOpc;
+ bool isDot;
+ if (!getAltivecCompareInfo(Op, CompareOpc, isDot))
+ return SDValue(); // Don't custom lower most intrinsics.
+
+ // If this is a non-dot comparison, make the VCMP node and we are done.
+ if (!isDot) {
+ SDValue Tmp = DAG.getNode(PPCISD::VCMP, dl, Op.getOperand(2).getValueType(),
+ Op.getOperand(1), Op.getOperand(2),
+ DAG.getConstant(CompareOpc, MVT::i32));
+ return DAG.getNode(ISD::BITCAST, dl, Op.getValueType(), Tmp);
+ }
+
+ // Create the PPCISD altivec 'dot' comparison node.
+ SDValue Ops[] = {
+ Op.getOperand(2), // LHS
+ Op.getOperand(3), // RHS
+ DAG.getConstant(CompareOpc, MVT::i32)
+ };
+ EVT VTs[] = { Op.getOperand(2).getValueType(), MVT::Glue };
+ SDValue CompNode = DAG.getNode(PPCISD::VCMPo, dl, VTs, Ops, 3);
+
+ // Now that we have the comparison, emit a copy from the CR to a GPR.
+ // This is flagged to the above dot comparison.
+ SDValue Flags = DAG.getNode(PPCISD::MFCR, dl, MVT::i32,
+ DAG.getRegister(PPC::CR6, MVT::i32),
+ CompNode.getValue(1));
+
+ // Unpack the result based on how the target uses it.
+ unsigned BitNo; // Bit # of CR6.
+ bool InvertBit; // Invert result?
+ switch (cast<ConstantSDNode>(Op.getOperand(1))->getZExtValue()) {
+ default: // Can't happen, don't crash on invalid number though.
+ case 0: // Return the value of the EQ bit of CR6.
+ BitNo = 0; InvertBit = false;
+ break;
+ case 1: // Return the inverted value of the EQ bit of CR6.
+ BitNo = 0; InvertBit = true;
+ break;
+ case 2: // Return the value of the LT bit of CR6.
+ BitNo = 2; InvertBit = false;
+ break;
+ case 3: // Return the inverted value of the LT bit of CR6.
+ BitNo = 2; InvertBit = true;
+ break;
+ }
+
+ // Shift the bit into the low position.
+ Flags = DAG.getNode(ISD::SRL, dl, MVT::i32, Flags,
+ DAG.getConstant(8-(3-BitNo), MVT::i32));
+ // Isolate the bit.
+ Flags = DAG.getNode(ISD::AND, dl, MVT::i32, Flags,
+ DAG.getConstant(1, MVT::i32));
+
+ // If we are supposed to, toggle the bit.
+ if (InvertBit)
+ Flags = DAG.getNode(ISD::XOR, dl, MVT::i32, Flags,
+ DAG.getConstant(1, MVT::i32));
+ return Flags;
+}
+
+SDValue PPCTargetLowering::LowerSCALAR_TO_VECTOR(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ // Create a stack slot that is 16-byte aligned.
+ MachineFrameInfo *FrameInfo = DAG.getMachineFunction().getFrameInfo();
+ int FrameIdx = FrameInfo->CreateStackObject(16, 16, false);
+ EVT PtrVT = getPointerTy();
+ SDValue FIdx = DAG.getFrameIndex(FrameIdx, PtrVT);
+
+ // Store the input value into Value#0 of the stack slot.
+ SDValue Store = DAG.getStore(DAG.getEntryNode(), dl,
+ Op.getOperand(0), FIdx, MachinePointerInfo(),
+ false, false, 0);
+ // Load it out.
+ return DAG.getLoad(Op.getValueType(), dl, Store, FIdx, MachinePointerInfo(),
+ false, false, false, 0);
+}
+
+SDValue PPCTargetLowering::LowerMUL(SDValue Op, SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ if (Op.getValueType() == MVT::v4i32) {
+ SDValue LHS = Op.getOperand(0), RHS = Op.getOperand(1);
+
+ SDValue Zero = BuildSplatI( 0, 1, MVT::v4i32, DAG, dl);
+ SDValue Neg16 = BuildSplatI(-16, 4, MVT::v4i32, DAG, dl);//+16 as shift amt.
+
+ SDValue RHSSwap = // = vrlw RHS, 16
+ BuildIntrinsicOp(Intrinsic::ppc_altivec_vrlw, RHS, Neg16, DAG, dl);
+
+ // Shrinkify inputs to v8i16.
+ LHS = DAG.getNode(ISD::BITCAST, dl, MVT::v8i16, LHS);
+ RHS = DAG.getNode(ISD::BITCAST, dl, MVT::v8i16, RHS);
+ RHSSwap = DAG.getNode(ISD::BITCAST, dl, MVT::v8i16, RHSSwap);
+
+ // Low parts multiplied together, generating 32-bit results (we ignore the
+ // top parts).
+ SDValue LoProd = BuildIntrinsicOp(Intrinsic::ppc_altivec_vmulouh,
+ LHS, RHS, DAG, dl, MVT::v4i32);
+
+ SDValue HiProd = BuildIntrinsicOp(Intrinsic::ppc_altivec_vmsumuhm,
+ LHS, RHSSwap, Zero, DAG, dl, MVT::v4i32);
+ // Shift the high parts up 16 bits.
+ HiProd = BuildIntrinsicOp(Intrinsic::ppc_altivec_vslw, HiProd,
+ Neg16, DAG, dl);
+ return DAG.getNode(ISD::ADD, dl, MVT::v4i32, LoProd, HiProd);
+ } else if (Op.getValueType() == MVT::v8i16) {
+ SDValue LHS = Op.getOperand(0), RHS = Op.getOperand(1);
+
+ SDValue Zero = BuildSplatI(0, 1, MVT::v8i16, DAG, dl);
+
+ return BuildIntrinsicOp(Intrinsic::ppc_altivec_vmladduhm,
+ LHS, RHS, Zero, DAG, dl);
+ } else if (Op.getValueType() == MVT::v16i8) {
+ SDValue LHS = Op.getOperand(0), RHS = Op.getOperand(1);
+
+ // Multiply the even 8-bit parts, producing 16-bit sums.
+ SDValue EvenParts = BuildIntrinsicOp(Intrinsic::ppc_altivec_vmuleub,
+ LHS, RHS, DAG, dl, MVT::v8i16);
+ EvenParts = DAG.getNode(ISD::BITCAST, dl, MVT::v16i8, EvenParts);
+
+ // Multiply the odd 8-bit parts, producing 16-bit sums.
+ SDValue OddParts = BuildIntrinsicOp(Intrinsic::ppc_altivec_vmuloub,
+ LHS, RHS, DAG, dl, MVT::v8i16);
+ OddParts = DAG.getNode(ISD::BITCAST, dl, MVT::v16i8, OddParts);
+
+ // Merge the results together.
+ int Ops[16];
+ for (unsigned i = 0; i != 8; ++i) {
+ Ops[i*2 ] = 2*i+1;
+ Ops[i*2+1] = 2*i+1+16;
+ }
+ return DAG.getVectorShuffle(MVT::v16i8, dl, EvenParts, OddParts, Ops);
+ } else {
+ llvm_unreachable("Unknown mul to lower!");
+ }
+}
+
+/// LowerOperation - Provide custom lowering hooks for some operations.
+///
+SDValue PPCTargetLowering::LowerOperation(SDValue Op, SelectionDAG &DAG) const {
+ switch (Op.getOpcode()) {
+ default: llvm_unreachable("Wasn't expecting to be able to lower this!");
+ case ISD::ConstantPool: return LowerConstantPool(Op, DAG);
+ case ISD::BlockAddress: return LowerBlockAddress(Op, DAG);
+ case ISD::GlobalAddress: return LowerGlobalAddress(Op, DAG);
+ case ISD::GlobalTLSAddress: return LowerGlobalTLSAddress(Op, DAG);
+ case ISD::JumpTable: return LowerJumpTable(Op, DAG);
+ case ISD::SETCC: return LowerSETCC(Op, DAG);
+ case ISD::INIT_TRAMPOLINE: return LowerINIT_TRAMPOLINE(Op, DAG);
+ case ISD::ADJUST_TRAMPOLINE: return LowerADJUST_TRAMPOLINE(Op, DAG);
+ case ISD::VASTART:
+ return LowerVASTART(Op, DAG, PPCSubTarget);
+
+ case ISD::VAARG:
+ return LowerVAARG(Op, DAG, PPCSubTarget);
+
+ case ISD::STACKRESTORE: return LowerSTACKRESTORE(Op, DAG, PPCSubTarget);
+ case ISD::DYNAMIC_STACKALLOC:
+ return LowerDYNAMIC_STACKALLOC(Op, DAG, PPCSubTarget);
+
+ case ISD::EH_SJLJ_SETJMP: return lowerEH_SJLJ_SETJMP(Op, DAG);
+ case ISD::EH_SJLJ_LONGJMP: return lowerEH_SJLJ_LONGJMP(Op, DAG);
+
+ case ISD::SELECT_CC: return LowerSELECT_CC(Op, DAG);
+ case ISD::FP_TO_UINT:
+ case ISD::FP_TO_SINT: return LowerFP_TO_INT(Op, DAG,
+ Op.getDebugLoc());
+ case ISD::UINT_TO_FP:
+ case ISD::SINT_TO_FP: return LowerINT_TO_FP(Op, DAG);
+ case ISD::FLT_ROUNDS_: return LowerFLT_ROUNDS_(Op, DAG);
+
+ // Lower 64-bit shifts.
+ case ISD::SHL_PARTS: return LowerSHL_PARTS(Op, DAG);
+ case ISD::SRL_PARTS: return LowerSRL_PARTS(Op, DAG);
+ case ISD::SRA_PARTS: return LowerSRA_PARTS(Op, DAG);
+
+ // Vector-related lowering.
+ case ISD::BUILD_VECTOR: return LowerBUILD_VECTOR(Op, DAG);
+ case ISD::VECTOR_SHUFFLE: return LowerVECTOR_SHUFFLE(Op, DAG);
+ case ISD::INTRINSIC_WO_CHAIN: return LowerINTRINSIC_WO_CHAIN(Op, DAG);
+ case ISD::SCALAR_TO_VECTOR: return LowerSCALAR_TO_VECTOR(Op, DAG);
+ case ISD::MUL: return LowerMUL(Op, DAG);
+
+ // Frame & Return address.
+ case ISD::RETURNADDR: return LowerRETURNADDR(Op, DAG);
+ case ISD::FRAMEADDR: return LowerFRAMEADDR(Op, DAG);
+ }
+}
+
+void PPCTargetLowering::ReplaceNodeResults(SDNode *N,
+ SmallVectorImpl<SDValue>&Results,
+ SelectionDAG &DAG) const {
+ const TargetMachine &TM = getTargetMachine();
+ DebugLoc dl = N->getDebugLoc();
+ switch (N->getOpcode()) {
+ default:
+ llvm_unreachable("Do not know how to custom type legalize this operation!");
+ case ISD::VAARG: {
+ if (!TM.getSubtarget<PPCSubtarget>().isSVR4ABI()
+ || TM.getSubtarget<PPCSubtarget>().isPPC64())
+ return;
+
+ EVT VT = N->getValueType(0);
+
+ if (VT == MVT::i64) {
+ SDValue NewNode = LowerVAARG(SDValue(N, 1), DAG, PPCSubTarget);
+
+ Results.push_back(NewNode);
+ Results.push_back(NewNode.getValue(1));
+ }
+ return;
+ }
+ case ISD::FP_ROUND_INREG: {
+ assert(N->getValueType(0) == MVT::ppcf128);
+ assert(N->getOperand(0).getValueType() == MVT::ppcf128);
+ SDValue Lo = DAG.getNode(ISD::EXTRACT_ELEMENT, dl,
+ MVT::f64, N->getOperand(0),
+ DAG.getIntPtrConstant(0));
+ SDValue Hi = DAG.getNode(ISD::EXTRACT_ELEMENT, dl,
+ MVT::f64, N->getOperand(0),
+ DAG.getIntPtrConstant(1));
+
+ // Add the two halves of the long double in round-to-zero mode.
+ SDValue FPreg = DAG.getNode(PPCISD::FADDRTZ, dl, MVT::f64, Lo, Hi);
+
+ // We know the low half is about to be thrown away, so just use something
+ // convenient.
+ Results.push_back(DAG.getNode(ISD::BUILD_PAIR, dl, MVT::ppcf128,
+ FPreg, FPreg));
+ return;
+ }
+ case ISD::FP_TO_SINT:
+ Results.push_back(LowerFP_TO_INT(SDValue(N, 0), DAG, dl));
+ return;
+ }
+}
+
+
+//===----------------------------------------------------------------------===//
+// Other Lowering Code
+//===----------------------------------------------------------------------===//
+
+MachineBasicBlock *
+PPCTargetLowering::EmitAtomicBinary(MachineInstr *MI, MachineBasicBlock *BB,
+ bool is64bit, unsigned BinOpcode) const {
+ // This also handles ATOMIC_SWAP, indicated by BinOpcode==0.
+ const TargetInstrInfo *TII = getTargetMachine().getInstrInfo();
+
+ const BasicBlock *LLVM_BB = BB->getBasicBlock();
+ MachineFunction *F = BB->getParent();
+ MachineFunction::iterator It = BB;
+ ++It;
+
+ unsigned dest = MI->getOperand(0).getReg();
+ unsigned ptrA = MI->getOperand(1).getReg();
+ unsigned ptrB = MI->getOperand(2).getReg();
+ unsigned incr = MI->getOperand(3).getReg();
+ DebugLoc dl = MI->getDebugLoc();
+
+ MachineBasicBlock *loopMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *exitMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ F->insert(It, loopMBB);
+ F->insert(It, exitMBB);
+ exitMBB->splice(exitMBB->begin(), BB,
+ llvm::next(MachineBasicBlock::iterator(MI)),
+ BB->end());
+ exitMBB->transferSuccessorsAndUpdatePHIs(BB);
+
+ MachineRegisterInfo &RegInfo = F->getRegInfo();
+ unsigned TmpReg = (!BinOpcode) ? incr :
+ RegInfo.createVirtualRegister(
+ is64bit ? (const TargetRegisterClass *) &PPC::G8RCRegClass :
+ (const TargetRegisterClass *) &PPC::GPRCRegClass);
+
+ // thisMBB:
+ // ...
+ // fallthrough --> loopMBB
+ BB->addSuccessor(loopMBB);
+
+ // loopMBB:
+ // l[wd]arx dest, ptr
+ // add r0, dest, incr
+ // st[wd]cx. r0, ptr
+ // bne- loopMBB
+ // fallthrough --> exitMBB
+ BB = loopMBB;
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::LDARX : PPC::LWARX), dest)
+ .addReg(ptrA).addReg(ptrB);
+ if (BinOpcode)
+ BuildMI(BB, dl, TII->get(BinOpcode), TmpReg).addReg(incr).addReg(dest);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::STDCX : PPC::STWCX))
+ .addReg(TmpReg).addReg(ptrA).addReg(ptrB);
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_NE).addReg(PPC::CR0).addMBB(loopMBB);
+ BB->addSuccessor(loopMBB);
+ BB->addSuccessor(exitMBB);
+
+ // exitMBB:
+ // ...
+ BB = exitMBB;
+ return BB;
+}
+
+MachineBasicBlock *
+PPCTargetLowering::EmitPartwordAtomicBinary(MachineInstr *MI,
+ MachineBasicBlock *BB,
+ bool is8bit, // operation
+ unsigned BinOpcode) const {
+ // This also handles ATOMIC_SWAP, indicated by BinOpcode==0.
+ const TargetInstrInfo *TII = getTargetMachine().getInstrInfo();
+ // In 64 bit mode we have to use 64 bits for addresses, even though the
+ // lwarx/stwcx are 32 bits. With the 32-bit atomics we can use address
+ // registers without caring whether they're 32 or 64, but here we're
+ // doing actual arithmetic on the addresses.
+ bool is64bit = PPCSubTarget.isPPC64();
+ unsigned ZeroReg = is64bit ? PPC::ZERO8 : PPC::ZERO;
+
+ const BasicBlock *LLVM_BB = BB->getBasicBlock();
+ MachineFunction *F = BB->getParent();
+ MachineFunction::iterator It = BB;
+ ++It;
+
+ unsigned dest = MI->getOperand(0).getReg();
+ unsigned ptrA = MI->getOperand(1).getReg();
+ unsigned ptrB = MI->getOperand(2).getReg();
+ unsigned incr = MI->getOperand(3).getReg();
+ DebugLoc dl = MI->getDebugLoc();
+
+ MachineBasicBlock *loopMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *exitMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ F->insert(It, loopMBB);
+ F->insert(It, exitMBB);
+ exitMBB->splice(exitMBB->begin(), BB,
+ llvm::next(MachineBasicBlock::iterator(MI)),
+ BB->end());
+ exitMBB->transferSuccessorsAndUpdatePHIs(BB);
+
+ MachineRegisterInfo &RegInfo = F->getRegInfo();
+ const TargetRegisterClass *RC =
+ is64bit ? (const TargetRegisterClass *) &PPC::G8RCRegClass :
+ (const TargetRegisterClass *) &PPC::GPRCRegClass;
+ unsigned PtrReg = RegInfo.createVirtualRegister(RC);
+ unsigned Shift1Reg = RegInfo.createVirtualRegister(RC);
+ unsigned ShiftReg = RegInfo.createVirtualRegister(RC);
+ unsigned Incr2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned MaskReg = RegInfo.createVirtualRegister(RC);
+ unsigned Mask2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Mask3Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Tmp2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Tmp3Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Tmp4Reg = RegInfo.createVirtualRegister(RC);
+ unsigned TmpDestReg = RegInfo.createVirtualRegister(RC);
+ unsigned Ptr1Reg;
+ unsigned TmpReg = (!BinOpcode) ? Incr2Reg : RegInfo.createVirtualRegister(RC);
+
+ // thisMBB:
+ // ...
+ // fallthrough --> loopMBB
+ BB->addSuccessor(loopMBB);
+
+ // The 4-byte load must be aligned, while a char or short may be
+ // anywhere in the word. Hence all this nasty bookkeeping code.
+ // add ptr1, ptrA, ptrB [copy if ptrA==0]
+ // rlwinm shift1, ptr1, 3, 27, 28 [3, 27, 27]
+ // xori shift, shift1, 24 [16]
+ // rlwinm ptr, ptr1, 0, 0, 29
+ // slw incr2, incr, shift
+ // li mask2, 255 [li mask3, 0; ori mask2, mask3, 65535]
+ // slw mask, mask2, shift
+ // loopMBB:
+ // lwarx tmpDest, ptr
+ // add tmp, tmpDest, incr2
+ // andc tmp2, tmpDest, mask
+ // and tmp3, tmp, mask
+ // or tmp4, tmp3, tmp2
+ // stwcx. tmp4, ptr
+ // bne- loopMBB
+ // fallthrough --> exitMBB
+ // srw dest, tmpDest, shift
+ if (ptrA != ZeroReg) {
+ Ptr1Reg = RegInfo.createVirtualRegister(RC);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::ADD8 : PPC::ADD4), Ptr1Reg)
+ .addReg(ptrA).addReg(ptrB);
+ } else {
+ Ptr1Reg = ptrB;
+ }
+ BuildMI(BB, dl, TII->get(PPC::RLWINM), Shift1Reg).addReg(Ptr1Reg)
+ .addImm(3).addImm(27).addImm(is8bit ? 28 : 27);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::XORI8 : PPC::XORI), ShiftReg)
+ .addReg(Shift1Reg).addImm(is8bit ? 24 : 16);
+ if (is64bit)
+ BuildMI(BB, dl, TII->get(PPC::RLDICR), PtrReg)
+ .addReg(Ptr1Reg).addImm(0).addImm(61);
+ else
+ BuildMI(BB, dl, TII->get(PPC::RLWINM), PtrReg)
+ .addReg(Ptr1Reg).addImm(0).addImm(0).addImm(29);
+ BuildMI(BB, dl, TII->get(PPC::SLW), Incr2Reg)
+ .addReg(incr).addReg(ShiftReg);
+ if (is8bit)
+ BuildMI(BB, dl, TII->get(PPC::LI), Mask2Reg).addImm(255);
+ else {
+ BuildMI(BB, dl, TII->get(PPC::LI), Mask3Reg).addImm(0);
+ BuildMI(BB, dl, TII->get(PPC::ORI),Mask2Reg).addReg(Mask3Reg).addImm(65535);
+ }
+ BuildMI(BB, dl, TII->get(PPC::SLW), MaskReg)
+ .addReg(Mask2Reg).addReg(ShiftReg);
+
+ BB = loopMBB;
+ BuildMI(BB, dl, TII->get(PPC::LWARX), TmpDestReg)
+ .addReg(ZeroReg).addReg(PtrReg);
+ if (BinOpcode)
+ BuildMI(BB, dl, TII->get(BinOpcode), TmpReg)
+ .addReg(Incr2Reg).addReg(TmpDestReg);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::ANDC8 : PPC::ANDC), Tmp2Reg)
+ .addReg(TmpDestReg).addReg(MaskReg);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::AND8 : PPC::AND), Tmp3Reg)
+ .addReg(TmpReg).addReg(MaskReg);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::OR8 : PPC::OR), Tmp4Reg)
+ .addReg(Tmp3Reg).addReg(Tmp2Reg);
+ BuildMI(BB, dl, TII->get(PPC::STWCX))
+ .addReg(Tmp4Reg).addReg(ZeroReg).addReg(PtrReg);
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_NE).addReg(PPC::CR0).addMBB(loopMBB);
+ BB->addSuccessor(loopMBB);
+ BB->addSuccessor(exitMBB);
+
+ // exitMBB:
+ // ...
+ BB = exitMBB;
+ BuildMI(*BB, BB->begin(), dl, TII->get(PPC::SRW), dest).addReg(TmpDestReg)
+ .addReg(ShiftReg);
+ return BB;
+}
+
+llvm::MachineBasicBlock*
+PPCTargetLowering::emitEHSjLjSetJmp(MachineInstr *MI,
+ MachineBasicBlock *MBB) const {
+ DebugLoc DL = MI->getDebugLoc();
+ const TargetInstrInfo *TII = getTargetMachine().getInstrInfo();
+
+ MachineFunction *MF = MBB->getParent();
+ MachineRegisterInfo &MRI = MF->getRegInfo();
+
+ const BasicBlock *BB = MBB->getBasicBlock();
+ MachineFunction::iterator I = MBB;
+ ++I;
+
+ // Memory Reference
+ MachineInstr::mmo_iterator MMOBegin = MI->memoperands_begin();
+ MachineInstr::mmo_iterator MMOEnd = MI->memoperands_end();
+
+ unsigned DstReg = MI->getOperand(0).getReg();
+ const TargetRegisterClass *RC = MRI.getRegClass(DstReg);
+ assert(RC->hasType(MVT::i32) && "Invalid destination!");
+ unsigned mainDstReg = MRI.createVirtualRegister(RC);
+ unsigned restoreDstReg = MRI.createVirtualRegister(RC);
+
+ MVT PVT = getPointerTy();
+ assert((PVT == MVT::i64 || PVT == MVT::i32) &&
+ "Invalid Pointer Size!");
+ // For v = setjmp(buf), we generate
+ //
+ // thisMBB:
+ // SjLjSetup mainMBB
+ // bl mainMBB
+ // v_restore = 1
+ // b sinkMBB
+ //
+ // mainMBB:
+ // buf[LabelOffset] = LR
+ // v_main = 0
+ //
+ // sinkMBB:
+ // v = phi(main, restore)
+ //
+
+ MachineBasicBlock *thisMBB = MBB;
+ MachineBasicBlock *mainMBB = MF->CreateMachineBasicBlock(BB);
+ MachineBasicBlock *sinkMBB = MF->CreateMachineBasicBlock(BB);
+ MF->insert(I, mainMBB);
+ MF->insert(I, sinkMBB);
+
+ MachineInstrBuilder MIB;
+
+ // Transfer the remainder of BB and its successor edges to sinkMBB.
+ sinkMBB->splice(sinkMBB->begin(), MBB,
+ llvm::next(MachineBasicBlock::iterator(MI)), MBB->end());
+ sinkMBB->transferSuccessorsAndUpdatePHIs(MBB);
+
+ // Note that the structure of the jmp_buf used here is not compatible
+ // with that used by libc, and is not designed to be. Specifically, it
+ // stores only those 'reserved' registers that LLVM does not otherwise
+ // understand how to spill. Also, by convention, by the time this
+ // intrinsic is called, Clang has already stored the frame address in the
+ // first slot of the buffer and stack address in the third. Following the
+ // X86 target code, we'll store the jump address in the second slot. We also
+ // need to save the TOC pointer (R2) to handle jumps between shared
+ // libraries, and that will be stored in the fourth slot. The thread
+ // identifier (R13) is not affected.
+
+ // thisMBB:
+ const int64_t LabelOffset = 1 * PVT.getStoreSize();
+ const int64_t TOCOffset = 3 * PVT.getStoreSize();
+
+ // Prepare IP either in reg.
+ const TargetRegisterClass *PtrRC = getRegClassFor(PVT);
+ unsigned LabelReg = MRI.createVirtualRegister(PtrRC);
+ unsigned BufReg = MI->getOperand(1).getReg();
+
+ if (PPCSubTarget.isPPC64() && PPCSubTarget.isSVR4ABI()) {
+ MIB = BuildMI(*thisMBB, MI, DL, TII->get(PPC::STD))
+ .addReg(PPC::X2)
+ .addImm(TOCOffset / 4)
+ .addReg(BufReg);
+
+ MIB.setMemRefs(MMOBegin, MMOEnd);
+ }
+
+ // Setup
+ MIB = BuildMI(*thisMBB, MI, DL, TII->get(PPC::BCLalways)).addMBB(mainMBB);
+ MIB.addRegMask(PPCRegInfo->getNoPreservedMask());
+
+ BuildMI(*thisMBB, MI, DL, TII->get(PPC::LI), restoreDstReg).addImm(1);
+
+ MIB = BuildMI(*thisMBB, MI, DL, TII->get(PPC::EH_SjLj_Setup))
+ .addMBB(mainMBB);
+ MIB = BuildMI(*thisMBB, MI, DL, TII->get(PPC::B)).addMBB(sinkMBB);
+
+ thisMBB->addSuccessor(mainMBB, /* weight */ 0);
+ thisMBB->addSuccessor(sinkMBB, /* weight */ 1);
+
+ // mainMBB:
+ // mainDstReg = 0
+ MIB = BuildMI(mainMBB, DL,
+ TII->get(PPCSubTarget.isPPC64() ? PPC::MFLR8 : PPC::MFLR), LabelReg);
+
+ // Store IP
+ if (PPCSubTarget.isPPC64()) {
+ MIB = BuildMI(mainMBB, DL, TII->get(PPC::STD))
+ .addReg(LabelReg)
+ .addImm(LabelOffset / 4)
+ .addReg(BufReg);
+ } else {
+ MIB = BuildMI(mainMBB, DL, TII->get(PPC::STW))
+ .addReg(LabelReg)
+ .addImm(LabelOffset)
+ .addReg(BufReg);
+ }
+
+ MIB.setMemRefs(MMOBegin, MMOEnd);
+
+ BuildMI(mainMBB, DL, TII->get(PPC::LI), mainDstReg).addImm(0);
+ mainMBB->addSuccessor(sinkMBB);
+
+ // sinkMBB:
+ BuildMI(*sinkMBB, sinkMBB->begin(), DL,
+ TII->get(PPC::PHI), DstReg)
+ .addReg(mainDstReg).addMBB(mainMBB)
+ .addReg(restoreDstReg).addMBB(thisMBB);
+
+ MI->eraseFromParent();
+ return sinkMBB;
+}
+
+MachineBasicBlock *
+PPCTargetLowering::emitEHSjLjLongJmp(MachineInstr *MI,
+ MachineBasicBlock *MBB) const {
+ DebugLoc DL = MI->getDebugLoc();
+ const TargetInstrInfo *TII = getTargetMachine().getInstrInfo();
+
+ MachineFunction *MF = MBB->getParent();
+ MachineRegisterInfo &MRI = MF->getRegInfo();
+
+ // Memory Reference
+ MachineInstr::mmo_iterator MMOBegin = MI->memoperands_begin();
+ MachineInstr::mmo_iterator MMOEnd = MI->memoperands_end();
+
+ MVT PVT = getPointerTy();
+ assert((PVT == MVT::i64 || PVT == MVT::i32) &&
+ "Invalid Pointer Size!");
+
+ const TargetRegisterClass *RC =
+ (PVT == MVT::i64) ? &PPC::G8RCRegClass : &PPC::GPRCRegClass;
+ unsigned Tmp = MRI.createVirtualRegister(RC);
+ // Since FP is only updated here but NOT referenced, it's treated as GPR.
+ unsigned FP = (PVT == MVT::i64) ? PPC::X31 : PPC::R31;
+ unsigned SP = (PVT == MVT::i64) ? PPC::X1 : PPC::R1;
+
+ MachineInstrBuilder MIB;
+
+ const int64_t LabelOffset = 1 * PVT.getStoreSize();
+ const int64_t SPOffset = 2 * PVT.getStoreSize();
+ const int64_t TOCOffset = 3 * PVT.getStoreSize();
+
+ unsigned BufReg = MI->getOperand(0).getReg();
+
+ // Reload FP (the jumped-to function may not have had a
+ // frame pointer, and if so, then its r31 will be restored
+ // as necessary).
+ if (PVT == MVT::i64) {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LD), FP)
+ .addImm(0)
+ .addReg(BufReg);
+ } else {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LWZ), FP)
+ .addImm(0)
+ .addReg(BufReg);
+ }
+ MIB.setMemRefs(MMOBegin, MMOEnd);
+
+ // Reload IP
+ if (PVT == MVT::i64) {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LD), Tmp)
+ .addImm(LabelOffset / 4)
+ .addReg(BufReg);
+ } else {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LWZ), Tmp)
+ .addImm(LabelOffset)
+ .addReg(BufReg);
+ }
+ MIB.setMemRefs(MMOBegin, MMOEnd);
+
+ // Reload SP
+ if (PVT == MVT::i64) {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LD), SP)
+ .addImm(SPOffset / 4)
+ .addReg(BufReg);
+ } else {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LWZ), SP)
+ .addImm(SPOffset)
+ .addReg(BufReg);
+ }
+ MIB.setMemRefs(MMOBegin, MMOEnd);
+
+ // FIXME: When we also support base pointers, that register must also be
+ // restored here.
+
+ // Reload TOC
+ if (PVT == MVT::i64 && PPCSubTarget.isSVR4ABI()) {
+ MIB = BuildMI(*MBB, MI, DL, TII->get(PPC::LD), PPC::X2)
+ .addImm(TOCOffset / 4)
+ .addReg(BufReg);
+
+ MIB.setMemRefs(MMOBegin, MMOEnd);
+ }
+
+ // Jump
+ BuildMI(*MBB, MI, DL,
+ TII->get(PVT == MVT::i64 ? PPC::MTCTR8 : PPC::MTCTR)).addReg(Tmp);
+ BuildMI(*MBB, MI, DL, TII->get(PVT == MVT::i64 ? PPC::BCTR8 : PPC::BCTR));
+
+ MI->eraseFromParent();
+ return MBB;
+}
+
+MachineBasicBlock *
+PPCTargetLowering::EmitInstrWithCustomInserter(MachineInstr *MI,
+ MachineBasicBlock *BB) const {
+ if (MI->getOpcode() == PPC::EH_SjLj_SetJmp32 ||
+ MI->getOpcode() == PPC::EH_SjLj_SetJmp64) {
+ return emitEHSjLjSetJmp(MI, BB);
+ } else if (MI->getOpcode() == PPC::EH_SjLj_LongJmp32 ||
+ MI->getOpcode() == PPC::EH_SjLj_LongJmp64) {
+ return emitEHSjLjLongJmp(MI, BB);
+ }
+
+ const TargetInstrInfo *TII = getTargetMachine().getInstrInfo();
+
+ // To "insert" these instructions we actually have to insert their
+ // control-flow patterns.
+ const BasicBlock *LLVM_BB = BB->getBasicBlock();
+ MachineFunction::iterator It = BB;
+ ++It;
+
+ MachineFunction *F = BB->getParent();
+
+ if (PPCSubTarget.hasISEL() && (MI->getOpcode() == PPC::SELECT_CC_I4 ||
+ MI->getOpcode() == PPC::SELECT_CC_I8)) {
+ unsigned OpCode = MI->getOpcode() == PPC::SELECT_CC_I8 ?
+ PPC::ISEL8 : PPC::ISEL;
+ unsigned SelectPred = MI->getOperand(4).getImm();
+ DebugLoc dl = MI->getDebugLoc();
+
+ unsigned SubIdx;
+ bool SwapOps;
+ switch (SelectPred) {
+ default: llvm_unreachable("invalid predicate for isel");
+ case PPC::PRED_EQ: SubIdx = PPC::sub_eq; SwapOps = false; break;
+ case PPC::PRED_NE: SubIdx = PPC::sub_eq; SwapOps = true; break;
+ case PPC::PRED_LT: SubIdx = PPC::sub_lt; SwapOps = false; break;
+ case PPC::PRED_GE: SubIdx = PPC::sub_lt; SwapOps = true; break;
+ case PPC::PRED_GT: SubIdx = PPC::sub_gt; SwapOps = false; break;
+ case PPC::PRED_LE: SubIdx = PPC::sub_gt; SwapOps = true; break;
+ case PPC::PRED_UN: SubIdx = PPC::sub_un; SwapOps = false; break;
+ case PPC::PRED_NU: SubIdx = PPC::sub_un; SwapOps = true; break;
+ }
+
+ BuildMI(*BB, MI, dl, TII->get(OpCode), MI->getOperand(0).getReg())
+ .addReg(MI->getOperand(SwapOps? 3 : 2).getReg())
+ .addReg(MI->getOperand(SwapOps? 2 : 3).getReg())
+ .addReg(MI->getOperand(1).getReg(), 0, SubIdx);
+ } else if (MI->getOpcode() == PPC::SELECT_CC_I4 ||
+ MI->getOpcode() == PPC::SELECT_CC_I8 ||
+ MI->getOpcode() == PPC::SELECT_CC_F4 ||
+ MI->getOpcode() == PPC::SELECT_CC_F8 ||
+ MI->getOpcode() == PPC::SELECT_CC_VRRC) {
+
+
+ // The incoming instruction knows the destination vreg to set, the
+ // condition code register to branch on, the true/false values to
+ // select between, and a branch opcode to use.
+
+ // thisMBB:
+ // ...
+ // TrueVal = ...
+ // cmpTY ccX, r1, r2
+ // bCC copy1MBB
+ // fallthrough --> copy0MBB
+ MachineBasicBlock *thisMBB = BB;
+ MachineBasicBlock *copy0MBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *sinkMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ unsigned SelectPred = MI->getOperand(4).getImm();
+ DebugLoc dl = MI->getDebugLoc();
+ F->insert(It, copy0MBB);
+ F->insert(It, sinkMBB);
+
+ // Transfer the remainder of BB and its successor edges to sinkMBB.
+ sinkMBB->splice(sinkMBB->begin(), BB,
+ llvm::next(MachineBasicBlock::iterator(MI)),
+ BB->end());
+ sinkMBB->transferSuccessorsAndUpdatePHIs(BB);
+
+ // Next, add the true and fallthrough blocks as its successors.
+ BB->addSuccessor(copy0MBB);
+ BB->addSuccessor(sinkMBB);
+
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(SelectPred).addReg(MI->getOperand(1).getReg()).addMBB(sinkMBB);
+
+ // copy0MBB:
+ // %FalseValue = ...
+ // # fallthrough to sinkMBB
+ BB = copy0MBB;
+
+ // Update machine-CFG edges
+ BB->addSuccessor(sinkMBB);
+
+ // sinkMBB:
+ // %Result = phi [ %FalseValue, copy0MBB ], [ %TrueValue, thisMBB ]
+ // ...
+ BB = sinkMBB;
+ BuildMI(*BB, BB->begin(), dl,
+ TII->get(PPC::PHI), MI->getOperand(0).getReg())
+ .addReg(MI->getOperand(3).getReg()).addMBB(copy0MBB)
+ .addReg(MI->getOperand(2).getReg()).addMBB(thisMBB);
+ }
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_ADD_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, PPC::ADD4);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_ADD_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, PPC::ADD4);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_ADD_I32)
+ BB = EmitAtomicBinary(MI, BB, false, PPC::ADD4);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_ADD_I64)
+ BB = EmitAtomicBinary(MI, BB, true, PPC::ADD8);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_AND_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, PPC::AND);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_AND_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, PPC::AND);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_AND_I32)
+ BB = EmitAtomicBinary(MI, BB, false, PPC::AND);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_AND_I64)
+ BB = EmitAtomicBinary(MI, BB, true, PPC::AND8);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_OR_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, PPC::OR);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_OR_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, PPC::OR);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_OR_I32)
+ BB = EmitAtomicBinary(MI, BB, false, PPC::OR);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_OR_I64)
+ BB = EmitAtomicBinary(MI, BB, true, PPC::OR8);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_XOR_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, PPC::XOR);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_XOR_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, PPC::XOR);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_XOR_I32)
+ BB = EmitAtomicBinary(MI, BB, false, PPC::XOR);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_XOR_I64)
+ BB = EmitAtomicBinary(MI, BB, true, PPC::XOR8);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_NAND_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, PPC::ANDC);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_NAND_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, PPC::ANDC);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_NAND_I32)
+ BB = EmitAtomicBinary(MI, BB, false, PPC::ANDC);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_NAND_I64)
+ BB = EmitAtomicBinary(MI, BB, true, PPC::ANDC8);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_SUB_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, PPC::SUBF);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_SUB_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, PPC::SUBF);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_SUB_I32)
+ BB = EmitAtomicBinary(MI, BB, false, PPC::SUBF);
+ else if (MI->getOpcode() == PPC::ATOMIC_LOAD_SUB_I64)
+ BB = EmitAtomicBinary(MI, BB, true, PPC::SUBF8);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_SWAP_I8)
+ BB = EmitPartwordAtomicBinary(MI, BB, true, 0);
+ else if (MI->getOpcode() == PPC::ATOMIC_SWAP_I16)
+ BB = EmitPartwordAtomicBinary(MI, BB, false, 0);
+ else if (MI->getOpcode() == PPC::ATOMIC_SWAP_I32)
+ BB = EmitAtomicBinary(MI, BB, false, 0);
+ else if (MI->getOpcode() == PPC::ATOMIC_SWAP_I64)
+ BB = EmitAtomicBinary(MI, BB, true, 0);
+
+ else if (MI->getOpcode() == PPC::ATOMIC_CMP_SWAP_I32 ||
+ MI->getOpcode() == PPC::ATOMIC_CMP_SWAP_I64) {
+ bool is64bit = MI->getOpcode() == PPC::ATOMIC_CMP_SWAP_I64;
+
+ unsigned dest = MI->getOperand(0).getReg();
+ unsigned ptrA = MI->getOperand(1).getReg();
+ unsigned ptrB = MI->getOperand(2).getReg();
+ unsigned oldval = MI->getOperand(3).getReg();
+ unsigned newval = MI->getOperand(4).getReg();
+ DebugLoc dl = MI->getDebugLoc();
+
+ MachineBasicBlock *loop1MBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *loop2MBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *midMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *exitMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ F->insert(It, loop1MBB);
+ F->insert(It, loop2MBB);
+ F->insert(It, midMBB);
+ F->insert(It, exitMBB);
+ exitMBB->splice(exitMBB->begin(), BB,
+ llvm::next(MachineBasicBlock::iterator(MI)),
+ BB->end());
+ exitMBB->transferSuccessorsAndUpdatePHIs(BB);
+
+ // thisMBB:
+ // ...
+ // fallthrough --> loopMBB
+ BB->addSuccessor(loop1MBB);
+
+ // loop1MBB:
+ // l[wd]arx dest, ptr
+ // cmp[wd] dest, oldval
+ // bne- midMBB
+ // loop2MBB:
+ // st[wd]cx. newval, ptr
+ // bne- loopMBB
+ // b exitBB
+ // midMBB:
+ // st[wd]cx. dest, ptr
+ // exitBB:
+ BB = loop1MBB;
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::LDARX : PPC::LWARX), dest)
+ .addReg(ptrA).addReg(ptrB);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::CMPD : PPC::CMPW), PPC::CR0)
+ .addReg(oldval).addReg(dest);
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_NE).addReg(PPC::CR0).addMBB(midMBB);
+ BB->addSuccessor(loop2MBB);
+ BB->addSuccessor(midMBB);
+
+ BB = loop2MBB;
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::STDCX : PPC::STWCX))
+ .addReg(newval).addReg(ptrA).addReg(ptrB);
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_NE).addReg(PPC::CR0).addMBB(loop1MBB);
+ BuildMI(BB, dl, TII->get(PPC::B)).addMBB(exitMBB);
+ BB->addSuccessor(loop1MBB);
+ BB->addSuccessor(exitMBB);
+
+ BB = midMBB;
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::STDCX : PPC::STWCX))
+ .addReg(dest).addReg(ptrA).addReg(ptrB);
+ BB->addSuccessor(exitMBB);
+
+ // exitMBB:
+ // ...
+ BB = exitMBB;
+ } else if (MI->getOpcode() == PPC::ATOMIC_CMP_SWAP_I8 ||
+ MI->getOpcode() == PPC::ATOMIC_CMP_SWAP_I16) {
+ // We must use 64-bit registers for addresses when targeting 64-bit,
+ // since we're actually doing arithmetic on them. Other registers
+ // can be 32-bit.
+ bool is64bit = PPCSubTarget.isPPC64();
+ bool is8bit = MI->getOpcode() == PPC::ATOMIC_CMP_SWAP_I8;
+
+ unsigned dest = MI->getOperand(0).getReg();
+ unsigned ptrA = MI->getOperand(1).getReg();
+ unsigned ptrB = MI->getOperand(2).getReg();
+ unsigned oldval = MI->getOperand(3).getReg();
+ unsigned newval = MI->getOperand(4).getReg();
+ DebugLoc dl = MI->getDebugLoc();
+
+ MachineBasicBlock *loop1MBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *loop2MBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *midMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *exitMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ F->insert(It, loop1MBB);
+ F->insert(It, loop2MBB);
+ F->insert(It, midMBB);
+ F->insert(It, exitMBB);
+ exitMBB->splice(exitMBB->begin(), BB,
+ llvm::next(MachineBasicBlock::iterator(MI)),
+ BB->end());
+ exitMBB->transferSuccessorsAndUpdatePHIs(BB);
+
+ MachineRegisterInfo &RegInfo = F->getRegInfo();
+ const TargetRegisterClass *RC =
+ is64bit ? (const TargetRegisterClass *) &PPC::G8RCRegClass :
+ (const TargetRegisterClass *) &PPC::GPRCRegClass;
+ unsigned PtrReg = RegInfo.createVirtualRegister(RC);
+ unsigned Shift1Reg = RegInfo.createVirtualRegister(RC);
+ unsigned ShiftReg = RegInfo.createVirtualRegister(RC);
+ unsigned NewVal2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned NewVal3Reg = RegInfo.createVirtualRegister(RC);
+ unsigned OldVal2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned OldVal3Reg = RegInfo.createVirtualRegister(RC);
+ unsigned MaskReg = RegInfo.createVirtualRegister(RC);
+ unsigned Mask2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Mask3Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Tmp2Reg = RegInfo.createVirtualRegister(RC);
+ unsigned Tmp4Reg = RegInfo.createVirtualRegister(RC);
+ unsigned TmpDestReg = RegInfo.createVirtualRegister(RC);
+ unsigned Ptr1Reg;
+ unsigned TmpReg = RegInfo.createVirtualRegister(RC);
+ unsigned ZeroReg = is64bit ? PPC::ZERO8 : PPC::ZERO;
+ // thisMBB:
+ // ...
+ // fallthrough --> loopMBB
+ BB->addSuccessor(loop1MBB);
+
+ // The 4-byte load must be aligned, while a char or short may be
+ // anywhere in the word. Hence all this nasty bookkeeping code.
+ // add ptr1, ptrA, ptrB [copy if ptrA==0]
+ // rlwinm shift1, ptr1, 3, 27, 28 [3, 27, 27]
+ // xori shift, shift1, 24 [16]
+ // rlwinm ptr, ptr1, 0, 0, 29
+ // slw newval2, newval, shift
+ // slw oldval2, oldval,shift
+ // li mask2, 255 [li mask3, 0; ori mask2, mask3, 65535]
+ // slw mask, mask2, shift
+ // and newval3, newval2, mask
+ // and oldval3, oldval2, mask
+ // loop1MBB:
+ // lwarx tmpDest, ptr
+ // and tmp, tmpDest, mask
+ // cmpw tmp, oldval3
+ // bne- midMBB
+ // loop2MBB:
+ // andc tmp2, tmpDest, mask
+ // or tmp4, tmp2, newval3
+ // stwcx. tmp4, ptr
+ // bne- loop1MBB
+ // b exitBB
+ // midMBB:
+ // stwcx. tmpDest, ptr
+ // exitBB:
+ // srw dest, tmpDest, shift
+ if (ptrA != ZeroReg) {
+ Ptr1Reg = RegInfo.createVirtualRegister(RC);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::ADD8 : PPC::ADD4), Ptr1Reg)
+ .addReg(ptrA).addReg(ptrB);
+ } else {
+ Ptr1Reg = ptrB;
+ }
+ BuildMI(BB, dl, TII->get(PPC::RLWINM), Shift1Reg).addReg(Ptr1Reg)
+ .addImm(3).addImm(27).addImm(is8bit ? 28 : 27);
+ BuildMI(BB, dl, TII->get(is64bit ? PPC::XORI8 : PPC::XORI), ShiftReg)
+ .addReg(Shift1Reg).addImm(is8bit ? 24 : 16);
+ if (is64bit)
+ BuildMI(BB, dl, TII->get(PPC::RLDICR), PtrReg)
+ .addReg(Ptr1Reg).addImm(0).addImm(61);
+ else
+ BuildMI(BB, dl, TII->get(PPC::RLWINM), PtrReg)
+ .addReg(Ptr1Reg).addImm(0).addImm(0).addImm(29);
+ BuildMI(BB, dl, TII->get(PPC::SLW), NewVal2Reg)
+ .addReg(newval).addReg(ShiftReg);
+ BuildMI(BB, dl, TII->get(PPC::SLW), OldVal2Reg)
+ .addReg(oldval).addReg(ShiftReg);
+ if (is8bit)
+ BuildMI(BB, dl, TII->get(PPC::LI), Mask2Reg).addImm(255);
+ else {
+ BuildMI(BB, dl, TII->get(PPC::LI), Mask3Reg).addImm(0);
+ BuildMI(BB, dl, TII->get(PPC::ORI), Mask2Reg)
+ .addReg(Mask3Reg).addImm(65535);
+ }
+ BuildMI(BB, dl, TII->get(PPC::SLW), MaskReg)
+ .addReg(Mask2Reg).addReg(ShiftReg);
+ BuildMI(BB, dl, TII->get(PPC::AND), NewVal3Reg)
+ .addReg(NewVal2Reg).addReg(MaskReg);
+ BuildMI(BB, dl, TII->get(PPC::AND), OldVal3Reg)
+ .addReg(OldVal2Reg).addReg(MaskReg);
+
+ BB = loop1MBB;
+ BuildMI(BB, dl, TII->get(PPC::LWARX), TmpDestReg)
+ .addReg(ZeroReg).addReg(PtrReg);
+ BuildMI(BB, dl, TII->get(PPC::AND),TmpReg)
+ .addReg(TmpDestReg).addReg(MaskReg);
+ BuildMI(BB, dl, TII->get(PPC::CMPW), PPC::CR0)
+ .addReg(TmpReg).addReg(OldVal3Reg);
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_NE).addReg(PPC::CR0).addMBB(midMBB);
+ BB->addSuccessor(loop2MBB);
+ BB->addSuccessor(midMBB);
+
+ BB = loop2MBB;
+ BuildMI(BB, dl, TII->get(PPC::ANDC),Tmp2Reg)
+ .addReg(TmpDestReg).addReg(MaskReg);
+ BuildMI(BB, dl, TII->get(PPC::OR),Tmp4Reg)
+ .addReg(Tmp2Reg).addReg(NewVal3Reg);
+ BuildMI(BB, dl, TII->get(PPC::STWCX)).addReg(Tmp4Reg)
+ .addReg(ZeroReg).addReg(PtrReg);
+ BuildMI(BB, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_NE).addReg(PPC::CR0).addMBB(loop1MBB);
+ BuildMI(BB, dl, TII->get(PPC::B)).addMBB(exitMBB);
+ BB->addSuccessor(loop1MBB);
+ BB->addSuccessor(exitMBB);
+
+ BB = midMBB;
+ BuildMI(BB, dl, TII->get(PPC::STWCX)).addReg(TmpDestReg)
+ .addReg(ZeroReg).addReg(PtrReg);
+ BB->addSuccessor(exitMBB);
+
+ // exitMBB:
+ // ...
+ BB = exitMBB;
+ BuildMI(*BB, BB->begin(), dl, TII->get(PPC::SRW),dest).addReg(TmpReg)
+ .addReg(ShiftReg);
+ } else if (MI->getOpcode() == PPC::FADDrtz) {
+ // This pseudo performs an FADD with rounding mode temporarily forced
+ // to round-to-zero. We emit this via custom inserter since the FPSCR
+ // is not modeled at the SelectionDAG level.
+ unsigned Dest = MI->getOperand(0).getReg();
+ unsigned Src1 = MI->getOperand(1).getReg();
+ unsigned Src2 = MI->getOperand(2).getReg();
+ DebugLoc dl = MI->getDebugLoc();
+
+ MachineRegisterInfo &RegInfo = F->getRegInfo();
+ unsigned MFFSReg = RegInfo.createVirtualRegister(&PPC::F8RCRegClass);
+
+ // Save FPSCR value.
+ BuildMI(*BB, MI, dl, TII->get(PPC::MFFS), MFFSReg);
+
+ // Set rounding mode to round-to-zero.
+ BuildMI(*BB, MI, dl, TII->get(PPC::MTFSB1)).addImm(31);
+ BuildMI(*BB, MI, dl, TII->get(PPC::MTFSB0)).addImm(30);
+
+ // Perform addition.
+ BuildMI(*BB, MI, dl, TII->get(PPC::FADD), Dest).addReg(Src1).addReg(Src2);
+
+ // Restore FPSCR value.
+ BuildMI(*BB, MI, dl, TII->get(PPC::MTFSF)).addImm(1).addReg(MFFSReg);
+ } else if (MI->getOpcode() == PPC::FRINDrint ||
+ MI->getOpcode() == PPC::FRINSrint) {
+ bool isf32 = MI->getOpcode() == PPC::FRINSrint;
+ unsigned Dest = MI->getOperand(0).getReg();
+ unsigned Src = MI->getOperand(1).getReg();
+ DebugLoc dl = MI->getDebugLoc();
+
+ MachineRegisterInfo &RegInfo = F->getRegInfo();
+ unsigned CRReg = RegInfo.createVirtualRegister(&PPC::CRRCRegClass);
+
+ // Perform the rounding.
+ BuildMI(*BB, MI, dl, TII->get(isf32 ? PPC::FRINS : PPC::FRIND), Dest)
+ .addReg(Src);
+
+ // Compare the results.
+ BuildMI(*BB, MI, dl, TII->get(isf32 ? PPC::FCMPUS : PPC::FCMPUD), CRReg)
+ .addReg(Dest).addReg(Src);
+
+ // If the results were not equal, then set the FPSCR XX bit.
+ MachineBasicBlock *midMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ MachineBasicBlock *exitMBB = F->CreateMachineBasicBlock(LLVM_BB);
+ F->insert(It, midMBB);
+ F->insert(It, exitMBB);
+ exitMBB->splice(exitMBB->begin(), BB,
+ llvm::next(MachineBasicBlock::iterator(MI)),
+ BB->end());
+ exitMBB->transferSuccessorsAndUpdatePHIs(BB);
+
+ BuildMI(*BB, MI, dl, TII->get(PPC::BCC))
+ .addImm(PPC::PRED_EQ).addReg(CRReg).addMBB(exitMBB);
+
+ BB->addSuccessor(midMBB);
+ BB->addSuccessor(exitMBB);
+
+ BB = midMBB;
+
+ // Set the FPSCR XX bit (FE_INEXACT). Note that we cannot just set
+ // the FI bit here because that will not automatically set XX also,
+ // and XX is what libm interprets as the FE_INEXACT flag.
+ BuildMI(BB, dl, TII->get(PPC::MTFSB1)).addImm(/* 38 - 32 = */ 6);
+ BuildMI(BB, dl, TII->get(PPC::B)).addMBB(exitMBB);
+
+ BB->addSuccessor(exitMBB);
+
+ BB = exitMBB;
+ } else {
+ llvm_unreachable("Unexpected instr type to insert");
+ }
+
+ MI->eraseFromParent(); // The pseudo instruction is gone now.
+ return BB;
+}
+
+//===----------------------------------------------------------------------===//
+// Target Optimization Hooks
+//===----------------------------------------------------------------------===//
+
+SDValue PPCTargetLowering::DAGCombineFastRecip(SDValue Op,
+ DAGCombinerInfo &DCI) const {
+ if (DCI.isAfterLegalizeVectorOps())
+ return SDValue();
+
+ EVT VT = Op.getValueType();
+
+ if ((VT == MVT::f32 && PPCSubTarget.hasFRES()) ||
+ (VT == MVT::f64 && PPCSubTarget.hasFRE()) ||
+ (VT == MVT::v4f32 && PPCSubTarget.hasAltivec())) {
+
+ // Newton iteration for a function: F(X) is X_{i+1} = X_i - F(X_i)/F'(X_i)
+ // For the reciprocal, we need to find the zero of the function:
+ // F(X) = A X - 1 [which has a zero at X = 1/A]
+ // =>
+ // X_{i+1} = X_i (2 - A X_i) = X_i + X_i (1 - A X_i) [this second form
+ // does not require additional intermediate precision]
+
+ // Convergence is quadratic, so we essentially double the number of digits
+ // correct after every iteration. The minimum architected relative
+ // accuracy is 2^-5. When hasRecipPrec(), this is 2^-14. IEEE float has
+ // 23 digits and double has 52 digits.
+ int Iterations = PPCSubTarget.hasRecipPrec() ? 1 : 3;
+ if (VT.getScalarType() == MVT::f64)
+ ++Iterations;
+
+ SelectionDAG &DAG = DCI.DAG;
+ DebugLoc dl = Op.getDebugLoc();
+
+ SDValue FPOne =
+ DAG.getConstantFP(1.0, VT.getScalarType());
+ if (VT.isVector()) {
+ assert(VT.getVectorNumElements() == 4 &&
+ "Unknown vector type");
+ FPOne = DAG.getNode(ISD::BUILD_VECTOR, dl, VT,
+ FPOne, FPOne, FPOne, FPOne);
+ }
+
+ SDValue Est = DAG.getNode(PPCISD::FRE, dl, VT, Op);
+ DCI.AddToWorklist(Est.getNode());
+
+ // Newton iterations: Est = Est + Est (1 - Arg * Est)
+ for (int i = 0; i < Iterations; ++i) {
+ SDValue NewEst = DAG.getNode(ISD::FMUL, dl, VT, Op, Est);
+ DCI.AddToWorklist(NewEst.getNode());
+
+ NewEst = DAG.getNode(ISD::FSUB, dl, VT, FPOne, NewEst);
+ DCI.AddToWorklist(NewEst.getNode());
+
+ NewEst = DAG.getNode(ISD::FMUL, dl, VT, Est, NewEst);
+ DCI.AddToWorklist(NewEst.getNode());
+
+ Est = DAG.getNode(ISD::FADD, dl, VT, Est, NewEst);
+ DCI.AddToWorklist(Est.getNode());
+ }
+
+ return Est;
+ }
+
+ return SDValue();
+}
+
+SDValue PPCTargetLowering::DAGCombineFastRecipFSQRT(SDValue Op,
+ DAGCombinerInfo &DCI) const {
+ if (DCI.isAfterLegalizeVectorOps())
+ return SDValue();
+
+ EVT VT = Op.getValueType();
+
+ if ((VT == MVT::f32 && PPCSubTarget.hasFRSQRTES()) ||
+ (VT == MVT::f64 && PPCSubTarget.hasFRSQRTE()) ||
+ (VT == MVT::v4f32 && PPCSubTarget.hasAltivec())) {
+
+ // Newton iteration for a function: F(X) is X_{i+1} = X_i - F(X_i)/F'(X_i)
+ // For the reciprocal sqrt, we need to find the zero of the function:
+ // F(X) = 1/X^2 - A [which has a zero at X = 1/sqrt(A)]
+ // =>
+ // X_{i+1} = X_i (1.5 - A X_i^2 / 2)
+ // As a result, we precompute A/2 prior to the iteration loop.
+
+ // Convergence is quadratic, so we essentially double the number of digits
+ // correct after every iteration. The minimum architected relative
+ // accuracy is 2^-5. When hasRecipPrec(), this is 2^-14. IEEE float has
+ // 23 digits and double has 52 digits.
+ int Iterations = PPCSubTarget.hasRecipPrec() ? 1 : 3;
+ if (VT.getScalarType() == MVT::f64)
+ ++Iterations;
+
+ SelectionDAG &DAG = DCI.DAG;
+ DebugLoc dl = Op.getDebugLoc();
+
+ SDValue FPThreeHalves =
+ DAG.getConstantFP(1.5, VT.getScalarType());
+ if (VT.isVector()) {
+ assert(VT.getVectorNumElements() == 4 &&
+ "Unknown vector type");
+ FPThreeHalves = DAG.getNode(ISD::BUILD_VECTOR, dl, VT,
+ FPThreeHalves, FPThreeHalves,
+ FPThreeHalves, FPThreeHalves);
+ }
+
+ SDValue Est = DAG.getNode(PPCISD::FRSQRTE, dl, VT, Op);
+ DCI.AddToWorklist(Est.getNode());
+
+ // We now need 0.5*Arg which we can write as (1.5*Arg - Arg) so that
+ // this entire sequence requires only one FP constant.
+ SDValue HalfArg = DAG.getNode(ISD::FMUL, dl, VT, FPThreeHalves, Op);
+ DCI.AddToWorklist(HalfArg.getNode());
+
+ HalfArg = DAG.getNode(ISD::FSUB, dl, VT, HalfArg, Op);
+ DCI.AddToWorklist(HalfArg.getNode());
+
+ // Newton iterations: Est = Est * (1.5 - HalfArg * Est * Est)
+ for (int i = 0; i < Iterations; ++i) {
+ SDValue NewEst = DAG.getNode(ISD::FMUL, dl, VT, Est, Est);
+ DCI.AddToWorklist(NewEst.getNode());
+
+ NewEst = DAG.getNode(ISD::FMUL, dl, VT, HalfArg, NewEst);
+ DCI.AddToWorklist(NewEst.getNode());
+
+ NewEst = DAG.getNode(ISD::FSUB, dl, VT, FPThreeHalves, NewEst);
+ DCI.AddToWorklist(NewEst.getNode());
+
+ Est = DAG.getNode(ISD::FMUL, dl, VT, Est, NewEst);
+ DCI.AddToWorklist(Est.getNode());
+ }
+
+ return Est;
+ }
+
+ return SDValue();
+}
+
+SDValue PPCTargetLowering::PerformDAGCombine(SDNode *N,
+ DAGCombinerInfo &DCI) const {
+ const TargetMachine &TM = getTargetMachine();
+ SelectionDAG &DAG = DCI.DAG;
+ DebugLoc dl = N->getDebugLoc();
+ switch (N->getOpcode()) {
+ default: break;
+ case PPCISD::SHL:
+ if (ConstantSDNode *C = dyn_cast<ConstantSDNode>(N->getOperand(0))) {
+ if (C->isNullValue()) // 0 << V -> 0.
+ return N->getOperand(0);
+ }
+ break;
+ case PPCISD::SRL:
+ if (ConstantSDNode *C = dyn_cast<ConstantSDNode>(N->getOperand(0))) {
+ if (C->isNullValue()) // 0 >>u V -> 0.
+ return N->getOperand(0);
+ }
+ break;
+ case PPCISD::SRA:
+ if (ConstantSDNode *C = dyn_cast<ConstantSDNode>(N->getOperand(0))) {
+ if (C->isNullValue() || // 0 >>s V -> 0.
+ C->isAllOnesValue()) // -1 >>s V -> -1.
+ return N->getOperand(0);
+ }
+ break;
+ case ISD::FDIV: {
+ assert(TM.Options.UnsafeFPMath &&
+ "Reciprocal estimates require UnsafeFPMath");
+
+ if (N->getOperand(1).getOpcode() == ISD::FSQRT) {
+ SDValue RV =
+ DAGCombineFastRecipFSQRT(N->getOperand(1).getOperand(0), DCI);
+ if (RV.getNode() != 0) {
+ DCI.AddToWorklist(RV.getNode());
+ return DAG.getNode(ISD::FMUL, dl, N->getValueType(0),
+ N->getOperand(0), RV);
+ }
+ } else if (N->getOperand(1).getOpcode() == ISD::FP_EXTEND &&
+ N->getOperand(1).getOperand(0).getOpcode() == ISD::FSQRT) {
+ SDValue RV =
+ DAGCombineFastRecipFSQRT(N->getOperand(1).getOperand(0).getOperand(0),
+ DCI);
+ if (RV.getNode() != 0) {
+ DCI.AddToWorklist(RV.getNode());
+ RV = DAG.getNode(ISD::FP_EXTEND, N->getOperand(1).getDebugLoc(),
+ N->getValueType(0), RV);
+ DCI.AddToWorklist(RV.getNode());
+ return DAG.getNode(ISD::FMUL, dl, N->getValueType(0),
+ N->getOperand(0), RV);
+ }
+ } else if (N->getOperand(1).getOpcode() == ISD::FP_ROUND &&
+ N->getOperand(1).getOperand(0).getOpcode() == ISD::FSQRT) {
+ SDValue RV =
+ DAGCombineFastRecipFSQRT(N->getOperand(1).getOperand(0).getOperand(0),
+ DCI);
+ if (RV.getNode() != 0) {
+ DCI.AddToWorklist(RV.getNode());
+ RV = DAG.getNode(ISD::FP_ROUND, N->getOperand(1).getDebugLoc(),
+ N->getValueType(0), RV,
+ N->getOperand(1).getOperand(1));
+ DCI.AddToWorklist(RV.getNode());
+ return DAG.getNode(ISD::FMUL, dl, N->getValueType(0),
+ N->getOperand(0), RV);
+ }
+ }
+
+ SDValue RV = DAGCombineFastRecip(N->getOperand(1), DCI);
+ if (RV.getNode() != 0) {
+ DCI.AddToWorklist(RV.getNode());
+ return DAG.getNode(ISD::FMUL, dl, N->getValueType(0),
+ N->getOperand(0), RV);
+ }
+
+ }
+ break;
+ case ISD::FSQRT: {
+ assert(TM.Options.UnsafeFPMath &&
+ "Reciprocal estimates require UnsafeFPMath");
+
+ // Compute this as 1/(1/sqrt(X)), which is the reciprocal of the
+ // reciprocal sqrt.
+ SDValue RV = DAGCombineFastRecipFSQRT(N->getOperand(0), DCI);
+ if (RV.getNode() != 0) {
+ DCI.AddToWorklist(RV.getNode());
+ RV = DAGCombineFastRecip(RV, DCI);
+ if (RV.getNode() != 0)
+ return RV;
+ }
+
+ }
+ break;
+ case ISD::SINT_TO_FP:
+ if (TM.getSubtarget<PPCSubtarget>().has64BitSupport()) {
+ if (N->getOperand(0).getOpcode() == ISD::FP_TO_SINT) {
+ // Turn (sint_to_fp (fp_to_sint X)) -> fctidz/fcfid without load/stores.
+ // We allow the src/dst to be either f32/f64, but the intermediate
+ // type must be i64.
+ if (N->getOperand(0).getValueType() == MVT::i64 &&
+ N->getOperand(0).getOperand(0).getValueType() != MVT::ppcf128) {
+ SDValue Val = N->getOperand(0).getOperand(0);
+ if (Val.getValueType() == MVT::f32) {
+ Val = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Val);
+ DCI.AddToWorklist(Val.getNode());
+ }
+
+ Val = DAG.getNode(PPCISD::FCTIDZ, dl, MVT::f64, Val);
+ DCI.AddToWorklist(Val.getNode());
+ Val = DAG.getNode(PPCISD::FCFID, dl, MVT::f64, Val);
+ DCI.AddToWorklist(Val.getNode());
+ if (N->getValueType(0) == MVT::f32) {
+ Val = DAG.getNode(ISD::FP_ROUND, dl, MVT::f32, Val,
+ DAG.getIntPtrConstant(0));
+ DCI.AddToWorklist(Val.getNode());
+ }
+ return Val;
+ } else if (N->getOperand(0).getValueType() == MVT::i32) {
+ // If the intermediate type is i32, we can avoid the load/store here
+ // too.
+ }
+ }
+ }
+ break;
+ case ISD::STORE:
+ // Turn STORE (FP_TO_SINT F) -> STFIWX(FCTIWZ(F)).
+ if (TM.getSubtarget<PPCSubtarget>().hasSTFIWX() &&
+ !cast<StoreSDNode>(N)->isTruncatingStore() &&
+ N->getOperand(1).getOpcode() == ISD::FP_TO_SINT &&
+ N->getOperand(1).getValueType() == MVT::i32 &&
+ N->getOperand(1).getOperand(0).getValueType() != MVT::ppcf128) {
+ SDValue Val = N->getOperand(1).getOperand(0);
+ if (Val.getValueType() == MVT::f32) {
+ Val = DAG.getNode(ISD::FP_EXTEND, dl, MVT::f64, Val);
+ DCI.AddToWorklist(Val.getNode());
+ }
+ Val = DAG.getNode(PPCISD::FCTIWZ, dl, MVT::f64, Val);
+ DCI.AddToWorklist(Val.getNode());
+
+ SDValue Ops[] = {
+ N->getOperand(0), Val, N->getOperand(2),
+ DAG.getValueType(N->getOperand(1).getValueType())
+ };
+
+ Val = DAG.getMemIntrinsicNode(PPCISD::STFIWX, dl,
+ DAG.getVTList(MVT::Other), Ops, array_lengthof(Ops),
+ cast<StoreSDNode>(N)->getMemoryVT(),
+ cast<StoreSDNode>(N)->getMemOperand());
+ DCI.AddToWorklist(Val.getNode());
+ return Val;
+ }
+
+ // Turn STORE (BSWAP) -> sthbrx/stwbrx.
+ if (cast<StoreSDNode>(N)->isUnindexed() &&
+ N->getOperand(1).getOpcode() == ISD::BSWAP &&
+ N->getOperand(1).getNode()->hasOneUse() &&
+ (N->getOperand(1).getValueType() == MVT::i32 ||
+ N->getOperand(1).getValueType() == MVT::i16 ||
+ (TM.getSubtarget<PPCSubtarget>().hasLDBRX() &&
+ TM.getSubtarget<PPCSubtarget>().isPPC64() &&
+ N->getOperand(1).getValueType() == MVT::i64))) {
+ SDValue BSwapOp = N->getOperand(1).getOperand(0);
+ // Do an any-extend to 32-bits if this is a half-word input.
+ if (BSwapOp.getValueType() == MVT::i16)
+ BSwapOp = DAG.getNode(ISD::ANY_EXTEND, dl, MVT::i32, BSwapOp);
+
+ SDValue Ops[] = {
+ N->getOperand(0), BSwapOp, N->getOperand(2),
+ DAG.getValueType(N->getOperand(1).getValueType())
+ };
+ return
+ DAG.getMemIntrinsicNode(PPCISD::STBRX, dl, DAG.getVTList(MVT::Other),
+ Ops, array_lengthof(Ops),
+ cast<StoreSDNode>(N)->getMemoryVT(),
+ cast<StoreSDNode>(N)->getMemOperand());
+ }
+ break;
+ case ISD::BSWAP:
+ // Turn BSWAP (LOAD) -> lhbrx/lwbrx.
+ if (ISD::isNON_EXTLoad(N->getOperand(0).getNode()) &&
+ N->getOperand(0).hasOneUse() &&
+ (N->getValueType(0) == MVT::i32 || N->getValueType(0) == MVT::i16 ||
+ (TM.getSubtarget<PPCSubtarget>().hasLDBRX() &&
+ TM.getSubtarget<PPCSubtarget>().isPPC64() &&
+ N->getValueType(0) == MVT::i64))) {
+ SDValue Load = N->getOperand(0);
+ LoadSDNode *LD = cast<LoadSDNode>(Load);
+ // Create the byte-swapping load.
+ SDValue Ops[] = {
+ LD->getChain(), // Chain
+ LD->getBasePtr(), // Ptr
+ DAG.getValueType(N->getValueType(0)) // VT
+ };
+ SDValue BSLoad =
+ DAG.getMemIntrinsicNode(PPCISD::LBRX, dl,
+ DAG.getVTList(N->getValueType(0) == MVT::i64 ?
+ MVT::i64 : MVT::i32, MVT::Other),
+ Ops, 3, LD->getMemoryVT(), LD->getMemOperand());
+
+ // If this is an i16 load, insert the truncate.
+ SDValue ResVal = BSLoad;
+ if (N->getValueType(0) == MVT::i16)
+ ResVal = DAG.getNode(ISD::TRUNCATE, dl, MVT::i16, BSLoad);
+
+ // First, combine the bswap away. This makes the value produced by the
+ // load dead.
+ DCI.CombineTo(N, ResVal);
+
+ // Next, combine the load away, we give it a bogus result value but a real
+ // chain result. The result value is dead because the bswap is dead.
+ DCI.CombineTo(Load.getNode(), ResVal, BSLoad.getValue(1));
+
+ // Return N so it doesn't get rechecked!
+ return SDValue(N, 0);
+ }
+
+ break;
+ case PPCISD::VCMP: {
+ // If a VCMPo node already exists with exactly the same operands as this
+ // node, use its result instead of this node (VCMPo computes both a CR6 and
+ // a normal output).
+ //
+ if (!N->getOperand(0).hasOneUse() &&
+ !N->getOperand(1).hasOneUse() &&
+ !N->getOperand(2).hasOneUse()) {
+
+ // Scan all of the users of the LHS, looking for VCMPo's that match.
+ SDNode *VCMPoNode = 0;
+
+ SDNode *LHSN = N->getOperand(0).getNode();
+ for (SDNode::use_iterator UI = LHSN->use_begin(), E = LHSN->use_end();
+ UI != E; ++UI)
+ if (UI->getOpcode() == PPCISD::VCMPo &&
+ UI->getOperand(1) == N->getOperand(1) &&
+ UI->getOperand(2) == N->getOperand(2) &&
+ UI->getOperand(0) == N->getOperand(0)) {
+ VCMPoNode = *UI;
+ break;
+ }
+
+ // If there is no VCMPo node, or if the flag value has a single use, don't
+ // transform this.
+ if (!VCMPoNode || VCMPoNode->hasNUsesOfValue(0, 1))
+ break;
+
+ // Look at the (necessarily single) use of the flag value. If it has a
+ // chain, this transformation is more complex. Note that multiple things
+ // could use the value result, which we should ignore.
+ SDNode *FlagUser = 0;
+ for (SDNode::use_iterator UI = VCMPoNode->use_begin();
+ FlagUser == 0; ++UI) {
+ assert(UI != VCMPoNode->use_end() && "Didn't find user!");
+ SDNode *User = *UI;
+ for (unsigned i = 0, e = User->getNumOperands(); i != e; ++i) {
+ if (User->getOperand(i) == SDValue(VCMPoNode, 1)) {
+ FlagUser = User;
+ break;
+ }
+ }
+ }
+
+ // If the user is a MFCR instruction, we know this is safe. Otherwise we
+ // give up for right now.
+ if (FlagUser->getOpcode() == PPCISD::MFCR)
+ return SDValue(VCMPoNode, 0);
+ }
+ break;
+ }
+ case ISD::BR_CC: {
+ // If this is a branch on an altivec predicate comparison, lower this so
+ // that we don't have to do a MFCR: instead, branch directly on CR6. This
+ // lowering is done pre-legalize, because the legalizer lowers the predicate
+ // compare down to code that is difficult to reassemble.
+ ISD::CondCode CC = cast<CondCodeSDNode>(N->getOperand(1))->get();
+ SDValue LHS = N->getOperand(2), RHS = N->getOperand(3);
+ int CompareOpc;
+ bool isDot;
+
+ if (LHS.getOpcode() == ISD::INTRINSIC_WO_CHAIN &&
+ isa<ConstantSDNode>(RHS) && (CC == ISD::SETEQ || CC == ISD::SETNE) &&
+ getAltivecCompareInfo(LHS, CompareOpc, isDot)) {
+ assert(isDot && "Can't compare against a vector result!");
+
+ // If this is a comparison against something other than 0/1, then we know
+ // that the condition is never/always true.
+ unsigned Val = cast<ConstantSDNode>(RHS)->getZExtValue();
+ if (Val != 0 && Val != 1) {
+ if (CC == ISD::SETEQ) // Cond never true, remove branch.
+ return N->getOperand(0);
+ // Always !=, turn it into an unconditional branch.
+ return DAG.getNode(ISD::BR, dl, MVT::Other,
+ N->getOperand(0), N->getOperand(4));
+ }
+
+ bool BranchOnWhenPredTrue = (CC == ISD::SETEQ) ^ (Val == 0);
+
+ // Create the PPCISD altivec 'dot' comparison node.
+ SDValue Ops[] = {
+ LHS.getOperand(2), // LHS of compare
+ LHS.getOperand(3), // RHS of compare
+ DAG.getConstant(CompareOpc, MVT::i32)
+ };
+ EVT VTs[] = { LHS.getOperand(2).getValueType(), MVT::Glue };
+ SDValue CompNode = DAG.getNode(PPCISD::VCMPo, dl, VTs, Ops, 3);
+
+ // Unpack the result based on how the target uses it.
+ PPC::Predicate CompOpc;
+ switch (cast<ConstantSDNode>(LHS.getOperand(1))->getZExtValue()) {
+ default: // Can't happen, don't crash on invalid number though.
+ case 0: // Branch on the value of the EQ bit of CR6.
+ CompOpc = BranchOnWhenPredTrue ? PPC::PRED_EQ : PPC::PRED_NE;
+ break;
+ case 1: // Branch on the inverted value of the EQ bit of CR6.
+ CompOpc = BranchOnWhenPredTrue ? PPC::PRED_NE : PPC::PRED_EQ;
+ break;
+ case 2: // Branch on the value of the LT bit of CR6.
+ CompOpc = BranchOnWhenPredTrue ? PPC::PRED_LT : PPC::PRED_GE;
+ break;
+ case 3: // Branch on the inverted value of the LT bit of CR6.
+ CompOpc = BranchOnWhenPredTrue ? PPC::PRED_GE : PPC::PRED_LT;
+ break;
+ }
+
+ return DAG.getNode(PPCISD::COND_BRANCH, dl, MVT::Other, N->getOperand(0),
+ DAG.getConstant(CompOpc, MVT::i32),
+ DAG.getRegister(PPC::CR6, MVT::i32),
+ N->getOperand(4), CompNode.getValue(1));
+ }
+ break;
+ }
+ }
+
+ return SDValue();
+}
+
+//===----------------------------------------------------------------------===//
+// Inline Assembly Support
+//===----------------------------------------------------------------------===//
+
+void PPCTargetLowering::computeMaskedBitsForTargetNode(const SDValue Op,
+ APInt &KnownZero,
+ APInt &KnownOne,
+ const SelectionDAG &DAG,
+ unsigned Depth) const {
+ KnownZero = KnownOne = APInt(KnownZero.getBitWidth(), 0);
+ switch (Op.getOpcode()) {
+ default: break;
+ case PPCISD::LBRX: {
+ // lhbrx is known to have the top bits cleared out.
+ if (cast<VTSDNode>(Op.getOperand(2))->getVT() == MVT::i16)
+ KnownZero = 0xFFFF0000;
+ break;
+ }
+ case ISD::INTRINSIC_WO_CHAIN: {
+ switch (cast<ConstantSDNode>(Op.getOperand(0))->getZExtValue()) {
+ default: break;
+ case Intrinsic::ppc_altivec_vcmpbfp_p:
+ case Intrinsic::ppc_altivec_vcmpeqfp_p:
+ case Intrinsic::ppc_altivec_vcmpequb_p:
+ case Intrinsic::ppc_altivec_vcmpequh_p:
+ case Intrinsic::ppc_altivec_vcmpequw_p:
+ case Intrinsic::ppc_altivec_vcmpgefp_p:
+ case Intrinsic::ppc_altivec_vcmpgtfp_p:
+ case Intrinsic::ppc_altivec_vcmpgtsb_p:
+ case Intrinsic::ppc_altivec_vcmpgtsh_p:
+ case Intrinsic::ppc_altivec_vcmpgtsw_p:
+ case Intrinsic::ppc_altivec_vcmpgtub_p:
+ case Intrinsic::ppc_altivec_vcmpgtuh_p:
+ case Intrinsic::ppc_altivec_vcmpgtuw_p:
+ KnownZero = ~1U; // All bits but the low one are known to be zero.
+ break;
+ }
+ }
+ }
+}
+
+
+/// getConstraintType - Given a constraint, return the type of
+/// constraint it is for this target.
+PPCTargetLowering::ConstraintType
+PPCTargetLowering::getConstraintType(const std::string &Constraint) const {
+ if (Constraint.size() == 1) {
+ switch (Constraint[0]) {
+ default: break;
+ case 'b':
+ case 'r':
+ case 'f':
+ case 'v':
+ case 'y':
+ return C_RegisterClass;
+ case 'Z':
+ // FIXME: While Z does indicate a memory constraint, it specifically
+ // indicates an r+r address (used in conjunction with the 'y' modifier
+ // in the replacement string). Currently, we're forcing the base
+ // register to be r0 in the asm printer (which is interpreted as zero)
+ // and forming the complete address in the second register. This is
+ // suboptimal.
+ return C_Memory;
+ }
+ }
+ return TargetLowering::getConstraintType(Constraint);
+}
+
+/// Examine constraint type and operand type and determine a weight value.
+/// This object must already have been set up with the operand type
+/// and the current alternative constraint selected.
+TargetLowering::ConstraintWeight
+PPCTargetLowering::getSingleConstraintMatchWeight(
+ AsmOperandInfo &info, const char *constraint) const {
+ ConstraintWeight weight = CW_Invalid;
+ Value *CallOperandVal = info.CallOperandVal;
+ // If we don't have a value, we can't do a match,
+ // but allow it at the lowest weight.
+ if (CallOperandVal == NULL)
+ return CW_Default;
+ Type *type = CallOperandVal->getType();
+ // Look at the constraint type.
+ switch (*constraint) {
+ default:
+ weight = TargetLowering::getSingleConstraintMatchWeight(info, constraint);
+ break;
+ case 'b':
+ if (type->isIntegerTy())
+ weight = CW_Register;
+ break;
+ case 'f':
+ if (type->isFloatTy())
+ weight = CW_Register;
+ break;
+ case 'd':
+ if (type->isDoubleTy())
+ weight = CW_Register;
+ break;
+ case 'v':
+ if (type->isVectorTy())
+ weight = CW_Register;
+ break;
+ case 'y':
+ weight = CW_Register;
+ break;
+ case 'Z':
+ weight = CW_Memory;
+ break;
+ }
+ return weight;
+}
+
+std::pair<unsigned, const TargetRegisterClass*>
+PPCTargetLowering::getRegForInlineAsmConstraint(const std::string &Constraint,
+ EVT VT) const {
+ if (Constraint.size() == 1) {
+ // GCC RS6000 Constraint Letters
+ switch (Constraint[0]) {
+ case 'b': // R1-R31
+ if (VT == MVT::i64 && PPCSubTarget.isPPC64())
+ return std::make_pair(0U, &PPC::G8RC_NOX0RegClass);
+ return std::make_pair(0U, &PPC::GPRC_NOR0RegClass);
+ case 'r': // R0-R31
+ if (VT == MVT::i64 && PPCSubTarget.isPPC64())
+ return std::make_pair(0U, &PPC::G8RCRegClass);
+ return std::make_pair(0U, &PPC::GPRCRegClass);
+ case 'f':
+ if (VT == MVT::f32 || VT == MVT::i32)
+ return std::make_pair(0U, &PPC::F4RCRegClass);
+ if (VT == MVT::f64 || VT == MVT::i64)
+ return std::make_pair(0U, &PPC::F8RCRegClass);
+ break;
+ case 'v':
+ return std::make_pair(0U, &PPC::VRRCRegClass);
+ case 'y': // crrc
+ return std::make_pair(0U, &PPC::CRRCRegClass);
+ }
+ }
+
+ return TargetLowering::getRegForInlineAsmConstraint(Constraint, VT);
+}
+
+
+/// LowerAsmOperandForConstraint - Lower the specified operand into the Ops
+/// vector. If it is invalid, don't add anything to Ops.
+void PPCTargetLowering::LowerAsmOperandForConstraint(SDValue Op,
+ std::string &Constraint,
+ std::vector<SDValue>&Ops,
+ SelectionDAG &DAG) const {
+ SDValue Result(0,0);
+
+ // Only support length 1 constraints.
+ if (Constraint.length() > 1) return;
+
+ char Letter = Constraint[0];
+ switch (Letter) {
+ default: break;
+ case 'I':
+ case 'J':
+ case 'K':
+ case 'L':
+ case 'M':
+ case 'N':
+ case 'O':
+ case 'P': {
+ ConstantSDNode *CST = dyn_cast<ConstantSDNode>(Op);
+ if (!CST) return; // Must be an immediate to match.
+ unsigned Value = CST->getZExtValue();
+ switch (Letter) {
+ default: llvm_unreachable("Unknown constraint letter!");
+ case 'I': // "I" is a signed 16-bit constant.
+ if ((short)Value == (int)Value)
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ case 'J': // "J" is a constant with only the high-order 16 bits nonzero.
+ case 'L': // "L" is a signed 16-bit constant shifted left 16 bits.
+ if ((short)Value == 0)
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ case 'K': // "K" is a constant with only the low-order 16 bits nonzero.
+ if ((Value >> 16) == 0)
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ case 'M': // "M" is a constant that is greater than 31.
+ if (Value > 31)
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ case 'N': // "N" is a positive constant that is an exact power of two.
+ if ((int)Value > 0 && isPowerOf2_32(Value))
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ case 'O': // "O" is the constant zero.
+ if (Value == 0)
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ case 'P': // "P" is a constant whose negation is a signed 16-bit constant.
+ if ((short)-Value == (int)-Value)
+ Result = DAG.getTargetConstant(Value, Op.getValueType());
+ break;
+ }
+ break;
+ }
+ }
+
+ if (Result.getNode()) {
+ Ops.push_back(Result);
+ return;
+ }
+
+ // Handle standard constraint letters.
+ TargetLowering::LowerAsmOperandForConstraint(Op, Constraint, Ops, DAG);
+}
+
+// isLegalAddressingMode - Return true if the addressing mode represented
+// by AM is legal for this target, for a load/store of the specified type.
+bool PPCTargetLowering::isLegalAddressingMode(const AddrMode &AM,
+ Type *Ty) const {
+ // FIXME: PPC does not allow r+i addressing modes for vectors!
+
+ // PPC allows a sign-extended 16-bit immediate field.
+ if (AM.BaseOffs <= -(1LL << 16) || AM.BaseOffs >= (1LL << 16)-1)
+ return false;
+
+ // No global is ever allowed as a base.
+ if (AM.BaseGV)
+ return false;
+
+ // PPC only support r+r,
+ switch (AM.Scale) {
+ case 0: // "r+i" or just "i", depending on HasBaseReg.
+ break;
+ case 1:
+ if (AM.HasBaseReg && AM.BaseOffs) // "r+r+i" is not allowed.
+ return false;
+ // Otherwise we have r+r or r+i.
+ break;
+ case 2:
+ if (AM.HasBaseReg || AM.BaseOffs) // 2*r+r or 2*r+i is not allowed.
+ return false;
+ // Allow 2*r as r+r.
+ break;
+ default:
+ // No other scales are supported.
+ return false;
+ }
+
+ return true;
+}
+
+/// isLegalAddressImmediate - Return true if the integer value can be used
+/// as the offset of the target addressing mode for load / store of the
+/// given type.
+bool PPCTargetLowering::isLegalAddressImmediate(int64_t V,Type *Ty) const{
+ // PPC allows a sign-extended 16-bit immediate field.
+ return (V > -(1 << 16) && V < (1 << 16)-1);
+}
+
+bool PPCTargetLowering::isLegalAddressImmediate(GlobalValue* GV) const {
+ return false;
+}
+
+SDValue PPCTargetLowering::LowerRETURNADDR(SDValue Op,
+ SelectionDAG &DAG) const {
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ MFI->setReturnAddressIsTaken(true);
+
+ DebugLoc dl = Op.getDebugLoc();
+ unsigned Depth = cast<ConstantSDNode>(Op.getOperand(0))->getZExtValue();
+
+ // Make sure the function does not optimize away the store of the RA to
+ // the stack.
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ FuncInfo->setLRStoreRequired();
+ bool isPPC64 = PPCSubTarget.isPPC64();
+ bool isDarwinABI = PPCSubTarget.isDarwinABI();
+
+ if (Depth > 0) {
+ SDValue FrameAddr = LowerFRAMEADDR(Op, DAG);
+ SDValue Offset =
+
+ DAG.getConstant(PPCFrameLowering::getReturnSaveOffset(isPPC64, isDarwinABI),
+ isPPC64? MVT::i64 : MVT::i32);
+ return DAG.getLoad(getPointerTy(), dl, DAG.getEntryNode(),
+ DAG.getNode(ISD::ADD, dl, getPointerTy(),
+ FrameAddr, Offset),
+ MachinePointerInfo(), false, false, false, 0);
+ }
+
+ // Just load the return address off the stack.
+ SDValue RetAddrFI = getReturnAddrFrameIndex(DAG);
+ return DAG.getLoad(getPointerTy(), dl, DAG.getEntryNode(),
+ RetAddrFI, MachinePointerInfo(), false, false, false, 0);
+}
+
+SDValue PPCTargetLowering::LowerFRAMEADDR(SDValue Op,
+ SelectionDAG &DAG) const {
+ DebugLoc dl = Op.getDebugLoc();
+ unsigned Depth = cast<ConstantSDNode>(Op.getOperand(0))->getZExtValue();
+
+ EVT PtrVT = DAG.getTargetLoweringInfo().getPointerTy();
+ bool isPPC64 = PtrVT == MVT::i64;
+
+ MachineFunction &MF = DAG.getMachineFunction();
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ MFI->setFrameAddressIsTaken(true);
+
+ // Naked functions never have a frame pointer, and so we use r1. For all
+ // other functions, this decision must be delayed until during PEI.
+ unsigned FrameReg;
+ if (MF.getFunction()->getAttributes().hasAttribute(
+ AttributeSet::FunctionIndex, Attribute::Naked))
+ FrameReg = isPPC64 ? PPC::X1 : PPC::R1;
+ else
+ FrameReg = isPPC64 ? PPC::FP8 : PPC::FP;
+
+ SDValue FrameAddr = DAG.getCopyFromReg(DAG.getEntryNode(), dl, FrameReg,
+ PtrVT);
+ while (Depth--)
+ FrameAddr = DAG.getLoad(Op.getValueType(), dl, DAG.getEntryNode(),
+ FrameAddr, MachinePointerInfo(), false, false,
+ false, 0);
+ return FrameAddr;
+}
+
+bool
+PPCTargetLowering::isOffsetFoldingLegal(const GlobalAddressSDNode *GA) const {
+ // The PowerPC target isn't yet aware of offsets.
+ return false;
+}
+
+/// getOptimalMemOpType - Returns the target specific optimal type for load
+/// and store operations as a result of memset, memcpy, and memmove
+/// lowering. If DstAlign is zero that means it's safe to destination
+/// alignment can satisfy any constraint. Similarly if SrcAlign is zero it
+/// means there isn't a need to check it against alignment requirement,
+/// probably because the source does not need to be loaded. If 'IsMemset' is
+/// true, that means it's expanding a memset. If 'ZeroMemset' is true, that
+/// means it's a memset of zero. 'MemcpyStrSrc' indicates whether the memcpy
+/// source is constant so it does not need to be loaded.
+/// It returns EVT::Other if the type should be determined using generic
+/// target-independent logic.
+EVT PPCTargetLowering::getOptimalMemOpType(uint64_t Size,
+ unsigned DstAlign, unsigned SrcAlign,
+ bool IsMemset, bool ZeroMemset,
+ bool MemcpyStrSrc,
+ MachineFunction &MF) const {
+ if (this->PPCSubTarget.isPPC64()) {
+ return MVT::i64;
+ } else {
+ return MVT::i32;
+ }
+}
+
+bool PPCTargetLowering::allowsUnalignedMemoryAccesses(EVT VT,
+ bool *Fast) const {
+ if (DisablePPCUnaligned)
+ return false;
+
+ // PowerPC supports unaligned memory access for simple non-vector types.
+ // Although accessing unaligned addresses is not as efficient as accessing
+ // aligned addresses, it is generally more efficient than manual expansion,
+ // and generally only traps for software emulation when crossing page
+ // boundaries.
+
+ if (!VT.isSimple())
+ return false;
+
+ if (VT.getSimpleVT().isVector())
+ return false;
+
+ if (VT == MVT::ppcf128)
+ return false;
+
+ if (Fast)
+ *Fast = true;
+
+ return true;
+}
+
+/// isFMAFasterThanMulAndAdd - Return true if an FMA operation is faster than
+/// a pair of mul and add instructions. fmuladd intrinsics will be expanded to
+/// FMAs when this method returns true (and FMAs are legal), otherwise fmuladd
+/// is expanded to mul + add.
+bool PPCTargetLowering::isFMAFasterThanMulAndAdd(EVT VT) const {
+ if (!VT.isSimple())
+ return false;
+
+ switch (VT.getSimpleVT().SimpleTy) {
+ case MVT::f32:
+ case MVT::f64:
+ case MVT::v4f32:
+ return true;
+ default:
+ break;
+ }
+
+ return false;
+}
+
+Sched::Preference PPCTargetLowering::getSchedulingPreference(SDNode *N) const {
+ if (DisableILPPref)
+ return TargetLowering::getSchedulingPreference(N);
+
+ return Sched::ILP;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCISelLowering.h b/contrib/llvm/lib/Target/PowerPC/PPCISelLowering.h
new file mode 100644
index 0000000..7157b70
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCISelLowering.h
@@ -0,0 +1,632 @@
+//===-- PPCISelLowering.h - PPC32 DAG Lowering Interface --------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the interfaces that PPC uses to lower LLVM code into a
+// selection DAG.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef LLVM_TARGET_POWERPC_PPC32ISELLOWERING_H
+#define LLVM_TARGET_POWERPC_PPC32ISELLOWERING_H
+
+#include "PPC.h"
+#include "PPCRegisterInfo.h"
+#include "PPCSubtarget.h"
+#include "llvm/CodeGen/SelectionDAG.h"
+#include "llvm/Target/TargetLowering.h"
+
+namespace llvm {
+ namespace PPCISD {
+ enum NodeType {
+ // Start the numbering where the builtin ops and target ops leave off.
+ FIRST_NUMBER = ISD::BUILTIN_OP_END,
+
+ /// FSEL - Traditional three-operand fsel node.
+ ///
+ FSEL,
+
+ /// FCFID - The FCFID instruction, taking an f64 operand and producing
+ /// and f64 value containing the FP representation of the integer that
+ /// was temporarily in the f64 operand.
+ FCFID,
+
+ /// Newer FCFID[US] integer-to-floating-point conversion instructions for
+ /// unsigned integers and single-precision outputs.
+ FCFIDU, FCFIDS, FCFIDUS,
+
+ /// FCTI[D,W]Z - The FCTIDZ and FCTIWZ instructions, taking an f32 or f64
+ /// operand, producing an f64 value containing the integer representation
+ /// of that FP value.
+ FCTIDZ, FCTIWZ,
+
+ /// Newer FCTI[D,W]UZ floating-point-to-integer conversion instructions for
+ /// unsigned integers.
+ FCTIDUZ, FCTIWUZ,
+
+ /// Reciprocal estimate instructions (unary FP ops).
+ FRE, FRSQRTE,
+
+ // VMADDFP, VNMSUBFP - The VMADDFP and VNMSUBFP instructions, taking
+ // three v4f32 operands and producing a v4f32 result.
+ VMADDFP, VNMSUBFP,
+
+ /// VPERM - The PPC VPERM Instruction.
+ ///
+ VPERM,
+
+ /// Hi/Lo - These represent the high and low 16-bit parts of a global
+ /// address respectively. These nodes have two operands, the first of
+ /// which must be a TargetGlobalAddress, and the second of which must be a
+ /// Constant. Selected naively, these turn into 'lis G+C' and 'li G+C',
+ /// though these are usually folded into other nodes.
+ Hi, Lo,
+
+ TOC_ENTRY,
+
+ /// The following three target-specific nodes are used for calls through
+ /// function pointers in the 64-bit SVR4 ABI.
+
+ /// Restore the TOC from the TOC save area of the current stack frame.
+ /// This is basically a hard coded load instruction which additionally
+ /// takes/produces a flag.
+ TOC_RESTORE,
+
+ /// Like a regular LOAD but additionally taking/producing a flag.
+ LOAD,
+
+ /// LOAD into r2 (also taking/producing a flag). Like TOC_RESTORE, this is
+ /// a hard coded load instruction.
+ LOAD_TOC,
+
+ /// OPRC, CHAIN = DYNALLOC(CHAIN, NEGSIZE, FRAME_INDEX)
+ /// This instruction is lowered in PPCRegisterInfo::eliminateFrameIndex to
+ /// compute an allocation on the stack.
+ DYNALLOC,
+
+ /// GlobalBaseReg - On Darwin, this node represents the result of the mflr
+ /// at function entry, used for PIC code.
+ GlobalBaseReg,
+
+ /// These nodes represent the 32-bit PPC shifts that operate on 6-bit
+ /// shift amounts. These nodes are generated by the multi-precision shift
+ /// code.
+ SRL, SRA, SHL,
+
+ /// CALL - A direct function call.
+ /// CALL_NOP is a call with the special NOP which follows 64-bit
+ /// SVR4 calls.
+ CALL, CALL_NOP,
+
+ /// CHAIN,FLAG = MTCTR(VAL, CHAIN[, INFLAG]) - Directly corresponds to a
+ /// MTCTR instruction.
+ MTCTR,
+
+ /// CHAIN,FLAG = BCTRL(CHAIN, INFLAG) - Directly corresponds to a
+ /// BCTRL instruction.
+ BCTRL,
+
+ /// Return with a flag operand, matched by 'blr'
+ RET_FLAG,
+
+ /// R32 = MFCR(CRREG, INFLAG) - Represents the MFCRpseud/MFOCRF
+ /// instructions. This copies the bits corresponding to the specified
+ /// CRREG into the resultant GPR. Bits corresponding to other CR regs
+ /// are undefined.
+ MFCR,
+
+ // EH_SJLJ_SETJMP - SjLj exception handling setjmp.
+ EH_SJLJ_SETJMP,
+
+ // EH_SJLJ_LONGJMP - SjLj exception handling longjmp.
+ EH_SJLJ_LONGJMP,
+
+ /// RESVEC = VCMP(LHS, RHS, OPC) - Represents one of the altivec VCMP*
+ /// instructions. For lack of better number, we use the opcode number
+ /// encoding for the OPC field to identify the compare. For example, 838
+ /// is VCMPGTSH.
+ VCMP,
+
+ /// RESVEC, OUTFLAG = VCMPo(LHS, RHS, OPC) - Represents one of the
+ /// altivec VCMP*o instructions. For lack of better number, we use the
+ /// opcode number encoding for the OPC field to identify the compare. For
+ /// example, 838 is VCMPGTSH.
+ VCMPo,
+
+ /// CHAIN = COND_BRANCH CHAIN, CRRC, OPC, DESTBB [, INFLAG] - This
+ /// corresponds to the COND_BRANCH pseudo instruction. CRRC is the
+ /// condition register to branch on, OPC is the branch opcode to use (e.g.
+ /// PPC::BLE), DESTBB is the destination block to branch to, and INFLAG is
+ /// an optional input flag argument.
+ COND_BRANCH,
+
+ /// F8RC = FADDRTZ F8RC, F8RC - This is an FADD done with rounding
+ /// towards zero. Used only as part of the long double-to-int
+ /// conversion sequence.
+ FADDRTZ,
+
+ /// F8RC = MFFS - This moves the FPSCR (not modeled) into the register.
+ MFFS,
+
+ /// LARX = This corresponds to PPC l{w|d}arx instrcution: load and
+ /// reserve indexed. This is used to implement atomic operations.
+ LARX,
+
+ /// STCX = This corresponds to PPC stcx. instrcution: store conditional
+ /// indexed. This is used to implement atomic operations.
+ STCX,
+
+ /// TC_RETURN - A tail call return.
+ /// operand #0 chain
+ /// operand #1 callee (register or absolute)
+ /// operand #2 stack adjustment
+ /// operand #3 optional in flag
+ TC_RETURN,
+
+ /// ch, gl = CR6[UN]SET ch, inglue - Toggle CR bit 6 for SVR4 vararg calls
+ CR6SET,
+ CR6UNSET,
+
+ /// G8RC = ADDIS_GOT_TPREL_HA %X2, Symbol - Used by the initial-exec
+ /// TLS model, produces an ADDIS8 instruction that adds the GOT
+ /// base to sym@got@tprel@ha.
+ ADDIS_GOT_TPREL_HA,
+
+ /// G8RC = LD_GOT_TPREL_L Symbol, G8RReg - Used by the initial-exec
+ /// TLS model, produces a LD instruction with base register G8RReg
+ /// and offset sym@got@tprel@l. This completes the addition that
+ /// finds the offset of "sym" relative to the thread pointer.
+ LD_GOT_TPREL_L,
+
+ /// G8RC = ADD_TLS G8RReg, Symbol - Used by the initial-exec TLS
+ /// model, produces an ADD instruction that adds the contents of
+ /// G8RReg to the thread pointer. Symbol contains a relocation
+ /// sym@tls which is to be replaced by the thread pointer and
+ /// identifies to the linker that the instruction is part of a
+ /// TLS sequence.
+ ADD_TLS,
+
+ /// G8RC = ADDIS_TLSGD_HA %X2, Symbol - For the general-dynamic TLS
+ /// model, produces an ADDIS8 instruction that adds the GOT base
+ /// register to sym@got@tlsgd@ha.
+ ADDIS_TLSGD_HA,
+
+ /// G8RC = ADDI_TLSGD_L G8RReg, Symbol - For the general-dynamic TLS
+ /// model, produces an ADDI8 instruction that adds G8RReg to
+ /// sym@got@tlsgd@l.
+ ADDI_TLSGD_L,
+
+ /// G8RC = GET_TLS_ADDR %X3, Symbol - For the general-dynamic TLS
+ /// model, produces a call to __tls_get_addr(sym@tlsgd).
+ GET_TLS_ADDR,
+
+ /// G8RC = ADDIS_TLSLD_HA %X2, Symbol - For the local-dynamic TLS
+ /// model, produces an ADDIS8 instruction that adds the GOT base
+ /// register to sym@got@tlsld@ha.
+ ADDIS_TLSLD_HA,
+
+ /// G8RC = ADDI_TLSLD_L G8RReg, Symbol - For the local-dynamic TLS
+ /// model, produces an ADDI8 instruction that adds G8RReg to
+ /// sym@got@tlsld@l.
+ ADDI_TLSLD_L,
+
+ /// G8RC = GET_TLSLD_ADDR %X3, Symbol - For the local-dynamic TLS
+ /// model, produces a call to __tls_get_addr(sym@tlsld).
+ GET_TLSLD_ADDR,
+
+ /// G8RC = ADDIS_DTPREL_HA %X3, Symbol, Chain - For the
+ /// local-dynamic TLS model, produces an ADDIS8 instruction
+ /// that adds X3 to sym@dtprel@ha. The Chain operand is needed
+ /// to tie this in place following a copy to %X3 from the result
+ /// of a GET_TLSLD_ADDR.
+ ADDIS_DTPREL_HA,
+
+ /// G8RC = ADDI_DTPREL_L G8RReg, Symbol - For the local-dynamic TLS
+ /// model, produces an ADDI8 instruction that adds G8RReg to
+ /// sym@got@dtprel@l.
+ ADDI_DTPREL_L,
+
+ /// VRRC = VADD_SPLAT Elt, EltSize - Temporary node to be expanded
+ /// during instruction selection to optimize a BUILD_VECTOR into
+ /// operations on splats. This is necessary to avoid losing these
+ /// optimizations due to constant folding.
+ VADD_SPLAT,
+
+ /// CHAIN = STBRX CHAIN, GPRC, Ptr, Type - This is a
+ /// byte-swapping store instruction. It byte-swaps the low "Type" bits of
+ /// the GPRC input, then stores it through Ptr. Type can be either i16 or
+ /// i32.
+ STBRX = ISD::FIRST_TARGET_MEMORY_OPCODE,
+
+ /// GPRC, CHAIN = LBRX CHAIN, Ptr, Type - This is a
+ /// byte-swapping load instruction. It loads "Type" bits, byte swaps it,
+ /// then puts it in the bottom bits of the GPRC. TYPE can be either i16
+ /// or i32.
+ LBRX,
+
+ /// STFIWX - The STFIWX instruction. The first operand is an input token
+ /// chain, then an f64 value to store, then an address to store it to.
+ STFIWX,
+
+ /// GPRC, CHAIN = LFIWAX CHAIN, Ptr - This is a floating-point
+ /// load which sign-extends from a 32-bit integer value into the
+ /// destination 64-bit register.
+ LFIWAX,
+
+ /// GPRC, CHAIN = LFIWZX CHAIN, Ptr - This is a floating-point
+ /// load which zero-extends from a 32-bit integer value into the
+ /// destination 64-bit register.
+ LFIWZX,
+
+ /// G8RC = ADDIS_TOC_HA %X2, Symbol - For medium and large code model,
+ /// produces an ADDIS8 instruction that adds the TOC base register to
+ /// sym@toc@ha.
+ ADDIS_TOC_HA,
+
+ /// G8RC = LD_TOC_L Symbol, G8RReg - For medium and large code model,
+ /// produces a LD instruction with base register G8RReg and offset
+ /// sym@toc@l. Preceded by an ADDIS_TOC_HA to form a full 32-bit offset.
+ LD_TOC_L,
+
+ /// G8RC = ADDI_TOC_L G8RReg, Symbol - For medium code model, produces
+ /// an ADDI8 instruction that adds G8RReg to sym@toc@l.
+ /// Preceded by an ADDIS_TOC_HA to form a full 32-bit offset.
+ ADDI_TOC_L
+ };
+ }
+
+ /// Define some predicates that are used for node matching.
+ namespace PPC {
+ /// isVPKUHUMShuffleMask - Return true if this is the shuffle mask for a
+ /// VPKUHUM instruction.
+ bool isVPKUHUMShuffleMask(ShuffleVectorSDNode *N, bool isUnary);
+
+ /// isVPKUWUMShuffleMask - Return true if this is the shuffle mask for a
+ /// VPKUWUM instruction.
+ bool isVPKUWUMShuffleMask(ShuffleVectorSDNode *N, bool isUnary);
+
+ /// isVMRGLShuffleMask - Return true if this is a shuffle mask suitable for
+ /// a VRGL* instruction with the specified unit size (1,2 or 4 bytes).
+ bool isVMRGLShuffleMask(ShuffleVectorSDNode *N, unsigned UnitSize,
+ bool isUnary);
+
+ /// isVMRGHShuffleMask - Return true if this is a shuffle mask suitable for
+ /// a VRGH* instruction with the specified unit size (1,2 or 4 bytes).
+ bool isVMRGHShuffleMask(ShuffleVectorSDNode *N, unsigned UnitSize,
+ bool isUnary);
+
+ /// isVSLDOIShuffleMask - If this is a vsldoi shuffle mask, return the shift
+ /// amount, otherwise return -1.
+ int isVSLDOIShuffleMask(SDNode *N, bool isUnary);
+
+ /// isSplatShuffleMask - Return true if the specified VECTOR_SHUFFLE operand
+ /// specifies a splat of a single element that is suitable for input to
+ /// VSPLTB/VSPLTH/VSPLTW.
+ bool isSplatShuffleMask(ShuffleVectorSDNode *N, unsigned EltSize);
+
+ /// isAllNegativeZeroVector - Returns true if all elements of build_vector
+ /// are -0.0.
+ bool isAllNegativeZeroVector(SDNode *N);
+
+ /// getVSPLTImmediate - Return the appropriate VSPLT* immediate to splat the
+ /// specified isSplatShuffleMask VECTOR_SHUFFLE mask.
+ unsigned getVSPLTImmediate(SDNode *N, unsigned EltSize);
+
+ /// get_VSPLTI_elt - If this is a build_vector of constants which can be
+ /// formed by using a vspltis[bhw] instruction of the specified element
+ /// size, return the constant being splatted. The ByteSize field indicates
+ /// the number of bytes of each element [124] -> [bhw].
+ SDValue get_VSPLTI_elt(SDNode *N, unsigned ByteSize, SelectionDAG &DAG);
+ }
+
+ class PPCTargetLowering : public TargetLowering {
+ const PPCSubtarget &PPCSubTarget;
+ const PPCRegisterInfo *PPCRegInfo;
+
+ public:
+ explicit PPCTargetLowering(PPCTargetMachine &TM);
+
+ /// getTargetNodeName() - This method returns the name of a target specific
+ /// DAG node.
+ virtual const char *getTargetNodeName(unsigned Opcode) const;
+
+ virtual MVT getScalarShiftAmountTy(EVT LHSTy) const { return MVT::i32; }
+
+ /// getSetCCResultType - Return the ISD::SETCC ValueType
+ virtual EVT getSetCCResultType(EVT VT) const;
+
+ /// getPreIndexedAddressParts - returns true by value, base pointer and
+ /// offset pointer and addressing mode by reference if the node's address
+ /// can be legally represented as pre-indexed load / store address.
+ virtual bool getPreIndexedAddressParts(SDNode *N, SDValue &Base,
+ SDValue &Offset,
+ ISD::MemIndexedMode &AM,
+ SelectionDAG &DAG) const;
+
+ /// SelectAddressRegReg - Given the specified addressed, check to see if it
+ /// can be represented as an indexed [r+r] operation. Returns false if it
+ /// can be more efficiently represented with [r+imm].
+ bool SelectAddressRegReg(SDValue N, SDValue &Base, SDValue &Index,
+ SelectionDAG &DAG) const;
+
+ /// SelectAddressRegImm - Returns true if the address N can be represented
+ /// by a base register plus a signed 16-bit displacement [r+imm], and if it
+ /// is not better represented as reg+reg.
+ bool SelectAddressRegImm(SDValue N, SDValue &Disp, SDValue &Base,
+ SelectionDAG &DAG) const;
+
+ /// SelectAddressRegRegOnly - Given the specified addressed, force it to be
+ /// represented as an indexed [r+r] operation.
+ bool SelectAddressRegRegOnly(SDValue N, SDValue &Base, SDValue &Index,
+ SelectionDAG &DAG) const;
+
+ /// SelectAddressRegImmShift - Returns true if the address N can be
+ /// represented by a base register plus a signed 14-bit displacement
+ /// [r+imm*4]. Suitable for use by STD and friends.
+ bool SelectAddressRegImmShift(SDValue N, SDValue &Disp, SDValue &Base,
+ SelectionDAG &DAG) const;
+
+ Sched::Preference getSchedulingPreference(SDNode *N) const;
+
+ /// LowerOperation - Provide custom lowering hooks for some operations.
+ ///
+ virtual SDValue LowerOperation(SDValue Op, SelectionDAG &DAG) const;
+
+ /// ReplaceNodeResults - Replace the results of node with an illegal result
+ /// type with new values built out of custom code.
+ ///
+ virtual void ReplaceNodeResults(SDNode *N, SmallVectorImpl<SDValue>&Results,
+ SelectionDAG &DAG) const;
+
+ virtual SDValue PerformDAGCombine(SDNode *N, DAGCombinerInfo &DCI) const;
+
+ virtual void computeMaskedBitsForTargetNode(const SDValue Op,
+ APInt &KnownZero,
+ APInt &KnownOne,
+ const SelectionDAG &DAG,
+ unsigned Depth = 0) const;
+
+ virtual MachineBasicBlock *
+ EmitInstrWithCustomInserter(MachineInstr *MI,
+ MachineBasicBlock *MBB) const;
+ MachineBasicBlock *EmitAtomicBinary(MachineInstr *MI,
+ MachineBasicBlock *MBB, bool is64Bit,
+ unsigned BinOpcode) const;
+ MachineBasicBlock *EmitPartwordAtomicBinary(MachineInstr *MI,
+ MachineBasicBlock *MBB,
+ bool is8bit, unsigned Opcode) const;
+
+ MachineBasicBlock *emitEHSjLjSetJmp(MachineInstr *MI,
+ MachineBasicBlock *MBB) const;
+
+ MachineBasicBlock *emitEHSjLjLongJmp(MachineInstr *MI,
+ MachineBasicBlock *MBB) const;
+
+ ConstraintType getConstraintType(const std::string &Constraint) const;
+
+ /// Examine constraint string and operand type and determine a weight value.
+ /// The operand object must already have been set up with the operand type.
+ ConstraintWeight getSingleConstraintMatchWeight(
+ AsmOperandInfo &info, const char *constraint) const;
+
+ std::pair<unsigned, const TargetRegisterClass*>
+ getRegForInlineAsmConstraint(const std::string &Constraint,
+ EVT VT) const;
+
+ /// getByValTypeAlignment - Return the desired alignment for ByVal aggregate
+ /// function arguments in the caller parameter area. This is the actual
+ /// alignment, not its logarithm.
+ unsigned getByValTypeAlignment(Type *Ty) const;
+
+ /// LowerAsmOperandForConstraint - Lower the specified operand into the Ops
+ /// vector. If it is invalid, don't add anything to Ops.
+ virtual void LowerAsmOperandForConstraint(SDValue Op,
+ std::string &Constraint,
+ std::vector<SDValue> &Ops,
+ SelectionDAG &DAG) const;
+
+ /// isLegalAddressingMode - Return true if the addressing mode represented
+ /// by AM is legal for this target, for a load/store of the specified type.
+ virtual bool isLegalAddressingMode(const AddrMode &AM, Type *Ty)const;
+
+ /// isLegalAddressImmediate - Return true if the integer value can be used
+ /// as the offset of the target addressing mode for load / store of the
+ /// given type.
+ virtual bool isLegalAddressImmediate(int64_t V, Type *Ty) const;
+
+ /// isLegalAddressImmediate - Return true if the GlobalValue can be used as
+ /// the offset of the target addressing mode.
+ virtual bool isLegalAddressImmediate(GlobalValue *GV) const;
+
+ virtual bool isOffsetFoldingLegal(const GlobalAddressSDNode *GA) const;
+
+ /// getOptimalMemOpType - Returns the target specific optimal type for load
+ /// and store operations as a result of memset, memcpy, and memmove
+ /// lowering. If DstAlign is zero that means it's safe to destination
+ /// alignment can satisfy any constraint. Similarly if SrcAlign is zero it
+ /// means there isn't a need to check it against alignment requirement,
+ /// probably because the source does not need to be loaded. If 'IsMemset' is
+ /// true, that means it's expanding a memset. If 'ZeroMemset' is true, that
+ /// means it's a memset of zero. 'MemcpyStrSrc' indicates whether the memcpy
+ /// source is constant so it does not need to be loaded.
+ /// It returns EVT::Other if the type should be determined using generic
+ /// target-independent logic.
+ virtual EVT
+ getOptimalMemOpType(uint64_t Size, unsigned DstAlign, unsigned SrcAlign,
+ bool IsMemset, bool ZeroMemset, bool MemcpyStrSrc,
+ MachineFunction &MF) const;
+
+ /// Is unaligned memory access allowed for the given type, and is it fast
+ /// relative to software emulation.
+ virtual bool allowsUnalignedMemoryAccesses(EVT VT, bool *Fast = 0) const;
+
+ /// isFMAFasterThanMulAndAdd - Return true if an FMA operation is faster than
+ /// a pair of mul and add instructions. fmuladd intrinsics will be expanded to
+ /// FMAs when this method returns true (and FMAs are legal), otherwise fmuladd
+ /// is expanded to mul + add.
+ virtual bool isFMAFasterThanMulAndAdd(EVT VT) const;
+
+ private:
+ SDValue getFramePointerFrameIndex(SelectionDAG & DAG) const;
+ SDValue getReturnAddrFrameIndex(SelectionDAG & DAG) const;
+
+ bool
+ IsEligibleForTailCallOptimization(SDValue Callee,
+ CallingConv::ID CalleeCC,
+ bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ SelectionDAG& DAG) const;
+
+ SDValue EmitTailCallLoadFPAndRetAddr(SelectionDAG & DAG,
+ int SPDiff,
+ SDValue Chain,
+ SDValue &LROpOut,
+ SDValue &FPOpOut,
+ bool isDarwinABI,
+ DebugLoc dl) const;
+
+ SDValue LowerRETURNADDR(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerFRAMEADDR(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerConstantPool(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerBlockAddress(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerGlobalTLSAddress(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerGlobalAddress(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerJumpTable(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerSETCC(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerINIT_TRAMPOLINE(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerADJUST_TRAMPOLINE(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerVASTART(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const;
+ SDValue LowerVAARG(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const;
+ SDValue LowerSTACKRESTORE(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const;
+ SDValue LowerDYNAMIC_STACKALLOC(SDValue Op, SelectionDAG &DAG,
+ const PPCSubtarget &Subtarget) const;
+ SDValue LowerSELECT_CC(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerFP_TO_INT(SDValue Op, SelectionDAG &DAG, DebugLoc dl) const;
+ SDValue LowerINT_TO_FP(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerFLT_ROUNDS_(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerSHL_PARTS(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerSRL_PARTS(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerSRA_PARTS(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerBUILD_VECTOR(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerVECTOR_SHUFFLE(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerINTRINSIC_WO_CHAIN(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerSCALAR_TO_VECTOR(SDValue Op, SelectionDAG &DAG) const;
+ SDValue LowerMUL(SDValue Op, SelectionDAG &DAG) const;
+
+ SDValue LowerCallResult(SDValue Chain, SDValue InFlag,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+ SDValue FinishCall(CallingConv::ID CallConv, DebugLoc dl, bool isTailCall,
+ bool isVarArg,
+ SelectionDAG &DAG,
+ SmallVector<std::pair<unsigned, SDValue>, 8>
+ &RegsToPass,
+ SDValue InFlag, SDValue Chain,
+ SDValue &Callee,
+ int SPDiff, unsigned NumBytes,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ SmallVectorImpl<SDValue> &InVals) const;
+
+ virtual SDValue
+ LowerFormalArguments(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+
+ virtual SDValue
+ LowerCall(TargetLowering::CallLoweringInfo &CLI,
+ SmallVectorImpl<SDValue> &InVals) const;
+
+ virtual bool
+ CanLowerReturn(CallingConv::ID CallConv, MachineFunction &MF,
+ bool isVarArg,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ LLVMContext &Context) const;
+
+ virtual SDValue
+ LowerReturn(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ DebugLoc dl, SelectionDAG &DAG) const;
+
+ SDValue
+ extendArgForPPC64(ISD::ArgFlagsTy Flags, EVT ObjectVT, SelectionDAG &DAG,
+ SDValue ArgVal, DebugLoc dl) const;
+
+ void
+ setMinReservedArea(MachineFunction &MF, SelectionDAG &DAG,
+ unsigned nAltivecParamsAtEnd,
+ unsigned MinReservedArea, bool isPPC64) const;
+
+ SDValue
+ LowerFormalArguments_Darwin(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+ SDValue
+ LowerFormalArguments_64SVR4(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+ SDValue
+ LowerFormalArguments_32SVR4(SDValue Chain,
+ CallingConv::ID CallConv, bool isVarArg,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+
+ SDValue
+ createMemcpyOutsideCallSeq(SDValue Arg, SDValue PtrOff,
+ SDValue CallSeqStart, ISD::ArgFlagsTy Flags,
+ SelectionDAG &DAG, DebugLoc dl) const;
+
+ SDValue
+ LowerCall_Darwin(SDValue Chain, SDValue Callee,
+ CallingConv::ID CallConv,
+ bool isVarArg, bool isTailCall,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+ SDValue
+ LowerCall_64SVR4(SDValue Chain, SDValue Callee,
+ CallingConv::ID CallConv,
+ bool isVarArg, bool isTailCall,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+ SDValue
+ LowerCall_32SVR4(SDValue Chain, SDValue Callee, CallingConv::ID CallConv,
+ bool isVarArg, bool isTailCall,
+ const SmallVectorImpl<ISD::OutputArg> &Outs,
+ const SmallVectorImpl<SDValue> &OutVals,
+ const SmallVectorImpl<ISD::InputArg> &Ins,
+ DebugLoc dl, SelectionDAG &DAG,
+ SmallVectorImpl<SDValue> &InVals) const;
+
+ SDValue lowerEH_SJLJ_SETJMP(SDValue Op, SelectionDAG &DAG) const;
+ SDValue lowerEH_SJLJ_LONGJMP(SDValue Op, SelectionDAG &DAG) const;
+
+ SDValue DAGCombineFastRecip(SDValue Op, DAGCombinerInfo &DCI) const;
+ SDValue DAGCombineFastRecipFSQRT(SDValue Op, DAGCombinerInfo &DCI) const;
+ };
+}
+
+#endif // LLVM_TARGET_POWERPC_PPC32ISELLOWERING_H
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstr64Bit.td b/contrib/llvm/lib/Target/PowerPC/PPCInstr64Bit.td
new file mode 100644
index 0000000..fa5b65f
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstr64Bit.td
@@ -0,0 +1,968 @@
+//===-- PPCInstr64Bit.td - The PowerPC 64-bit Support ------*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file describes the PowerPC 64-bit instructions. These patterns are used
+// both when in ppc64 mode and when in "use 64-bit extensions in 32-bit" mode.
+//
+//===----------------------------------------------------------------------===//
+
+//===----------------------------------------------------------------------===//
+// 64-bit operands.
+//
+def s16imm64 : Operand<i64> {
+ let PrintMethod = "printS16ImmOperand";
+}
+def u16imm64 : Operand<i64> {
+ let PrintMethod = "printU16ImmOperand";
+}
+def symbolHi64 : Operand<i64> {
+ let PrintMethod = "printSymbolHi";
+ let EncoderMethod = "getHA16Encoding";
+}
+def symbolLo64 : Operand<i64> {
+ let PrintMethod = "printSymbolLo";
+ let EncoderMethod = "getLO16Encoding";
+}
+def tocentry : Operand<iPTR> {
+ let MIOperandInfo = (ops i64imm:$imm);
+}
+def tlsreg : Operand<i64> {
+ let EncoderMethod = "getTLSRegEncoding";
+}
+def tlsgd : Operand<i64> {}
+
+//===----------------------------------------------------------------------===//
+// 64-bit transformation functions.
+//
+
+def SHL64 : SDNodeXForm<imm, [{
+ // Transformation function: 63 - imm
+ return getI32Imm(63 - N->getZExtValue());
+}]>;
+
+def SRL64 : SDNodeXForm<imm, [{
+ // Transformation function: 64 - imm
+ return N->getZExtValue() ? getI32Imm(64 - N->getZExtValue()) : getI32Imm(0);
+}]>;
+
+def HI32_48 : SDNodeXForm<imm, [{
+ // Transformation function: shift the immediate value down into the low bits.
+ return getI32Imm((unsigned short)(N->getZExtValue() >> 32));
+}]>;
+
+def HI48_64 : SDNodeXForm<imm, [{
+ // Transformation function: shift the immediate value down into the low bits.
+ return getI32Imm((unsigned short)(N->getZExtValue() >> 48));
+}]>;
+
+
+//===----------------------------------------------------------------------===//
+// Calls.
+//
+
+let isTerminator = 1, isBarrier = 1, PPC970_Unit = 7 in {
+ let isBranch = 1, isIndirectBranch = 1, Uses = [CTR8] in
+ def BCTR8 : XLForm_2_ext<19, 528, 20, 0, 0, (outs), (ins), "bctr", BrB, []>,
+ Requires<[In64BitMode]>;
+}
+
+let Defs = [LR8] in
+ def MovePCtoLR8 : Pseudo<(outs), (ins), "#MovePCtoLR8", []>,
+ PPC970_Unit_BRU;
+
+let isBranch = 1, isTerminator = 1, hasCtrlDep = 1, PPC970_Unit = 7 in {
+ let Defs = [CTR8], Uses = [CTR8] in {
+ def BDZ8 : BForm_1<16, 18, 0, 0, (outs), (ins condbrtarget:$dst),
+ "bdz $dst">;
+ def BDNZ8 : BForm_1<16, 16, 0, 0, (outs), (ins condbrtarget:$dst),
+ "bdnz $dst">;
+ }
+}
+
+let isCall = 1, PPC970_Unit = 7, Defs = [LR8] in {
+ // Convenient aliases for call instructions
+ let Uses = [RM] in {
+ def BL8 : IForm<18, 0, 1, (outs), (ins calltarget:$func),
+ "bl $func", BrB, []>; // See Pat patterns below.
+
+ def BLA8 : IForm<18, 1, 1, (outs), (ins aaddr:$func),
+ "bla $func", BrB, [(PPCcall (i64 imm:$func))]>;
+ }
+ let Uses = [RM], isCodeGenOnly = 1 in {
+ def BL8_NOP : IForm_and_DForm_4_zero<18, 0, 1, 24,
+ (outs), (ins calltarget:$func),
+ "bl $func\n\tnop", BrB, []>;
+
+ def BL8_NOP_TLSGD : IForm_and_DForm_4_zero<18, 0, 1, 24,
+ (outs), (ins calltarget:$func, tlsgd:$sym),
+ "bl $func($sym)\n\tnop", BrB, []>;
+
+ def BL8_NOP_TLSLD : IForm_and_DForm_4_zero<18, 0, 1, 24,
+ (outs), (ins calltarget:$func, tlsgd:$sym),
+ "bl $func($sym)\n\tnop", BrB, []>;
+
+ def BLA8_NOP : IForm_and_DForm_4_zero<18, 1, 1, 24,
+ (outs), (ins aaddr:$func),
+ "bla $func\n\tnop", BrB,
+ [(PPCcall_nop (i64 imm:$func))]>;
+ }
+ let Uses = [CTR8, RM] in {
+ def BCTRL8 : XLForm_2_ext<19, 528, 20, 0, 1, (outs), (ins),
+ "bctrl", BrB, [(PPCbctrl)]>,
+ Requires<[In64BitMode]>;
+ }
+}
+
+
+// Calls
+def : Pat<(PPCcall (i64 tglobaladdr:$dst)),
+ (BL8 tglobaladdr:$dst)>;
+def : Pat<(PPCcall_nop (i64 tglobaladdr:$dst)),
+ (BL8_NOP tglobaladdr:$dst)>;
+
+def : Pat<(PPCcall (i64 texternalsym:$dst)),
+ (BL8 texternalsym:$dst)>;
+def : Pat<(PPCcall_nop (i64 texternalsym:$dst)),
+ (BL8_NOP texternalsym:$dst)>;
+
+// Atomic operations
+let usesCustomInserter = 1 in {
+ let Defs = [CR0] in {
+ def ATOMIC_LOAD_ADD_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$incr), "#ATOMIC_LOAD_ADD_I64",
+ [(set i64:$dst, (atomic_load_add_64 xoaddr:$ptr, i64:$incr))]>;
+ def ATOMIC_LOAD_SUB_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$incr), "#ATOMIC_LOAD_SUB_I64",
+ [(set i64:$dst, (atomic_load_sub_64 xoaddr:$ptr, i64:$incr))]>;
+ def ATOMIC_LOAD_OR_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$incr), "#ATOMIC_LOAD_OR_I64",
+ [(set i64:$dst, (atomic_load_or_64 xoaddr:$ptr, i64:$incr))]>;
+ def ATOMIC_LOAD_XOR_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$incr), "#ATOMIC_LOAD_XOR_I64",
+ [(set i64:$dst, (atomic_load_xor_64 xoaddr:$ptr, i64:$incr))]>;
+ def ATOMIC_LOAD_AND_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$incr), "#ATOMIC_LOAD_AND_i64",
+ [(set i64:$dst, (atomic_load_and_64 xoaddr:$ptr, i64:$incr))]>;
+ def ATOMIC_LOAD_NAND_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$incr), "#ATOMIC_LOAD_NAND_I64",
+ [(set i64:$dst, (atomic_load_nand_64 xoaddr:$ptr, i64:$incr))]>;
+
+ def ATOMIC_CMP_SWAP_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$old, G8RC:$new), "#ATOMIC_CMP_SWAP_I64",
+ [(set i64:$dst, (atomic_cmp_swap_64 xoaddr:$ptr, i64:$old, i64:$new))]>;
+
+ def ATOMIC_SWAP_I64 : Pseudo<
+ (outs G8RC:$dst), (ins memrr:$ptr, G8RC:$new), "#ATOMIC_SWAP_I64",
+ [(set i64:$dst, (atomic_swap_64 xoaddr:$ptr, i64:$new))]>;
+ }
+}
+
+// Instructions to support atomic operations
+def LDARX : XForm_1<31, 84, (outs G8RC:$rD), (ins memrr:$ptr),
+ "ldarx $rD, $ptr", LdStLDARX,
+ [(set i64:$rD, (PPClarx xoaddr:$ptr))]>;
+
+let Defs = [CR0] in
+def STDCX : XForm_1<31, 214, (outs), (ins G8RC:$rS, memrr:$dst),
+ "stdcx. $rS, $dst", LdStSTDCX,
+ [(PPCstcx i64:$rS, xoaddr:$dst)]>,
+ isDOT;
+
+let isCall = 1, isTerminator = 1, isReturn = 1, isBarrier = 1, Uses = [RM] in
+def TCRETURNdi8 :Pseudo< (outs),
+ (ins calltarget:$dst, i32imm:$offset),
+ "#TC_RETURNd8 $dst $offset",
+ []>;
+
+let isCall = 1, isTerminator = 1, isReturn = 1, isBarrier = 1, Uses = [RM] in
+def TCRETURNai8 :Pseudo<(outs), (ins aaddr:$func, i32imm:$offset),
+ "#TC_RETURNa8 $func $offset",
+ [(PPCtc_return (i64 imm:$func), imm:$offset)]>;
+
+let isCall = 1, isTerminator = 1, isReturn = 1, isBarrier = 1, Uses = [RM] in
+def TCRETURNri8 : Pseudo<(outs), (ins CTRRC8:$dst, i32imm:$offset),
+ "#TC_RETURNr8 $dst $offset",
+ []>;
+
+let isCodeGenOnly = 1 in {
+
+let isTerminator = 1, isBarrier = 1, PPC970_Unit = 7, isBranch = 1,
+ isIndirectBranch = 1, isCall = 1, isReturn = 1, Uses = [CTR8, RM] in
+def TAILBCTR8 : XLForm_2_ext<19, 528, 20, 0, 0, (outs), (ins), "bctr", BrB, []>,
+ Requires<[In64BitMode]>;
+
+
+let isBranch = 1, isTerminator = 1, hasCtrlDep = 1, PPC970_Unit = 7,
+ isBarrier = 1, isCall = 1, isReturn = 1, Uses = [RM] in
+def TAILB8 : IForm<18, 0, 0, (outs), (ins calltarget:$dst),
+ "b $dst", BrB,
+ []>;
+
+
+let isBranch = 1, isTerminator = 1, hasCtrlDep = 1, PPC970_Unit = 7,
+ isBarrier = 1, isCall = 1, isReturn = 1, Uses = [RM] in
+def TAILBA8 : IForm<18, 0, 0, (outs), (ins aaddr:$dst),
+ "ba $dst", BrB,
+ []>;
+
+}
+
+def : Pat<(PPCtc_return (i64 tglobaladdr:$dst), imm:$imm),
+ (TCRETURNdi8 tglobaladdr:$dst, imm:$imm)>;
+
+def : Pat<(PPCtc_return (i64 texternalsym:$dst), imm:$imm),
+ (TCRETURNdi8 texternalsym:$dst, imm:$imm)>;
+
+def : Pat<(PPCtc_return CTRRC8:$dst, imm:$imm),
+ (TCRETURNri8 CTRRC8:$dst, imm:$imm)>;
+
+
+// 64-bit CR instructions
+def MTCRF8 : XFXForm_5<31, 144, (outs crbitm:$FXM), (ins G8RC:$rS),
+ "mtcrf $FXM, $rS", BrMCRX>,
+ PPC970_MicroCode, PPC970_Unit_CRU;
+
+let isCodeGenOnly = 1 in
+def MFCR8pseud: XFXForm_3<31, 19, (outs G8RC:$rT), (ins crbitm:$FXM),
+ "#MFCR8pseud", SprMFCR>,
+ PPC970_MicroCode, PPC970_Unit_CRU;
+
+def MFCR8 : XFXForm_3<31, 19, (outs G8RC:$rT), (ins),
+ "mfcr $rT", SprMFCR>,
+ PPC970_MicroCode, PPC970_Unit_CRU;
+
+let hasSideEffects = 1, isBarrier = 1, usesCustomInserter = 1 in {
+ def EH_SjLj_SetJmp64 : Pseudo<(outs GPRC:$dst), (ins memr:$buf),
+ "#EH_SJLJ_SETJMP64",
+ [(set i32:$dst, (PPCeh_sjlj_setjmp addr:$buf))]>,
+ Requires<[In64BitMode]>;
+ let isTerminator = 1 in
+ def EH_SjLj_LongJmp64 : Pseudo<(outs), (ins memr:$buf),
+ "#EH_SJLJ_LONGJMP64",
+ [(PPCeh_sjlj_longjmp addr:$buf)]>,
+ Requires<[In64BitMode]>;
+}
+
+//===----------------------------------------------------------------------===//
+// 64-bit SPR manipulation instrs.
+
+let Uses = [CTR8] in {
+def MFCTR8 : XFXForm_1_ext<31, 339, 9, (outs G8RC:$rT), (ins),
+ "mfctr $rT", SprMFSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+let Pattern = [(PPCmtctr i64:$rS)], Defs = [CTR8] in {
+def MTCTR8 : XFXForm_7_ext<31, 467, 9, (outs), (ins G8RC:$rS),
+ "mtctr $rS", SprMTSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+
+let Pattern = [(set i64:$rT, readcyclecounter)] in
+def MFTB8 : XFXForm_1_ext<31, 339, 268, (outs G8RC:$rT), (ins),
+ "mfspr $rT, 268", SprMFTB>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+// Note that encoding mftb using mfspr is now the preferred form,
+// and has been since at least ISA v2.03. The mftb instruction has
+// now been phased out. Using mfspr, however, is known not to work on
+// the POWER3.
+
+let Defs = [X1], Uses = [X1] in
+def DYNALLOC8 : Pseudo<(outs G8RC:$result), (ins G8RC:$negsize, memri:$fpsi),"#DYNALLOC8",
+ [(set i64:$result,
+ (PPCdynalloc i64:$negsize, iaddr:$fpsi))]>;
+
+let Defs = [LR8] in {
+def MTLR8 : XFXForm_7_ext<31, 467, 8, (outs), (ins G8RC:$rS),
+ "mtlr $rS", SprMTSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+let Uses = [LR8] in {
+def MFLR8 : XFXForm_1_ext<31, 339, 8, (outs G8RC:$rT), (ins),
+ "mflr $rT", SprMFSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+
+//===----------------------------------------------------------------------===//
+// Fixed point instructions.
+//
+
+let PPC970_Unit = 1 in { // FXU Operations.
+
+let isReMaterializable = 1, isAsCheapAsAMove = 1, isMoveImm = 1 in {
+def LI8 : DForm_2_r0<14, (outs G8RC:$rD), (ins symbolLo64:$imm),
+ "li $rD, $imm", IntSimple,
+ [(set i64:$rD, immSExt16:$imm)]>;
+def LIS8 : DForm_2_r0<15, (outs G8RC:$rD), (ins symbolHi64:$imm),
+ "lis $rD, $imm", IntSimple,
+ [(set i64:$rD, imm16ShiftedSExt:$imm)]>;
+}
+
+// Logical ops.
+def NAND8: XForm_6<31, 476, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "nand $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (not (and i64:$rS, i64:$rB)))]>;
+def AND8 : XForm_6<31, 28, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "and $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (and i64:$rS, i64:$rB))]>;
+def ANDC8: XForm_6<31, 60, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "andc $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (and i64:$rS, (not i64:$rB)))]>;
+def OR8 : XForm_6<31, 444, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "or $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (or i64:$rS, i64:$rB))]>;
+def NOR8 : XForm_6<31, 124, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "nor $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (not (or i64:$rS, i64:$rB)))]>;
+def ORC8 : XForm_6<31, 412, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "orc $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (or i64:$rS, (not i64:$rB)))]>;
+def EQV8 : XForm_6<31, 284, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "eqv $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (not (xor i64:$rS, i64:$rB)))]>;
+def XOR8 : XForm_6<31, 316, (outs G8RC:$rA), (ins G8RC:$rS, G8RC:$rB),
+ "xor $rA, $rS, $rB", IntSimple,
+ [(set i64:$rA, (xor i64:$rS, i64:$rB))]>;
+
+// Logical ops with immediate.
+def ANDIo8 : DForm_4<28, (outs G8RC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "andi. $dst, $src1, $src2", IntGeneral,
+ [(set i64:$dst, (and i64:$src1, immZExt16:$src2))]>,
+ isDOT;
+def ANDISo8 : DForm_4<29, (outs G8RC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "andis. $dst, $src1, $src2", IntGeneral,
+ [(set i64:$dst, (and i64:$src1, imm16ShiftedZExt:$src2))]>,
+ isDOT;
+def ORI8 : DForm_4<24, (outs G8RC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "ori $dst, $src1, $src2", IntSimple,
+ [(set i64:$dst, (or i64:$src1, immZExt16:$src2))]>;
+def ORIS8 : DForm_4<25, (outs G8RC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "oris $dst, $src1, $src2", IntSimple,
+ [(set i64:$dst, (or i64:$src1, imm16ShiftedZExt:$src2))]>;
+def XORI8 : DForm_4<26, (outs G8RC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "xori $dst, $src1, $src2", IntSimple,
+ [(set i64:$dst, (xor i64:$src1, immZExt16:$src2))]>;
+def XORIS8 : DForm_4<27, (outs G8RC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "xoris $dst, $src1, $src2", IntSimple,
+ [(set i64:$dst, (xor i64:$src1, imm16ShiftedZExt:$src2))]>;
+
+def ADD8 : XOForm_1<31, 266, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "add $rT, $rA, $rB", IntSimple,
+ [(set i64:$rT, (add i64:$rA, i64:$rB))]>;
+// ADD8 has a special form: reg = ADD8(reg, sym@tls) for use by the
+// initial-exec thread-local storage model.
+let isCodeGenOnly = 1 in
+def ADD8TLS : XOForm_1<31, 266, 0, (outs G8RC:$rT), (ins G8RC:$rA, tlsreg:$rB),
+ "add $rT, $rA, $rB@tls", IntSimple,
+ [(set i64:$rT, (add i64:$rA, tglobaltlsaddr:$rB))]>;
+
+let Defs = [CARRY] in {
+def ADDC8 : XOForm_1<31, 10, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "addc $rT, $rA, $rB", IntGeneral,
+ [(set i64:$rT, (addc i64:$rA, i64:$rB))]>,
+ PPC970_DGroup_Cracked;
+def ADDIC8 : DForm_2<12, (outs G8RC:$rD), (ins G8RC:$rA, s16imm64:$imm),
+ "addic $rD, $rA, $imm", IntGeneral,
+ [(set i64:$rD, (addc i64:$rA, immSExt16:$imm))]>;
+}
+def ADDI8 : DForm_2<14, (outs G8RC:$rD), (ins G8RC_NOX0:$rA, symbolLo64:$imm),
+ "addi $rD, $rA, $imm", IntSimple,
+ [(set i64:$rD, (add i64:$rA, immSExt16:$imm))]>;
+def ADDIS8 : DForm_2<15, (outs G8RC:$rD), (ins G8RC_NOX0:$rA, symbolHi64:$imm),
+ "addis $rD, $rA, $imm", IntSimple,
+ [(set i64:$rD, (add i64:$rA, imm16ShiftedSExt:$imm))]>;
+
+let Defs = [CARRY] in {
+def SUBFIC8: DForm_2< 8, (outs G8RC:$rD), (ins G8RC:$rA, s16imm64:$imm),
+ "subfic $rD, $rA, $imm", IntGeneral,
+ [(set i64:$rD, (subc immSExt16:$imm, i64:$rA))]>;
+def SUBFC8 : XOForm_1<31, 8, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "subfc $rT, $rA, $rB", IntGeneral,
+ [(set i64:$rT, (subc i64:$rB, i64:$rA))]>,
+ PPC970_DGroup_Cracked;
+}
+def SUBF8 : XOForm_1<31, 40, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "subf $rT, $rA, $rB", IntGeneral,
+ [(set i64:$rT, (sub i64:$rB, i64:$rA))]>;
+def NEG8 : XOForm_3<31, 104, 0, (outs G8RC:$rT), (ins G8RC:$rA),
+ "neg $rT, $rA", IntSimple,
+ [(set i64:$rT, (ineg i64:$rA))]>;
+let Uses = [CARRY], Defs = [CARRY] in {
+def ADDE8 : XOForm_1<31, 138, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "adde $rT, $rA, $rB", IntGeneral,
+ [(set i64:$rT, (adde i64:$rA, i64:$rB))]>;
+def ADDME8 : XOForm_3<31, 234, 0, (outs G8RC:$rT), (ins G8RC:$rA),
+ "addme $rT, $rA", IntGeneral,
+ [(set i64:$rT, (adde i64:$rA, -1))]>;
+def ADDZE8 : XOForm_3<31, 202, 0, (outs G8RC:$rT), (ins G8RC:$rA),
+ "addze $rT, $rA", IntGeneral,
+ [(set i64:$rT, (adde i64:$rA, 0))]>;
+def SUBFE8 : XOForm_1<31, 136, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "subfe $rT, $rA, $rB", IntGeneral,
+ [(set i64:$rT, (sube i64:$rB, i64:$rA))]>;
+def SUBFME8 : XOForm_3<31, 232, 0, (outs G8RC:$rT), (ins G8RC:$rA),
+ "subfme $rT, $rA", IntGeneral,
+ [(set i64:$rT, (sube -1, i64:$rA))]>;
+def SUBFZE8 : XOForm_3<31, 200, 0, (outs G8RC:$rT), (ins G8RC:$rA),
+ "subfze $rT, $rA", IntGeneral,
+ [(set i64:$rT, (sube 0, i64:$rA))]>;
+}
+
+
+def MULHD : XOForm_1<31, 73, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "mulhd $rT, $rA, $rB", IntMulHW,
+ [(set i64:$rT, (mulhs i64:$rA, i64:$rB))]>;
+def MULHDU : XOForm_1<31, 9, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "mulhdu $rT, $rA, $rB", IntMulHWU,
+ [(set i64:$rT, (mulhu i64:$rA, i64:$rB))]>;
+
+def CMPD : XForm_16_ext<31, 0, (outs CRRC:$crD), (ins G8RC:$rA, G8RC:$rB),
+ "cmpd $crD, $rA, $rB", IntCompare>, isPPC64;
+def CMPLD : XForm_16_ext<31, 32, (outs CRRC:$crD), (ins G8RC:$rA, G8RC:$rB),
+ "cmpld $crD, $rA, $rB", IntCompare>, isPPC64;
+def CMPDI : DForm_5_ext<11, (outs CRRC:$crD), (ins G8RC:$rA, s16imm:$imm),
+ "cmpdi $crD, $rA, $imm", IntCompare>, isPPC64;
+def CMPLDI : DForm_6_ext<10, (outs CRRC:$dst), (ins G8RC:$src1, u16imm:$src2),
+ "cmpldi $dst, $src1, $src2", IntCompare>, isPPC64;
+
+def SLD : XForm_6<31, 27, (outs G8RC:$rA), (ins G8RC:$rS, GPRC:$rB),
+ "sld $rA, $rS, $rB", IntRotateD,
+ [(set i64:$rA, (PPCshl i64:$rS, i32:$rB))]>, isPPC64;
+def SRD : XForm_6<31, 539, (outs G8RC:$rA), (ins G8RC:$rS, GPRC:$rB),
+ "srd $rA, $rS, $rB", IntRotateD,
+ [(set i64:$rA, (PPCsrl i64:$rS, i32:$rB))]>, isPPC64;
+let Defs = [CARRY] in {
+def SRAD : XForm_6<31, 794, (outs G8RC:$rA), (ins G8RC:$rS, GPRC:$rB),
+ "srad $rA, $rS, $rB", IntRotateD,
+ [(set i64:$rA, (PPCsra i64:$rS, i32:$rB))]>, isPPC64;
+}
+
+def EXTSB8 : XForm_11<31, 954, (outs G8RC:$rA), (ins G8RC:$rS),
+ "extsb $rA, $rS", IntSimple,
+ [(set i64:$rA, (sext_inreg i64:$rS, i8))]>;
+def EXTSH8 : XForm_11<31, 922, (outs G8RC:$rA), (ins G8RC:$rS),
+ "extsh $rA, $rS", IntSimple,
+ [(set i64:$rA, (sext_inreg i64:$rS, i16))]>;
+
+def EXTSW : XForm_11<31, 986, (outs G8RC:$rA), (ins G8RC:$rS),
+ "extsw $rA, $rS", IntSimple,
+ [(set i64:$rA, (sext_inreg i64:$rS, i32))]>, isPPC64;
+def EXTSW_32_64 : XForm_11<31, 986, (outs G8RC:$rA), (ins GPRC:$rS),
+ "extsw $rA, $rS", IntSimple,
+ [(set i64:$rA, (sext i32:$rS))]>, isPPC64;
+
+let Defs = [CARRY] in {
+def SRADI : XSForm_1<31, 413, (outs G8RC:$rA), (ins G8RC:$rS, u6imm:$SH),
+ "sradi $rA, $rS, $SH", IntRotateDI,
+ [(set i64:$rA, (sra i64:$rS, (i32 imm:$SH)))]>, isPPC64;
+}
+def CNTLZD : XForm_11<31, 58, (outs G8RC:$rA), (ins G8RC:$rS),
+ "cntlzd $rA, $rS", IntGeneral,
+ [(set i64:$rA, (ctlz i64:$rS))]>;
+def POPCNTD : XForm_11<31, 506, (outs G8RC:$rA), (ins G8RC:$rS),
+ "popcntd $rA, $rS", IntGeneral,
+ [(set i64:$rA, (ctpop i64:$rS))]>;
+
+// popcntw also does a population count on the high 32 bits (storing the
+// results in the high 32-bits of the output). We'll ignore that here (which is
+// safe because we never separately use the high part of the 64-bit registers).
+def POPCNTW : XForm_11<31, 378, (outs GPRC:$rA), (ins GPRC:$rS),
+ "popcntw $rA, $rS", IntGeneral,
+ [(set i32:$rA, (ctpop i32:$rS))]>;
+
+def DIVD : XOForm_1<31, 489, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "divd $rT, $rA, $rB", IntDivD,
+ [(set i64:$rT, (sdiv i64:$rA, i64:$rB))]>, isPPC64,
+ PPC970_DGroup_First, PPC970_DGroup_Cracked;
+def DIVDU : XOForm_1<31, 457, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "divdu $rT, $rA, $rB", IntDivD,
+ [(set i64:$rT, (udiv i64:$rA, i64:$rB))]>, isPPC64,
+ PPC970_DGroup_First, PPC970_DGroup_Cracked;
+def MULLD : XOForm_1<31, 233, 0, (outs G8RC:$rT), (ins G8RC:$rA, G8RC:$rB),
+ "mulld $rT, $rA, $rB", IntMulHD,
+ [(set i64:$rT, (mul i64:$rA, i64:$rB))]>, isPPC64;
+
+
+let isCommutable = 1 in {
+def RLDIMI : MDForm_1<30, 3,
+ (outs G8RC:$rA), (ins G8RC:$rSi, G8RC:$rS, u6imm:$SH, u6imm:$MB),
+ "rldimi $rA, $rS, $SH, $MB", IntRotateDI,
+ []>, isPPC64, RegConstraint<"$rSi = $rA">,
+ NoEncode<"$rSi">;
+}
+
+// Rotate instructions.
+def RLDCL : MDForm_1<30, 0,
+ (outs G8RC:$rA), (ins G8RC:$rS, GPRC:$rB, u6imm:$MBE),
+ "rldcl $rA, $rS, $rB, $MBE", IntRotateD,
+ []>, isPPC64;
+def RLDICL : MDForm_1<30, 0,
+ (outs G8RC:$rA), (ins G8RC:$rS, u6imm:$SH, u6imm:$MBE),
+ "rldicl $rA, $rS, $SH, $MBE", IntRotateDI,
+ []>, isPPC64;
+def RLDICR : MDForm_1<30, 1,
+ (outs G8RC:$rA), (ins G8RC:$rS, u6imm:$SH, u6imm:$MBE),
+ "rldicr $rA, $rS, $SH, $MBE", IntRotateDI,
+ []>, isPPC64;
+
+def RLWINM8 : MForm_2<21,
+ (outs G8RC:$rA), (ins G8RC:$rS, u5imm:$SH, u5imm:$MB, u5imm:$ME),
+ "rlwinm $rA, $rS, $SH, $MB, $ME", IntGeneral,
+ []>;
+
+def ISEL8 : AForm_4<31, 15,
+ (outs G8RC:$rT), (ins G8RC_NOX0:$rA, G8RC:$rB, CRBITRC:$cond),
+ "isel $rT, $rA, $rB, $cond", IntGeneral,
+ []>;
+} // End FXU Operations.
+
+
+//===----------------------------------------------------------------------===//
+// Load/Store instructions.
+//
+
+
+// Sign extending loads.
+let canFoldAsLoad = 1, PPC970_Unit = 2 in {
+def LHA8: DForm_1<42, (outs G8RC:$rD), (ins memri:$src),
+ "lha $rD, $src", LdStLHA,
+ [(set i64:$rD, (sextloadi16 iaddr:$src))]>,
+ PPC970_DGroup_Cracked;
+def LWA : DSForm_1<58, 2, (outs G8RC:$rD), (ins memrix:$src),
+ "lwa $rD, $src", LdStLWA,
+ [(set i64:$rD,
+ (aligned4sextloadi32 ixaddr:$src))]>, isPPC64,
+ PPC970_DGroup_Cracked;
+def LHAX8: XForm_1<31, 343, (outs G8RC:$rD), (ins memrr:$src),
+ "lhax $rD, $src", LdStLHA,
+ [(set i64:$rD, (sextloadi16 xaddr:$src))]>,
+ PPC970_DGroup_Cracked;
+def LWAX : XForm_1<31, 341, (outs G8RC:$rD), (ins memrr:$src),
+ "lwax $rD, $src", LdStLHA,
+ [(set i64:$rD, (sextloadi32 xaddr:$src))]>, isPPC64,
+ PPC970_DGroup_Cracked;
+
+// Update forms.
+let mayLoad = 1 in {
+def LHAU8 : DForm_1<43, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memri:$addr),
+ "lhau $rD, $addr", LdStLHAU,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+// NO LWAU!
+
+def LHAUX8 : XForm_1<31, 375, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lhaux $rD, $addr", LdStLHAU,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+def LWAUX : XForm_1<31, 373, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lwaux $rD, $addr", LdStLHAU,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">, isPPC64;
+}
+}
+
+// Zero extending loads.
+let canFoldAsLoad = 1, PPC970_Unit = 2 in {
+def LBZ8 : DForm_1<34, (outs G8RC:$rD), (ins memri:$src),
+ "lbz $rD, $src", LdStLoad,
+ [(set i64:$rD, (zextloadi8 iaddr:$src))]>;
+def LHZ8 : DForm_1<40, (outs G8RC:$rD), (ins memri:$src),
+ "lhz $rD, $src", LdStLoad,
+ [(set i64:$rD, (zextloadi16 iaddr:$src))]>;
+def LWZ8 : DForm_1<32, (outs G8RC:$rD), (ins memri:$src),
+ "lwz $rD, $src", LdStLoad,
+ [(set i64:$rD, (zextloadi32 iaddr:$src))]>, isPPC64;
+
+def LBZX8 : XForm_1<31, 87, (outs G8RC:$rD), (ins memrr:$src),
+ "lbzx $rD, $src", LdStLoad,
+ [(set i64:$rD, (zextloadi8 xaddr:$src))]>;
+def LHZX8 : XForm_1<31, 279, (outs G8RC:$rD), (ins memrr:$src),
+ "lhzx $rD, $src", LdStLoad,
+ [(set i64:$rD, (zextloadi16 xaddr:$src))]>;
+def LWZX8 : XForm_1<31, 23, (outs G8RC:$rD), (ins memrr:$src),
+ "lwzx $rD, $src", LdStLoad,
+ [(set i64:$rD, (zextloadi32 xaddr:$src))]>;
+
+
+// Update forms.
+let mayLoad = 1 in {
+def LBZU8 : DForm_1<35, (outs G8RC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lbzu $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+def LHZU8 : DForm_1<41, (outs G8RC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lhzu $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+def LWZU8 : DForm_1<33, (outs G8RC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lwzu $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LBZUX8 : XForm_1<31, 119, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lbzux $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+def LHZUX8 : XForm_1<31, 311, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lhzux $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+def LWZUX8 : XForm_1<31, 55, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lwzux $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+}
+}
+
+
+// Full 8-byte loads.
+let canFoldAsLoad = 1, PPC970_Unit = 2 in {
+def LD : DSForm_1<58, 0, (outs G8RC:$rD), (ins memrix:$src),
+ "ld $rD, $src", LdStLD,
+ [(set i64:$rD, (aligned4load ixaddr:$src))]>, isPPC64;
+// The following three definitions are selected for small code model only.
+// Otherwise, we need to create two instructions to form a 32-bit offset,
+// so we have a custom matcher for TOC_ENTRY in PPCDAGToDAGIsel::Select().
+def LDtoc: Pseudo<(outs G8RC:$rD), (ins tocentry:$disp, G8RC:$reg),
+ "#LDtoc",
+ [(set i64:$rD,
+ (PPCtoc_entry tglobaladdr:$disp, i64:$reg))]>, isPPC64;
+def LDtocJTI: Pseudo<(outs G8RC:$rD), (ins tocentry:$disp, G8RC:$reg),
+ "#LDtocJTI",
+ [(set i64:$rD,
+ (PPCtoc_entry tjumptable:$disp, i64:$reg))]>, isPPC64;
+def LDtocCPT: Pseudo<(outs G8RC:$rD), (ins tocentry:$disp, G8RC:$reg),
+ "#LDtocCPT",
+ [(set i64:$rD,
+ (PPCtoc_entry tconstpool:$disp, i64:$reg))]>, isPPC64;
+
+let hasSideEffects = 1, isCodeGenOnly = 1 in {
+let RST = 2, DS = 2 in
+def LDinto_toc: DSForm_1a<58, 0, (outs), (ins G8RC:$reg),
+ "ld 2, 8($reg)", LdStLD,
+ [(PPCload_toc i64:$reg)]>, isPPC64;
+
+let RST = 2, DS = 10, RA = 1 in
+def LDtoc_restore : DSForm_1a<58, 0, (outs), (ins),
+ "ld 2, 40(1)", LdStLD,
+ [(PPCtoc_restore)]>, isPPC64;
+}
+def LDX : XForm_1<31, 21, (outs G8RC:$rD), (ins memrr:$src),
+ "ldx $rD, $src", LdStLD,
+ [(set i64:$rD, (load xaddr:$src))]>, isPPC64;
+def LDBRX : XForm_1<31, 532, (outs G8RC:$rD), (ins memrr:$src),
+ "ldbrx $rD, $src", LdStLoad,
+ [(set i64:$rD, (PPClbrx xoaddr:$src, i64))]>, isPPC64;
+
+let mayLoad = 1 in
+def LDU : DSForm_1<58, 1, (outs G8RC:$rD, ptr_rc_nor0:$ea_result), (ins memrix:$addr),
+ "ldu $rD, $addr", LdStLDU,
+ []>, RegConstraint<"$addr.reg = $ea_result">, isPPC64,
+ NoEncode<"$ea_result">;
+
+def LDUX : XForm_1<31, 53, (outs G8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "ldux $rD, $addr", LdStLDU,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">, isPPC64;
+}
+
+def : Pat<(PPCload ixaddr:$src),
+ (LD ixaddr:$src)>;
+def : Pat<(PPCload xaddr:$src),
+ (LDX xaddr:$src)>;
+
+// Support for medium and large code model.
+def ADDIStocHA: Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, tocentry:$disp),
+ "#ADDIStocHA",
+ [(set i64:$rD,
+ (PPCaddisTocHA i64:$reg, tglobaladdr:$disp))]>,
+ isPPC64;
+def LDtocL: Pseudo<(outs G8RC:$rD), (ins tocentry:$disp, G8RC_NOX0:$reg),
+ "#LDtocL",
+ [(set i64:$rD,
+ (PPCldTocL tglobaladdr:$disp, i64:$reg))]>, isPPC64;
+def ADDItocL: Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, tocentry:$disp),
+ "#ADDItocL",
+ [(set i64:$rD,
+ (PPCaddiTocL i64:$reg, tglobaladdr:$disp))]>, isPPC64;
+
+// Support for thread-local storage.
+def ADDISgotTprelHA: Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolHi64:$disp),
+ "#ADDISgotTprelHA",
+ [(set i64:$rD,
+ (PPCaddisGotTprelHA i64:$reg,
+ tglobaltlsaddr:$disp))]>,
+ isPPC64;
+def LDgotTprelL: Pseudo<(outs G8RC:$rD), (ins symbolLo64:$disp, G8RC_NOX0:$reg),
+ "#LDgotTprelL",
+ [(set i64:$rD,
+ (PPCldGotTprelL tglobaltlsaddr:$disp, i64:$reg))]>,
+ isPPC64;
+def : Pat<(PPCaddTls i64:$in, tglobaltlsaddr:$g),
+ (ADD8TLS $in, tglobaltlsaddr:$g)>;
+def ADDIStlsgdHA: Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolHi64:$disp),
+ "#ADDIStlsgdHA",
+ [(set i64:$rD,
+ (PPCaddisTlsgdHA i64:$reg, tglobaltlsaddr:$disp))]>,
+ isPPC64;
+def ADDItlsgdL : Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolLo64:$disp),
+ "#ADDItlsgdL",
+ [(set i64:$rD,
+ (PPCaddiTlsgdL i64:$reg, tglobaltlsaddr:$disp))]>,
+ isPPC64;
+def GETtlsADDR : Pseudo<(outs G8RC:$rD), (ins G8RC:$reg, tlsgd:$sym),
+ "#GETtlsADDR",
+ [(set i64:$rD,
+ (PPCgetTlsAddr i64:$reg, tglobaltlsaddr:$sym))]>,
+ isPPC64;
+def ADDIStlsldHA: Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolHi64:$disp),
+ "#ADDIStlsldHA",
+ [(set i64:$rD,
+ (PPCaddisTlsldHA i64:$reg, tglobaltlsaddr:$disp))]>,
+ isPPC64;
+def ADDItlsldL : Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolLo64:$disp),
+ "#ADDItlsldL",
+ [(set i64:$rD,
+ (PPCaddiTlsldL i64:$reg, tglobaltlsaddr:$disp))]>,
+ isPPC64;
+def GETtlsldADDR : Pseudo<(outs G8RC:$rD), (ins G8RC:$reg, tlsgd:$sym),
+ "#GETtlsldADDR",
+ [(set i64:$rD,
+ (PPCgetTlsldAddr i64:$reg, tglobaltlsaddr:$sym))]>,
+ isPPC64;
+def ADDISdtprelHA: Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolHi64:$disp),
+ "#ADDISdtprelHA",
+ [(set i64:$rD,
+ (PPCaddisDtprelHA i64:$reg,
+ tglobaltlsaddr:$disp))]>,
+ isPPC64;
+def ADDIdtprelL : Pseudo<(outs G8RC:$rD), (ins G8RC_NOX0:$reg, symbolLo64:$disp),
+ "#ADDIdtprelL",
+ [(set i64:$rD,
+ (PPCaddiDtprelL i64:$reg, tglobaltlsaddr:$disp))]>,
+ isPPC64;
+
+let PPC970_Unit = 2 in {
+// Truncating stores.
+def STB8 : DForm_1<38, (outs), (ins G8RC:$rS, memri:$src),
+ "stb $rS, $src", LdStStore,
+ [(truncstorei8 i64:$rS, iaddr:$src)]>;
+def STH8 : DForm_1<44, (outs), (ins G8RC:$rS, memri:$src),
+ "sth $rS, $src", LdStStore,
+ [(truncstorei16 i64:$rS, iaddr:$src)]>;
+def STW8 : DForm_1<36, (outs), (ins G8RC:$rS, memri:$src),
+ "stw $rS, $src", LdStStore,
+ [(truncstorei32 i64:$rS, iaddr:$src)]>;
+def STBX8 : XForm_8<31, 215, (outs), (ins G8RC:$rS, memrr:$dst),
+ "stbx $rS, $dst", LdStStore,
+ [(truncstorei8 i64:$rS, xaddr:$dst)]>,
+ PPC970_DGroup_Cracked;
+def STHX8 : XForm_8<31, 407, (outs), (ins G8RC:$rS, memrr:$dst),
+ "sthx $rS, $dst", LdStStore,
+ [(truncstorei16 i64:$rS, xaddr:$dst)]>,
+ PPC970_DGroup_Cracked;
+def STWX8 : XForm_8<31, 151, (outs), (ins G8RC:$rS, memrr:$dst),
+ "stwx $rS, $dst", LdStStore,
+ [(truncstorei32 i64:$rS, xaddr:$dst)]>,
+ PPC970_DGroup_Cracked;
+// Normal 8-byte stores.
+def STD : DSForm_1<62, 0, (outs), (ins G8RC:$rS, memrix:$dst),
+ "std $rS, $dst", LdStSTD,
+ [(aligned4store i64:$rS, ixaddr:$dst)]>, isPPC64;
+def STDX : XForm_8<31, 149, (outs), (ins G8RC:$rS, memrr:$dst),
+ "stdx $rS, $dst", LdStSTD,
+ [(store i64:$rS, xaddr:$dst)]>, isPPC64,
+ PPC970_DGroup_Cracked;
+def STDBRX: XForm_8<31, 660, (outs), (ins G8RC:$rS, memrr:$dst),
+ "stdbrx $rS, $dst", LdStStore,
+ [(PPCstbrx i64:$rS, xoaddr:$dst, i64)]>, isPPC64,
+ PPC970_DGroup_Cracked;
+}
+
+// Stores with Update (pre-inc).
+let PPC970_Unit = 2, mayStore = 1 in {
+def STBU8 : DForm_1<39, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memri:$dst),
+ "stbu $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STHU8 : DForm_1<45, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memri:$dst),
+ "sthu $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STWU8 : DForm_1<37, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memri:$dst),
+ "stwu $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STDU : DSForm_1<62, 1, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memrix:$dst),
+ "stdu $rS, $dst", LdStSTDU, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">,
+ isPPC64;
+
+def STBUX8: XForm_8<31, 247, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memrr:$dst),
+ "stbux $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STHUX8: XForm_8<31, 439, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memrr:$dst),
+ "sthux $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STWUX8: XForm_8<31, 183, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memrr:$dst),
+ "stwux $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STDUX : XForm_8<31, 181, (outs ptr_rc_nor0:$ea_res), (ins G8RC:$rS, memrr:$dst),
+ "stdux $rS, $dst", LdStSTDU, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked, isPPC64;
+}
+
+// Patterns to match the pre-inc stores. We can't put the patterns on
+// the instruction definitions directly as ISel wants the address base
+// and offset to be separate operands, not a single complex operand.
+def : Pat<(pre_truncsti8 i64:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STBU8 $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(pre_truncsti16 i64:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STHU8 $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(pre_truncsti32 i64:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STWU8 $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(aligned4pre_store i64:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STDU $rS, iaddroff:$ptroff, $ptrreg)>;
+
+def : Pat<(pre_truncsti8 i64:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STBUX8 $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_truncsti16 i64:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STHUX8 $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_truncsti32 i64:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STWUX8 $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_store i64:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STDUX $rS, $ptrreg, $ptroff)>;
+
+
+//===----------------------------------------------------------------------===//
+// Floating point instructions.
+//
+
+
+let PPC970_Unit = 3, Uses = [RM] in { // FPU Operations.
+def FCFID : XForm_26<63, 846, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fcfid $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfcfid f64:$frB))]>, isPPC64;
+def FCTIDZ : XForm_26<63, 815, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fctidz $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfctidz f64:$frB))]>, isPPC64;
+
+def FCFIDU : XForm_26<63, 974, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fcfidu $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfcfidu f64:$frB))]>, isPPC64;
+def FCFIDS : XForm_26<59, 846, (outs F4RC:$frD), (ins F8RC:$frB),
+ "fcfids $frD, $frB", FPGeneral,
+ [(set f32:$frD, (PPCfcfids f64:$frB))]>, isPPC64;
+def FCFIDUS : XForm_26<59, 974, (outs F4RC:$frD), (ins F8RC:$frB),
+ "fcfidus $frD, $frB", FPGeneral,
+ [(set f32:$frD, (PPCfcfidus f64:$frB))]>, isPPC64;
+def FCTIDUZ : XForm_26<63, 943, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fctiduz $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfctiduz f64:$frB))]>, isPPC64;
+def FCTIWUZ : XForm_26<63, 143, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fctiwuz $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfctiwuz f64:$frB))]>, isPPC64;
+}
+
+
+//===----------------------------------------------------------------------===//
+// Instruction Patterns
+//
+
+// Extensions and truncates to/from 32-bit regs.
+def : Pat<(i64 (zext i32:$in)),
+ (RLDICL (INSERT_SUBREG (i64 (IMPLICIT_DEF)), $in, sub_32),
+ 0, 32)>;
+def : Pat<(i64 (anyext i32:$in)),
+ (INSERT_SUBREG (i64 (IMPLICIT_DEF)), $in, sub_32)>;
+def : Pat<(i32 (trunc i64:$in)),
+ (EXTRACT_SUBREG $in, sub_32)>;
+
+// Extending loads with i64 targets.
+def : Pat<(zextloadi1 iaddr:$src),
+ (LBZ8 iaddr:$src)>;
+def : Pat<(zextloadi1 xaddr:$src),
+ (LBZX8 xaddr:$src)>;
+def : Pat<(extloadi1 iaddr:$src),
+ (LBZ8 iaddr:$src)>;
+def : Pat<(extloadi1 xaddr:$src),
+ (LBZX8 xaddr:$src)>;
+def : Pat<(extloadi8 iaddr:$src),
+ (LBZ8 iaddr:$src)>;
+def : Pat<(extloadi8 xaddr:$src),
+ (LBZX8 xaddr:$src)>;
+def : Pat<(extloadi16 iaddr:$src),
+ (LHZ8 iaddr:$src)>;
+def : Pat<(extloadi16 xaddr:$src),
+ (LHZX8 xaddr:$src)>;
+def : Pat<(extloadi32 iaddr:$src),
+ (LWZ8 iaddr:$src)>;
+def : Pat<(extloadi32 xaddr:$src),
+ (LWZX8 xaddr:$src)>;
+
+// Standard shifts. These are represented separately from the real shifts above
+// so that we can distinguish between shifts that allow 6-bit and 7-bit shift
+// amounts.
+def : Pat<(sra i64:$rS, i32:$rB),
+ (SRAD $rS, $rB)>;
+def : Pat<(srl i64:$rS, i32:$rB),
+ (SRD $rS, $rB)>;
+def : Pat<(shl i64:$rS, i32:$rB),
+ (SLD $rS, $rB)>;
+
+// SHL/SRL
+def : Pat<(shl i64:$in, (i32 imm:$imm)),
+ (RLDICR $in, imm:$imm, (SHL64 imm:$imm))>;
+def : Pat<(srl i64:$in, (i32 imm:$imm)),
+ (RLDICL $in, (SRL64 imm:$imm), imm:$imm)>;
+
+// ROTL
+def : Pat<(rotl i64:$in, i32:$sh),
+ (RLDCL $in, $sh, 0)>;
+def : Pat<(rotl i64:$in, (i32 imm:$imm)),
+ (RLDICL $in, imm:$imm, 0)>;
+
+// Hi and Lo for Darwin Global Addresses.
+def : Pat<(PPChi tglobaladdr:$in, 0), (LIS8 tglobaladdr:$in)>;
+def : Pat<(PPClo tglobaladdr:$in, 0), (LI8 tglobaladdr:$in)>;
+def : Pat<(PPChi tconstpool:$in , 0), (LIS8 tconstpool:$in)>;
+def : Pat<(PPClo tconstpool:$in , 0), (LI8 tconstpool:$in)>;
+def : Pat<(PPChi tjumptable:$in , 0), (LIS8 tjumptable:$in)>;
+def : Pat<(PPClo tjumptable:$in , 0), (LI8 tjumptable:$in)>;
+def : Pat<(PPChi tblockaddress:$in, 0), (LIS8 tblockaddress:$in)>;
+def : Pat<(PPClo tblockaddress:$in, 0), (LI8 tblockaddress:$in)>;
+def : Pat<(PPChi tglobaltlsaddr:$g, i64:$in),
+ (ADDIS8 $in, tglobaltlsaddr:$g)>;
+def : Pat<(PPClo tglobaltlsaddr:$g, i64:$in),
+ (ADDI8 $in, tglobaltlsaddr:$g)>;
+def : Pat<(add i64:$in, (PPChi tglobaladdr:$g, 0)),
+ (ADDIS8 $in, tglobaladdr:$g)>;
+def : Pat<(add i64:$in, (PPChi tconstpool:$g, 0)),
+ (ADDIS8 $in, tconstpool:$g)>;
+def : Pat<(add i64:$in, (PPChi tjumptable:$g, 0)),
+ (ADDIS8 $in, tjumptable:$g)>;
+def : Pat<(add i64:$in, (PPChi tblockaddress:$g, 0)),
+ (ADDIS8 $in, tblockaddress:$g)>;
+
+// Patterns to match r+r indexed loads and stores for
+// addresses without at least 4-byte alignment.
+def : Pat<(i64 (unaligned4sextloadi32 xoaddr:$src)),
+ (LWAX xoaddr:$src)>;
+def : Pat<(i64 (unaligned4load xoaddr:$src)),
+ (LDX xoaddr:$src)>;
+def : Pat<(unaligned4store i64:$rS, xoaddr:$dst),
+ (STDX $rS, xoaddr:$dst)>;
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstrAltivec.td b/contrib/llvm/lib/Target/PowerPC/PPCInstrAltivec.td
new file mode 100644
index 0000000..a5ba4c8
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstrAltivec.td
@@ -0,0 +1,828 @@
+//===-- PPCInstrAltivec.td - The PowerPC Altivec Extension -*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file describes the Altivec extension to the PowerPC instruction set.
+//
+//===----------------------------------------------------------------------===//
+
+//===----------------------------------------------------------------------===//
+// Altivec transformation functions and pattern fragments.
+//
+
+// Since we canonicalize buildvectors to v16i8, all vnots "-1" operands will be
+// of that type.
+def vnot_ppc : PatFrag<(ops node:$in),
+ (xor node:$in, (bitconvert (v16i8 immAllOnesV)))>;
+
+def vpkuhum_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVPKUHUMShuffleMask(cast<ShuffleVectorSDNode>(N), false);
+}]>;
+def vpkuwum_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVPKUWUMShuffleMask(cast<ShuffleVectorSDNode>(N), false);
+}]>;
+def vpkuhum_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVPKUHUMShuffleMask(cast<ShuffleVectorSDNode>(N), true);
+}]>;
+def vpkuwum_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVPKUWUMShuffleMask(cast<ShuffleVectorSDNode>(N), true);
+}]>;
+
+
+def vmrglb_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGLShuffleMask(cast<ShuffleVectorSDNode>(N), 1, false);
+}]>;
+def vmrglh_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGLShuffleMask(cast<ShuffleVectorSDNode>(N), 2, false);
+}]>;
+def vmrglw_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGLShuffleMask(cast<ShuffleVectorSDNode>(N), 4, false);
+}]>;
+def vmrghb_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGHShuffleMask(cast<ShuffleVectorSDNode>(N), 1, false);
+}]>;
+def vmrghh_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGHShuffleMask(cast<ShuffleVectorSDNode>(N), 2, false);
+}]>;
+def vmrghw_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGHShuffleMask(cast<ShuffleVectorSDNode>(N), 4, false);
+}]>;
+
+
+def vmrglb_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle (v16i8 node:$lhs), node:$rhs), [{
+ return PPC::isVMRGLShuffleMask(cast<ShuffleVectorSDNode>(N), 1, true);
+}]>;
+def vmrglh_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVMRGLShuffleMask(cast<ShuffleVectorSDNode>(N), 2, true);
+}]>;
+def vmrglw_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVMRGLShuffleMask(cast<ShuffleVectorSDNode>(N), 4, true);
+}]>;
+def vmrghb_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVMRGHShuffleMask(cast<ShuffleVectorSDNode>(N), 1, true);
+}]>;
+def vmrghh_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVMRGHShuffleMask(cast<ShuffleVectorSDNode>(N), 2, true);
+}]>;
+def vmrghw_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVMRGHShuffleMask(cast<ShuffleVectorSDNode>(N), 4, true);
+}]>;
+
+
+def VSLDOI_get_imm : SDNodeXForm<vector_shuffle, [{
+ return getI32Imm(PPC::isVSLDOIShuffleMask(N, false));
+}]>;
+def vsldoi_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVSLDOIShuffleMask(N, false) != -1;
+}], VSLDOI_get_imm>;
+
+
+/// VSLDOI_unary* - These are used to match vsldoi(X,X), which is turned into
+/// vector_shuffle(X,undef,mask) by the dag combiner.
+def VSLDOI_unary_get_imm : SDNodeXForm<vector_shuffle, [{
+ return getI32Imm(PPC::isVSLDOIShuffleMask(N, true));
+}]>;
+def vsldoi_unary_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isVSLDOIShuffleMask(N, true) != -1;
+}], VSLDOI_unary_get_imm>;
+
+
+// VSPLT*_get_imm xform function: convert vector_shuffle mask to VSPLT* imm.
+def VSPLTB_get_imm : SDNodeXForm<vector_shuffle, [{
+ return getI32Imm(PPC::getVSPLTImmediate(N, 1));
+}]>;
+def vspltb_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isSplatShuffleMask(cast<ShuffleVectorSDNode>(N), 1);
+}], VSPLTB_get_imm>;
+def VSPLTH_get_imm : SDNodeXForm<vector_shuffle, [{
+ return getI32Imm(PPC::getVSPLTImmediate(N, 2));
+}]>;
+def vsplth_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isSplatShuffleMask(cast<ShuffleVectorSDNode>(N), 2);
+}], VSPLTH_get_imm>;
+def VSPLTW_get_imm : SDNodeXForm<vector_shuffle, [{
+ return getI32Imm(PPC::getVSPLTImmediate(N, 4));
+}]>;
+def vspltw_shuffle : PatFrag<(ops node:$lhs, node:$rhs),
+ (vector_shuffle node:$lhs, node:$rhs), [{
+ return PPC::isSplatShuffleMask(cast<ShuffleVectorSDNode>(N), 4);
+}], VSPLTW_get_imm>;
+
+
+// VSPLTISB_get_imm xform function: convert build_vector to VSPLTISB imm.
+def VSPLTISB_get_imm : SDNodeXForm<build_vector, [{
+ return PPC::get_VSPLTI_elt(N, 1, *CurDAG);
+}]>;
+def vecspltisb : PatLeaf<(build_vector), [{
+ return PPC::get_VSPLTI_elt(N, 1, *CurDAG).getNode() != 0;
+}], VSPLTISB_get_imm>;
+
+// VSPLTISH_get_imm xform function: convert build_vector to VSPLTISH imm.
+def VSPLTISH_get_imm : SDNodeXForm<build_vector, [{
+ return PPC::get_VSPLTI_elt(N, 2, *CurDAG);
+}]>;
+def vecspltish : PatLeaf<(build_vector), [{
+ return PPC::get_VSPLTI_elt(N, 2, *CurDAG).getNode() != 0;
+}], VSPLTISH_get_imm>;
+
+// VSPLTISW_get_imm xform function: convert build_vector to VSPLTISW imm.
+def VSPLTISW_get_imm : SDNodeXForm<build_vector, [{
+ return PPC::get_VSPLTI_elt(N, 4, *CurDAG);
+}]>;
+def vecspltisw : PatLeaf<(build_vector), [{
+ return PPC::get_VSPLTI_elt(N, 4, *CurDAG).getNode() != 0;
+}], VSPLTISW_get_imm>;
+
+//===----------------------------------------------------------------------===//
+// Helpers for defining instructions that directly correspond to intrinsics.
+
+// VA1a_Int_Ty - A VAForm_1a intrinsic definition of specific type.
+class VA1a_Int_Ty<bits<6> xo, string opc, Intrinsic IntID, ValueType Ty>
+ : VAForm_1a<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB, VRRC:$vC),
+ !strconcat(opc, " $vD, $vA, $vB, $vC"), VecFP,
+ [(set Ty:$vD, (IntID Ty:$vA, Ty:$vB, Ty:$vC))]>;
+
+// VA1a_Int_Ty2 - A VAForm_1a intrinsic definition where the type of the
+// inputs doesn't match the type of the output.
+class VA1a_Int_Ty2<bits<6> xo, string opc, Intrinsic IntID, ValueType OutTy,
+ ValueType InTy>
+ : VAForm_1a<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB, VRRC:$vC),
+ !strconcat(opc, " $vD, $vA, $vB, $vC"), VecFP,
+ [(set OutTy:$vD, (IntID InTy:$vA, InTy:$vB, InTy:$vC))]>;
+
+// VA1a_Int_Ty3 - A VAForm_1a intrinsic definition where there are two
+// input types and an output type.
+class VA1a_Int_Ty3<bits<6> xo, string opc, Intrinsic IntID, ValueType OutTy,
+ ValueType In1Ty, ValueType In2Ty>
+ : VAForm_1a<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB, VRRC:$vC),
+ !strconcat(opc, " $vD, $vA, $vB, $vC"), VecFP,
+ [(set OutTy:$vD,
+ (IntID In1Ty:$vA, In1Ty:$vB, In2Ty:$vC))]>;
+
+// VX1_Int_Ty - A VXForm_1 intrinsic definition of specific type.
+class VX1_Int_Ty<bits<11> xo, string opc, Intrinsic IntID, ValueType Ty>
+ : VXForm_1<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ !strconcat(opc, " $vD, $vA, $vB"), VecFP,
+ [(set Ty:$vD, (IntID Ty:$vA, Ty:$vB))]>;
+
+// VX1_Int_Ty2 - A VXForm_1 intrinsic definition where the type of the
+// inputs doesn't match the type of the output.
+class VX1_Int_Ty2<bits<11> xo, string opc, Intrinsic IntID, ValueType OutTy,
+ ValueType InTy>
+ : VXForm_1<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ !strconcat(opc, " $vD, $vA, $vB"), VecFP,
+ [(set OutTy:$vD, (IntID InTy:$vA, InTy:$vB))]>;
+
+// VX1_Int_Ty3 - A VXForm_1 intrinsic definition where there are two
+// input types and an output type.
+class VX1_Int_Ty3<bits<11> xo, string opc, Intrinsic IntID, ValueType OutTy,
+ ValueType In1Ty, ValueType In2Ty>
+ : VXForm_1<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ !strconcat(opc, " $vD, $vA, $vB"), VecFP,
+ [(set OutTy:$vD, (IntID In1Ty:$vA, In2Ty:$vB))]>;
+
+// VX2_Int_SP - A VXForm_2 intrinsic definition of vector single-precision type.
+class VX2_Int_SP<bits<11> xo, string opc, Intrinsic IntID>
+ : VXForm_2<xo, (outs VRRC:$vD), (ins VRRC:$vB),
+ !strconcat(opc, " $vD, $vB"), VecFP,
+ [(set v4f32:$vD, (IntID v4f32:$vB))]>;
+
+// VX2_Int_Ty2 - A VXForm_2 intrinsic definition where the type of the
+// inputs doesn't match the type of the output.
+class VX2_Int_Ty2<bits<11> xo, string opc, Intrinsic IntID, ValueType OutTy,
+ ValueType InTy>
+ : VXForm_2<xo, (outs VRRC:$vD), (ins VRRC:$vB),
+ !strconcat(opc, " $vD, $vB"), VecFP,
+ [(set OutTy:$vD, (IntID InTy:$vB))]>;
+
+//===----------------------------------------------------------------------===//
+// Instruction Definitions.
+
+def HasAltivec : Predicate<"PPCSubTarget.hasAltivec()">;
+let Predicates = [HasAltivec] in {
+
+let isCodeGenOnly = 1 in {
+def DSS : DSS_Form<822, (outs),
+ (ins u5imm:$ZERO0, u5imm:$STRM,u5imm:$ZERO1,u5imm:$ZERO2),
+ "dss $STRM", LdStLoad /*FIXME*/, []>;
+def DSSALL : DSS_Form<822, (outs),
+ (ins u5imm:$ONE, u5imm:$ZERO0,u5imm:$ZERO1,u5imm:$ZERO2),
+ "dssall", LdStLoad /*FIXME*/, []>;
+def DST : DSS_Form<342, (outs),
+ (ins u5imm:$ZERO, u5imm:$STRM, GPRC:$rA, GPRC:$rB),
+ "dst $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+def DSTT : DSS_Form<342, (outs),
+ (ins u5imm:$ONE, u5imm:$STRM, GPRC:$rA, GPRC:$rB),
+ "dstt $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+def DSTST : DSS_Form<374, (outs),
+ (ins u5imm:$ZERO, u5imm:$STRM, GPRC:$rA, GPRC:$rB),
+ "dstst $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+def DSTSTT : DSS_Form<374, (outs),
+ (ins u5imm:$ONE, u5imm:$STRM, GPRC:$rA, GPRC:$rB),
+ "dststt $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+
+def DST64 : DSS_Form<342, (outs),
+ (ins u5imm:$ZERO, u5imm:$STRM, G8RC:$rA, GPRC:$rB),
+ "dst $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+def DSTT64 : DSS_Form<342, (outs),
+ (ins u5imm:$ONE, u5imm:$STRM, G8RC:$rA, GPRC:$rB),
+ "dstt $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+def DSTST64 : DSS_Form<374, (outs),
+ (ins u5imm:$ZERO, u5imm:$STRM, G8RC:$rA, GPRC:$rB),
+ "dstst $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+def DSTSTT64 : DSS_Form<374, (outs),
+ (ins u5imm:$ONE, u5imm:$STRM, G8RC:$rA, GPRC:$rB),
+ "dststt $rA, $rB, $STRM", LdStLoad /*FIXME*/, []>;
+}
+
+def MFVSCR : VXForm_4<1540, (outs VRRC:$vD), (ins),
+ "mfvscr $vD", LdStStore,
+ [(set v8i16:$vD, (int_ppc_altivec_mfvscr))]>;
+def MTVSCR : VXForm_5<1604, (outs), (ins VRRC:$vB),
+ "mtvscr $vB", LdStLoad,
+ [(int_ppc_altivec_mtvscr v4i32:$vB)]>;
+
+let canFoldAsLoad = 1, PPC970_Unit = 2 in { // Loads.
+def LVEBX: XForm_1<31, 7, (outs VRRC:$vD), (ins memrr:$src),
+ "lvebx $vD, $src", LdStLoad,
+ [(set v16i8:$vD, (int_ppc_altivec_lvebx xoaddr:$src))]>;
+def LVEHX: XForm_1<31, 39, (outs VRRC:$vD), (ins memrr:$src),
+ "lvehx $vD, $src", LdStLoad,
+ [(set v8i16:$vD, (int_ppc_altivec_lvehx xoaddr:$src))]>;
+def LVEWX: XForm_1<31, 71, (outs VRRC:$vD), (ins memrr:$src),
+ "lvewx $vD, $src", LdStLoad,
+ [(set v4i32:$vD, (int_ppc_altivec_lvewx xoaddr:$src))]>;
+def LVX : XForm_1<31, 103, (outs VRRC:$vD), (ins memrr:$src),
+ "lvx $vD, $src", LdStLoad,
+ [(set v4i32:$vD, (int_ppc_altivec_lvx xoaddr:$src))]>;
+def LVXL : XForm_1<31, 359, (outs VRRC:$vD), (ins memrr:$src),
+ "lvxl $vD, $src", LdStLoad,
+ [(set v4i32:$vD, (int_ppc_altivec_lvxl xoaddr:$src))]>;
+}
+
+def LVSL : XForm_1<31, 6, (outs VRRC:$vD), (ins memrr:$src),
+ "lvsl $vD, $src", LdStLoad,
+ [(set v16i8:$vD, (int_ppc_altivec_lvsl xoaddr:$src))]>,
+ PPC970_Unit_LSU;
+def LVSR : XForm_1<31, 38, (outs VRRC:$vD), (ins memrr:$src),
+ "lvsr $vD, $src", LdStLoad,
+ [(set v16i8:$vD, (int_ppc_altivec_lvsr xoaddr:$src))]>,
+ PPC970_Unit_LSU;
+
+let PPC970_Unit = 2 in { // Stores.
+def STVEBX: XForm_8<31, 135, (outs), (ins VRRC:$rS, memrr:$dst),
+ "stvebx $rS, $dst", LdStStore,
+ [(int_ppc_altivec_stvebx v16i8:$rS, xoaddr:$dst)]>;
+def STVEHX: XForm_8<31, 167, (outs), (ins VRRC:$rS, memrr:$dst),
+ "stvehx $rS, $dst", LdStStore,
+ [(int_ppc_altivec_stvehx v8i16:$rS, xoaddr:$dst)]>;
+def STVEWX: XForm_8<31, 199, (outs), (ins VRRC:$rS, memrr:$dst),
+ "stvewx $rS, $dst", LdStStore,
+ [(int_ppc_altivec_stvewx v4i32:$rS, xoaddr:$dst)]>;
+def STVX : XForm_8<31, 231, (outs), (ins VRRC:$rS, memrr:$dst),
+ "stvx $rS, $dst", LdStStore,
+ [(int_ppc_altivec_stvx v4i32:$rS, xoaddr:$dst)]>;
+def STVXL : XForm_8<31, 487, (outs), (ins VRRC:$rS, memrr:$dst),
+ "stvxl $rS, $dst", LdStStore,
+ [(int_ppc_altivec_stvxl v4i32:$rS, xoaddr:$dst)]>;
+}
+
+let PPC970_Unit = 5 in { // VALU Operations.
+// VA-Form instructions. 3-input AltiVec ops.
+def VMADDFP : VAForm_1<46, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vC, VRRC:$vB),
+ "vmaddfp $vD, $vA, $vC, $vB", VecFP,
+ [(set v4f32:$vD,
+ (fma v4f32:$vA, v4f32:$vC, v4f32:$vB))]>;
+
+// FIXME: The fma+fneg pattern won't match because fneg is not legal.
+def VNMSUBFP: VAForm_1<47, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vC, VRRC:$vB),
+ "vnmsubfp $vD, $vA, $vC, $vB", VecFP,
+ [(set v4f32:$vD, (fneg (fma v4f32:$vA, v4f32:$vC,
+ (fneg v4f32:$vB))))]>;
+
+def VMHADDSHS : VA1a_Int_Ty<32, "vmhaddshs", int_ppc_altivec_vmhaddshs, v8i16>;
+def VMHRADDSHS : VA1a_Int_Ty<33, "vmhraddshs", int_ppc_altivec_vmhraddshs,
+ v8i16>;
+def VMLADDUHM : VA1a_Int_Ty<34, "vmladduhm", int_ppc_altivec_vmladduhm, v8i16>;
+
+def VPERM : VA1a_Int_Ty3<43, "vperm", int_ppc_altivec_vperm,
+ v4i32, v4i32, v16i8>;
+def VSEL : VA1a_Int_Ty<42, "vsel", int_ppc_altivec_vsel, v4i32>;
+
+// Shuffles.
+def VSLDOI : VAForm_2<44, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB, u5imm:$SH),
+ "vsldoi $vD, $vA, $vB, $SH", VecFP,
+ [(set v16i8:$vD,
+ (vsldoi_shuffle:$SH v16i8:$vA, v16i8:$vB))]>;
+
+// VX-Form instructions. AltiVec arithmetic ops.
+def VADDFP : VXForm_1<10, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vaddfp $vD, $vA, $vB", VecFP,
+ [(set v4f32:$vD, (fadd v4f32:$vA, v4f32:$vB))]>;
+
+def VADDUBM : VXForm_1<0, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vaddubm $vD, $vA, $vB", VecGeneral,
+ [(set v16i8:$vD, (add v16i8:$vA, v16i8:$vB))]>;
+def VADDUHM : VXForm_1<64, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vadduhm $vD, $vA, $vB", VecGeneral,
+ [(set v8i16:$vD, (add v8i16:$vA, v8i16:$vB))]>;
+def VADDUWM : VXForm_1<128, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vadduwm $vD, $vA, $vB", VecGeneral,
+ [(set v4i32:$vD, (add v4i32:$vA, v4i32:$vB))]>;
+
+def VADDCUW : VX1_Int_Ty<384, "vaddcuw", int_ppc_altivec_vaddcuw, v4i32>;
+def VADDSBS : VX1_Int_Ty<768, "vaddsbs", int_ppc_altivec_vaddsbs, v16i8>;
+def VADDSHS : VX1_Int_Ty<832, "vaddshs", int_ppc_altivec_vaddshs, v8i16>;
+def VADDSWS : VX1_Int_Ty<896, "vaddsws", int_ppc_altivec_vaddsws, v4i32>;
+def VADDUBS : VX1_Int_Ty<512, "vaddubs", int_ppc_altivec_vaddubs, v16i8>;
+def VADDUHS : VX1_Int_Ty<576, "vadduhs", int_ppc_altivec_vadduhs, v8i16>;
+def VADDUWS : VX1_Int_Ty<640, "vadduws", int_ppc_altivec_vadduws, v4i32>;
+
+
+def VAND : VXForm_1<1028, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vand $vD, $vA, $vB", VecFP,
+ [(set v4i32:$vD, (and v4i32:$vA, v4i32:$vB))]>;
+def VANDC : VXForm_1<1092, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vandc $vD, $vA, $vB", VecFP,
+ [(set v4i32:$vD, (and v4i32:$vA,
+ (vnot_ppc v4i32:$vB)))]>;
+
+def VCFSX : VXForm_1<842, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vcfsx $vD, $vB, $UIMM", VecFP,
+ [(set v4f32:$vD,
+ (int_ppc_altivec_vcfsx v4i32:$vB, imm:$UIMM))]>;
+def VCFUX : VXForm_1<778, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vcfux $vD, $vB, $UIMM", VecFP,
+ [(set v4f32:$vD,
+ (int_ppc_altivec_vcfux v4i32:$vB, imm:$UIMM))]>;
+def VCTSXS : VXForm_1<970, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vctsxs $vD, $vB, $UIMM", VecFP,
+ [(set v4i32:$vD,
+ (int_ppc_altivec_vctsxs v4f32:$vB, imm:$UIMM))]>;
+def VCTUXS : VXForm_1<906, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vctuxs $vD, $vB, $UIMM", VecFP,
+ [(set v4i32:$vD,
+ (int_ppc_altivec_vctuxs v4f32:$vB, imm:$UIMM))]>;
+
+// Defines with the UIM field set to 0 for floating-point
+// to integer (fp_to_sint/fp_to_uint) conversions and integer
+// to floating-point (sint_to_fp/uint_to_fp) conversions.
+let VA = 0 in {
+def VCFSX_0 : VXForm_1<842, (outs VRRC:$vD), (ins VRRC:$vB),
+ "vcfsx $vD, $vB, 0", VecFP,
+ [(set v4f32:$vD,
+ (int_ppc_altivec_vcfsx v4i32:$vB, 0))]>;
+def VCTUXS_0 : VXForm_1<906, (outs VRRC:$vD), (ins VRRC:$vB),
+ "vctuxs $vD, $vB, 0", VecFP,
+ [(set v4i32:$vD,
+ (int_ppc_altivec_vctuxs v4f32:$vB, 0))]>;
+def VCFUX_0 : VXForm_1<778, (outs VRRC:$vD), (ins VRRC:$vB),
+ "vcfux $vD, $vB, 0", VecFP,
+ [(set v4f32:$vD,
+ (int_ppc_altivec_vcfux v4i32:$vB, 0))]>;
+def VCTSXS_0 : VXForm_1<970, (outs VRRC:$vD), (ins VRRC:$vB),
+ "vctsxs $vD, $vB, 0", VecFP,
+ [(set v4i32:$vD,
+ (int_ppc_altivec_vctsxs v4f32:$vB, 0))]>;
+}
+def VEXPTEFP : VX2_Int_SP<394, "vexptefp", int_ppc_altivec_vexptefp>;
+def VLOGEFP : VX2_Int_SP<458, "vlogefp", int_ppc_altivec_vlogefp>;
+
+def VAVGSB : VX1_Int_Ty<1282, "vavgsb", int_ppc_altivec_vavgsb, v16i8>;
+def VAVGSH : VX1_Int_Ty<1346, "vavgsh", int_ppc_altivec_vavgsh, v8i16>;
+def VAVGSW : VX1_Int_Ty<1410, "vavgsw", int_ppc_altivec_vavgsw, v4i32>;
+def VAVGUB : VX1_Int_Ty<1026, "vavgub", int_ppc_altivec_vavgub, v16i8>;
+def VAVGUH : VX1_Int_Ty<1090, "vavguh", int_ppc_altivec_vavguh, v8i16>;
+def VAVGUW : VX1_Int_Ty<1154, "vavguw", int_ppc_altivec_vavguw, v4i32>;
+
+def VMAXFP : VX1_Int_Ty<1034, "vmaxfp", int_ppc_altivec_vmaxfp, v4f32>;
+def VMAXSB : VX1_Int_Ty< 258, "vmaxsb", int_ppc_altivec_vmaxsb, v16i8>;
+def VMAXSH : VX1_Int_Ty< 322, "vmaxsh", int_ppc_altivec_vmaxsh, v8i16>;
+def VMAXSW : VX1_Int_Ty< 386, "vmaxsw", int_ppc_altivec_vmaxsw, v4i32>;
+def VMAXUB : VX1_Int_Ty< 2, "vmaxub", int_ppc_altivec_vmaxub, v16i8>;
+def VMAXUH : VX1_Int_Ty< 66, "vmaxuh", int_ppc_altivec_vmaxuh, v8i16>;
+def VMAXUW : VX1_Int_Ty< 130, "vmaxuw", int_ppc_altivec_vmaxuw, v4i32>;
+def VMINFP : VX1_Int_Ty<1098, "vminfp", int_ppc_altivec_vminfp, v4f32>;
+def VMINSB : VX1_Int_Ty< 770, "vminsb", int_ppc_altivec_vminsb, v16i8>;
+def VMINSH : VX1_Int_Ty< 834, "vminsh", int_ppc_altivec_vminsh, v8i16>;
+def VMINSW : VX1_Int_Ty< 898, "vminsw", int_ppc_altivec_vminsw, v4i32>;
+def VMINUB : VX1_Int_Ty< 514, "vminub", int_ppc_altivec_vminub, v16i8>;
+def VMINUH : VX1_Int_Ty< 578, "vminuh", int_ppc_altivec_vminuh, v8i16>;
+def VMINUW : VX1_Int_Ty< 642, "vminuw", int_ppc_altivec_vminuw, v4i32>;
+
+def VMRGHB : VXForm_1< 12, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vmrghb $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD, (vmrghb_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VMRGHH : VXForm_1< 76, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vmrghh $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD, (vmrghh_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VMRGHW : VXForm_1<140, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vmrghw $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD, (vmrghw_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VMRGLB : VXForm_1<268, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vmrglb $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD, (vmrglb_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VMRGLH : VXForm_1<332, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vmrglh $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD, (vmrglh_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VMRGLW : VXForm_1<396, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vmrglw $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD, (vmrglw_shuffle v16i8:$vA, v16i8:$vB))]>;
+
+def VMSUMMBM : VA1a_Int_Ty3<37, "vmsummbm", int_ppc_altivec_vmsummbm,
+ v4i32, v16i8, v4i32>;
+def VMSUMSHM : VA1a_Int_Ty3<40, "vmsumshm", int_ppc_altivec_vmsumshm,
+ v4i32, v8i16, v4i32>;
+def VMSUMSHS : VA1a_Int_Ty3<41, "vmsumshs", int_ppc_altivec_vmsumshs,
+ v4i32, v8i16, v4i32>;
+def VMSUMUBM : VA1a_Int_Ty3<36, "vmsumubm", int_ppc_altivec_vmsumubm,
+ v4i32, v16i8, v4i32>;
+def VMSUMUHM : VA1a_Int_Ty3<38, "vmsumuhm", int_ppc_altivec_vmsumuhm,
+ v4i32, v8i16, v4i32>;
+def VMSUMUHS : VA1a_Int_Ty3<39, "vmsumuhs", int_ppc_altivec_vmsumuhs,
+ v4i32, v8i16, v4i32>;
+
+def VMULESB : VX1_Int_Ty2<776, "vmulesb", int_ppc_altivec_vmulesb,
+ v8i16, v16i8>;
+def VMULESH : VX1_Int_Ty2<840, "vmulesh", int_ppc_altivec_vmulesh,
+ v4i32, v8i16>;
+def VMULEUB : VX1_Int_Ty2<520, "vmuleub", int_ppc_altivec_vmuleub,
+ v8i16, v16i8>;
+def VMULEUH : VX1_Int_Ty2<584, "vmuleuh", int_ppc_altivec_vmuleuh,
+ v4i32, v8i16>;
+def VMULOSB : VX1_Int_Ty2<264, "vmulosb", int_ppc_altivec_vmulosb,
+ v8i16, v16i8>;
+def VMULOSH : VX1_Int_Ty2<328, "vmulosh", int_ppc_altivec_vmulosh,
+ v4i32, v8i16>;
+def VMULOUB : VX1_Int_Ty2< 8, "vmuloub", int_ppc_altivec_vmuloub,
+ v8i16, v16i8>;
+def VMULOUH : VX1_Int_Ty2< 72, "vmulouh", int_ppc_altivec_vmulouh,
+ v4i32, v8i16>;
+
+def VREFP : VX2_Int_SP<266, "vrefp", int_ppc_altivec_vrefp>;
+def VRFIM : VX2_Int_SP<714, "vrfim", int_ppc_altivec_vrfim>;
+def VRFIN : VX2_Int_SP<522, "vrfin", int_ppc_altivec_vrfin>;
+def VRFIP : VX2_Int_SP<650, "vrfip", int_ppc_altivec_vrfip>;
+def VRFIZ : VX2_Int_SP<586, "vrfiz", int_ppc_altivec_vrfiz>;
+def VRSQRTEFP : VX2_Int_SP<330, "vrsqrtefp", int_ppc_altivec_vrsqrtefp>;
+
+def VSUBCUW : VX1_Int_Ty<74, "vsubcuw", int_ppc_altivec_vsubcuw, v4i32>;
+
+def VSUBFP : VXForm_1<74, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vsubfp $vD, $vA, $vB", VecGeneral,
+ [(set v4f32:$vD, (fsub v4f32:$vA, v4f32:$vB))]>;
+def VSUBUBM : VXForm_1<1024, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vsububm $vD, $vA, $vB", VecGeneral,
+ [(set v16i8:$vD, (sub v16i8:$vA, v16i8:$vB))]>;
+def VSUBUHM : VXForm_1<1088, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vsubuhm $vD, $vA, $vB", VecGeneral,
+ [(set v8i16:$vD, (sub v8i16:$vA, v8i16:$vB))]>;
+def VSUBUWM : VXForm_1<1152, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vsubuwm $vD, $vA, $vB", VecGeneral,
+ [(set v4i32:$vD, (sub v4i32:$vA, v4i32:$vB))]>;
+
+def VSUBSBS : VX1_Int_Ty<1792, "vsubsbs" , int_ppc_altivec_vsubsbs, v16i8>;
+def VSUBSHS : VX1_Int_Ty<1856, "vsubshs" , int_ppc_altivec_vsubshs, v8i16>;
+def VSUBSWS : VX1_Int_Ty<1920, "vsubsws" , int_ppc_altivec_vsubsws, v4i32>;
+def VSUBUBS : VX1_Int_Ty<1536, "vsububs" , int_ppc_altivec_vsububs, v16i8>;
+def VSUBUHS : VX1_Int_Ty<1600, "vsubuhs" , int_ppc_altivec_vsubuhs, v8i16>;
+def VSUBUWS : VX1_Int_Ty<1664, "vsubuws" , int_ppc_altivec_vsubuws, v4i32>;
+
+def VSUMSWS : VX1_Int_Ty<1928, "vsumsws" , int_ppc_altivec_vsumsws, v4i32>;
+def VSUM2SWS: VX1_Int_Ty<1672, "vsum2sws", int_ppc_altivec_vsum2sws, v4i32>;
+
+def VSUM4SBS: VX1_Int_Ty3<1672, "vsum4sbs", int_ppc_altivec_vsum4sbs,
+ v4i32, v16i8, v4i32>;
+def VSUM4SHS: VX1_Int_Ty3<1608, "vsum4shs", int_ppc_altivec_vsum4shs,
+ v4i32, v8i16, v4i32>;
+def VSUM4UBS: VX1_Int_Ty3<1544, "vsum4ubs", int_ppc_altivec_vsum4ubs,
+ v4i32, v16i8, v4i32>;
+
+def VNOR : VXForm_1<1284, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vnor $vD, $vA, $vB", VecFP,
+ [(set v4i32:$vD, (vnot_ppc (or v4i32:$vA,
+ v4i32:$vB)))]>;
+def VOR : VXForm_1<1156, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vor $vD, $vA, $vB", VecFP,
+ [(set v4i32:$vD, (or v4i32:$vA, v4i32:$vB))]>;
+def VXOR : VXForm_1<1220, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vxor $vD, $vA, $vB", VecFP,
+ [(set v4i32:$vD, (xor v4i32:$vA, v4i32:$vB))]>;
+
+def VRLB : VX1_Int_Ty< 4, "vrlb", int_ppc_altivec_vrlb, v16i8>;
+def VRLH : VX1_Int_Ty< 68, "vrlh", int_ppc_altivec_vrlh, v8i16>;
+def VRLW : VX1_Int_Ty< 132, "vrlw", int_ppc_altivec_vrlw, v4i32>;
+
+def VSL : VX1_Int_Ty< 452, "vsl" , int_ppc_altivec_vsl, v4i32 >;
+def VSLO : VX1_Int_Ty<1036, "vslo", int_ppc_altivec_vslo, v4i32>;
+
+def VSLB : VX1_Int_Ty< 260, "vslb", int_ppc_altivec_vslb, v16i8>;
+def VSLH : VX1_Int_Ty< 324, "vslh", int_ppc_altivec_vslh, v8i16>;
+def VSLW : VX1_Int_Ty< 388, "vslw", int_ppc_altivec_vslw, v4i32>;
+
+def VSPLTB : VXForm_1<524, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vspltb $vD, $vB, $UIMM", VecPerm,
+ [(set v16i8:$vD,
+ (vspltb_shuffle:$UIMM v16i8:$vB, (undef)))]>;
+def VSPLTH : VXForm_1<588, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vsplth $vD, $vB, $UIMM", VecPerm,
+ [(set v16i8:$vD,
+ (vsplth_shuffle:$UIMM v16i8:$vB, (undef)))]>;
+def VSPLTW : VXForm_1<652, (outs VRRC:$vD), (ins u5imm:$UIMM, VRRC:$vB),
+ "vspltw $vD, $vB, $UIMM", VecPerm,
+ [(set v16i8:$vD,
+ (vspltw_shuffle:$UIMM v16i8:$vB, (undef)))]>;
+
+def VSR : VX1_Int_Ty< 708, "vsr" , int_ppc_altivec_vsr, v4i32>;
+def VSRO : VX1_Int_Ty<1100, "vsro" , int_ppc_altivec_vsro, v4i32>;
+
+def VSRAB : VX1_Int_Ty< 772, "vsrab", int_ppc_altivec_vsrab, v16i8>;
+def VSRAH : VX1_Int_Ty< 836, "vsrah", int_ppc_altivec_vsrah, v8i16>;
+def VSRAW : VX1_Int_Ty< 900, "vsraw", int_ppc_altivec_vsraw, v4i32>;
+def VSRB : VX1_Int_Ty< 516, "vsrb" , int_ppc_altivec_vsrb , v16i8>;
+def VSRH : VX1_Int_Ty< 580, "vsrh" , int_ppc_altivec_vsrh , v8i16>;
+def VSRW : VX1_Int_Ty< 644, "vsrw" , int_ppc_altivec_vsrw , v4i32>;
+
+
+def VSPLTISB : VXForm_3<780, (outs VRRC:$vD), (ins s5imm:$SIMM),
+ "vspltisb $vD, $SIMM", VecPerm,
+ [(set v16i8:$vD, (v16i8 vecspltisb:$SIMM))]>;
+def VSPLTISH : VXForm_3<844, (outs VRRC:$vD), (ins s5imm:$SIMM),
+ "vspltish $vD, $SIMM", VecPerm,
+ [(set v8i16:$vD, (v8i16 vecspltish:$SIMM))]>;
+def VSPLTISW : VXForm_3<908, (outs VRRC:$vD), (ins s5imm:$SIMM),
+ "vspltisw $vD, $SIMM", VecPerm,
+ [(set v4i32:$vD, (v4i32 vecspltisw:$SIMM))]>;
+
+// Vector Pack.
+def VPKPX : VX1_Int_Ty2<782, "vpkpx", int_ppc_altivec_vpkpx,
+ v8i16, v4i32>;
+def VPKSHSS : VX1_Int_Ty2<398, "vpkshss", int_ppc_altivec_vpkshss,
+ v16i8, v8i16>;
+def VPKSHUS : VX1_Int_Ty2<270, "vpkshus", int_ppc_altivec_vpkshus,
+ v16i8, v8i16>;
+def VPKSWSS : VX1_Int_Ty2<462, "vpkswss", int_ppc_altivec_vpkswss,
+ v16i8, v4i32>;
+def VPKSWUS : VX1_Int_Ty2<334, "vpkswus", int_ppc_altivec_vpkswus,
+ v8i16, v4i32>;
+def VPKUHUM : VXForm_1<14, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vpkuhum $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD,
+ (vpkuhum_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VPKUHUS : VX1_Int_Ty2<142, "vpkuhus", int_ppc_altivec_vpkuhus,
+ v16i8, v8i16>;
+def VPKUWUM : VXForm_1<78, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),
+ "vpkuwum $vD, $vA, $vB", VecFP,
+ [(set v16i8:$vD,
+ (vpkuwum_shuffle v16i8:$vA, v16i8:$vB))]>;
+def VPKUWUS : VX1_Int_Ty2<206, "vpkuwus", int_ppc_altivec_vpkuwus,
+ v8i16, v4i32>;
+
+// Vector Unpack.
+def VUPKHPX : VX2_Int_Ty2<846, "vupkhpx", int_ppc_altivec_vupkhpx,
+ v4i32, v8i16>;
+def VUPKHSB : VX2_Int_Ty2<526, "vupkhsb", int_ppc_altivec_vupkhsb,
+ v8i16, v16i8>;
+def VUPKHSH : VX2_Int_Ty2<590, "vupkhsh", int_ppc_altivec_vupkhsh,
+ v4i32, v8i16>;
+def VUPKLPX : VX2_Int_Ty2<974, "vupklpx", int_ppc_altivec_vupklpx,
+ v4i32, v8i16>;
+def VUPKLSB : VX2_Int_Ty2<654, "vupklsb", int_ppc_altivec_vupklsb,
+ v8i16, v16i8>;
+def VUPKLSH : VX2_Int_Ty2<718, "vupklsh", int_ppc_altivec_vupklsh,
+ v4i32, v8i16>;
+
+
+// Altivec Comparisons.
+
+class VCMP<bits<10> xo, string asmstr, ValueType Ty>
+ : VXRForm_1<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),asmstr,VecFPCompare,
+ [(set Ty:$vD, (Ty (PPCvcmp Ty:$vA, Ty:$vB, xo)))]>;
+class VCMPo<bits<10> xo, string asmstr, ValueType Ty>
+ : VXRForm_1<xo, (outs VRRC:$vD), (ins VRRC:$vA, VRRC:$vB),asmstr,VecFPCompare,
+ [(set Ty:$vD, (Ty (PPCvcmp_o Ty:$vA, Ty:$vB, xo)))]> {
+ let Defs = [CR6];
+ let RC = 1;
+}
+
+// f32 element comparisons.0
+def VCMPBFP : VCMP <966, "vcmpbfp $vD, $vA, $vB" , v4f32>;
+def VCMPBFPo : VCMPo<966, "vcmpbfp. $vD, $vA, $vB" , v4f32>;
+def VCMPEQFP : VCMP <198, "vcmpeqfp $vD, $vA, $vB" , v4f32>;
+def VCMPEQFPo : VCMPo<198, "vcmpeqfp. $vD, $vA, $vB", v4f32>;
+def VCMPGEFP : VCMP <454, "vcmpgefp $vD, $vA, $vB" , v4f32>;
+def VCMPGEFPo : VCMPo<454, "vcmpgefp. $vD, $vA, $vB", v4f32>;
+def VCMPGTFP : VCMP <710, "vcmpgtfp $vD, $vA, $vB" , v4f32>;
+def VCMPGTFPo : VCMPo<710, "vcmpgtfp. $vD, $vA, $vB", v4f32>;
+
+// i8 element comparisons.
+def VCMPEQUB : VCMP < 6, "vcmpequb $vD, $vA, $vB" , v16i8>;
+def VCMPEQUBo : VCMPo< 6, "vcmpequb. $vD, $vA, $vB", v16i8>;
+def VCMPGTSB : VCMP <774, "vcmpgtsb $vD, $vA, $vB" , v16i8>;
+def VCMPGTSBo : VCMPo<774, "vcmpgtsb. $vD, $vA, $vB", v16i8>;
+def VCMPGTUB : VCMP <518, "vcmpgtub $vD, $vA, $vB" , v16i8>;
+def VCMPGTUBo : VCMPo<518, "vcmpgtub. $vD, $vA, $vB", v16i8>;
+
+// i16 element comparisons.
+def VCMPEQUH : VCMP < 70, "vcmpequh $vD, $vA, $vB" , v8i16>;
+def VCMPEQUHo : VCMPo< 70, "vcmpequh. $vD, $vA, $vB", v8i16>;
+def VCMPGTSH : VCMP <838, "vcmpgtsh $vD, $vA, $vB" , v8i16>;
+def VCMPGTSHo : VCMPo<838, "vcmpgtsh. $vD, $vA, $vB", v8i16>;
+def VCMPGTUH : VCMP <582, "vcmpgtuh $vD, $vA, $vB" , v8i16>;
+def VCMPGTUHo : VCMPo<582, "vcmpgtuh. $vD, $vA, $vB", v8i16>;
+
+// i32 element comparisons.
+def VCMPEQUW : VCMP <134, "vcmpequw $vD, $vA, $vB" , v4i32>;
+def VCMPEQUWo : VCMPo<134, "vcmpequw. $vD, $vA, $vB", v4i32>;
+def VCMPGTSW : VCMP <902, "vcmpgtsw $vD, $vA, $vB" , v4i32>;
+def VCMPGTSWo : VCMPo<902, "vcmpgtsw. $vD, $vA, $vB", v4i32>;
+def VCMPGTUW : VCMP <646, "vcmpgtuw $vD, $vA, $vB" , v4i32>;
+def VCMPGTUWo : VCMPo<646, "vcmpgtuw. $vD, $vA, $vB", v4i32>;
+
+let isCodeGenOnly = 1 in
+def V_SET0 : VXForm_setzero<1220, (outs VRRC:$vD), (ins),
+ "vxor $vD, $vD, $vD", VecFP,
+ [(set v4i32:$vD, (v4i32 immAllZerosV))]>;
+let IMM=-1 in {
+def V_SETALLONES : VXForm_3<908, (outs VRRC:$vD), (ins),
+ "vspltisw $vD, -1", VecFP,
+ [(set v4i32:$vD, (v4i32 immAllOnesV))]>;
+}
+} // VALU Operations.
+
+//===----------------------------------------------------------------------===//
+// Additional Altivec Patterns
+//
+
+// DS* intrinsics
+def : Pat<(int_ppc_altivec_dssall), (DSSALL 1, 0, 0, 0)>;
+def : Pat<(int_ppc_altivec_dss imm:$STRM), (DSS 0, imm:$STRM, 0, 0)>;
+
+// * 32-bit
+def : Pat<(int_ppc_altivec_dst i32:$rA, i32:$rB, imm:$STRM),
+ (DST 0, imm:$STRM, $rA, $rB)>;
+def : Pat<(int_ppc_altivec_dstt i32:$rA, i32:$rB, imm:$STRM),
+ (DSTT 1, imm:$STRM, $rA, $rB)>;
+def : Pat<(int_ppc_altivec_dstst i32:$rA, i32:$rB, imm:$STRM),
+ (DSTST 0, imm:$STRM, $rA, $rB)>;
+def : Pat<(int_ppc_altivec_dststt i32:$rA, i32:$rB, imm:$STRM),
+ (DSTSTT 1, imm:$STRM, $rA, $rB)>;
+
+// * 64-bit
+def : Pat<(int_ppc_altivec_dst i64:$rA, i32:$rB, imm:$STRM),
+ (DST64 0, imm:$STRM, $rA, $rB)>;
+def : Pat<(int_ppc_altivec_dstt i64:$rA, i32:$rB, imm:$STRM),
+ (DSTT64 1, imm:$STRM, $rA, $rB)>;
+def : Pat<(int_ppc_altivec_dstst i64:$rA, i32:$rB, imm:$STRM),
+ (DSTST64 0, imm:$STRM, $rA, $rB)>;
+def : Pat<(int_ppc_altivec_dststt i64:$rA, i32:$rB, imm:$STRM),
+ (DSTSTT64 1, imm:$STRM, $rA, $rB)>;
+
+// Loads.
+def : Pat<(v4i32 (load xoaddr:$src)), (LVX xoaddr:$src)>;
+
+// Stores.
+def : Pat<(store v4i32:$rS, xoaddr:$dst),
+ (STVX $rS, xoaddr:$dst)>;
+
+// Bit conversions.
+def : Pat<(v16i8 (bitconvert (v8i16 VRRC:$src))), (v16i8 VRRC:$src)>;
+def : Pat<(v16i8 (bitconvert (v4i32 VRRC:$src))), (v16i8 VRRC:$src)>;
+def : Pat<(v16i8 (bitconvert (v4f32 VRRC:$src))), (v16i8 VRRC:$src)>;
+
+def : Pat<(v8i16 (bitconvert (v16i8 VRRC:$src))), (v8i16 VRRC:$src)>;
+def : Pat<(v8i16 (bitconvert (v4i32 VRRC:$src))), (v8i16 VRRC:$src)>;
+def : Pat<(v8i16 (bitconvert (v4f32 VRRC:$src))), (v8i16 VRRC:$src)>;
+
+def : Pat<(v4i32 (bitconvert (v16i8 VRRC:$src))), (v4i32 VRRC:$src)>;
+def : Pat<(v4i32 (bitconvert (v8i16 VRRC:$src))), (v4i32 VRRC:$src)>;
+def : Pat<(v4i32 (bitconvert (v4f32 VRRC:$src))), (v4i32 VRRC:$src)>;
+
+def : Pat<(v4f32 (bitconvert (v16i8 VRRC:$src))), (v4f32 VRRC:$src)>;
+def : Pat<(v4f32 (bitconvert (v8i16 VRRC:$src))), (v4f32 VRRC:$src)>;
+def : Pat<(v4f32 (bitconvert (v4i32 VRRC:$src))), (v4f32 VRRC:$src)>;
+
+// Shuffles.
+
+// Match vsldoi(x,x), vpkuwum(x,x), vpkuhum(x,x)
+def:Pat<(vsldoi_unary_shuffle:$in v16i8:$vA, undef),
+ (VSLDOI $vA, $vA, (VSLDOI_unary_get_imm $in))>;
+def:Pat<(vpkuwum_unary_shuffle v16i8:$vA, undef),
+ (VPKUWUM $vA, $vA)>;
+def:Pat<(vpkuhum_unary_shuffle v16i8:$vA, undef),
+ (VPKUHUM $vA, $vA)>;
+
+// Match vmrg*(x,x)
+def:Pat<(vmrglb_unary_shuffle v16i8:$vA, undef),
+ (VMRGLB $vA, $vA)>;
+def:Pat<(vmrglh_unary_shuffle v16i8:$vA, undef),
+ (VMRGLH $vA, $vA)>;
+def:Pat<(vmrglw_unary_shuffle v16i8:$vA, undef),
+ (VMRGLW $vA, $vA)>;
+def:Pat<(vmrghb_unary_shuffle v16i8:$vA, undef),
+ (VMRGHB $vA, $vA)>;
+def:Pat<(vmrghh_unary_shuffle v16i8:$vA, undef),
+ (VMRGHH $vA, $vA)>;
+def:Pat<(vmrghw_unary_shuffle v16i8:$vA, undef),
+ (VMRGHW $vA, $vA)>;
+
+// Logical Operations
+def : Pat<(vnot_ppc v4i32:$vA), (VNOR $vA, $vA)>;
+
+def : Pat<(vnot_ppc (or v4i32:$A, v4i32:$B)),
+ (VNOR $A, $B)>;
+def : Pat<(and v4i32:$A, (vnot_ppc v4i32:$B)),
+ (VANDC $A, $B)>;
+
+def : Pat<(fmul v4f32:$vA, v4f32:$vB),
+ (VMADDFP $vA, $vB,
+ (v4i32 (VSLW (V_SETALLONES), (V_SETALLONES))))>;
+
+// Fused multiply add and multiply sub for packed float. These are represented
+// separately from the real instructions above, for operations that must have
+// the additional precision, such as Newton-Rhapson (used by divide, sqrt)
+def : Pat<(PPCvmaddfp v4f32:$A, v4f32:$B, v4f32:$C),
+ (VMADDFP $A, $B, $C)>;
+def : Pat<(PPCvnmsubfp v4f32:$A, v4f32:$B, v4f32:$C),
+ (VNMSUBFP $A, $B, $C)>;
+
+def : Pat<(int_ppc_altivec_vmaddfp v4f32:$A, v4f32:$B, v4f32:$C),
+ (VMADDFP $A, $B, $C)>;
+def : Pat<(int_ppc_altivec_vnmsubfp v4f32:$A, v4f32:$B, v4f32:$C),
+ (VNMSUBFP $A, $B, $C)>;
+
+def : Pat<(PPCvperm v16i8:$vA, v16i8:$vB, v16i8:$vC),
+ (VPERM $vA, $vB, $vC)>;
+
+def : Pat<(PPCfre v4f32:$A), (VREFP $A)>;
+def : Pat<(PPCfrsqrte v4f32:$A), (VRSQRTEFP $A)>;
+
+// Vector shifts
+def : Pat<(v16i8 (shl v16i8:$vA, v16i8:$vB)),
+ (v16i8 (VSLB $vA, $vB))>;
+def : Pat<(v8i16 (shl v8i16:$vA, v8i16:$vB)),
+ (v8i16 (VSLH $vA, $vB))>;
+def : Pat<(v4i32 (shl v4i32:$vA, v4i32:$vB)),
+ (v4i32 (VSLW $vA, $vB))>;
+
+def : Pat<(v16i8 (srl v16i8:$vA, v16i8:$vB)),
+ (v16i8 (VSRB $vA, $vB))>;
+def : Pat<(v8i16 (srl v8i16:$vA, v8i16:$vB)),
+ (v8i16 (VSRH $vA, $vB))>;
+def : Pat<(v4i32 (srl v4i32:$vA, v4i32:$vB)),
+ (v4i32 (VSRW $vA, $vB))>;
+
+def : Pat<(v16i8 (sra v16i8:$vA, v16i8:$vB)),
+ (v16i8 (VSRAB $vA, $vB))>;
+def : Pat<(v8i16 (sra v8i16:$vA, v8i16:$vB)),
+ (v8i16 (VSRAH $vA, $vB))>;
+def : Pat<(v4i32 (sra v4i32:$vA, v4i32:$vB)),
+ (v4i32 (VSRAW $vA, $vB))>;
+
+// Float to integer and integer to float conversions
+def : Pat<(v4i32 (fp_to_sint v4f32:$vA)),
+ (VCTSXS_0 $vA)>;
+def : Pat<(v4i32 (fp_to_uint v4f32:$vA)),
+ (VCTUXS_0 $vA)>;
+def : Pat<(v4f32 (sint_to_fp v4i32:$vA)),
+ (VCFSX_0 $vA)>;
+def : Pat<(v4f32 (uint_to_fp v4i32:$vA)),
+ (VCFUX_0 $vA)>;
+
+// Floating-point rounding
+def : Pat<(v4f32 (ffloor v4f32:$vA)),
+ (VRFIM $vA)>;
+def : Pat<(v4f32 (fceil v4f32:$vA)),
+ (VRFIP $vA)>;
+def : Pat<(v4f32 (ftrunc v4f32:$vA)),
+ (VRFIZ $vA)>;
+def : Pat<(v4f32 (fnearbyint v4f32:$vA)),
+ (VRFIN $vA)>;
+
+} // end HasAltivec
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstrBuilder.h b/contrib/llvm/lib/Target/PowerPC/PPCInstrBuilder.h
new file mode 100644
index 0000000..b424d11
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstrBuilder.h
@@ -0,0 +1,43 @@
+//===-- PPCInstrBuilder.h - Aides for building PPC insts --------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file exposes functions that may be used with BuildMI from the
+// MachineInstrBuilder.h file to simplify generating frame and constant pool
+// references.
+//
+// For reference, the order of operands for memory references is:
+// (Operand), Dest Reg, Base Reg, and either Reg Index or Immediate
+// Displacement.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPC_INSTRBUILDER_H
+#define POWERPC_INSTRBUILDER_H
+
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+
+namespace llvm {
+
+/// addFrameReference - This function is used to add a reference to the base of
+/// an abstract object on the stack frame of the current function. This
+/// reference has base register as the FrameIndex offset until it is resolved.
+/// This allows a constant offset to be specified as well...
+///
+static inline const MachineInstrBuilder&
+addFrameReference(const MachineInstrBuilder &MIB, int FI, int Offset = 0,
+ bool mem = true) {
+ if (mem)
+ return MIB.addImm(Offset).addFrameIndex(FI);
+ else
+ return MIB.addFrameIndex(FI).addImm(Offset);
+}
+
+} // End llvm namespace
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstrFormats.td b/contrib/llvm/lib/Target/PowerPC/PPCInstrFormats.td
new file mode 100644
index 0000000..400b7e3
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstrFormats.td
@@ -0,0 +1,1003 @@
+//===- PowerPCInstrFormats.td - PowerPC Instruction Formats --*- tablegen -*-=//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+//===----------------------------------------------------------------------===//
+//
+// PowerPC instruction formats
+
+class I<bits<6> opcode, dag OOL, dag IOL, string asmstr, InstrItinClass itin>
+ : Instruction {
+ field bits<32> Inst;
+
+ bit PPC64 = 0; // Default value, override with isPPC64
+
+ let Namespace = "PPC";
+ let Inst{0-5} = opcode;
+ let OutOperandList = OOL;
+ let InOperandList = IOL;
+ let AsmString = asmstr;
+ let Itinerary = itin;
+
+ bits<1> PPC970_First = 0;
+ bits<1> PPC970_Single = 0;
+ bits<1> PPC970_Cracked = 0;
+ bits<3> PPC970_Unit = 0;
+
+ /// These fields correspond to the fields in PPCInstrInfo.h. Any changes to
+ /// these must be reflected there! See comments there for what these are.
+ let TSFlags{0} = PPC970_First;
+ let TSFlags{1} = PPC970_Single;
+ let TSFlags{2} = PPC970_Cracked;
+ let TSFlags{5-3} = PPC970_Unit;
+}
+
+class PPC970_DGroup_First { bits<1> PPC970_First = 1; }
+class PPC970_DGroup_Single { bits<1> PPC970_Single = 1; }
+class PPC970_DGroup_Cracked { bits<1> PPC970_Cracked = 1; }
+class PPC970_MicroCode;
+
+class PPC970_Unit_Pseudo { bits<3> PPC970_Unit = 0; }
+class PPC970_Unit_FXU { bits<3> PPC970_Unit = 1; }
+class PPC970_Unit_LSU { bits<3> PPC970_Unit = 2; }
+class PPC970_Unit_FPU { bits<3> PPC970_Unit = 3; }
+class PPC970_Unit_CRU { bits<3> PPC970_Unit = 4; }
+class PPC970_Unit_VALU { bits<3> PPC970_Unit = 5; }
+class PPC970_Unit_VPERM { bits<3> PPC970_Unit = 6; }
+class PPC970_Unit_BRU { bits<3> PPC970_Unit = 7; }
+
+// Two joined instructions; used to emit two adjacent instructions as one.
+// The itinerary from the first instruction is used for scheduling and
+// classification.
+class I2<bits<6> opcode1, bits<6> opcode2, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : Instruction {
+ field bits<64> Inst;
+
+ bit PPC64 = 0; // Default value, override with isPPC64
+
+ let Namespace = "PPC";
+ let Inst{0-5} = opcode1;
+ let Inst{32-37} = opcode2;
+ let OutOperandList = OOL;
+ let InOperandList = IOL;
+ let AsmString = asmstr;
+ let Itinerary = itin;
+
+ bits<1> PPC970_First = 0;
+ bits<1> PPC970_Single = 0;
+ bits<1> PPC970_Cracked = 0;
+ bits<3> PPC970_Unit = 0;
+
+ /// These fields correspond to the fields in PPCInstrInfo.h. Any changes to
+ /// these must be reflected there! See comments there for what these are.
+ let TSFlags{0} = PPC970_First;
+ let TSFlags{1} = PPC970_Single;
+ let TSFlags{2} = PPC970_Cracked;
+ let TSFlags{5-3} = PPC970_Unit;
+}
+
+// 1.7.1 I-Form
+class IForm<bits<6> opcode, bit aa, bit lk, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ let Pattern = pattern;
+ bits<24> LI;
+
+ let Inst{6-29} = LI;
+ let Inst{30} = aa;
+ let Inst{31} = lk;
+}
+
+// 1.7.2 B-Form
+class BForm<bits<6> opcode, bit aa, bit lk, dag OOL, dag IOL, string asmstr>
+ : I<opcode, OOL, IOL, asmstr, BrB> {
+ bits<7> BIBO; // 2 bits of BI and 5 bits of BO.
+ bits<3> CR;
+ bits<14> BD;
+
+ bits<5> BI;
+ let BI{0-1} = BIBO{5-6};
+ let BI{2-4} = CR{0-2};
+
+ let Inst{6-10} = BIBO{4-0};
+ let Inst{11-15} = BI;
+ let Inst{16-29} = BD;
+ let Inst{30} = aa;
+ let Inst{31} = lk;
+}
+
+class BForm_1<bits<6> opcode, bits<5> bo, bit aa, bit lk, dag OOL, dag IOL,
+ string asmstr>
+ : BForm<opcode, aa, lk, OOL, IOL, asmstr> {
+ let BIBO{4-0} = bo;
+ let BIBO{6-5} = 0;
+ let CR = 0;
+}
+
+class BForm_2<bits<6> opcode, bits<5> bo, bits<5> bi, bit aa, bit lk,
+ dag OOL, dag IOL, string asmstr>
+ : I<opcode, OOL, IOL, asmstr, BrB> {
+ bits<14> BD;
+
+ let Inst{6-10} = bo;
+ let Inst{11-15} = bi;
+ let Inst{16-29} = BD;
+ let Inst{30} = aa;
+ let Inst{31} = lk;
+}
+
+// 1.7.4 D-Form
+class DForm_base<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<5> B;
+ bits<16> C;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = A;
+ let Inst{11-15} = B;
+ let Inst{16-31} = C;
+}
+
+class DForm_1<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<21> Addr;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = A;
+ let Inst{11-15} = Addr{20-16}; // Base Reg
+ let Inst{16-31} = Addr{15-0}; // Displacement
+}
+
+class DForm_1a<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<16> C;
+ bits<5> B;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = A;
+ let Inst{11-15} = B;
+ let Inst{16-31} = C;
+}
+
+
+class DForm_2<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : DForm_base<opcode, OOL, IOL, asmstr, itin, pattern>;
+
+class DForm_2_r0<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<16> B;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = A;
+ let Inst{11-15} = 0;
+ let Inst{16-31} = B;
+}
+
+class DForm_4<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> B;
+ bits<5> A;
+ bits<16> C;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = A;
+ let Inst{11-15} = B;
+ let Inst{16-31} = C;
+}
+
+class DForm_4_zero<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : DForm_1<opcode, OOL, IOL, asmstr, itin, pattern> {
+ let A = 0;
+ let Addr = 0;
+}
+
+class IForm_and_DForm_1<bits<6> opcode1, bit aa, bit lk, bits<6> opcode2,
+ dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I2<opcode1, opcode2, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<21> Addr;
+
+ let Pattern = pattern;
+ bits<24> LI;
+
+ let Inst{6-29} = LI;
+ let Inst{30} = aa;
+ let Inst{31} = lk;
+
+ let Inst{38-42} = A;
+ let Inst{43-47} = Addr{20-16}; // Base Reg
+ let Inst{48-63} = Addr{15-0}; // Displacement
+}
+
+// This is used to emit BL8+NOP.
+class IForm_and_DForm_4_zero<bits<6> opcode1, bit aa, bit lk, bits<6> opcode2,
+ dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : IForm_and_DForm_1<opcode1, aa, lk, opcode2,
+ OOL, IOL, asmstr, itin, pattern> {
+ let A = 0;
+ let Addr = 0;
+}
+
+class DForm_5<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<3> BF;
+ bits<1> L;
+ bits<5> RA;
+ bits<16> I;
+
+ let Inst{6-8} = BF;
+ let Inst{9} = 0;
+ let Inst{10} = L;
+ let Inst{11-15} = RA;
+ let Inst{16-31} = I;
+}
+
+class DForm_5_ext<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : DForm_5<opcode, OOL, IOL, asmstr, itin> {
+ let L = PPC64;
+}
+
+class DForm_6<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : DForm_5<opcode, OOL, IOL, asmstr, itin>;
+
+class DForm_6_ext<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : DForm_6<opcode, OOL, IOL, asmstr, itin> {
+ let L = PPC64;
+}
+
+
+// 1.7.5 DS-Form
+class DSForm_1<bits<6> opcode, bits<2> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RST;
+ bits<19> DS_RA;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = RST;
+ let Inst{11-15} = DS_RA{18-14}; // Register #
+ let Inst{16-29} = DS_RA{13-0}; // Displacement.
+ let Inst{30-31} = xo;
+}
+
+class DSForm_1a<bits<6> opcode, bits<2> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RST;
+ bits<14> DS;
+ bits<5> RA;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = RST;
+ let Inst{11-15} = RA;
+ let Inst{16-29} = DS;
+ let Inst{30-31} = xo;
+}
+
+// 1.7.6 X-Form
+class XForm_base_r3xo<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RST;
+ bits<5> A;
+ bits<5> B;
+
+ let Pattern = pattern;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = RST;
+ let Inst{11-15} = A;
+ let Inst{16-20} = B;
+ let Inst{21-30} = xo;
+ let Inst{31} = RC;
+}
+
+// This is the same as XForm_base_r3xo, but the first two operands are swapped
+// when code is emitted.
+class XForm_base_r3xo_swapped
+ <bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<5> RST;
+ bits<5> B;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = RST;
+ let Inst{11-15} = A;
+ let Inst{16-20} = B;
+ let Inst{21-30} = xo;
+ let Inst{31} = RC;
+}
+
+
+class XForm_1<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern>;
+
+class XForm_6<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo_swapped<opcode, xo, OOL, IOL, asmstr, itin> {
+ let Pattern = pattern;
+}
+
+class XForm_8<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern>;
+
+class XForm_10<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo_swapped<opcode, xo, OOL, IOL, asmstr, itin> {
+ let Pattern = pattern;
+}
+
+class XForm_11<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo_swapped<opcode, xo, OOL, IOL, asmstr, itin> {
+ let B = 0;
+ let Pattern = pattern;
+}
+
+class XForm_16<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<3> BF;
+ bits<1> L;
+ bits<5> RA;
+ bits<5> RB;
+
+ let Inst{6-8} = BF;
+ let Inst{9} = 0;
+ let Inst{10} = L;
+ let Inst{11-15} = RA;
+ let Inst{16-20} = RB;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XForm_16_ext<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : XForm_16<opcode, xo, OOL, IOL, asmstr, itin> {
+ let L = PPC64;
+}
+
+class XForm_17<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<3> BF;
+ bits<5> FRA;
+ bits<5> FRB;
+
+ let Inst{6-8} = BF;
+ let Inst{9-10} = 0;
+ let Inst{11-15} = FRA;
+ let Inst{16-20} = FRB;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XForm_24<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ let Pattern = pattern;
+ let Inst{6-10} = 31;
+ let Inst{11-15} = 0;
+ let Inst{16-20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XForm_24_sync<bits<6> opcode, bits<10> xo, dag OOL, dag IOL,
+ string asmstr, InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ let Pattern = pattern;
+ let Inst{6-10} = 0;
+ let Inst{11-15} = 0;
+ let Inst{16-20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XForm_25<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+}
+
+class XForm_26<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+ let A = 0;
+}
+
+class XForm_28<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+}
+
+// This is used for MFFS, MTFSB0, MTFSB1. 42 is arbitrary; this series of
+// numbers presumably relates to some document, but I haven't found it.
+class XForm_42<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+ let Pattern = pattern;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = RST;
+ let Inst{11-20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = RC;
+}
+class XForm_43<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : XForm_base_r3xo<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+ let Pattern = pattern;
+ bits<5> FM;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = FM;
+ let Inst{11-20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = RC;
+}
+
+// DCB_Form - Form X instruction, used for dcb* instructions.
+class DCB_Form<bits<10> xo, bits<5> immfield, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<31, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<5> B;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = immfield;
+ let Inst{11-15} = A;
+ let Inst{16-20} = B;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+
+// DSS_Form - Form X instruction, used for altivec dss* instructions.
+class DSS_Form<bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<31, OOL, IOL, asmstr, itin> {
+ bits<1> T;
+ bits<2> STRM;
+ bits<5> A;
+ bits<5> B;
+
+ let Pattern = pattern;
+
+ let Inst{6} = T;
+ let Inst{7-8} = 0;
+ let Inst{9-10} = STRM;
+ let Inst{11-15} = A;
+ let Inst{16-20} = B;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+// 1.7.7 XL-Form
+class XLForm_1<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> CRD;
+ bits<5> CRA;
+ bits<5> CRB;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = CRD;
+ let Inst{11-15} = CRA;
+ let Inst{16-20} = CRB;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XLForm_1_ext<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> CRD;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = CRD;
+ let Inst{11-15} = CRD;
+ let Inst{16-20} = CRD;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XLForm_2<bits<6> opcode, bits<10> xo, bit lk, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> BO;
+ bits<5> BI;
+ bits<2> BH;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = BO;
+ let Inst{11-15} = BI;
+ let Inst{16-18} = 0;
+ let Inst{19-20} = BH;
+ let Inst{21-30} = xo;
+ let Inst{31} = lk;
+}
+
+class XLForm_2_br<bits<6> opcode, bits<10> xo, bit lk,
+ dag OOL, dag IOL, string asmstr, InstrItinClass itin, list<dag> pattern>
+ : XLForm_2<opcode, xo, lk, OOL, IOL, asmstr, itin, pattern> {
+ bits<7> BIBO; // 2 bits of BI and 5 bits of BO.
+ bits<3> CR;
+
+ let BO = BIBO{2-6};
+ let BI{0-1} = BIBO{0-1};
+ let BI{2-4} = CR;
+ let BH = 0;
+}
+
+
+class XLForm_2_ext<bits<6> opcode, bits<10> xo, bits<5> bo, bits<5> bi, bit lk,
+ dag OOL, dag IOL, string asmstr, InstrItinClass itin, list<dag> pattern>
+ : XLForm_2<opcode, xo, lk, OOL, IOL, asmstr, itin, pattern> {
+ let BO = bo;
+ let BI = bi;
+ let BH = 0;
+}
+
+class XLForm_3<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<3> BF;
+ bits<3> BFA;
+
+ let Inst{6-8} = BF;
+ let Inst{9-10} = 0;
+ let Inst{11-13} = BFA;
+ let Inst{14-15} = 0;
+ let Inst{16-20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+// 1.7.8 XFX-Form
+class XFXForm_1<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RT;
+ bits<10> SPR;
+
+ let Inst{6-10} = RT;
+ let Inst{11} = SPR{4};
+ let Inst{12} = SPR{3};
+ let Inst{13} = SPR{2};
+ let Inst{14} = SPR{1};
+ let Inst{15} = SPR{0};
+ let Inst{16} = SPR{9};
+ let Inst{17} = SPR{8};
+ let Inst{18} = SPR{7};
+ let Inst{19} = SPR{6};
+ let Inst{20} = SPR{5};
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XFXForm_1_ext<bits<6> opcode, bits<10> xo, bits<10> spr,
+ dag OOL, dag IOL, string asmstr, InstrItinClass itin>
+ : XFXForm_1<opcode, xo, OOL, IOL, asmstr, itin> {
+ let SPR = spr;
+}
+
+class XFXForm_3<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RT;
+
+ let Inst{6-10} = RT;
+ let Inst{11-20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XFXForm_5<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<8> FXM;
+ bits<5> rS;
+
+ let Inst{6-10} = rS;
+ let Inst{11} = 0;
+ let Inst{12-19} = FXM;
+ let Inst{20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XFXForm_5a<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> ST;
+ bits<8> FXM;
+
+ let Inst{6-10} = ST;
+ let Inst{11} = 1;
+ let Inst{12-19} = FXM;
+ let Inst{20} = 0;
+ let Inst{21-30} = xo;
+ let Inst{31} = 0;
+}
+
+class XFXForm_7<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin>
+ : XFXForm_1<opcode, xo, OOL, IOL, asmstr, itin>;
+
+class XFXForm_7_ext<bits<6> opcode, bits<10> xo, bits<10> spr,
+ dag OOL, dag IOL, string asmstr, InstrItinClass itin>
+ : XFXForm_7<opcode, xo, OOL, IOL, asmstr, itin> {
+ let SPR = spr;
+}
+
+// XFL-Form - MTFSF
+// This is probably 1.7.9, but I don't have the reference that uses this
+// numbering scheme...
+class XFLForm<bits<6> opcode, bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag>pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<8> FM;
+ bits<5> rT;
+
+ bit RC = 0; // set by isDOT
+ let Pattern = pattern;
+
+ let Inst{6} = 0;
+ let Inst{7-14} = FM;
+ let Inst{15} = 0;
+ let Inst{16-20} = rT;
+ let Inst{21-30} = xo;
+ let Inst{31} = RC;
+}
+
+// 1.7.10 XS-Form - SRADI.
+class XSForm_1<bits<6> opcode, bits<9> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> A;
+ bits<5> RS;
+ bits<6> SH;
+
+ bit RC = 0; // set by isDOT
+ let Pattern = pattern;
+
+ let Inst{6-10} = RS;
+ let Inst{11-15} = A;
+ let Inst{16-20} = SH{4,3,2,1,0};
+ let Inst{21-29} = xo;
+ let Inst{30} = SH{5};
+ let Inst{31} = RC;
+}
+
+// 1.7.11 XO-Form
+class XOForm_1<bits<6> opcode, bits<9> xo, bit oe, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RT;
+ bits<5> RA;
+ bits<5> RB;
+
+ let Pattern = pattern;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = RT;
+ let Inst{11-15} = RA;
+ let Inst{16-20} = RB;
+ let Inst{21} = oe;
+ let Inst{22-30} = xo;
+ let Inst{31} = RC;
+}
+
+class XOForm_3<bits<6> opcode, bits<9> xo, bit oe,
+ dag OOL, dag IOL, string asmstr, InstrItinClass itin, list<dag> pattern>
+ : XOForm_1<opcode, xo, oe, OOL, IOL, asmstr, itin, pattern> {
+ let RB = 0;
+}
+
+// 1.7.12 A-Form
+class AForm_1<bits<6> opcode, bits<5> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> FRT;
+ bits<5> FRA;
+ bits<5> FRC;
+ bits<5> FRB;
+
+ let Pattern = pattern;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = FRT;
+ let Inst{11-15} = FRA;
+ let Inst{16-20} = FRB;
+ let Inst{21-25} = FRC;
+ let Inst{26-30} = xo;
+ let Inst{31} = RC;
+}
+
+class AForm_2<bits<6> opcode, bits<5> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : AForm_1<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+ let FRC = 0;
+}
+
+class AForm_3<bits<6> opcode, bits<5> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : AForm_1<opcode, xo, OOL, IOL, asmstr, itin, pattern> {
+ let FRB = 0;
+}
+
+class AForm_4<bits<6> opcode, bits<5> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RT;
+ bits<5> RA;
+ bits<5> RB;
+ bits<5> COND;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = RT;
+ let Inst{11-15} = RA;
+ let Inst{16-20} = RB;
+ let Inst{21-25} = COND;
+ let Inst{26-30} = xo;
+ let Inst{31} = 0;
+}
+
+// 1.7.13 M-Form
+class MForm_1<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RA;
+ bits<5> RS;
+ bits<5> RB;
+ bits<5> MB;
+ bits<5> ME;
+
+ let Pattern = pattern;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = RS;
+ let Inst{11-15} = RA;
+ let Inst{16-20} = RB;
+ let Inst{21-25} = MB;
+ let Inst{26-30} = ME;
+ let Inst{31} = RC;
+}
+
+class MForm_2<bits<6> opcode, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : MForm_1<opcode, OOL, IOL, asmstr, itin, pattern> {
+}
+
+// 1.7.14 MD-Form
+class MDForm_1<bits<6> opcode, bits<3> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<opcode, OOL, IOL, asmstr, itin> {
+ bits<5> RA;
+ bits<5> RS;
+ bits<6> SH;
+ bits<6> MBE;
+
+ let Pattern = pattern;
+
+ bit RC = 0; // set by isDOT
+
+ let Inst{6-10} = RS;
+ let Inst{11-15} = RA;
+ let Inst{16-20} = SH{4,3,2,1,0};
+ let Inst{21-26} = MBE{4,3,2,1,0,5};
+ let Inst{27-29} = xo;
+ let Inst{30} = SH{5};
+ let Inst{31} = RC;
+}
+
+
+
+// E-1 VA-Form
+
+// VAForm_1 - DACB ordering.
+class VAForm_1<bits<6> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> VA;
+ bits<5> VC;
+ bits<5> VB;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = VA;
+ let Inst{16-20} = VB;
+ let Inst{21-25} = VC;
+ let Inst{26-31} = xo;
+}
+
+// VAForm_1a - DABC ordering.
+class VAForm_1a<bits<6> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> VA;
+ bits<5> VB;
+ bits<5> VC;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = VA;
+ let Inst{16-20} = VB;
+ let Inst{21-25} = VC;
+ let Inst{26-31} = xo;
+}
+
+class VAForm_2<bits<6> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> VA;
+ bits<5> VB;
+ bits<4> SH;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = VA;
+ let Inst{16-20} = VB;
+ let Inst{21} = 0;
+ let Inst{22-25} = SH;
+ let Inst{26-31} = xo;
+}
+
+// E-2 VX-Form
+class VXForm_1<bits<11> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> VA;
+ bits<5> VB;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = VA;
+ let Inst{16-20} = VB;
+ let Inst{21-31} = xo;
+}
+
+class VXForm_setzero<bits<11> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : VXForm_1<xo, OOL, IOL, asmstr, itin, pattern> {
+ let VA = VD;
+ let VB = VD;
+}
+
+
+class VXForm_2<bits<11> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> VB;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = 0;
+ let Inst{16-20} = VB;
+ let Inst{21-31} = xo;
+}
+
+class VXForm_3<bits<11> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> IMM;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = IMM;
+ let Inst{16-20} = 0;
+ let Inst{21-31} = xo;
+}
+
+/// VXForm_4 - VX instructions with "VD,0,0" register fields, like mfvscr.
+class VXForm_4<bits<11> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = 0;
+ let Inst{16-20} = 0;
+ let Inst{21-31} = xo;
+}
+
+/// VXForm_5 - VX instructions with "0,0,VB" register fields, like mtvscr.
+class VXForm_5<bits<11> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VB;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = 0;
+ let Inst{11-15} = 0;
+ let Inst{16-20} = VB;
+ let Inst{21-31} = xo;
+}
+
+// E-4 VXR-Form
+class VXRForm_1<bits<10> xo, dag OOL, dag IOL, string asmstr,
+ InstrItinClass itin, list<dag> pattern>
+ : I<4, OOL, IOL, asmstr, itin> {
+ bits<5> VD;
+ bits<5> VA;
+ bits<5> VB;
+ bit RC = 0;
+
+ let Pattern = pattern;
+
+ let Inst{6-10} = VD;
+ let Inst{11-15} = VA;
+ let Inst{16-20} = VB;
+ let Inst{21} = RC;
+ let Inst{22-31} = xo;
+}
+
+//===----------------------------------------------------------------------===//
+class Pseudo<dag OOL, dag IOL, string asmstr, list<dag> pattern>
+ : I<0, OOL, IOL, asmstr, NoItinerary> {
+ let isCodeGenOnly = 1;
+ let PPC64 = 0;
+ let Pattern = pattern;
+ let Inst{31-0} = 0;
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.cpp b/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.cpp
new file mode 100644
index 0000000..69c54ed
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.cpp
@@ -0,0 +1,731 @@
+//===-- PPCInstrInfo.cpp - PowerPC Instruction Information ----------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the PowerPC implementation of the TargetInstrInfo class.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCInstrInfo.h"
+#include "MCTargetDesc/PPCPredicates.h"
+#include "PPC.h"
+#include "PPCHazardRecognizers.h"
+#include "PPCInstrBuilder.h"
+#include "PPCMachineFunctionInfo.h"
+#include "PPCTargetMachine.h"
+#include "llvm/ADT/STLExtras.h"
+#include "llvm/CodeGen/MachineFrameInfo.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineMemOperand.h"
+#include "llvm/CodeGen/MachineRegisterInfo.h"
+#include "llvm/CodeGen/PseudoSourceValue.h"
+#include "llvm/MC/MCAsmInfo.h"
+#include "llvm/Support/CommandLine.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/TargetRegistry.h"
+#include "llvm/Support/raw_ostream.h"
+
+#define GET_INSTRINFO_CTOR
+#include "PPCGenInstrInfo.inc"
+
+using namespace llvm;
+
+static cl::
+opt<bool> DisableCTRLoopAnal("disable-ppc-ctrloop-analysis", cl::Hidden,
+ cl::desc("Disable analysis for CTR loops"));
+
+PPCInstrInfo::PPCInstrInfo(PPCTargetMachine &tm)
+ : PPCGenInstrInfo(PPC::ADJCALLSTACKDOWN, PPC::ADJCALLSTACKUP),
+ TM(tm), RI(*TM.getSubtargetImpl(), *this) {}
+
+/// CreateTargetHazardRecognizer - Return the hazard recognizer to use for
+/// this target when scheduling the DAG.
+ScheduleHazardRecognizer *PPCInstrInfo::CreateTargetHazardRecognizer(
+ const TargetMachine *TM,
+ const ScheduleDAG *DAG) const {
+ unsigned Directive = TM->getSubtarget<PPCSubtarget>().getDarwinDirective();
+ if (Directive == PPC::DIR_440 || Directive == PPC::DIR_A2 ||
+ Directive == PPC::DIR_E500mc || Directive == PPC::DIR_E5500) {
+ const InstrItineraryData *II = TM->getInstrItineraryData();
+ return new PPCScoreboardHazardRecognizer(II, DAG);
+ }
+
+ return TargetInstrInfo::CreateTargetHazardRecognizer(TM, DAG);
+}
+
+/// CreateTargetPostRAHazardRecognizer - Return the postRA hazard recognizer
+/// to use for this target when scheduling the DAG.
+ScheduleHazardRecognizer *PPCInstrInfo::CreateTargetPostRAHazardRecognizer(
+ const InstrItineraryData *II,
+ const ScheduleDAG *DAG) const {
+ unsigned Directive = TM.getSubtarget<PPCSubtarget>().getDarwinDirective();
+
+ // Most subtargets use a PPC970 recognizer.
+ if (Directive != PPC::DIR_440 && Directive != PPC::DIR_A2 &&
+ Directive != PPC::DIR_E500mc && Directive != PPC::DIR_E5500) {
+ const TargetInstrInfo *TII = TM.getInstrInfo();
+ assert(TII && "No InstrInfo?");
+
+ return new PPCHazardRecognizer970(*TII);
+ }
+
+ return new PPCScoreboardHazardRecognizer(II, DAG);
+}
+
+// Detect 32 -> 64-bit extensions where we may reuse the low sub-register.
+bool PPCInstrInfo::isCoalescableExtInstr(const MachineInstr &MI,
+ unsigned &SrcReg, unsigned &DstReg,
+ unsigned &SubIdx) const {
+ switch (MI.getOpcode()) {
+ default: return false;
+ case PPC::EXTSW:
+ case PPC::EXTSW_32_64:
+ SrcReg = MI.getOperand(1).getReg();
+ DstReg = MI.getOperand(0).getReg();
+ SubIdx = PPC::sub_32;
+ return true;
+ }
+}
+
+unsigned PPCInstrInfo::isLoadFromStackSlot(const MachineInstr *MI,
+ int &FrameIndex) const {
+ // Note: This list must be kept consistent with LoadRegFromStackSlot.
+ switch (MI->getOpcode()) {
+ default: break;
+ case PPC::LD:
+ case PPC::LWZ:
+ case PPC::LFS:
+ case PPC::LFD:
+ case PPC::RESTORE_CR:
+ case PPC::LVX:
+ case PPC::RESTORE_VRSAVE:
+ // Check for the operands added by addFrameReference (the immediate is the
+ // offset which defaults to 0).
+ if (MI->getOperand(1).isImm() && !MI->getOperand(1).getImm() &&
+ MI->getOperand(2).isFI()) {
+ FrameIndex = MI->getOperand(2).getIndex();
+ return MI->getOperand(0).getReg();
+ }
+ break;
+ }
+ return 0;
+}
+
+unsigned PPCInstrInfo::isStoreToStackSlot(const MachineInstr *MI,
+ int &FrameIndex) const {
+ // Note: This list must be kept consistent with StoreRegToStackSlot.
+ switch (MI->getOpcode()) {
+ default: break;
+ case PPC::STD:
+ case PPC::STW:
+ case PPC::STFS:
+ case PPC::STFD:
+ case PPC::SPILL_CR:
+ case PPC::STVX:
+ case PPC::SPILL_VRSAVE:
+ // Check for the operands added by addFrameReference (the immediate is the
+ // offset which defaults to 0).
+ if (MI->getOperand(1).isImm() && !MI->getOperand(1).getImm() &&
+ MI->getOperand(2).isFI()) {
+ FrameIndex = MI->getOperand(2).getIndex();
+ return MI->getOperand(0).getReg();
+ }
+ break;
+ }
+ return 0;
+}
+
+// commuteInstruction - We can commute rlwimi instructions, but only if the
+// rotate amt is zero. We also have to munge the immediates a bit.
+MachineInstr *
+PPCInstrInfo::commuteInstruction(MachineInstr *MI, bool NewMI) const {
+ MachineFunction &MF = *MI->getParent()->getParent();
+
+ // Normal instructions can be commuted the obvious way.
+ if (MI->getOpcode() != PPC::RLWIMI)
+ return TargetInstrInfo::commuteInstruction(MI, NewMI);
+
+ // Cannot commute if it has a non-zero rotate count.
+ if (MI->getOperand(3).getImm() != 0)
+ return 0;
+
+ // If we have a zero rotate count, we have:
+ // M = mask(MB,ME)
+ // Op0 = (Op1 & ~M) | (Op2 & M)
+ // Change this to:
+ // M = mask((ME+1)&31, (MB-1)&31)
+ // Op0 = (Op2 & ~M) | (Op1 & M)
+
+ // Swap op1/op2
+ unsigned Reg0 = MI->getOperand(0).getReg();
+ unsigned Reg1 = MI->getOperand(1).getReg();
+ unsigned Reg2 = MI->getOperand(2).getReg();
+ bool Reg1IsKill = MI->getOperand(1).isKill();
+ bool Reg2IsKill = MI->getOperand(2).isKill();
+ bool ChangeReg0 = false;
+ // If machine instrs are no longer in two-address forms, update
+ // destination register as well.
+ if (Reg0 == Reg1) {
+ // Must be two address instruction!
+ assert(MI->getDesc().getOperandConstraint(0, MCOI::TIED_TO) &&
+ "Expecting a two-address instruction!");
+ Reg2IsKill = false;
+ ChangeReg0 = true;
+ }
+
+ // Masks.
+ unsigned MB = MI->getOperand(4).getImm();
+ unsigned ME = MI->getOperand(5).getImm();
+
+ if (NewMI) {
+ // Create a new instruction.
+ unsigned Reg0 = ChangeReg0 ? Reg2 : MI->getOperand(0).getReg();
+ bool Reg0IsDead = MI->getOperand(0).isDead();
+ return BuildMI(MF, MI->getDebugLoc(), MI->getDesc())
+ .addReg(Reg0, RegState::Define | getDeadRegState(Reg0IsDead))
+ .addReg(Reg2, getKillRegState(Reg2IsKill))
+ .addReg(Reg1, getKillRegState(Reg1IsKill))
+ .addImm((ME+1) & 31)
+ .addImm((MB-1) & 31);
+ }
+
+ if (ChangeReg0)
+ MI->getOperand(0).setReg(Reg2);
+ MI->getOperand(2).setReg(Reg1);
+ MI->getOperand(1).setReg(Reg2);
+ MI->getOperand(2).setIsKill(Reg1IsKill);
+ MI->getOperand(1).setIsKill(Reg2IsKill);
+
+ // Swap the mask around.
+ MI->getOperand(4).setImm((ME+1) & 31);
+ MI->getOperand(5).setImm((MB-1) & 31);
+ return MI;
+}
+
+void PPCInstrInfo::insertNoop(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI) const {
+ DebugLoc DL;
+ BuildMI(MBB, MI, DL, get(PPC::NOP));
+}
+
+
+// Branch analysis.
+// Note: If the condition register is set to CTR or CTR8 then this is a
+// BDNZ (imm == 1) or BDZ (imm == 0) branch.
+bool PPCInstrInfo::AnalyzeBranch(MachineBasicBlock &MBB,MachineBasicBlock *&TBB,
+ MachineBasicBlock *&FBB,
+ SmallVectorImpl<MachineOperand> &Cond,
+ bool AllowModify) const {
+ bool isPPC64 = TM.getSubtargetImpl()->isPPC64();
+
+ // If the block has no terminators, it just falls into the block after it.
+ MachineBasicBlock::iterator I = MBB.end();
+ if (I == MBB.begin())
+ return false;
+ --I;
+ while (I->isDebugValue()) {
+ if (I == MBB.begin())
+ return false;
+ --I;
+ }
+ if (!isUnpredicatedTerminator(I))
+ return false;
+
+ // Get the last instruction in the block.
+ MachineInstr *LastInst = I;
+
+ // If there is only one terminator instruction, process it.
+ if (I == MBB.begin() || !isUnpredicatedTerminator(--I)) {
+ if (LastInst->getOpcode() == PPC::B) {
+ if (!LastInst->getOperand(0).isMBB())
+ return true;
+ TBB = LastInst->getOperand(0).getMBB();
+ return false;
+ } else if (LastInst->getOpcode() == PPC::BCC) {
+ if (!LastInst->getOperand(2).isMBB())
+ return true;
+ // Block ends with fall-through condbranch.
+ TBB = LastInst->getOperand(2).getMBB();
+ Cond.push_back(LastInst->getOperand(0));
+ Cond.push_back(LastInst->getOperand(1));
+ return false;
+ } else if (LastInst->getOpcode() == PPC::BDNZ8 ||
+ LastInst->getOpcode() == PPC::BDNZ) {
+ if (!LastInst->getOperand(0).isMBB())
+ return true;
+ if (DisableCTRLoopAnal)
+ return true;
+ TBB = LastInst->getOperand(0).getMBB();
+ Cond.push_back(MachineOperand::CreateImm(1));
+ Cond.push_back(MachineOperand::CreateReg(isPPC64 ? PPC::CTR8 : PPC::CTR,
+ true));
+ return false;
+ } else if (LastInst->getOpcode() == PPC::BDZ8 ||
+ LastInst->getOpcode() == PPC::BDZ) {
+ if (!LastInst->getOperand(0).isMBB())
+ return true;
+ if (DisableCTRLoopAnal)
+ return true;
+ TBB = LastInst->getOperand(0).getMBB();
+ Cond.push_back(MachineOperand::CreateImm(0));
+ Cond.push_back(MachineOperand::CreateReg(isPPC64 ? PPC::CTR8 : PPC::CTR,
+ true));
+ return false;
+ }
+
+ // Otherwise, don't know what this is.
+ return true;
+ }
+
+ // Get the instruction before it if it's a terminator.
+ MachineInstr *SecondLastInst = I;
+
+ // If there are three terminators, we don't know what sort of block this is.
+ if (SecondLastInst && I != MBB.begin() &&
+ isUnpredicatedTerminator(--I))
+ return true;
+
+ // If the block ends with PPC::B and PPC:BCC, handle it.
+ if (SecondLastInst->getOpcode() == PPC::BCC &&
+ LastInst->getOpcode() == PPC::B) {
+ if (!SecondLastInst->getOperand(2).isMBB() ||
+ !LastInst->getOperand(0).isMBB())
+ return true;
+ TBB = SecondLastInst->getOperand(2).getMBB();
+ Cond.push_back(SecondLastInst->getOperand(0));
+ Cond.push_back(SecondLastInst->getOperand(1));
+ FBB = LastInst->getOperand(0).getMBB();
+ return false;
+ } else if ((SecondLastInst->getOpcode() == PPC::BDNZ8 ||
+ SecondLastInst->getOpcode() == PPC::BDNZ) &&
+ LastInst->getOpcode() == PPC::B) {
+ if (!SecondLastInst->getOperand(0).isMBB() ||
+ !LastInst->getOperand(0).isMBB())
+ return true;
+ if (DisableCTRLoopAnal)
+ return true;
+ TBB = SecondLastInst->getOperand(0).getMBB();
+ Cond.push_back(MachineOperand::CreateImm(1));
+ Cond.push_back(MachineOperand::CreateReg(isPPC64 ? PPC::CTR8 : PPC::CTR,
+ true));
+ FBB = LastInst->getOperand(0).getMBB();
+ return false;
+ } else if ((SecondLastInst->getOpcode() == PPC::BDZ8 ||
+ SecondLastInst->getOpcode() == PPC::BDZ) &&
+ LastInst->getOpcode() == PPC::B) {
+ if (!SecondLastInst->getOperand(0).isMBB() ||
+ !LastInst->getOperand(0).isMBB())
+ return true;
+ if (DisableCTRLoopAnal)
+ return true;
+ TBB = SecondLastInst->getOperand(0).getMBB();
+ Cond.push_back(MachineOperand::CreateImm(0));
+ Cond.push_back(MachineOperand::CreateReg(isPPC64 ? PPC::CTR8 : PPC::CTR,
+ true));
+ FBB = LastInst->getOperand(0).getMBB();
+ return false;
+ }
+
+ // If the block ends with two PPC:Bs, handle it. The second one is not
+ // executed, so remove it.
+ if (SecondLastInst->getOpcode() == PPC::B &&
+ LastInst->getOpcode() == PPC::B) {
+ if (!SecondLastInst->getOperand(0).isMBB())
+ return true;
+ TBB = SecondLastInst->getOperand(0).getMBB();
+ I = LastInst;
+ if (AllowModify)
+ I->eraseFromParent();
+ return false;
+ }
+
+ // Otherwise, can't handle this.
+ return true;
+}
+
+unsigned PPCInstrInfo::RemoveBranch(MachineBasicBlock &MBB) const {
+ MachineBasicBlock::iterator I = MBB.end();
+ if (I == MBB.begin()) return 0;
+ --I;
+ while (I->isDebugValue()) {
+ if (I == MBB.begin())
+ return 0;
+ --I;
+ }
+ if (I->getOpcode() != PPC::B && I->getOpcode() != PPC::BCC &&
+ I->getOpcode() != PPC::BDNZ8 && I->getOpcode() != PPC::BDNZ &&
+ I->getOpcode() != PPC::BDZ8 && I->getOpcode() != PPC::BDZ)
+ return 0;
+
+ // Remove the branch.
+ I->eraseFromParent();
+
+ I = MBB.end();
+
+ if (I == MBB.begin()) return 1;
+ --I;
+ if (I->getOpcode() != PPC::BCC &&
+ I->getOpcode() != PPC::BDNZ8 && I->getOpcode() != PPC::BDNZ &&
+ I->getOpcode() != PPC::BDZ8 && I->getOpcode() != PPC::BDZ)
+ return 1;
+
+ // Remove the branch.
+ I->eraseFromParent();
+ return 2;
+}
+
+unsigned
+PPCInstrInfo::InsertBranch(MachineBasicBlock &MBB, MachineBasicBlock *TBB,
+ MachineBasicBlock *FBB,
+ const SmallVectorImpl<MachineOperand> &Cond,
+ DebugLoc DL) const {
+ // Shouldn't be a fall through.
+ assert(TBB && "InsertBranch must not be told to insert a fallthrough");
+ assert((Cond.size() == 2 || Cond.size() == 0) &&
+ "PPC branch conditions have two components!");
+
+ bool isPPC64 = TM.getSubtargetImpl()->isPPC64();
+
+ // One-way branch.
+ if (FBB == 0) {
+ if (Cond.empty()) // Unconditional branch
+ BuildMI(&MBB, DL, get(PPC::B)).addMBB(TBB);
+ else if (Cond[1].getReg() == PPC::CTR || Cond[1].getReg() == PPC::CTR8)
+ BuildMI(&MBB, DL, get(Cond[0].getImm() ?
+ (isPPC64 ? PPC::BDNZ8 : PPC::BDNZ) :
+ (isPPC64 ? PPC::BDZ8 : PPC::BDZ))).addMBB(TBB);
+ else // Conditional branch
+ BuildMI(&MBB, DL, get(PPC::BCC))
+ .addImm(Cond[0].getImm()).addReg(Cond[1].getReg()).addMBB(TBB);
+ return 1;
+ }
+
+ // Two-way Conditional Branch.
+ if (Cond[1].getReg() == PPC::CTR || Cond[1].getReg() == PPC::CTR8)
+ BuildMI(&MBB, DL, get(Cond[0].getImm() ?
+ (isPPC64 ? PPC::BDNZ8 : PPC::BDNZ) :
+ (isPPC64 ? PPC::BDZ8 : PPC::BDZ))).addMBB(TBB);
+ else
+ BuildMI(&MBB, DL, get(PPC::BCC))
+ .addImm(Cond[0].getImm()).addReg(Cond[1].getReg()).addMBB(TBB);
+ BuildMI(&MBB, DL, get(PPC::B)).addMBB(FBB);
+ return 2;
+}
+
+void PPCInstrInfo::copyPhysReg(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator I, DebugLoc DL,
+ unsigned DestReg, unsigned SrcReg,
+ bool KillSrc) const {
+ unsigned Opc;
+ if (PPC::GPRCRegClass.contains(DestReg, SrcReg))
+ Opc = PPC::OR;
+ else if (PPC::G8RCRegClass.contains(DestReg, SrcReg))
+ Opc = PPC::OR8;
+ else if (PPC::F4RCRegClass.contains(DestReg, SrcReg))
+ Opc = PPC::FMR;
+ else if (PPC::CRRCRegClass.contains(DestReg, SrcReg))
+ Opc = PPC::MCRF;
+ else if (PPC::VRRCRegClass.contains(DestReg, SrcReg))
+ Opc = PPC::VOR;
+ else if (PPC::CRBITRCRegClass.contains(DestReg, SrcReg))
+ Opc = PPC::CROR;
+ else
+ llvm_unreachable("Impossible reg-to-reg copy");
+
+ const MCInstrDesc &MCID = get(Opc);
+ if (MCID.getNumOperands() == 3)
+ BuildMI(MBB, I, DL, MCID, DestReg)
+ .addReg(SrcReg).addReg(SrcReg, getKillRegState(KillSrc));
+ else
+ BuildMI(MBB, I, DL, MCID, DestReg).addReg(SrcReg, getKillRegState(KillSrc));
+}
+
+// This function returns true if a CR spill is necessary and false otherwise.
+bool
+PPCInstrInfo::StoreRegToStackSlot(MachineFunction &MF,
+ unsigned SrcReg, bool isKill,
+ int FrameIdx,
+ const TargetRegisterClass *RC,
+ SmallVectorImpl<MachineInstr*> &NewMIs,
+ bool &NonRI, bool &SpillsVRS) const{
+ // Note: If additional store instructions are added here,
+ // update isStoreToStackSlot.
+
+ DebugLoc DL;
+ if (PPC::GPRCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::STW))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ } else if (PPC::G8RCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::STD))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ } else if (PPC::F8RCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::STFD))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ } else if (PPC::F4RCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::STFS))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ } else if (PPC::CRRCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::SPILL_CR))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ return true;
+ } else if (PPC::CRBITRCRegClass.hasSubClassEq(RC)) {
+ // FIXME: We use CRi here because there is no mtcrf on a bit. Since the
+ // backend currently only uses CR1EQ as an individual bit, this should
+ // not cause any bug. If we need other uses of CR bits, the following
+ // code may be invalid.
+ unsigned Reg = 0;
+ if (SrcReg == PPC::CR0LT || SrcReg == PPC::CR0GT ||
+ SrcReg == PPC::CR0EQ || SrcReg == PPC::CR0UN)
+ Reg = PPC::CR0;
+ else if (SrcReg == PPC::CR1LT || SrcReg == PPC::CR1GT ||
+ SrcReg == PPC::CR1EQ || SrcReg == PPC::CR1UN)
+ Reg = PPC::CR1;
+ else if (SrcReg == PPC::CR2LT || SrcReg == PPC::CR2GT ||
+ SrcReg == PPC::CR2EQ || SrcReg == PPC::CR2UN)
+ Reg = PPC::CR2;
+ else if (SrcReg == PPC::CR3LT || SrcReg == PPC::CR3GT ||
+ SrcReg == PPC::CR3EQ || SrcReg == PPC::CR3UN)
+ Reg = PPC::CR3;
+ else if (SrcReg == PPC::CR4LT || SrcReg == PPC::CR4GT ||
+ SrcReg == PPC::CR4EQ || SrcReg == PPC::CR4UN)
+ Reg = PPC::CR4;
+ else if (SrcReg == PPC::CR5LT || SrcReg == PPC::CR5GT ||
+ SrcReg == PPC::CR5EQ || SrcReg == PPC::CR5UN)
+ Reg = PPC::CR5;
+ else if (SrcReg == PPC::CR6LT || SrcReg == PPC::CR6GT ||
+ SrcReg == PPC::CR6EQ || SrcReg == PPC::CR6UN)
+ Reg = PPC::CR6;
+ else if (SrcReg == PPC::CR7LT || SrcReg == PPC::CR7GT ||
+ SrcReg == PPC::CR7EQ || SrcReg == PPC::CR7UN)
+ Reg = PPC::CR7;
+
+ return StoreRegToStackSlot(MF, Reg, isKill, FrameIdx,
+ &PPC::CRRCRegClass, NewMIs, NonRI, SpillsVRS);
+
+ } else if (PPC::VRRCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::STVX))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ NonRI = true;
+ } else if (PPC::VRSAVERCRegClass.hasSubClassEq(RC)) {
+ assert(TM.getSubtargetImpl()->isDarwin() &&
+ "VRSAVE only needs spill/restore on Darwin");
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::SPILL_VRSAVE))
+ .addReg(SrcReg,
+ getKillRegState(isKill)),
+ FrameIdx));
+ SpillsVRS = true;
+ } else {
+ llvm_unreachable("Unknown regclass!");
+ }
+
+ return false;
+}
+
+void
+PPCInstrInfo::storeRegToStackSlot(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI,
+ unsigned SrcReg, bool isKill, int FrameIdx,
+ const TargetRegisterClass *RC,
+ const TargetRegisterInfo *TRI) const {
+ MachineFunction &MF = *MBB.getParent();
+ SmallVector<MachineInstr*, 4> NewMIs;
+
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ FuncInfo->setHasSpills();
+
+ bool NonRI = false, SpillsVRS = false;
+ if (StoreRegToStackSlot(MF, SrcReg, isKill, FrameIdx, RC, NewMIs,
+ NonRI, SpillsVRS))
+ FuncInfo->setSpillsCR();
+
+ if (SpillsVRS)
+ FuncInfo->setSpillsVRSAVE();
+
+ if (NonRI)
+ FuncInfo->setHasNonRISpills();
+
+ for (unsigned i = 0, e = NewMIs.size(); i != e; ++i)
+ MBB.insert(MI, NewMIs[i]);
+
+ const MachineFrameInfo &MFI = *MF.getFrameInfo();
+ MachineMemOperand *MMO =
+ MF.getMachineMemOperand(MachinePointerInfo::getFixedStack(FrameIdx),
+ MachineMemOperand::MOStore,
+ MFI.getObjectSize(FrameIdx),
+ MFI.getObjectAlignment(FrameIdx));
+ NewMIs.back()->addMemOperand(MF, MMO);
+}
+
+bool
+PPCInstrInfo::LoadRegFromStackSlot(MachineFunction &MF, DebugLoc DL,
+ unsigned DestReg, int FrameIdx,
+ const TargetRegisterClass *RC,
+ SmallVectorImpl<MachineInstr*> &NewMIs,
+ bool &NonRI, bool &SpillsVRS) const{
+ // Note: If additional load instructions are added here,
+ // update isLoadFromStackSlot.
+
+ if (PPC::GPRCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::LWZ),
+ DestReg), FrameIdx));
+ } else if (PPC::G8RCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::LD), DestReg),
+ FrameIdx));
+ } else if (PPC::F8RCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::LFD), DestReg),
+ FrameIdx));
+ } else if (PPC::F4RCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::LFS), DestReg),
+ FrameIdx));
+ } else if (PPC::CRRCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL,
+ get(PPC::RESTORE_CR), DestReg),
+ FrameIdx));
+ return true;
+ } else if (PPC::CRBITRCRegClass.hasSubClassEq(RC)) {
+
+ unsigned Reg = 0;
+ if (DestReg == PPC::CR0LT || DestReg == PPC::CR0GT ||
+ DestReg == PPC::CR0EQ || DestReg == PPC::CR0UN)
+ Reg = PPC::CR0;
+ else if (DestReg == PPC::CR1LT || DestReg == PPC::CR1GT ||
+ DestReg == PPC::CR1EQ || DestReg == PPC::CR1UN)
+ Reg = PPC::CR1;
+ else if (DestReg == PPC::CR2LT || DestReg == PPC::CR2GT ||
+ DestReg == PPC::CR2EQ || DestReg == PPC::CR2UN)
+ Reg = PPC::CR2;
+ else if (DestReg == PPC::CR3LT || DestReg == PPC::CR3GT ||
+ DestReg == PPC::CR3EQ || DestReg == PPC::CR3UN)
+ Reg = PPC::CR3;
+ else if (DestReg == PPC::CR4LT || DestReg == PPC::CR4GT ||
+ DestReg == PPC::CR4EQ || DestReg == PPC::CR4UN)
+ Reg = PPC::CR4;
+ else if (DestReg == PPC::CR5LT || DestReg == PPC::CR5GT ||
+ DestReg == PPC::CR5EQ || DestReg == PPC::CR5UN)
+ Reg = PPC::CR5;
+ else if (DestReg == PPC::CR6LT || DestReg == PPC::CR6GT ||
+ DestReg == PPC::CR6EQ || DestReg == PPC::CR6UN)
+ Reg = PPC::CR6;
+ else if (DestReg == PPC::CR7LT || DestReg == PPC::CR7GT ||
+ DestReg == PPC::CR7EQ || DestReg == PPC::CR7UN)
+ Reg = PPC::CR7;
+
+ return LoadRegFromStackSlot(MF, DL, Reg, FrameIdx,
+ &PPC::CRRCRegClass, NewMIs, NonRI, SpillsVRS);
+
+ } else if (PPC::VRRCRegClass.hasSubClassEq(RC)) {
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL, get(PPC::LVX), DestReg),
+ FrameIdx));
+ NonRI = true;
+ } else if (PPC::VRSAVERCRegClass.hasSubClassEq(RC)) {
+ assert(TM.getSubtargetImpl()->isDarwin() &&
+ "VRSAVE only needs spill/restore on Darwin");
+ NewMIs.push_back(addFrameReference(BuildMI(MF, DL,
+ get(PPC::RESTORE_VRSAVE),
+ DestReg),
+ FrameIdx));
+ SpillsVRS = true;
+ } else {
+ llvm_unreachable("Unknown regclass!");
+ }
+
+ return false;
+}
+
+void
+PPCInstrInfo::loadRegFromStackSlot(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI,
+ unsigned DestReg, int FrameIdx,
+ const TargetRegisterClass *RC,
+ const TargetRegisterInfo *TRI) const {
+ MachineFunction &MF = *MBB.getParent();
+ SmallVector<MachineInstr*, 4> NewMIs;
+ DebugLoc DL;
+ if (MI != MBB.end()) DL = MI->getDebugLoc();
+
+ PPCFunctionInfo *FuncInfo = MF.getInfo<PPCFunctionInfo>();
+ FuncInfo->setHasSpills();
+
+ bool NonRI = false, SpillsVRS = false;
+ if (LoadRegFromStackSlot(MF, DL, DestReg, FrameIdx, RC, NewMIs,
+ NonRI, SpillsVRS))
+ FuncInfo->setSpillsCR();
+
+ if (SpillsVRS)
+ FuncInfo->setSpillsVRSAVE();
+
+ if (NonRI)
+ FuncInfo->setHasNonRISpills();
+
+ for (unsigned i = 0, e = NewMIs.size(); i != e; ++i)
+ MBB.insert(MI, NewMIs[i]);
+
+ const MachineFrameInfo &MFI = *MF.getFrameInfo();
+ MachineMemOperand *MMO =
+ MF.getMachineMemOperand(MachinePointerInfo::getFixedStack(FrameIdx),
+ MachineMemOperand::MOLoad,
+ MFI.getObjectSize(FrameIdx),
+ MFI.getObjectAlignment(FrameIdx));
+ NewMIs.back()->addMemOperand(MF, MMO);
+}
+
+MachineInstr*
+PPCInstrInfo::emitFrameIndexDebugValue(MachineFunction &MF,
+ int FrameIx, uint64_t Offset,
+ const MDNode *MDPtr,
+ DebugLoc DL) const {
+ MachineInstrBuilder MIB = BuildMI(MF, DL, get(PPC::DBG_VALUE));
+ addFrameReference(MIB, FrameIx, 0, false).addImm(Offset).addMetadata(MDPtr);
+ return &*MIB;
+}
+
+bool PPCInstrInfo::
+ReverseBranchCondition(SmallVectorImpl<MachineOperand> &Cond) const {
+ assert(Cond.size() == 2 && "Invalid PPC branch opcode!");
+ if (Cond[1].getReg() == PPC::CTR8 || Cond[1].getReg() == PPC::CTR)
+ Cond[0].setImm(Cond[0].getImm() == 0 ? 1 : 0);
+ else
+ // Leave the CR# the same, but invert the condition.
+ Cond[0].setImm(PPC::InvertPredicate((PPC::Predicate)Cond[0].getImm()));
+ return false;
+}
+
+/// GetInstSize - Return the number of bytes of code the specified
+/// instruction may be. This returns the maximum number of bytes.
+///
+unsigned PPCInstrInfo::GetInstSizeInBytes(const MachineInstr *MI) const {
+ switch (MI->getOpcode()) {
+ case PPC::INLINEASM: { // Inline Asm: Variable size.
+ const MachineFunction *MF = MI->getParent()->getParent();
+ const char *AsmStr = MI->getOperand(0).getSymbolName();
+ return getInlineAsmLength(AsmStr, *MF->getTarget().getMCAsmInfo());
+ }
+ case PPC::PROLOG_LABEL:
+ case PPC::EH_LABEL:
+ case PPC::GC_LABEL:
+ case PPC::DBG_VALUE:
+ return 0;
+ case PPC::BL8_NOP:
+ case PPC::BLA8_NOP:
+ return 8;
+ default:
+ return 4; // PowerPC instructions are all 4 bytes
+ }
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.h b/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.h
new file mode 100644
index 0000000..635e348
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.h
@@ -0,0 +1,157 @@
+//===-- PPCInstrInfo.h - PowerPC Instruction Information --------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the PowerPC implementation of the TargetInstrInfo class.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPC_INSTRUCTIONINFO_H
+#define POWERPC_INSTRUCTIONINFO_H
+
+#include "PPC.h"
+#include "PPCRegisterInfo.h"
+#include "llvm/Target/TargetInstrInfo.h"
+
+#define GET_INSTRINFO_HEADER
+#include "PPCGenInstrInfo.inc"
+
+namespace llvm {
+
+/// PPCII - This namespace holds all of the PowerPC target-specific
+/// per-instruction flags. These must match the corresponding definitions in
+/// PPC.td and PPCInstrFormats.td.
+namespace PPCII {
+enum {
+ // PPC970 Instruction Flags. These flags describe the characteristics of the
+ // PowerPC 970 (aka G5) dispatch groups and how they are formed out of
+ // raw machine instructions.
+
+ /// PPC970_First - This instruction starts a new dispatch group, so it will
+ /// always be the first one in the group.
+ PPC970_First = 0x1,
+
+ /// PPC970_Single - This instruction starts a new dispatch group and
+ /// terminates it, so it will be the sole instruction in the group.
+ PPC970_Single = 0x2,
+
+ /// PPC970_Cracked - This instruction is cracked into two pieces, requiring
+ /// two dispatch pipes to be available to issue.
+ PPC970_Cracked = 0x4,
+
+ /// PPC970_Mask/Shift - This is a bitmask that selects the pipeline type that
+ /// an instruction is issued to.
+ PPC970_Shift = 3,
+ PPC970_Mask = 0x07 << PPC970_Shift
+};
+enum PPC970_Unit {
+ /// These are the various PPC970 execution unit pipelines. Each instruction
+ /// is one of these.
+ PPC970_Pseudo = 0 << PPC970_Shift, // Pseudo instruction
+ PPC970_FXU = 1 << PPC970_Shift, // Fixed Point (aka Integer/ALU) Unit
+ PPC970_LSU = 2 << PPC970_Shift, // Load Store Unit
+ PPC970_FPU = 3 << PPC970_Shift, // Floating Point Unit
+ PPC970_CRU = 4 << PPC970_Shift, // Control Register Unit
+ PPC970_VALU = 5 << PPC970_Shift, // Vector ALU
+ PPC970_VPERM = 6 << PPC970_Shift, // Vector Permute Unit
+ PPC970_BRU = 7 << PPC970_Shift // Branch Unit
+};
+} // end namespace PPCII
+
+
+class PPCInstrInfo : public PPCGenInstrInfo {
+ PPCTargetMachine &TM;
+ const PPCRegisterInfo RI;
+
+ bool StoreRegToStackSlot(MachineFunction &MF,
+ unsigned SrcReg, bool isKill, int FrameIdx,
+ const TargetRegisterClass *RC,
+ SmallVectorImpl<MachineInstr*> &NewMIs,
+ bool &NonRI, bool &SpillsVRS) const;
+ bool LoadRegFromStackSlot(MachineFunction &MF, DebugLoc DL,
+ unsigned DestReg, int FrameIdx,
+ const TargetRegisterClass *RC,
+ SmallVectorImpl<MachineInstr*> &NewMIs,
+ bool &NonRI, bool &SpillsVRS) const;
+public:
+ explicit PPCInstrInfo(PPCTargetMachine &TM);
+
+ /// getRegisterInfo - TargetInstrInfo is a superset of MRegister info. As
+ /// such, whenever a client has an instance of instruction info, it should
+ /// always be able to get register info as well (through this method).
+ ///
+ virtual const PPCRegisterInfo &getRegisterInfo() const { return RI; }
+
+ ScheduleHazardRecognizer *
+ CreateTargetHazardRecognizer(const TargetMachine *TM,
+ const ScheduleDAG *DAG) const;
+ ScheduleHazardRecognizer *
+ CreateTargetPostRAHazardRecognizer(const InstrItineraryData *II,
+ const ScheduleDAG *DAG) const;
+
+ bool isCoalescableExtInstr(const MachineInstr &MI,
+ unsigned &SrcReg, unsigned &DstReg,
+ unsigned &SubIdx) const;
+ unsigned isLoadFromStackSlot(const MachineInstr *MI,
+ int &FrameIndex) const;
+ unsigned isStoreToStackSlot(const MachineInstr *MI,
+ int &FrameIndex) const;
+
+ // commuteInstruction - We can commute rlwimi instructions, but only if the
+ // rotate amt is zero. We also have to munge the immediates a bit.
+ virtual MachineInstr *commuteInstruction(MachineInstr *MI, bool NewMI) const;
+
+ virtual void insertNoop(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MI) const;
+
+
+ // Branch analysis.
+ virtual bool AnalyzeBranch(MachineBasicBlock &MBB, MachineBasicBlock *&TBB,
+ MachineBasicBlock *&FBB,
+ SmallVectorImpl<MachineOperand> &Cond,
+ bool AllowModify) const;
+ virtual unsigned RemoveBranch(MachineBasicBlock &MBB) const;
+ virtual unsigned InsertBranch(MachineBasicBlock &MBB, MachineBasicBlock *TBB,
+ MachineBasicBlock *FBB,
+ const SmallVectorImpl<MachineOperand> &Cond,
+ DebugLoc DL) const;
+ virtual void copyPhysReg(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator I, DebugLoc DL,
+ unsigned DestReg, unsigned SrcReg,
+ bool KillSrc) const;
+
+ virtual void storeRegToStackSlot(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MBBI,
+ unsigned SrcReg, bool isKill, int FrameIndex,
+ const TargetRegisterClass *RC,
+ const TargetRegisterInfo *TRI) const;
+
+ virtual void loadRegFromStackSlot(MachineBasicBlock &MBB,
+ MachineBasicBlock::iterator MBBI,
+ unsigned DestReg, int FrameIndex,
+ const TargetRegisterClass *RC,
+ const TargetRegisterInfo *TRI) const;
+
+ virtual MachineInstr *emitFrameIndexDebugValue(MachineFunction &MF,
+ int FrameIx,
+ uint64_t Offset,
+ const MDNode *MDPtr,
+ DebugLoc DL) const;
+
+ virtual
+ bool ReverseBranchCondition(SmallVectorImpl<MachineOperand> &Cond) const;
+
+ /// GetInstSize - Return the number of bytes of code the specified
+ /// instruction may be. This returns the maximum number of bytes.
+ ///
+ virtual unsigned GetInstSizeInBytes(const MachineInstr *MI) const;
+};
+
+}
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.td b/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.td
new file mode 100644
index 0000000..ab90762
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCInstrInfo.td
@@ -0,0 +1,1717 @@
+//===-- PPCInstrInfo.td - The PowerPC Instruction Set ------*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file describes the subset of the 32-bit PowerPC instruction set, as used
+// by the PowerPC instruction selector.
+//
+//===----------------------------------------------------------------------===//
+
+include "PPCInstrFormats.td"
+
+//===----------------------------------------------------------------------===//
+// PowerPC specific type constraints.
+//
+def SDT_PPCstfiwx : SDTypeProfile<0, 2, [ // stfiwx
+ SDTCisVT<0, f64>, SDTCisPtrTy<1>
+]>;
+def SDT_PPClfiwx : SDTypeProfile<1, 1, [ // lfiw[az]x
+ SDTCisVT<0, f64>, SDTCisPtrTy<1>
+]>;
+
+def SDT_PPCCallSeqStart : SDCallSeqStart<[ SDTCisVT<0, i32> ]>;
+def SDT_PPCCallSeqEnd : SDCallSeqEnd<[ SDTCisVT<0, i32>,
+ SDTCisVT<1, i32> ]>;
+def SDT_PPCvperm : SDTypeProfile<1, 3, [
+ SDTCisVT<3, v16i8>, SDTCisSameAs<0, 1>, SDTCisSameAs<0, 2>
+]>;
+
+def SDT_PPCvcmp : SDTypeProfile<1, 3, [
+ SDTCisSameAs<0, 1>, SDTCisSameAs<1, 2>, SDTCisVT<3, i32>
+]>;
+
+def SDT_PPCcondbr : SDTypeProfile<0, 3, [
+ SDTCisVT<0, i32>, SDTCisVT<2, OtherVT>
+]>;
+
+def SDT_PPClbrx : SDTypeProfile<1, 2, [
+ SDTCisInt<0>, SDTCisPtrTy<1>, SDTCisVT<2, OtherVT>
+]>;
+def SDT_PPCstbrx : SDTypeProfile<0, 3, [
+ SDTCisInt<0>, SDTCisPtrTy<1>, SDTCisVT<2, OtherVT>
+]>;
+
+def SDT_PPClarx : SDTypeProfile<1, 1, [
+ SDTCisInt<0>, SDTCisPtrTy<1>
+]>;
+def SDT_PPCstcx : SDTypeProfile<0, 2, [
+ SDTCisInt<0>, SDTCisPtrTy<1>
+]>;
+
+def SDT_PPCTC_ret : SDTypeProfile<0, 2, [
+ SDTCisPtrTy<0>, SDTCisVT<1, i32>
+]>;
+
+
+//===----------------------------------------------------------------------===//
+// PowerPC specific DAG Nodes.
+//
+
+def PPCfre : SDNode<"PPCISD::FRE", SDTFPUnaryOp, []>;
+def PPCfrsqrte: SDNode<"PPCISD::FRSQRTE", SDTFPUnaryOp, []>;
+
+def PPCfcfid : SDNode<"PPCISD::FCFID", SDTFPUnaryOp, []>;
+def PPCfcfidu : SDNode<"PPCISD::FCFIDU", SDTFPUnaryOp, []>;
+def PPCfcfids : SDNode<"PPCISD::FCFIDS", SDTFPRoundOp, []>;
+def PPCfcfidus: SDNode<"PPCISD::FCFIDUS", SDTFPRoundOp, []>;
+def PPCfctidz : SDNode<"PPCISD::FCTIDZ", SDTFPUnaryOp, []>;
+def PPCfctiwz : SDNode<"PPCISD::FCTIWZ", SDTFPUnaryOp, []>;
+def PPCfctiduz: SDNode<"PPCISD::FCTIDUZ",SDTFPUnaryOp, []>;
+def PPCfctiwuz: SDNode<"PPCISD::FCTIWUZ",SDTFPUnaryOp, []>;
+def PPCstfiwx : SDNode<"PPCISD::STFIWX", SDT_PPCstfiwx,
+ [SDNPHasChain, SDNPMayStore]>;
+def PPClfiwax : SDNode<"PPCISD::LFIWAX", SDT_PPClfiwx,
+ [SDNPHasChain, SDNPMayLoad]>;
+def PPClfiwzx : SDNode<"PPCISD::LFIWZX", SDT_PPClfiwx,
+ [SDNPHasChain, SDNPMayLoad]>;
+
+// Extract FPSCR (not modeled at the DAG level).
+def PPCmffs : SDNode<"PPCISD::MFFS",
+ SDTypeProfile<1, 0, [SDTCisVT<0, f64>]>, []>;
+
+// Perform FADD in round-to-zero mode.
+def PPCfaddrtz: SDNode<"PPCISD::FADDRTZ", SDTFPBinOp, []>;
+
+
+def PPCfsel : SDNode<"PPCISD::FSEL",
+ // Type constraint for fsel.
+ SDTypeProfile<1, 3, [SDTCisSameAs<0, 2>, SDTCisSameAs<0, 3>,
+ SDTCisFP<0>, SDTCisVT<1, f64>]>, []>;
+
+def PPChi : SDNode<"PPCISD::Hi", SDTIntBinOp, []>;
+def PPClo : SDNode<"PPCISD::Lo", SDTIntBinOp, []>;
+def PPCtoc_entry: SDNode<"PPCISD::TOC_ENTRY", SDTIntBinOp, [SDNPMayLoad]>;
+def PPCvmaddfp : SDNode<"PPCISD::VMADDFP", SDTFPTernaryOp, []>;
+def PPCvnmsubfp : SDNode<"PPCISD::VNMSUBFP", SDTFPTernaryOp, []>;
+
+def PPCaddisGotTprelHA : SDNode<"PPCISD::ADDIS_GOT_TPREL_HA", SDTIntBinOp>;
+def PPCldGotTprelL : SDNode<"PPCISD::LD_GOT_TPREL_L", SDTIntBinOp,
+ [SDNPMayLoad]>;
+def PPCaddTls : SDNode<"PPCISD::ADD_TLS", SDTIntBinOp, []>;
+def PPCaddisTlsgdHA : SDNode<"PPCISD::ADDIS_TLSGD_HA", SDTIntBinOp>;
+def PPCaddiTlsgdL : SDNode<"PPCISD::ADDI_TLSGD_L", SDTIntBinOp>;
+def PPCgetTlsAddr : SDNode<"PPCISD::GET_TLS_ADDR", SDTIntBinOp>;
+def PPCaddisTlsldHA : SDNode<"PPCISD::ADDIS_TLSLD_HA", SDTIntBinOp>;
+def PPCaddiTlsldL : SDNode<"PPCISD::ADDI_TLSLD_L", SDTIntBinOp>;
+def PPCgetTlsldAddr : SDNode<"PPCISD::GET_TLSLD_ADDR", SDTIntBinOp>;
+def PPCaddisDtprelHA : SDNode<"PPCISD::ADDIS_DTPREL_HA", SDTIntBinOp,
+ [SDNPHasChain]>;
+def PPCaddiDtprelL : SDNode<"PPCISD::ADDI_DTPREL_L", SDTIntBinOp>;
+
+def PPCvperm : SDNode<"PPCISD::VPERM", SDT_PPCvperm, []>;
+
+// These nodes represent the 32-bit PPC shifts that operate on 6-bit shift
+// amounts. These nodes are generated by the multi-precision shift code.
+def PPCsrl : SDNode<"PPCISD::SRL" , SDTIntShiftOp>;
+def PPCsra : SDNode<"PPCISD::SRA" , SDTIntShiftOp>;
+def PPCshl : SDNode<"PPCISD::SHL" , SDTIntShiftOp>;
+
+// These are target-independent nodes, but have target-specific formats.
+def callseq_start : SDNode<"ISD::CALLSEQ_START", SDT_PPCCallSeqStart,
+ [SDNPHasChain, SDNPOutGlue]>;
+def callseq_end : SDNode<"ISD::CALLSEQ_END", SDT_PPCCallSeqEnd,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue]>;
+
+def SDT_PPCCall : SDTypeProfile<0, -1, [SDTCisInt<0>]>;
+def PPCcall : SDNode<"PPCISD::CALL", SDT_PPCCall,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue,
+ SDNPVariadic]>;
+def PPCcall_nop : SDNode<"PPCISD::CALL_NOP", SDT_PPCCall,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue,
+ SDNPVariadic]>;
+def PPCload : SDNode<"PPCISD::LOAD", SDTypeProfile<1, 1, []>,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue]>;
+def PPCload_toc : SDNode<"PPCISD::LOAD_TOC", SDTypeProfile<0, 1, []>,
+ [SDNPHasChain, SDNPSideEffect,
+ SDNPInGlue, SDNPOutGlue]>;
+def PPCtoc_restore : SDNode<"PPCISD::TOC_RESTORE", SDTypeProfile<0, 0, []>,
+ [SDNPHasChain, SDNPSideEffect,
+ SDNPInGlue, SDNPOutGlue]>;
+def PPCmtctr : SDNode<"PPCISD::MTCTR", SDT_PPCCall,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue]>;
+def PPCbctrl : SDNode<"PPCISD::BCTRL", SDTNone,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue,
+ SDNPVariadic]>;
+
+def retflag : SDNode<"PPCISD::RET_FLAG", SDTNone,
+ [SDNPHasChain, SDNPOptInGlue, SDNPVariadic]>;
+
+def PPCtc_return : SDNode<"PPCISD::TC_RETURN", SDT_PPCTC_ret,
+ [SDNPHasChain, SDNPOptInGlue, SDNPVariadic]>;
+
+def PPCeh_sjlj_setjmp : SDNode<"PPCISD::EH_SJLJ_SETJMP",
+ SDTypeProfile<1, 1, [SDTCisInt<0>,
+ SDTCisPtrTy<1>]>,
+ [SDNPHasChain, SDNPSideEffect]>;
+def PPCeh_sjlj_longjmp : SDNode<"PPCISD::EH_SJLJ_LONGJMP",
+ SDTypeProfile<0, 1, [SDTCisPtrTy<0>]>,
+ [SDNPHasChain, SDNPSideEffect]>;
+
+def PPCvcmp : SDNode<"PPCISD::VCMP" , SDT_PPCvcmp, []>;
+def PPCvcmp_o : SDNode<"PPCISD::VCMPo", SDT_PPCvcmp, [SDNPOutGlue]>;
+
+def PPCcondbranch : SDNode<"PPCISD::COND_BRANCH", SDT_PPCcondbr,
+ [SDNPHasChain, SDNPOptInGlue]>;
+
+def PPClbrx : SDNode<"PPCISD::LBRX", SDT_PPClbrx,
+ [SDNPHasChain, SDNPMayLoad]>;
+def PPCstbrx : SDNode<"PPCISD::STBRX", SDT_PPCstbrx,
+ [SDNPHasChain, SDNPMayStore]>;
+
+// Instructions to set/unset CR bit 6 for SVR4 vararg calls
+def PPCcr6set : SDNode<"PPCISD::CR6SET", SDTNone,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue]>;
+def PPCcr6unset : SDNode<"PPCISD::CR6UNSET", SDTNone,
+ [SDNPHasChain, SDNPOptInGlue, SDNPOutGlue]>;
+
+// Instructions to support atomic operations
+def PPClarx : SDNode<"PPCISD::LARX", SDT_PPClarx,
+ [SDNPHasChain, SDNPMayLoad]>;
+def PPCstcx : SDNode<"PPCISD::STCX", SDT_PPCstcx,
+ [SDNPHasChain, SDNPMayStore]>;
+
+// Instructions to support medium and large code model
+def PPCaddisTocHA : SDNode<"PPCISD::ADDIS_TOC_HA", SDTIntBinOp, []>;
+def PPCldTocL : SDNode<"PPCISD::LD_TOC_L", SDTIntBinOp, [SDNPMayLoad]>;
+def PPCaddiTocL : SDNode<"PPCISD::ADDI_TOC_L", SDTIntBinOp, []>;
+
+
+// Instructions to support dynamic alloca.
+def SDTDynOp : SDTypeProfile<1, 2, []>;
+def PPCdynalloc : SDNode<"PPCISD::DYNALLOC", SDTDynOp, [SDNPHasChain]>;
+
+//===----------------------------------------------------------------------===//
+// PowerPC specific transformation functions and pattern fragments.
+//
+
+def SHL32 : SDNodeXForm<imm, [{
+ // Transformation function: 31 - imm
+ return getI32Imm(31 - N->getZExtValue());
+}]>;
+
+def SRL32 : SDNodeXForm<imm, [{
+ // Transformation function: 32 - imm
+ return N->getZExtValue() ? getI32Imm(32 - N->getZExtValue()) : getI32Imm(0);
+}]>;
+
+def LO16 : SDNodeXForm<imm, [{
+ // Transformation function: get the low 16 bits.
+ return getI32Imm((unsigned short)N->getZExtValue());
+}]>;
+
+def HI16 : SDNodeXForm<imm, [{
+ // Transformation function: shift the immediate value down into the low bits.
+ return getI32Imm((unsigned)N->getZExtValue() >> 16);
+}]>;
+
+def HA16 : SDNodeXForm<imm, [{
+ // Transformation function: shift the immediate value down into the low bits.
+ signed int Val = N->getZExtValue();
+ return getI32Imm((Val - (signed short)Val) >> 16);
+}]>;
+def MB : SDNodeXForm<imm, [{
+ // Transformation function: get the start bit of a mask
+ unsigned mb = 0, me;
+ (void)isRunOfOnes((unsigned)N->getZExtValue(), mb, me);
+ return getI32Imm(mb);
+}]>;
+
+def ME : SDNodeXForm<imm, [{
+ // Transformation function: get the end bit of a mask
+ unsigned mb, me = 0;
+ (void)isRunOfOnes((unsigned)N->getZExtValue(), mb, me);
+ return getI32Imm(me);
+}]>;
+def maskimm32 : PatLeaf<(imm), [{
+ // maskImm predicate - True if immediate is a run of ones.
+ unsigned mb, me;
+ if (N->getValueType(0) == MVT::i32)
+ return isRunOfOnes((unsigned)N->getZExtValue(), mb, me);
+ else
+ return false;
+}]>;
+
+def immSExt16 : PatLeaf<(imm), [{
+ // immSExt16 predicate - True if the immediate fits in a 16-bit sign extended
+ // field. Used by instructions like 'addi'.
+ if (N->getValueType(0) == MVT::i32)
+ return (int32_t)N->getZExtValue() == (short)N->getZExtValue();
+ else
+ return (int64_t)N->getZExtValue() == (short)N->getZExtValue();
+}]>;
+def immZExt16 : PatLeaf<(imm), [{
+ // immZExt16 predicate - True if the immediate fits in a 16-bit zero extended
+ // field. Used by instructions like 'ori'.
+ return (uint64_t)N->getZExtValue() == (unsigned short)N->getZExtValue();
+}], LO16>;
+
+// imm16Shifted* - These match immediates where the low 16-bits are zero. There
+// are two forms: imm16ShiftedSExt and imm16ShiftedZExt. These two forms are
+// identical in 32-bit mode, but in 64-bit mode, they return true if the
+// immediate fits into a sign/zero extended 32-bit immediate (with the low bits
+// clear).
+def imm16ShiftedZExt : PatLeaf<(imm), [{
+ // imm16ShiftedZExt predicate - True if only bits in the top 16-bits of the
+ // immediate are set. Used by instructions like 'xoris'.
+ return (N->getZExtValue() & ~uint64_t(0xFFFF0000)) == 0;
+}], HI16>;
+
+def imm16ShiftedSExt : PatLeaf<(imm), [{
+ // imm16ShiftedSExt predicate - True if only bits in the top 16-bits of the
+ // immediate are set. Used by instructions like 'addis'. Identical to
+ // imm16ShiftedZExt in 32-bit mode.
+ if (N->getZExtValue() & 0xFFFF) return false;
+ if (N->getValueType(0) == MVT::i32)
+ return true;
+ // For 64-bit, make sure it is sext right.
+ return N->getZExtValue() == (uint64_t)(int)N->getZExtValue();
+}], HI16>;
+
+// Some r+i load/store instructions (such as LD, STD, LDU, etc.) that require
+// restricted memrix (offset/4) constants are alignment sensitive. If these
+// offsets are hidden behind TOC entries than the values of the lower-order
+// bits cannot be checked directly. As a result, we need to also incorporate
+// an alignment check into the relevant patterns.
+
+def aligned4load : PatFrag<(ops node:$ptr), (load node:$ptr), [{
+ return cast<LoadSDNode>(N)->getAlignment() >= 4;
+}]>;
+def aligned4store : PatFrag<(ops node:$val, node:$ptr),
+ (store node:$val, node:$ptr), [{
+ return cast<StoreSDNode>(N)->getAlignment() >= 4;
+}]>;
+def aligned4sextloadi32 : PatFrag<(ops node:$ptr), (sextloadi32 node:$ptr), [{
+ return cast<LoadSDNode>(N)->getAlignment() >= 4;
+}]>;
+def aligned4pre_store : PatFrag<
+ (ops node:$val, node:$base, node:$offset),
+ (pre_store node:$val, node:$base, node:$offset), [{
+ return cast<StoreSDNode>(N)->getAlignment() >= 4;
+}]>;
+
+def unaligned4load : PatFrag<(ops node:$ptr), (load node:$ptr), [{
+ return cast<LoadSDNode>(N)->getAlignment() < 4;
+}]>;
+def unaligned4store : PatFrag<(ops node:$val, node:$ptr),
+ (store node:$val, node:$ptr), [{
+ return cast<StoreSDNode>(N)->getAlignment() < 4;
+}]>;
+def unaligned4sextloadi32 : PatFrag<(ops node:$ptr), (sextloadi32 node:$ptr), [{
+ return cast<LoadSDNode>(N)->getAlignment() < 4;
+}]>;
+
+//===----------------------------------------------------------------------===//
+// PowerPC Flag Definitions.
+
+class isPPC64 { bit PPC64 = 1; }
+class isDOT {
+ list<Register> Defs = [CR0];
+ bit RC = 1;
+}
+
+class RegConstraint<string C> {
+ string Constraints = C;
+}
+class NoEncode<string E> {
+ string DisableEncoding = E;
+}
+
+
+//===----------------------------------------------------------------------===//
+// PowerPC Operand Definitions.
+
+def s5imm : Operand<i32> {
+ let PrintMethod = "printS5ImmOperand";
+}
+def u5imm : Operand<i32> {
+ let PrintMethod = "printU5ImmOperand";
+}
+def u6imm : Operand<i32> {
+ let PrintMethod = "printU6ImmOperand";
+}
+def s16imm : Operand<i32> {
+ let PrintMethod = "printS16ImmOperand";
+}
+def u16imm : Operand<i32> {
+ let PrintMethod = "printU16ImmOperand";
+}
+def directbrtarget : Operand<OtherVT> {
+ let PrintMethod = "printBranchOperand";
+ let EncoderMethod = "getDirectBrEncoding";
+}
+def condbrtarget : Operand<OtherVT> {
+ let PrintMethod = "printBranchOperand";
+ let EncoderMethod = "getCondBrEncoding";
+}
+def calltarget : Operand<iPTR> {
+ let EncoderMethod = "getDirectBrEncoding";
+}
+def aaddr : Operand<iPTR> {
+ let PrintMethod = "printAbsAddrOperand";
+}
+def symbolHi: Operand<i32> {
+ let PrintMethod = "printSymbolHi";
+ let EncoderMethod = "getHA16Encoding";
+}
+def symbolLo: Operand<i32> {
+ let PrintMethod = "printSymbolLo";
+ let EncoderMethod = "getLO16Encoding";
+}
+def crbitm: Operand<i8> {
+ let PrintMethod = "printcrbitm";
+ let EncoderMethod = "get_crbitm_encoding";
+}
+// Address operands
+// A version of ptr_rc which excludes R0 (or X0 in 64-bit mode).
+def ptr_rc_nor0 : PointerLikeRegClass<1>;
+
+def dispRI : Operand<iPTR>;
+def dispRIX : Operand<iPTR>;
+
+def memri : Operand<iPTR> {
+ let PrintMethod = "printMemRegImm";
+ let MIOperandInfo = (ops dispRI:$imm, ptr_rc_nor0:$reg);
+ let EncoderMethod = "getMemRIEncoding";
+}
+def memrr : Operand<iPTR> {
+ let PrintMethod = "printMemRegReg";
+ let MIOperandInfo = (ops ptr_rc_nor0:$ptrreg, ptr_rc:$offreg);
+}
+def memrix : Operand<iPTR> { // memri where the imm is shifted 2 bits.
+ let PrintMethod = "printMemRegImmShifted";
+ let MIOperandInfo = (ops dispRIX:$imm, ptr_rc_nor0:$reg);
+ let EncoderMethod = "getMemRIXEncoding";
+}
+
+// A single-register address. This is used with the SjLj
+// pseudo-instructions.
+def memr : Operand<iPTR> {
+ let MIOperandInfo = (ops ptr_rc:$ptrreg);
+}
+
+// PowerPC Predicate operand.
+def pred : Operand<OtherVT> {
+ let PrintMethod = "printPredicateOperand";
+ let MIOperandInfo = (ops i32imm:$bibo, CRRC:$reg);
+}
+
+// Define PowerPC specific addressing mode.
+def iaddr : ComplexPattern<iPTR, 2, "SelectAddrImm", [], []>;
+def xaddr : ComplexPattern<iPTR, 2, "SelectAddrIdx", [], []>;
+def xoaddr : ComplexPattern<iPTR, 2, "SelectAddrIdxOnly",[], []>;
+def ixaddr : ComplexPattern<iPTR, 2, "SelectAddrImmShift", [], []>; // "std"
+
+// The address in a single register. This is used with the SjLj
+// pseudo-instructions.
+def addr : ComplexPattern<iPTR, 1, "SelectAddr",[], []>;
+
+/// This is just the offset part of iaddr, used for preinc.
+def iaddroff : ComplexPattern<iPTR, 1, "SelectAddrImmOffs", [], []>;
+
+//===----------------------------------------------------------------------===//
+// PowerPC Instruction Predicate Definitions.
+def In32BitMode : Predicate<"!PPCSubTarget.isPPC64()">;
+def In64BitMode : Predicate<"PPCSubTarget.isPPC64()">;
+def IsBookE : Predicate<"PPCSubTarget.isBookE()">;
+
+//===----------------------------------------------------------------------===//
+// PowerPC Instruction Definitions.
+
+// Pseudo-instructions:
+
+let hasCtrlDep = 1 in {
+let Defs = [R1], Uses = [R1] in {
+def ADJCALLSTACKDOWN : Pseudo<(outs), (ins u16imm:$amt), "#ADJCALLSTACKDOWN $amt",
+ [(callseq_start timm:$amt)]>;
+def ADJCALLSTACKUP : Pseudo<(outs), (ins u16imm:$amt1, u16imm:$amt2), "#ADJCALLSTACKUP $amt1 $amt2",
+ [(callseq_end timm:$amt1, timm:$amt2)]>;
+}
+
+def UPDATE_VRSAVE : Pseudo<(outs GPRC:$rD), (ins GPRC:$rS),
+ "UPDATE_VRSAVE $rD, $rS", []>;
+}
+
+let Defs = [R1], Uses = [R1] in
+def DYNALLOC : Pseudo<(outs GPRC:$result), (ins GPRC:$negsize, memri:$fpsi), "#DYNALLOC",
+ [(set i32:$result,
+ (PPCdynalloc i32:$negsize, iaddr:$fpsi))]>;
+
+// SELECT_CC_* - Used to implement the SELECT_CC DAG operation. Expanded after
+// instruction selection into a branch sequence.
+let usesCustomInserter = 1, // Expanded after instruction selection.
+ PPC970_Single = 1 in {
+ // Note that SELECT_CC_I4 and SELECT_CC_I8 use the no-r0 register classes
+ // because either operand might become the first operand in an isel, and
+ // that operand cannot be r0.
+ def SELECT_CC_I4 : Pseudo<(outs GPRC:$dst), (ins CRRC:$cond,
+ GPRC_NOR0:$T, GPRC_NOR0:$F,
+ i32imm:$BROPC), "#SELECT_CC_I4",
+ []>;
+ def SELECT_CC_I8 : Pseudo<(outs G8RC:$dst), (ins CRRC:$cond,
+ G8RC_NOX0:$T, G8RC_NOX0:$F,
+ i32imm:$BROPC), "#SELECT_CC_I8",
+ []>;
+ def SELECT_CC_F4 : Pseudo<(outs F4RC:$dst), (ins CRRC:$cond, F4RC:$T, F4RC:$F,
+ i32imm:$BROPC), "#SELECT_CC_F4",
+ []>;
+ def SELECT_CC_F8 : Pseudo<(outs F8RC:$dst), (ins CRRC:$cond, F8RC:$T, F8RC:$F,
+ i32imm:$BROPC), "#SELECT_CC_F8",
+ []>;
+ def SELECT_CC_VRRC: Pseudo<(outs VRRC:$dst), (ins CRRC:$cond, VRRC:$T, VRRC:$F,
+ i32imm:$BROPC), "#SELECT_CC_VRRC",
+ []>;
+}
+
+// SPILL_CR - Indicate that we're dumping the CR register, so we'll need to
+// scavenge a register for it.
+let mayStore = 1 in
+def SPILL_CR : Pseudo<(outs), (ins CRRC:$cond, memri:$F),
+ "#SPILL_CR", []>;
+
+// RESTORE_CR - Indicate that we're restoring the CR register (previously
+// spilled), so we'll need to scavenge a register for it.
+let mayLoad = 1 in
+def RESTORE_CR : Pseudo<(outs CRRC:$cond), (ins memri:$F),
+ "#RESTORE_CR", []>;
+
+let isTerminator = 1, isBarrier = 1, PPC970_Unit = 7 in {
+ let isReturn = 1, Uses = [LR, RM] in
+ def BLR : XLForm_2_ext<19, 16, 20, 0, 0, (outs), (ins), "blr", BrB,
+ [(retflag)]>;
+ let isBranch = 1, isIndirectBranch = 1, Uses = [CTR] in
+ def BCTR : XLForm_2_ext<19, 528, 20, 0, 0, (outs), (ins), "bctr", BrB, []>;
+}
+
+let Defs = [LR] in
+ def MovePCtoLR : Pseudo<(outs), (ins), "#MovePCtoLR", []>,
+ PPC970_Unit_BRU;
+
+let isBranch = 1, isTerminator = 1, hasCtrlDep = 1, PPC970_Unit = 7 in {
+ let isBarrier = 1 in {
+ def B : IForm<18, 0, 0, (outs), (ins directbrtarget:$dst),
+ "b $dst", BrB,
+ [(br bb:$dst)]>;
+ }
+
+ // BCC represents an arbitrary conditional branch on a predicate.
+ // FIXME: should be able to write a pattern for PPCcondbranch, but can't use
+ // a two-value operand where a dag node expects two operands. :(
+ let isCodeGenOnly = 1 in
+ def BCC : BForm<16, 0, 0, (outs), (ins pred:$cond, condbrtarget:$dst),
+ "b${cond:cc} ${cond:reg}, $dst"
+ /*[(PPCcondbranch CRRC:$crS, imm:$opc, bb:$dst)]*/>;
+
+ let Defs = [CTR], Uses = [CTR] in {
+ def BDZ : BForm_1<16, 18, 0, 0, (outs), (ins condbrtarget:$dst),
+ "bdz $dst">;
+ def BDNZ : BForm_1<16, 16, 0, 0, (outs), (ins condbrtarget:$dst),
+ "bdnz $dst">;
+ }
+}
+
+// The unconditional BCL used by the SjLj setjmp code.
+let isCall = 1, hasCtrlDep = 1, isCodeGenOnly = 1, PPC970_Unit = 7 in {
+ let Defs = [LR], Uses = [RM] in {
+ def BCLalways : BForm_2<16, 20, 31, 0, 1, (outs), (ins condbrtarget:$dst),
+ "bcl 20, 31, $dst">;
+ }
+}
+
+let isCall = 1, PPC970_Unit = 7, Defs = [LR] in {
+ // Convenient aliases for call instructions
+ let Uses = [RM] in {
+ def BL : IForm<18, 0, 1, (outs), (ins calltarget:$func),
+ "bl $func", BrB, []>; // See Pat patterns below.
+ def BLA : IForm<18, 1, 1, (outs), (ins aaddr:$func),
+ "bla $func", BrB, [(PPCcall (i32 imm:$func))]>;
+ }
+ let Uses = [CTR, RM] in {
+ def BCTRL : XLForm_2_ext<19, 528, 20, 0, 1, (outs), (ins),
+ "bctrl", BrB, [(PPCbctrl)]>,
+ Requires<[In32BitMode]>;
+ }
+}
+
+let isCall = 1, isTerminator = 1, isReturn = 1, isBarrier = 1, Uses = [RM] in
+def TCRETURNdi :Pseudo< (outs),
+ (ins calltarget:$dst, i32imm:$offset),
+ "#TC_RETURNd $dst $offset",
+ []>;
+
+
+let isCall = 1, isTerminator = 1, isReturn = 1, isBarrier = 1, Uses = [RM] in
+def TCRETURNai :Pseudo<(outs), (ins aaddr:$func, i32imm:$offset),
+ "#TC_RETURNa $func $offset",
+ [(PPCtc_return (i32 imm:$func), imm:$offset)]>;
+
+let isCall = 1, isTerminator = 1, isReturn = 1, isBarrier = 1, Uses = [RM] in
+def TCRETURNri : Pseudo<(outs), (ins CTRRC:$dst, i32imm:$offset),
+ "#TC_RETURNr $dst $offset",
+ []>;
+
+
+let isCodeGenOnly = 1 in {
+
+let isTerminator = 1, isBarrier = 1, PPC970_Unit = 7, isBranch = 1,
+ isIndirectBranch = 1, isCall = 1, isReturn = 1, Uses = [CTR, RM] in
+def TAILBCTR : XLForm_2_ext<19, 528, 20, 0, 0, (outs), (ins), "bctr", BrB, []>,
+ Requires<[In32BitMode]>;
+
+
+
+let isBranch = 1, isTerminator = 1, hasCtrlDep = 1, PPC970_Unit = 7,
+ isBarrier = 1, isCall = 1, isReturn = 1, Uses = [RM] in
+def TAILB : IForm<18, 0, 0, (outs), (ins calltarget:$dst),
+ "b $dst", BrB,
+ []>;
+
+}
+
+let isBranch = 1, isTerminator = 1, hasCtrlDep = 1, PPC970_Unit = 7,
+ isBarrier = 1, isCall = 1, isReturn = 1, Uses = [RM] in
+def TAILBA : IForm<18, 0, 0, (outs), (ins aaddr:$dst),
+ "ba $dst", BrB,
+ []>;
+
+let hasSideEffects = 1, isBarrier = 1, usesCustomInserter = 1 in {
+ def EH_SjLj_SetJmp32 : Pseudo<(outs GPRC:$dst), (ins memr:$buf),
+ "#EH_SJLJ_SETJMP32",
+ [(set i32:$dst, (PPCeh_sjlj_setjmp addr:$buf))]>,
+ Requires<[In32BitMode]>;
+ let isTerminator = 1 in
+ def EH_SjLj_LongJmp32 : Pseudo<(outs), (ins memr:$buf),
+ "#EH_SJLJ_LONGJMP32",
+ [(PPCeh_sjlj_longjmp addr:$buf)]>,
+ Requires<[In32BitMode]>;
+}
+
+let isBranch = 1, isTerminator = 1 in {
+ def EH_SjLj_Setup : Pseudo<(outs), (ins directbrtarget:$dst),
+ "#EH_SjLj_Setup\t$dst", []>;
+}
+
+// DCB* instructions.
+def DCBA : DCB_Form<758, 0, (outs), (ins memrr:$dst),
+ "dcba $dst", LdStDCBF, [(int_ppc_dcba xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBF : DCB_Form<86, 0, (outs), (ins memrr:$dst),
+ "dcbf $dst", LdStDCBF, [(int_ppc_dcbf xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBI : DCB_Form<470, 0, (outs), (ins memrr:$dst),
+ "dcbi $dst", LdStDCBF, [(int_ppc_dcbi xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBST : DCB_Form<54, 0, (outs), (ins memrr:$dst),
+ "dcbst $dst", LdStDCBF, [(int_ppc_dcbst xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBT : DCB_Form<278, 0, (outs), (ins memrr:$dst),
+ "dcbt $dst", LdStDCBF, [(int_ppc_dcbt xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBTST : DCB_Form<246, 0, (outs), (ins memrr:$dst),
+ "dcbtst $dst", LdStDCBF, [(int_ppc_dcbtst xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBZ : DCB_Form<1014, 0, (outs), (ins memrr:$dst),
+ "dcbz $dst", LdStDCBF, [(int_ppc_dcbz xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+def DCBZL : DCB_Form<1014, 1, (outs), (ins memrr:$dst),
+ "dcbzl $dst", LdStDCBF, [(int_ppc_dcbzl xoaddr:$dst)]>,
+ PPC970_DGroup_Single;
+
+def : Pat<(prefetch xoaddr:$dst, (i32 0), imm, (i32 1)),
+ (DCBT xoaddr:$dst)>;
+
+// Atomic operations
+let usesCustomInserter = 1 in {
+ let Defs = [CR0] in {
+ def ATOMIC_LOAD_ADD_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_ADD_I8",
+ [(set i32:$dst, (atomic_load_add_8 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_SUB_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_SUB_I8",
+ [(set i32:$dst, (atomic_load_sub_8 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_AND_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_AND_I8",
+ [(set i32:$dst, (atomic_load_and_8 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_OR_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_OR_I8",
+ [(set i32:$dst, (atomic_load_or_8 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_XOR_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "ATOMIC_LOAD_XOR_I8",
+ [(set i32:$dst, (atomic_load_xor_8 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_NAND_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_NAND_I8",
+ [(set i32:$dst, (atomic_load_nand_8 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_ADD_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_ADD_I16",
+ [(set i32:$dst, (atomic_load_add_16 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_SUB_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_SUB_I16",
+ [(set i32:$dst, (atomic_load_sub_16 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_AND_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_AND_I16",
+ [(set i32:$dst, (atomic_load_and_16 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_OR_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_OR_I16",
+ [(set i32:$dst, (atomic_load_or_16 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_XOR_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_XOR_I16",
+ [(set i32:$dst, (atomic_load_xor_16 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_NAND_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_NAND_I16",
+ [(set i32:$dst, (atomic_load_nand_16 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_ADD_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_ADD_I32",
+ [(set i32:$dst, (atomic_load_add_32 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_SUB_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_SUB_I32",
+ [(set i32:$dst, (atomic_load_sub_32 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_AND_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_AND_I32",
+ [(set i32:$dst, (atomic_load_and_32 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_OR_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_OR_I32",
+ [(set i32:$dst, (atomic_load_or_32 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_XOR_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_XOR_I32",
+ [(set i32:$dst, (atomic_load_xor_32 xoaddr:$ptr, i32:$incr))]>;
+ def ATOMIC_LOAD_NAND_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$incr), "#ATOMIC_LOAD_NAND_I32",
+ [(set i32:$dst, (atomic_load_nand_32 xoaddr:$ptr, i32:$incr))]>;
+
+ def ATOMIC_CMP_SWAP_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$old, GPRC:$new), "#ATOMIC_CMP_SWAP_I8",
+ [(set i32:$dst, (atomic_cmp_swap_8 xoaddr:$ptr, i32:$old, i32:$new))]>;
+ def ATOMIC_CMP_SWAP_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$old, GPRC:$new), "#ATOMIC_CMP_SWAP_I16 $dst $ptr $old $new",
+ [(set i32:$dst, (atomic_cmp_swap_16 xoaddr:$ptr, i32:$old, i32:$new))]>;
+ def ATOMIC_CMP_SWAP_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$old, GPRC:$new), "#ATOMIC_CMP_SWAP_I32 $dst $ptr $old $new",
+ [(set i32:$dst, (atomic_cmp_swap_32 xoaddr:$ptr, i32:$old, i32:$new))]>;
+
+ def ATOMIC_SWAP_I8 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$new), "#ATOMIC_SWAP_i8",
+ [(set i32:$dst, (atomic_swap_8 xoaddr:$ptr, i32:$new))]>;
+ def ATOMIC_SWAP_I16 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$new), "#ATOMIC_SWAP_I16",
+ [(set i32:$dst, (atomic_swap_16 xoaddr:$ptr, i32:$new))]>;
+ def ATOMIC_SWAP_I32 : Pseudo<
+ (outs GPRC:$dst), (ins memrr:$ptr, GPRC:$new), "#ATOMIC_SWAP_I32",
+ [(set i32:$dst, (atomic_swap_32 xoaddr:$ptr, i32:$new))]>;
+ }
+}
+
+// Instructions to support atomic operations
+def LWARX : XForm_1<31, 20, (outs GPRC:$rD), (ins memrr:$src),
+ "lwarx $rD, $src", LdStLWARX,
+ [(set i32:$rD, (PPClarx xoaddr:$src))]>;
+
+let Defs = [CR0] in
+def STWCX : XForm_1<31, 150, (outs), (ins GPRC:$rS, memrr:$dst),
+ "stwcx. $rS, $dst", LdStSTWCX,
+ [(PPCstcx i32:$rS, xoaddr:$dst)]>,
+ isDOT;
+
+let isTerminator = 1, isBarrier = 1, hasCtrlDep = 1 in
+def TRAP : XForm_24<31, 4, (outs), (ins), "trap", LdStLoad, [(trap)]>;
+
+//===----------------------------------------------------------------------===//
+// PPC32 Load Instructions.
+//
+
+// Unindexed (r+i) Loads.
+let canFoldAsLoad = 1, PPC970_Unit = 2 in {
+def LBZ : DForm_1<34, (outs GPRC:$rD), (ins memri:$src),
+ "lbz $rD, $src", LdStLoad,
+ [(set i32:$rD, (zextloadi8 iaddr:$src))]>;
+def LHA : DForm_1<42, (outs GPRC:$rD), (ins memri:$src),
+ "lha $rD, $src", LdStLHA,
+ [(set i32:$rD, (sextloadi16 iaddr:$src))]>,
+ PPC970_DGroup_Cracked;
+def LHZ : DForm_1<40, (outs GPRC:$rD), (ins memri:$src),
+ "lhz $rD, $src", LdStLoad,
+ [(set i32:$rD, (zextloadi16 iaddr:$src))]>;
+def LWZ : DForm_1<32, (outs GPRC:$rD), (ins memri:$src),
+ "lwz $rD, $src", LdStLoad,
+ [(set i32:$rD, (load iaddr:$src))]>;
+
+def LFS : DForm_1<48, (outs F4RC:$rD), (ins memri:$src),
+ "lfs $rD, $src", LdStLFD,
+ [(set f32:$rD, (load iaddr:$src))]>;
+def LFD : DForm_1<50, (outs F8RC:$rD), (ins memri:$src),
+ "lfd $rD, $src", LdStLFD,
+ [(set f64:$rD, (load iaddr:$src))]>;
+
+
+// Unindexed (r+i) Loads with Update (preinc).
+let mayLoad = 1 in {
+def LBZU : DForm_1<35, (outs GPRC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lbzu $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LHAU : DForm_1<43, (outs GPRC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lhau $rD, $addr", LdStLHAU,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LHZU : DForm_1<41, (outs GPRC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lhzu $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LWZU : DForm_1<33, (outs GPRC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lwzu $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LFSU : DForm_1<49, (outs F4RC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lfsu $rD, $addr", LdStLFDU,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LFDU : DForm_1<51, (outs F8RC:$rD, ptr_rc_nor0:$ea_result), (ins memri:$addr),
+ "lfdu $rD, $addr", LdStLFDU,
+ []>, RegConstraint<"$addr.reg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+
+// Indexed (r+r) Loads with Update (preinc).
+def LBZUX : XForm_1<31, 119, (outs GPRC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lbzux $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LHAUX : XForm_1<31, 375, (outs GPRC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lhaux $rD, $addr", LdStLHAU,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LHZUX : XForm_1<31, 311, (outs GPRC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lhzux $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LWZUX : XForm_1<31, 55, (outs GPRC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lwzux $rD, $addr", LdStLoadUpd,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LFSUX : XForm_1<31, 567, (outs F4RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lfsux $rD, $addr", LdStLFDU,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+
+def LFDUX : XForm_1<31, 631, (outs F8RC:$rD, ptr_rc_nor0:$ea_result),
+ (ins memrr:$addr),
+ "lfdux $rD, $addr", LdStLFDU,
+ []>, RegConstraint<"$addr.ptrreg = $ea_result">,
+ NoEncode<"$ea_result">;
+}
+}
+
+// Indexed (r+r) Loads.
+//
+let canFoldAsLoad = 1, PPC970_Unit = 2 in {
+def LBZX : XForm_1<31, 87, (outs GPRC:$rD), (ins memrr:$src),
+ "lbzx $rD, $src", LdStLoad,
+ [(set i32:$rD, (zextloadi8 xaddr:$src))]>;
+def LHAX : XForm_1<31, 343, (outs GPRC:$rD), (ins memrr:$src),
+ "lhax $rD, $src", LdStLHA,
+ [(set i32:$rD, (sextloadi16 xaddr:$src))]>,
+ PPC970_DGroup_Cracked;
+def LHZX : XForm_1<31, 279, (outs GPRC:$rD), (ins memrr:$src),
+ "lhzx $rD, $src", LdStLoad,
+ [(set i32:$rD, (zextloadi16 xaddr:$src))]>;
+def LWZX : XForm_1<31, 23, (outs GPRC:$rD), (ins memrr:$src),
+ "lwzx $rD, $src", LdStLoad,
+ [(set i32:$rD, (load xaddr:$src))]>;
+
+
+def LHBRX : XForm_1<31, 790, (outs GPRC:$rD), (ins memrr:$src),
+ "lhbrx $rD, $src", LdStLoad,
+ [(set i32:$rD, (PPClbrx xoaddr:$src, i16))]>;
+def LWBRX : XForm_1<31, 534, (outs GPRC:$rD), (ins memrr:$src),
+ "lwbrx $rD, $src", LdStLoad,
+ [(set i32:$rD, (PPClbrx xoaddr:$src, i32))]>;
+
+def LFSX : XForm_25<31, 535, (outs F4RC:$frD), (ins memrr:$src),
+ "lfsx $frD, $src", LdStLFD,
+ [(set f32:$frD, (load xaddr:$src))]>;
+def LFDX : XForm_25<31, 599, (outs F8RC:$frD), (ins memrr:$src),
+ "lfdx $frD, $src", LdStLFD,
+ [(set f64:$frD, (load xaddr:$src))]>;
+
+def LFIWAX : XForm_25<31, 855, (outs F8RC:$frD), (ins memrr:$src),
+ "lfiwax $frD, $src", LdStLFD,
+ [(set f64:$frD, (PPClfiwax xoaddr:$src))]>;
+def LFIWZX : XForm_25<31, 887, (outs F8RC:$frD), (ins memrr:$src),
+ "lfiwzx $frD, $src", LdStLFD,
+ [(set f64:$frD, (PPClfiwzx xoaddr:$src))]>;
+}
+
+//===----------------------------------------------------------------------===//
+// PPC32 Store Instructions.
+//
+
+// Unindexed (r+i) Stores.
+let PPC970_Unit = 2 in {
+def STB : DForm_1<38, (outs), (ins GPRC:$rS, memri:$src),
+ "stb $rS, $src", LdStStore,
+ [(truncstorei8 i32:$rS, iaddr:$src)]>;
+def STH : DForm_1<44, (outs), (ins GPRC:$rS, memri:$src),
+ "sth $rS, $src", LdStStore,
+ [(truncstorei16 i32:$rS, iaddr:$src)]>;
+def STW : DForm_1<36, (outs), (ins GPRC:$rS, memri:$src),
+ "stw $rS, $src", LdStStore,
+ [(store i32:$rS, iaddr:$src)]>;
+def STFS : DForm_1<52, (outs), (ins F4RC:$rS, memri:$dst),
+ "stfs $rS, $dst", LdStSTFD,
+ [(store f32:$rS, iaddr:$dst)]>;
+def STFD : DForm_1<54, (outs), (ins F8RC:$rS, memri:$dst),
+ "stfd $rS, $dst", LdStSTFD,
+ [(store f64:$rS, iaddr:$dst)]>;
+}
+
+// Unindexed (r+i) Stores with Update (preinc).
+let PPC970_Unit = 2, mayStore = 1 in {
+def STBU : DForm_1<39, (outs ptr_rc_nor0:$ea_res), (ins GPRC:$rS, memri:$dst),
+ "stbu $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STHU : DForm_1<45, (outs ptr_rc_nor0:$ea_res), (ins GPRC:$rS, memri:$dst),
+ "sthu $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STWU : DForm_1<37, (outs ptr_rc_nor0:$ea_res), (ins GPRC:$rS, memri:$dst),
+ "stwu $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STFSU : DForm_1<37, (outs ptr_rc_nor0:$ea_res), (ins F4RC:$rS, memri:$dst),
+ "stfsu $rS, $dst", LdStSTFDU, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+def STFDU : DForm_1<37, (outs ptr_rc_nor0:$ea_res), (ins F8RC:$rS, memri:$dst),
+ "stfdu $rS, $dst", LdStSTFDU, []>,
+ RegConstraint<"$dst.reg = $ea_res">, NoEncode<"$ea_res">;
+}
+
+// Patterns to match the pre-inc stores. We can't put the patterns on
+// the instruction definitions directly as ISel wants the address base
+// and offset to be separate operands, not a single complex operand.
+def : Pat<(pre_truncsti8 i32:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STBU $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(pre_truncsti16 i32:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STHU $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(pre_store i32:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STWU $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(pre_store f32:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STFSU $rS, iaddroff:$ptroff, $ptrreg)>;
+def : Pat<(pre_store f64:$rS, iPTR:$ptrreg, iaddroff:$ptroff),
+ (STFDU $rS, iaddroff:$ptroff, $ptrreg)>;
+
+// Indexed (r+r) Stores.
+let PPC970_Unit = 2 in {
+def STBX : XForm_8<31, 215, (outs), (ins GPRC:$rS, memrr:$dst),
+ "stbx $rS, $dst", LdStStore,
+ [(truncstorei8 i32:$rS, xaddr:$dst)]>,
+ PPC970_DGroup_Cracked;
+def STHX : XForm_8<31, 407, (outs), (ins GPRC:$rS, memrr:$dst),
+ "sthx $rS, $dst", LdStStore,
+ [(truncstorei16 i32:$rS, xaddr:$dst)]>,
+ PPC970_DGroup_Cracked;
+def STWX : XForm_8<31, 151, (outs), (ins GPRC:$rS, memrr:$dst),
+ "stwx $rS, $dst", LdStStore,
+ [(store i32:$rS, xaddr:$dst)]>,
+ PPC970_DGroup_Cracked;
+
+def STHBRX: XForm_8<31, 918, (outs), (ins GPRC:$rS, memrr:$dst),
+ "sthbrx $rS, $dst", LdStStore,
+ [(PPCstbrx i32:$rS, xoaddr:$dst, i16)]>,
+ PPC970_DGroup_Cracked;
+def STWBRX: XForm_8<31, 662, (outs), (ins GPRC:$rS, memrr:$dst),
+ "stwbrx $rS, $dst", LdStStore,
+ [(PPCstbrx i32:$rS, xoaddr:$dst, i32)]>,
+ PPC970_DGroup_Cracked;
+
+def STFIWX: XForm_28<31, 983, (outs), (ins F8RC:$frS, memrr:$dst),
+ "stfiwx $frS, $dst", LdStSTFD,
+ [(PPCstfiwx f64:$frS, xoaddr:$dst)]>;
+
+def STFSX : XForm_28<31, 663, (outs), (ins F4RC:$frS, memrr:$dst),
+ "stfsx $frS, $dst", LdStSTFD,
+ [(store f32:$frS, xaddr:$dst)]>;
+def STFDX : XForm_28<31, 727, (outs), (ins F8RC:$frS, memrr:$dst),
+ "stfdx $frS, $dst", LdStSTFD,
+ [(store f64:$frS, xaddr:$dst)]>;
+}
+
+// Indexed (r+r) Stores with Update (preinc).
+let PPC970_Unit = 2, mayStore = 1 in {
+def STBUX : XForm_8<31, 247, (outs ptr_rc_nor0:$ea_res), (ins GPRC:$rS, memrr:$dst),
+ "stbux $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STHUX : XForm_8<31, 439, (outs ptr_rc_nor0:$ea_res), (ins GPRC:$rS, memrr:$dst),
+ "sthux $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STWUX : XForm_8<31, 183, (outs ptr_rc_nor0:$ea_res), (ins GPRC:$rS, memrr:$dst),
+ "stwux $rS, $dst", LdStStoreUpd, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STFSUX: XForm_8<31, 695, (outs ptr_rc_nor0:$ea_res), (ins F4RC:$rS, memrr:$dst),
+ "stfsux $rS, $dst", LdStSTFDU, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+def STFDUX: XForm_8<31, 759, (outs ptr_rc_nor0:$ea_res), (ins F8RC:$rS, memrr:$dst),
+ "stfdux $rS, $dst", LdStSTFDU, []>,
+ RegConstraint<"$dst.ptrreg = $ea_res">, NoEncode<"$ea_res">,
+ PPC970_DGroup_Cracked;
+}
+
+// Patterns to match the pre-inc stores. We can't put the patterns on
+// the instruction definitions directly as ISel wants the address base
+// and offset to be separate operands, not a single complex operand.
+def : Pat<(pre_truncsti8 i32:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STBUX $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_truncsti16 i32:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STHUX $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_store i32:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STWUX $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_store f32:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STFSUX $rS, $ptrreg, $ptroff)>;
+def : Pat<(pre_store f64:$rS, iPTR:$ptrreg, iPTR:$ptroff),
+ (STFDUX $rS, $ptrreg, $ptroff)>;
+
+def SYNC : XForm_24_sync<31, 598, (outs), (ins),
+ "sync", LdStSync,
+ [(int_ppc_sync)]>;
+
+//===----------------------------------------------------------------------===//
+// PPC32 Arithmetic Instructions.
+//
+
+let PPC970_Unit = 1 in { // FXU Operations.
+def ADDI : DForm_2<14, (outs GPRC:$rD), (ins GPRC_NOR0:$rA, symbolLo:$imm),
+ "addi $rD, $rA, $imm", IntSimple,
+ [(set i32:$rD, (add i32:$rA, immSExt16:$imm))]>;
+let Defs = [CARRY] in {
+def ADDIC : DForm_2<12, (outs GPRC:$rD), (ins GPRC:$rA, s16imm:$imm),
+ "addic $rD, $rA, $imm", IntGeneral,
+ [(set i32:$rD, (addc i32:$rA, immSExt16:$imm))]>,
+ PPC970_DGroup_Cracked;
+def ADDICo : DForm_2<13, (outs GPRC:$rD), (ins GPRC:$rA, s16imm:$imm),
+ "addic. $rD, $rA, $imm", IntGeneral,
+ []>;
+}
+def ADDIS : DForm_2<15, (outs GPRC:$rD), (ins GPRC_NOR0:$rA, symbolHi:$imm),
+ "addis $rD, $rA, $imm", IntSimple,
+ [(set i32:$rD, (add i32:$rA, imm16ShiftedSExt:$imm))]>;
+let isCodeGenOnly = 1 in
+def LA : DForm_2<14, (outs GPRC:$rD), (ins GPRC_NOR0:$rA, symbolLo:$sym),
+ "la $rD, $sym($rA)", IntGeneral,
+ [(set i32:$rD, (add i32:$rA,
+ (PPClo tglobaladdr:$sym, 0)))]>;
+def MULLI : DForm_2< 7, (outs GPRC:$rD), (ins GPRC:$rA, s16imm:$imm),
+ "mulli $rD, $rA, $imm", IntMulLI,
+ [(set i32:$rD, (mul i32:$rA, immSExt16:$imm))]>;
+let Defs = [CARRY] in {
+def SUBFIC : DForm_2< 8, (outs GPRC:$rD), (ins GPRC:$rA, s16imm:$imm),
+ "subfic $rD, $rA, $imm", IntGeneral,
+ [(set i32:$rD, (subc immSExt16:$imm, i32:$rA))]>;
+}
+
+let isReMaterializable = 1, isAsCheapAsAMove = 1, isMoveImm = 1 in {
+ def LI : DForm_2_r0<14, (outs GPRC:$rD), (ins symbolLo:$imm),
+ "li $rD, $imm", IntSimple,
+ [(set i32:$rD, immSExt16:$imm)]>;
+ def LIS : DForm_2_r0<15, (outs GPRC:$rD), (ins symbolHi:$imm),
+ "lis $rD, $imm", IntSimple,
+ [(set i32:$rD, imm16ShiftedSExt:$imm)]>;
+}
+}
+
+let PPC970_Unit = 1 in { // FXU Operations.
+def ANDIo : DForm_4<28, (outs GPRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "andi. $dst, $src1, $src2", IntGeneral,
+ [(set i32:$dst, (and i32:$src1, immZExt16:$src2))]>,
+ isDOT;
+def ANDISo : DForm_4<29, (outs GPRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "andis. $dst, $src1, $src2", IntGeneral,
+ [(set i32:$dst, (and i32:$src1, imm16ShiftedZExt:$src2))]>,
+ isDOT;
+def ORI : DForm_4<24, (outs GPRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "ori $dst, $src1, $src2", IntSimple,
+ [(set i32:$dst, (or i32:$src1, immZExt16:$src2))]>;
+def ORIS : DForm_4<25, (outs GPRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "oris $dst, $src1, $src2", IntSimple,
+ [(set i32:$dst, (or i32:$src1, imm16ShiftedZExt:$src2))]>;
+def XORI : DForm_4<26, (outs GPRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "xori $dst, $src1, $src2", IntSimple,
+ [(set i32:$dst, (xor i32:$src1, immZExt16:$src2))]>;
+def XORIS : DForm_4<27, (outs GPRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "xoris $dst, $src1, $src2", IntSimple,
+ [(set i32:$dst, (xor i32:$src1, imm16ShiftedZExt:$src2))]>;
+def NOP : DForm_4_zero<24, (outs), (ins), "nop", IntSimple,
+ []>;
+def CMPWI : DForm_5_ext<11, (outs CRRC:$crD), (ins GPRC:$rA, s16imm:$imm),
+ "cmpwi $crD, $rA, $imm", IntCompare>;
+def CMPLWI : DForm_6_ext<10, (outs CRRC:$dst), (ins GPRC:$src1, u16imm:$src2),
+ "cmplwi $dst, $src1, $src2", IntCompare>;
+}
+
+
+let PPC970_Unit = 1 in { // FXU Operations.
+def NAND : XForm_6<31, 476, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "nand $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (not (and i32:$rS, i32:$rB)))]>;
+def AND : XForm_6<31, 28, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "and $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (and i32:$rS, i32:$rB))]>;
+def ANDC : XForm_6<31, 60, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "andc $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (and i32:$rS, (not i32:$rB)))]>;
+def OR : XForm_6<31, 444, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "or $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (or i32:$rS, i32:$rB))]>;
+def NOR : XForm_6<31, 124, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "nor $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (not (or i32:$rS, i32:$rB)))]>;
+def ORC : XForm_6<31, 412, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "orc $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (or i32:$rS, (not i32:$rB)))]>;
+def EQV : XForm_6<31, 284, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "eqv $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (not (xor i32:$rS, i32:$rB)))]>;
+def XOR : XForm_6<31, 316, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "xor $rA, $rS, $rB", IntSimple,
+ [(set i32:$rA, (xor i32:$rS, i32:$rB))]>;
+def SLW : XForm_6<31, 24, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "slw $rA, $rS, $rB", IntGeneral,
+ [(set i32:$rA, (PPCshl i32:$rS, i32:$rB))]>;
+def SRW : XForm_6<31, 536, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "srw $rA, $rS, $rB", IntGeneral,
+ [(set i32:$rA, (PPCsrl i32:$rS, i32:$rB))]>;
+let Defs = [CARRY] in {
+def SRAW : XForm_6<31, 792, (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB),
+ "sraw $rA, $rS, $rB", IntShift,
+ [(set i32:$rA, (PPCsra i32:$rS, i32:$rB))]>;
+}
+}
+
+let PPC970_Unit = 1 in { // FXU Operations.
+let Defs = [CARRY] in {
+def SRAWI : XForm_10<31, 824, (outs GPRC:$rA), (ins GPRC:$rS, u5imm:$SH),
+ "srawi $rA, $rS, $SH", IntShift,
+ [(set i32:$rA, (sra i32:$rS, (i32 imm:$SH)))]>;
+}
+def CNTLZW : XForm_11<31, 26, (outs GPRC:$rA), (ins GPRC:$rS),
+ "cntlzw $rA, $rS", IntGeneral,
+ [(set i32:$rA, (ctlz i32:$rS))]>;
+def EXTSB : XForm_11<31, 954, (outs GPRC:$rA), (ins GPRC:$rS),
+ "extsb $rA, $rS", IntSimple,
+ [(set i32:$rA, (sext_inreg i32:$rS, i8))]>;
+def EXTSH : XForm_11<31, 922, (outs GPRC:$rA), (ins GPRC:$rS),
+ "extsh $rA, $rS", IntSimple,
+ [(set i32:$rA, (sext_inreg i32:$rS, i16))]>;
+
+def CMPW : XForm_16_ext<31, 0, (outs CRRC:$crD), (ins GPRC:$rA, GPRC:$rB),
+ "cmpw $crD, $rA, $rB", IntCompare>;
+def CMPLW : XForm_16_ext<31, 32, (outs CRRC:$crD), (ins GPRC:$rA, GPRC:$rB),
+ "cmplw $crD, $rA, $rB", IntCompare>;
+}
+let PPC970_Unit = 3 in { // FPU Operations.
+//def FCMPO : XForm_17<63, 32, (outs CRRC:$crD), (ins FPRC:$fA, FPRC:$fB),
+// "fcmpo $crD, $fA, $fB", FPCompare>;
+def FCMPUS : XForm_17<63, 0, (outs CRRC:$crD), (ins F4RC:$fA, F4RC:$fB),
+ "fcmpu $crD, $fA, $fB", FPCompare>;
+def FCMPUD : XForm_17<63, 0, (outs CRRC:$crD), (ins F8RC:$fA, F8RC:$fB),
+ "fcmpu $crD, $fA, $fB", FPCompare>;
+
+let Uses = [RM] in {
+ def FCTIWZ : XForm_26<63, 15, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fctiwz $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfctiwz f64:$frB))]>;
+
+ def FRSP : XForm_26<63, 12, (outs F4RC:$frD), (ins F8RC:$frB),
+ "frsp $frD, $frB", FPGeneral,
+ [(set f32:$frD, (fround f64:$frB))]>;
+
+ // The frin -> nearbyint mapping is valid only in fast-math mode.
+ def FRIND : XForm_26<63, 392, (outs F8RC:$frD), (ins F8RC:$frB),
+ "frin $frD, $frB", FPGeneral,
+ [(set f64:$frD, (fnearbyint f64:$frB))]>;
+ def FRINS : XForm_26<63, 392, (outs F4RC:$frD), (ins F4RC:$frB),
+ "frin $frD, $frB", FPGeneral,
+ [(set f32:$frD, (fnearbyint f32:$frB))]>;
+
+ // These pseudos expand to rint but also set FE_INEXACT when the result does
+ // not equal the argument.
+ let usesCustomInserter = 1, Defs = [RM] in { // FIXME: Model FPSCR!
+ def FRINDrint : Pseudo<(outs F8RC:$frD), (ins F8RC:$frB),
+ "#FRINDrint", [(set f64:$frD, (frint f64:$frB))]>;
+ def FRINSrint : Pseudo<(outs F4RC:$frD), (ins F4RC:$frB),
+ "#FRINSrint", [(set f32:$frD, (frint f32:$frB))]>;
+ }
+
+ def FRIPD : XForm_26<63, 456, (outs F8RC:$frD), (ins F8RC:$frB),
+ "frip $frD, $frB", FPGeneral,
+ [(set f64:$frD, (fceil f64:$frB))]>;
+ def FRIPS : XForm_26<63, 456, (outs F4RC:$frD), (ins F4RC:$frB),
+ "frip $frD, $frB", FPGeneral,
+ [(set f32:$frD, (fceil f32:$frB))]>;
+ def FRIZD : XForm_26<63, 424, (outs F8RC:$frD), (ins F8RC:$frB),
+ "friz $frD, $frB", FPGeneral,
+ [(set f64:$frD, (ftrunc f64:$frB))]>;
+ def FRIZS : XForm_26<63, 424, (outs F4RC:$frD), (ins F4RC:$frB),
+ "friz $frD, $frB", FPGeneral,
+ [(set f32:$frD, (ftrunc f32:$frB))]>;
+ def FRIMD : XForm_26<63, 488, (outs F8RC:$frD), (ins F8RC:$frB),
+ "frim $frD, $frB", FPGeneral,
+ [(set f64:$frD, (ffloor f64:$frB))]>;
+ def FRIMS : XForm_26<63, 488, (outs F4RC:$frD), (ins F4RC:$frB),
+ "frim $frD, $frB", FPGeneral,
+ [(set f32:$frD, (ffloor f32:$frB))]>;
+
+ def FSQRT : XForm_26<63, 22, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fsqrt $frD, $frB", FPSqrt,
+ [(set f64:$frD, (fsqrt f64:$frB))]>;
+ def FSQRTS : XForm_26<59, 22, (outs F4RC:$frD), (ins F4RC:$frB),
+ "fsqrts $frD, $frB", FPSqrt,
+ [(set f32:$frD, (fsqrt f32:$frB))]>;
+ }
+}
+
+/// Note that FMR is defined as pseudo-ops on the PPC970 because they are
+/// often coalesced away and we don't want the dispatch group builder to think
+/// that they will fill slots (which could cause the load of a LSU reject to
+/// sneak into a d-group with a store).
+def FMR : XForm_26<63, 72, (outs F4RC:$frD), (ins F4RC:$frB),
+ "fmr $frD, $frB", FPGeneral,
+ []>, // (set f32:$frD, f32:$frB)
+ PPC970_Unit_Pseudo;
+
+let PPC970_Unit = 3 in { // FPU Operations.
+// These are artificially split into two different forms, for 4/8 byte FP.
+def FABSS : XForm_26<63, 264, (outs F4RC:$frD), (ins F4RC:$frB),
+ "fabs $frD, $frB", FPGeneral,
+ [(set f32:$frD, (fabs f32:$frB))]>;
+def FABSD : XForm_26<63, 264, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fabs $frD, $frB", FPGeneral,
+ [(set f64:$frD, (fabs f64:$frB))]>;
+def FNABSS : XForm_26<63, 136, (outs F4RC:$frD), (ins F4RC:$frB),
+ "fnabs $frD, $frB", FPGeneral,
+ [(set f32:$frD, (fneg (fabs f32:$frB)))]>;
+def FNABSD : XForm_26<63, 136, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fnabs $frD, $frB", FPGeneral,
+ [(set f64:$frD, (fneg (fabs f64:$frB)))]>;
+def FNEGS : XForm_26<63, 40, (outs F4RC:$frD), (ins F4RC:$frB),
+ "fneg $frD, $frB", FPGeneral,
+ [(set f32:$frD, (fneg f32:$frB))]>;
+def FNEGD : XForm_26<63, 40, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fneg $frD, $frB", FPGeneral,
+ [(set f64:$frD, (fneg f64:$frB))]>;
+
+// Reciprocal estimates.
+def FRE : XForm_26<63, 24, (outs F8RC:$frD), (ins F8RC:$frB),
+ "fre $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfre f64:$frB))]>;
+def FRES : XForm_26<59, 24, (outs F4RC:$frD), (ins F4RC:$frB),
+ "fres $frD, $frB", FPGeneral,
+ [(set f32:$frD, (PPCfre f32:$frB))]>;
+def FRSQRTE : XForm_26<63, 26, (outs F8RC:$frD), (ins F8RC:$frB),
+ "frsqrte $frD, $frB", FPGeneral,
+ [(set f64:$frD, (PPCfrsqrte f64:$frB))]>;
+def FRSQRTES : XForm_26<59, 26, (outs F4RC:$frD), (ins F4RC:$frB),
+ "frsqrtes $frD, $frB", FPGeneral,
+ [(set f32:$frD, (PPCfrsqrte f32:$frB))]>;
+}
+
+// XL-Form instructions. condition register logical ops.
+//
+def MCRF : XLForm_3<19, 0, (outs CRRC:$BF), (ins CRRC:$BFA),
+ "mcrf $BF, $BFA", BrMCR>,
+ PPC970_DGroup_First, PPC970_Unit_CRU;
+
+def CREQV : XLForm_1<19, 289, (outs CRBITRC:$CRD),
+ (ins CRBITRC:$CRA, CRBITRC:$CRB),
+ "creqv $CRD, $CRA, $CRB", BrCR,
+ []>;
+
+def CROR : XLForm_1<19, 449, (outs CRBITRC:$CRD),
+ (ins CRBITRC:$CRA, CRBITRC:$CRB),
+ "cror $CRD, $CRA, $CRB", BrCR,
+ []>;
+
+let isCodeGenOnly = 1 in {
+def CRSET : XLForm_1_ext<19, 289, (outs CRBITRC:$dst), (ins),
+ "creqv $dst, $dst, $dst", BrCR,
+ []>;
+
+def CRUNSET: XLForm_1_ext<19, 193, (outs CRBITRC:$dst), (ins),
+ "crxor $dst, $dst, $dst", BrCR,
+ []>;
+
+let Defs = [CR1EQ], CRD = 6 in {
+def CR6SET : XLForm_1_ext<19, 289, (outs), (ins),
+ "creqv 6, 6, 6", BrCR,
+ [(PPCcr6set)]>;
+
+def CR6UNSET: XLForm_1_ext<19, 193, (outs), (ins),
+ "crxor 6, 6, 6", BrCR,
+ [(PPCcr6unset)]>;
+}
+}
+
+// XFX-Form instructions. Instructions that deal with SPRs.
+//
+let Uses = [CTR] in {
+def MFCTR : XFXForm_1_ext<31, 339, 9, (outs GPRC:$rT), (ins),
+ "mfctr $rT", SprMFSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+let Defs = [CTR], Pattern = [(PPCmtctr i32:$rS)] in {
+def MTCTR : XFXForm_7_ext<31, 467, 9, (outs), (ins GPRC:$rS),
+ "mtctr $rS", SprMTSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+
+let Defs = [LR] in {
+def MTLR : XFXForm_7_ext<31, 467, 8, (outs), (ins GPRC:$rS),
+ "mtlr $rS", SprMTSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+let Uses = [LR] in {
+def MFLR : XFXForm_1_ext<31, 339, 8, (outs GPRC:$rT), (ins),
+ "mflr $rT", SprMFSPR>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+
+// Move to/from VRSAVE: despite being a SPR, the VRSAVE register is renamed like
+// a GPR on the PPC970. As such, copies in and out have the same performance
+// characteristics as an OR instruction.
+def MTVRSAVE : XFXForm_7_ext<31, 467, 256, (outs), (ins GPRC:$rS),
+ "mtspr 256, $rS", IntGeneral>,
+ PPC970_DGroup_Single, PPC970_Unit_FXU;
+def MFVRSAVE : XFXForm_1_ext<31, 339, 256, (outs GPRC:$rT), (ins),
+ "mfspr $rT, 256", IntGeneral>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+
+let isCodeGenOnly = 1 in {
+ def MTVRSAVEv : XFXForm_7_ext<31, 467, 256,
+ (outs VRSAVERC:$reg), (ins GPRC:$rS),
+ "mtspr 256, $rS", IntGeneral>,
+ PPC970_DGroup_Single, PPC970_Unit_FXU;
+ def MFVRSAVEv : XFXForm_1_ext<31, 339, 256, (outs GPRC:$rT),
+ (ins VRSAVERC:$reg),
+ "mfspr $rT, 256", IntGeneral>,
+ PPC970_DGroup_First, PPC970_Unit_FXU;
+}
+
+// SPILL_VRSAVE - Indicate that we're dumping the VRSAVE register,
+// so we'll need to scavenge a register for it.
+let mayStore = 1 in
+def SPILL_VRSAVE : Pseudo<(outs), (ins VRSAVERC:$vrsave, memri:$F),
+ "#SPILL_VRSAVE", []>;
+
+// RESTORE_VRSAVE - Indicate that we're restoring the VRSAVE register (previously
+// spilled), so we'll need to scavenge a register for it.
+let mayLoad = 1 in
+def RESTORE_VRSAVE : Pseudo<(outs VRSAVERC:$vrsave), (ins memri:$F),
+ "#RESTORE_VRSAVE", []>;
+
+def MTCRF : XFXForm_5<31, 144, (outs crbitm:$FXM), (ins GPRC:$rS),
+ "mtcrf $FXM, $rS", BrMCRX>,
+ PPC970_MicroCode, PPC970_Unit_CRU;
+
+// This is a pseudo for MFCR, which implicitly uses all 8 of its subregisters;
+// declaring that here gives the local register allocator problems with this:
+// vreg = MCRF CR0
+// MFCR <kill of whatever preg got assigned to vreg>
+// while not declaring it breaks DeadMachineInstructionElimination.
+// As it turns out, in all cases where we currently use this,
+// we're only interested in one subregister of it. Represent this in the
+// instruction to keep the register allocator from becoming confused.
+//
+// FIXME: Make this a real Pseudo instruction when the JIT switches to MC.
+let isCodeGenOnly = 1 in
+def MFCRpseud: XFXForm_3<31, 19, (outs GPRC:$rT), (ins crbitm:$FXM),
+ "#MFCRpseud", SprMFCR>,
+ PPC970_MicroCode, PPC970_Unit_CRU;
+
+def MFCR : XFXForm_3<31, 19, (outs GPRC:$rT), (ins),
+ "mfcr $rT", SprMFCR>,
+ PPC970_MicroCode, PPC970_Unit_CRU;
+
+def MFOCRF: XFXForm_5a<31, 19, (outs GPRC:$rT), (ins crbitm:$FXM),
+ "mfocrf $rT, $FXM", SprMFCR>,
+ PPC970_DGroup_First, PPC970_Unit_CRU;
+
+// Pseudo instruction to perform FADD in round-to-zero mode.
+let usesCustomInserter = 1, Uses = [RM] in {
+ def FADDrtz: Pseudo<(outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRB), "",
+ [(set f64:$FRT, (PPCfaddrtz f64:$FRA, f64:$FRB))]>;
+}
+
+// The above pseudo gets expanded to make use of the following instructions
+// to manipulate FPSCR. Note that FPSCR is not modeled at the DAG level.
+let Uses = [RM], Defs = [RM] in {
+ def MTFSB0 : XForm_43<63, 70, (outs), (ins u5imm:$FM),
+ "mtfsb0 $FM", IntMTFSB0, []>,
+ PPC970_DGroup_Single, PPC970_Unit_FPU;
+ def MTFSB1 : XForm_43<63, 38, (outs), (ins u5imm:$FM),
+ "mtfsb1 $FM", IntMTFSB0, []>,
+ PPC970_DGroup_Single, PPC970_Unit_FPU;
+ def MTFSF : XFLForm<63, 711, (outs), (ins i32imm:$FM, F8RC:$rT),
+ "mtfsf $FM, $rT", IntMTFSB0, []>,
+ PPC970_DGroup_Single, PPC970_Unit_FPU;
+}
+let Uses = [RM] in {
+ def MFFS : XForm_42<63, 583, (outs F8RC:$rT), (ins),
+ "mffs $rT", IntMFFS,
+ [(set f64:$rT, (PPCmffs))]>,
+ PPC970_DGroup_Single, PPC970_Unit_FPU;
+}
+
+
+let PPC970_Unit = 1 in { // FXU Operations.
+
+// XO-Form instructions. Arithmetic instructions that can set overflow bit
+//
+def ADD4 : XOForm_1<31, 266, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "add $rT, $rA, $rB", IntSimple,
+ [(set i32:$rT, (add i32:$rA, i32:$rB))]>;
+let Defs = [CARRY] in {
+def ADDC : XOForm_1<31, 10, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "addc $rT, $rA, $rB", IntGeneral,
+ [(set i32:$rT, (addc i32:$rA, i32:$rB))]>,
+ PPC970_DGroup_Cracked;
+}
+def DIVW : XOForm_1<31, 491, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "divw $rT, $rA, $rB", IntDivW,
+ [(set i32:$rT, (sdiv i32:$rA, i32:$rB))]>,
+ PPC970_DGroup_First, PPC970_DGroup_Cracked;
+def DIVWU : XOForm_1<31, 459, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "divwu $rT, $rA, $rB", IntDivW,
+ [(set i32:$rT, (udiv i32:$rA, i32:$rB))]>,
+ PPC970_DGroup_First, PPC970_DGroup_Cracked;
+def MULHW : XOForm_1<31, 75, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "mulhw $rT, $rA, $rB", IntMulHW,
+ [(set i32:$rT, (mulhs i32:$rA, i32:$rB))]>;
+def MULHWU : XOForm_1<31, 11, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "mulhwu $rT, $rA, $rB", IntMulHWU,
+ [(set i32:$rT, (mulhu i32:$rA, i32:$rB))]>;
+def MULLW : XOForm_1<31, 235, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "mullw $rT, $rA, $rB", IntMulHW,
+ [(set i32:$rT, (mul i32:$rA, i32:$rB))]>;
+def SUBF : XOForm_1<31, 40, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "subf $rT, $rA, $rB", IntGeneral,
+ [(set i32:$rT, (sub i32:$rB, i32:$rA))]>;
+let Defs = [CARRY] in {
+def SUBFC : XOForm_1<31, 8, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "subfc $rT, $rA, $rB", IntGeneral,
+ [(set i32:$rT, (subc i32:$rB, i32:$rA))]>,
+ PPC970_DGroup_Cracked;
+}
+def NEG : XOForm_3<31, 104, 0, (outs GPRC:$rT), (ins GPRC:$rA),
+ "neg $rT, $rA", IntSimple,
+ [(set i32:$rT, (ineg i32:$rA))]>;
+let Uses = [CARRY], Defs = [CARRY] in {
+def ADDE : XOForm_1<31, 138, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "adde $rT, $rA, $rB", IntGeneral,
+ [(set i32:$rT, (adde i32:$rA, i32:$rB))]>;
+def ADDME : XOForm_3<31, 234, 0, (outs GPRC:$rT), (ins GPRC:$rA),
+ "addme $rT, $rA", IntGeneral,
+ [(set i32:$rT, (adde i32:$rA, -1))]>;
+def ADDZE : XOForm_3<31, 202, 0, (outs GPRC:$rT), (ins GPRC:$rA),
+ "addze $rT, $rA", IntGeneral,
+ [(set i32:$rT, (adde i32:$rA, 0))]>;
+def SUBFE : XOForm_1<31, 136, 0, (outs GPRC:$rT), (ins GPRC:$rA, GPRC:$rB),
+ "subfe $rT, $rA, $rB", IntGeneral,
+ [(set i32:$rT, (sube i32:$rB, i32:$rA))]>;
+def SUBFME : XOForm_3<31, 232, 0, (outs GPRC:$rT), (ins GPRC:$rA),
+ "subfme $rT, $rA", IntGeneral,
+ [(set i32:$rT, (sube -1, i32:$rA))]>;
+def SUBFZE : XOForm_3<31, 200, 0, (outs GPRC:$rT), (ins GPRC:$rA),
+ "subfze $rT, $rA", IntGeneral,
+ [(set i32:$rT, (sube 0, i32:$rA))]>;
+}
+}
+
+// A-Form instructions. Most of the instructions executed in the FPU are of
+// this type.
+//
+let PPC970_Unit = 3 in { // FPU Operations.
+let Uses = [RM] in {
+ def FMADD : AForm_1<63, 29,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRC, F8RC:$FRB),
+ "fmadd $FRT, $FRA, $FRC, $FRB", FPFused,
+ [(set f64:$FRT, (fma f64:$FRA, f64:$FRC, f64:$FRB))]>;
+ def FMADDS : AForm_1<59, 29,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRC, F4RC:$FRB),
+ "fmadds $FRT, $FRA, $FRC, $FRB", FPGeneral,
+ [(set f32:$FRT, (fma f32:$FRA, f32:$FRC, f32:$FRB))]>;
+ def FMSUB : AForm_1<63, 28,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRC, F8RC:$FRB),
+ "fmsub $FRT, $FRA, $FRC, $FRB", FPFused,
+ [(set f64:$FRT,
+ (fma f64:$FRA, f64:$FRC, (fneg f64:$FRB)))]>;
+ def FMSUBS : AForm_1<59, 28,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRC, F4RC:$FRB),
+ "fmsubs $FRT, $FRA, $FRC, $FRB", FPGeneral,
+ [(set f32:$FRT,
+ (fma f32:$FRA, f32:$FRC, (fneg f32:$FRB)))]>;
+ def FNMADD : AForm_1<63, 31,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRC, F8RC:$FRB),
+ "fnmadd $FRT, $FRA, $FRC, $FRB", FPFused,
+ [(set f64:$FRT,
+ (fneg (fma f64:$FRA, f64:$FRC, f64:$FRB)))]>;
+ def FNMADDS : AForm_1<59, 31,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRC, F4RC:$FRB),
+ "fnmadds $FRT, $FRA, $FRC, $FRB", FPGeneral,
+ [(set f32:$FRT,
+ (fneg (fma f32:$FRA, f32:$FRC, f32:$FRB)))]>;
+ def FNMSUB : AForm_1<63, 30,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRC, F8RC:$FRB),
+ "fnmsub $FRT, $FRA, $FRC, $FRB", FPFused,
+ [(set f64:$FRT, (fneg (fma f64:$FRA, f64:$FRC,
+ (fneg f64:$FRB))))]>;
+ def FNMSUBS : AForm_1<59, 30,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRC, F4RC:$FRB),
+ "fnmsubs $FRT, $FRA, $FRC, $FRB", FPGeneral,
+ [(set f32:$FRT, (fneg (fma f32:$FRA, f32:$FRC,
+ (fneg f32:$FRB))))]>;
+}
+// FSEL is artificially split into 4 and 8-byte forms for the result. To avoid
+// having 4 of these, force the comparison to always be an 8-byte double (code
+// should use an FMRSD if the input comparison value really wants to be a float)
+// and 4/8 byte forms for the result and operand type..
+def FSELD : AForm_1<63, 23,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRC, F8RC:$FRB),
+ "fsel $FRT, $FRA, $FRC, $FRB", FPGeneral,
+ [(set f64:$FRT, (PPCfsel f64:$FRA, f64:$FRC, f64:$FRB))]>;
+def FSELS : AForm_1<63, 23,
+ (outs F4RC:$FRT), (ins F8RC:$FRA, F4RC:$FRC, F4RC:$FRB),
+ "fsel $FRT, $FRA, $FRC, $FRB", FPGeneral,
+ [(set f32:$FRT, (PPCfsel f64:$FRA, f32:$FRC, f32:$FRB))]>;
+let Uses = [RM] in {
+ def FADD : AForm_2<63, 21,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRB),
+ "fadd $FRT, $FRA, $FRB", FPAddSub,
+ [(set f64:$FRT, (fadd f64:$FRA, f64:$FRB))]>;
+ def FADDS : AForm_2<59, 21,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRB),
+ "fadds $FRT, $FRA, $FRB", FPGeneral,
+ [(set f32:$FRT, (fadd f32:$FRA, f32:$FRB))]>;
+ def FDIV : AForm_2<63, 18,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRB),
+ "fdiv $FRT, $FRA, $FRB", FPDivD,
+ [(set f64:$FRT, (fdiv f64:$FRA, f64:$FRB))]>;
+ def FDIVS : AForm_2<59, 18,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRB),
+ "fdivs $FRT, $FRA, $FRB", FPDivS,
+ [(set f32:$FRT, (fdiv f32:$FRA, f32:$FRB))]>;
+ def FMUL : AForm_3<63, 25,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRC),
+ "fmul $FRT, $FRA, $FRC", FPFused,
+ [(set f64:$FRT, (fmul f64:$FRA, f64:$FRC))]>;
+ def FMULS : AForm_3<59, 25,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRC),
+ "fmuls $FRT, $FRA, $FRC", FPGeneral,
+ [(set f32:$FRT, (fmul f32:$FRA, f32:$FRC))]>;
+ def FSUB : AForm_2<63, 20,
+ (outs F8RC:$FRT), (ins F8RC:$FRA, F8RC:$FRB),
+ "fsub $FRT, $FRA, $FRB", FPAddSub,
+ [(set f64:$FRT, (fsub f64:$FRA, f64:$FRB))]>;
+ def FSUBS : AForm_2<59, 20,
+ (outs F4RC:$FRT), (ins F4RC:$FRA, F4RC:$FRB),
+ "fsubs $FRT, $FRA, $FRB", FPGeneral,
+ [(set f32:$FRT, (fsub f32:$FRA, f32:$FRB))]>;
+ }
+}
+
+let PPC970_Unit = 1 in { // FXU Operations.
+ def ISEL : AForm_4<31, 15,
+ (outs GPRC:$rT), (ins GPRC_NOR0:$rA, GPRC:$rB, CRBITRC:$cond),
+ "isel $rT, $rA, $rB, $cond", IntGeneral,
+ []>;
+}
+
+let PPC970_Unit = 1 in { // FXU Operations.
+// M-Form instructions. rotate and mask instructions.
+//
+let isCommutable = 1 in {
+// RLWIMI can be commuted if the rotate amount is zero.
+def RLWIMI : MForm_2<20,
+ (outs GPRC:$rA), (ins GPRC:$rSi, GPRC:$rS, u5imm:$SH, u5imm:$MB,
+ u5imm:$ME), "rlwimi $rA, $rS, $SH, $MB, $ME", IntRotate,
+ []>, PPC970_DGroup_Cracked, RegConstraint<"$rSi = $rA">,
+ NoEncode<"$rSi">;
+}
+def RLWINM : MForm_2<21,
+ (outs GPRC:$rA), (ins GPRC:$rS, u5imm:$SH, u5imm:$MB, u5imm:$ME),
+ "rlwinm $rA, $rS, $SH, $MB, $ME", IntGeneral,
+ []>;
+def RLWINMo : MForm_2<21,
+ (outs GPRC:$rA), (ins GPRC:$rS, u5imm:$SH, u5imm:$MB, u5imm:$ME),
+ "rlwinm. $rA, $rS, $SH, $MB, $ME", IntGeneral,
+ []>, isDOT, PPC970_DGroup_Cracked;
+def RLWNM : MForm_2<23,
+ (outs GPRC:$rA), (ins GPRC:$rS, GPRC:$rB, u5imm:$MB, u5imm:$ME),
+ "rlwnm $rA, $rS, $rB, $MB, $ME", IntGeneral,
+ []>;
+}
+
+
+//===----------------------------------------------------------------------===//
+// PowerPC Instruction Patterns
+//
+
+// Arbitrary immediate support. Implement in terms of LIS/ORI.
+def : Pat<(i32 imm:$imm),
+ (ORI (LIS (HI16 imm:$imm)), (LO16 imm:$imm))>;
+
+// Implement the 'not' operation with the NOR instruction.
+def NOT : Pat<(not i32:$in),
+ (NOR $in, $in)>;
+
+// ADD an arbitrary immediate.
+def : Pat<(add i32:$in, imm:$imm),
+ (ADDIS (ADDI $in, (LO16 imm:$imm)), (HA16 imm:$imm))>;
+// OR an arbitrary immediate.
+def : Pat<(or i32:$in, imm:$imm),
+ (ORIS (ORI $in, (LO16 imm:$imm)), (HI16 imm:$imm))>;
+// XOR an arbitrary immediate.
+def : Pat<(xor i32:$in, imm:$imm),
+ (XORIS (XORI $in, (LO16 imm:$imm)), (HI16 imm:$imm))>;
+// SUBFIC
+def : Pat<(sub immSExt16:$imm, i32:$in),
+ (SUBFIC $in, imm:$imm)>;
+
+// SHL/SRL
+def : Pat<(shl i32:$in, (i32 imm:$imm)),
+ (RLWINM $in, imm:$imm, 0, (SHL32 imm:$imm))>;
+def : Pat<(srl i32:$in, (i32 imm:$imm)),
+ (RLWINM $in, (SRL32 imm:$imm), imm:$imm, 31)>;
+
+// ROTL
+def : Pat<(rotl i32:$in, i32:$sh),
+ (RLWNM $in, $sh, 0, 31)>;
+def : Pat<(rotl i32:$in, (i32 imm:$imm)),
+ (RLWINM $in, imm:$imm, 0, 31)>;
+
+// RLWNM
+def : Pat<(and (rotl i32:$in, i32:$sh), maskimm32:$imm),
+ (RLWNM $in, $sh, (MB maskimm32:$imm), (ME maskimm32:$imm))>;
+
+// Calls
+def : Pat<(PPCcall (i32 tglobaladdr:$dst)),
+ (BL tglobaladdr:$dst)>;
+def : Pat<(PPCcall (i32 texternalsym:$dst)),
+ (BL texternalsym:$dst)>;
+
+
+def : Pat<(PPCtc_return (i32 tglobaladdr:$dst), imm:$imm),
+ (TCRETURNdi tglobaladdr:$dst, imm:$imm)>;
+
+def : Pat<(PPCtc_return (i32 texternalsym:$dst), imm:$imm),
+ (TCRETURNdi texternalsym:$dst, imm:$imm)>;
+
+def : Pat<(PPCtc_return CTRRC:$dst, imm:$imm),
+ (TCRETURNri CTRRC:$dst, imm:$imm)>;
+
+
+
+// Hi and Lo for Darwin Global Addresses.
+def : Pat<(PPChi tglobaladdr:$in, 0), (LIS tglobaladdr:$in)>;
+def : Pat<(PPClo tglobaladdr:$in, 0), (LI tglobaladdr:$in)>;
+def : Pat<(PPChi tconstpool:$in, 0), (LIS tconstpool:$in)>;
+def : Pat<(PPClo tconstpool:$in, 0), (LI tconstpool:$in)>;
+def : Pat<(PPChi tjumptable:$in, 0), (LIS tjumptable:$in)>;
+def : Pat<(PPClo tjumptable:$in, 0), (LI tjumptable:$in)>;
+def : Pat<(PPChi tblockaddress:$in, 0), (LIS tblockaddress:$in)>;
+def : Pat<(PPClo tblockaddress:$in, 0), (LI tblockaddress:$in)>;
+def : Pat<(PPChi tglobaltlsaddr:$g, i32:$in),
+ (ADDIS $in, tglobaltlsaddr:$g)>;
+def : Pat<(PPClo tglobaltlsaddr:$g, i32:$in),
+ (ADDI $in, tglobaltlsaddr:$g)>;
+def : Pat<(add i32:$in, (PPChi tglobaladdr:$g, 0)),
+ (ADDIS $in, tglobaladdr:$g)>;
+def : Pat<(add i32:$in, (PPChi tconstpool:$g, 0)),
+ (ADDIS $in, tconstpool:$g)>;
+def : Pat<(add i32:$in, (PPChi tjumptable:$g, 0)),
+ (ADDIS $in, tjumptable:$g)>;
+def : Pat<(add i32:$in, (PPChi tblockaddress:$g, 0)),
+ (ADDIS $in, tblockaddress:$g)>;
+
+// Standard shifts. These are represented separately from the real shifts above
+// so that we can distinguish between shifts that allow 5-bit and 6-bit shift
+// amounts.
+def : Pat<(sra i32:$rS, i32:$rB),
+ (SRAW $rS, $rB)>;
+def : Pat<(srl i32:$rS, i32:$rB),
+ (SRW $rS, $rB)>;
+def : Pat<(shl i32:$rS, i32:$rB),
+ (SLW $rS, $rB)>;
+
+def : Pat<(zextloadi1 iaddr:$src),
+ (LBZ iaddr:$src)>;
+def : Pat<(zextloadi1 xaddr:$src),
+ (LBZX xaddr:$src)>;
+def : Pat<(extloadi1 iaddr:$src),
+ (LBZ iaddr:$src)>;
+def : Pat<(extloadi1 xaddr:$src),
+ (LBZX xaddr:$src)>;
+def : Pat<(extloadi8 iaddr:$src),
+ (LBZ iaddr:$src)>;
+def : Pat<(extloadi8 xaddr:$src),
+ (LBZX xaddr:$src)>;
+def : Pat<(extloadi16 iaddr:$src),
+ (LHZ iaddr:$src)>;
+def : Pat<(extloadi16 xaddr:$src),
+ (LHZX xaddr:$src)>;
+def : Pat<(f64 (extloadf32 iaddr:$src)),
+ (COPY_TO_REGCLASS (LFS iaddr:$src), F8RC)>;
+def : Pat<(f64 (extloadf32 xaddr:$src)),
+ (COPY_TO_REGCLASS (LFSX xaddr:$src), F8RC)>;
+
+def : Pat<(f64 (fextend f32:$src)),
+ (COPY_TO_REGCLASS $src, F8RC)>;
+
+// Memory barriers
+def : Pat<(membarrier (i32 imm /*ll*/),
+ (i32 imm /*ls*/),
+ (i32 imm /*sl*/),
+ (i32 imm /*ss*/),
+ (i32 imm /*device*/)),
+ (SYNC)>;
+
+def : Pat<(atomic_fence (imm), (imm)), (SYNC)>;
+
+// Additional FNMSUB patterns: -a*c + b == -(a*c - b)
+def : Pat<(fma (fneg f64:$A), f64:$C, f64:$B),
+ (FNMSUB $A, $C, $B)>;
+def : Pat<(fma f64:$A, (fneg f64:$C), f64:$B),
+ (FNMSUB $A, $C, $B)>;
+def : Pat<(fma (fneg f32:$A), f32:$C, f32:$B),
+ (FNMSUBS $A, $C, $B)>;
+def : Pat<(fma f32:$A, (fneg f32:$C), f32:$B),
+ (FNMSUBS $A, $C, $B)>;
+
+include "PPCInstrAltivec.td"
+include "PPCInstr64Bit.td"
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCJITInfo.cpp b/contrib/llvm/lib/Target/PowerPC/PPCJITInfo.cpp
new file mode 100644
index 0000000..cfcd749
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCJITInfo.cpp
@@ -0,0 +1,471 @@
+//===-- PPCJITInfo.cpp - Implement the JIT interfaces for the PowerPC -----===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements the JIT interfaces for the 32-bit PowerPC target.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "jit"
+#include "PPCJITInfo.h"
+#include "PPCRelocations.h"
+#include "PPCTargetMachine.h"
+#include "llvm/IR/Function.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/Memory.h"
+#include "llvm/Support/raw_ostream.h"
+using namespace llvm;
+
+static TargetJITInfo::JITCompilerFn JITCompilerFunction;
+
+#define BUILD_ADDIS(RD,RS,IMM16) \
+ ((15 << 26) | ((RD) << 21) | ((RS) << 16) | ((IMM16) & 65535))
+#define BUILD_ORI(RD,RS,UIMM16) \
+ ((24 << 26) | ((RS) << 21) | ((RD) << 16) | ((UIMM16) & 65535))
+#define BUILD_ORIS(RD,RS,UIMM16) \
+ ((25 << 26) | ((RS) << 21) | ((RD) << 16) | ((UIMM16) & 65535))
+#define BUILD_RLDICR(RD,RS,SH,ME) \
+ ((30 << 26) | ((RS) << 21) | ((RD) << 16) | (((SH) & 31) << 11) | \
+ (((ME) & 63) << 6) | (1 << 2) | ((((SH) >> 5) & 1) << 1))
+#define BUILD_MTSPR(RS,SPR) \
+ ((31 << 26) | ((RS) << 21) | ((SPR) << 16) | (467 << 1))
+#define BUILD_BCCTRx(BO,BI,LINK) \
+ ((19 << 26) | ((BO) << 21) | ((BI) << 16) | (528 << 1) | ((LINK) & 1))
+#define BUILD_B(TARGET, LINK) \
+ ((18 << 26) | (((TARGET) & 0x00FFFFFF) << 2) | ((LINK) & 1))
+
+// Pseudo-ops
+#define BUILD_LIS(RD,IMM16) BUILD_ADDIS(RD,0,IMM16)
+#define BUILD_SLDI(RD,RS,IMM6) BUILD_RLDICR(RD,RS,IMM6,63-IMM6)
+#define BUILD_MTCTR(RS) BUILD_MTSPR(RS,9)
+#define BUILD_BCTR(LINK) BUILD_BCCTRx(20,0,LINK)
+
+static void EmitBranchToAt(uint64_t At, uint64_t To, bool isCall, bool is64Bit){
+ intptr_t Offset = ((intptr_t)To - (intptr_t)At) >> 2;
+ unsigned *AtI = (unsigned*)(intptr_t)At;
+
+ if (Offset >= -(1 << 23) && Offset < (1 << 23)) { // In range?
+ AtI[0] = BUILD_B(Offset, isCall); // b/bl target
+ } else if (!is64Bit) {
+ AtI[0] = BUILD_LIS(12, To >> 16); // lis r12, hi16(address)
+ AtI[1] = BUILD_ORI(12, 12, To); // ori r12, r12, lo16(address)
+ AtI[2] = BUILD_MTCTR(12); // mtctr r12
+ AtI[3] = BUILD_BCTR(isCall); // bctr/bctrl
+ } else {
+ AtI[0] = BUILD_LIS(12, To >> 48); // lis r12, hi16(address)
+ AtI[1] = BUILD_ORI(12, 12, To >> 32); // ori r12, r12, lo16(address)
+ AtI[2] = BUILD_SLDI(12, 12, 32); // sldi r12, r12, 32
+ AtI[3] = BUILD_ORIS(12, 12, To >> 16); // oris r12, r12, hi16(address)
+ AtI[4] = BUILD_ORI(12, 12, To); // ori r12, r12, lo16(address)
+ AtI[5] = BUILD_MTCTR(12); // mtctr r12
+ AtI[6] = BUILD_BCTR(isCall); // bctr/bctrl
+ }
+}
+
+extern "C" void PPC32CompilationCallback();
+extern "C" void PPC64CompilationCallback();
+
+#if (defined(__POWERPC__) || defined (__ppc__) || defined(_POWER)) && \
+ !(defined(__ppc64__) || defined(__FreeBSD__))
+// CompilationCallback stub - We can't use a C function with inline assembly in
+// it, because we the prolog/epilog inserted by GCC won't work for us. Instead,
+// write our own wrapper, which does things our way, so we have complete control
+// over register saving and restoring.
+asm(
+ ".text\n"
+ ".align 2\n"
+ ".globl _PPC32CompilationCallback\n"
+"_PPC32CompilationCallback:\n"
+ // Make space for 8 ints r[3-10] and 13 doubles f[1-13] and the
+ // FIXME: need to save v[0-19] for altivec?
+ // FIXME: could shrink frame
+ // Set up a proper stack frame
+ // FIXME Layout
+ // PowerPC32 ABI linkage - 24 bytes
+ // parameters - 32 bytes
+ // 13 double registers - 104 bytes
+ // 8 int registers - 32 bytes
+ "mflr r0\n"
+ "stw r0, 8(r1)\n"
+ "stwu r1, -208(r1)\n"
+ // Save all int arg registers
+ "stw r10, 204(r1)\n" "stw r9, 200(r1)\n"
+ "stw r8, 196(r1)\n" "stw r7, 192(r1)\n"
+ "stw r6, 188(r1)\n" "stw r5, 184(r1)\n"
+ "stw r4, 180(r1)\n" "stw r3, 176(r1)\n"
+ // Save all call-clobbered FP regs.
+ "stfd f13, 168(r1)\n" "stfd f12, 160(r1)\n"
+ "stfd f11, 152(r1)\n" "stfd f10, 144(r1)\n"
+ "stfd f9, 136(r1)\n" "stfd f8, 128(r1)\n"
+ "stfd f7, 120(r1)\n" "stfd f6, 112(r1)\n"
+ "stfd f5, 104(r1)\n" "stfd f4, 96(r1)\n"
+ "stfd f3, 88(r1)\n" "stfd f2, 80(r1)\n"
+ "stfd f1, 72(r1)\n"
+ // Arguments to Compilation Callback:
+ // r3 - our lr (address of the call instruction in stub plus 4)
+ // r4 - stub's lr (address of instruction that called the stub plus 4)
+ // r5 - is64Bit - always 0.
+ "mr r3, r0\n"
+ "lwz r2, 208(r1)\n" // stub's frame
+ "lwz r4, 8(r2)\n" // stub's lr
+ "li r5, 0\n" // 0 == 32 bit
+ "bl _LLVMPPCCompilationCallback\n"
+ "mtctr r3\n"
+ // Restore all int arg registers
+ "lwz r10, 204(r1)\n" "lwz r9, 200(r1)\n"
+ "lwz r8, 196(r1)\n" "lwz r7, 192(r1)\n"
+ "lwz r6, 188(r1)\n" "lwz r5, 184(r1)\n"
+ "lwz r4, 180(r1)\n" "lwz r3, 176(r1)\n"
+ // Restore all FP arg registers
+ "lfd f13, 168(r1)\n" "lfd f12, 160(r1)\n"
+ "lfd f11, 152(r1)\n" "lfd f10, 144(r1)\n"
+ "lfd f9, 136(r1)\n" "lfd f8, 128(r1)\n"
+ "lfd f7, 120(r1)\n" "lfd f6, 112(r1)\n"
+ "lfd f5, 104(r1)\n" "lfd f4, 96(r1)\n"
+ "lfd f3, 88(r1)\n" "lfd f2, 80(r1)\n"
+ "lfd f1, 72(r1)\n"
+ // Pop 3 frames off the stack and branch to target
+ "lwz r1, 208(r1)\n"
+ "lwz r2, 8(r1)\n"
+ "mtlr r2\n"
+ "bctr\n"
+ );
+
+#elif defined(__PPC__) && !defined(__ppc64__)
+// Linux & FreeBSD / PPC 32 support
+
+// CompilationCallback stub - We can't use a C function with inline assembly in
+// it, because we the prolog/epilog inserted by GCC won't work for us. Instead,
+// write our own wrapper, which does things our way, so we have complete control
+// over register saving and restoring.
+asm(
+ ".text\n"
+ ".align 2\n"
+ ".globl PPC32CompilationCallback\n"
+"PPC32CompilationCallback:\n"
+ // Make space for 8 ints r[3-10] and 8 doubles f[1-8] and the
+ // FIXME: need to save v[0-19] for altivec?
+ // FIXME: could shrink frame
+ // Set up a proper stack frame
+ // FIXME Layout
+ // 8 double registers - 64 bytes
+ // 8 int registers - 32 bytes
+ "mflr 0\n"
+ "stw 0, 4(1)\n"
+ "stwu 1, -104(1)\n"
+ // Save all int arg registers
+ "stw 10, 100(1)\n" "stw 9, 96(1)\n"
+ "stw 8, 92(1)\n" "stw 7, 88(1)\n"
+ "stw 6, 84(1)\n" "stw 5, 80(1)\n"
+ "stw 4, 76(1)\n" "stw 3, 72(1)\n"
+ // Save all call-clobbered FP regs.
+ "stfd 8, 64(1)\n"
+ "stfd 7, 56(1)\n" "stfd 6, 48(1)\n"
+ "stfd 5, 40(1)\n" "stfd 4, 32(1)\n"
+ "stfd 3, 24(1)\n" "stfd 2, 16(1)\n"
+ "stfd 1, 8(1)\n"
+ // Arguments to Compilation Callback:
+ // r3 - our lr (address of the call instruction in stub plus 4)
+ // r4 - stub's lr (address of instruction that called the stub plus 4)
+ // r5 - is64Bit - always 0.
+ "mr 3, 0\n"
+ "lwz 5, 104(1)\n" // stub's frame
+ "lwz 4, 4(5)\n" // stub's lr
+ "li 5, 0\n" // 0 == 32 bit
+ "bl LLVMPPCCompilationCallback\n"
+ "mtctr 3\n"
+ // Restore all int arg registers
+ "lwz 10, 100(1)\n" "lwz 9, 96(1)\n"
+ "lwz 8, 92(1)\n" "lwz 7, 88(1)\n"
+ "lwz 6, 84(1)\n" "lwz 5, 80(1)\n"
+ "lwz 4, 76(1)\n" "lwz 3, 72(1)\n"
+ // Restore all FP arg registers
+ "lfd 8, 64(1)\n"
+ "lfd 7, 56(1)\n" "lfd 6, 48(1)\n"
+ "lfd 5, 40(1)\n" "lfd 4, 32(1)\n"
+ "lfd 3, 24(1)\n" "lfd 2, 16(1)\n"
+ "lfd 1, 8(1)\n"
+ // Pop 3 frames off the stack and branch to target
+ "lwz 1, 104(1)\n"
+ "lwz 0, 4(1)\n"
+ "mtlr 0\n"
+ "bctr\n"
+ );
+#else
+void PPC32CompilationCallback() {
+ llvm_unreachable("This is not a power pc, you can't execute this!");
+}
+#endif
+
+#if (defined(__POWERPC__) || defined (__ppc__) || defined(_POWER)) && \
+ defined(__ppc64__)
+#ifdef __ELF__
+asm(
+ ".text\n"
+ ".align 2\n"
+ ".globl PPC64CompilationCallback\n"
+ ".section \".opd\",\"aw\",@progbits\n"
+ ".align 3\n"
+"PPC64CompilationCallback:\n"
+ ".quad .L.PPC64CompilationCallback,.TOC.@tocbase,0\n"
+ ".size PPC64CompilationCallback,24\n"
+ ".previous\n"
+ ".align 4\n"
+ ".type PPC64CompilationCallback,@function\n"
+".L.PPC64CompilationCallback:\n"
+#else
+asm(
+ ".text\n"
+ ".align 2\n"
+ ".globl _PPC64CompilationCallback\n"
+"_PPC64CompilationCallback:\n"
+#endif
+ // Make space for 8 ints r[3-10] and 13 doubles f[1-13] and the
+ // FIXME: need to save v[0-19] for altivec?
+ // Set up a proper stack frame
+ // Layout
+ // PowerPC64 ABI linkage - 48 bytes
+ // parameters - 64 bytes
+ // 13 double registers - 104 bytes
+ // 8 int registers - 64 bytes
+ "mflr 0\n"
+ "std 0, 16(1)\n"
+ "stdu 1, -280(1)\n"
+ // Save all int arg registers
+ "std 10, 272(1)\n" "std 9, 264(1)\n"
+ "std 8, 256(1)\n" "std 7, 248(1)\n"
+ "std 6, 240(1)\n" "std 5, 232(1)\n"
+ "std 4, 224(1)\n" "std 3, 216(1)\n"
+ // Save all call-clobbered FP regs.
+ "stfd 13, 208(1)\n" "stfd 12, 200(1)\n"
+ "stfd 11, 192(1)\n" "stfd 10, 184(1)\n"
+ "stfd 9, 176(1)\n" "stfd 8, 168(1)\n"
+ "stfd 7, 160(1)\n" "stfd 6, 152(1)\n"
+ "stfd 5, 144(1)\n" "stfd 4, 136(1)\n"
+ "stfd 3, 128(1)\n" "stfd 2, 120(1)\n"
+ "stfd 1, 112(1)\n"
+ // Arguments to Compilation Callback:
+ // r3 - our lr (address of the call instruction in stub plus 4)
+ // r4 - stub's lr (address of instruction that called the stub plus 4)
+ // r5 - is64Bit - always 1.
+ "mr 3, 0\n" // return address (still in r0)
+ "ld 5, 280(1)\n" // stub's frame
+ "ld 4, 16(5)\n" // stub's lr
+ "li 5, 1\n" // 1 == 64 bit
+#ifdef __ELF__
+ "bl LLVMPPCCompilationCallback\n"
+ "nop\n"
+#else
+ "bl _LLVMPPCCompilationCallback\n"
+#endif
+ "mtctr 3\n"
+ // Restore all int arg registers
+ "ld 10, 272(1)\n" "ld 9, 264(1)\n"
+ "ld 8, 256(1)\n" "ld 7, 248(1)\n"
+ "ld 6, 240(1)\n" "ld 5, 232(1)\n"
+ "ld 4, 224(1)\n" "ld 3, 216(1)\n"
+ // Restore all FP arg registers
+ "lfd 13, 208(1)\n" "lfd 12, 200(1)\n"
+ "lfd 11, 192(1)\n" "lfd 10, 184(1)\n"
+ "lfd 9, 176(1)\n" "lfd 8, 168(1)\n"
+ "lfd 7, 160(1)\n" "lfd 6, 152(1)\n"
+ "lfd 5, 144(1)\n" "lfd 4, 136(1)\n"
+ "lfd 3, 128(1)\n" "lfd 2, 120(1)\n"
+ "lfd 1, 112(1)\n"
+ // Pop 3 frames off the stack and branch to target
+ "ld 1, 280(1)\n"
+ "ld 0, 16(1)\n"
+ "mtlr 0\n"
+ // XXX: any special TOC handling in the ELF case for JIT?
+ "bctr\n"
+ );
+#else
+void PPC64CompilationCallback() {
+ llvm_unreachable("This is not a power pc, you can't execute this!");
+}
+#endif
+
+extern "C" {
+LLVM_LIBRARY_VISIBILITY void *
+LLVMPPCCompilationCallback(unsigned *StubCallAddrPlus4,
+ unsigned *OrigCallAddrPlus4,
+ bool is64Bit) {
+ // Adjust the pointer to the address of the call instruction in the stub
+ // emitted by emitFunctionStub, rather than the instruction after it.
+ unsigned *StubCallAddr = StubCallAddrPlus4 - 1;
+ unsigned *OrigCallAddr = OrigCallAddrPlus4 - 1;
+
+ void *Target = JITCompilerFunction(StubCallAddr);
+
+ // Check to see if *OrigCallAddr is a 'bl' instruction, and if we can rewrite
+ // it to branch directly to the destination. If so, rewrite it so it does not
+ // need to go through the stub anymore.
+ unsigned OrigCallInst = *OrigCallAddr;
+ if ((OrigCallInst >> 26) == 18) { // Direct call.
+ intptr_t Offset = ((intptr_t)Target - (intptr_t)OrigCallAddr) >> 2;
+
+ if (Offset >= -(1 << 23) && Offset < (1 << 23)) { // In range?
+ // Clear the original target out.
+ OrigCallInst &= (63 << 26) | 3;
+ // Fill in the new target.
+ OrigCallInst |= (Offset & ((1 << 24)-1)) << 2;
+ // Replace the call.
+ *OrigCallAddr = OrigCallInst;
+ }
+ }
+
+ // Assert that we are coming from a stub that was created with our
+ // emitFunctionStub.
+ if ((*StubCallAddr >> 26) == 18)
+ StubCallAddr -= 3;
+ else {
+ assert((*StubCallAddr >> 26) == 19 && "Call in stub is not indirect!");
+ StubCallAddr -= is64Bit ? 9 : 6;
+ }
+
+ // Rewrite the stub with an unconditional branch to the target, for any users
+ // who took the address of the stub.
+ EmitBranchToAt((intptr_t)StubCallAddr, (intptr_t)Target, false, is64Bit);
+ sys::Memory::InvalidateInstructionCache(StubCallAddr, 7*4);
+
+ // Put the address of the target function to call and the address to return to
+ // after calling the target function in a place that is easy to get on the
+ // stack after we restore all regs.
+ return Target;
+}
+}
+
+
+
+TargetJITInfo::LazyResolverFn
+PPCJITInfo::getLazyResolverFunction(JITCompilerFn Fn) {
+ JITCompilerFunction = Fn;
+ return is64Bit ? PPC64CompilationCallback : PPC32CompilationCallback;
+}
+
+TargetJITInfo::StubLayout PPCJITInfo::getStubLayout() {
+ // The stub contains up to 10 4-byte instructions, aligned at 4 bytes: 3
+ // instructions to save the caller's address if this is a lazy-compilation
+ // stub, plus a 1-, 4-, or 7-instruction sequence to load an arbitrary address
+ // into a register and jump through it.
+ StubLayout Result = {10*4, 4};
+ return Result;
+}
+
+#if (defined(__POWERPC__) || defined (__ppc__) || defined(_POWER)) && \
+defined(__APPLE__)
+extern "C" void sys_icache_invalidate(const void *Addr, size_t len);
+#endif
+
+void *PPCJITInfo::emitFunctionStub(const Function* F, void *Fn,
+ JITCodeEmitter &JCE) {
+ // If this is just a call to an external function, emit a branch instead of a
+ // call. The code is the same except for one bit of the last instruction.
+ if (Fn != (void*)(intptr_t)PPC32CompilationCallback &&
+ Fn != (void*)(intptr_t)PPC64CompilationCallback) {
+ void *Addr = (void*)JCE.getCurrentPCValue();
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ EmitBranchToAt((intptr_t)Addr, (intptr_t)Fn, false, is64Bit);
+ sys::Memory::InvalidateInstructionCache(Addr, 7*4);
+ return Addr;
+ }
+
+ void *Addr = (void*)JCE.getCurrentPCValue();
+ if (is64Bit) {
+ JCE.emitWordBE(0xf821ffb1); // stdu r1,-80(r1)
+ JCE.emitWordBE(0x7d6802a6); // mflr r11
+ JCE.emitWordBE(0xf9610060); // std r11, 96(r1)
+ } else if (TM.getSubtargetImpl()->isDarwinABI()){
+ JCE.emitWordBE(0x9421ffe0); // stwu r1,-32(r1)
+ JCE.emitWordBE(0x7d6802a6); // mflr r11
+ JCE.emitWordBE(0x91610028); // stw r11, 40(r1)
+ } else {
+ JCE.emitWordBE(0x9421ffe0); // stwu r1,-32(r1)
+ JCE.emitWordBE(0x7d6802a6); // mflr r11
+ JCE.emitWordBE(0x91610024); // stw r11, 36(r1)
+ }
+ intptr_t BranchAddr = (intptr_t)JCE.getCurrentPCValue();
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ JCE.emitWordBE(0);
+ EmitBranchToAt(BranchAddr, (intptr_t)Fn, true, is64Bit);
+ sys::Memory::InvalidateInstructionCache(Addr, 10*4);
+ return Addr;
+}
+
+
+void PPCJITInfo::relocate(void *Function, MachineRelocation *MR,
+ unsigned NumRelocs, unsigned char* GOTBase) {
+ for (unsigned i = 0; i != NumRelocs; ++i, ++MR) {
+ unsigned *RelocPos = (unsigned*)Function + MR->getMachineCodeOffset()/4;
+ intptr_t ResultPtr = (intptr_t)MR->getResultPointer();
+ switch ((PPC::RelocationType)MR->getRelocationType()) {
+ default: llvm_unreachable("Unknown relocation type!");
+ case PPC::reloc_pcrel_bx:
+ // PC-relative relocation for b and bl instructions.
+ ResultPtr = (ResultPtr-(intptr_t)RelocPos) >> 2;
+ assert(ResultPtr >= -(1 << 23) && ResultPtr < (1 << 23) &&
+ "Relocation out of range!");
+ *RelocPos |= (ResultPtr & ((1 << 24)-1)) << 2;
+ break;
+ case PPC::reloc_pcrel_bcx:
+ // PC-relative relocation for BLT,BLE,BEQ,BGE,BGT,BNE, or other
+ // bcx instructions.
+ ResultPtr = (ResultPtr-(intptr_t)RelocPos) >> 2;
+ assert(ResultPtr >= -(1 << 13) && ResultPtr < (1 << 13) &&
+ "Relocation out of range!");
+ *RelocPos |= (ResultPtr & ((1 << 14)-1)) << 2;
+ break;
+ case PPC::reloc_absolute_high: // high bits of ref -> low 16 of instr
+ case PPC::reloc_absolute_low: { // low bits of ref -> low 16 of instr
+ ResultPtr += MR->getConstantVal();
+
+ // If this is a high-part access, get the high-part.
+ if (MR->getRelocationType() == PPC::reloc_absolute_high) {
+ // If the low part will have a carry (really a borrow) from the low
+ // 16-bits into the high 16, add a bit to borrow from.
+ if (((int)ResultPtr << 16) < 0)
+ ResultPtr += 1 << 16;
+ ResultPtr >>= 16;
+ }
+
+ // Do the addition then mask, so the addition does not overflow the 16-bit
+ // immediate section of the instruction.
+ unsigned LowBits = (*RelocPos + ResultPtr) & 65535;
+ unsigned HighBits = *RelocPos & ~65535;
+ *RelocPos = LowBits | HighBits; // Slam into low 16-bits
+ break;
+ }
+ case PPC::reloc_absolute_low_ix: { // low bits of ref -> low 14 of instr
+ ResultPtr += MR->getConstantVal();
+ // Do the addition then mask, so the addition does not overflow the 16-bit
+ // immediate section of the instruction.
+ unsigned LowBits = (*RelocPos + ResultPtr) & 0xFFFC;
+ unsigned HighBits = *RelocPos & 0xFFFF0003;
+ *RelocPos = LowBits | HighBits; // Slam into low 14-bits.
+ break;
+ }
+ }
+ }
+}
+
+void PPCJITInfo::replaceMachineCodeForFunction(void *Old, void *New) {
+ EmitBranchToAt((intptr_t)Old, (intptr_t)New, false, is64Bit);
+ sys::Memory::InvalidateInstructionCache(Old, 7*4);
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCJITInfo.h b/contrib/llvm/lib/Target/PowerPC/PPCJITInfo.h
new file mode 100644
index 0000000..46d4a08
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCJITInfo.h
@@ -0,0 +1,49 @@
+//===-- PPCJITInfo.h - PowerPC impl. of the JIT interface -------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the PowerPC implementation of the TargetJITInfo class.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPC_JITINFO_H
+#define POWERPC_JITINFO_H
+
+#include "llvm/CodeGen/JITCodeEmitter.h"
+#include "llvm/Target/TargetJITInfo.h"
+
+namespace llvm {
+ class PPCTargetMachine;
+
+ class PPCJITInfo : public TargetJITInfo {
+ protected:
+ PPCTargetMachine &TM;
+ bool is64Bit;
+ public:
+ PPCJITInfo(PPCTargetMachine &tm, bool tmIs64Bit) : TM(tm) {
+ useGOT = 0;
+ is64Bit = tmIs64Bit;
+ }
+
+ virtual StubLayout getStubLayout();
+ virtual void *emitFunctionStub(const Function* F, void *Fn,
+ JITCodeEmitter &JCE);
+ virtual LazyResolverFn getLazyResolverFunction(JITCompilerFn);
+ virtual void relocate(void *Function, MachineRelocation *MR,
+ unsigned NumRelocs, unsigned char* GOTBase);
+
+ /// replaceMachineCodeForFunction - Make it so that calling the function
+ /// whose machine code is at OLD turns into a call to NEW, perhaps by
+ /// overwriting OLD with a branch to NEW. This is used for self-modifying
+ /// code.
+ ///
+ virtual void replaceMachineCodeForFunction(void *Old, void *New);
+ };
+}
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCMCInstLower.cpp b/contrib/llvm/lib/Target/PowerPC/PPCMCInstLower.cpp
new file mode 100644
index 0000000..9b0df3e
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCMCInstLower.cpp
@@ -0,0 +1,194 @@
+//===-- PPCMCInstLower.cpp - Convert PPC MachineInstr to an MCInst --------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains code to lower PPC MachineInstrs to their corresponding
+// MCInst records.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPC.h"
+#include "llvm/ADT/SmallString.h"
+#include "llvm/CodeGen/AsmPrinter.h"
+#include "llvm/CodeGen/MachineFunction.h"
+#include "llvm/CodeGen/MachineModuleInfoImpls.h"
+#include "llvm/IR/GlobalValue.h"
+#include "llvm/MC/MCAsmInfo.h"
+#include "llvm/MC/MCExpr.h"
+#include "llvm/MC/MCInst.h"
+#include "llvm/Target/Mangler.h"
+using namespace llvm;
+
+static MachineModuleInfoMachO &getMachOMMI(AsmPrinter &AP) {
+ return AP.MMI->getObjFileInfo<MachineModuleInfoMachO>();
+}
+
+
+static MCSymbol *GetSymbolFromOperand(const MachineOperand &MO, AsmPrinter &AP){
+ MCContext &Ctx = AP.OutContext;
+
+ SmallString<128> Name;
+ if (!MO.isGlobal()) {
+ assert(MO.isSymbol() && "Isn't a symbol reference");
+ Name += AP.MAI->getGlobalPrefix();
+ Name += MO.getSymbolName();
+ } else {
+ const GlobalValue *GV = MO.getGlobal();
+ bool isImplicitlyPrivate = false;
+ if (MO.getTargetFlags() == PPCII::MO_DARWIN_STUB ||
+ (MO.getTargetFlags() & PPCII::MO_NLP_FLAG))
+ isImplicitlyPrivate = true;
+
+ AP.Mang->getNameWithPrefix(Name, GV, isImplicitlyPrivate);
+ }
+
+ // If the target flags on the operand changes the name of the symbol, do that
+ // before we return the symbol.
+ if (MO.getTargetFlags() == PPCII::MO_DARWIN_STUB) {
+ Name += "$stub";
+ MCSymbol *Sym = Ctx.GetOrCreateSymbol(Name.str());
+ MachineModuleInfoImpl::StubValueTy &StubSym =
+ getMachOMMI(AP).getFnStubEntry(Sym);
+ if (StubSym.getPointer())
+ return Sym;
+
+ if (MO.isGlobal()) {
+ StubSym =
+ MachineModuleInfoImpl::
+ StubValueTy(AP.Mang->getSymbol(MO.getGlobal()),
+ !MO.getGlobal()->hasInternalLinkage());
+ } else {
+ Name.erase(Name.end()-5, Name.end());
+ StubSym =
+ MachineModuleInfoImpl::
+ StubValueTy(Ctx.GetOrCreateSymbol(Name.str()), false);
+ }
+ return Sym;
+ }
+
+ // If the symbol reference is actually to a non_lazy_ptr, not to the symbol,
+ // then add the suffix.
+ if (MO.getTargetFlags() & PPCII::MO_NLP_FLAG) {
+ Name += "$non_lazy_ptr";
+ MCSymbol *Sym = Ctx.GetOrCreateSymbol(Name.str());
+
+ MachineModuleInfoMachO &MachO = getMachOMMI(AP);
+
+ MachineModuleInfoImpl::StubValueTy &StubSym =
+ (MO.getTargetFlags() & PPCII::MO_NLP_HIDDEN_FLAG) ?
+ MachO.getHiddenGVStubEntry(Sym) : MachO.getGVStubEntry(Sym);
+
+ if (StubSym.getPointer() == 0) {
+ assert(MO.isGlobal() && "Extern symbol not handled yet");
+ StubSym = MachineModuleInfoImpl::
+ StubValueTy(AP.Mang->getSymbol(MO.getGlobal()),
+ !MO.getGlobal()->hasInternalLinkage());
+ }
+ return Sym;
+ }
+
+ return Ctx.GetOrCreateSymbol(Name.str());
+}
+
+static MCOperand GetSymbolRef(const MachineOperand &MO, const MCSymbol *Symbol,
+ AsmPrinter &Printer, bool isDarwin) {
+ MCContext &Ctx = Printer.OutContext;
+ MCSymbolRefExpr::VariantKind RefKind = MCSymbolRefExpr::VK_None;
+
+ unsigned access = MO.getTargetFlags() & PPCII::MO_ACCESS_MASK;
+
+ switch (access) {
+ case PPCII::MO_HA16: RefKind = isDarwin ?
+ MCSymbolRefExpr::VK_PPC_DARWIN_HA16 :
+ MCSymbolRefExpr::VK_PPC_GAS_HA16;
+ break;
+ case PPCII::MO_LO16: RefKind = isDarwin ?
+ MCSymbolRefExpr::VK_PPC_DARWIN_LO16 :
+ MCSymbolRefExpr::VK_PPC_GAS_LO16;
+ break;
+ case PPCII::MO_TPREL16_HA: RefKind = MCSymbolRefExpr::VK_PPC_TPREL16_HA;
+ break;
+ case PPCII::MO_TPREL16_LO: RefKind = MCSymbolRefExpr::VK_PPC_TPREL16_LO;
+ break;
+ case PPCII::MO_DTPREL16_LO: RefKind = MCSymbolRefExpr::VK_PPC_DTPREL16_LO;
+ break;
+ case PPCII::MO_TLSLD16_LO: RefKind = MCSymbolRefExpr::VK_PPC_GOT_TLSLD16_LO;
+ break;
+ case PPCII::MO_TOC16_LO: RefKind = MCSymbolRefExpr::VK_PPC_TOC16_LO;
+ break;
+ }
+
+ // FIXME: This isn't right, but we don't have a good way to express this in
+ // the MC Level, see below.
+ if (MO.getTargetFlags() & PPCII::MO_PIC_FLAG)
+ RefKind = MCSymbolRefExpr::VK_None;
+
+ const MCExpr *Expr = MCSymbolRefExpr::Create(Symbol, RefKind, Ctx);
+
+ if (!MO.isJTI() && MO.getOffset())
+ Expr = MCBinaryExpr::CreateAdd(Expr,
+ MCConstantExpr::Create(MO.getOffset(), Ctx),
+ Ctx);
+
+ // Subtract off the PIC base if required.
+ if (MO.getTargetFlags() & PPCII::MO_PIC_FLAG) {
+ const MachineFunction *MF = MO.getParent()->getParent()->getParent();
+
+ const MCExpr *PB = MCSymbolRefExpr::Create(MF->getPICBaseSymbol(), Ctx);
+ Expr = MCBinaryExpr::CreateSub(Expr, PB, Ctx);
+ // FIXME: We have no way to make the result be VK_PPC_LO16/VK_PPC_HA16,
+ // since it is not a symbol!
+ }
+
+ return MCOperand::CreateExpr(Expr);
+}
+
+void llvm::LowerPPCMachineInstrToMCInst(const MachineInstr *MI, MCInst &OutMI,
+ AsmPrinter &AP, bool isDarwin) {
+ OutMI.setOpcode(MI->getOpcode());
+
+ for (unsigned i = 0, e = MI->getNumOperands(); i != e; ++i) {
+ const MachineOperand &MO = MI->getOperand(i);
+
+ MCOperand MCOp;
+ switch (MO.getType()) {
+ default:
+ MI->dump();
+ llvm_unreachable("unknown operand type");
+ case MachineOperand::MO_Register:
+ assert(!MO.getSubReg() && "Subregs should be eliminated!");
+ MCOp = MCOperand::CreateReg(MO.getReg());
+ break;
+ case MachineOperand::MO_Immediate:
+ MCOp = MCOperand::CreateImm(MO.getImm());
+ break;
+ case MachineOperand::MO_MachineBasicBlock:
+ MCOp = MCOperand::CreateExpr(MCSymbolRefExpr::Create(
+ MO.getMBB()->getSymbol(), AP.OutContext));
+ break;
+ case MachineOperand::MO_GlobalAddress:
+ case MachineOperand::MO_ExternalSymbol:
+ MCOp = GetSymbolRef(MO, GetSymbolFromOperand(MO, AP), AP, isDarwin);
+ break;
+ case MachineOperand::MO_JumpTableIndex:
+ MCOp = GetSymbolRef(MO, AP.GetJTISymbol(MO.getIndex()), AP, isDarwin);
+ break;
+ case MachineOperand::MO_ConstantPoolIndex:
+ MCOp = GetSymbolRef(MO, AP.GetCPISymbol(MO.getIndex()), AP, isDarwin);
+ break;
+ case MachineOperand::MO_BlockAddress:
+ MCOp = GetSymbolRef(MO,AP.GetBlockAddressSymbol(MO.getBlockAddress()),AP,
+ isDarwin);
+ break;
+ case MachineOperand::MO_RegisterMask:
+ continue;
+ }
+
+ OutMI.addOperand(MCOp);
+ }
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.cpp b/contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.cpp
new file mode 100644
index 0000000..6a0aec8
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.cpp
@@ -0,0 +1,15 @@
+//===-- PPCMachineFunctionInfo.cpp - Private data used for PowerPC --------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCMachineFunctionInfo.h"
+
+using namespace llvm;
+
+void PPCFunctionInfo::anchor() { }
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.h b/contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.h
new file mode 100644
index 0000000..ee18ead
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCMachineFunctionInfo.h
@@ -0,0 +1,162 @@
+//===-- PPCMachineFunctionInfo.h - Private data used for PowerPC --*- C++ -*-=//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file declares the PowerPC specific subclass of MachineFunctionInfo.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPC_MACHINE_FUNCTION_INFO_H
+#define PPC_MACHINE_FUNCTION_INFO_H
+
+#include "llvm/CodeGen/MachineFunction.h"
+
+namespace llvm {
+
+/// PPCFunctionInfo - This class is derived from MachineFunction private
+/// PowerPC target-specific information for each MachineFunction.
+class PPCFunctionInfo : public MachineFunctionInfo {
+ virtual void anchor();
+
+ /// FramePointerSaveIndex - Frame index of where the old frame pointer is
+ /// stored. Also used as an anchor for instructions that need to be altered
+ /// when using frame pointers (dyna_add, dyna_sub.)
+ int FramePointerSaveIndex;
+
+ /// ReturnAddrSaveIndex - Frame index of where the return address is stored.
+ ///
+ int ReturnAddrSaveIndex;
+
+ /// MustSaveLR - Indicates whether LR is defined (or clobbered) in the current
+ /// function. This is only valid after the initial scan of the function by
+ /// PEI.
+ bool MustSaveLR;
+
+ /// Does this function have any stack spills.
+ bool HasSpills;
+
+ /// Does this function spill using instructions with only r+r (not r+i)
+ /// forms.
+ bool HasNonRISpills;
+
+ /// SpillsCR - Indicates whether CR is spilled in the current function.
+ bool SpillsCR;
+
+ /// Indicates whether VRSAVE is spilled in the current function.
+ bool SpillsVRSAVE;
+
+ /// LRStoreRequired - The bool indicates whether there is some explicit use of
+ /// the LR/LR8 stack slot that is not obvious from scanning the code. This
+ /// requires that the code generator produce a store of LR to the stack on
+ /// entry, even though LR may otherwise apparently not be used.
+ bool LRStoreRequired;
+
+ /// MinReservedArea - This is the frame size that is at least reserved in a
+ /// potential caller (parameter+linkage area).
+ unsigned MinReservedArea;
+
+ /// TailCallSPDelta - Stack pointer delta used when tail calling. Maximum
+ /// amount the stack pointer is adjusted to make the frame bigger for tail
+ /// calls. Used for creating an area before the register spill area.
+ int TailCallSPDelta;
+
+ /// HasFastCall - Does this function contain a fast call. Used to determine
+ /// how the caller's stack pointer should be calculated (epilog/dynamicalloc).
+ bool HasFastCall;
+
+ /// VarArgsFrameIndex - FrameIndex for start of varargs area.
+ int VarArgsFrameIndex;
+ /// VarArgsStackOffset - StackOffset for start of stack
+ /// arguments.
+ int VarArgsStackOffset;
+ /// VarArgsNumGPR - Index of the first unused integer
+ /// register for parameter passing.
+ unsigned VarArgsNumGPR;
+ /// VarArgsNumFPR - Index of the first unused double
+ /// register for parameter passing.
+ unsigned VarArgsNumFPR;
+
+ /// CRSpillFrameIndex - FrameIndex for CR spill slot for 32-bit SVR4.
+ int CRSpillFrameIndex;
+
+public:
+ explicit PPCFunctionInfo(MachineFunction &MF)
+ : FramePointerSaveIndex(0),
+ ReturnAddrSaveIndex(0),
+ HasSpills(false),
+ HasNonRISpills(false),
+ SpillsCR(false),
+ SpillsVRSAVE(false),
+ LRStoreRequired(false),
+ MinReservedArea(0),
+ TailCallSPDelta(0),
+ HasFastCall(false),
+ VarArgsFrameIndex(0),
+ VarArgsStackOffset(0),
+ VarArgsNumGPR(0),
+ VarArgsNumFPR(0),
+ CRSpillFrameIndex(0) {}
+
+ int getFramePointerSaveIndex() const { return FramePointerSaveIndex; }
+ void setFramePointerSaveIndex(int Idx) { FramePointerSaveIndex = Idx; }
+
+ int getReturnAddrSaveIndex() const { return ReturnAddrSaveIndex; }
+ void setReturnAddrSaveIndex(int idx) { ReturnAddrSaveIndex = idx; }
+
+ unsigned getMinReservedArea() const { return MinReservedArea; }
+ void setMinReservedArea(unsigned size) { MinReservedArea = size; }
+
+ int getTailCallSPDelta() const { return TailCallSPDelta; }
+ void setTailCallSPDelta(int size) { TailCallSPDelta = size; }
+
+ /// MustSaveLR - This is set when the prolog/epilog inserter does its initial
+ /// scan of the function. It is true if the LR/LR8 register is ever explicitly
+ /// defined/clobbered in the machine function (e.g. by calls and movpctolr,
+ /// which is used in PIC generation), or if the LR stack slot is explicitly
+ /// referenced by builtin_return_address.
+ void setMustSaveLR(bool U) { MustSaveLR = U; }
+ bool mustSaveLR() const { return MustSaveLR; }
+
+ void setHasSpills() { HasSpills = true; }
+ bool hasSpills() const { return HasSpills; }
+
+ void setHasNonRISpills() { HasNonRISpills = true; }
+ bool hasNonRISpills() const { return HasNonRISpills; }
+
+ void setSpillsCR() { SpillsCR = true; }
+ bool isCRSpilled() const { return SpillsCR; }
+
+ void setSpillsVRSAVE() { SpillsVRSAVE = true; }
+ bool isVRSAVESpilled() const { return SpillsVRSAVE; }
+
+ void setLRStoreRequired() { LRStoreRequired = true; }
+ bool isLRStoreRequired() const { return LRStoreRequired; }
+
+ void setHasFastCall() { HasFastCall = true; }
+ bool hasFastCall() const { return HasFastCall;}
+
+ int getVarArgsFrameIndex() const { return VarArgsFrameIndex; }
+ void setVarArgsFrameIndex(int Index) { VarArgsFrameIndex = Index; }
+
+ int getVarArgsStackOffset() const { return VarArgsStackOffset; }
+ void setVarArgsStackOffset(int Offset) { VarArgsStackOffset = Offset; }
+
+ unsigned getVarArgsNumGPR() const { return VarArgsNumGPR; }
+ void setVarArgsNumGPR(unsigned Num) { VarArgsNumGPR = Num; }
+
+ unsigned getVarArgsNumFPR() const { return VarArgsNumFPR; }
+ void setVarArgsNumFPR(unsigned Num) { VarArgsNumFPR = Num; }
+
+ int getCRSpillFrameIndex() const { return CRSpillFrameIndex; }
+ void setCRSpillFrameIndex(int idx) { CRSpillFrameIndex = idx; }
+};
+
+} // end of namespace llvm
+
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCPerfectShuffle.h b/contrib/llvm/lib/Target/PowerPC/PPCPerfectShuffle.h
new file mode 100644
index 0000000..17b836d
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCPerfectShuffle.h
@@ -0,0 +1,6586 @@
+//===-- PPCPerfectShuffle.h - Altivec Perfect Shuffle Table -----*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file, which was autogenerated by llvm-PerfectShuffle, contains data
+// for the optimal way to build a perfect shuffle without using vperm.
+//
+//===----------------------------------------------------------------------===//
+
+// 31 entries have cost 0
+// 292 entries have cost 1
+// 1384 entries have cost 2
+// 3061 entries have cost 3
+// 1733 entries have cost 4
+// 60 entries have cost 5
+
+// This table is 6561*4 = 26244 bytes in size.
+static const unsigned PerfectShuffleTable[6561+1] = {
+ 202162278U, // <0,0,0,0>: Cost 1 vspltisw0 LHS
+ 1140850790U, // <0,0,0,1>: Cost 2 vmrghw <0,0,0,0>, LHS
+ 2617247181U, // <0,0,0,2>: Cost 3 vsldoi4 <0,0,0,0>, <2,0,3,0>
+ 2635163787U, // <0,0,0,3>: Cost 3 vsldoi4 <3,0,0,0>, <3,0,0,0>
+ 1543507254U, // <0,0,0,4>: Cost 2 vsldoi4 <0,0,0,0>, RHS
+ 2281701705U, // <0,0,0,5>: Cost 3 vmrglw <0,0,0,0>, <0,4,0,5>
+ 2617250133U, // <0,0,0,6>: Cost 3 vsldoi4 <0,0,0,0>, <6,0,7,0>
+ 2659054575U, // <0,0,0,7>: Cost 3 vsldoi4 <7,0,0,0>, <7,0,0,0>
+ 202162278U, // <0,0,0,u>: Cost 1 vspltisw0 LHS
+ 1141686282U, // <0,0,1,0>: Cost 2 vmrghw LHS, <0,0,1,1>
+ 67944550U, // <0,0,1,1>: Cost 1 vmrghw LHS, LHS
+ 1685241958U, // <0,0,1,2>: Cost 2 vsldoi12 <1,2,3,0>, LHS
+ 2215870716U, // <0,0,1,3>: Cost 3 vmrghw LHS, <0,3,1,0>
+ 1141727570U, // <0,0,1,4>: Cost 2 vmrghw LHS, <0,4,1,5>
+ 2215428562U, // <0,0,1,5>: Cost 3 vmrghw LHS, <0,5,6,7>
+ 2215428589U, // <0,0,1,6>: Cost 3 vmrghw LHS, <0,6,0,7>
+ 2659062768U, // <0,0,1,7>: Cost 3 vsldoi4 <7,0,0,1>, <7,0,0,1>
+ 67945117U, // <0,0,1,u>: Cost 1 vmrghw LHS, LHS
+ 2684356045U, // <0,0,2,0>: Cost 3 vsldoi8 <0,0,0,0>, <2,0,3,0>
+ 2216009830U, // <0,0,2,1>: Cost 3 vmrghw <0,2,1,2>, LHS
+ 2216009901U, // <0,0,2,2>: Cost 3 vmrghw <0,2,1,2>, <0,2,1,2>
+ 2698290853U, // <0,0,2,3>: Cost 3 vsldoi8 <2,3,0,0>, <2,3,0,0>
+ 3289751890U, // <0,0,2,4>: Cost 4 vmrghw <0,2,1,2>, <0,4,1,5>
+ 3758098275U, // <0,0,2,5>: Cost 4 vsldoi8 <0,0,0,0>, <2,5,3,1>
+ 2684356538U, // <0,0,2,6>: Cost 3 vsldoi8 <0,0,0,0>, <2,6,3,7>
+ 3758098410U, // <0,0,2,7>: Cost 4 vsldoi8 <0,0,0,0>, <2,7,0,1>
+ 2216010397U, // <0,0,2,u>: Cost 3 vmrghw <0,2,1,2>, LHS
+ 2702272651U, // <0,0,3,0>: Cost 3 vsldoi8 <3,0,0,0>, <3,0,0,0>
+ 2216656998U, // <0,0,3,1>: Cost 3 vmrghw <0,3,1,0>, LHS
+ 3844669704U, // <0,0,3,2>: Cost 4 vsldoi12 <3,2,3,0>, <0,3,2,3>
+ 2216657148U, // <0,0,3,3>: Cost 3 vmrghw <0,3,1,0>, <0,3,1,0>
+ 2684357122U, // <0,0,3,4>: Cost 3 vsldoi8 <0,0,0,0>, <3,4,5,6>
+ 3732820066U, // <0,0,3,5>: Cost 4 vsldoi4 <7,0,0,3>, <5,6,7,0>
+ 3778005624U, // <0,0,3,6>: Cost 4 vsldoi8 <3,3,0,0>, <3,6,0,7>
+ 3374713464U, // <0,0,3,7>: Cost 4 vmrglw <3,2,0,3>, <3,6,0,7>
+ 2216657565U, // <0,0,3,u>: Cost 3 vmrghw <0,3,1,0>, LHS
+ 2217361408U, // <0,0,4,0>: Cost 3 vmrghw <0,4,1,5>, <0,0,0,0>
+ 1143619686U, // <0,0,4,1>: Cost 2 vmrghw <0,4,1,5>, LHS
+ 3291103405U, // <0,0,4,2>: Cost 4 vmrghw <0,4,1,5>, <0,2,1,2>
+ 3827269988U, // <0,0,4,3>: Cost 4 vsldoi12 <0,3,1,0>, <0,4,3,5>
+ 1143619922U, // <0,0,4,4>: Cost 2 vmrghw <0,4,1,5>, <0,4,1,5>
+ 1610616118U, // <0,0,4,5>: Cost 2 vsldoi8 <0,0,0,0>, RHS
+ 3758099833U, // <0,0,4,6>: Cost 4 vsldoi8 <0,0,0,0>, <4,6,5,2>
+ 3854107016U, // <0,0,4,7>: Cost 4 vsldoi12 <4,7,5,0>, <0,4,7,5>
+ 1143620253U, // <0,0,4,u>: Cost 2 vmrghw <0,4,1,5>, LHS
+ 2284396544U, // <0,0,5,0>: Cost 3 vmrglw <0,4,0,5>, <0,0,0,0>
+ 2218025062U, // <0,0,5,1>: Cost 3 vmrghw <0,5,1,5>, LHS
+ 3758100203U, // <0,0,5,2>: Cost 4 vsldoi8 <0,0,0,0>, <5,2,1,3>
+ 3395966100U, // <0,0,5,3>: Cost 4 vmrglw <6,7,0,5>, <7,2,0,3>
+ 3804549052U, // <0,0,5,4>: Cost 4 vsldoi8 <7,7,0,0>, <5,4,6,5>
+ 2302314964U, // <0,0,5,5>: Cost 3 vmrglw <3,4,0,5>, <3,4,0,5>
+ 2785821138U, // <0,0,5,6>: Cost 3 vsldoi12 <5,6,7,0>, <0,5,6,7>
+ 3395966428U, // <0,0,5,7>: Cost 4 vmrglw <6,7,0,5>, <7,6,0,7>
+ 2787148260U, // <0,0,5,u>: Cost 3 vsldoi12 <5,u,7,0>, <0,5,u,7>
+ 2684358997U, // <0,0,6,0>: Cost 3 vsldoi8 <0,0,0,0>, <6,0,7,0>
+ 2218631270U, // <0,0,6,1>: Cost 3 vmrghw <0,6,0,7>, LHS
+ 2684359162U, // <0,0,6,2>: Cost 3 vsldoi8 <0,0,0,0>, <6,2,7,3>
+ 3758101042U, // <0,0,6,3>: Cost 4 vsldoi8 <0,0,0,0>, <6,3,4,5>
+ 3732843830U, // <0,0,6,4>: Cost 4 vsldoi4 <7,0,0,6>, RHS
+ 3758101227U, // <0,0,6,5>: Cost 4 vsldoi8 <0,0,0,0>, <6,5,7,1>
+ 2684359480U, // <0,0,6,6>: Cost 3 vsldoi8 <0,0,0,0>, <6,6,6,6>
+ 2724836173U, // <0,0,6,7>: Cost 3 vsldoi8 <6,7,0,0>, <6,7,0,0>
+ 2725499806U, // <0,0,6,u>: Cost 3 vsldoi8 <6,u,0,0>, <6,u,0,0>
+ 2726163439U, // <0,0,7,0>: Cost 3 vsldoi8 <7,0,0,0>, <7,0,0,0>
+ 2219311206U, // <0,0,7,1>: Cost 3 vmrghw <0,7,1,0>, LHS
+ 3868557900U, // <0,0,7,2>: Cost 4 vsldoi12 <7,2,3,0>, <0,7,2,3>
+ 3377400112U, // <0,0,7,3>: Cost 4 vmrglw <3,6,0,7>, <3,2,0,3>
+ 2684360038U, // <0,0,7,4>: Cost 3 vsldoi8 <0,0,0,0>, <7,4,5,6>
+ 3732852834U, // <0,0,7,5>: Cost 4 vsldoi4 <7,0,0,7>, <5,6,7,0>
+ 3871507060U, // <0,0,7,6>: Cost 4 vsldoi12 <7,6,7,0>, <0,7,6,7>
+ 2303658616U, // <0,0,7,7>: Cost 3 vmrglw <3,6,0,7>, <3,6,0,7>
+ 2726163439U, // <0,0,7,u>: Cost 3 vsldoi8 <7,0,0,0>, <7,0,0,0>
+ 202162278U, // <0,0,u,0>: Cost 1 vspltisw0 LHS
+ 72589414U, // <0,0,u,1>: Cost 1 vmrghw LHS, LHS
+ 1685242525U, // <0,0,u,2>: Cost 2 vsldoi12 <1,2,3,0>, LHS
+ 2220073212U, // <0,0,u,3>: Cost 3 vmrghw LHS, <0,3,1,0>
+ 1146331474U, // <0,0,u,4>: Cost 2 vmrghw LHS, <0,4,1,5>
+ 1610619034U, // <0,0,u,5>: Cost 2 vsldoi8 <0,0,0,0>, RHS
+ 2785821138U, // <0,0,u,6>: Cost 3 vsldoi12 <5,6,7,0>, <0,5,6,7>
+ 2659120119U, // <0,0,u,7>: Cost 3 vsldoi4 <7,0,0,u>, <7,0,0,u>
+ 72589981U, // <0,0,u,u>: Cost 1 vmrghw LHS, LHS
+ 2698297344U, // <0,1,0,0>: Cost 3 vsldoi8 <2,3,0,1>, <0,0,0,0>
+ 1624555622U, // <0,1,0,1>: Cost 2 vsldoi8 <2,3,0,1>, LHS
+ 2758984428U, // <0,1,0,2>: Cost 3 vsldoi12 <1,2,3,0>, <1,0,2,1>
+ 2635237524U, // <0,1,0,3>: Cost 3 vsldoi4 <3,0,1,0>, <3,0,1,0>
+ 2693652818U, // <0,1,0,4>: Cost 3 vsldoi8 <1,5,0,1>, <0,4,1,5>
+ 2281701714U, // <0,1,0,5>: Cost 3 vmrglw <0,0,0,0>, <0,4,1,5>
+ 2698297846U, // <0,1,0,6>: Cost 3 vsldoi8 <2,3,0,1>, <0,6,1,7>
+ 2659128312U, // <0,1,0,7>: Cost 3 vsldoi4 <7,0,1,0>, <7,0,1,0>
+ 1624556189U, // <0,1,0,u>: Cost 2 vsldoi8 <2,3,0,1>, LHS
+ 1543585802U, // <0,1,1,0>: Cost 2 vsldoi4 <0,0,1,1>, <0,0,1,1>
+ 1141728052U, // <0,1,1,1>: Cost 2 vmrghw LHS, <1,1,1,1>
+ 1141728150U, // <0,1,1,2>: Cost 2 vmrghw LHS, <1,2,3,0>
+ 2295644334U, // <0,1,1,3>: Cost 3 vmrglw <2,3,0,1>, <0,2,1,3>
+ 1543589174U, // <0,1,1,4>: Cost 2 vsldoi4 <0,0,1,1>, RHS
+ 2290999634U, // <0,1,1,5>: Cost 3 vmrglw <1,5,0,1>, <0,4,1,5>
+ 2617332135U, // <0,1,1,6>: Cost 3 vsldoi4 <0,0,1,1>, <6,1,7,1>
+ 2617332720U, // <0,1,1,7>: Cost 3 vsldoi4 <0,0,1,1>, <7,0,0,1>
+ 1142171004U, // <0,1,1,u>: Cost 2 vmrghw LHS, <1,u,3,0>
+ 1561509990U, // <0,1,2,0>: Cost 2 vsldoi4 <3,0,1,2>, LHS
+ 2623308516U, // <0,1,2,1>: Cost 3 vsldoi4 <1,0,1,2>, <1,0,1,2>
+ 2698298984U, // <0,1,2,2>: Cost 3 vsldoi8 <2,3,0,1>, <2,2,2,2>
+ 835584U, // <0,1,2,3>: Cost 0 copy LHS
+ 1561513270U, // <0,1,2,4>: Cost 2 vsldoi4 <3,0,1,2>, RHS
+ 2647199304U, // <0,1,2,5>: Cost 3 vsldoi4 <5,0,1,2>, <5,0,1,2>
+ 2698299322U, // <0,1,2,6>: Cost 3 vsldoi8 <2,3,0,1>, <2,6,3,7>
+ 1585402874U, // <0,1,2,7>: Cost 2 vsldoi4 <7,0,1,2>, <7,0,1,2>
+ 835584U, // <0,1,2,u>: Cost 0 copy LHS
+ 2698299540U, // <0,1,3,0>: Cost 3 vsldoi8 <2,3,0,1>, <3,0,1,0>
+ 3290399540U, // <0,1,3,1>: Cost 4 vmrghw <0,3,1,0>, <1,1,1,1>
+ 2698299720U, // <0,1,3,2>: Cost 3 vsldoi8 <2,3,0,1>, <3,2,3,0>
+ 2698299804U, // <0,1,3,3>: Cost 3 vsldoi8 <2,3,0,1>, <3,3,3,3>
+ 2698299906U, // <0,1,3,4>: Cost 3 vsldoi8 <2,3,0,1>, <3,4,5,6>
+ 3832726521U, // <0,1,3,5>: Cost 4 vsldoi12 <1,2,3,0>, <1,3,5,0>
+ 2724842160U, // <0,1,3,6>: Cost 3 vsldoi8 <6,7,0,1>, <3,6,7,0>
+ 2706926275U, // <0,1,3,7>: Cost 3 vsldoi8 <3,7,0,1>, <3,7,0,1>
+ 2698300190U, // <0,1,3,u>: Cost 3 vsldoi8 <2,3,0,1>, <3,u,1,2>
+ 2635268198U, // <0,1,4,0>: Cost 3 vsldoi4 <3,0,1,4>, LHS
+ 2217362228U, // <0,1,4,1>: Cost 3 vmrghw <0,4,1,5>, <1,1,1,1>
+ 2217362326U, // <0,1,4,2>: Cost 3 vmrghw <0,4,1,5>, <1,2,3,0>
+ 2635270296U, // <0,1,4,3>: Cost 3 vsldoi4 <3,0,1,4>, <3,0,1,4>
+ 2635271478U, // <0,1,4,4>: Cost 3 vsldoi4 <3,0,1,4>, RHS
+ 1624558902U, // <0,1,4,5>: Cost 2 vsldoi8 <2,3,0,1>, RHS
+ 2659160910U, // <0,1,4,6>: Cost 3 vsldoi4 <7,0,1,4>, <6,7,0,1>
+ 2659161084U, // <0,1,4,7>: Cost 3 vsldoi4 <7,0,1,4>, <7,0,1,4>
+ 1624559145U, // <0,1,4,u>: Cost 2 vsldoi8 <2,3,0,1>, RHS
+ 3832726639U, // <0,1,5,0>: Cost 4 vsldoi12 <1,2,3,0>, <1,5,0,1>
+ 2714889871U, // <0,1,5,1>: Cost 3 vsldoi8 <5,1,0,1>, <5,1,0,1>
+ 2302314646U, // <0,1,5,2>: Cost 3 vmrglw <3,4,0,5>, <3,0,1,2>
+ 3834717321U, // <0,1,5,3>: Cost 4 vsldoi12 <1,5,3,0>, <1,5,3,0>
+ 3832726679U, // <0,1,5,4>: Cost 4 vsldoi12 <1,2,3,0>, <1,5,4,5>
+ 2717544403U, // <0,1,5,5>: Cost 3 vsldoi8 <5,5,0,1>, <5,5,0,1>
+ 2718208036U, // <0,1,5,6>: Cost 3 vsldoi8 <5,6,0,1>, <5,6,0,1>
+ 3792613493U, // <0,1,5,7>: Cost 4 vsldoi8 <5,7,0,1>, <5,7,0,1>
+ 2719535302U, // <0,1,5,u>: Cost 3 vsldoi8 <5,u,0,1>, <5,u,0,1>
+ 2659172454U, // <0,1,6,0>: Cost 3 vsldoi4 <7,0,1,6>, LHS
+ 3832726735U, // <0,1,6,1>: Cost 4 vsldoi12 <1,2,3,0>, <1,6,1,7>
+ 2724844026U, // <0,1,6,2>: Cost 3 vsldoi8 <6,7,0,1>, <6,2,7,3>
+ 3775361608U, // <0,1,6,3>: Cost 4 vsldoi8 <2,u,0,1>, <6,3,7,0>
+ 2659175734U, // <0,1,6,4>: Cost 3 vsldoi4 <7,0,1,6>, RHS
+ 3832726771U, // <0,1,6,5>: Cost 4 vsldoi12 <1,2,3,0>, <1,6,5,7>
+ 2724844344U, // <0,1,6,6>: Cost 3 vsldoi8 <6,7,0,1>, <6,6,6,6>
+ 1651102542U, // <0,1,6,7>: Cost 2 vsldoi8 <6,7,0,1>, <6,7,0,1>
+ 1651766175U, // <0,1,6,u>: Cost 2 vsldoi8 <6,u,0,1>, <6,u,0,1>
+ 2724844536U, // <0,1,7,0>: Cost 3 vsldoi8 <6,7,0,1>, <7,0,1,0>
+ 3377397770U, // <0,1,7,1>: Cost 4 vmrglw <3,6,0,7>, <0,0,1,1>
+ 2698302636U, // <0,1,7,2>: Cost 3 vsldoi8 <2,3,0,1>, <7,2,3,0>
+ 2728162531U, // <0,1,7,3>: Cost 3 vsldoi8 <7,3,0,1>, <7,3,0,1>
+ 2724844902U, // <0,1,7,4>: Cost 3 vsldoi8 <6,7,0,1>, <7,4,5,6>
+ 3377398098U, // <0,1,7,5>: Cost 4 vmrglw <3,6,0,7>, <0,4,1,5>
+ 2724845076U, // <0,1,7,6>: Cost 3 vsldoi8 <6,7,0,1>, <7,6,7,0>
+ 2724845164U, // <0,1,7,7>: Cost 3 vsldoi8 <6,7,0,1>, <7,7,7,7>
+ 2724845186U, // <0,1,7,u>: Cost 3 vsldoi8 <6,7,0,1>, <7,u,1,2>
+ 1561559142U, // <0,1,u,0>: Cost 2 vsldoi4 <3,0,1,u>, LHS
+ 1146331956U, // <0,1,u,1>: Cost 2 vmrghw LHS, <1,1,1,1>
+ 1146332054U, // <0,1,u,2>: Cost 2 vmrghw LHS, <1,2,3,0>
+ 835584U, // <0,1,u,3>: Cost 0 copy LHS
+ 1561562422U, // <0,1,u,4>: Cost 2 vsldoi4 <3,0,1,u>, RHS
+ 1624561818U, // <0,1,u,5>: Cost 2 vsldoi8 <2,3,0,1>, RHS
+ 2220074191U, // <0,1,u,6>: Cost 3 vmrghw LHS, <1,6,1,7>
+ 1585452032U, // <0,1,u,7>: Cost 2 vsldoi4 <7,0,1,u>, <7,0,1,u>
+ 835584U, // <0,1,u,u>: Cost 0 copy LHS
+ 2214593997U, // <0,2,0,0>: Cost 3 vmrghw <0,0,0,0>, <2,0,3,0>
+ 2214675999U, // <0,2,0,1>: Cost 3 vmrghw <0,0,1,1>, <2,1,3,1>
+ 2214594152U, // <0,2,0,2>: Cost 3 vmrghw <0,0,0,0>, <2,2,2,2>
+ 1207959654U, // <0,2,0,3>: Cost 2 vmrglw <0,0,0,0>, LHS
+ 3709054262U, // <0,2,0,4>: Cost 4 vsldoi4 <3,0,2,0>, RHS
+ 3375350836U, // <0,2,0,5>: Cost 4 vmrglw <3,3,0,0>, <1,4,2,5>
+ 2214594490U, // <0,2,0,6>: Cost 3 vmrghw <0,0,0,0>, <2,6,3,7>
+ 3288336362U, // <0,2,0,7>: Cost 4 vmrghw <0,0,0,0>, <2,7,0,1>
+ 1207959659U, // <0,2,0,u>: Cost 2 vmrglw <0,0,0,0>, LHS
+ 2215871994U, // <0,2,1,0>: Cost 3 vmrghw LHS, <2,0,u,0>
+ 2215470623U, // <0,2,1,1>: Cost 3 vmrghw LHS, <2,1,3,1>
+ 1141728872U, // <0,2,1,2>: Cost 2 vmrghw LHS, <2,2,2,2>
+ 1141728934U, // <0,2,1,3>: Cost 2 vmrghw LHS, <2,3,0,1>
+ 2215872323U, // <0,2,1,4>: Cost 3 vmrghw LHS, <2,4,u,5>
+ 2215872405U, // <0,2,1,5>: Cost 3 vmrghw LHS, <2,5,u,6>
+ 1141729210U, // <0,2,1,6>: Cost 2 vmrghw LHS, <2,6,3,7>
+ 2215430122U, // <0,2,1,7>: Cost 3 vmrghw LHS, <2,7,0,1>
+ 1141729368U, // <0,2,1,u>: Cost 2 vmrghw LHS, <2,u,3,3>
+ 3289736698U, // <0,2,2,0>: Cost 4 vmrghw <0,2,1,0>, <2,0,u,0>
+ 3289744927U, // <0,2,2,1>: Cost 4 vmrghw <0,2,1,1>, <2,1,3,1>
+ 2216011368U, // <0,2,2,2>: Cost 3 vmrghw <0,2,1,2>, <2,2,2,2>
+ 2216019622U, // <0,2,2,3>: Cost 3 vmrghw <0,2,1,3>, <2,3,0,1>
+ 3289769795U, // <0,2,2,4>: Cost 4 vmrghw <0,2,1,4>, <2,4,u,5>
+ 3289778069U, // <0,2,2,5>: Cost 4 vmrghw <0,2,1,5>, <2,5,u,6>
+ 2216044474U, // <0,2,2,6>: Cost 3 vmrghw <0,2,1,6>, <2,6,3,7>
+ 3732960259U, // <0,2,2,7>: Cost 4 vsldoi4 <7,0,2,2>, <7,0,2,2>
+ 2216061016U, // <0,2,2,u>: Cost 3 vmrghw <0,2,1,u>, <2,u,3,3>
+ 2758985382U, // <0,2,3,0>: Cost 3 vsldoi12 <1,2,3,0>, <2,3,0,1>
+ 2758985392U, // <0,2,3,1>: Cost 3 vsldoi12 <1,2,3,0>, <2,3,1,2>
+ 3290400360U, // <0,2,3,2>: Cost 4 vmrghw <0,3,1,0>, <2,2,2,2>
+ 2758985408U, // <0,2,3,3>: Cost 3 vsldoi12 <1,2,3,0>, <2,3,3,0>
+ 2758985422U, // <0,2,3,4>: Cost 3 vsldoi12 <1,2,3,0>, <2,3,4,5>
+ 2785822424U, // <0,2,3,5>: Cost 3 vsldoi12 <5,6,7,0>, <2,3,5,6>
+ 3290400698U, // <0,2,3,6>: Cost 4 vmrghw <0,3,1,0>, <2,6,3,7>
+ 2765915876U, // <0,2,3,7>: Cost 3 vsldoi12 <2,3,7,0>, <2,3,7,0>
+ 2758985453U, // <0,2,3,u>: Cost 3 vsldoi12 <1,2,3,0>, <2,3,u,0>
+ 3291104762U, // <0,2,4,0>: Cost 4 vmrghw <0,4,1,5>, <2,0,u,0>
+ 2217362979U, // <0,2,4,1>: Cost 3 vmrghw <0,4,1,5>, <2,1,3,5>
+ 2217363048U, // <0,2,4,2>: Cost 3 vmrghw <0,4,1,5>, <2,2,2,2>
+ 2217363110U, // <0,2,4,3>: Cost 3 vmrghw <0,4,1,5>, <2,3,0,1>
+ 3291105087U, // <0,2,4,4>: Cost 4 vmrghw <0,4,1,5>, <2,4,u,1>
+ 3291105173U, // <0,2,4,5>: Cost 4 vmrghw <0,4,1,5>, <2,5,u,6>
+ 2217363386U, // <0,2,4,6>: Cost 3 vmrghw <0,4,1,5>, <2,6,3,7>
+ 3788639688U, // <0,2,4,7>: Cost 4 vsldoi8 <5,1,0,2>, <4,7,5,0>
+ 2217363515U, // <0,2,4,u>: Cost 3 vmrghw <0,4,1,5>, <2,u,0,1>
+ 3376054371U, // <0,2,5,0>: Cost 4 vmrglw <3,4,0,5>, <0,1,2,0>
+ 3788639888U, // <0,2,5,1>: Cost 4 vsldoi8 <5,1,0,2>, <5,1,0,2>
+ 3376055912U, // <0,2,5,2>: Cost 4 vmrglw <3,4,0,5>, <2,2,2,2>
+ 2302312550U, // <0,2,5,3>: Cost 3 vmrglw <3,4,0,5>, LHS
+ 3376054375U, // <0,2,5,4>: Cost 4 vmrglw <3,4,0,5>, <0,1,2,4>
+ 3374728244U, // <0,2,5,5>: Cost 4 vmrglw <3,2,0,5>, <1,4,2,5>
+ 3805229154U, // <0,2,5,6>: Cost 4 vsldoi8 <7,u,0,2>, <5,6,7,0>
+ 3376055512U, // <0,2,5,7>: Cost 4 vmrglw <3,4,0,5>, <1,6,2,7>
+ 2302312555U, // <0,2,5,u>: Cost 3 vmrglw <3,4,0,5>, LHS
+ 3709100134U, // <0,2,6,0>: Cost 4 vsldoi4 <3,0,2,6>, LHS
+ 3709100950U, // <0,2,6,1>: Cost 4 vsldoi4 <3,0,2,6>, <1,2,3,0>
+ 3709102010U, // <0,2,6,2>: Cost 4 vsldoi4 <3,0,2,6>, <2,6,3,7>
+ 2758985658U, // <0,2,6,3>: Cost 3 vsldoi12 <1,2,3,0>, <2,6,3,7>
+ 3709103414U, // <0,2,6,4>: Cost 4 vsldoi4 <3,0,2,6>, RHS
+ 3732992098U, // <0,2,6,5>: Cost 4 vsldoi4 <7,0,2,6>, <5,6,7,0>
+ 3292374970U, // <0,2,6,6>: Cost 4 vmrghw <0,6,0,7>, <2,6,3,7>
+ 3798594383U, // <0,2,6,7>: Cost 4 vsldoi8 <6,7,0,2>, <6,7,0,2>
+ 2758985703U, // <0,2,6,u>: Cost 3 vsldoi12 <1,2,3,0>, <2,6,u,7>
+ 3788641274U, // <0,2,7,0>: Cost 4 vsldoi8 <5,1,0,2>, <7,0,1,2>
+ 3377398508U, // <0,2,7,1>: Cost 4 vmrglw <3,6,0,7>, <1,0,2,1>
+ 3377398590U, // <0,2,7,2>: Cost 4 vmrglw <3,6,0,7>, <1,1,2,2>
+ 2303656038U, // <0,2,7,3>: Cost 3 vmrglw <3,6,0,7>, LHS
+ 3709111606U, // <0,2,7,4>: Cost 4 vsldoi4 <3,0,2,7>, RHS
+ 3377398836U, // <0,2,7,5>: Cost 4 vmrglw <3,6,0,7>, <1,4,2,5>
+ 3803903447U, // <0,2,7,6>: Cost 4 vsldoi8 <7,6,0,2>, <7,6,0,2>
+ 3293054954U, // <0,2,7,7>: Cost 4 vmrghw <0,7,1,0>, <2,7,0,1>
+ 2303656043U, // <0,2,7,u>: Cost 3 vmrglw <3,6,0,7>, LHS
+ 2220074490U, // <0,2,u,0>: Cost 3 vmrghw LHS, <2,0,u,0>
+ 2220074527U, // <0,2,u,1>: Cost 3 vmrghw LHS, <2,1,3,1>
+ 1146332776U, // <0,2,u,2>: Cost 2 vmrghw LHS, <2,2,2,2>
+ 1146332838U, // <0,2,u,3>: Cost 2 vmrghw LHS, <2,3,0,1>
+ 2220074819U, // <0,2,u,4>: Cost 3 vmrghw LHS, <2,4,u,5>
+ 2220074901U, // <0,2,u,5>: Cost 3 vmrghw LHS, <2,5,u,6>
+ 1146333114U, // <0,2,u,6>: Cost 2 vmrghw LHS, <2,6,3,7>
+ 2220074986U, // <0,2,u,7>: Cost 3 vmrghw LHS, <2,7,0,1>
+ 1146333243U, // <0,2,u,u>: Cost 2 vmrghw LHS, <2,u,0,1>
+ 2629410816U, // <0,3,0,0>: Cost 3 vsldoi4 <2,0,3,0>, <0,0,0,0>
+ 2753530006U, // <0,3,0,1>: Cost 3 vsldoi12 <0,3,1,0>, <3,0,1,2>
+ 2629412301U, // <0,3,0,2>: Cost 3 vsldoi4 <2,0,3,0>, <2,0,3,0>
+ 2214594972U, // <0,3,0,3>: Cost 3 vmrghw <0,0,0,0>, <3,3,3,3>
+ 2758985908U, // <0,3,0,4>: Cost 3 vsldoi12 <1,2,3,0>, <3,0,4,5>
+ 3733016674U, // <0,3,0,5>: Cost 4 vsldoi4 <7,0,3,0>, <5,6,7,0>
+ 3777364488U, // <0,3,0,6>: Cost 4 vsldoi8 <3,2,0,3>, <0,6,3,7>
+ 2281703354U, // <0,3,0,7>: Cost 3 vmrglw <0,0,0,0>, <2,6,3,7>
+ 2758985941U, // <0,3,0,u>: Cost 3 vsldoi12 <1,2,3,0>, <3,0,u,2>
+ 1141729430U, // <0,3,1,0>: Cost 2 vmrghw LHS, <3,0,1,2>
+ 2215471334U, // <0,3,1,1>: Cost 3 vmrghw LHS, <3,1,1,1>
+ 2215471425U, // <0,3,1,2>: Cost 3 vmrghw LHS, <3,2,2,2>
+ 1141729692U, // <0,3,1,3>: Cost 2 vmrghw LHS, <3,3,3,3>
+ 1141729794U, // <0,3,1,4>: Cost 2 vmrghw LHS, <3,4,5,6>
+ 2215430738U, // <0,3,1,5>: Cost 3 vmrghw LHS, <3,5,5,5>
+ 2215430776U, // <0,3,1,6>: Cost 3 vmrghw LHS, <3,6,0,7>
+ 2295646138U, // <0,3,1,7>: Cost 3 vmrglw <2,3,0,1>, <2,6,3,7>
+ 1141730078U, // <0,3,1,u>: Cost 2 vmrghw LHS, <3,u,1,2>
+ 2758986032U, // <0,3,2,0>: Cost 3 vsldoi12 <1,2,3,0>, <3,2,0,3>
+ 3709141910U, // <0,3,2,1>: Cost 4 vsldoi4 <3,0,3,2>, <1,2,3,0>
+ 3289753921U, // <0,3,2,2>: Cost 4 vmrghw <0,2,1,2>, <3,2,2,2>
+ 2770929992U, // <0,3,2,3>: Cost 3 vsldoi12 <3,2,3,0>, <3,2,3,0>
+ 3289754114U, // <0,3,2,4>: Cost 4 vmrghw <0,2,1,2>, <3,4,5,6>
+ 3362095460U, // <0,3,2,5>: Cost 5 vmrglw <1,1,0,2>, <0,4,3,5>
+ 3832727910U, // <0,3,2,6>: Cost 4 vsldoi12 <1,2,3,0>, <3,2,6,3>
+ 3365414842U, // <0,3,2,7>: Cost 4 vmrglw <1,6,0,2>, <2,6,3,7>
+ 2771298677U, // <0,3,2,u>: Cost 3 vsldoi12 <3,2,u,0>, <3,2,u,0>
+ 2216659094U, // <0,3,3,0>: Cost 3 vmrghw <0,3,1,0>, <3,0,1,2>
+ 3290409190U, // <0,3,3,1>: Cost 4 vmrghw <0,3,1,1>, <3,1,1,1>
+ 2703624496U, // <0,3,3,2>: Cost 3 vsldoi8 <3,2,0,3>, <3,2,0,3>
+ 2216683932U, // <0,3,3,3>: Cost 3 vmrghw <0,3,1,3>, <3,3,3,3>
+ 2216692226U, // <0,3,3,4>: Cost 3 vmrghw <0,3,1,4>, <3,4,5,6>
+ 3733041250U, // <0,3,3,5>: Cost 4 vsldoi4 <7,0,3,3>, <5,6,7,0>
+ 3832727988U, // <0,3,3,6>: Cost 4 vsldoi12 <1,2,3,0>, <3,3,6,0>
+ 3374712762U, // <0,3,3,7>: Cost 4 vmrglw <3,2,0,3>, <2,6,3,7>
+ 2216725278U, // <0,3,3,u>: Cost 3 vmrghw <0,3,1,u>, <3,u,1,2>
+ 2217363606U, // <0,3,4,0>: Cost 3 vmrghw <0,4,1,5>, <3,0,1,2>
+ 3291105510U, // <0,3,4,1>: Cost 4 vmrghw <0,4,1,5>, <3,1,1,1>
+ 3291105601U, // <0,3,4,2>: Cost 4 vmrghw <0,4,1,5>, <3,2,2,2>
+ 2217363868U, // <0,3,4,3>: Cost 3 vmrghw <0,4,1,5>, <3,3,3,3>
+ 2217363970U, // <0,3,4,4>: Cost 3 vmrghw <0,4,1,5>, <3,4,5,6>
+ 2758986242U, // <0,3,4,5>: Cost 3 vsldoi12 <1,2,3,0>, <3,4,5,6>
+ 3727077685U, // <0,3,4,6>: Cost 4 vsldoi4 <6,0,3,4>, <6,0,3,4>
+ 3364767674U, // <0,3,4,7>: Cost 4 vmrglw <1,5,0,4>, <2,6,3,7>
+ 2217364254U, // <0,3,4,u>: Cost 3 vmrghw <0,4,1,5>, <3,u,1,2>
+ 3832728102U, // <0,3,5,0>: Cost 4 vsldoi12 <1,2,3,0>, <3,5,0,6>
+ 3405916003U, // <0,3,5,1>: Cost 4 vmrglw <u,4,0,5>, <2,5,3,1>
+ 3376055840U, // <0,3,5,2>: Cost 4 vmrglw <3,4,0,5>, <2,1,3,2>
+ 3376055679U, // <0,3,5,3>: Cost 4 vmrglw <3,4,0,5>, <1,u,3,3>
+ 3376055194U, // <0,3,5,4>: Cost 4 vmrglw <3,4,0,5>, <1,2,3,4>
+ 3859565138U, // <0,3,5,5>: Cost 4 vsldoi12 <5,6,7,0>, <3,5,5,5>
+ 2727514210U, // <0,3,5,6>: Cost 3 vsldoi8 <7,2,0,3>, <5,6,7,0>
+ 3376056250U, // <0,3,5,7>: Cost 4 vmrglw <3,4,0,5>, <2,6,3,7>
+ 2727514210U, // <0,3,5,u>: Cost 3 vsldoi8 <7,2,0,3>, <5,6,7,0>
+ 2758986360U, // <0,3,6,0>: Cost 3 vsldoi12 <1,2,3,0>, <3,6,0,7>
+ 3709174678U, // <0,3,6,1>: Cost 4 vsldoi4 <3,0,3,6>, <1,2,3,0>
+ 3795284411U, // <0,3,6,2>: Cost 4 vsldoi8 <6,2,0,3>, <6,2,0,3>
+ 3709175980U, // <0,3,6,3>: Cost 4 vsldoi4 <3,0,3,6>, <3,0,3,6>
+ 3833096860U, // <0,3,6,4>: Cost 4 vsldoi12 <1,2,u,0>, <3,6,4,7>
+ 3376728235U, // <0,3,6,5>: Cost 5 vmrglw <3,5,0,6>, <3,0,3,5>
+ 3859565229U, // <0,3,6,6>: Cost 4 vsldoi12 <5,6,7,0>, <3,6,6,6>
+ 2773879472U, // <0,3,6,7>: Cost 3 vsldoi12 <3,6,7,0>, <3,6,7,0>
+ 2758986360U, // <0,3,6,u>: Cost 3 vsldoi12 <1,2,3,0>, <3,6,0,7>
+ 2303656854U, // <0,3,7,0>: Cost 3 vmrglw <3,6,0,7>, <1,2,3,0>
+ 3807229018U, // <0,3,7,1>: Cost 4 vsldoi8 <u,2,0,3>, <7,1,2,u>
+ 2727515284U, // <0,3,7,2>: Cost 3 vsldoi8 <7,2,0,3>, <7,2,0,3>
+ 3377399410U, // <0,3,7,3>: Cost 4 vmrglw <3,6,0,7>, <2,2,3,3>
+ 3377398682U, // <0,3,7,4>: Cost 4 vmrglw <3,6,0,7>, <1,2,3,4>
+ 3801257409U, // <0,3,7,5>: Cost 4 vsldoi8 <7,2,0,3>, <7,5,6,7>
+ 3377399980U, // <0,3,7,6>: Cost 4 vmrglw <3,6,0,7>, <3,0,3,6>
+ 3375409082U, // <0,3,7,7>: Cost 4 vmrglw <3,3,0,7>, <2,6,3,7>
+ 2731497082U, // <0,3,7,u>: Cost 3 vsldoi8 <7,u,0,3>, <7,u,0,3>
+ 1146333334U, // <0,3,u,0>: Cost 2 vmrghw LHS, <3,0,1,2>
+ 2220075238U, // <0,3,u,1>: Cost 3 vmrghw LHS, <3,1,1,1>
+ 2220075329U, // <0,3,u,2>: Cost 3 vmrghw LHS, <3,2,2,2>
+ 1146333596U, // <0,3,u,3>: Cost 2 vmrghw LHS, <3,3,3,3>
+ 1146333698U, // <0,3,u,4>: Cost 2 vmrghw LHS, <3,4,5,6>
+ 2758986566U, // <0,3,u,5>: Cost 3 vsldoi12 <1,2,3,0>, <3,u,5,6>
+ 2803739472U, // <0,3,u,6>: Cost 3 vsldoi12 <u,6,7,0>, <3,u,6,7>
+ 2295703482U, // <0,3,u,7>: Cost 3 vmrglw <2,3,0,u>, <2,6,3,7>
+ 1146333982U, // <0,3,u,u>: Cost 2 vmrghw LHS, <3,u,1,2>
+ 2214595473U, // <0,4,0,0>: Cost 3 vmrghw <0,0,0,0>, <4,0,5,0>
+ 2693677158U, // <0,4,0,1>: Cost 3 vsldoi8 <1,5,0,4>, LHS
+ 3839437689U, // <0,4,0,2>: Cost 4 vsldoi12 <2,3,4,0>, <4,0,2,3>
+ 3709200559U, // <0,4,0,3>: Cost 4 vsldoi4 <3,0,4,0>, <3,0,4,0>
+ 2693677394U, // <0,4,0,4>: Cost 3 vsldoi8 <1,5,0,4>, <0,4,1,5>
+ 1140854070U, // <0,4,0,5>: Cost 2 vmrghw <0,0,0,0>, RHS
+ 3767419409U, // <0,4,0,6>: Cost 4 vsldoi8 <1,5,0,4>, <0,6,4,7>
+ 3854109604U, // <0,4,0,7>: Cost 4 vsldoi12 <4,7,5,0>, <4,0,7,1>
+ 1140854313U, // <0,4,0,u>: Cost 2 vmrghw <0,0,0,0>, RHS
+ 1141689234U, // <0,4,1,0>: Cost 2 vmrghw LHS, <4,0,5,1>
+ 2215431114U, // <0,4,1,1>: Cost 3 vmrghw LHS, <4,1,2,3>
+ 2215431221U, // <0,4,1,2>: Cost 3 vmrghw LHS, <4,2,5,2>
+ 2635466928U, // <0,4,1,3>: Cost 3 vsldoi4 <3,0,4,1>, <3,0,4,1>
+ 1141689552U, // <0,4,1,4>: Cost 2 vmrghw LHS, <4,4,4,4>
+ 67947830U, // <0,4,1,5>: Cost 1 vmrghw LHS, RHS
+ 2215431545U, // <0,4,1,6>: Cost 3 vmrghw LHS, <4,6,5,2>
+ 2659357716U, // <0,4,1,7>: Cost 3 vsldoi4 <7,0,4,1>, <7,0,4,1>
+ 67948073U, // <0,4,1,u>: Cost 1 vmrghw LHS, RHS
+ 3767420369U, // <0,4,2,0>: Cost 4 vsldoi8 <1,5,0,4>, <2,0,3,4>
+ 3767420451U, // <0,4,2,1>: Cost 4 vsldoi8 <1,5,0,4>, <2,1,3,5>
+ 3767420520U, // <0,4,2,2>: Cost 4 vsldoi8 <1,5,0,4>, <2,2,2,2>
+ 2698323625U, // <0,4,2,3>: Cost 3 vsldoi8 <2,3,0,4>, <2,3,0,4>
+ 3709218102U, // <0,4,2,4>: Cost 4 vsldoi4 <3,0,4,2>, RHS
+ 2216013110U, // <0,4,2,5>: Cost 3 vmrghw <0,2,1,2>, RHS
+ 3767420858U, // <0,4,2,6>: Cost 4 vsldoi8 <1,5,0,4>, <2,6,3,7>
+ 3774719981U, // <0,4,2,7>: Cost 4 vsldoi8 <2,7,0,4>, <2,7,0,4>
+ 2216013353U, // <0,4,2,u>: Cost 3 vmrghw <0,2,1,2>, RHS
+ 3767421078U, // <0,4,3,0>: Cost 4 vsldoi8 <1,5,0,4>, <3,0,1,2>
+ 3776710880U, // <0,4,3,1>: Cost 4 vsldoi8 <3,1,0,4>, <3,1,0,4>
+ 3833097325U, // <0,4,3,2>: Cost 5 vsldoi12 <1,2,u,0>, <4,3,2,4>
+ 3767421340U, // <0,4,3,3>: Cost 4 vsldoi8 <1,5,0,4>, <3,3,3,3>
+ 3767421442U, // <0,4,3,4>: Cost 4 vsldoi8 <1,5,0,4>, <3,4,5,6>
+ 2216660278U, // <0,4,3,5>: Cost 3 vmrghw <0,3,1,0>, RHS
+ 3833097361U, // <0,4,3,6>: Cost 5 vsldoi12 <1,2,u,0>, <4,3,6,4>
+ 3780692678U, // <0,4,3,7>: Cost 4 vsldoi8 <3,7,0,4>, <3,7,0,4>
+ 2216660521U, // <0,4,3,u>: Cost 3 vmrghw <0,3,1,0>, RHS
+ 2617573416U, // <0,4,4,0>: Cost 3 vsldoi4 <0,0,4,4>, <0,0,4,4>
+ 2217364450U, // <0,4,4,1>: Cost 3 vmrghw <0,4,1,5>, <4,1,5,0>
+ 3691316771U, // <0,4,4,2>: Cost 4 vsldoi4 <0,0,4,4>, <2,1,3,5>
+ 3709233331U, // <0,4,4,3>: Cost 4 vsldoi4 <3,0,4,4>, <3,0,4,4>
+ 2785823952U, // <0,4,4,4>: Cost 3 vsldoi12 <5,6,7,0>, <4,4,4,4>
+ 1143622966U, // <0,4,4,5>: Cost 2 vmrghw <0,4,1,5>, RHS
+ 3691319723U, // <0,4,4,6>: Cost 4 vsldoi4 <0,0,4,4>, <6,1,7,5>
+ 3854109932U, // <0,4,4,7>: Cost 4 vsldoi12 <4,7,5,0>, <4,4,7,5>
+ 1143623209U, // <0,4,4,u>: Cost 2 vmrghw <0,4,1,5>, RHS
+ 2635497574U, // <0,4,5,0>: Cost 3 vsldoi4 <3,0,4,5>, LHS
+ 2635498390U, // <0,4,5,1>: Cost 3 vsldoi4 <3,0,4,5>, <1,2,3,0>
+ 3709240936U, // <0,4,5,2>: Cost 4 vsldoi4 <3,0,4,5>, <2,2,2,2>
+ 2635499700U, // <0,4,5,3>: Cost 3 vsldoi4 <3,0,4,5>, <3,0,4,5>
+ 2635500854U, // <0,4,5,4>: Cost 3 vsldoi4 <3,0,4,5>, RHS
+ 2785824044U, // <0,4,5,5>: Cost 3 vsldoi12 <5,6,7,0>, <4,5,5,6>
+ 1685245238U, // <0,4,5,6>: Cost 2 vsldoi12 <1,2,3,0>, RHS
+ 2659390488U, // <0,4,5,7>: Cost 3 vsldoi4 <7,0,4,5>, <7,0,4,5>
+ 1685245256U, // <0,4,5,u>: Cost 2 vsldoi12 <1,2,3,0>, RHS
+ 3839438161U, // <0,4,6,0>: Cost 4 vsldoi12 <2,3,4,0>, <4,6,0,7>
+ 3798610347U, // <0,4,6,1>: Cost 4 vsldoi8 <6,7,0,4>, <6,1,7,5>
+ 3798610426U, // <0,4,6,2>: Cost 4 vsldoi8 <6,7,0,4>, <6,2,7,3>
+ 3795956237U, // <0,4,6,3>: Cost 4 vsldoi8 <6,3,0,4>, <6,3,0,4>
+ 3733138742U, // <0,4,6,4>: Cost 4 vsldoi4 <7,0,4,6>, RHS
+ 2218634550U, // <0,4,6,5>: Cost 3 vmrghw <0,6,0,7>, RHS
+ 3798610744U, // <0,4,6,6>: Cost 4 vsldoi8 <6,7,0,4>, <6,6,6,6>
+ 2724868945U, // <0,4,6,7>: Cost 3 vsldoi8 <6,7,0,4>, <6,7,0,4>
+ 2725532578U, // <0,4,6,u>: Cost 3 vsldoi8 <6,u,0,4>, <6,u,0,4>
+ 3383371465U, // <0,4,7,0>: Cost 4 vmrglw <4,6,0,7>, <2,3,4,0>
+ 3800601668U, // <0,4,7,1>: Cost 4 vsldoi8 <7,1,0,4>, <7,1,0,4>
+ 3775386826U, // <0,4,7,2>: Cost 5 vsldoi8 <2,u,0,4>, <7,2,6,3>
+ 3801928934U, // <0,4,7,3>: Cost 4 vsldoi8 <7,3,0,4>, <7,3,0,4>
+ 3721202998U, // <0,4,7,4>: Cost 4 vsldoi4 <5,0,4,7>, RHS
+ 2780368328U, // <0,4,7,5>: Cost 3 vsldoi12 <4,7,5,0>, <4,7,5,0>
+ 3383372686U, // <0,4,7,6>: Cost 5 vmrglw <4,6,0,7>, <4,0,4,6>
+ 3854110170U, // <0,4,7,7>: Cost 4 vsldoi12 <4,7,5,0>, <4,7,7,0>
+ 2780368328U, // <0,4,7,u>: Cost 3 vsldoi12 <4,7,5,0>, <4,7,5,0>
+ 1146334098U, // <0,4,u,0>: Cost 2 vmrghw LHS, <4,0,5,1>
+ 2220076002U, // <0,4,u,1>: Cost 3 vmrghw LHS, <4,1,5,0>
+ 2220076085U, // <0,4,u,2>: Cost 3 vmrghw LHS, <4,2,5,2>
+ 2635524279U, // <0,4,u,3>: Cost 3 vsldoi4 <3,0,4,u>, <3,0,4,u>
+ 1146334416U, // <0,4,u,4>: Cost 2 vmrghw LHS, <4,4,4,4>
+ 72592694U, // <0,4,u,5>: Cost 1 vmrghw LHS, RHS
+ 1685245481U, // <0,4,u,6>: Cost 2 vsldoi12 <1,2,3,0>, RHS
+ 2659415067U, // <0,4,u,7>: Cost 3 vsldoi4 <7,0,4,u>, <7,0,4,u>
+ 72592937U, // <0,4,u,u>: Cost 1 vmrghw LHS, RHS
+ 2281704337U, // <0,5,0,0>: Cost 3 vmrglw <0,0,0,0>, <4,0,5,0>
+ 2704965734U, // <0,5,0,1>: Cost 3 vsldoi8 <3,4,0,5>, LHS
+ 3778707666U, // <0,5,0,2>: Cost 4 vsldoi8 <3,4,0,5>, <0,2,5,3>
+ 3778707708U, // <0,5,0,3>: Cost 4 vsldoi8 <3,4,0,5>, <0,3,1,0>
+ 2687050057U, // <0,5,0,4>: Cost 3 vsldoi8 <0,4,0,5>, <0,4,0,5>
+ 2214596612U, // <0,5,0,5>: Cost 3 vmrghw <0,0,0,0>, <5,5,5,5>
+ 2785824372U, // <0,5,0,6>: Cost 3 vsldoi12 <5,6,7,0>, <5,0,6,1>
+ 3854110332U, // <0,5,0,7>: Cost 4 vsldoi12 <4,7,5,0>, <5,0,7,0>
+ 2704966301U, // <0,5,0,u>: Cost 3 vsldoi8 <3,4,0,5>, LHS
+ 1567768678U, // <0,5,1,0>: Cost 2 vsldoi4 <4,0,5,1>, LHS
+ 2312236570U, // <0,5,1,1>: Cost 3 vmrglw <5,1,0,1>, <4,u,5,1>
+ 2215431915U, // <0,5,1,2>: Cost 3 vmrghw LHS, <5,2,1,3>
+ 2641512598U, // <0,5,1,3>: Cost 3 vsldoi4 <4,0,5,1>, <3,0,1,2>
+ 1567771538U, // <0,5,1,4>: Cost 2 vsldoi4 <4,0,5,1>, <4,0,5,1>
+ 1141690372U, // <0,5,1,5>: Cost 2 vmrghw LHS, <5,5,5,5>
+ 1141690466U, // <0,5,1,6>: Cost 2 vmrghw LHS, <5,6,7,0>
+ 2641515514U, // <0,5,1,7>: Cost 3 vsldoi4 <4,0,5,1>, <7,0,1,2>
+ 1141690615U, // <0,5,1,u>: Cost 2 vmrghw LHS, <5,u,5,5>
+ 3772736973U, // <0,5,2,0>: Cost 4 vsldoi8 <2,4,0,5>, <2,0,3,0>
+ 3778709024U, // <0,5,2,1>: Cost 4 vsldoi8 <3,4,0,5>, <2,1,3,2>
+ 3778709096U, // <0,5,2,2>: Cost 4 vsldoi8 <3,4,0,5>, <2,2,2,2>
+ 3778709158U, // <0,5,2,3>: Cost 4 vsldoi8 <3,4,0,5>, <2,3,0,1>
+ 3772737275U, // <0,5,2,4>: Cost 4 vsldoi8 <2,4,0,5>, <2,4,0,5>
+ 3859566351U, // <0,5,2,5>: Cost 4 vsldoi12 <5,6,7,0>, <5,2,5,3>
+ 3778709434U, // <0,5,2,6>: Cost 4 vsldoi8 <3,4,0,5>, <2,6,3,7>
+ 3805251562U, // <0,5,2,7>: Cost 4 vsldoi8 <7,u,0,5>, <2,7,0,1>
+ 3775391807U, // <0,5,2,u>: Cost 4 vsldoi8 <2,u,0,5>, <2,u,0,5>
+ 2704967830U, // <0,5,3,0>: Cost 3 vsldoi8 <3,4,0,5>, <3,0,1,2>
+ 3776719073U, // <0,5,3,1>: Cost 4 vsldoi8 <3,1,0,5>, <3,1,0,5>
+ 3777382706U, // <0,5,3,2>: Cost 4 vsldoi8 <3,2,0,5>, <3,2,0,5>
+ 3778709887U, // <0,5,3,3>: Cost 4 vsldoi8 <3,4,0,5>, <3,3,0,1>
+ 2704968148U, // <0,5,3,4>: Cost 3 vsldoi8 <3,4,0,5>, <3,4,0,5>
+ 3857428317U, // <0,5,3,5>: Cost 4 vsldoi12 <5,3,5,0>, <5,3,5,0>
+ 3364096514U, // <0,5,3,6>: Cost 4 vmrglw <1,4,0,3>, <3,4,5,6>
+ 3780700871U, // <0,5,3,7>: Cost 4 vsldoi8 <3,7,0,5>, <3,7,0,5>
+ 2707622680U, // <0,5,3,u>: Cost 3 vsldoi8 <3,u,0,5>, <3,u,0,5>
+ 2728856466U, // <0,5,4,0>: Cost 3 vsldoi8 <7,4,0,5>, <4,0,5,1>
+ 3697361674U, // <0,5,4,1>: Cost 4 vsldoi4 <1,0,5,4>, <1,0,5,4>
+ 3697362601U, // <0,5,4,2>: Cost 4 vsldoi4 <1,0,5,4>, <2,3,0,4>
+ 3364766635U, // <0,5,4,3>: Cost 4 vmrglw <1,5,0,4>, <1,2,5,3>
+ 2217365428U, // <0,5,4,4>: Cost 3 vmrghw <0,4,1,5>, <5,4,5,6>
+ 2704969014U, // <0,5,4,5>: Cost 3 vsldoi8 <3,4,0,5>, RHS
+ 2785824700U, // <0,5,4,6>: Cost 3 vsldoi12 <5,6,7,0>, <5,4,6,5>
+ 3364766963U, // <0,5,4,7>: Cost 4 vmrglw <1,5,0,4>, <1,6,5,7>
+ 2704969257U, // <0,5,4,u>: Cost 3 vsldoi8 <3,4,0,5>, RHS
+ 3846148050U, // <0,5,5,0>: Cost 4 vsldoi12 <3,4,5,0>, <5,5,0,0>
+ 2326203282U, // <0,5,5,1>: Cost 3 vmrglw <7,4,0,5>, <4,0,5,1>
+ 3291746027U, // <0,5,5,2>: Cost 4 vmrghw <0,5,1,2>, <5,2,1,3>
+ 3376054482U, // <0,5,5,3>: Cost 4 vmrglw <3,4,0,5>, <0,2,5,3>
+ 3790655366U, // <0,5,5,4>: Cost 4 vsldoi8 <5,4,0,5>, <5,4,0,5>
+ 2785824772U, // <0,5,5,5>: Cost 3 vsldoi12 <5,6,7,0>, <5,5,5,5>
+ 2724876386U, // <0,5,5,6>: Cost 3 vsldoi8 <6,7,0,5>, <5,6,7,0>
+ 3858903057U, // <0,5,5,7>: Cost 4 vsldoi12 <5,5,7,0>, <5,5,7,0>
+ 2736820484U, // <0,5,5,u>: Cost 3 vsldoi8 <u,7,0,5>, <5,u,7,0>
+ 2659467366U, // <0,5,6,0>: Cost 3 vsldoi4 <7,0,5,6>, LHS
+ 3859566643U, // <0,5,6,1>: Cost 4 vsldoi12 <5,6,7,0>, <5,6,1,7>
+ 3798618618U, // <0,5,6,2>: Cost 4 vsldoi8 <6,7,0,5>, <6,2,7,3>
+ 3852857410U, // <0,5,6,3>: Cost 4 vsldoi12 <4,5,6,0>, <5,6,3,4>
+ 2659470646U, // <0,5,6,4>: Cost 3 vsldoi4 <7,0,5,6>, RHS
+ 2659471458U, // <0,5,6,5>: Cost 3 vsldoi4 <7,0,5,6>, <5,6,7,0>
+ 3832729696U, // <0,5,6,6>: Cost 4 vsldoi12 <1,2,3,0>, <5,6,6,7>
+ 1712083042U, // <0,5,6,7>: Cost 2 vsldoi12 <5,6,7,0>, <5,6,7,0>
+ 1712156779U, // <0,5,6,u>: Cost 2 vsldoi12 <5,6,u,0>, <5,6,u,0>
+ 2731512826U, // <0,5,7,0>: Cost 3 vsldoi8 <7,u,0,5>, <7,0,1,2>
+ 3859566717U, // <0,5,7,1>: Cost 4 vsldoi12 <5,6,7,0>, <5,7,1,0>
+ 3798619284U, // <0,5,7,2>: Cost 4 vsldoi8 <6,7,0,5>, <7,2,0,3>
+ 3778712803U, // <0,5,7,3>: Cost 4 vsldoi8 <3,4,0,5>, <7,3,0,1>
+ 2728858936U, // <0,5,7,4>: Cost 3 vsldoi8 <7,4,0,5>, <7,4,0,5>
+ 3859566753U, // <0,5,7,5>: Cost 4 vsldoi12 <5,6,7,0>, <5,7,5,0>
+ 3377398135U, // <0,5,7,6>: Cost 4 vmrglw <3,6,0,7>, <0,4,5,6>
+ 3798619686U, // <0,5,7,7>: Cost 4 vsldoi8 <6,7,0,5>, <7,7,0,0>
+ 2731513468U, // <0,5,7,u>: Cost 3 vsldoi8 <7,u,0,5>, <7,u,0,5>
+ 1567826022U, // <0,5,u,0>: Cost 2 vsldoi4 <4,0,5,u>, LHS
+ 2704971566U, // <0,5,u,1>: Cost 3 vsldoi8 <3,4,0,5>, LHS
+ 2220076779U, // <0,5,u,2>: Cost 3 vmrghw LHS, <5,2,1,3>
+ 2641569942U, // <0,5,u,3>: Cost 3 vsldoi4 <4,0,5,u>, <3,0,1,2>
+ 1567828889U, // <0,5,u,4>: Cost 2 vsldoi4 <4,0,5,u>, <4,0,5,u>
+ 1146335236U, // <0,5,u,5>: Cost 2 vmrghw LHS, <5,5,5,5>
+ 1146335330U, // <0,5,u,6>: Cost 2 vmrghw LHS, <5,6,7,0>
+ 1713410308U, // <0,5,u,7>: Cost 2 vsldoi12 <5,u,7,0>, <5,u,7,0>
+ 1713484045U, // <0,5,u,u>: Cost 2 vsldoi12 <5,u,u,0>, <5,u,u,0>
+ 2214596949U, // <0,6,0,0>: Cost 3 vmrghw <0,0,0,0>, <6,0,7,0>
+ 2214678951U, // <0,6,0,1>: Cost 3 vmrghw <0,0,1,1>, <6,1,7,1>
+ 2214597114U, // <0,6,0,2>: Cost 3 vmrghw <0,0,0,0>, <6,2,7,3>
+ 3852857653U, // <0,6,0,3>: Cost 4 vsldoi12 <4,5,6,0>, <6,0,3,4>
+ 3832729919U, // <0,6,0,4>: Cost 4 vsldoi12 <1,2,3,0>, <6,0,4,5>
+ 3721293427U, // <0,6,0,5>: Cost 4 vsldoi4 <5,0,6,0>, <5,0,6,0>
+ 2214597432U, // <0,6,0,6>: Cost 3 vmrghw <0,0,0,0>, <6,6,6,6>
+ 1207962934U, // <0,6,0,7>: Cost 2 vmrglw <0,0,0,0>, RHS
+ 1207962935U, // <0,6,0,u>: Cost 2 vmrglw <0,0,0,0>, RHS
+ 2215432481U, // <0,6,1,0>: Cost 3 vmrghw LHS, <6,0,1,2>
+ 2215432615U, // <0,6,1,1>: Cost 3 vmrghw LHS, <6,1,7,1>
+ 1141690874U, // <0,6,1,2>: Cost 2 vmrghw LHS, <6,2,7,3>
+ 2215432754U, // <0,6,1,3>: Cost 3 vmrghw LHS, <6,3,4,5>
+ 2215432817U, // <0,6,1,4>: Cost 3 vmrghw LHS, <6,4,2,5>
+ 2215432939U, // <0,6,1,5>: Cost 3 vmrghw LHS, <6,5,7,1>
+ 1141691192U, // <0,6,1,6>: Cost 2 vmrghw LHS, <6,6,6,6>
+ 1221905718U, // <0,6,1,7>: Cost 2 vmrglw <2,3,0,1>, RHS
+ 1221905719U, // <0,6,1,u>: Cost 2 vmrglw <2,3,0,1>, RHS
+ 3852857787U, // <0,6,2,0>: Cost 4 vsldoi12 <4,5,6,0>, <6,2,0,3>
+ 3289764265U, // <0,6,2,1>: Cost 4 vmrghw <0,2,1,3>, <6,1,7,3>
+ 3289690618U, // <0,6,2,2>: Cost 4 vmrghw <0,2,0,3>, <6,2,7,3>
+ 3862589907U, // <0,6,2,3>: Cost 4 vsldoi12 <6,2,3,0>, <6,2,3,0>
+ 3733253430U, // <0,6,2,4>: Cost 4 vsldoi4 <7,0,6,2>, RHS
+ 3733254242U, // <0,6,2,5>: Cost 4 vsldoi4 <7,0,6,2>, <5,6,7,0>
+ 3777390522U, // <0,6,2,6>: Cost 4 vsldoi8 <3,2,0,6>, <2,6,3,7>
+ 2785825274U, // <0,6,2,7>: Cost 3 vsldoi12 <5,6,7,0>, <6,2,7,3>
+ 2785825283U, // <0,6,2,u>: Cost 3 vsldoi12 <5,6,7,0>, <6,2,u,3>
+ 3777390742U, // <0,6,3,0>: Cost 4 vsldoi8 <3,2,0,6>, <3,0,1,2>
+ 3863106066U, // <0,6,3,1>: Cost 4 vsldoi12 <6,3,1,0>, <6,3,1,0>
+ 3777390899U, // <0,6,3,2>: Cost 4 vsldoi8 <3,2,0,6>, <3,2,0,6>
+ 3290436146U, // <0,6,3,3>: Cost 4 vmrghw <0,3,1,4>, <6,3,4,5>
+ 3779381762U, // <0,6,3,4>: Cost 4 vsldoi8 <3,5,0,6>, <3,4,5,6>
+ 3779381798U, // <0,6,3,5>: Cost 4 vsldoi8 <3,5,0,6>, <3,5,0,6>
+ 3733262920U, // <0,6,3,6>: Cost 4 vsldoi4 <7,0,6,3>, <6,3,7,0>
+ 2300972342U, // <0,6,3,7>: Cost 3 vmrglw <3,2,0,3>, RHS
+ 2300972343U, // <0,6,3,u>: Cost 3 vmrglw <3,2,0,3>, RHS
+ 3802606482U, // <0,6,4,0>: Cost 4 vsldoi8 <7,4,0,6>, <4,0,5,1>
+ 2217365931U, // <0,6,4,1>: Cost 3 vmrghw <0,4,1,5>, <6,1,7,5>
+ 2217366010U, // <0,6,4,2>: Cost 3 vmrghw <0,4,1,5>, <6,2,7,3>
+ 3291107890U, // <0,6,4,3>: Cost 4 vmrghw <0,4,1,5>, <6,3,4,5>
+ 3291099805U, // <0,6,4,4>: Cost 4 vmrghw <0,4,1,4>, <6,4,7,4>
+ 3777391926U, // <0,6,4,5>: Cost 4 vsldoi8 <3,2,0,6>, RHS
+ 2217366328U, // <0,6,4,6>: Cost 3 vmrghw <0,4,1,5>, <6,6,6,6>
+ 2291027254U, // <0,6,4,7>: Cost 3 vmrglw <1,5,0,4>, RHS
+ 2291027255U, // <0,6,4,u>: Cost 3 vmrglw <1,5,0,4>, RHS
+ 3852858033U, // <0,6,5,0>: Cost 4 vsldoi12 <4,5,6,0>, <6,5,0,6>
+ 3395964532U, // <0,6,5,1>: Cost 4 vmrglw <6,7,0,5>, <5,0,6,1>
+ 3864507069U, // <0,6,5,2>: Cost 4 vsldoi12 <6,5,2,0>, <6,5,2,0>
+ 3376056678U, // <0,6,5,3>: Cost 5 vmrglw <3,4,0,5>, <3,2,6,3>
+ 3721334070U, // <0,6,5,4>: Cost 4 vsldoi4 <5,0,6,5>, RHS
+ 3395964860U, // <0,6,5,5>: Cost 4 vmrglw <6,7,0,5>, <5,4,6,5>
+ 3864802017U, // <0,6,5,6>: Cost 4 vsldoi12 <6,5,6,0>, <6,5,6,0>
+ 2302315830U, // <0,6,5,7>: Cost 3 vmrglw <3,4,0,5>, RHS
+ 2302315831U, // <0,6,5,u>: Cost 3 vmrglw <3,4,0,5>, RHS
+ 3852858108U, // <0,6,6,0>: Cost 4 vsldoi12 <4,5,6,0>, <6,6,0,0>
+ 3398624745U, // <0,6,6,1>: Cost 4 vmrglw <7,2,0,6>, <2,0,6,1>
+ 2218668538U, // <0,6,6,2>: Cost 3 vmrghw <0,6,1,2>, <6,2,7,3>
+ 3292418610U, // <0,6,6,3>: Cost 4 vmrghw <0,6,1,3>, <6,3,4,5>
+ 3733286198U, // <0,6,6,4>: Cost 4 vsldoi4 <7,0,6,6>, RHS
+ 3797299889U, // <0,6,6,5>: Cost 4 vsldoi8 <6,5,0,6>, <6,5,0,6>
+ 2785825592U, // <0,6,6,6>: Cost 3 vsldoi12 <5,6,7,0>, <6,6,6,6>
+ 2785825602U, // <0,6,6,7>: Cost 3 vsldoi12 <5,6,7,0>, <6,6,7,7>
+ 2785825611U, // <0,6,6,u>: Cost 3 vsldoi12 <5,6,7,0>, <6,6,u,7>
+ 2785825614U, // <0,6,7,0>: Cost 3 vsldoi12 <5,6,7,0>, <6,7,0,1>
+ 2758988632U, // <0,6,7,1>: Cost 3 vsldoi12 <1,2,3,0>, <6,7,1,2>
+ 3377400084U, // <0,6,7,2>: Cost 4 vmrglw <3,6,0,7>, <3,1,6,2>
+ 2792166248U, // <0,6,7,3>: Cost 3 vsldoi12 <6,7,3,0>, <6,7,3,0>
+ 2785825654U, // <0,6,7,4>: Cost 3 vsldoi12 <5,6,7,0>, <6,7,4,5>
+ 2785825664U, // <0,6,7,5>: Cost 3 vsldoi12 <5,6,7,0>, <6,7,5,6>
+ 3859567493U, // <0,6,7,6>: Cost 4 vsldoi12 <5,6,7,0>, <6,7,6,2>
+ 2303659318U, // <0,6,7,7>: Cost 3 vmrglw <3,6,0,7>, RHS
+ 2303659319U, // <0,6,7,u>: Cost 3 vmrglw <3,6,0,7>, RHS
+ 2785825695U, // <0,6,u,0>: Cost 3 vsldoi12 <5,6,7,0>, <6,u,0,1>
+ 2220077479U, // <0,6,u,1>: Cost 3 vmrghw LHS, <6,1,7,1>
+ 1146335738U, // <0,6,u,2>: Cost 2 vmrghw LHS, <6,2,7,3>
+ 2792829881U, // <0,6,u,3>: Cost 3 vsldoi12 <6,u,3,0>, <6,u,3,0>
+ 2785825735U, // <0,6,u,4>: Cost 3 vsldoi12 <5,6,7,0>, <6,u,4,5>
+ 2785825664U, // <0,6,u,5>: Cost 3 vsldoi12 <5,6,7,0>, <6,7,5,6>
+ 1146336056U, // <0,6,u,6>: Cost 2 vmrghw LHS, <6,6,6,6>
+ 1221963062U, // <0,6,u,7>: Cost 2 vmrglw <2,3,0,u>, RHS
+ 1221963063U, // <0,6,u,u>: Cost 2 vmrglw <2,3,0,u>, RHS
+ 2653593600U, // <0,7,0,0>: Cost 3 vsldoi4 <6,0,7,0>, <0,0,0,0>
+ 2706309222U, // <0,7,0,1>: Cost 3 vsldoi8 <3,6,0,7>, LHS
+ 3709421498U, // <0,7,0,2>: Cost 4 vsldoi4 <3,0,7,0>, <2,6,3,7>
+ 2281705978U, // <0,7,0,3>: Cost 3 vmrglw <0,0,0,0>, <6,2,7,3>
+ 2785825816U, // <0,7,0,4>: Cost 3 vsldoi12 <5,6,7,0>, <7,0,4,5>
+ 2785825826U, // <0,7,0,5>: Cost 3 vsldoi12 <5,6,7,0>, <7,0,5,6>
+ 2653598037U, // <0,7,0,6>: Cost 3 vsldoi4 <6,0,7,0>, <6,0,7,0>
+ 2214598252U, // <0,7,0,7>: Cost 3 vmrghw <0,0,0,0>, <7,7,7,7>
+ 2706309789U, // <0,7,0,u>: Cost 3 vsldoi8 <3,6,0,7>, LHS
+ 1141691386U, // <0,7,1,0>: Cost 2 vmrghw LHS, <7,0,1,2>
+ 2215433290U, // <0,7,1,1>: Cost 3 vmrghw LHS, <7,1,1,1>
+ 2706310038U, // <0,7,1,2>: Cost 3 vsldoi8 <3,6,0,7>, <1,2,3,0>
+ 2322190842U, // <0,7,1,3>: Cost 3 vmrglw <6,7,0,1>, <6,2,7,3>
+ 1141691750U, // <0,7,1,4>: Cost 2 vmrghw LHS, <7,4,5,6>
+ 2215433654U, // <0,7,1,5>: Cost 3 vmrghw LHS, <7,5,5,5>
+ 2653606230U, // <0,7,1,6>: Cost 3 vsldoi4 <6,0,7,1>, <6,0,7,1>
+ 1141692012U, // <0,7,1,7>: Cost 2 vmrghw LHS, <7,7,7,7>
+ 1141692034U, // <0,7,1,u>: Cost 2 vmrghw LHS, <7,u,1,2>
+ 2785825940U, // <0,7,2,0>: Cost 3 vsldoi12 <5,6,7,0>, <7,2,0,3>
+ 3768108576U, // <0,7,2,1>: Cost 5 vsldoi8 <1,6,0,7>, <2,1,3,2>
+ 3780052584U, // <0,7,2,2>: Cost 4 vsldoi8 <3,6,0,7>, <2,2,2,2>
+ 2794820780U, // <0,7,2,3>: Cost 3 vsldoi12 <7,2,3,0>, <7,2,3,0>
+ 3859641528U, // <0,7,2,4>: Cost 4 vsldoi12 <5,6,u,0>, <7,2,4,3>
+ 3733327970U, // <0,7,2,5>: Cost 4 vsldoi4 <7,0,7,2>, <5,6,7,0>
+ 3778062266U, // <0,7,2,6>: Cost 4 vsldoi8 <3,3,0,7>, <2,6,3,7>
+ 3733328944U, // <0,7,2,7>: Cost 4 vsldoi4 <7,0,7,2>, <7,0,7,2>
+ 2795189465U, // <0,7,2,u>: Cost 3 vsldoi12 <7,2,u,0>, <7,2,u,0>
+ 2324861026U, // <0,7,3,0>: Cost 3 vmrglw <7,2,0,3>, <5,6,7,0>
+ 3780053233U, // <0,7,3,1>: Cost 4 vsldoi8 <3,6,0,7>, <3,1,2,3>
+ 3780053296U, // <0,7,3,2>: Cost 4 vsldoi8 <3,6,0,7>, <3,2,0,3>
+ 3778062725U, // <0,7,3,3>: Cost 4 vsldoi8 <3,3,0,7>, <3,3,0,7>
+ 3780053506U, // <0,7,3,4>: Cost 4 vsldoi8 <3,6,0,7>, <3,4,5,6>
+ 3803941469U, // <0,7,3,5>: Cost 4 vsldoi8 <7,6,0,7>, <3,5,6,7>
+ 2706311800U, // <0,7,3,6>: Cost 3 vsldoi8 <3,6,0,7>, <3,6,0,7>
+ 3398603586U, // <0,7,3,7>: Cost 4 vmrglw <7,2,0,3>, <6,6,7,7>
+ 2707639066U, // <0,7,3,u>: Cost 3 vsldoi8 <3,u,0,7>, <3,u,0,7>
+ 2217366522U, // <0,7,4,0>: Cost 3 vmrghw <0,4,1,5>, <7,0,1,2>
+ 3727369110U, // <0,7,4,1>: Cost 4 vsldoi4 <6,0,7,4>, <1,2,3,0>
+ 3291108500U, // <0,7,4,2>: Cost 4 vmrghw <0,4,1,5>, <7,2,0,3>
+ 3727370872U, // <0,7,4,3>: Cost 4 vsldoi4 <6,0,7,4>, <3,6,0,7>
+ 2217366886U, // <0,7,4,4>: Cost 3 vmrghw <0,4,1,5>, <7,4,5,6>
+ 2706312502U, // <0,7,4,5>: Cost 3 vsldoi8 <3,6,0,7>, RHS
+ 3786026321U, // <0,7,4,6>: Cost 4 vsldoi8 <4,6,0,7>, <4,6,0,7>
+ 2217367148U, // <0,7,4,7>: Cost 3 vmrghw <0,4,1,5>, <7,7,7,7>
+ 2706312745U, // <0,7,4,u>: Cost 3 vsldoi8 <3,6,0,7>, RHS
+ 2322223202U, // <0,7,5,0>: Cost 3 vmrglw <6,7,0,5>, <5,6,7,0>
+ 3399946987U, // <0,7,5,1>: Cost 4 vmrglw <7,4,0,5>, <6,5,7,1>
+ 3291780244U, // <0,7,5,2>: Cost 4 vmrghw <0,5,1,6>, <7,2,0,3>
+ 3727378582U, // <0,7,5,3>: Cost 4 vsldoi4 <6,0,7,5>, <3,0,1,2>
+ 3727379766U, // <0,7,5,4>: Cost 4 vsldoi4 <6,0,7,5>, RHS
+ 3859568054U, // <0,7,5,5>: Cost 4 vsldoi12 <5,6,7,0>, <7,5,5,5>
+ 2785826241U, // <0,7,5,6>: Cost 3 vsldoi12 <5,6,7,0>, <7,5,6,7>
+ 3395965762U, // <0,7,5,7>: Cost 4 vmrglw <6,7,0,5>, <6,6,7,7>
+ 2787153363U, // <0,7,5,u>: Cost 3 vsldoi12 <5,u,7,0>, <7,5,u,7>
+ 2785826268U, // <0,7,6,0>: Cost 3 vsldoi12 <5,6,7,0>, <7,6,0,7>
+ 3780055420U, // <0,7,6,1>: Cost 5 vsldoi8 <3,6,0,7>, <6,1,2,3>
+ 3859568110U, // <0,7,6,2>: Cost 4 vsldoi12 <5,6,7,0>, <7,6,2,7>
+ 3874534903U, // <0,7,6,3>: Cost 4 vsldoi12 <u,2,3,0>, <7,6,3,7>
+ 3859641856U, // <0,7,6,4>: Cost 4 vsldoi12 <5,6,u,0>, <7,6,4,7>
+ 3733360738U, // <0,7,6,5>: Cost 4 vsldoi4 <7,0,7,6>, <5,6,7,0>
+ 3859568145U, // <0,7,6,6>: Cost 4 vsldoi12 <5,6,7,0>, <7,6,6,6>
+ 2797770260U, // <0,7,6,7>: Cost 3 vsldoi12 <7,6,7,0>, <7,6,7,0>
+ 2797843997U, // <0,7,6,u>: Cost 3 vsldoi12 <7,6,u,0>, <7,6,u,0>
+ 2785826342U, // <0,7,7,0>: Cost 3 vsldoi12 <5,6,7,0>, <7,7,0,0>
+ 3727393686U, // <0,7,7,1>: Cost 4 vsldoi4 <6,0,7,7>, <1,2,3,0>
+ 3868563003U, // <0,7,7,2>: Cost 4 vsldoi12 <7,2,3,0>, <7,7,2,3>
+ 3377397988U, // <0,7,7,3>: Cost 4 vmrglw <3,6,0,7>, <0,2,7,3>
+ 2219349350U, // <0,7,7,4>: Cost 3 vmrghw <0,7,1,4>, <7,4,5,6>
+ 3859568217U, // <0,7,7,5>: Cost 4 vsldoi12 <5,6,7,0>, <7,7,5,6>
+ 2730202588U, // <0,7,7,6>: Cost 3 vsldoi8 <7,6,0,7>, <7,6,0,7>
+ 2785826412U, // <0,7,7,7>: Cost 3 vsldoi12 <5,6,7,0>, <7,7,7,7>
+ 2731529854U, // <0,7,7,u>: Cost 3 vsldoi8 <7,u,0,7>, <7,u,0,7>
+ 1146336250U, // <0,7,u,0>: Cost 2 vmrghw LHS, <7,0,1,2>
+ 2706315054U, // <0,7,u,1>: Cost 3 vsldoi8 <3,6,0,7>, LHS
+ 2653660845U, // <0,7,u,2>: Cost 3 vsldoi4 <6,0,7,u>, <2,3,0,u>
+ 2322248186U, // <0,7,u,3>: Cost 3 vmrglw <6,7,0,u>, <6,2,7,3>
+ 1146336614U, // <0,7,u,4>: Cost 2 vmrghw LHS, <7,4,5,6>
+ 2706315418U, // <0,7,u,5>: Cost 3 vsldoi8 <3,6,0,7>, RHS
+ 2653663581U, // <0,7,u,6>: Cost 3 vsldoi4 <6,0,7,u>, <6,0,7,u>
+ 1146336876U, // <0,7,u,7>: Cost 2 vmrghw LHS, <7,7,7,7>
+ 1146336898U, // <0,7,u,u>: Cost 2 vmrghw LHS, <7,u,1,2>
+ 202162278U, // <0,u,0,0>: Cost 1 vspltisw0 LHS
+ 1624612966U, // <0,u,0,1>: Cost 2 vsldoi8 <2,3,0,u>, LHS
+ 2629780986U, // <0,u,0,2>: Cost 3 vsldoi4 <2,0,u,0>, <2,0,u,0>
+ 1207959708U, // <0,u,0,3>: Cost 2 vmrglw <0,0,0,0>, LHS
+ 1544097078U, // <0,u,0,4>: Cost 2 vsldoi4 <0,0,u,0>, RHS
+ 1140856986U, // <0,u,0,5>: Cost 2 vmrghw <0,0,0,0>, RHS
+ 2698355253U, // <0,u,0,6>: Cost 3 vsldoi8 <2,3,0,u>, <0,6,u,7>
+ 1207962952U, // <0,u,0,7>: Cost 2 vmrglw <0,0,0,0>, RHS
+ 202162278U, // <0,u,0,u>: Cost 1 vspltisw0 LHS
+ 1142134483U, // <0,u,1,0>: Cost 2 vmrghw LHS, <u,0,1,2>
+ 67950382U, // <0,u,1,1>: Cost 1 vmrghw LHS, LHS
+ 1142175624U, // <0,u,1,2>: Cost 2 vmrghw LHS, <u,2,3,3>
+ 1142175676U, // <0,u,1,3>: Cost 2 vmrghw LHS, <u,3,0,1>
+ 1142134847U, // <0,u,1,4>: Cost 2 vmrghw LHS, <u,4,5,6>
+ 67950746U, // <0,u,1,5>: Cost 1 vmrghw LHS, RHS
+ 1142175952U, // <0,u,1,6>: Cost 2 vmrghw LHS, <u,6,3,7>
+ 1221905736U, // <0,u,1,7>: Cost 2 vmrglw <2,3,0,1>, RHS
+ 67950949U, // <0,u,1,u>: Cost 1 vmrghw LHS, LHS
+ 1562026086U, // <0,u,2,0>: Cost 2 vsldoi4 <3,0,u,2>, LHS
+ 2216015662U, // <0,u,2,1>: Cost 3 vmrghw <0,2,1,2>, LHS
+ 2698356328U, // <0,u,2,2>: Cost 3 vsldoi8 <2,3,0,u>, <2,2,2,2>
+ 835584U, // <0,u,2,3>: Cost 0 copy LHS
+ 1562029366U, // <0,u,2,4>: Cost 2 vsldoi4 <3,0,u,2>, RHS
+ 2216016026U, // <0,u,2,5>: Cost 3 vmrghw <0,2,1,2>, RHS
+ 2698356666U, // <0,u,2,6>: Cost 3 vsldoi8 <2,3,0,u>, <2,6,3,7>
+ 1585919033U, // <0,u,2,7>: Cost 2 vsldoi4 <7,0,u,2>, <7,0,u,2>
+ 835584U, // <0,u,2,u>: Cost 0 copy LHS
+ 2758989756U, // <0,u,3,0>: Cost 3 vsldoi12 <1,2,3,0>, <u,3,0,1>
+ 2216662830U, // <0,u,3,1>: Cost 3 vmrghw <0,3,1,0>, LHS
+ 2703665461U, // <0,u,3,2>: Cost 3 vsldoi8 <3,2,0,u>, <3,2,0,u>
+ 2758989782U, // <0,u,3,3>: Cost 3 vsldoi12 <1,2,3,0>, <u,3,3,0>
+ 2758989796U, // <0,u,3,4>: Cost 3 vsldoi12 <1,2,3,0>, <u,3,4,5>
+ 2216663194U, // <0,u,3,5>: Cost 3 vmrghw <0,3,1,0>, RHS
+ 2706319993U, // <0,u,3,6>: Cost 3 vsldoi8 <3,6,0,u>, <3,6,0,u>
+ 2300972360U, // <0,u,3,7>: Cost 3 vmrglw <3,2,0,3>, RHS
+ 2216663397U, // <0,u,3,u>: Cost 3 vmrghw <0,3,1,0>, LHS
+ 2217367251U, // <0,u,4,0>: Cost 3 vmrghw <0,4,1,5>, <u,0,1,2>
+ 1143625518U, // <0,u,4,1>: Cost 2 vmrghw <0,4,1,5>, LHS
+ 2217367432U, // <0,u,4,2>: Cost 3 vmrghw <0,4,1,5>, <u,2,3,3>
+ 2217367484U, // <0,u,4,3>: Cost 3 vmrghw <0,4,1,5>, <u,3,0,1>
+ 1143619922U, // <0,u,4,4>: Cost 2 vmrghw <0,4,1,5>, <0,4,1,5>
+ 1143625882U, // <0,u,4,5>: Cost 2 vmrghw <0,4,1,5>, RHS
+ 2217367760U, // <0,u,4,6>: Cost 3 vmrghw <0,4,1,5>, <u,6,3,7>
+ 2291027272U, // <0,u,4,7>: Cost 3 vmrglw <1,5,0,4>, RHS
+ 1143626085U, // <0,u,4,u>: Cost 2 vmrghw <0,4,1,5>, LHS
+ 2635792486U, // <0,u,5,0>: Cost 3 vsldoi4 <3,0,u,5>, LHS
+ 2635793302U, // <0,u,5,1>: Cost 3 vsldoi4 <3,0,u,5>, <1,2,3,0>
+ 2302314646U, // <0,u,5,2>: Cost 3 vmrglw <3,4,0,5>, <3,0,1,2>
+ 2635794648U, // <0,u,5,3>: Cost 3 vsldoi4 <3,0,u,5>, <3,0,u,5>
+ 2635795766U, // <0,u,5,4>: Cost 3 vsldoi4 <3,0,u,5>, RHS
+ 2717601754U, // <0,u,5,5>: Cost 3 vsldoi8 <5,5,0,u>, <5,5,0,u>
+ 1685248154U, // <0,u,5,6>: Cost 2 vsldoi12 <1,2,3,0>, RHS
+ 2302315848U, // <0,u,5,7>: Cost 3 vmrglw <3,4,0,5>, RHS
+ 1685248172U, // <0,u,5,u>: Cost 2 vsldoi12 <1,2,3,0>, RHS
+ 2759358645U, // <0,u,6,0>: Cost 3 vsldoi12 <1,2,u,0>, <u,6,0,7>
+ 2218637102U, // <0,u,6,1>: Cost 3 vmrghw <0,6,0,7>, LHS
+ 2724901370U, // <0,u,6,2>: Cost 3 vsldoi8 <6,7,0,u>, <6,2,7,3>
+ 2758990032U, // <0,u,6,3>: Cost 3 vsldoi12 <1,2,3,0>, <u,6,3,7>
+ 2659691830U, // <0,u,6,4>: Cost 3 vsldoi4 <7,0,u,6>, RHS
+ 2659471458U, // <0,u,6,5>: Cost 3 vsldoi4 <7,0,5,6>, <5,6,7,0>
+ 2724901688U, // <0,u,6,6>: Cost 3 vsldoi8 <6,7,0,u>, <6,6,6,6>
+ 1651159893U, // <0,u,6,7>: Cost 2 vsldoi8 <6,7,0,u>, <6,7,0,u>
+ 1651823526U, // <0,u,6,u>: Cost 2 vsldoi8 <6,u,0,u>, <6,u,0,u>
+ 2785827072U, // <0,u,7,0>: Cost 3 vsldoi12 <5,6,7,0>, <u,7,0,1>
+ 2803964168U, // <0,u,7,1>: Cost 3 vsldoi12 <u,7,1,0>, <u,7,1,0>
+ 2727556249U, // <0,u,7,2>: Cost 3 vsldoi8 <7,2,0,u>, <7,2,0,u>
+ 2303656092U, // <0,u,7,3>: Cost 3 vmrglw <3,6,0,7>, LHS
+ 2785827112U, // <0,u,7,4>: Cost 3 vsldoi12 <5,6,7,0>, <u,7,4,5>
+ 2785827122U, // <0,u,7,5>: Cost 3 vsldoi12 <5,6,7,0>, <u,7,5,6>
+ 2730210781U, // <0,u,7,6>: Cost 3 vsldoi8 <7,6,0,u>, <7,6,0,u>
+ 2303659336U, // <0,u,7,7>: Cost 3 vmrglw <3,6,0,7>, RHS
+ 2303656097U, // <0,u,7,u>: Cost 3 vmrglw <3,6,0,7>, LHS
+ 202162278U, // <0,u,u,0>: Cost 1 vspltisw0 LHS
+ 72595246U, // <0,u,u,1>: Cost 1 vmrghw LHS, LHS
+ 1146337160U, // <0,u,u,2>: Cost 2 vmrghw LHS, <u,2,3,3>
+ 835584U, // <0,u,u,3>: Cost 0 copy LHS
+ 1146337343U, // <0,u,u,4>: Cost 2 vmrghw LHS, <u,4,5,6>
+ 72595610U, // <0,u,u,5>: Cost 1 vmrghw LHS, RHS
+ 1146337488U, // <0,u,u,6>: Cost 2 vmrghw LHS, <u,6,3,7>
+ 1221963080U, // <0,u,u,7>: Cost 2 vmrglw <2,3,0,u>, RHS
+ 835584U, // <0,u,u,u>: Cost 0 copy LHS
+ 2756853760U, // <1,0,0,0>: Cost 3 vsldoi12 <0,u,1,1>, <0,0,0,0>
+ 1677803530U, // <1,0,0,1>: Cost 2 vsldoi12 <0,0,1,1>, <0,0,1,1>
+ 3759497387U, // <1,0,0,2>: Cost 4 vsldoi8 <0,2,1,0>, <0,2,1,0>
+ 2686419196U, // <1,0,0,3>: Cost 3 vsldoi8 <0,3,1,0>, <0,3,1,0>
+ 2751766565U, // <1,0,0,4>: Cost 3 vsldoi12 <0,0,4,1>, <0,0,4,1>
+ 2687746462U, // <1,0,0,5>: Cost 3 vsldoi8 <0,5,1,0>, <0,5,1,0>
+ 3776086518U, // <1,0,0,6>: Cost 4 vsldoi8 <3,0,1,0>, <0,6,1,7>
+ 2689073728U, // <1,0,0,7>: Cost 3 vsldoi8 <0,7,1,0>, <0,7,1,0>
+ 1678319689U, // <1,0,0,u>: Cost 2 vsldoi12 <0,0,u,1>, <0,0,u,1>
+ 2287091712U, // <1,0,1,0>: Cost 3 vmrglw <0,u,1,1>, <0,0,0,0>
+ 1147568230U, // <1,0,1,1>: Cost 2 vmrghw <1,1,1,1>, LHS
+ 1683112038U, // <1,0,1,2>: Cost 2 vsldoi12 <0,u,1,1>, LHS
+ 3294970108U, // <1,0,1,3>: Cost 4 vmrghw <1,1,0,0>, <0,3,1,0>
+ 2623892790U, // <1,0,1,4>: Cost 3 vsldoi4 <1,1,0,1>, RHS
+ 2647781007U, // <1,0,1,5>: Cost 3 vsldoi4 <5,1,0,1>, <5,1,0,1>
+ 2791948430U, // <1,0,1,6>: Cost 3 vsldoi12 <6,7,0,1>, <0,1,6,7>
+ 3721524218U, // <1,0,1,7>: Cost 4 vsldoi4 <5,1,0,1>, <7,0,1,2>
+ 1683112092U, // <1,0,1,u>: Cost 2 vsldoi12 <0,u,1,1>, LHS
+ 2222112768U, // <1,0,2,0>: Cost 3 vmrghw <1,2,3,0>, <0,0,0,0>
+ 1148371046U, // <1,0,2,1>: Cost 2 vmrghw <1,2,3,0>, LHS
+ 3356862524U, // <1,0,2,2>: Cost 4 vmrglw <0,2,1,2>, <2,u,0,2>
+ 2702345894U, // <1,0,2,3>: Cost 3 vsldoi8 <3,0,1,0>, <2,3,0,1>
+ 2222113106U, // <1,0,2,4>: Cost 3 vmrghw <1,2,3,0>, <0,4,1,5>
+ 2299709908U, // <1,0,2,5>: Cost 3 vmrglw <3,0,1,2>, <3,4,0,5>
+ 3760162746U, // <1,0,2,6>: Cost 4 vsldoi8 <0,3,1,0>, <2,6,3,7>
+ 3369470584U, // <1,0,2,7>: Cost 4 vmrglw <2,3,1,2>, <3,6,0,7>
+ 1148371613U, // <1,0,2,u>: Cost 2 vmrghw <1,2,3,0>, LHS
+ 2686421142U, // <1,0,3,0>: Cost 3 vsldoi8 <0,3,1,0>, <3,0,1,2>
+ 2283128486U, // <1,0,3,1>: Cost 3 vmrglw <0,2,1,3>, <2,3,0,1>
+ 3296305326U, // <1,0,3,2>: Cost 4 vmrghw <1,3,0,1>, <0,2,1,3>
+ 3760163199U, // <1,0,3,3>: Cost 4 vsldoi8 <0,3,1,0>, <3,3,0,1>
+ 3760163330U, // <1,0,3,4>: Cost 4 vsldoi8 <0,3,1,0>, <3,4,5,6>
+ 3779406377U, // <1,0,3,5>: Cost 4 vsldoi8 <3,5,1,0>, <3,5,1,0>
+ 3865690416U, // <1,0,3,6>: Cost 4 vsldoi12 <6,7,0,1>, <0,3,6,7>
+ 3366824568U, // <1,0,3,7>: Cost 5 vmrglw <1,u,1,3>, <3,6,0,7>
+ 2707655452U, // <1,0,3,u>: Cost 3 vsldoi8 <3,u,1,0>, <3,u,1,0>
+ 2734861202U, // <1,0,4,0>: Cost 3 vsldoi8 <u,4,1,0>, <4,0,5,1>
+ 2756854098U, // <1,0,4,1>: Cost 3 vsldoi12 <0,u,1,1>, <0,4,1,5>
+ 3830595931U, // <1,0,4,2>: Cost 5 vsldoi12 <0,u,1,1>, <0,4,2,5>
+ 3296968960U, // <1,0,4,3>: Cost 4 vmrghw <1,4,0,1>, <0,3,1,4>
+ 3830595949U, // <1,0,4,4>: Cost 4 vsldoi12 <0,u,1,1>, <0,4,4,5>
+ 2686422326U, // <1,0,4,5>: Cost 3 vsldoi8 <0,3,1,0>, RHS
+ 3297378806U, // <1,0,4,6>: Cost 5 vmrghw <1,4,5,6>, <0,6,1,7>
+ 3810594248U, // <1,0,4,7>: Cost 4 vsldoi8 <u,7,1,0>, <4,7,5,0>
+ 2686422569U, // <1,0,4,u>: Cost 3 vsldoi8 <0,3,1,0>, RHS
+ 2284470272U, // <1,0,5,0>: Cost 3 vmrglw <0,4,1,5>, <0,0,0,0>
+ 2284471974U, // <1,0,5,1>: Cost 3 vmrglw <0,4,1,5>, <2,3,0,1>
+ 3809267435U, // <1,0,5,2>: Cost 4 vsldoi8 <u,5,1,0>, <5,2,1,3>
+ 3297968384U, // <1,0,5,3>: Cost 4 vmrghw <1,5,4,6>, <0,3,1,4>
+ 2284471977U, // <1,0,5,4>: Cost 3 vmrglw <0,4,1,5>, <2,3,0,4>
+ 3721555603U, // <1,0,5,5>: Cost 4 vsldoi4 <5,1,0,5>, <5,1,0,5>
+ 3792679010U, // <1,0,5,6>: Cost 4 vsldoi8 <5,7,1,0>, <5,6,7,0>
+ 3792679037U, // <1,0,5,7>: Cost 4 vsldoi8 <5,7,1,0>, <5,7,1,0>
+ 2284471981U, // <1,0,5,u>: Cost 3 vmrglw <0,4,1,5>, <2,3,0,u>
+ 3356893184U, // <1,0,6,0>: Cost 4 vmrglw <0,2,1,6>, <0,0,0,0>
+ 2224676966U, // <1,0,6,1>: Cost 3 vmrghw <1,6,1,7>, LHS
+ 3298295985U, // <1,0,6,2>: Cost 4 vmrghw <1,6,0,1>, <0,2,1,6>
+ 3298345212U, // <1,0,6,3>: Cost 4 vmrghw <1,6,0,7>, <0,3,1,0>
+ 2224972114U, // <1,0,6,4>: Cost 3 vmrghw <1,6,5,7>, <0,4,1,5>
+ 3808604907U, // <1,0,6,5>: Cost 4 vsldoi8 <u,4,1,0>, <6,5,7,1>
+ 3799978808U, // <1,0,6,6>: Cost 4 vsldoi8 <7,0,1,0>, <6,6,6,6>
+ 2726237006U, // <1,0,6,7>: Cost 3 vsldoi8 <7,0,1,0>, <6,7,0,1>
+ 2224677522U, // <1,0,6,u>: Cost 3 vmrghw <1,6,1,7>, <0,u,1,1>
+ 2726237176U, // <1,0,7,0>: Cost 3 vsldoi8 <7,0,1,0>, <7,0,1,0>
+ 2285815462U, // <1,0,7,1>: Cost 3 vmrglw <0,6,1,7>, <2,3,0,1>
+ 3805951193U, // <1,0,7,2>: Cost 4 vsldoi8 <u,0,1,0>, <7,2,u,0>
+ 3807941859U, // <1,0,7,3>: Cost 4 vsldoi8 <u,3,1,0>, <7,3,0,1>
+ 3799979366U, // <1,0,7,4>: Cost 4 vsldoi8 <7,0,1,0>, <7,4,5,6>
+ 3803297165U, // <1,0,7,5>: Cost 4 vsldoi8 <7,5,1,0>, <7,5,1,0>
+ 3799979540U, // <1,0,7,6>: Cost 4 vsldoi8 <7,0,1,0>, <7,6,7,0>
+ 3799979628U, // <1,0,7,7>: Cost 4 vsldoi8 <7,0,1,0>, <7,7,7,7>
+ 2731546240U, // <1,0,7,u>: Cost 3 vsldoi8 <7,u,1,0>, <7,u,1,0>
+ 2284494848U, // <1,0,u,0>: Cost 3 vmrglw <0,4,1,u>, <0,0,0,0>
+ 1683112594U, // <1,0,u,1>: Cost 2 vsldoi12 <0,u,1,1>, <0,u,1,1>
+ 1683112605U, // <1,0,u,2>: Cost 2 vsldoi12 <0,u,1,1>, LHS
+ 2734200772U, // <1,0,u,3>: Cost 3 vsldoi8 <u,3,1,0>, <u,3,1,0>
+ 2757075629U, // <1,0,u,4>: Cost 3 vsldoi12 <0,u,4,1>, <0,u,4,1>
+ 2686425242U, // <1,0,u,5>: Cost 3 vsldoi8 <0,3,1,0>, RHS
+ 2791948430U, // <1,0,u,6>: Cost 3 vsldoi12 <6,7,0,1>, <0,1,6,7>
+ 2736855304U, // <1,0,u,7>: Cost 3 vsldoi8 <u,7,1,0>, <u,7,1,0>
+ 1683112659U, // <1,0,u,u>: Cost 2 vsldoi12 <0,u,1,1>, LHS
+ 1610694666U, // <1,1,0,0>: Cost 2 vsldoi8 <0,0,1,1>, <0,0,1,1>
+ 1616003174U, // <1,1,0,1>: Cost 2 vsldoi8 <0,u,1,1>, LHS
+ 2283767958U, // <1,1,0,2>: Cost 3 vmrglw <0,3,1,0>, <3,0,1,2>
+ 3357507596U, // <1,1,0,3>: Cost 4 vmrglw <0,3,1,0>, <0,0,1,3>
+ 2689745234U, // <1,1,0,4>: Cost 3 vsldoi8 <0,u,1,1>, <0,4,1,5>
+ 3357507922U, // <1,1,0,5>: Cost 4 vmrglw <0,3,1,0>, <0,4,1,5>
+ 3294397647U, // <1,1,0,6>: Cost 4 vmrghw <1,0,1,2>, <1,6,1,7>
+ 3373433334U, // <1,1,0,7>: Cost 4 vmrglw <3,0,1,0>, <0,6,1,7>
+ 1616003730U, // <1,1,0,u>: Cost 2 vsldoi8 <0,u,1,1>, <0,u,1,1>
+ 1550221414U, // <1,1,1,0>: Cost 2 vsldoi4 <1,1,1,1>, LHS
+ 269271142U, // <1,1,1,1>: Cost 1 vspltisw1 LHS
+ 2287093910U, // <1,1,1,2>: Cost 3 vmrglw <0,u,1,1>, <3,0,1,2>
+ 2287092615U, // <1,1,1,3>: Cost 3 vmrglw <0,u,1,1>, <1,2,1,3>
+ 1550224694U, // <1,1,1,4>: Cost 2 vsldoi4 <1,1,1,1>, RHS
+ 2287092050U, // <1,1,1,5>: Cost 3 vmrglw <0,u,1,1>, <0,4,1,5>
+ 2689746127U, // <1,1,1,6>: Cost 3 vsldoi8 <0,u,1,1>, <1,6,1,7>
+ 2659800138U, // <1,1,1,7>: Cost 3 vsldoi4 <7,1,1,1>, <7,1,1,1>
+ 269271142U, // <1,1,1,u>: Cost 1 vspltisw1 LHS
+ 2222113516U, // <1,1,2,0>: Cost 3 vmrghw <1,2,3,0>, <1,0,2,1>
+ 2756854663U, // <1,1,2,1>: Cost 3 vsldoi12 <0,u,1,1>, <1,2,1,3>
+ 1148371862U, // <1,1,2,2>: Cost 2 vmrghw <1,2,3,0>, <1,2,3,0>
+ 2689746598U, // <1,1,2,3>: Cost 3 vsldoi8 <0,u,1,1>, <2,3,0,1>
+ 2618002742U, // <1,1,2,4>: Cost 3 vsldoi4 <0,1,1,2>, RHS
+ 2299707730U, // <1,1,2,5>: Cost 3 vmrglw <3,0,1,2>, <0,4,1,5>
+ 2689746874U, // <1,1,2,6>: Cost 3 vsldoi8 <0,u,1,1>, <2,6,3,7>
+ 3361506511U, // <1,1,2,7>: Cost 4 vmrglw <1,0,1,2>, <1,6,1,7>
+ 1148371862U, // <1,1,2,u>: Cost 2 vmrghw <1,2,3,0>, <1,2,3,0>
+ 2689747094U, // <1,1,3,0>: Cost 3 vsldoi8 <0,u,1,1>, <3,0,1,2>
+ 2691074278U, // <1,1,3,1>: Cost 3 vsldoi8 <1,1,1,1>, <3,1,1,1>
+ 3356870806U, // <1,1,3,2>: Cost 4 vmrglw <0,2,1,3>, <3,0,1,2>
+ 2283126958U, // <1,1,3,3>: Cost 3 vmrglw <0,2,1,3>, <0,2,1,3>
+ 2689747458U, // <1,1,3,4>: Cost 3 vsldoi8 <0,u,1,1>, <3,4,5,6>
+ 3356868946U, // <1,1,3,5>: Cost 4 vmrglw <0,2,1,3>, <0,4,1,5>
+ 3811265144U, // <1,1,3,6>: Cost 4 vsldoi8 <u,u,1,1>, <3,6,0,7>
+ 3362841807U, // <1,1,3,7>: Cost 4 vmrglw <1,2,1,3>, <1,6,1,7>
+ 2689747742U, // <1,1,3,u>: Cost 3 vsldoi8 <0,u,1,1>, <3,u,1,2>
+ 2623987814U, // <1,1,4,0>: Cost 3 vsldoi4 <1,1,1,4>, LHS
+ 2758181931U, // <1,1,4,1>: Cost 3 vsldoi12 <1,1,1,1>, <1,4,1,5>
+ 2223408022U, // <1,1,4,2>: Cost 3 vmrghw <1,4,2,5>, <1,2,3,0>
+ 3697731734U, // <1,1,4,3>: Cost 4 vsldoi4 <1,1,1,4>, <3,0,1,2>
+ 2283798784U, // <1,1,4,4>: Cost 3 vmrglw <0,3,1,4>, <0,3,1,4>
+ 1616006454U, // <1,1,4,5>: Cost 2 vsldoi8 <0,u,1,1>, RHS
+ 3297379535U, // <1,1,4,6>: Cost 4 vmrghw <1,4,5,6>, <1,6,1,7>
+ 3373466102U, // <1,1,4,7>: Cost 4 vmrglw <3,0,1,4>, <0,6,1,7>
+ 1616006697U, // <1,1,4,u>: Cost 2 vsldoi8 <0,u,1,1>, RHS
+ 2760762479U, // <1,1,5,0>: Cost 3 vsldoi12 <1,5,0,1>, <1,5,0,1>
+ 2284470282U, // <1,1,5,1>: Cost 3 vmrglw <0,4,1,5>, <0,0,1,1>
+ 2284472470U, // <1,1,5,2>: Cost 3 vmrglw <0,4,1,5>, <3,0,1,2>
+ 3358212270U, // <1,1,5,3>: Cost 4 vmrglw <0,4,1,5>, <0,2,1,3>
+ 2284470285U, // <1,1,5,4>: Cost 3 vmrglw <0,4,1,5>, <0,0,1,4>
+ 1210728786U, // <1,1,5,5>: Cost 2 vmrglw <0,4,1,5>, <0,4,1,5>
+ 2737524834U, // <1,1,5,6>: Cost 3 vsldoi8 <u,u,1,1>, <5,6,7,0>
+ 3360867535U, // <1,1,5,7>: Cost 4 vmrglw <0,u,1,5>, <1,6,1,7>
+ 1210728786U, // <1,1,5,u>: Cost 2 vmrglw <0,4,1,5>, <0,4,1,5>
+ 3697746022U, // <1,1,6,0>: Cost 4 vsldoi4 <1,1,1,6>, LHS
+ 2756854991U, // <1,1,6,1>: Cost 3 vsldoi12 <0,u,1,1>, <1,6,1,7>
+ 2737525242U, // <1,1,6,2>: Cost 3 vsldoi8 <u,u,1,1>, <6,2,7,3>
+ 3839149281U, // <1,1,6,3>: Cost 4 vsldoi12 <2,3,0,1>, <1,6,3,7>
+ 3697749302U, // <1,1,6,4>: Cost 4 vsldoi4 <1,1,1,6>, RHS
+ 3356893522U, // <1,1,6,5>: Cost 4 vmrglw <0,2,1,6>, <0,4,1,5>
+ 2283151537U, // <1,1,6,6>: Cost 3 vmrglw <0,2,1,6>, <0,2,1,6>
+ 2791949566U, // <1,1,6,7>: Cost 3 vsldoi12 <6,7,0,1>, <1,6,7,0>
+ 2792613127U, // <1,1,6,u>: Cost 3 vsldoi12 <6,u,0,1>, <1,6,u,0>
+ 2737525754U, // <1,1,7,0>: Cost 3 vsldoi8 <u,u,1,1>, <7,0,1,2>
+ 2291786386U, // <1,1,7,1>: Cost 3 vmrglw <1,6,1,7>, <0,u,1,1>
+ 3365528292U, // <1,1,7,2>: Cost 4 vmrglw <1,6,1,7>, <1,0,1,2>
+ 3365528455U, // <1,1,7,3>: Cost 4 vmrglw <1,6,1,7>, <1,2,1,3>
+ 2737526118U, // <1,1,7,4>: Cost 3 vsldoi8 <u,u,1,1>, <7,4,5,6>
+ 3365527890U, // <1,1,7,5>: Cost 4 vmrglw <1,6,1,7>, <0,4,1,5>
+ 3365528377U, // <1,1,7,6>: Cost 4 vmrglw <1,6,1,7>, <1,1,1,6>
+ 2291786959U, // <1,1,7,7>: Cost 3 vmrglw <1,6,1,7>, <1,6,1,7>
+ 2737526402U, // <1,1,7,u>: Cost 3 vsldoi8 <u,u,1,1>, <7,u,1,2>
+ 1550221414U, // <1,1,u,0>: Cost 2 vsldoi4 <1,1,1,1>, LHS
+ 269271142U, // <1,1,u,1>: Cost 1 vspltisw1 LHS
+ 1148371862U, // <1,1,u,2>: Cost 2 vmrghw <1,2,3,0>, <1,2,3,0>
+ 2689750972U, // <1,1,u,3>: Cost 3 vsldoi8 <0,u,1,1>, <u,3,0,1>
+ 1550224694U, // <1,1,u,4>: Cost 2 vsldoi4 <1,1,1,1>, RHS
+ 1616009370U, // <1,1,u,5>: Cost 2 vsldoi8 <0,u,1,1>, RHS
+ 2689751248U, // <1,1,u,6>: Cost 3 vsldoi8 <0,u,1,1>, <u,6,3,7>
+ 2736863497U, // <1,1,u,7>: Cost 3 vsldoi8 <u,7,1,1>, <u,7,1,1>
+ 269271142U, // <1,1,u,u>: Cost 1 vspltisw1 LHS
+ 2702360576U, // <1,2,0,0>: Cost 3 vsldoi8 <3,0,1,2>, <0,0,0,0>
+ 1628618854U, // <1,2,0,1>: Cost 2 vsldoi8 <3,0,1,2>, LHS
+ 2685771949U, // <1,2,0,2>: Cost 3 vsldoi8 <0,2,1,2>, <0,2,1,2>
+ 2283765862U, // <1,2,0,3>: Cost 3 vmrglw <0,3,1,0>, LHS
+ 2702360914U, // <1,2,0,4>: Cost 3 vsldoi8 <3,0,1,2>, <0,4,1,5>
+ 3788046813U, // <1,2,0,5>: Cost 4 vsldoi8 <5,0,1,2>, <0,5,u,0>
+ 2688426481U, // <1,2,0,6>: Cost 3 vsldoi8 <0,6,1,2>, <0,6,1,2>
+ 2726249024U, // <1,2,0,7>: Cost 3 vsldoi8 <7,0,1,2>, <0,7,1,0>
+ 1628619421U, // <1,2,0,u>: Cost 2 vsldoi8 <3,0,1,2>, LHS
+ 2690417380U, // <1,2,1,0>: Cost 3 vsldoi8 <1,0,1,2>, <1,0,1,2>
+ 2702361396U, // <1,2,1,1>: Cost 3 vsldoi8 <3,0,1,2>, <1,1,1,1>
+ 2287093352U, // <1,2,1,2>: Cost 3 vmrglw <0,u,1,1>, <2,2,2,2>
+ 1213349990U, // <1,2,1,3>: Cost 2 vmrglw <0,u,1,1>, LHS
+ 3764159522U, // <1,2,1,4>: Cost 4 vsldoi8 <1,0,1,2>, <1,4,0,5>
+ 3295053672U, // <1,2,1,5>: Cost 4 vmrghw <1,1,1,1>, <2,5,3,6>
+ 2221311930U, // <1,2,1,6>: Cost 3 vmrghw <1,1,1,1>, <2,6,3,7>
+ 3799991593U, // <1,2,1,7>: Cost 4 vsldoi8 <7,0,1,2>, <1,7,2,7>
+ 1213349995U, // <1,2,1,u>: Cost 2 vmrglw <0,u,1,1>, LHS
+ 2624045158U, // <1,2,2,0>: Cost 3 vsldoi4 <1,1,2,2>, LHS
+ 2702362144U, // <1,2,2,1>: Cost 3 vsldoi8 <3,0,1,2>, <2,1,3,2>
+ 2283120232U, // <1,2,2,2>: Cost 3 vmrglw <0,2,1,2>, <2,2,2,2>
+ 1225965670U, // <1,2,2,3>: Cost 2 vmrglw <3,0,1,2>, LHS
+ 2624048438U, // <1,2,2,4>: Cost 3 vsldoi4 <1,1,2,2>, RHS
+ 3356860763U, // <1,2,2,5>: Cost 4 vmrglw <0,2,1,2>, <0,4,2,5>
+ 2222114746U, // <1,2,2,6>: Cost 3 vmrghw <1,2,3,0>, <2,6,3,7>
+ 2299708632U, // <1,2,2,7>: Cost 3 vmrglw <3,0,1,2>, <1,6,2,7>
+ 1225965675U, // <1,2,2,u>: Cost 2 vmrglw <3,0,1,2>, LHS
+ 470597734U, // <1,2,3,0>: Cost 1 vsldoi4 LHS, LHS
+ 1544340276U, // <1,2,3,1>: Cost 2 vsldoi4 LHS, <1,1,1,1>
+ 1544341096U, // <1,2,3,2>: Cost 2 vsldoi4 LHS, <2,2,2,2>
+ 1544341916U, // <1,2,3,3>: Cost 2 vsldoi4 LHS, <3,3,3,3>
+ 470601014U, // <1,2,3,4>: Cost 1 vsldoi4 LHS, RHS
+ 1592119300U, // <1,2,3,5>: Cost 2 vsldoi4 LHS, <5,5,5,5>
+ 1592119802U, // <1,2,3,6>: Cost 2 vsldoi4 LHS, <6,2,7,3>
+ 1592120314U, // <1,2,3,7>: Cost 2 vsldoi4 LHS, <7,0,1,2>
+ 470603566U, // <1,2,3,u>: Cost 1 vsldoi4 LHS, LHS
+ 2708335471U, // <1,2,4,0>: Cost 3 vsldoi8 <4,0,1,2>, <4,0,1,2>
+ 3838043908U, // <1,2,4,1>: Cost 4 vsldoi12 <2,1,3,1>, <2,4,1,5>
+ 3357541992U, // <1,2,4,2>: Cost 4 vmrglw <0,3,1,4>, <2,2,2,2>
+ 2283798630U, // <1,2,4,3>: Cost 3 vmrglw <0,3,1,4>, LHS
+ 2726251728U, // <1,2,4,4>: Cost 3 vsldoi8 <7,0,1,2>, <4,4,4,4>
+ 1628622134U, // <1,2,4,5>: Cost 2 vsldoi8 <3,0,1,2>, RHS
+ 3297077178U, // <1,2,4,6>: Cost 4 vmrghw <1,4,1,5>, <2,6,3,7>
+ 2726251976U, // <1,2,4,7>: Cost 3 vsldoi8 <7,0,1,2>, <4,7,5,0>
+ 1628622377U, // <1,2,4,u>: Cost 2 vsldoi8 <3,0,1,2>, RHS
+ 2714308168U, // <1,2,5,0>: Cost 3 vsldoi8 <5,0,1,2>, <5,0,1,2>
+ 3297633827U, // <1,2,5,1>: Cost 4 vmrghw <1,5,0,1>, <2,1,3,5>
+ 2284471912U, // <1,2,5,2>: Cost 3 vmrglw <0,4,1,5>, <2,2,2,2>
+ 1210728550U, // <1,2,5,3>: Cost 2 vmrglw <0,4,1,5>, LHS
+ 3776106420U, // <1,2,5,4>: Cost 4 vsldoi8 <3,0,1,2>, <5,4,5,6>
+ 2726252548U, // <1,2,5,5>: Cost 3 vsldoi8 <7,0,1,2>, <5,5,5,5>
+ 2726252642U, // <1,2,5,6>: Cost 3 vsldoi8 <7,0,1,2>, <5,6,7,0>
+ 3799994538U, // <1,2,5,7>: Cost 4 vsldoi8 <7,0,1,2>, <5,7,6,0>
+ 1210728555U, // <1,2,5,u>: Cost 2 vmrglw <0,4,1,5>, LHS
+ 2720280865U, // <1,2,6,0>: Cost 3 vsldoi8 <6,0,1,2>, <6,0,1,2>
+ 2702365096U, // <1,2,6,1>: Cost 3 vsldoi8 <3,0,1,2>, <6,1,7,2>
+ 2726253050U, // <1,2,6,2>: Cost 3 vsldoi8 <7,0,1,2>, <6,2,7,3>
+ 2283151462U, // <1,2,6,3>: Cost 3 vmrglw <0,2,1,6>, LHS
+ 3697823030U, // <1,2,6,4>: Cost 4 vsldoi4 <1,1,2,6>, RHS
+ 3298715497U, // <1,2,6,5>: Cost 4 vmrghw <1,6,5,7>, <2,5,3,7>
+ 2726253368U, // <1,2,6,6>: Cost 3 vsldoi8 <7,0,1,2>, <6,6,6,6>
+ 2724926296U, // <1,2,6,7>: Cost 3 vsldoi8 <6,7,1,2>, <6,7,1,2>
+ 2283151467U, // <1,2,6,u>: Cost 3 vmrglw <0,2,1,6>, LHS
+ 1652511738U, // <1,2,7,0>: Cost 2 vsldoi8 <7,0,1,2>, <7,0,1,2>
+ 3371500916U, // <1,2,7,1>: Cost 4 vmrglw <2,6,1,7>, <1,u,2,1>
+ 3365529192U, // <1,2,7,2>: Cost 4 vmrglw <1,6,1,7>, <2,2,2,2>
+ 2291785830U, // <1,2,7,3>: Cost 3 vmrglw <1,6,1,7>, LHS
+ 2726253926U, // <1,2,7,4>: Cost 3 vsldoi8 <7,0,1,2>, <7,4,5,6>
+ 3788051845U, // <1,2,7,5>: Cost 4 vsldoi8 <5,0,1,2>, <7,5,0,1>
+ 3794023894U, // <1,2,7,6>: Cost 4 vsldoi8 <6,0,1,2>, <7,6,0,1>
+ 2726254119U, // <1,2,7,7>: Cost 3 vsldoi8 <7,0,1,2>, <7,7,0,1>
+ 1657820802U, // <1,2,7,u>: Cost 2 vsldoi8 <7,u,1,2>, <7,u,1,2>
+ 470638699U, // <1,2,u,0>: Cost 1 vsldoi4 LHS, LHS
+ 1544381236U, // <1,2,u,1>: Cost 2 vsldoi4 LHS, <1,1,1,1>
+ 1544382056U, // <1,2,u,2>: Cost 2 vsldoi4 LHS, <2,2,2,2>
+ 1544382614U, // <1,2,u,3>: Cost 2 vsldoi4 LHS, <3,0,1,2>
+ 470641974U, // <1,2,u,4>: Cost 1 vsldoi4 LHS, RHS
+ 1628625050U, // <1,2,u,5>: Cost 2 vsldoi8 <3,0,1,2>, RHS
+ 1592160762U, // <1,2,u,6>: Cost 2 vsldoi4 LHS, <6,2,7,3>
+ 1592161274U, // <1,2,u,7>: Cost 2 vsldoi4 LHS, <7,0,1,2>
+ 470644526U, // <1,2,u,u>: Cost 1 vsldoi4 LHS, LHS
+ 2769389708U, // <1,3,0,0>: Cost 3 vsldoi12 <3,0,0,1>, <3,0,0,1>
+ 2685780070U, // <1,3,0,1>: Cost 3 vsldoi8 <0,2,1,3>, LHS
+ 2685780142U, // <1,3,0,2>: Cost 3 vsldoi8 <0,2,1,3>, <0,2,1,3>
+ 2686443775U, // <1,3,0,3>: Cost 3 vsldoi8 <0,3,1,3>, <0,3,1,3>
+ 2769684656U, // <1,3,0,4>: Cost 3 vsldoi12 <3,0,4,1>, <3,0,4,1>
+ 3357507940U, // <1,3,0,5>: Cost 4 vmrglw <0,3,1,0>, <0,4,3,5>
+ 3759522294U, // <1,3,0,6>: Cost 4 vsldoi8 <0,2,1,3>, <0,6,1,7>
+ 3357509562U, // <1,3,0,7>: Cost 4 vmrglw <0,3,1,0>, <2,6,3,7>
+ 2685780637U, // <1,3,0,u>: Cost 3 vsldoi8 <0,2,1,3>, LHS
+ 2287092630U, // <1,3,1,0>: Cost 3 vmrglw <0,u,1,1>, <1,2,3,0>
+ 2221312230U, // <1,3,1,1>: Cost 3 vmrghw <1,1,1,1>, <3,1,1,1>
+ 2691752839U, // <1,3,1,2>: Cost 3 vsldoi8 <1,2,1,3>, <1,2,1,3>
+ 2287093362U, // <1,3,1,3>: Cost 3 vmrglw <0,u,1,1>, <2,2,3,3>
+ 2287092634U, // <1,3,1,4>: Cost 3 vmrglw <0,u,1,1>, <1,2,3,4>
+ 3360835107U, // <1,3,1,5>: Cost 4 vmrglw <0,u,1,1>, <2,1,3,5>
+ 3759523041U, // <1,3,1,6>: Cost 4 vsldoi8 <0,2,1,3>, <1,6,3,7>
+ 2287093690U, // <1,3,1,7>: Cost 3 vmrglw <0,u,1,1>, <2,6,3,7>
+ 2287092638U, // <1,3,1,u>: Cost 3 vmrglw <0,u,1,1>, <1,2,3,u>
+ 2222114966U, // <1,3,2,0>: Cost 3 vmrghw <1,2,3,0>, <3,0,1,2>
+ 2222115057U, // <1,3,2,1>: Cost 3 vmrghw <1,2,3,0>, <3,1,2,3>
+ 2630092320U, // <1,3,2,2>: Cost 3 vsldoi4 <2,1,3,2>, <2,1,3,2>
+ 2685781670U, // <1,3,2,3>: Cost 3 vsldoi8 <0,2,1,3>, <2,3,0,1>
+ 2222115330U, // <1,3,2,4>: Cost 3 vmrghw <1,2,3,0>, <3,4,5,6>
+ 3373449572U, // <1,3,2,5>: Cost 4 vmrglw <3,0,1,2>, <0,4,3,5>
+ 2222115448U, // <1,3,2,6>: Cost 3 vmrghw <1,2,3,0>, <3,6,0,7>
+ 2299709370U, // <1,3,2,7>: Cost 3 vmrglw <3,0,1,2>, <2,6,3,7>
+ 2222115614U, // <1,3,2,u>: Cost 3 vmrghw <1,2,3,0>, <3,u,1,2>
+ 2771380607U, // <1,3,3,0>: Cost 3 vsldoi12 <3,3,0,1>, <3,3,0,1>
+ 3356874468U, // <1,3,3,1>: Cost 4 vmrglw <0,2,1,3>, <u,0,3,1>
+ 3759524168U, // <1,3,3,2>: Cost 4 vsldoi8 <0,2,1,3>, <3,2,3,0>
+ 2283792796U, // <1,3,3,3>: Cost 3 vmrglw <0,3,1,3>, <3,3,3,3>
+ 3356869530U, // <1,3,3,4>: Cost 4 vmrglw <0,2,1,3>, <1,2,3,4>
+ 3721760428U, // <1,3,3,5>: Cost 4 vsldoi4 <5,1,3,3>, <5,1,3,3>
+ 3296496248U, // <1,3,3,6>: Cost 4 vmrghw <1,3,2,6>, <3,6,0,7>
+ 3356870586U, // <1,3,3,7>: Cost 4 vmrglw <0,2,1,3>, <2,6,3,7>
+ 2771970503U, // <1,3,3,u>: Cost 3 vsldoi12 <3,3,u,1>, <3,3,u,1>
+ 2772044240U, // <1,3,4,0>: Cost 3 vsldoi12 <3,4,0,1>, <3,4,0,1>
+ 3362186135U, // <1,3,4,1>: Cost 4 vmrglw <1,1,1,4>, <1,2,3,1>
+ 3297151280U, // <1,3,4,2>: Cost 4 vmrghw <1,4,2,5>, <3,2,0,3>
+ 3357542002U, // <1,3,4,3>: Cost 4 vmrglw <0,3,1,4>, <2,2,3,3>
+ 3357540626U, // <1,3,4,4>: Cost 4 vmrglw <0,3,1,4>, <0,3,3,4>
+ 2685783350U, // <1,3,4,5>: Cost 3 vsldoi8 <0,2,1,3>, RHS
+ 3357546622U, // <1,3,4,6>: Cost 4 vmrglw <0,3,1,4>, <u,5,3,6>
+ 3357542330U, // <1,3,4,7>: Cost 4 vmrglw <0,3,1,4>, <2,6,3,7>
+ 2685783593U, // <1,3,4,u>: Cost 3 vsldoi8 <0,2,1,3>, RHS
+ 2284471190U, // <1,3,5,0>: Cost 3 vmrglw <0,4,1,5>, <1,2,3,0>
+ 3358213015U, // <1,3,5,1>: Cost 4 vmrglw <0,4,1,5>, <1,2,3,1>
+ 2630116899U, // <1,3,5,2>: Cost 3 vsldoi4 <2,1,3,5>, <2,1,3,5>
+ 2284471922U, // <1,3,5,3>: Cost 3 vmrglw <0,4,1,5>, <2,2,3,3>
+ 2284471194U, // <1,3,5,4>: Cost 3 vmrglw <0,4,1,5>, <1,2,3,4>
+ 2284471843U, // <1,3,5,5>: Cost 3 vmrglw <0,4,1,5>, <2,1,3,5>
+ 3358218366U, // <1,3,5,6>: Cost 4 vmrglw <0,4,1,5>, <u,5,3,6>
+ 2284472250U, // <1,3,5,7>: Cost 3 vmrglw <0,4,1,5>, <2,6,3,7>
+ 2284471198U, // <1,3,5,u>: Cost 3 vmrglw <0,4,1,5>, <1,2,3,u>
+ 2224752790U, // <1,3,6,0>: Cost 3 vmrghw <1,6,2,7>, <3,0,1,2>
+ 3832736385U, // <1,3,6,1>: Cost 4 vsldoi12 <1,2,3,1>, <3,6,1,7>
+ 3703866916U, // <1,3,6,2>: Cost 4 vsldoi4 <2,1,3,6>, <2,1,3,6>
+ 3356894834U, // <1,3,6,3>: Cost 4 vmrglw <0,2,1,6>, <2,2,3,3>
+ 3356894106U, // <1,3,6,4>: Cost 4 vmrglw <0,2,1,6>, <1,2,3,4>
+ 3356894755U, // <1,3,6,5>: Cost 5 vmrglw <0,2,1,6>, <2,1,3,5>
+ 3356899130U, // <1,3,6,6>: Cost 4 vmrglw <0,2,1,6>, <u,1,3,6>
+ 2283153338U, // <1,3,6,7>: Cost 3 vmrglw <0,2,1,6>, <2,6,3,7>
+ 2283153338U, // <1,3,6,u>: Cost 3 vmrglw <0,2,1,6>, <2,6,3,7>
+ 2774035139U, // <1,3,7,0>: Cost 3 vsldoi12 <3,7,0,1>, <3,7,0,1>
+ 3703874767U, // <1,3,7,1>: Cost 4 vsldoi4 <2,1,3,7>, <1,6,1,7>
+ 3703875109U, // <1,3,7,2>: Cost 4 vsldoi4 <2,1,3,7>, <2,1,3,7>
+ 3365529202U, // <1,3,7,3>: Cost 4 vmrglw <1,6,1,7>, <2,2,3,3>
+ 3365528474U, // <1,3,7,4>: Cost 4 vmrglw <1,6,1,7>, <1,2,3,4>
+ 3789387159U, // <1,3,7,5>: Cost 4 vsldoi8 <5,2,1,3>, <7,5,2,1>
+ 3865692927U, // <1,3,7,6>: Cost 4 vsldoi12 <6,7,0,1>, <3,7,6,7>
+ 3363538874U, // <1,3,7,7>: Cost 4 vmrglw <1,3,1,7>, <2,6,3,7>
+ 2774625035U, // <1,3,7,u>: Cost 3 vsldoi12 <3,7,u,1>, <3,7,u,1>
+ 2284495766U, // <1,3,u,0>: Cost 3 vmrglw <0,4,1,u>, <1,2,3,0>
+ 2685785902U, // <1,3,u,1>: Cost 3 vsldoi8 <0,2,1,3>, LHS
+ 2630141478U, // <1,3,u,2>: Cost 3 vsldoi4 <2,1,3,u>, <2,1,3,u>
+ 2283169880U, // <1,3,u,3>: Cost 3 vmrglw <0,2,1,u>, <2,u,3,3>
+ 2284495770U, // <1,3,u,4>: Cost 3 vmrglw <0,4,1,u>, <1,2,3,4>
+ 2685786266U, // <1,3,u,5>: Cost 3 vsldoi8 <0,2,1,3>, RHS
+ 2222115448U, // <1,3,u,6>: Cost 3 vmrghw <1,2,3,0>, <3,6,0,7>
+ 2284496826U, // <1,3,u,7>: Cost 3 vmrglw <0,4,1,u>, <2,6,3,7>
+ 2685786469U, // <1,3,u,u>: Cost 3 vsldoi8 <0,2,1,3>, LHS
+ 2684461069U, // <1,4,0,0>: Cost 3 vsldoi8 <0,0,1,4>, <0,0,1,4>
+ 2686451814U, // <1,4,0,1>: Cost 3 vsldoi8 <0,3,1,4>, LHS
+ 3759530159U, // <1,4,0,2>: Cost 4 vsldoi8 <0,2,1,4>, <0,2,1,4>
+ 2686451968U, // <1,4,0,3>: Cost 3 vsldoi8 <0,3,1,4>, <0,3,1,4>
+ 2684461394U, // <1,4,0,4>: Cost 3 vsldoi8 <0,0,1,4>, <0,4,1,5>
+ 1701989266U, // <1,4,0,5>: Cost 2 vsldoi12 <4,0,5,1>, <4,0,5,1>
+ 3776119286U, // <1,4,0,6>: Cost 4 vsldoi8 <3,0,1,4>, <0,6,1,7>
+ 2689106500U, // <1,4,0,7>: Cost 3 vsldoi8 <0,7,1,4>, <0,7,1,4>
+ 1702210477U, // <1,4,0,u>: Cost 2 vsldoi12 <4,0,u,1>, <4,0,u,1>
+ 2221312914U, // <1,4,1,0>: Cost 3 vmrghw <1,1,1,1>, <4,0,5,1>
+ 2691097399U, // <1,4,1,1>: Cost 3 vsldoi8 <1,1,1,4>, <1,1,1,4>
+ 3760194454U, // <1,4,1,2>: Cost 4 vsldoi8 <0,3,1,4>, <1,2,3,0>
+ 3766166489U, // <1,4,1,3>: Cost 4 vsldoi8 <1,3,1,4>, <1,3,1,4>
+ 2334870736U, // <1,4,1,4>: Cost 3 vmrglw <u,u,1,1>, <4,4,4,4>
+ 1147571510U, // <1,4,1,5>: Cost 2 vmrghw <1,1,1,1>, RHS
+ 3760194794U, // <1,4,1,6>: Cost 4 vsldoi8 <0,3,1,4>, <1,6,4,7>
+ 3867315188U, // <1,4,1,7>: Cost 4 vsldoi12 <7,0,4,1>, <4,1,7,0>
+ 1147571753U, // <1,4,1,u>: Cost 2 vmrghw <1,1,1,1>, RHS
+ 2222115730U, // <1,4,2,0>: Cost 3 vmrghw <1,2,3,0>, <4,0,5,1>
+ 2222115812U, // <1,4,2,1>: Cost 3 vmrghw <1,2,3,0>, <4,1,5,2>
+ 3760195176U, // <1,4,2,2>: Cost 4 vsldoi8 <0,3,1,4>, <2,2,2,2>
+ 2702378662U, // <1,4,2,3>: Cost 3 vsldoi8 <3,0,1,4>, <2,3,0,1>
+ 2323598544U, // <1,4,2,4>: Cost 3 vmrglw <7,0,1,2>, <4,4,4,4>
+ 1148374326U, // <1,4,2,5>: Cost 2 vmrghw <1,2,3,0>, RHS
+ 3760195514U, // <1,4,2,6>: Cost 4 vsldoi8 <0,3,1,4>, <2,6,3,7>
+ 3373451932U, // <1,4,2,7>: Cost 4 vmrglw <3,0,1,2>, <3,6,4,7>
+ 1148374569U, // <1,4,2,u>: Cost 2 vmrghw <1,2,3,0>, RHS
+ 2702379160U, // <1,4,3,0>: Cost 3 vsldoi8 <3,0,1,4>, <3,0,1,4>
+ 3760195840U, // <1,4,3,1>: Cost 4 vsldoi8 <0,3,1,4>, <3,1,4,0>
+ 3776121160U, // <1,4,3,2>: Cost 4 vsldoi8 <3,0,1,4>, <3,2,3,0>
+ 3760195996U, // <1,4,3,3>: Cost 4 vsldoi8 <0,3,1,4>, <3,3,3,3>
+ 2686454274U, // <1,4,3,4>: Cost 3 vsldoi8 <0,3,1,4>, <3,4,5,6>
+ 3356870350U, // <1,4,3,5>: Cost 4 vmrglw <0,2,1,3>, <2,3,4,5>
+ 3800009392U, // <1,4,3,6>: Cost 4 vsldoi8 <7,0,1,4>, <3,6,7,0>
+ 3366824604U, // <1,4,3,7>: Cost 5 vmrglw <1,u,1,3>, <3,6,4,7>
+ 2707688224U, // <1,4,3,u>: Cost 3 vsldoi8 <3,u,1,4>, <3,u,1,4>
+ 2775731368U, // <1,4,4,0>: Cost 3 vsldoi12 <4,0,5,1>, <4,4,0,0>
+ 3830820018U, // <1,4,4,1>: Cost 4 vsldoi12 <0,u,4,1>, <4,4,1,1>
+ 3691980454U, // <1,4,4,2>: Cost 4 vsldoi4 <0,1,4,4>, <2,3,0,1>
+ 3357541282U, // <1,4,4,3>: Cost 4 vmrglw <0,3,1,4>, <1,2,4,3>
+ 2781039824U, // <1,4,4,4>: Cost 3 vsldoi12 <4,u,5,1>, <4,4,4,4>
+ 2686455094U, // <1,4,4,5>: Cost 3 vsldoi8 <0,3,1,4>, RHS
+ 3357541528U, // <1,4,4,6>: Cost 4 vmrglw <0,3,1,4>, <1,5,4,6>
+ 3810627020U, // <1,4,4,7>: Cost 4 vsldoi8 <u,7,1,4>, <4,7,5,4>
+ 2686455337U, // <1,4,4,u>: Cost 3 vsldoi8 <0,3,1,4>, RHS
+ 2624217190U, // <1,4,5,0>: Cost 3 vsldoi4 <1,1,4,5>, LHS
+ 2284470309U, // <1,4,5,1>: Cost 3 vmrglw <0,4,1,5>, <0,0,4,1>
+ 2618246822U, // <1,4,5,2>: Cost 3 vsldoi4 <0,1,4,5>, <2,3,0,1>
+ 3358212297U, // <1,4,5,3>: Cost 4 vmrglw <0,4,1,5>, <0,2,4,3>
+ 2284470312U, // <1,4,5,4>: Cost 3 vmrglw <0,4,1,5>, <0,0,4,4>
+ 2284470637U, // <1,4,5,5>: Cost 3 vmrglw <0,4,1,5>, <0,4,4,5>
+ 1683115318U, // <1,4,5,6>: Cost 2 vsldoi12 <0,u,1,1>, RHS
+ 3721851898U, // <1,4,5,7>: Cost 4 vsldoi4 <5,1,4,5>, <7,0,1,2>
+ 1683115336U, // <1,4,5,u>: Cost 2 vsldoi12 <0,u,1,1>, RHS
+ 3794039075U, // <1,4,6,0>: Cost 4 vsldoi8 <6,0,1,4>, <6,0,1,4>
+ 3830820186U, // <1,4,6,1>: Cost 4 vsldoi12 <0,u,4,1>, <4,6,1,7>
+ 3800011258U, // <1,4,6,2>: Cost 4 vsldoi8 <7,0,1,4>, <6,2,7,3>
+ 3807973938U, // <1,4,6,3>: Cost 4 vsldoi8 <u,3,1,4>, <6,3,4,5>
+ 3298716880U, // <1,4,6,4>: Cost 4 vmrghw <1,6,5,7>, <4,4,4,4>
+ 2224680246U, // <1,4,6,5>: Cost 3 vmrghw <1,6,1,7>, RHS
+ 3800011576U, // <1,4,6,6>: Cost 4 vsldoi8 <7,0,1,4>, <6,6,6,6>
+ 2726269774U, // <1,4,6,7>: Cost 3 vsldoi8 <7,0,1,4>, <6,7,0,1>
+ 2224680489U, // <1,4,6,u>: Cost 3 vmrghw <1,6,1,7>, RHS
+ 2726269948U, // <1,4,7,0>: Cost 3 vsldoi8 <7,0,1,4>, <7,0,1,4>
+ 3383444141U, // <1,4,7,1>: Cost 4 vmrglw <4,6,1,7>, <0,u,4,1>
+ 3805983961U, // <1,4,7,2>: Cost 4 vsldoi8 <u,0,1,4>, <7,2,u,0>
+ 3807974667U, // <1,4,7,3>: Cost 4 vsldoi8 <u,3,1,4>, <7,3,4,5>
+ 2736887142U, // <1,4,7,4>: Cost 3 vsldoi8 <u,7,1,4>, <7,4,5,6>
+ 3365528403U, // <1,4,7,5>: Cost 4 vmrglw <1,6,1,7>, <1,1,4,5>
+ 3800012308U, // <1,4,7,6>: Cost 4 vsldoi8 <7,0,1,4>, <7,6,7,0>
+ 3800012396U, // <1,4,7,7>: Cost 4 vsldoi8 <7,0,1,4>, <7,7,7,7>
+ 2731579012U, // <1,4,7,u>: Cost 3 vsldoi8 <7,u,1,4>, <7,u,1,4>
+ 2624241766U, // <1,4,u,0>: Cost 3 vsldoi4 <1,1,4,u>, LHS
+ 2686457646U, // <1,4,u,1>: Cost 3 vsldoi8 <0,3,1,4>, LHS
+ 2618271398U, // <1,4,u,2>: Cost 3 vsldoi4 <0,1,4,u>, <2,3,0,1>
+ 2734233544U, // <1,4,u,3>: Cost 3 vsldoi8 <u,3,1,4>, <u,3,1,4>
+ 2689775679U, // <1,4,u,4>: Cost 3 vsldoi8 <0,u,1,4>, <u,4,5,6>
+ 1152355638U, // <1,4,u,5>: Cost 2 vmrghw <1,u,3,0>, RHS
+ 1683115561U, // <1,4,u,6>: Cost 2 vsldoi12 <0,u,1,1>, RHS
+ 2736888076U, // <1,4,u,7>: Cost 3 vsldoi8 <u,7,1,4>, <u,7,1,4>
+ 1683115579U, // <1,4,u,u>: Cost 2 vsldoi12 <0,u,1,1>, RHS
+ 2687123456U, // <1,5,0,0>: Cost 3 vsldoi8 <0,4,1,5>, <0,0,0,0>
+ 1613381734U, // <1,5,0,1>: Cost 2 vsldoi8 <0,4,1,5>, LHS
+ 3759538352U, // <1,5,0,2>: Cost 4 vsldoi8 <0,2,1,5>, <0,2,1,5>
+ 3760865532U, // <1,5,0,3>: Cost 4 vsldoi8 <0,4,1,5>, <0,3,1,0>
+ 1613381970U, // <1,5,0,4>: Cost 2 vsldoi8 <0,4,1,5>, <0,4,1,5>
+ 2687787427U, // <1,5,0,5>: Cost 3 vsldoi8 <0,5,1,5>, <0,5,1,5>
+ 2781777524U, // <1,5,0,6>: Cost 3 vsldoi12 <5,0,6,1>, <5,0,6,1>
+ 3733828717U, // <1,5,0,7>: Cost 4 vsldoi4 <7,1,5,0>, <7,1,5,0>
+ 1613382301U, // <1,5,0,u>: Cost 2 vsldoi8 <0,4,1,5>, LHS
+ 2781040271U, // <1,5,1,0>: Cost 3 vsldoi12 <4,u,5,1>, <5,1,0,1>
+ 2687124276U, // <1,5,1,1>: Cost 3 vsldoi8 <0,4,1,5>, <1,1,1,1>
+ 2687124374U, // <1,5,1,2>: Cost 3 vsldoi8 <0,4,1,5>, <1,2,3,0>
+ 3760866297U, // <1,5,1,3>: Cost 4 vsldoi8 <0,4,1,5>, <1,3,5,0>
+ 2693096491U, // <1,5,1,4>: Cost 3 vsldoi8 <1,4,1,5>, <1,4,1,5>
+ 2687124591U, // <1,5,1,5>: Cost 3 vsldoi8 <0,4,1,5>, <1,5,0,1>
+ 2687124723U, // <1,5,1,6>: Cost 3 vsldoi8 <0,4,1,5>, <1,6,5,7>
+ 3360834803U, // <1,5,1,7>: Cost 4 vmrglw <0,u,1,1>, <1,6,5,7>
+ 2687124860U, // <1,5,1,u>: Cost 3 vsldoi8 <0,4,1,5>, <1,u,3,0>
+ 2323598792U, // <1,5,2,0>: Cost 3 vmrglw <7,0,1,2>, <4,7,5,0>
+ 2687125027U, // <1,5,2,1>: Cost 3 vsldoi8 <0,4,1,5>, <2,1,3,5>
+ 2687125096U, // <1,5,2,2>: Cost 3 vsldoi8 <0,4,1,5>, <2,2,2,2>
+ 2687125158U, // <1,5,2,3>: Cost 3 vsldoi8 <0,4,1,5>, <2,3,0,1>
+ 2642185188U, // <1,5,2,4>: Cost 3 vsldoi4 <4,1,5,2>, <4,1,5,2>
+ 2323598554U, // <1,5,2,5>: Cost 3 vmrglw <7,0,1,2>, <4,4,5,5>
+ 2687125434U, // <1,5,2,6>: Cost 3 vsldoi8 <0,4,1,5>, <2,6,3,7>
+ 3373450483U, // <1,5,2,7>: Cost 4 vmrglw <3,0,1,2>, <1,6,5,7>
+ 2687125563U, // <1,5,2,u>: Cost 3 vsldoi8 <0,4,1,5>, <2,u,0,1>
+ 2687125654U, // <1,5,3,0>: Cost 3 vsldoi8 <0,4,1,5>, <3,0,1,2>
+ 2312990234U, // <1,5,3,1>: Cost 3 vmrglw <5,2,1,3>, <4,u,5,1>
+ 3760867649U, // <1,5,3,2>: Cost 4 vsldoi8 <0,4,1,5>, <3,2,2,2>
+ 2687125916U, // <1,5,3,3>: Cost 3 vsldoi8 <0,4,1,5>, <3,3,3,3>
+ 2687126018U, // <1,5,3,4>: Cost 3 vsldoi8 <0,4,1,5>, <3,4,5,6>
+ 3386731738U, // <1,5,3,5>: Cost 4 vmrglw <5,2,1,3>, <4,4,5,5>
+ 3356871170U, // <1,5,3,6>: Cost 4 vmrglw <0,2,1,3>, <3,4,5,6>
+ 3808643779U, // <1,5,3,7>: Cost 4 vsldoi8 <u,4,1,5>, <3,7,0,1>
+ 2687126302U, // <1,5,3,u>: Cost 3 vsldoi8 <0,4,1,5>, <3,u,1,2>
+ 2642198630U, // <1,5,4,0>: Cost 3 vsldoi4 <4,1,5,4>, LHS
+ 2687126498U, // <1,5,4,1>: Cost 3 vsldoi8 <0,4,1,5>, <4,1,5,0>
+ 3715941923U, // <1,5,4,2>: Cost 4 vsldoi4 <4,1,5,4>, <2,1,3,5>
+ 3709970701U, // <1,5,4,3>: Cost 4 vsldoi4 <3,1,5,4>, <3,1,5,4>
+ 2687126736U, // <1,5,4,4>: Cost 3 vsldoi8 <0,4,1,5>, <4,4,4,4>
+ 1613385014U, // <1,5,4,5>: Cost 2 vsldoi8 <0,4,1,5>, RHS
+ 2283801090U, // <1,5,4,6>: Cost 3 vmrglw <0,3,1,4>, <3,4,5,6>
+ 3733861489U, // <1,5,4,7>: Cost 4 vsldoi4 <7,1,5,4>, <7,1,5,4>
+ 1613385257U, // <1,5,4,u>: Cost 2 vsldoi8 <0,4,1,5>, RHS
+ 2624290918U, // <1,5,5,0>: Cost 3 vsldoi4 <1,1,5,5>, LHS
+ 2624291676U, // <1,5,5,1>: Cost 3 vsldoi4 <1,1,5,5>, <1,1,5,5>
+ 3698034211U, // <1,5,5,2>: Cost 4 vsldoi4 <1,1,5,5>, <2,1,3,5>
+ 2284471211U, // <1,5,5,3>: Cost 3 vmrglw <0,4,1,5>, <1,2,5,3>
+ 2624294198U, // <1,5,5,4>: Cost 3 vsldoi4 <1,1,5,5>, RHS
+ 2284471132U, // <1,5,5,5>: Cost 3 vmrglw <0,4,1,5>, <1,1,5,5>
+ 2284472834U, // <1,5,5,6>: Cost 3 vmrglw <0,4,1,5>, <3,4,5,6>
+ 2284471539U, // <1,5,5,7>: Cost 3 vmrglw <0,4,1,5>, <1,6,5,7>
+ 2284471216U, // <1,5,5,u>: Cost 3 vmrglw <0,4,1,5>, <1,2,5,u>
+ 2785316900U, // <1,5,6,0>: Cost 3 vsldoi12 <5,6,0,1>, <5,6,0,1>
+ 2781040691U, // <1,5,6,1>: Cost 3 vsldoi12 <4,u,5,1>, <5,6,1,7>
+ 2734903802U, // <1,5,6,2>: Cost 3 vsldoi8 <u,4,1,5>, <6,2,7,3>
+ 3848736834U, // <1,5,6,3>: Cost 4 vsldoi12 <3,u,4,1>, <5,6,3,4>
+ 3298717620U, // <1,5,6,4>: Cost 4 vmrghw <1,6,5,7>, <5,4,5,6>
+ 3298717700U, // <1,5,6,5>: Cost 4 vmrghw <1,6,5,7>, <5,5,5,5>
+ 2734904120U, // <1,5,6,6>: Cost 3 vsldoi8 <u,4,1,5>, <6,6,6,6>
+ 2781040738U, // <1,5,6,7>: Cost 3 vsldoi12 <4,u,5,1>, <5,6,7,0>
+ 2781040747U, // <1,5,6,u>: Cost 3 vsldoi12 <4,u,5,1>, <5,6,u,0>
+ 2734904314U, // <1,5,7,0>: Cost 3 vsldoi8 <u,4,1,5>, <7,0,1,2>
+ 2315677210U, // <1,5,7,1>: Cost 3 vmrglw <5,6,1,7>, <4,u,5,1>
+ 3808646292U, // <1,5,7,2>: Cost 4 vsldoi8 <u,4,1,5>, <7,2,0,3>
+ 3808646371U, // <1,5,7,3>: Cost 4 vsldoi8 <u,4,1,5>, <7,3,0,1>
+ 2734904678U, // <1,5,7,4>: Cost 3 vsldoi8 <u,4,1,5>, <7,4,5,6>
+ 3389418714U, // <1,5,7,5>: Cost 4 vmrglw <5,6,1,7>, <4,4,5,5>
+ 3365528656U, // <1,5,7,6>: Cost 4 vmrglw <1,6,1,7>, <1,4,5,6>
+ 2734904940U, // <1,5,7,7>: Cost 3 vsldoi8 <u,4,1,5>, <7,7,7,7>
+ 2734904962U, // <1,5,7,u>: Cost 3 vsldoi8 <u,4,1,5>, <7,u,1,2>
+ 2687129299U, // <1,5,u,0>: Cost 3 vsldoi8 <0,4,1,5>, <u,0,1,2>
+ 1613387566U, // <1,5,u,1>: Cost 2 vsldoi8 <0,4,1,5>, LHS
+ 2687129480U, // <1,5,u,2>: Cost 3 vsldoi8 <0,4,1,5>, <u,2,3,3>
+ 2687129532U, // <1,5,u,3>: Cost 3 vsldoi8 <0,4,1,5>, <u,3,0,1>
+ 1661163546U, // <1,5,u,4>: Cost 2 vsldoi8 <u,4,1,5>, <u,4,1,5>
+ 1613387930U, // <1,5,u,5>: Cost 2 vsldoi8 <0,4,1,5>, RHS
+ 2687129808U, // <1,5,u,6>: Cost 3 vsldoi8 <0,4,1,5>, <u,6,3,7>
+ 2781040900U, // <1,5,u,7>: Cost 3 vsldoi12 <4,u,5,1>, <5,u,7,0>
+ 1613388133U, // <1,5,u,u>: Cost 2 vsldoi8 <0,4,1,5>, LHS
+ 3759546368U, // <1,6,0,0>: Cost 4 vsldoi8 <0,2,1,6>, <0,0,0,0>
+ 2685804646U, // <1,6,0,1>: Cost 3 vsldoi8 <0,2,1,6>, LHS
+ 2685804721U, // <1,6,0,2>: Cost 3 vsldoi8 <0,2,1,6>, <0,2,1,6>
+ 3861270834U, // <1,6,0,3>: Cost 4 vsldoi12 <6,0,3,1>, <6,0,3,1>
+ 3759546706U, // <1,6,0,4>: Cost 4 vsldoi8 <0,2,1,6>, <0,4,1,5>
+ 2687795620U, // <1,6,0,5>: Cost 3 vsldoi8 <0,5,1,6>, <0,5,1,6>
+ 2688459253U, // <1,6,0,6>: Cost 3 vsldoi8 <0,6,1,6>, <0,6,1,6>
+ 2283769142U, // <1,6,0,7>: Cost 3 vmrglw <0,3,1,0>, RHS
+ 2685805213U, // <1,6,0,u>: Cost 3 vsldoi8 <0,2,1,6>, LHS
+ 3698073702U, // <1,6,1,0>: Cost 4 vsldoi4 <1,1,6,1>, LHS
+ 3759547188U, // <1,6,1,1>: Cost 4 vsldoi8 <0,2,1,6>, <1,1,1,1>
+ 2221314554U, // <1,6,1,2>: Cost 3 vmrghw <1,1,1,1>, <6,2,7,3>
+ 3759547401U, // <1,6,1,3>: Cost 4 vsldoi8 <0,2,1,6>, <1,3,6,7>
+ 3698076982U, // <1,6,1,4>: Cost 4 vsldoi4 <1,1,6,1>, RHS
+ 3767510141U, // <1,6,1,5>: Cost 4 vsldoi8 <1,5,1,6>, <1,5,1,6>
+ 2334872376U, // <1,6,1,6>: Cost 3 vmrglw <u,u,1,1>, <6,6,6,6>
+ 1213353270U, // <1,6,1,7>: Cost 2 vmrglw <0,u,1,1>, RHS
+ 1213353271U, // <1,6,1,u>: Cost 2 vmrglw <0,u,1,1>, RHS
+ 3704053862U, // <1,6,2,0>: Cost 4 vsldoi4 <2,1,6,2>, LHS
+ 3759547961U, // <1,6,2,1>: Cost 4 vsldoi8 <0,2,1,6>, <2,1,6,0>
+ 2222117370U, // <1,6,2,2>: Cost 3 vmrghw <1,2,3,0>, <6,2,7,3>
+ 3759548070U, // <1,6,2,3>: Cost 4 vsldoi8 <0,2,1,6>, <2,3,0,1>
+ 3704057142U, // <1,6,2,4>: Cost 4 vsldoi4 <2,1,6,2>, RHS
+ 3373451057U, // <1,6,2,5>: Cost 4 vmrglw <3,0,1,2>, <2,4,6,5>
+ 2685806522U, // <1,6,2,6>: Cost 3 vsldoi8 <0,2,1,6>, <2,6,3,7>
+ 1225968950U, // <1,6,2,7>: Cost 2 vmrglw <3,0,1,2>, RHS
+ 1225968951U, // <1,6,2,u>: Cost 2 vmrglw <3,0,1,2>, RHS
+ 3759548566U, // <1,6,3,0>: Cost 4 vsldoi8 <0,2,1,6>, <3,0,1,2>
+ 3842912793U, // <1,6,3,1>: Cost 4 vsldoi12 <2,u,6,1>, <6,3,1,7>
+ 3759548774U, // <1,6,3,2>: Cost 4 vsldoi8 <0,2,1,6>, <3,2,6,3>
+ 3759548828U, // <1,6,3,3>: Cost 4 vsldoi8 <0,2,1,6>, <3,3,3,3>
+ 3759548930U, // <1,6,3,4>: Cost 4 vsldoi8 <0,2,1,6>, <3,4,5,6>
+ 3809315421U, // <1,6,3,5>: Cost 4 vsldoi8 <u,5,1,6>, <3,5,6,7>
+ 3386733368U, // <1,6,3,6>: Cost 4 vmrglw <5,2,1,3>, <6,6,6,6>
+ 2283130166U, // <1,6,3,7>: Cost 3 vmrglw <0,2,1,3>, RHS
+ 2283130167U, // <1,6,3,u>: Cost 3 vmrglw <0,2,1,3>, RHS
+ 3704070246U, // <1,6,4,0>: Cost 4 vsldoi4 <2,1,6,4>, LHS
+ 3862229608U, // <1,6,4,1>: Cost 4 vsldoi12 <6,1,7,1>, <6,4,1,5>
+ 3704071741U, // <1,6,4,2>: Cost 4 vsldoi4 <2,1,6,4>, <2,1,6,4>
+ 3721988610U, // <1,6,4,3>: Cost 4 vsldoi4 <5,1,6,4>, <3,4,5,6>
+ 3704073526U, // <1,6,4,4>: Cost 4 vsldoi4 <2,1,6,4>, RHS
+ 2685807926U, // <1,6,4,5>: Cost 3 vsldoi8 <0,2,1,6>, RHS
+ 3865621141U, // <1,6,4,6>: Cost 4 vsldoi12 <6,6,u,1>, <6,4,6,5>
+ 2283801910U, // <1,6,4,7>: Cost 3 vmrglw <0,3,1,4>, RHS
+ 2685808169U, // <1,6,4,u>: Cost 3 vsldoi8 <0,2,1,6>, RHS
+ 3710050406U, // <1,6,5,0>: Cost 4 vsldoi4 <3,1,6,5>, LHS
+ 3710051571U, // <1,6,5,1>: Cost 4 vsldoi4 <3,1,6,5>, <1,6,5,7>
+ 3405989597U, // <1,6,5,2>: Cost 4 vmrglw <u,4,1,5>, <2,3,6,2>
+ 3358214502U, // <1,6,5,3>: Cost 4 vmrglw <0,4,1,5>, <3,2,6,3>
+ 3710053686U, // <1,6,5,4>: Cost 4 vsldoi4 <3,1,6,5>, RHS
+ 3721998025U, // <1,6,5,5>: Cost 4 vsldoi4 <5,1,6,5>, <5,1,6,5>
+ 2332250936U, // <1,6,5,6>: Cost 3 vmrglw <u,4,1,5>, <6,6,6,6>
+ 1210731830U, // <1,6,5,7>: Cost 2 vmrglw <0,4,1,5>, RHS
+ 1210731831U, // <1,6,5,u>: Cost 2 vmrglw <0,4,1,5>, RHS
+ 2791289597U, // <1,6,6,0>: Cost 3 vsldoi12 <6,6,0,1>, <6,6,0,1>
+ 3698115430U, // <1,6,6,1>: Cost 4 vsldoi4 <1,1,6,6>, <1,1,6,6>
+ 3698116538U, // <1,6,6,2>: Cost 4 vsldoi4 <1,1,6,6>, <2,6,3,7>
+ 3356894132U, // <1,6,6,3>: Cost 4 vmrglw <0,2,1,6>, <1,2,6,3>
+ 3698117942U, // <1,6,6,4>: Cost 4 vsldoi4 <1,1,6,6>, RHS
+ 3722006218U, // <1,6,6,5>: Cost 4 vsldoi4 <5,1,6,6>, <5,1,6,6>
+ 2781041464U, // <1,6,6,6>: Cost 3 vsldoi12 <4,u,5,1>, <6,6,6,6>
+ 2283154742U, // <1,6,6,7>: Cost 3 vmrglw <0,2,1,6>, RHS
+ 2283154743U, // <1,6,6,u>: Cost 3 vmrglw <0,2,1,6>, RHS
+ 1718211406U, // <1,6,7,0>: Cost 2 vsldoi12 <6,7,0,1>, <6,7,0,1>
+ 2792026967U, // <1,6,7,1>: Cost 3 vsldoi12 <6,7,1,1>, <6,7,1,1>
+ 2765411170U, // <1,6,7,2>: Cost 3 vsldoi12 <2,3,0,1>, <6,7,2,3>
+ 3854783336U, // <1,6,7,3>: Cost 4 vsldoi12 <4,u,5,1>, <6,7,3,0>
+ 2781041526U, // <1,6,7,4>: Cost 3 vsldoi12 <4,u,5,1>, <6,7,4,5>
+ 3365528664U, // <1,6,7,5>: Cost 4 vmrglw <1,6,1,7>, <1,4,6,5>
+ 2791953290U, // <1,6,7,6>: Cost 3 vsldoi12 <6,7,0,1>, <6,7,6,7>
+ 2291789110U, // <1,6,7,7>: Cost 3 vmrglw <1,6,1,7>, RHS
+ 1718801302U, // <1,6,7,u>: Cost 2 vsldoi12 <6,7,u,1>, <6,7,u,1>
+ 1718875039U, // <1,6,u,0>: Cost 2 vsldoi12 <6,u,0,1>, <6,u,0,1>
+ 2685810478U, // <1,6,u,1>: Cost 3 vsldoi8 <0,2,1,6>, LHS
+ 2792764337U, // <1,6,u,2>: Cost 3 vsldoi12 <6,u,2,1>, <6,u,2,1>
+ 3759552444U, // <1,6,u,3>: Cost 4 vsldoi8 <0,2,1,6>, <u,3,0,1>
+ 2781041607U, // <1,6,u,4>: Cost 3 vsldoi12 <4,u,5,1>, <6,u,4,5>
+ 2685810842U, // <1,6,u,5>: Cost 3 vsldoi8 <0,2,1,6>, RHS
+ 2689792208U, // <1,6,u,6>: Cost 3 vsldoi8 <0,u,1,6>, <u,6,3,7>
+ 1210756406U, // <1,6,u,7>: Cost 2 vmrglw <0,4,1,u>, RHS
+ 1210756407U, // <1,6,u,u>: Cost 2 vmrglw <0,4,1,u>, RHS
+ 2793280496U, // <1,7,0,0>: Cost 3 vsldoi12 <7,0,0,1>, <7,0,0,1>
+ 2694439014U, // <1,7,0,1>: Cost 3 vsldoi8 <1,6,1,7>, LHS
+ 3393343912U, // <1,7,0,2>: Cost 4 vmrglw <6,3,1,0>, <6,1,7,2>
+ 3397325306U, // <1,7,0,3>: Cost 4 vmrglw <7,0,1,0>, <6,2,7,3>
+ 2793575444U, // <1,7,0,4>: Cost 3 vsldoi12 <7,0,4,1>, <7,0,4,1>
+ 3722030797U, // <1,7,0,5>: Cost 4 vsldoi4 <5,1,7,0>, <5,1,7,0>
+ 2688467446U, // <1,7,0,6>: Cost 3 vsldoi8 <0,6,1,7>, <0,6,1,7>
+ 2689131079U, // <1,7,0,7>: Cost 3 vsldoi8 <0,7,1,7>, <0,7,1,7>
+ 2694439570U, // <1,7,0,u>: Cost 3 vsldoi8 <1,6,1,7>, <0,u,1,1>
+ 2654265354U, // <1,7,1,0>: Cost 3 vsldoi4 <6,1,7,1>, <0,0,1,1>
+ 2794017866U, // <1,7,1,1>: Cost 3 vsldoi12 <7,1,1,1>, <7,1,1,1>
+ 3768181639U, // <1,7,1,2>: Cost 4 vsldoi8 <1,6,1,7>, <1,2,1,3>
+ 2334872058U, // <1,7,1,3>: Cost 3 vmrglw <u,u,1,1>, <6,2,7,3>
+ 2654268726U, // <1,7,1,4>: Cost 3 vsldoi4 <6,1,7,1>, RHS
+ 3792069797U, // <1,7,1,5>: Cost 4 vsldoi8 <5,6,1,7>, <1,5,6,1>
+ 2694440143U, // <1,7,1,6>: Cost 3 vsldoi8 <1,6,1,7>, <1,6,1,7>
+ 2334872386U, // <1,7,1,7>: Cost 3 vmrglw <u,u,1,1>, <6,6,7,7>
+ 2695767409U, // <1,7,1,u>: Cost 3 vsldoi8 <1,u,1,7>, <1,u,1,7>
+ 2654273638U, // <1,7,2,0>: Cost 3 vsldoi4 <6,1,7,2>, LHS
+ 2222117973U, // <1,7,2,1>: Cost 3 vmrghw <1,2,3,0>, <7,1,2,3>
+ 2299711912U, // <1,7,2,2>: Cost 3 vmrglw <3,0,1,2>, <6,1,7,2>
+ 2654275734U, // <1,7,2,3>: Cost 3 vsldoi4 <6,1,7,2>, <3,0,1,2>
+ 2654276918U, // <1,7,2,4>: Cost 3 vsldoi4 <6,1,7,2>, RHS
+ 3385397675U, // <1,7,2,5>: Cost 4 vmrglw <5,0,1,2>, <6,1,7,5>
+ 2654278056U, // <1,7,2,6>: Cost 3 vsldoi4 <6,1,7,2>, <6,1,7,2>
+ 2323599627U, // <1,7,2,7>: Cost 3 vmrglw <7,0,1,2>, <5,u,7,7>
+ 2654279470U, // <1,7,2,u>: Cost 3 vsldoi4 <6,1,7,2>, LHS
+ 2795271395U, // <1,7,3,0>: Cost 3 vsldoi12 <7,3,0,1>, <7,3,0,1>
+ 3768183059U, // <1,7,3,1>: Cost 4 vsldoi8 <1,6,1,7>, <3,1,6,1>
+ 3728025254U, // <1,7,3,2>: Cost 4 vsldoi4 <6,1,7,3>, <2,3,0,1>
+ 3768183196U, // <1,7,3,3>: Cost 4 vsldoi8 <1,6,1,7>, <3,3,3,3>
+ 3768183298U, // <1,7,3,4>: Cost 4 vsldoi8 <1,6,1,7>, <3,4,5,6>
+ 3792071255U, // <1,7,3,5>: Cost 4 vsldoi8 <5,6,1,7>, <3,5,6,1>
+ 3780127361U, // <1,7,3,6>: Cost 4 vsldoi8 <3,6,1,7>, <3,6,1,7>
+ 3847779617U, // <1,7,3,7>: Cost 4 vsldoi12 <3,7,0,1>, <7,3,7,0>
+ 2795861291U, // <1,7,3,u>: Cost 3 vsldoi12 <7,3,u,1>, <7,3,u,1>
+ 2795935028U, // <1,7,4,0>: Cost 3 vsldoi12 <7,4,0,1>, <7,4,0,1>
+ 3728032975U, // <1,7,4,1>: Cost 4 vsldoi4 <6,1,7,4>, <1,6,1,7>
+ 3839153480U, // <1,7,4,2>: Cost 4 vsldoi12 <2,3,0,1>, <7,4,2,3>
+ 3397358074U, // <1,7,4,3>: Cost 4 vmrglw <7,0,1,4>, <6,2,7,3>
+ 3854783835U, // <1,7,4,4>: Cost 4 vsldoi12 <4,u,5,1>, <7,4,4,4>
+ 2694442294U, // <1,7,4,5>: Cost 3 vsldoi8 <1,6,1,7>, RHS
+ 3786100058U, // <1,7,4,6>: Cost 4 vsldoi8 <4,6,1,7>, <4,6,1,7>
+ 3722065254U, // <1,7,4,7>: Cost 4 vsldoi4 <5,1,7,4>, <7,4,5,6>
+ 2694442537U, // <1,7,4,u>: Cost 3 vsldoi8 <1,6,1,7>, RHS
+ 2654298214U, // <1,7,5,0>: Cost 3 vsldoi4 <6,1,7,5>, LHS
+ 3854783893U, // <1,7,5,1>: Cost 4 vsldoi12 <4,u,5,1>, <7,5,1,u>
+ 3710126010U, // <1,7,5,2>: Cost 4 vsldoi4 <3,1,7,5>, <2,6,3,7>
+ 2332250618U, // <1,7,5,3>: Cost 3 vmrglw <u,4,1,5>, <6,2,7,3>
+ 2654301494U, // <1,7,5,4>: Cost 3 vsldoi4 <6,1,7,5>, RHS
+ 2284474795U, // <1,7,5,5>: Cost 3 vmrglw <0,4,1,5>, <6,1,7,5>
+ 2718330931U, // <1,7,5,6>: Cost 3 vsldoi8 <5,6,1,7>, <5,6,1,7>
+ 2332250946U, // <1,7,5,7>: Cost 3 vmrglw <u,4,1,5>, <6,6,7,7>
+ 2719658197U, // <1,7,5,u>: Cost 3 vsldoi8 <5,u,1,7>, <5,u,1,7>
+ 2332921954U, // <1,7,6,0>: Cost 3 vmrglw <u,5,1,6>, <5,6,7,0>
+ 3768185254U, // <1,7,6,1>: Cost 4 vsldoi8 <1,6,1,7>, <6,1,7,0>
+ 3710134202U, // <1,7,6,2>: Cost 4 vsldoi4 <3,1,7,6>, <2,6,3,7>
+ 3710134561U, // <1,7,6,3>: Cost 4 vsldoi4 <3,1,7,6>, <3,1,7,6>
+ 3710135606U, // <1,7,6,4>: Cost 4 vsldoi4 <3,1,7,6>, RHS
+ 3864884745U, // <1,7,6,5>: Cost 4 vsldoi12 <6,5,7,1>, <7,6,5,7>
+ 3854784017U, // <1,7,6,6>: Cost 4 vsldoi12 <4,u,5,1>, <7,6,6,6>
+ 2791953940U, // <1,7,6,7>: Cost 3 vsldoi12 <6,7,0,1>, <7,6,7,0>
+ 2792617501U, // <1,7,6,u>: Cost 3 vsldoi12 <6,u,0,1>, <7,6,u,0>
+ 2797925927U, // <1,7,7,0>: Cost 3 vsldoi12 <7,7,0,1>, <7,7,0,1>
+ 3365528426U, // <1,7,7,1>: Cost 4 vmrglw <1,6,1,7>, <1,1,7,1>
+ 3728058022U, // <1,7,7,2>: Cost 4 vsldoi4 <6,1,7,7>, <2,3,0,1>
+ 3365528509U, // <1,7,7,3>: Cost 4 vmrglw <1,6,1,7>, <1,2,7,3>
+ 3854784079U, // <1,7,7,4>: Cost 4 vsldoi12 <4,u,5,1>, <7,7,4,5>
+ 3722088148U, // <1,7,7,5>: Cost 4 vsldoi4 <5,1,7,7>, <5,1,7,7>
+ 3728060845U, // <1,7,7,6>: Cost 4 vsldoi4 <6,1,7,7>, <6,1,7,7>
+ 2781042284U, // <1,7,7,7>: Cost 3 vsldoi12 <4,u,5,1>, <7,7,7,7>
+ 2798515823U, // <1,7,7,u>: Cost 3 vsldoi12 <7,7,u,1>, <7,7,u,1>
+ 2654322705U, // <1,7,u,0>: Cost 3 vsldoi4 <6,1,7,u>, <0,0,1,u>
+ 2694444846U, // <1,7,u,1>: Cost 3 vsldoi8 <1,6,1,7>, LHS
+ 2299711912U, // <1,7,u,2>: Cost 3 vmrglw <3,0,1,2>, <6,1,7,2>
+ 2323649018U, // <1,7,u,3>: Cost 3 vmrglw <7,0,1,u>, <6,2,7,3>
+ 2654326070U, // <1,7,u,4>: Cost 3 vsldoi4 <6,1,7,u>, RHS
+ 2694445210U, // <1,7,u,5>: Cost 3 vsldoi8 <1,6,1,7>, RHS
+ 2654327214U, // <1,7,u,6>: Cost 3 vsldoi4 <6,1,7,u>, <6,1,7,u>
+ 2323649346U, // <1,7,u,7>: Cost 3 vmrglw <7,0,1,u>, <6,6,7,7>
+ 2694445413U, // <1,7,u,u>: Cost 3 vsldoi8 <1,6,1,7>, LHS
+ 1610752017U, // <1,u,0,0>: Cost 2 vsldoi8 <0,0,1,u>, <0,0,1,u>
+ 1613406310U, // <1,u,0,1>: Cost 2 vsldoi8 <0,4,1,u>, LHS
+ 2685821107U, // <1,u,0,2>: Cost 3 vsldoi8 <0,2,1,u>, <0,2,1,u>
+ 2283765916U, // <1,u,0,3>: Cost 3 vmrglw <0,3,1,0>, LHS
+ 1613406549U, // <1,u,0,4>: Cost 2 vsldoi8 <0,4,1,u>, <0,4,1,u>
+ 1725880054U, // <1,u,0,5>: Cost 2 vsldoi12 <u,0,5,1>, <u,0,5,1>
+ 2688475639U, // <1,u,0,6>: Cost 3 vsldoi8 <0,6,1,u>, <0,6,1,u>
+ 2283769160U, // <1,u,0,7>: Cost 3 vmrglw <0,3,1,0>, RHS
+ 1613406877U, // <1,u,0,u>: Cost 2 vsldoi8 <0,4,1,u>, LHS
+ 1550221414U, // <1,u,1,0>: Cost 2 vsldoi4 <1,1,1,1>, LHS
+ 269271142U, // <1,u,1,1>: Cost 1 vspltisw1 LHS
+ 1683117870U, // <1,u,1,2>: Cost 2 vsldoi12 <0,u,1,1>, LHS
+ 1213350044U, // <1,u,1,3>: Cost 2 vmrglw <0,u,1,1>, LHS
+ 1550224694U, // <1,u,1,4>: Cost 2 vsldoi4 <1,1,1,1>, RHS
+ 1147574426U, // <1,u,1,5>: Cost 2 vmrghw <1,1,1,1>, RHS
+ 2687149326U, // <1,u,1,6>: Cost 3 vsldoi8 <0,4,1,u>, <1,6,u,7>
+ 1213353288U, // <1,u,1,7>: Cost 2 vmrglw <0,u,1,1>, RHS
+ 269271142U, // <1,u,1,u>: Cost 1 vspltisw1 LHS
+ 2222118611U, // <1,u,2,0>: Cost 3 vmrghw <1,2,3,0>, <u,0,1,2>
+ 1148376878U, // <1,u,2,1>: Cost 2 vmrghw <1,2,3,0>, LHS
+ 1148371862U, // <1,u,2,2>: Cost 2 vmrghw <1,2,3,0>, <1,2,3,0>
+ 1225965724U, // <1,u,2,3>: Cost 2 vmrglw <3,0,1,2>, LHS
+ 2222118975U, // <1,u,2,4>: Cost 3 vmrghw <1,2,3,0>, <u,4,5,6>
+ 1148377242U, // <1,u,2,5>: Cost 2 vmrghw <1,2,3,0>, RHS
+ 2687150010U, // <1,u,2,6>: Cost 3 vsldoi8 <0,4,1,u>, <2,6,3,7>
+ 1225968968U, // <1,u,2,7>: Cost 2 vmrglw <3,0,1,2>, RHS
+ 1148377445U, // <1,u,2,u>: Cost 2 vmrghw <1,2,3,0>, LHS
+ 471040156U, // <1,u,3,0>: Cost 1 vsldoi4 LHS, LHS
+ 1544782644U, // <1,u,3,1>: Cost 2 vsldoi4 LHS, <1,1,1,1>
+ 1544783464U, // <1,u,3,2>: Cost 2 vsldoi4 LHS, <2,2,2,2>
+ 1544784022U, // <1,u,3,3>: Cost 2 vsldoi4 LHS, <3,0,1,2>
+ 471043382U, // <1,u,3,4>: Cost 1 vsldoi4 LHS, RHS
+ 1592561668U, // <1,u,3,5>: Cost 2 vsldoi4 LHS, <5,5,5,5>
+ 1592562170U, // <1,u,3,6>: Cost 2 vsldoi4 LHS, <6,2,7,3>
+ 1592562682U, // <1,u,3,7>: Cost 2 vsldoi4 LHS, <7,0,1,2>
+ 471045934U, // <1,u,3,u>: Cost 1 vsldoi4 LHS, LHS
+ 2708384629U, // <1,u,4,0>: Cost 3 vsldoi8 <4,0,1,u>, <4,0,1,u>
+ 2687151101U, // <1,u,4,1>: Cost 3 vsldoi8 <0,4,1,u>, <4,1,u,0>
+ 2223408022U, // <1,u,4,2>: Cost 3 vmrghw <1,4,2,5>, <1,2,3,0>
+ 2283798684U, // <1,u,4,3>: Cost 3 vmrglw <0,3,1,4>, LHS
+ 2642422785U, // <1,u,4,4>: Cost 3 vsldoi4 <4,1,u,4>, <4,1,u,4>
+ 1613409590U, // <1,u,4,5>: Cost 2 vsldoi8 <0,4,1,u>, RHS
+ 2283801090U, // <1,u,4,6>: Cost 3 vmrglw <0,3,1,4>, <3,4,5,6>
+ 2283801928U, // <1,u,4,7>: Cost 3 vmrglw <0,3,1,4>, RHS
+ 1613409833U, // <1,u,4,u>: Cost 2 vsldoi8 <0,4,1,u>, RHS
+ 2284471235U, // <1,u,5,0>: Cost 3 vmrglw <0,4,1,5>, <1,2,u,0>
+ 2284472046U, // <1,u,5,1>: Cost 3 vmrglw <0,4,1,5>, <2,3,u,1>
+ 2284472533U, // <1,u,5,2>: Cost 3 vmrglw <0,4,1,5>, <3,0,u,2>
+ 1210728604U, // <1,u,5,3>: Cost 2 vmrglw <0,4,1,5>, LHS
+ 2284471239U, // <1,u,5,4>: Cost 3 vmrglw <0,4,1,5>, <1,2,u,4>
+ 1210728786U, // <1,u,5,5>: Cost 2 vmrglw <0,4,1,5>, <0,4,1,5>
+ 1683118234U, // <1,u,5,6>: Cost 2 vsldoi12 <0,u,1,1>, RHS
+ 1210731848U, // <1,u,5,7>: Cost 2 vmrglw <0,4,1,5>, RHS
+ 1210728609U, // <1,u,5,u>: Cost 2 vmrglw <0,4,1,5>, LHS
+ 2720330023U, // <1,u,6,0>: Cost 3 vsldoi8 <6,0,1,u>, <6,0,1,u>
+ 2757376190U, // <1,u,6,1>: Cost 3 vsldoi12 <0,u,u,1>, <u,6,1,7>
+ 2726302202U, // <1,u,6,2>: Cost 3 vsldoi8 <7,0,1,u>, <6,2,7,3>
+ 2283151516U, // <1,u,6,3>: Cost 3 vmrglw <0,2,1,6>, LHS
+ 2224972114U, // <1,u,6,4>: Cost 3 vmrghw <1,6,5,7>, <0,4,1,5>
+ 2224683162U, // <1,u,6,5>: Cost 3 vmrghw <1,6,1,7>, RHS
+ 2726302520U, // <1,u,6,6>: Cost 3 vsldoi8 <7,0,1,u>, <6,6,6,6>
+ 2283154760U, // <1,u,6,7>: Cost 3 vmrglw <0,2,1,6>, RHS
+ 2283151521U, // <1,u,6,u>: Cost 3 vmrglw <0,2,1,6>, LHS
+ 1652560896U, // <1,u,7,0>: Cost 2 vsldoi8 <7,0,1,u>, <7,0,1,u>
+ 2333590225U, // <1,u,7,1>: Cost 3 vmrglw <u,6,1,7>, <0,u,u,1>
+ 2765412628U, // <1,u,7,2>: Cost 3 vsldoi12 <2,3,0,1>, <u,7,2,3>
+ 2291785884U, // <1,u,7,3>: Cost 3 vmrglw <1,6,1,7>, LHS
+ 2781042984U, // <1,u,7,4>: Cost 3 vsldoi12 <4,u,5,1>, <u,7,4,5>
+ 3365527953U, // <1,u,7,5>: Cost 4 vmrglw <1,6,1,7>, <0,4,u,5>
+ 2791954748U, // <1,u,7,6>: Cost 3 vsldoi12 <6,7,0,1>, <u,7,6,7>
+ 2291789128U, // <1,u,7,7>: Cost 3 vmrglw <1,6,1,7>, RHS
+ 1657869960U, // <1,u,7,u>: Cost 2 vsldoi8 <7,u,1,u>, <7,u,1,u>
+ 471081121U, // <1,u,u,0>: Cost 1 vsldoi4 LHS, LHS
+ 269271142U, // <1,u,u,1>: Cost 1 vspltisw1 LHS
+ 1544824424U, // <1,u,u,2>: Cost 2 vsldoi4 LHS, <2,2,2,2>
+ 1544824982U, // <1,u,u,3>: Cost 2 vsldoi4 LHS, <3,0,1,2>
+ 471084342U, // <1,u,u,4>: Cost 1 vsldoi4 LHS, RHS
+ 1613412506U, // <1,u,u,5>: Cost 2 vsldoi8 <0,4,1,u>, RHS
+ 1683118477U, // <1,u,u,6>: Cost 2 vsldoi12 <0,u,1,1>, RHS
+ 1210756424U, // <1,u,u,7>: Cost 2 vmrglw <0,4,1,u>, RHS
+ 471086894U, // <1,u,u,u>: Cost 1 vsldoi4 LHS, LHS
+ 2226757632U, // <2,0,0,0>: Cost 3 vmrghw <2,0,3,0>, <0,0,0,0>
+ 2226757734U, // <2,0,0,1>: Cost 3 vmrghw <2,0,3,0>, LHS
+ 3826622483U, // <2,0,0,2>: Cost 4 vsldoi12 <0,2,1,2>, <0,0,2,1>
+ 3843211292U, // <2,0,0,3>: Cost 4 vsldoi12 <3,0,1,2>, <0,0,3,1>
+ 3300499794U, // <2,0,0,4>: Cost 4 vmrghw <2,0,3,0>, <0,4,1,5>
+ 3356256724U, // <2,0,0,5>: Cost 4 vmrglw <0,1,2,0>, <3,4,0,5>
+ 3825664056U, // <2,0,0,6>: Cost 4 vsldoi12 <0,0,6,2>, <0,0,6,2>
+ 3762889289U, // <2,0,0,7>: Cost 4 vsldoi8 <0,7,2,0>, <0,7,2,0>
+ 2226758301U, // <2,0,0,u>: Cost 3 vmrghw <2,0,3,0>, LHS
+ 2227429386U, // <2,0,1,0>: Cost 3 vmrghw <2,1,3,1>, <0,0,1,1>
+ 2227429478U, // <2,0,1,1>: Cost 3 vmrghw <2,1,3,1>, LHS
+ 1691156582U, // <2,0,1,2>: Cost 2 vsldoi12 <2,2,2,2>, LHS
+ 2666358997U, // <2,0,1,3>: Cost 3 vsldoi4 <u,2,0,1>, <3,0,u,2>
+ 2227462482U, // <2,0,1,4>: Cost 3 vmrghw <2,1,3,5>, <0,4,1,5>
+ 3722186464U, // <2,0,1,5>: Cost 4 vsldoi4 <5,2,0,1>, <5,2,0,1>
+ 3867099278U, // <2,0,1,6>: Cost 4 vsldoi12 <7,0,1,2>, <0,1,6,7>
+ 3366881912U, // <2,0,1,7>: Cost 4 vmrglw <1,u,2,1>, <3,6,0,7>
+ 1691156636U, // <2,0,1,u>: Cost 2 vsldoi12 <2,2,2,2>, LHS
+ 2228027392U, // <2,0,2,0>: Cost 3 vmrghw <2,2,2,2>, <0,0,0,0>
+ 1154285670U, // <2,0,2,1>: Cost 2 vmrghw <2,2,2,2>, LHS
+ 2228027565U, // <2,0,2,2>: Cost 3 vmrghw <2,2,2,2>, <0,2,1,2>
+ 3301769468U, // <2,0,2,3>: Cost 4 vmrghw <2,2,2,2>, <0,3,1,0>
+ 2228027730U, // <2,0,2,4>: Cost 3 vmrghw <2,2,2,2>, <0,4,1,5>
+ 3301769635U, // <2,0,2,5>: Cost 4 vmrghw <2,2,2,2>, <0,5,1,5>
+ 3780806586U, // <2,0,2,6>: Cost 4 vsldoi8 <3,7,2,0>, <2,6,3,7>
+ 3368880760U, // <2,0,2,7>: Cost 4 vmrglw <2,2,2,2>, <3,6,0,7>
+ 1154286237U, // <2,0,2,u>: Cost 2 vmrghw <2,2,2,2>, LHS
+ 1213440000U, // <2,0,3,0>: Cost 2 vmrglw LHS, <0,0,0,0>
+ 1213441702U, // <2,0,3,1>: Cost 2 vmrglw LHS, <2,3,0,1>
+ 2228535470U, // <2,0,3,2>: Cost 3 vmrghw <2,3,0,1>, <0,2,1,3>
+ 2636515632U, // <2,0,3,3>: Cost 3 vsldoi4 <3,2,0,3>, <3,2,0,3>
+ 2287182962U, // <2,0,3,4>: Cost 3 vmrglw LHS, <1,5,0,4>
+ 2660405346U, // <2,0,3,5>: Cost 3 vsldoi4 <7,2,0,3>, <5,6,7,0>
+ 2228535798U, // <2,0,3,6>: Cost 3 vmrghw <2,3,0,1>, <0,6,1,7>
+ 2660406420U, // <2,0,3,7>: Cost 3 vsldoi4 <7,2,0,3>, <7,2,0,3>
+ 1213441709U, // <2,0,3,u>: Cost 2 vmrglw LHS, <2,3,0,u>
+ 3368894464U, // <2,0,4,0>: Cost 4 vmrglw <2,2,2,4>, <0,0,0,0>
+ 2764898642U, // <2,0,4,1>: Cost 3 vsldoi12 <2,2,2,2>, <0,4,1,5>
+ 3826622811U, // <2,0,4,2>: Cost 4 vsldoi12 <0,2,1,2>, <0,4,2,5>
+ 3843211620U, // <2,0,4,3>: Cost 4 vsldoi12 <3,0,1,2>, <0,4,3,5>
+ 3838640493U, // <2,0,4,4>: Cost 4 vsldoi12 <2,2,2,2>, <0,4,4,5>
+ 2732944694U, // <2,0,4,5>: Cost 3 vsldoi8 <u,1,2,0>, RHS
+ 3797396857U, // <2,0,4,6>: Cost 4 vsldoi8 <6,5,2,0>, <4,6,5,2>
+ 3867099528U, // <2,0,4,7>: Cost 4 vsldoi12 <7,0,1,2>, <0,4,7,5>
+ 2764898705U, // <2,0,4,u>: Cost 3 vsldoi12 <2,2,2,2>, <0,4,u,5>
+ 3364257792U, // <2,0,5,0>: Cost 4 vmrglw <1,4,2,5>, <0,0,0,0>
+ 2230124646U, // <2,0,5,1>: Cost 3 vmrghw <2,5,3,6>, LHS
+ 3304235184U, // <2,0,5,2>: Cost 4 vmrghw <2,5,u,6>, <0,2,1,5>
+ 3364260144U, // <2,0,5,3>: Cost 4 vmrglw <1,4,2,5>, <3,2,0,3>
+ 3303817554U, // <2,0,5,4>: Cost 4 vmrghw <2,5,3,0>, <0,4,1,5>
+ 3364260146U, // <2,0,5,5>: Cost 4 vmrglw <1,4,2,5>, <3,2,0,5>
+ 3867099602U, // <2,0,5,6>: Cost 4 vsldoi12 <7,0,1,2>, <0,5,6,7>
+ 3364260472U, // <2,0,5,7>: Cost 4 vmrglw <1,4,2,5>, <3,6,0,7>
+ 2230125213U, // <2,0,5,u>: Cost 3 vmrghw <2,5,3,6>, LHS
+ 2230796288U, // <2,0,6,0>: Cost 3 vmrghw <2,6,3,7>, <0,0,0,0>
+ 1157054566U, // <2,0,6,1>: Cost 2 vmrghw <2,6,3,7>, LHS
+ 2230796465U, // <2,0,6,2>: Cost 3 vmrghw <2,6,3,7>, <0,2,1,6>
+ 3304538364U, // <2,0,6,3>: Cost 4 vmrghw <2,6,3,7>, <0,3,1,0>
+ 2230796626U, // <2,0,6,4>: Cost 3 vmrghw <2,6,3,7>, <0,4,1,5>
+ 3797398205U, // <2,0,6,5>: Cost 4 vsldoi8 <6,5,2,0>, <6,5,2,0>
+ 3304538614U, // <2,0,6,6>: Cost 4 vmrghw <2,6,3,7>, <0,6,1,7>
+ 3798725471U, // <2,0,6,7>: Cost 4 vsldoi8 <6,7,2,0>, <6,7,2,0>
+ 1157055133U, // <2,0,6,u>: Cost 2 vmrghw <2,6,3,7>, LHS
+ 3371573248U, // <2,0,7,0>: Cost 4 vmrglw <2,6,2,7>, <0,0,0,0>
+ 2231189606U, // <2,0,7,1>: Cost 3 vmrghw <2,7,0,1>, LHS
+ 3801380003U, // <2,0,7,2>: Cost 4 vsldoi8 <7,2,2,0>, <7,2,2,0>
+ 3802043636U, // <2,0,7,3>: Cost 4 vsldoi8 <7,3,2,0>, <7,3,2,0>
+ 3806688614U, // <2,0,7,4>: Cost 4 vsldoi8 <u,1,2,0>, <7,4,5,6>
+ 3356317308U, // <2,0,7,5>: Cost 4 vmrglw <0,1,2,7>, <7,u,0,5>
+ 3804034535U, // <2,0,7,6>: Cost 4 vsldoi8 <7,6,2,0>, <7,6,2,0>
+ 3806688876U, // <2,0,7,7>: Cost 4 vsldoi8 <u,1,2,0>, <7,7,7,7>
+ 2231190173U, // <2,0,7,u>: Cost 3 vmrghw <2,7,0,1>, LHS
+ 1208836096U, // <2,0,u,0>: Cost 2 vmrglw LHS, <0,0,0,0>
+ 1208837798U, // <2,0,u,1>: Cost 2 vmrglw LHS, <2,3,0,1>
+ 1691157149U, // <2,0,u,2>: Cost 2 vsldoi12 <2,2,2,2>, LHS
+ 2636556597U, // <2,0,u,3>: Cost 3 vsldoi4 <3,2,0,u>, <3,2,0,u>
+ 2282579625U, // <2,0,u,4>: Cost 3 vmrglw LHS, <2,3,0,4>
+ 2660446306U, // <2,0,u,5>: Cost 3 vsldoi4 <7,2,0,u>, <5,6,7,0>
+ 2228535798U, // <2,0,u,6>: Cost 3 vmrghw <2,3,0,1>, <0,6,1,7>
+ 2660447385U, // <2,0,u,7>: Cost 3 vsldoi4 <7,2,0,u>, <7,2,0,u>
+ 1208837805U, // <2,0,u,u>: Cost 2 vmrglw LHS, <2,3,0,u>
+ 3692388523U, // <2,1,0,0>: Cost 4 vsldoi4 <0,2,1,0>, <0,2,1,0>
+ 2757526244U, // <2,1,0,1>: Cost 3 vsldoi12 <1,0,1,2>, <1,0,1,2>
+ 2330290974U, // <2,1,0,2>: Cost 3 vmrglw <u,1,2,0>, <3,u,1,2>
+ 3843212020U, // <2,1,0,3>: Cost 4 vsldoi12 <3,0,1,2>, <1,0,3,0>
+ 3692391734U, // <2,1,0,4>: Cost 4 vsldoi4 <0,2,1,0>, RHS
+ 3300533362U, // <2,1,0,5>: Cost 4 vmrghw <2,0,3,4>, <1,5,0,4>
+ 3794084337U, // <2,1,0,6>: Cost 4 vsldoi8 <6,0,2,1>, <0,6,1,2>
+ 3374170614U, // <2,1,0,7>: Cost 5 vmrglw <3,1,2,0>, <0,6,1,7>
+ 2758042403U, // <2,1,0,u>: Cost 3 vsldoi12 <1,0,u,2>, <1,0,u,2>
+ 2690482924U, // <2,1,1,0>: Cost 3 vsldoi8 <1,0,2,1>, <1,0,2,1>
+ 2764899124U, // <2,1,1,1>: Cost 3 vsldoi12 <2,2,2,2>, <1,1,1,1>
+ 2695791510U, // <2,1,1,2>: Cost 3 vsldoi8 <1,u,2,1>, <1,2,3,0>
+ 3362235271U, // <2,1,1,3>: Cost 4 vmrglw <1,1,2,1>, <1,2,1,3>
+ 3692399926U, // <2,1,1,4>: Cost 4 vsldoi4 <0,2,1,1>, RHS
+ 3832226649U, // <2,1,1,5>: Cost 4 vsldoi12 <1,1,5,2>, <1,1,5,2>
+ 3301205235U, // <2,1,1,6>: Cost 4 vmrghw <2,1,3,5>, <1,6,5,7>
+ 3768870179U, // <2,1,1,7>: Cost 4 vsldoi8 <1,7,2,1>, <1,7,2,1>
+ 2695791988U, // <2,1,1,u>: Cost 3 vsldoi8 <1,u,2,1>, <1,u,2,1>
+ 2618663085U, // <2,1,2,0>: Cost 3 vsldoi4 <0,2,1,2>, <0,2,1,2>
+ 2228028212U, // <2,1,2,1>: Cost 3 vmrghw <2,2,2,2>, <1,1,1,1>
+ 2618664552U, // <2,1,2,2>: Cost 3 vsldoi4 <0,2,1,2>, <2,2,2,2>
+ 2759000984U, // <2,1,2,3>: Cost 3 vsldoi12 <1,2,3,2>, <1,2,3,2>
+ 2618666294U, // <2,1,2,4>: Cost 3 vsldoi4 <0,2,1,2>, RHS
+ 2295136594U, // <2,1,2,5>: Cost 3 vmrglw <2,2,2,2>, <0,4,1,5>
+ 3769534376U, // <2,1,2,6>: Cost 4 vsldoi8 <1,u,2,1>, <2,6,1,7>
+ 2793358266U, // <2,1,2,7>: Cost 3 vsldoi12 <7,0,1,2>, <1,2,7,0>
+ 2618668846U, // <2,1,2,u>: Cost 3 vsldoi4 <0,2,1,2>, LHS
+ 2282536969U, // <2,1,3,0>: Cost 3 vmrglw LHS, <0,0,1,0>
+ 1208795146U, // <2,1,3,1>: Cost 2 vmrglw LHS, <0,0,1,1>
+ 1213442198U, // <2,1,3,2>: Cost 2 vmrglw LHS, <3,0,1,2>
+ 2287181998U, // <2,1,3,3>: Cost 3 vmrglw LHS, <0,2,1,3>
+ 2618674486U, // <2,1,3,4>: Cost 3 vsldoi4 <0,2,1,3>, RHS
+ 1208795474U, // <2,1,3,5>: Cost 2 vmrglw LHS, <0,4,1,5>
+ 2287182001U, // <2,1,3,6>: Cost 3 vmrglw LHS, <0,2,1,6>
+ 2287183055U, // <2,1,3,7>: Cost 3 vmrglw LHS, <1,6,1,7>
+ 1208795153U, // <2,1,3,u>: Cost 2 vmrglw LHS, <0,0,1,u>
+ 3692421295U, // <2,1,4,0>: Cost 4 vsldoi4 <0,2,1,4>, <0,2,1,4>
+ 3838641195U, // <2,1,4,1>: Cost 4 vsldoi12 <2,2,2,2>, <1,4,1,5>
+ 2330323742U, // <2,1,4,2>: Cost 3 vmrglw <u,1,2,4>, <3,u,1,2>
+ 3692423318U, // <2,1,4,3>: Cost 5 vsldoi4 <0,2,1,4>, <3,0,1,2>
+ 3692424502U, // <2,1,4,4>: Cost 4 vsldoi4 <0,2,1,4>, RHS
+ 2695793974U, // <2,1,4,5>: Cost 3 vsldoi8 <1,u,2,1>, RHS
+ 3799395705U, // <2,1,4,6>: Cost 4 vsldoi8 <6,u,2,1>, <4,6,5,2>
+ 3368895695U, // <2,1,4,7>: Cost 5 vmrglw <2,2,2,4>, <1,6,1,7>
+ 2695794217U, // <2,1,4,u>: Cost 3 vsldoi8 <1,u,2,1>, RHS
+ 3692429488U, // <2,1,5,0>: Cost 4 vsldoi4 <0,2,1,5>, <0,2,1,5>
+ 3364257802U, // <2,1,5,1>: Cost 4 vmrglw <1,4,2,5>, <0,0,1,1>
+ 3692431253U, // <2,1,5,2>: Cost 4 vsldoi4 <0,2,1,5>, <2,5,u,6>
+ 3692431874U, // <2,1,5,3>: Cost 4 vsldoi4 <0,2,1,5>, <3,4,5,6>
+ 3692432694U, // <2,1,5,4>: Cost 4 vsldoi4 <0,2,1,5>, RHS
+ 3364258130U, // <2,1,5,5>: Cost 4 vmrglw <1,4,2,5>, <0,4,1,5>
+ 3303875827U, // <2,1,5,6>: Cost 4 vmrghw <2,5,3,7>, <1,6,5,7>
+ 3867100333U, // <2,1,5,7>: Cost 4 vsldoi12 <7,0,1,2>, <1,5,7,0>
+ 3692435246U, // <2,1,5,u>: Cost 4 vsldoi4 <0,2,1,5>, LHS
+ 2618695857U, // <2,1,6,0>: Cost 3 vsldoi4 <0,2,1,6>, <0,2,1,6>
+ 2230797108U, // <2,1,6,1>: Cost 3 vmrghw <2,6,3,7>, <1,1,1,1>
+ 2618697658U, // <2,1,6,2>: Cost 3 vsldoi4 <0,2,1,6>, <2,6,3,7>
+ 3692439702U, // <2,1,6,3>: Cost 4 vsldoi4 <0,2,1,6>, <3,0,1,2>
+ 2618699062U, // <2,1,6,4>: Cost 3 vsldoi4 <0,2,1,6>, RHS
+ 3364929874U, // <2,1,6,5>: Cost 4 vmrglw <1,5,2,6>, <0,4,1,5>
+ 3692442424U, // <2,1,6,6>: Cost 4 vsldoi4 <0,2,1,6>, <6,6,6,6>
+ 3798733664U, // <2,1,6,7>: Cost 4 vsldoi8 <6,7,2,1>, <6,7,2,1>
+ 2618701614U, // <2,1,6,u>: Cost 3 vsldoi4 <0,2,1,6>, LHS
+ 3799397370U, // <2,1,7,0>: Cost 4 vsldoi8 <6,u,2,1>, <7,0,1,2>
+ 3371573258U, // <2,1,7,1>: Cost 4 vmrglw <2,6,2,7>, <0,0,1,1>
+ 2330351234U, // <2,1,7,2>: Cost 3 vmrglw <u,1,2,7>, <7,u,1,2>
+ 3799397658U, // <2,1,7,3>: Cost 4 vsldoi8 <6,u,2,1>, <7,3,6,2>
+ 3799397734U, // <2,1,7,4>: Cost 4 vsldoi8 <6,u,2,1>, <7,4,5,6>
+ 3371573586U, // <2,1,7,5>: Cost 4 vmrglw <2,6,2,7>, <0,4,1,5>
+ 3799397870U, // <2,1,7,6>: Cost 4 vsldoi8 <6,u,2,1>, <7,6,2,7>
+ 3799397956U, // <2,1,7,7>: Cost 4 vsldoi8 <6,u,2,1>, <7,7,3,3>
+ 2330351234U, // <2,1,7,u>: Cost 3 vmrglw <u,1,2,7>, <7,u,1,2>
+ 2282577929U, // <2,1,u,0>: Cost 3 vmrglw LHS, <0,0,1,0>
+ 1208836106U, // <2,1,u,1>: Cost 2 vmrglw LHS, <0,0,1,1>
+ 1208838294U, // <2,1,u,2>: Cost 2 vmrglw LHS, <3,0,1,2>
+ 2282578094U, // <2,1,u,3>: Cost 3 vmrglw LHS, <0,2,1,3>
+ 2282577933U, // <2,1,u,4>: Cost 3 vmrglw LHS, <0,0,1,4>
+ 1208836434U, // <2,1,u,5>: Cost 2 vmrglw LHS, <0,4,1,5>
+ 2282578097U, // <2,1,u,6>: Cost 3 vmrglw LHS, <0,2,1,6>
+ 2287224015U, // <2,1,u,7>: Cost 3 vmrglw LHS, <1,6,1,7>
+ 1208836113U, // <2,1,u,u>: Cost 2 vmrglw LHS, <0,0,1,u>
+ 2226759117U, // <2,2,0,0>: Cost 3 vmrghw <2,0,3,0>, <2,0,3,0>
+ 1624047718U, // <2,2,0,1>: Cost 2 vsldoi8 <2,2,2,2>, LHS
+ 2697789613U, // <2,2,0,2>: Cost 3 vsldoi8 <2,2,2,2>, <0,2,1,2>
+ 2226767526U, // <2,2,0,3>: Cost 3 vmrghw <2,0,3,1>, <2,3,0,1>
+ 2697789778U, // <2,2,0,4>: Cost 3 vsldoi8 <2,2,2,2>, <0,4,1,5>
+ 3300657000U, // <2,2,0,5>: Cost 4 vmrghw <2,0,5,1>, <2,5,3,6>
+ 2226988986U, // <2,2,0,6>: Cost 3 vmrghw <2,0,6,1>, <2,6,3,7>
+ 3734271139U, // <2,2,0,7>: Cost 4 vsldoi4 <7,2,2,0>, <7,2,2,0>
+ 1624048285U, // <2,2,0,u>: Cost 2 vsldoi8 <2,2,2,2>, LHS
+ 3831268868U, // <2,2,1,0>: Cost 4 vsldoi12 <1,0,1,2>, <2,1,0,1>
+ 2293138804U, // <2,2,1,1>: Cost 3 vmrglw <1,u,2,1>, <1,u,2,1>
+ 2697790358U, // <2,2,1,2>: Cost 3 vsldoi8 <2,2,2,2>, <1,2,3,0>
+ 2293137510U, // <2,2,1,3>: Cost 3 vmrglw <1,u,2,1>, LHS
+ 3771532331U, // <2,2,1,4>: Cost 4 vsldoi8 <2,2,2,2>, <1,4,1,5>
+ 3767551106U, // <2,2,1,5>: Cost 4 vsldoi8 <1,5,2,2>, <1,5,2,2>
+ 3301173178U, // <2,2,1,6>: Cost 4 vmrghw <2,1,3,1>, <2,6,3,7>
+ 3372853169U, // <2,2,1,7>: Cost 4 vmrglw <2,u,2,1>, <2,6,2,7>
+ 2293137515U, // <2,2,1,u>: Cost 3 vmrglw <1,u,2,1>, LHS
+ 1556938854U, // <2,2,2,0>: Cost 2 vsldoi4 <2,2,2,2>, LHS
+ 2295137733U, // <2,2,2,1>: Cost 3 vmrglw <2,2,2,2>, <2,0,2,1>
+ 336380006U, // <2,2,2,2>: Cost 1 vspltisw2 LHS
+ 1221394534U, // <2,2,2,3>: Cost 2 vmrglw <2,2,2,2>, LHS
+ 1556942134U, // <2,2,2,4>: Cost 2 vsldoi4 <2,2,2,2>, RHS
+ 2295138061U, // <2,2,2,5>: Cost 3 vmrglw <2,2,2,2>, <2,4,2,5>
+ 2228029370U, // <2,2,2,6>: Cost 3 vmrghw <2,2,2,2>, <2,6,3,7>
+ 2660545701U, // <2,2,2,7>: Cost 3 vsldoi4 <7,2,2,2>, <7,2,2,2>
+ 336380006U, // <2,2,2,u>: Cost 1 vspltisw2 LHS
+ 2697791638U, // <2,2,3,0>: Cost 3 vsldoi8 <2,2,2,2>, <3,0,1,2>
+ 2765489840U, // <2,2,3,1>: Cost 3 vsldoi12 <2,3,1,2>, <2,3,1,2>
+ 1213441640U, // <2,2,3,2>: Cost 2 vmrglw LHS, <2,2,2,2>
+ 135053414U, // <2,2,3,3>: Cost 1 vmrglw LHS, LHS
+ 2697792002U, // <2,2,3,4>: Cost 3 vsldoi8 <2,2,2,2>, <3,4,5,6>
+ 2330313780U, // <2,2,3,5>: Cost 3 vmrglw LHS, <1,4,2,5>
+ 2287183549U, // <2,2,3,6>: Cost 3 vmrglw LHS, <2,3,2,6>
+ 2660553894U, // <2,2,3,7>: Cost 3 vsldoi4 <7,2,2,3>, <7,2,2,3>
+ 135053419U, // <2,2,3,u>: Cost 1 vmrglw LHS, LHS
+ 2630697062U, // <2,2,4,0>: Cost 3 vsldoi4 <2,2,2,4>, LHS
+ 3771534282U, // <2,2,4,1>: Cost 4 vsldoi8 <2,2,2,2>, <4,1,2,3>
+ 2764900109U, // <2,2,4,2>: Cost 3 vsldoi12 <2,2,2,2>, <2,4,2,5>
+ 2295152742U, // <2,2,4,3>: Cost 3 vmrglw <2,2,2,4>, LHS
+ 2295154282U, // <2,2,4,4>: Cost 3 vmrglw <2,2,2,4>, <2,2,2,4>
+ 1624050998U, // <2,2,4,5>: Cost 2 vsldoi8 <2,2,2,2>, RHS
+ 2229675962U, // <2,2,4,6>: Cost 3 vmrghw <2,4,6,5>, <2,6,3,7>
+ 3368896433U, // <2,2,4,7>: Cost 4 vmrglw <2,2,2,4>, <2,6,2,7>
+ 1624051241U, // <2,2,4,u>: Cost 2 vsldoi8 <2,2,2,2>, RHS
+ 3771534920U, // <2,2,5,0>: Cost 4 vsldoi8 <2,2,2,2>, <5,0,1,2>
+ 3364258540U, // <2,2,5,1>: Cost 4 vmrglw <1,4,2,5>, <1,0,2,1>
+ 2296489576U, // <2,2,5,2>: Cost 3 vmrglw <2,4,2,5>, <2,2,2,2>
+ 2290516070U, // <2,2,5,3>: Cost 3 vmrglw <1,4,2,5>, LHS
+ 3771535284U, // <2,2,5,4>: Cost 4 vsldoi8 <2,2,2,2>, <5,4,5,6>
+ 2290517044U, // <2,2,5,5>: Cost 3 vmrglw <1,4,2,5>, <1,4,2,5>
+ 2697793634U, // <2,2,5,6>: Cost 3 vsldoi8 <2,2,2,2>, <5,6,7,0>
+ 3370231729U, // <2,2,5,7>: Cost 4 vmrglw <2,4,2,5>, <2,6,2,7>
+ 2290516075U, // <2,2,5,u>: Cost 3 vmrglw <1,4,2,5>, LHS
+ 2230797801U, // <2,2,6,0>: Cost 3 vmrghw <2,6,3,7>, <2,0,6,1>
+ 3304539679U, // <2,2,6,1>: Cost 4 vmrghw <2,6,3,7>, <2,1,3,1>
+ 2764900273U, // <2,2,6,2>: Cost 3 vsldoi12 <2,2,2,2>, <2,6,2,7>
+ 2764900282U, // <2,2,6,3>: Cost 3 vsldoi12 <2,2,2,2>, <2,6,3,7>
+ 2230798129U, // <2,2,6,4>: Cost 3 vmrghw <2,6,3,7>, <2,4,6,5>
+ 3304540008U, // <2,2,6,5>: Cost 4 vmrghw <2,6,3,7>, <2,5,3,6>
+ 1157056442U, // <2,2,6,6>: Cost 2 vmrghw <2,6,3,7>, <2,6,3,7>
+ 2725000033U, // <2,2,6,7>: Cost 3 vsldoi8 <6,7,2,2>, <6,7,2,2>
+ 1157056442U, // <2,2,6,u>: Cost 2 vmrghw <2,6,3,7>, <2,6,3,7>
+ 2793359338U, // <2,2,7,0>: Cost 3 vsldoi12 <7,0,1,2>, <2,7,0,1>
+ 3371574725U, // <2,2,7,1>: Cost 4 vmrglw <2,6,2,7>, <2,0,2,1>
+ 2297833064U, // <2,2,7,2>: Cost 3 vmrglw <2,6,2,7>, <2,2,2,2>
+ 2297831526U, // <2,2,7,3>: Cost 3 vmrglw <2,6,2,7>, LHS
+ 2697794918U, // <2,2,7,4>: Cost 3 vsldoi8 <2,2,2,2>, <7,4,5,6>
+ 3371575053U, // <2,2,7,5>: Cost 4 vmrglw <2,6,2,7>, <2,4,2,5>
+ 3304933297U, // <2,2,7,6>: Cost 4 vmrghw <2,7,0,1>, <2,6,2,7>
+ 2297833393U, // <2,2,7,7>: Cost 3 vmrglw <2,6,2,7>, <2,6,2,7>
+ 2297831531U, // <2,2,7,u>: Cost 3 vmrglw <2,6,2,7>, LHS
+ 1556938854U, // <2,2,u,0>: Cost 2 vsldoi4 <2,2,2,2>, LHS
+ 1624053550U, // <2,2,u,1>: Cost 2 vsldoi8 <2,2,2,2>, LHS
+ 336380006U, // <2,2,u,2>: Cost 1 vspltisw2 LHS
+ 135094374U, // <2,2,u,3>: Cost 1 vmrglw LHS, LHS
+ 1556942134U, // <2,2,u,4>: Cost 2 vsldoi4 <2,2,2,2>, RHS
+ 1624053914U, // <2,2,u,5>: Cost 2 vsldoi8 <2,2,2,2>, RHS
+ 1157056442U, // <2,2,u,6>: Cost 2 vmrghw <2,6,3,7>, <2,6,3,7>
+ 2660594859U, // <2,2,u,7>: Cost 3 vsldoi4 <7,2,2,u>, <7,2,2,u>
+ 135094379U, // <2,2,u,u>: Cost 1 vmrglw LHS, LHS
+ 1611448320U, // <2,3,0,0>: Cost 2 vsldoi8 LHS, <0,0,0,0>
+ 537706598U, // <2,3,0,1>: Cost 1 vsldoi8 LHS, LHS
+ 2689835181U, // <2,3,0,2>: Cost 3 vsldoi8 LHS, <0,2,1,2>
+ 2689835260U, // <2,3,0,3>: Cost 3 vsldoi8 LHS, <0,3,1,0>
+ 1611448658U, // <2,3,0,4>: Cost 2 vsldoi8 LHS, <0,4,1,5>
+ 2732966354U, // <2,3,0,5>: Cost 3 vsldoi8 LHS, <0,5,6,7>
+ 2732966390U, // <2,3,0,6>: Cost 3 vsldoi8 LHS, <0,6,1,7>
+ 2660603052U, // <2,3,0,7>: Cost 3 vsldoi4 <7,2,3,0>, <7,2,3,0>
+ 537707165U, // <2,3,0,u>: Cost 1 vsldoi8 LHS, LHS
+ 2689835748U, // <2,3,1,0>: Cost 3 vsldoi8 LHS, <1,0,1,2>
+ 1611449140U, // <2,3,1,1>: Cost 2 vsldoi8 LHS, <1,1,1,1>
+ 1611449238U, // <2,3,1,2>: Cost 2 vsldoi8 LHS, <1,2,3,0>
+ 3763577805U, // <2,3,1,3>: Cost 4 vsldoi8 LHS, <1,3,0,1>
+ 2689836112U, // <2,3,1,4>: Cost 3 vsldoi8 LHS, <1,4,5,6>
+ 2689836143U, // <2,3,1,5>: Cost 3 vsldoi8 LHS, <1,5,0,1>
+ 2689836239U, // <2,3,1,6>: Cost 3 vsldoi8 LHS, <1,6,1,7>
+ 3366881210U, // <2,3,1,7>: Cost 4 vmrglw <1,u,2,1>, <2,6,3,7>
+ 1616094588U, // <2,3,1,u>: Cost 2 vsldoi8 LHS, <1,u,3,0>
+ 2689836493U, // <2,3,2,0>: Cost 3 vsldoi8 LHS, <2,0,3,0>
+ 2685191711U, // <2,3,2,1>: Cost 3 vsldoi8 LHS, <2,1,3,1>
+ 1611449960U, // <2,3,2,2>: Cost 2 vsldoi8 LHS, <2,2,2,2>
+ 1611450022U, // <2,3,2,3>: Cost 2 vsldoi8 LHS, <2,3,0,1>
+ 2689836822U, // <2,3,2,4>: Cost 3 vsldoi8 LHS, <2,4,3,5>
+ 2689836904U, // <2,3,2,5>: Cost 3 vsldoi8 LHS, <2,5,3,6>
+ 1611450298U, // <2,3,2,6>: Cost 2 vsldoi8 LHS, <2,6,3,7>
+ 2295138234U, // <2,3,2,7>: Cost 3 vmrglw <2,2,2,2>, <2,6,3,7>
+ 1611450456U, // <2,3,2,u>: Cost 2 vsldoi8 LHS, <2,u,3,3>
+ 1213440918U, // <2,3,3,0>: Cost 2 vmrglw LHS, <1,2,3,0>
+ 2282538527U, // <2,3,3,1>: Cost 3 vmrglw LHS, <2,1,3,1>
+ 1557022322U, // <2,3,3,2>: Cost 2 vsldoi4 <2,2,3,3>, <2,2,3,3>
+ 1208796786U, // <2,3,3,3>: Cost 2 vmrglw LHS, <2,2,3,3>
+ 1213440922U, // <2,3,3,4>: Cost 2 vmrglw LHS, <1,2,3,4>
+ 2282538531U, // <2,3,3,5>: Cost 3 vmrglw LHS, <2,1,3,5>
+ 2287188094U, // <2,3,3,6>: Cost 3 vmrglw LHS, <u,5,3,6>
+ 1213441978U, // <2,3,3,7>: Cost 2 vmrglw LHS, <2,6,3,7>
+ 1208796791U, // <2,3,3,u>: Cost 2 vmrglw LHS, <2,2,3,u>
+ 1551056998U, // <2,3,4,0>: Cost 2 vsldoi4 <1,2,3,4>, LHS
+ 1551057818U, // <2,3,4,1>: Cost 2 vsldoi4 <1,2,3,4>, <1,2,3,4>
+ 2624800360U, // <2,3,4,2>: Cost 3 vsldoi4 <1,2,3,4>, <2,2,2,2>
+ 2624800918U, // <2,3,4,3>: Cost 3 vsldoi4 <1,2,3,4>, <3,0,1,2>
+ 1551060278U, // <2,3,4,4>: Cost 2 vsldoi4 <1,2,3,4>, RHS
+ 537709878U, // <2,3,4,5>: Cost 1 vsldoi8 LHS, RHS
+ 2732969337U, // <2,3,4,6>: Cost 3 vsldoi8 LHS, <4,6,5,2>
+ 2660635824U, // <2,3,4,7>: Cost 3 vsldoi4 <7,2,3,4>, <7,2,3,4>
+ 537710121U, // <2,3,4,u>: Cost 1 vsldoi8 LHS, RHS
+ 2689838664U, // <2,3,5,0>: Cost 3 vsldoi8 LHS, <5,0,1,2>
+ 2732969615U, // <2,3,5,1>: Cost 3 vsldoi8 LHS, <5,1,0,1>
+ 2732969707U, // <2,3,5,2>: Cost 3 vsldoi8 LHS, <5,2,1,3>
+ 3763580721U, // <2,3,5,3>: Cost 4 vsldoi8 LHS, <5,3,0,1>
+ 2689839028U, // <2,3,5,4>: Cost 3 vsldoi8 LHS, <5,4,5,6>
+ 1659228164U, // <2,3,5,5>: Cost 2 vsldoi8 LHS, <5,5,5,5>
+ 1659228258U, // <2,3,5,6>: Cost 2 vsldoi8 LHS, <5,6,7,0>
+ 3364259770U, // <2,3,5,7>: Cost 4 vmrglw <1,4,2,5>, <2,6,3,7>
+ 1659228420U, // <2,3,5,u>: Cost 2 vsldoi8 LHS, <5,u,7,0>
+ 2230798486U, // <2,3,6,0>: Cost 3 vmrghw <2,6,3,7>, <3,0,1,2>
+ 2732970407U, // <2,3,6,1>: Cost 3 vsldoi8 LHS, <6,1,7,1>
+ 1659228666U, // <2,3,6,2>: Cost 2 vsldoi8 LHS, <6,2,7,3>
+ 2230798748U, // <2,3,6,3>: Cost 3 vmrghw <2,6,3,7>, <3,3,3,3>
+ 2230798850U, // <2,3,6,4>: Cost 3 vmrghw <2,6,3,7>, <3,4,5,6>
+ 2732970731U, // <2,3,6,5>: Cost 3 vsldoi8 LHS, <6,5,7,1>
+ 1659228984U, // <2,3,6,6>: Cost 2 vsldoi8 LHS, <6,6,6,6>
+ 1659229006U, // <2,3,6,7>: Cost 2 vsldoi8 LHS, <6,7,0,1>
+ 1659229087U, // <2,3,6,u>: Cost 2 vsldoi8 LHS, <6,u,0,1>
+ 1659229178U, // <2,3,7,0>: Cost 2 vsldoi8 LHS, <7,0,1,2>
+ 2726999125U, // <2,3,7,1>: Cost 3 vsldoi8 <7,1,2,3>, <7,1,2,3>
+ 2727662758U, // <2,3,7,2>: Cost 3 vsldoi8 <7,2,2,3>, <7,2,2,3>
+ 2732971235U, // <2,3,7,3>: Cost 3 vsldoi8 LHS, <7,3,0,1>
+ 1659229542U, // <2,3,7,4>: Cost 2 vsldoi8 LHS, <7,4,5,6>
+ 2732971446U, // <2,3,7,5>: Cost 3 vsldoi8 LHS, <7,5,5,5>
+ 2732971484U, // <2,3,7,6>: Cost 3 vsldoi8 LHS, <7,6,0,7>
+ 1659229804U, // <2,3,7,7>: Cost 2 vsldoi8 LHS, <7,7,7,7>
+ 1659229826U, // <2,3,7,u>: Cost 2 vsldoi8 LHS, <7,u,1,2>
+ 1208837014U, // <2,3,u,0>: Cost 2 vmrglw LHS, <1,2,3,0>
+ 537712430U, // <2,3,u,1>: Cost 1 vsldoi8 LHS, LHS
+ 1616099205U, // <2,3,u,2>: Cost 2 vsldoi8 LHS, <u,2,3,0>
+ 1208837746U, // <2,3,u,3>: Cost 2 vmrglw LHS, <2,2,3,3>
+ 1208837018U, // <2,3,u,4>: Cost 2 vmrglw LHS, <1,2,3,4>
+ 537712794U, // <2,3,u,5>: Cost 1 vsldoi8 LHS, RHS
+ 1616099536U, // <2,3,u,6>: Cost 2 vsldoi8 LHS, <u,6,3,7>
+ 1208838074U, // <2,3,u,7>: Cost 2 vmrglw LHS, <2,6,3,7>
+ 537712997U, // <2,3,u,u>: Cost 1 vsldoi8 LHS, LHS
+ 3771547648U, // <2,4,0,0>: Cost 4 vsldoi8 <2,2,2,4>, <0,0,0,0>
+ 2697805926U, // <2,4,0,1>: Cost 3 vsldoi8 <2,2,2,4>, LHS
+ 3770884269U, // <2,4,0,2>: Cost 4 vsldoi8 <2,1,2,4>, <0,2,1,2>
+ 3806716164U, // <2,4,0,3>: Cost 4 vsldoi8 <u,1,2,4>, <0,3,1,u>
+ 3771547986U, // <2,4,0,4>: Cost 4 vsldoi8 <2,2,2,4>, <0,4,1,5>
+ 2226761014U, // <2,4,0,5>: Cost 3 vmrghw <2,0,3,0>, RHS
+ 3853462427U, // <2,4,0,6>: Cost 4 vsldoi12 <4,6,5,2>, <4,0,6,1>
+ 3867102116U, // <2,4,0,7>: Cost 4 vsldoi12 <7,0,1,2>, <4,0,7,1>
+ 2226761257U, // <2,4,0,u>: Cost 3 vmrghw <2,0,3,0>, RHS
+ 3849186231U, // <2,4,1,0>: Cost 4 vsldoi12 <4,0,1,2>, <4,1,0,2>
+ 3301207010U, // <2,4,1,1>: Cost 4 vmrghw <2,1,3,5>, <4,1,5,0>
+ 3766240150U, // <2,4,1,2>: Cost 4 vsldoi8 <1,3,2,4>, <1,2,3,0>
+ 3766240226U, // <2,4,1,3>: Cost 4 vsldoi8 <1,3,2,4>, <1,3,2,4>
+ 3301207248U, // <2,4,1,4>: Cost 4 vmrghw <2,1,3,5>, <4,4,4,4>
+ 2227432758U, // <2,4,1,5>: Cost 3 vmrghw <2,1,3,1>, RHS
+ 3758941400U, // <2,4,1,6>: Cost 4 vsldoi8 <0,1,2,4>, <1,6,2,7>
+ 3768894758U, // <2,4,1,7>: Cost 4 vsldoi8 <1,7,2,4>, <1,7,2,4>
+ 2227433001U, // <2,4,1,u>: Cost 3 vmrghw <2,1,3,1>, RHS
+ 2228030354U, // <2,4,2,0>: Cost 3 vmrghw <2,2,2,2>, <4,0,5,1>
+ 3770885657U, // <2,4,2,1>: Cost 4 vsldoi8 <2,1,2,4>, <2,1,2,4>
+ 2697807466U, // <2,4,2,2>: Cost 3 vsldoi8 <2,2,2,4>, <2,2,2,4>
+ 3368880468U, // <2,4,2,3>: Cost 4 vmrglw <2,2,2,2>, <3,2,4,3>
+ 2228030672U, // <2,4,2,4>: Cost 3 vmrghw <2,2,2,2>, <4,4,4,4>
+ 1154288950U, // <2,4,2,5>: Cost 2 vmrghw <2,2,2,2>, RHS
+ 3771549617U, // <2,4,2,6>: Cost 4 vsldoi8 <2,2,2,4>, <2,6,2,7>
+ 3368880796U, // <2,4,2,7>: Cost 4 vmrglw <2,2,2,2>, <3,6,4,7>
+ 1154289193U, // <2,4,2,u>: Cost 2 vmrghw <2,2,2,2>, RHS
+ 2636808294U, // <2,4,3,0>: Cost 3 vsldoi4 <3,2,4,3>, LHS
+ 2287181861U, // <2,4,3,1>: Cost 3 vmrglw LHS, <0,0,4,1>
+ 2228866102U, // <2,4,3,2>: Cost 3 vmrghw <2,3,4,5>, <4,2,5,3>
+ 2636810580U, // <2,4,3,3>: Cost 3 vsldoi4 <3,2,4,3>, <3,2,4,3>
+ 1256574160U, // <2,4,3,4>: Cost 2 vmrglw LHS, <4,4,4,4>
+ 1213441742U, // <2,4,3,5>: Cost 2 vmrglw LHS, <2,3,4,5>
+ 2228866430U, // <2,4,3,6>: Cost 3 vmrghw <2,3,4,5>, <4,6,5,7>
+ 2660701368U, // <2,4,3,7>: Cost 3 vsldoi4 <7,2,4,3>, <7,2,4,3>
+ 1213441745U, // <2,4,3,u>: Cost 2 vmrglw LHS, <2,3,4,u>
+ 3704586342U, // <2,4,4,0>: Cost 4 vsldoi4 <2,2,4,4>, LHS
+ 3782831051U, // <2,4,4,1>: Cost 4 vsldoi8 <4,1,2,4>, <4,1,2,4>
+ 3704587900U, // <2,4,4,2>: Cost 4 vsldoi4 <2,2,4,4>, <2,2,4,4>
+ 3368896123U, // <2,4,4,3>: Cost 4 vmrglw <2,2,2,4>, <2,2,4,3>
+ 2793360592U, // <2,4,4,4>: Cost 3 vsldoi12 <7,0,1,2>, <4,4,4,4>
+ 2697809206U, // <2,4,4,5>: Cost 3 vsldoi8 <2,2,2,4>, RHS
+ 3303198078U, // <2,4,4,6>: Cost 4 vmrghw <2,4,3,5>, <4,6,5,7>
+ 3867102444U, // <2,4,4,7>: Cost 4 vsldoi12 <7,0,1,2>, <4,4,7,5>
+ 2697809449U, // <2,4,4,u>: Cost 3 vsldoi8 <2,2,2,4>, RHS
+ 2630852710U, // <2,4,5,0>: Cost 3 vsldoi4 <2,2,4,5>, LHS
+ 2624881572U, // <2,4,5,1>: Cost 3 vsldoi4 <1,2,4,5>, <1,2,4,5>
+ 2630854269U, // <2,4,5,2>: Cost 3 vsldoi4 <2,2,4,5>, <2,2,4,5>
+ 2666686677U, // <2,4,5,3>: Cost 3 vsldoi4 <u,2,4,5>, <3,0,u,2>
+ 2630855990U, // <2,4,5,4>: Cost 3 vsldoi4 <2,2,4,5>, RHS
+ 2230127926U, // <2,4,5,5>: Cost 3 vmrghw <2,5,3,6>, RHS
+ 1691159862U, // <2,4,5,6>: Cost 2 vsldoi12 <2,2,2,2>, RHS
+ 3867102520U, // <2,4,5,7>: Cost 4 vsldoi12 <7,0,1,2>, <4,5,7,0>
+ 1691159880U, // <2,4,5,u>: Cost 2 vsldoi12 <2,2,2,2>, RHS
+ 2230799250U, // <2,4,6,0>: Cost 3 vmrghw <2,6,3,7>, <4,0,5,1>
+ 3304541130U, // <2,4,6,1>: Cost 4 vmrghw <2,6,3,7>, <4,1,2,3>
+ 2230799417U, // <2,4,6,2>: Cost 3 vmrghw <2,6,3,7>, <4,2,5,6>
+ 3304541323U, // <2,4,6,3>: Cost 4 vmrghw <2,6,3,7>, <4,3,5,7>
+ 2230799568U, // <2,4,6,4>: Cost 3 vmrghw <2,6,3,7>, <4,4,4,4>
+ 1157057846U, // <2,4,6,5>: Cost 2 vmrghw <2,6,3,7>, RHS
+ 3304541566U, // <2,4,6,6>: Cost 4 vmrghw <2,6,3,7>, <4,6,5,7>
+ 3798758243U, // <2,4,6,7>: Cost 4 vsldoi8 <6,7,2,4>, <6,7,2,4>
+ 1157058089U, // <2,4,6,u>: Cost 2 vmrghw <2,6,3,7>, RHS
+ 3806721018U, // <2,4,7,0>: Cost 4 vsldoi8 <u,1,2,4>, <7,0,1,2>
+ 3853831590U, // <2,4,7,1>: Cost 4 vsldoi12 <4,7,1,2>, <4,7,1,2>
+ 3801412775U, // <2,4,7,2>: Cost 4 vsldoi8 <7,2,2,4>, <7,2,2,4>
+ 3802076408U, // <2,4,7,3>: Cost 4 vsldoi8 <7,3,2,4>, <7,3,2,4>
+ 3401436368U, // <2,4,7,4>: Cost 4 vmrglw <7,6,2,7>, <4,4,4,4>
+ 2793360840U, // <2,4,7,5>: Cost 3 vsldoi12 <7,0,1,2>, <4,7,5,0>
+ 3804067307U, // <2,4,7,6>: Cost 4 vsldoi8 <7,6,2,4>, <7,6,2,4>
+ 3867102682U, // <2,4,7,7>: Cost 4 vsldoi12 <7,0,1,2>, <4,7,7,0>
+ 2793360867U, // <2,4,7,u>: Cost 3 vsldoi12 <7,0,1,2>, <4,7,u,0>
+ 2630877286U, // <2,4,u,0>: Cost 3 vsldoi4 <2,2,4,u>, LHS
+ 2282580144U, // <2,4,u,1>: Cost 3 vmrglw LHS, <3,0,4,1>
+ 2630878848U, // <2,4,u,2>: Cost 3 vsldoi4 <2,2,4,u>, <2,2,4,u>
+ 2636851545U, // <2,4,u,3>: Cost 3 vsldoi4 <3,2,4,u>, <3,2,4,u>
+ 1256615120U, // <2,4,u,4>: Cost 2 vmrglw LHS, <4,4,4,4>
+ 1208837838U, // <2,4,u,5>: Cost 2 vmrglw LHS, <2,3,4,5>
+ 1691160105U, // <2,4,u,6>: Cost 2 vsldoi12 <2,2,2,2>, RHS
+ 2660742333U, // <2,4,u,7>: Cost 3 vsldoi4 <7,2,4,u>, <7,2,4,u>
+ 1208837841U, // <2,4,u,u>: Cost 2 vmrglw LHS, <2,3,4,u>
+ 3766910976U, // <2,5,0,0>: Cost 4 vsldoi8 <1,4,2,5>, <0,0,0,0>
+ 2693169254U, // <2,5,0,1>: Cost 3 vsldoi8 <1,4,2,5>, LHS
+ 3760939181U, // <2,5,0,2>: Cost 4 vsldoi8 <0,4,2,5>, <0,2,1,2>
+ 3843214936U, // <2,5,0,3>: Cost 4 vsldoi12 <3,0,1,2>, <5,0,3,0>
+ 3760939355U, // <2,5,0,4>: Cost 4 vsldoi8 <0,4,2,5>, <0,4,2,5>
+ 3867102827U, // <2,5,0,5>: Cost 4 vsldoi12 <7,0,1,2>, <5,0,5,1>
+ 3867102836U, // <2,5,0,6>: Cost 4 vsldoi12 <7,0,1,2>, <5,0,6,1>
+ 3867102844U, // <2,5,0,7>: Cost 4 vsldoi12 <7,0,1,2>, <5,0,7,0>
+ 2693169821U, // <2,5,0,u>: Cost 3 vsldoi8 <1,4,2,5>, LHS
+ 3766911724U, // <2,5,1,0>: Cost 4 vsldoi8 <1,4,2,5>, <1,0,2,1>
+ 3766911796U, // <2,5,1,1>: Cost 4 vsldoi8 <1,4,2,5>, <1,1,1,1>
+ 2693170070U, // <2,5,1,2>: Cost 3 vsldoi8 <1,4,2,5>, <1,2,3,0>
+ 3384798262U, // <2,5,1,3>: Cost 4 vmrglw <4,u,2,1>, <4,2,5,3>
+ 2693170228U, // <2,5,1,4>: Cost 3 vsldoi8 <1,4,2,5>, <1,4,2,5>
+ 3301208068U, // <2,5,1,5>: Cost 4 vmrghw <2,1,3,5>, <5,5,5,5>
+ 3366879607U, // <2,5,1,6>: Cost 4 vmrglw <1,u,2,1>, <0,4,5,6>
+ 3867102925U, // <2,5,1,7>: Cost 4 vsldoi12 <7,0,1,2>, <5,1,7,0>
+ 2695824760U, // <2,5,1,u>: Cost 3 vsldoi8 <1,u,2,5>, <1,u,2,5>
+ 2642845798U, // <2,5,2,0>: Cost 3 vsldoi4 <4,2,5,2>, LHS
+ 2295139218U, // <2,5,2,1>: Cost 3 vmrglw <2,2,2,2>, <4,0,5,1>
+ 2699142760U, // <2,5,2,2>: Cost 3 vsldoi8 <2,4,2,5>, <2,2,2,2>
+ 3766912678U, // <2,5,2,3>: Cost 4 vsldoi8 <1,4,2,5>, <2,3,0,1>
+ 2699142925U, // <2,5,2,4>: Cost 3 vsldoi8 <2,4,2,5>, <2,4,2,5>
+ 2228031492U, // <2,5,2,5>: Cost 3 vmrghw <2,2,2,2>, <5,5,5,5>
+ 2295138818U, // <2,5,2,6>: Cost 3 vmrglw <2,2,2,2>, <3,4,5,6>
+ 3368879347U, // <2,5,2,7>: Cost 4 vmrglw <2,2,2,2>, <1,6,5,7>
+ 2295138820U, // <2,5,2,u>: Cost 3 vmrglw <2,2,2,2>, <3,4,5,u>
+ 2287184866U, // <2,5,3,0>: Cost 3 vmrglw LHS, <4,1,5,0>
+ 1256573842U, // <2,5,3,1>: Cost 2 vmrglw LHS, <4,0,5,1>
+ 2642855630U, // <2,5,3,2>: Cost 3 vsldoi4 <4,2,5,3>, <2,3,4,5>
+ 2287182763U, // <2,5,3,3>: Cost 3 vmrglw LHS, <1,2,5,3>
+ 2287184870U, // <2,5,3,4>: Cost 3 vmrglw LHS, <4,1,5,4>
+ 1256574170U, // <2,5,3,5>: Cost 2 vmrglw LHS, <4,4,5,5>
+ 1213442562U, // <2,5,3,6>: Cost 2 vmrglw LHS, <3,4,5,6>
+ 2287183091U, // <2,5,3,7>: Cost 3 vmrglw LHS, <1,6,5,7>
+ 1213442564U, // <2,5,3,u>: Cost 2 vmrglw LHS, <3,4,5,u>
+ 3716604006U, // <2,5,4,0>: Cost 4 vsldoi4 <4,2,5,4>, LHS
+ 3716604822U, // <2,5,4,1>: Cost 4 vsldoi4 <4,2,5,4>, <1,2,3,0>
+ 3766914099U, // <2,5,4,2>: Cost 4 vsldoi8 <1,4,2,5>, <4,2,5,0>
+ 3368895403U, // <2,5,4,3>: Cost 5 vmrglw <2,2,2,4>, <1,2,5,3>
+ 3716607031U, // <2,5,4,4>: Cost 4 vsldoi4 <4,2,5,4>, <4,2,5,4>
+ 2693172534U, // <2,5,4,5>: Cost 3 vsldoi8 <1,4,2,5>, RHS
+ 3363588610U, // <2,5,4,6>: Cost 4 vmrglw <1,3,2,4>, <3,4,5,6>
+ 3368895731U, // <2,5,4,7>: Cost 5 vmrglw <2,2,2,4>, <1,6,5,7>
+ 2693172777U, // <2,5,4,u>: Cost 3 vsldoi8 <1,4,2,5>, RHS
+ 3704668262U, // <2,5,5,0>: Cost 4 vsldoi4 <2,2,5,5>, LHS
+ 3704669078U, // <2,5,5,1>: Cost 4 vsldoi4 <2,2,5,5>, <1,2,3,0>
+ 3704669830U, // <2,5,5,2>: Cost 4 vsldoi4 <2,2,5,5>, <2,2,5,5>
+ 3364259460U, // <2,5,5,3>: Cost 4 vmrglw <1,4,2,5>, <2,2,5,3>
+ 3704671542U, // <2,5,5,4>: Cost 4 vsldoi4 <2,2,5,5>, RHS
+ 2793361412U, // <2,5,5,5>: Cost 3 vsldoi12 <7,0,1,2>, <5,5,5,5>
+ 3364258167U, // <2,5,5,6>: Cost 4 vmrglw <1,4,2,5>, <0,4,5,6>
+ 3867103249U, // <2,5,5,7>: Cost 4 vsldoi12 <7,0,1,2>, <5,5,7,0>
+ 2793361412U, // <2,5,5,u>: Cost 3 vsldoi12 <7,0,1,2>, <5,5,5,5>
+ 2642878566U, // <2,5,6,0>: Cost 3 vsldoi4 <4,2,5,6>, LHS
+ 3386166810U, // <2,5,6,1>: Cost 4 vmrglw <5,1,2,6>, <4,u,5,1>
+ 2723033594U, // <2,5,6,2>: Cost 3 vsldoi8 <6,4,2,5>, <6,2,7,3>
+ 3848523842U, // <2,5,6,3>: Cost 4 vsldoi12 <3,u,1,2>, <5,6,3,4>
+ 2723033713U, // <2,5,6,4>: Cost 3 vsldoi8 <6,4,2,5>, <6,4,2,5>
+ 2230800388U, // <2,5,6,5>: Cost 3 vmrghw <2,6,3,7>, <5,5,5,5>
+ 2230800482U, // <2,5,6,6>: Cost 3 vmrghw <2,6,3,7>, <5,6,7,0>
+ 2785841252U, // <2,5,6,7>: Cost 3 vsldoi12 <5,6,7,2>, <5,6,7,2>
+ 2785914989U, // <2,5,6,u>: Cost 3 vsldoi12 <5,6,u,2>, <5,6,u,2>
+ 3796775930U, // <2,5,7,0>: Cost 4 vsldoi8 <6,4,2,5>, <7,0,1,2>
+ 3800757335U, // <2,5,7,1>: Cost 4 vsldoi8 <7,1,2,5>, <7,1,2,5>
+ 3853463689U, // <2,5,7,2>: Cost 4 vsldoi12 <4,6,5,2>, <5,7,2,3>
+ 3796776218U, // <2,5,7,3>: Cost 4 vsldoi8 <6,4,2,5>, <7,3,6,2>
+ 3796776294U, // <2,5,7,4>: Cost 4 vsldoi8 <6,4,2,5>, <7,4,5,6>
+ 3803411867U, // <2,5,7,5>: Cost 4 vsldoi8 <7,5,2,5>, <7,5,2,5>
+ 3371575081U, // <2,5,7,6>: Cost 4 vmrglw <2,6,2,7>, <2,4,5,6>
+ 3796776516U, // <2,5,7,7>: Cost 4 vsldoi8 <6,4,2,5>, <7,7,3,3>
+ 3371575083U, // <2,5,7,u>: Cost 4 vmrglw <2,6,2,7>, <2,4,5,u>
+ 2287225826U, // <2,5,u,0>: Cost 3 vmrglw LHS, <4,1,5,0>
+ 1256614802U, // <2,5,u,1>: Cost 2 vmrglw LHS, <4,0,5,1>
+ 2642896590U, // <2,5,u,2>: Cost 3 vsldoi4 <4,2,5,u>, <2,3,4,5>
+ 2287223723U, // <2,5,u,3>: Cost 3 vmrglw LHS, <1,2,5,3>
+ 2287225830U, // <2,5,u,4>: Cost 3 vmrglw LHS, <4,1,5,4>
+ 1256615130U, // <2,5,u,5>: Cost 2 vmrglw LHS, <4,4,5,5>
+ 1208838658U, // <2,5,u,6>: Cost 2 vmrglw LHS, <3,4,5,6>
+ 2287224051U, // <2,5,u,7>: Cost 3 vmrglw LHS, <1,6,5,7>
+ 1208838660U, // <2,5,u,u>: Cost 2 vmrglw LHS, <3,4,5,u>
+ 3772227584U, // <2,6,0,0>: Cost 4 vsldoi8 <2,3,2,6>, <0,0,0,0>
+ 2698485862U, // <2,6,0,1>: Cost 3 vsldoi8 <2,3,2,6>, LHS
+ 3759620282U, // <2,6,0,2>: Cost 4 vsldoi8 <0,2,2,6>, <0,2,2,6>
+ 3710675299U, // <2,6,0,3>: Cost 4 vsldoi4 <3,2,6,0>, <3,2,6,0>
+ 3767583058U, // <2,6,0,4>: Cost 4 vsldoi8 <1,5,2,6>, <0,4,1,5>
+ 3378153265U, // <2,6,0,5>: Cost 5 vmrglw <3,7,2,0>, <2,4,6,5>
+ 3865186637U, // <2,6,0,6>: Cost 4 vsldoi12 <6,6,2,2>, <6,0,6,1>
+ 2330291510U, // <2,6,0,7>: Cost 3 vmrglw <u,1,2,0>, RHS
+ 2698486429U, // <2,6,0,u>: Cost 3 vsldoi8 <2,3,2,6>, LHS
+ 3734569062U, // <2,6,1,0>: Cost 4 vsldoi4 <7,2,6,1>, LHS
+ 3764929346U, // <2,6,1,1>: Cost 4 vsldoi8 <1,1,2,6>, <1,1,2,6>
+ 3772228502U, // <2,6,1,2>: Cost 4 vsldoi8 <2,3,2,6>, <1,2,3,0>
+ 3734571158U, // <2,6,1,3>: Cost 4 vsldoi4 <7,2,6,1>, <3,0,1,2>
+ 3734572342U, // <2,6,1,4>: Cost 4 vsldoi4 <7,2,6,1>, RHS
+ 3767583878U, // <2,6,1,5>: Cost 4 vsldoi8 <1,5,2,6>, <1,5,2,6>
+ 3768247511U, // <2,6,1,6>: Cost 4 vsldoi8 <1,6,2,6>, <1,6,2,6>
+ 2293140790U, // <2,6,1,7>: Cost 3 vmrglw <1,u,2,1>, RHS
+ 2293140791U, // <2,6,1,u>: Cost 3 vmrglw <1,u,2,1>, RHS
+ 3704717414U, // <2,6,2,0>: Cost 4 vsldoi4 <2,2,6,2>, LHS
+ 3395424589U, // <2,6,2,1>: Cost 4 vmrglw <6,6,2,2>, <6,0,6,1>
+ 2228031993U, // <2,6,2,2>: Cost 3 vmrghw <2,2,2,2>, <6,2,7,2>
+ 2698487485U, // <2,6,2,3>: Cost 3 vsldoi8 <2,3,2,6>, <2,3,2,6>
+ 3704720694U, // <2,6,2,4>: Cost 4 vsldoi4 <2,2,6,2>, RHS
+ 3773556575U, // <2,6,2,5>: Cost 4 vsldoi8 <2,5,2,6>, <2,5,2,6>
+ 2698487738U, // <2,6,2,6>: Cost 3 vsldoi8 <2,3,2,6>, <2,6,3,7>
+ 1221397814U, // <2,6,2,7>: Cost 2 vmrglw <2,2,2,2>, RHS
+ 1221397815U, // <2,6,2,u>: Cost 2 vmrglw <2,2,2,2>, RHS
+ 2636955750U, // <2,6,3,0>: Cost 3 vsldoi4 <3,2,6,3>, LHS
+ 2330314217U, // <2,6,3,1>: Cost 3 vmrglw LHS, <2,0,6,1>
+ 2636957626U, // <2,6,3,2>: Cost 3 vsldoi4 <3,2,6,3>, <2,6,3,7>
+ 2287184230U, // <2,6,3,3>: Cost 3 vmrglw LHS, <3,2,6,3>
+ 2636959030U, // <2,6,3,4>: Cost 3 vsldoi4 <3,2,6,3>, RHS
+ 2648903448U, // <2,6,3,5>: Cost 3 vsldoi4 <5,2,6,3>, <5,2,6,3>
+ 1256575800U, // <2,6,3,6>: Cost 2 vmrglw LHS, <6,6,6,6>
+ 135056694U, // <2,6,3,7>: Cost 1 vmrglw LHS, RHS
+ 135056695U, // <2,6,3,u>: Cost 1 vmrglw LHS, RHS
+ 3710705766U, // <2,6,4,0>: Cost 4 vsldoi4 <3,2,6,4>, LHS
+ 3698762677U, // <2,6,4,1>: Cost 5 vsldoi4 <1,2,6,4>, <1,2,6,4>
+ 3710707389U, // <2,6,4,2>: Cost 4 vsldoi4 <3,2,6,4>, <2,3,2,6>
+ 3710708071U, // <2,6,4,3>: Cost 4 vsldoi4 <3,2,6,4>, <3,2,6,4>
+ 3710709046U, // <2,6,4,4>: Cost 4 vsldoi4 <3,2,6,4>, RHS
+ 2698489142U, // <2,6,4,5>: Cost 3 vsldoi8 <2,3,2,6>, RHS
+ 3796782457U, // <2,6,4,6>: Cost 4 vsldoi8 <6,4,2,6>, <4,6,5,2>
+ 2295156022U, // <2,6,4,7>: Cost 3 vmrglw <2,2,2,4>, RHS
+ 2295156023U, // <2,6,4,u>: Cost 3 vmrglw <2,2,2,4>, RHS
+ 3303870753U, // <2,6,5,0>: Cost 4 vmrghw <2,5,3,6>, <6,0,1,2>
+ 3788820134U, // <2,6,5,1>: Cost 4 vsldoi8 <5,1,2,6>, <5,1,2,6>
+ 3779530520U, // <2,6,5,2>: Cost 4 vsldoi8 <3,5,2,6>, <5,2,6,3>
+ 3303871026U, // <2,6,5,3>: Cost 4 vmrghw <2,5,3,6>, <6,3,4,5>
+ 3303871117U, // <2,6,5,4>: Cost 4 vmrghw <2,5,3,6>, <6,4,5,6>
+ 3791474666U, // <2,6,5,5>: Cost 4 vsldoi8 <5,5,2,6>, <5,5,2,6>
+ 3792138299U, // <2,6,5,6>: Cost 4 vsldoi8 <5,6,2,6>, <5,6,2,6>
+ 2290519350U, // <2,6,5,7>: Cost 3 vmrglw <1,4,2,5>, RHS
+ 2290519351U, // <2,6,5,u>: Cost 3 vmrglw <1,4,2,5>, RHS
+ 2631008358U, // <2,6,6,0>: Cost 3 vsldoi4 <2,2,6,6>, LHS
+ 3372893673U, // <2,6,6,1>: Cost 4 vmrglw <2,u,2,6>, <2,0,6,1>
+ 2791445264U, // <2,6,6,2>: Cost 3 vsldoi12 <6,6,2,2>, <6,6,2,2>
+ 2230800968U, // <2,6,6,3>: Cost 3 vmrghw <2,6,3,7>, <6,3,7,0>
+ 2631011638U, // <2,6,6,4>: Cost 3 vsldoi4 <2,2,6,6>, RHS
+ 3372894001U, // <2,6,6,5>: Cost 4 vmrglw <2,u,2,6>, <2,4,6,5>
+ 2793362232U, // <2,6,6,6>: Cost 3 vsldoi12 <7,0,1,2>, <6,6,6,6>
+ 2295835958U, // <2,6,6,7>: Cost 3 vmrglw <2,3,2,6>, RHS
+ 2295835959U, // <2,6,6,u>: Cost 3 vmrglw <2,3,2,6>, RHS
+ 2793362254U, // <2,6,7,0>: Cost 3 vsldoi12 <7,0,1,2>, <6,7,0,1>
+ 2792035160U, // <2,6,7,1>: Cost 3 vsldoi12 <6,7,1,2>, <6,7,1,2>
+ 2792108897U, // <2,6,7,2>: Cost 3 vsldoi12 <6,7,2,2>, <6,7,2,2>
+ 2769474408U, // <2,6,7,3>: Cost 3 vsldoi12 <3,0,1,2>, <6,7,3,0>
+ 2793362294U, // <2,6,7,4>: Cost 3 vsldoi12 <7,0,1,2>, <6,7,4,5>
+ 3371575089U, // <2,6,7,5>: Cost 4 vmrglw <2,6,2,7>, <2,4,6,5>
+ 2792403845U, // <2,6,7,6>: Cost 3 vsldoi12 <6,7,6,2>, <6,7,6,2>
+ 2297834806U, // <2,6,7,7>: Cost 3 vmrglw <2,6,2,7>, RHS
+ 2297834807U, // <2,6,7,u>: Cost 3 vmrglw <2,6,2,7>, RHS
+ 2636996710U, // <2,6,u,0>: Cost 3 vsldoi4 <3,2,6,u>, LHS
+ 2698491694U, // <2,6,u,1>: Cost 3 vsldoi8 <2,3,2,6>, LHS
+ 2636998631U, // <2,6,u,2>: Cost 3 vsldoi4 <3,2,6,u>, <2,6,u,7>
+ 2282580326U, // <2,6,u,3>: Cost 3 vmrglw LHS, <3,2,6,3>
+ 2636999990U, // <2,6,u,4>: Cost 3 vsldoi4 <3,2,6,u>, RHS
+ 2698492058U, // <2,6,u,5>: Cost 3 vsldoi8 <2,3,2,6>, RHS
+ 1256616760U, // <2,6,u,6>: Cost 2 vmrglw LHS, <6,6,6,6>
+ 135097654U, // <2,6,u,7>: Cost 1 vmrglw LHS, RHS
+ 135097655U, // <2,6,u,u>: Cost 1 vmrglw LHS, RHS
+ 2666864742U, // <2,7,0,0>: Cost 3 vsldoi4 <u,2,7,0>, LHS
+ 1719620602U, // <2,7,0,1>: Cost 2 vsldoi12 <7,0,1,2>, <7,0,1,2>
+ 3768254637U, // <2,7,0,2>: Cost 4 vsldoi8 <1,6,2,7>, <0,2,1,2>
+ 3393417722U, // <2,7,0,3>: Cost 4 vmrglw <6,3,2,0>, <6,2,7,3>
+ 2666868022U, // <2,7,0,4>: Cost 3 vsldoi4 <u,2,7,0>, RHS
+ 3867104290U, // <2,7,0,5>: Cost 4 vsldoi12 <7,0,1,2>, <7,0,5,6>
+ 3728667127U, // <2,7,0,6>: Cost 4 vsldoi4 <6,2,7,0>, <6,2,7,0>
+ 2666869817U, // <2,7,0,7>: Cost 3 vsldoi4 <u,2,7,0>, <7,0,u,2>
+ 1720136761U, // <2,7,0,u>: Cost 2 vsldoi12 <7,0,u,2>, <7,0,u,2>
+ 3728670822U, // <2,7,1,0>: Cost 4 vsldoi4 <6,2,7,1>, LHS
+ 3774227252U, // <2,7,1,1>: Cost 4 vsldoi8 <2,6,2,7>, <1,1,1,1>
+ 3774227350U, // <2,7,1,2>: Cost 4 vsldoi8 <2,6,2,7>, <1,2,3,0>
+ 2323001850U, // <2,7,1,3>: Cost 3 vmrglw <6,u,2,1>, <6,2,7,3>
+ 3728674102U, // <2,7,1,4>: Cost 4 vsldoi4 <6,2,7,1>, RHS
+ 3774227567U, // <2,7,1,5>: Cost 5 vsldoi8 <2,6,2,7>, <1,5,0,1>
+ 2694513880U, // <2,7,1,6>: Cost 3 vsldoi8 <1,6,2,7>, <1,6,2,7>
+ 3396744002U, // <2,7,1,7>: Cost 4 vmrglw <6,u,2,1>, <6,6,7,7>
+ 2323001850U, // <2,7,1,u>: Cost 3 vmrglw <6,u,2,1>, <6,2,7,3>
+ 2654937190U, // <2,7,2,0>: Cost 3 vsldoi4 <6,2,7,2>, LHS
+ 3728679732U, // <2,7,2,1>: Cost 4 vsldoi4 <6,2,7,2>, <1,1,1,1>
+ 2700486248U, // <2,7,2,2>: Cost 3 vsldoi8 <2,6,2,7>, <2,2,2,2>
+ 2321682938U, // <2,7,2,3>: Cost 3 vmrglw <6,6,2,2>, <6,2,7,3>
+ 2654940470U, // <2,7,2,4>: Cost 3 vsldoi4 <6,2,7,2>, RHS
+ 3859584196U, // <2,7,2,5>: Cost 4 vsldoi12 <5,6,7,2>, <7,2,5,6>
+ 2700486577U, // <2,7,2,6>: Cost 3 vsldoi8 <2,6,2,7>, <2,6,2,7>
+ 2228033132U, // <2,7,2,7>: Cost 3 vmrghw <2,2,2,2>, <7,7,7,7>
+ 2701813843U, // <2,7,2,u>: Cost 3 vsldoi8 <2,u,2,7>, <2,u,2,7>
+ 1581203558U, // <2,7,3,0>: Cost 2 vsldoi4 <6,2,7,3>, LHS
+ 2654946100U, // <2,7,3,1>: Cost 3 vsldoi4 <6,2,7,3>, <1,1,1,1>
+ 2637031354U, // <2,7,3,2>: Cost 3 vsldoi4 <3,2,7,3>, <2,6,3,7>
+ 1256575482U, // <2,7,3,3>: Cost 2 vmrglw LHS, <6,2,7,3>
+ 1581206838U, // <2,7,3,4>: Cost 2 vsldoi4 <6,2,7,3>, RHS
+ 2654949380U, // <2,7,3,5>: Cost 3 vsldoi4 <6,2,7,3>, <5,5,5,5>
+ 1581208058U, // <2,7,3,6>: Cost 2 vsldoi4 <6,2,7,3>, <6,2,7,3>
+ 1256575810U, // <2,7,3,7>: Cost 2 vmrglw LHS, <6,6,7,7>
+ 1581209390U, // <2,7,3,u>: Cost 2 vsldoi4 <6,2,7,3>, LHS
+ 3728695398U, // <2,7,4,0>: Cost 4 vsldoi4 <6,2,7,4>, LHS
+ 3869758782U, // <2,7,4,1>: Cost 4 vsldoi12 <7,4,1,2>, <7,4,1,2>
+ 3728696936U, // <2,7,4,2>: Cost 4 vsldoi4 <6,2,7,4>, <2,2,2,2>
+ 3393450490U, // <2,7,4,3>: Cost 4 vmrglw <6,3,2,4>, <6,2,7,3>
+ 3728698678U, // <2,7,4,4>: Cost 4 vsldoi4 <6,2,7,4>, RHS
+ 2700487990U, // <2,7,4,5>: Cost 3 vsldoi8 <2,6,2,7>, RHS
+ 3728699899U, // <2,7,4,6>: Cost 4 vsldoi4 <6,2,7,4>, <6,2,7,4>
+ 3867104626U, // <2,7,4,7>: Cost 4 vsldoi12 <7,0,1,2>, <7,4,7,0>
+ 2700488233U, // <2,7,4,u>: Cost 3 vsldoi8 <2,6,2,7>, RHS
+ 3855160709U, // <2,7,5,0>: Cost 4 vsldoi12 <5,0,1,2>, <7,5,0,1>
+ 3728704406U, // <2,7,5,1>: Cost 4 vsldoi4 <6,2,7,5>, <1,2,3,0>
+ 3370233956U, // <2,7,5,2>: Cost 4 vmrglw <2,4,2,5>, <5,6,7,2>
+ 2320380410U, // <2,7,5,3>: Cost 3 vmrglw <6,4,2,5>, <6,2,7,3>
+ 3728706870U, // <2,7,5,4>: Cost 4 vsldoi4 <6,2,7,5>, RHS
+ 3867104694U, // <2,7,5,5>: Cost 4 vsldoi12 <7,0,1,2>, <7,5,5,5>
+ 3792146492U, // <2,7,5,6>: Cost 4 vsldoi8 <5,6,2,7>, <5,6,2,7>
+ 3394122562U, // <2,7,5,7>: Cost 4 vmrglw <6,4,2,5>, <6,6,7,7>
+ 2320380410U, // <2,7,5,u>: Cost 3 vmrglw <6,4,2,5>, <6,2,7,3>
+ 2230801402U, // <2,7,6,0>: Cost 3 vmrghw <2,6,3,7>, <7,0,1,2>
+ 3768258984U, // <2,7,6,1>: Cost 4 vsldoi8 <1,6,2,7>, <6,1,7,2>
+ 2730349050U, // <2,7,6,2>: Cost 3 vsldoi8 <7,6,2,7>, <6,2,7,3>
+ 3372894575U, // <2,7,6,3>: Cost 4 vmrglw <2,u,2,6>, <3,2,7,3>
+ 2230801766U, // <2,7,6,4>: Cost 3 vmrghw <2,6,3,7>, <7,4,5,6>
+ 3304543670U, // <2,7,6,5>: Cost 4 vmrghw <2,6,3,7>, <7,5,5,5>
+ 3728716285U, // <2,7,6,6>: Cost 4 vsldoi4 <6,2,7,6>, <6,2,7,6>
+ 2230802028U, // <2,7,6,7>: Cost 3 vmrghw <2,6,3,7>, <7,7,7,7>
+ 2730349050U, // <2,7,6,u>: Cost 3 vsldoi8 <7,6,2,7>, <6,2,7,3>
+ 2793362983U, // <2,7,7,0>: Cost 3 vsldoi12 <7,0,1,2>, <7,7,0,1>
+ 3728721112U, // <2,7,7,1>: Cost 4 vsldoi4 <6,2,7,7>, <1,6,2,7>
+ 3371574933U, // <2,7,7,2>: Cost 4 vmrglw <2,6,2,7>, <2,2,7,2>
+ 2327695866U, // <2,7,7,3>: Cost 3 vmrglw <7,6,2,7>, <6,2,7,3>
+ 3728723254U, // <2,7,7,4>: Cost 4 vsldoi4 <6,2,7,7>, RHS
+ 3371574855U, // <2,7,7,5>: Cost 5 vmrglw <2,6,2,7>, <2,1,7,5>
+ 2730350062U, // <2,7,7,6>: Cost 3 vsldoi8 <7,6,2,7>, <7,6,2,7>
+ 2793363052U, // <2,7,7,7>: Cost 3 vsldoi12 <7,0,1,2>, <7,7,7,7>
+ 2798671471U, // <2,7,7,u>: Cost 3 vsldoi12 <7,u,1,2>, <7,7,u,1>
+ 1581244518U, // <2,7,u,0>: Cost 2 vsldoi4 <6,2,7,u>, LHS
+ 1724929666U, // <2,7,u,1>: Cost 2 vsldoi12 <7,u,1,2>, <7,u,1,2>
+ 2637072314U, // <2,7,u,2>: Cost 3 vsldoi4 <3,2,7,u>, <2,6,3,7>
+ 1256616442U, // <2,7,u,3>: Cost 2 vmrglw LHS, <6,2,7,3>
+ 1581247798U, // <2,7,u,4>: Cost 2 vsldoi4 <6,2,7,u>, RHS
+ 2700490906U, // <2,7,u,5>: Cost 3 vsldoi8 <2,6,2,7>, RHS
+ 1581249023U, // <2,7,u,6>: Cost 2 vsldoi4 <6,2,7,u>, <6,2,7,u>
+ 1256616770U, // <2,7,u,7>: Cost 2 vmrglw LHS, <6,6,7,7>
+ 1581250350U, // <2,7,u,u>: Cost 2 vsldoi4 <6,2,7,u>, LHS
+ 1611489280U, // <2,u,0,0>: Cost 2 vsldoi8 LHS, <0,0,0,0>
+ 537747563U, // <2,u,0,1>: Cost 1 vsldoi8 LHS, LHS
+ 2685231277U, // <2,u,0,2>: Cost 3 vsldoi8 LHS, <0,2,1,2>
+ 2685231356U, // <2,u,0,3>: Cost 3 vsldoi8 LHS, <0,3,1,0>
+ 1611489618U, // <2,u,0,4>: Cost 2 vsldoi8 LHS, <0,4,1,5>
+ 2226763930U, // <2,u,0,5>: Cost 3 vmrghw <2,0,3,0>, RHS
+ 2733007350U, // <2,u,0,6>: Cost 3 vsldoi8 LHS, <0,6,1,7>
+ 2660971737U, // <2,u,0,7>: Cost 3 vsldoi4 <7,2,u,0>, <7,2,u,0>
+ 537748125U, // <2,u,0,u>: Cost 1 vsldoi8 LHS, LHS
+ 2689876708U, // <2,u,1,0>: Cost 3 vsldoi8 LHS, <1,0,1,2>
+ 1611490100U, // <2,u,1,1>: Cost 2 vsldoi8 LHS, <1,1,1,1>
+ 1611490198U, // <2,u,1,2>: Cost 2 vsldoi8 LHS, <1,2,3,0>
+ 2293137564U, // <2,u,1,3>: Cost 3 vmrglw <1,u,2,1>, LHS
+ 2689877072U, // <2,u,1,4>: Cost 3 vsldoi8 LHS, <1,4,5,6>
+ 2689877103U, // <2,u,1,5>: Cost 3 vsldoi8 LHS, <1,5,0,1>
+ 2689877199U, // <2,u,1,6>: Cost 3 vsldoi8 LHS, <1,6,1,7>
+ 2293140808U, // <2,u,1,7>: Cost 3 vmrglw <1,u,2,1>, RHS
+ 1616135548U, // <2,u,1,u>: Cost 2 vsldoi8 LHS, <1,u,3,0>
+ 1556938854U, // <2,u,2,0>: Cost 2 vsldoi4 <2,2,2,2>, LHS
+ 1154291502U, // <2,u,2,1>: Cost 2 vmrghw <2,2,2,2>, LHS
+ 336380006U, // <2,u,2,2>: Cost 1 vspltisw2 LHS
+ 1611490982U, // <2,u,2,3>: Cost 2 vsldoi8 LHS, <2,3,0,1>
+ 1556942134U, // <2,u,2,4>: Cost 2 vsldoi4 <2,2,2,2>, RHS
+ 1154291866U, // <2,u,2,5>: Cost 2 vmrghw <2,2,2,2>, RHS
+ 1611491258U, // <2,u,2,6>: Cost 2 vsldoi8 LHS, <2,6,3,7>
+ 1221397832U, // <2,u,2,7>: Cost 2 vmrglw <2,2,2,2>, RHS
+ 336380006U, // <2,u,2,u>: Cost 1 vspltisw2 LHS
+ 1611491478U, // <2,u,3,0>: Cost 2 vsldoi8 LHS, <3,0,1,2>
+ 1213440073U, // <2,u,3,1>: Cost 2 vmrglw LHS, <0,0,u,1>
+ 1213442261U, // <2,u,3,2>: Cost 2 vmrglw LHS, <3,0,u,2>
+ 135053468U, // <2,u,3,3>: Cost 1 vmrglw LHS, LHS
+ 1611491842U, // <2,u,3,4>: Cost 2 vsldoi8 LHS, <3,4,5,6>
+ 1213440401U, // <2,u,3,5>: Cost 2 vmrglw LHS, <0,4,u,5>
+ 1213442589U, // <2,u,3,6>: Cost 2 vmrglw LHS, <3,4,u,6>
+ 135056712U, // <2,u,3,7>: Cost 1 vmrglw LHS, RHS
+ 135053473U, // <2,u,3,u>: Cost 1 vmrglw LHS, LHS
+ 1551425638U, // <2,u,4,0>: Cost 2 vsldoi4 <1,2,u,4>, LHS
+ 1551426503U, // <2,u,4,1>: Cost 2 vsldoi4 <1,2,u,4>, <1,2,u,4>
+ 2625169000U, // <2,u,4,2>: Cost 3 vsldoi4 <1,2,u,4>, <2,2,2,2>
+ 2625169558U, // <2,u,4,3>: Cost 3 vsldoi4 <1,2,u,4>, <3,0,1,2>
+ 1551428918U, // <2,u,4,4>: Cost 2 vsldoi4 <1,2,u,4>, RHS
+ 537750838U, // <2,u,4,5>: Cost 1 vsldoi8 LHS, RHS
+ 2733010297U, // <2,u,4,6>: Cost 3 vsldoi8 LHS, <4,6,5,2>
+ 2295156040U, // <2,u,4,7>: Cost 3 vmrglw <2,2,2,4>, RHS
+ 537751081U, // <2,u,4,u>: Cost 1 vsldoi8 LHS, RHS
+ 2689879624U, // <2,u,5,0>: Cost 3 vsldoi8 LHS, <5,0,1,2>
+ 2230130478U, // <2,u,5,1>: Cost 3 vmrghw <2,5,3,6>, LHS
+ 2631149217U, // <2,u,5,2>: Cost 3 vsldoi4 <2,2,u,5>, <2,2,u,5>
+ 2290516124U, // <2,u,5,3>: Cost 3 vmrglw <1,4,2,5>, LHS
+ 2689879988U, // <2,u,5,4>: Cost 3 vsldoi8 LHS, <5,4,5,6>
+ 1659269124U, // <2,u,5,5>: Cost 2 vsldoi8 LHS, <5,5,5,5>
+ 1691162778U, // <2,u,5,6>: Cost 2 vsldoi12 <2,2,2,2>, RHS
+ 2290519368U, // <2,u,5,7>: Cost 3 vmrglw <1,4,2,5>, RHS
+ 1691162796U, // <2,u,5,u>: Cost 2 vsldoi12 <2,2,2,2>, RHS
+ 2230802131U, // <2,u,6,0>: Cost 3 vmrghw <2,6,3,7>, <u,0,1,2>
+ 1157060398U, // <2,u,6,1>: Cost 2 vmrghw <2,6,3,7>, LHS
+ 1659269626U, // <2,u,6,2>: Cost 2 vsldoi8 LHS, <6,2,7,3>
+ 2764904656U, // <2,u,6,3>: Cost 3 vsldoi12 <2,2,2,2>, <u,6,3,7>
+ 2230802495U, // <2,u,6,4>: Cost 3 vmrghw <2,6,3,7>, <u,4,5,6>
+ 1157060762U, // <2,u,6,5>: Cost 2 vmrghw <2,6,3,7>, RHS
+ 1659269944U, // <2,u,6,6>: Cost 2 vsldoi8 LHS, <6,6,6,6>
+ 1659269966U, // <2,u,6,7>: Cost 2 vsldoi8 LHS, <6,7,0,1>
+ 1157060965U, // <2,u,6,u>: Cost 2 vmrghw <2,6,3,7>, LHS
+ 1659270138U, // <2,u,7,0>: Cost 2 vsldoi8 LHS, <7,0,1,2>
+ 2727040090U, // <2,u,7,1>: Cost 3 vsldoi8 <7,1,2,u>, <7,1,2,u>
+ 2727703723U, // <2,u,7,2>: Cost 3 vsldoi8 <7,2,2,u>, <7,2,2,u>
+ 2297831580U, // <2,u,7,3>: Cost 3 vmrglw <2,6,2,7>, LHS
+ 1659270502U, // <2,u,7,4>: Cost 2 vsldoi8 LHS, <7,4,5,6>
+ 2733012406U, // <2,u,7,5>: Cost 3 vsldoi8 LHS, <7,5,5,5>
+ 2730358255U, // <2,u,7,6>: Cost 3 vsldoi8 <7,6,2,u>, <7,6,2,u>
+ 1659270764U, // <2,u,7,7>: Cost 2 vsldoi8 LHS, <7,7,7,7>
+ 1659270786U, // <2,u,7,u>: Cost 2 vsldoi8 LHS, <7,u,1,2>
+ 1213481923U, // <2,u,u,0>: Cost 2 vmrglw LHS, <1,2,u,0>
+ 537753390U, // <2,u,u,1>: Cost 1 vsldoi8 LHS, LHS
+ 336380006U, // <2,u,u,2>: Cost 1 vspltisw2 LHS
+ 135094428U, // <2,u,u,3>: Cost 1 vmrglw LHS, LHS
+ 1213481927U, // <2,u,u,4>: Cost 2 vmrglw LHS, <1,2,u,4>
+ 537753754U, // <2,u,u,5>: Cost 1 vsldoi8 LHS, RHS
+ 1208838685U, // <2,u,u,6>: Cost 2 vmrglw LHS, <3,4,u,6>
+ 135097672U, // <2,u,u,7>: Cost 1 vmrglw LHS, RHS
+ 135094433U, // <2,u,u,u>: Cost 1 vmrglw LHS, LHS
+ 1678557184U, // <3,0,0,0>: Cost 2 vsldoi12 LHS, <0,0,0,0>
+ 1678557194U, // <3,0,0,1>: Cost 2 vsldoi12 LHS, <0,0,1,1>
+ 2631181989U, // <3,0,0,2>: Cost 3 vsldoi4 <2,3,0,0>, <2,3,0,0>
+ 2289223984U, // <3,0,0,3>: Cost 3 vmrglw <1,2,3,0>, <3,2,0,3>
+ 2756943909U, // <3,0,0,4>: Cost 3 vsldoi12 LHS, <0,0,4,1>
+ 3362965729U, // <3,0,0,5>: Cost 4 vmrglw <1,2,3,0>, <3,1,0,5>
+ 3362966054U, // <3,0,0,6>: Cost 4 vmrglw <1,2,3,0>, <3,5,0,6>
+ 2289224312U, // <3,0,0,7>: Cost 3 vmrglw <1,2,3,0>, <3,6,0,7>
+ 1683202121U, // <3,0,0,u>: Cost 2 vsldoi12 LHS, <0,0,u,1>
+ 1557446758U, // <3,0,1,0>: Cost 2 vsldoi4 <2,3,0,1>, LHS
+ 2752741467U, // <3,0,1,1>: Cost 3 vsldoi12 LHS, <0,1,1,1>
+ 604815462U, // <3,0,1,2>: Cost 1 vsldoi12 LHS, LHS
+ 2631190676U, // <3,0,1,3>: Cost 3 vsldoi4 <2,3,0,1>, <3,0,1,0>
+ 1557450038U, // <3,0,1,4>: Cost 2 vsldoi4 <2,3,0,1>, RHS
+ 2667024388U, // <3,0,1,5>: Cost 3 vsldoi4 <u,3,0,1>, <5,5,5,5>
+ 2800074894U, // <3,0,1,6>: Cost 3 vsldoi12 LHS, <0,1,6,7>
+ 2661053667U, // <3,0,1,7>: Cost 3 vsldoi4 <7,3,0,1>, <7,3,0,1>
+ 604815516U, // <3,0,1,u>: Cost 1 vsldoi12 LHS, LHS
+ 2696521165U, // <3,0,2,0>: Cost 3 vsldoi8 <2,0,3,0>, <2,0,3,0>
+ 2752741549U, // <3,0,2,1>: Cost 3 vsldoi12 LHS, <0,2,1,2>
+ 2691876456U, // <3,0,2,2>: Cost 3 vsldoi8 <1,2,3,0>, <2,2,2,2>
+ 2691876518U, // <3,0,2,3>: Cost 3 vsldoi8 <1,2,3,0>, <2,3,0,1>
+ 3830685895U, // <3,0,2,4>: Cost 4 vsldoi12 LHS, <0,2,4,1>
+ 3765618536U, // <3,0,2,5>: Cost 4 vsldoi8 <1,2,3,0>, <2,5,3,6>
+ 2691876794U, // <3,0,2,6>: Cost 3 vsldoi8 <1,2,3,0>, <2,6,3,7>
+ 2701166596U, // <3,0,2,7>: Cost 3 vsldoi8 <2,7,3,0>, <2,7,3,0>
+ 2756944108U, // <3,0,2,u>: Cost 3 vsldoi12 LHS, <0,2,u,2>
+ 2691877014U, // <3,0,3,0>: Cost 3 vsldoi8 <1,2,3,0>, <3,0,1,2>
+ 1161003110U, // <3,0,3,1>: Cost 2 vmrghw <3,3,3,3>, LHS
+ 2691877168U, // <3,0,3,2>: Cost 3 vsldoi8 <1,2,3,0>, <3,2,0,3>
+ 2691877246U, // <3,0,3,3>: Cost 3 vsldoi8 <1,2,3,0>, <3,3,0,0>
+ 2691877378U, // <3,0,3,4>: Cost 3 vsldoi8 <1,2,3,0>, <3,4,5,6>
+ 3765619238U, // <3,0,3,5>: Cost 4 vsldoi8 <1,2,3,0>, <3,5,0,6>
+ 2691877496U, // <3,0,3,6>: Cost 3 vsldoi8 <1,2,3,0>, <3,6,0,7>
+ 3368962680U, // <3,0,3,7>: Cost 4 vmrglw <2,2,3,3>, <3,6,0,7>
+ 1161003677U, // <3,0,3,u>: Cost 2 vmrghw <3,3,3,3>, LHS
+ 2289254400U, // <3,0,4,0>: Cost 3 vmrglw <1,2,3,4>, <0,0,0,0>
+ 1678557522U, // <3,0,4,1>: Cost 2 vsldoi12 LHS, <0,4,1,5>
+ 2631214761U, // <3,0,4,2>: Cost 3 vsldoi4 <2,3,0,4>, <2,3,0,4>
+ 2235580672U, // <3,0,4,3>: Cost 3 vmrghw <3,4,5,6>, <0,3,1,4>
+ 2756944237U, // <3,0,4,4>: Cost 3 vsldoi12 LHS, <0,4,4,5>
+ 1618136374U, // <3,0,4,5>: Cost 2 vsldoi8 <1,2,3,0>, RHS
+ 3309322742U, // <3,0,4,6>: Cost 4 vmrghw <3,4,5,6>, <0,6,1,7>
+ 3362998904U, // <3,0,4,7>: Cost 4 vmrglw <1,2,3,4>, <3,6,0,7>
+ 1683202449U, // <3,0,4,u>: Cost 2 vsldoi12 LHS, <0,4,u,5>
+ 3765620296U, // <3,0,5,0>: Cost 4 vsldoi8 <1,2,3,0>, <5,0,1,2>
+ 2752299427U, // <3,0,5,1>: Cost 3 vsldoi12 LHS, <0,5,1,5>
+ 3789508346U, // <3,0,5,2>: Cost 4 vsldoi8 <5,2,3,0>, <5,2,3,0>
+ 3403486842U, // <3,0,5,3>: Cost 4 vmrglw <u,0,3,5>, <7,u,0,3>
+ 3765620660U, // <3,0,5,4>: Cost 4 vsldoi8 <1,2,3,0>, <5,4,5,6>
+ 2733682692U, // <3,0,5,5>: Cost 3 vsldoi8 <u,2,3,0>, <5,5,5,5>
+ 2800075218U, // <3,0,5,6>: Cost 3 vsldoi12 LHS, <0,5,6,7>
+ 3873817044U, // <3,0,5,7>: Cost 4 vsldoi12 LHS, <0,5,7,0>
+ 2800075234U, // <3,0,5,u>: Cost 3 vsldoi12 LHS, <0,5,u,5>
+ 2752299501U, // <3,0,6,0>: Cost 3 vsldoi12 LHS, <0,6,0,7>
+ 2236547174U, // <3,0,6,1>: Cost 3 vmrghw <3,6,0,7>, LHS
+ 2733683194U, // <3,0,6,2>: Cost 3 vsldoi8 <u,2,3,0>, <6,2,7,3>
+ 3844473352U, // <3,0,6,3>: Cost 4 vsldoi12 <3,2,0,3>, <0,6,3,7>
+ 3310289234U, // <3,0,6,4>: Cost 4 vmrghw <3,6,0,7>, <0,4,1,5>
+ 3873817114U, // <3,0,6,5>: Cost 4 vsldoi12 LHS, <0,6,5,7>
+ 2733683512U, // <3,0,6,6>: Cost 3 vsldoi8 <u,2,3,0>, <6,6,6,6>
+ 2725057384U, // <3,0,6,7>: Cost 3 vsldoi8 <6,7,3,0>, <6,7,3,0>
+ 2236547741U, // <3,0,6,u>: Cost 3 vmrghw <3,6,0,7>, LHS
+ 2297905152U, // <3,0,7,0>: Cost 3 vmrglw <2,6,3,7>, <0,0,0,0>
+ 2297906854U, // <3,0,7,1>: Cost 3 vmrglw <2,6,3,7>, <2,3,0,1>
+ 2727711916U, // <3,0,7,2>: Cost 3 vsldoi8 <7,2,3,0>, <7,2,3,0>
+ 3371649328U, // <3,0,7,3>: Cost 4 vmrglw <2,6,3,7>, <3,2,0,3>
+ 2733684070U, // <3,0,7,4>: Cost 3 vsldoi8 <u,2,3,0>, <7,4,5,6>
+ 3734843490U, // <3,0,7,5>: Cost 4 vsldoi4 <7,3,0,7>, <5,6,7,0>
+ 3798799895U, // <3,0,7,6>: Cost 4 vsldoi8 <6,7,3,0>, <7,6,7,3>
+ 2733684332U, // <3,0,7,7>: Cost 3 vsldoi8 <u,2,3,0>, <7,7,7,7>
+ 2297906861U, // <3,0,7,u>: Cost 3 vmrglw <2,6,3,7>, <2,3,0,u>
+ 1557504102U, // <3,0,u,0>: Cost 2 vsldoi4 <2,3,0,u>, LHS
+ 1678557842U, // <3,0,u,1>: Cost 2 vsldoi12 LHS, <0,u,1,1>
+ 604816029U, // <3,0,u,2>: Cost 1 vsldoi12 LHS, LHS
+ 2691880892U, // <3,0,u,3>: Cost 3 vsldoi8 <1,2,3,0>, <u,3,0,1>
+ 1557507382U, // <3,0,u,4>: Cost 2 vsldoi4 <2,3,0,u>, RHS
+ 1618139290U, // <3,0,u,5>: Cost 2 vsldoi8 <1,2,3,0>, RHS
+ 2691881168U, // <3,0,u,6>: Cost 3 vsldoi8 <1,2,3,0>, <u,6,3,7>
+ 2661111018U, // <3,0,u,7>: Cost 3 vsldoi4 <7,3,0,u>, <7,3,0,u>
+ 604816083U, // <3,0,u,u>: Cost 1 vsldoi12 LHS, LHS
+ 2619310332U, // <3,1,0,0>: Cost 3 vsldoi4 <0,3,1,0>, <0,3,1,0>
+ 2756944612U, // <3,1,0,1>: Cost 3 vsldoi12 LHS, <1,0,1,2>
+ 2289221724U, // <3,1,0,2>: Cost 3 vmrglw <1,2,3,0>, <0,1,1,2>
+ 2619312278U, // <3,1,0,3>: Cost 3 vsldoi4 <0,3,1,0>, <3,0,1,2>
+ 2619313462U, // <3,1,0,4>: Cost 3 vsldoi4 <0,3,1,0>, RHS
+ 2289221970U, // <3,1,0,5>: Cost 3 vmrglw <1,2,3,0>, <0,4,1,5>
+ 2232599768U, // <3,1,0,6>: Cost 3 vmrghw <3,0,1,2>, <1,6,2,7>
+ 3362964687U, // <3,1,0,7>: Cost 4 vmrglw <1,2,3,0>, <1,6,1,7>
+ 2619316014U, // <3,1,0,u>: Cost 3 vsldoi4 <0,3,1,0>, LHS
+ 2756944683U, // <3,1,1,0>: Cost 3 vsldoi12 LHS, <1,1,0,1>
+ 1678558004U, // <3,1,1,1>: Cost 2 vsldoi12 LHS, <1,1,1,1>
+ 2691883927U, // <3,1,1,2>: Cost 3 vsldoi8 <1,2,3,1>, <1,2,3,1>
+ 3826631496U, // <3,1,1,3>: Cost 4 vsldoi12 <0,2,1,3>, <1,1,3,3>
+ 2756944723U, // <3,1,1,4>: Cost 3 vsldoi12 LHS, <1,1,4,5>
+ 2756944732U, // <3,1,1,5>: Cost 3 vsldoi12 LHS, <1,1,5,5>
+ 3830686561U, // <3,1,1,6>: Cost 4 vsldoi12 LHS, <1,1,6,1>
+ 3734869228U, // <3,1,1,7>: Cost 4 vsldoi4 <7,3,1,1>, <7,3,1,1>
+ 1678558004U, // <3,1,1,u>: Cost 2 vsldoi12 LHS, <1,1,1,1>
+ 2696529358U, // <3,1,2,0>: Cost 3 vsldoi8 <2,0,3,1>, <2,0,3,1>
+ 2756944775U, // <3,1,2,1>: Cost 3 vsldoi12 LHS, <1,2,1,3>
+ 2294548630U, // <3,1,2,2>: Cost 3 vmrglw <2,1,3,2>, <3,0,1,2>
+ 1678558102U, // <3,1,2,3>: Cost 2 vsldoi12 LHS, <1,2,3,0>
+ 2631273782U, // <3,1,2,4>: Cost 3 vsldoi4 <2,3,1,2>, RHS
+ 2756944811U, // <3,1,2,5>: Cost 3 vsldoi12 LHS, <1,2,5,3>
+ 3830686644U, // <3,1,2,6>: Cost 4 vsldoi12 LHS, <1,2,6,3>
+ 2800075706U, // <3,1,2,7>: Cost 3 vsldoi12 LHS, <1,2,7,0>
+ 1679000515U, // <3,1,2,u>: Cost 2 vsldoi12 LHS, <1,2,u,0>
+ 2619334911U, // <3,1,3,0>: Cost 3 vsldoi4 <0,3,1,3>, <0,3,1,3>
+ 2295218186U, // <3,1,3,1>: Cost 3 vmrglw <2,2,3,3>, <0,0,1,1>
+ 2293229718U, // <3,1,3,2>: Cost 3 vmrglw <1,u,3,3>, <3,0,1,2>
+ 2619337116U, // <3,1,3,3>: Cost 3 vsldoi4 <0,3,1,3>, <3,3,3,3>
+ 2619338038U, // <3,1,3,4>: Cost 3 vsldoi4 <0,3,1,3>, RHS
+ 2295218514U, // <3,1,3,5>: Cost 3 vmrglw <2,2,3,3>, <0,4,1,5>
+ 3830686729U, // <3,1,3,6>: Cost 4 vsldoi12 LHS, <1,3,6,7>
+ 3368961231U, // <3,1,3,7>: Cost 4 vmrglw <2,2,3,3>, <1,6,1,7>
+ 2619340590U, // <3,1,3,u>: Cost 3 vsldoi4 <0,3,1,3>, LHS
+ 2619343104U, // <3,1,4,0>: Cost 3 vsldoi4 <0,3,1,4>, <0,3,1,4>
+ 2289254410U, // <3,1,4,1>: Cost 3 vmrglw <1,2,3,4>, <0,0,1,1>
+ 2289256598U, // <3,1,4,2>: Cost 3 vmrglw <1,2,3,4>, <3,0,1,2>
+ 2619345410U, // <3,1,4,3>: Cost 3 vsldoi4 <0,3,1,4>, <3,4,5,6>
+ 2619346230U, // <3,1,4,4>: Cost 3 vsldoi4 <0,3,1,4>, RHS
+ 2756944976U, // <3,1,4,5>: Cost 3 vsldoi12 LHS, <1,4,5,6>
+ 3362996401U, // <3,1,4,6>: Cost 4 vmrglw <1,2,3,4>, <0,2,1,6>
+ 3362997455U, // <3,1,4,7>: Cost 4 vmrglw <1,2,3,4>, <1,6,1,7>
+ 2619348782U, // <3,1,4,u>: Cost 3 vsldoi4 <0,3,1,4>, LHS
+ 2756945007U, // <3,1,5,0>: Cost 3 vsldoi12 LHS, <1,5,0,1>
+ 3830686840U, // <3,1,5,1>: Cost 4 vsldoi12 LHS, <1,5,1,1>
+ 3358361750U, // <3,1,5,2>: Cost 4 vmrglw <0,4,3,5>, <3,0,1,2>
+ 3830686857U, // <3,1,5,3>: Cost 4 vsldoi12 LHS, <1,5,3,0>
+ 2756945047U, // <3,1,5,4>: Cost 3 vsldoi12 LHS, <1,5,4,5>
+ 2294571346U, // <3,1,5,5>: Cost 3 vmrglw <2,1,3,5>, <0,4,1,5>
+ 3806105698U, // <3,1,5,6>: Cost 4 vsldoi8 <u,0,3,1>, <5,6,7,0>
+ 3873817774U, // <3,1,5,7>: Cost 4 vsldoi12 LHS, <1,5,7,1>
+ 2756945079U, // <3,1,5,u>: Cost 3 vsldoi12 LHS, <1,5,u,1>
+ 3830686912U, // <3,1,6,0>: Cost 4 vsldoi12 LHS, <1,6,0,1>
+ 2756945103U, // <3,1,6,1>: Cost 3 vsldoi12 LHS, <1,6,1,7>
+ 2236547990U, // <3,1,6,2>: Cost 3 vmrghw <3,6,0,7>, <1,2,3,0>
+ 3826631905U, // <3,1,6,3>: Cost 4 vsldoi12 <0,2,1,3>, <1,6,3,7>
+ 3830686952U, // <3,1,6,4>: Cost 4 vsldoi12 LHS, <1,6,4,5>
+ 2756945139U, // <3,1,6,5>: Cost 3 vsldoi12 LHS, <1,6,5,7>
+ 3830686972U, // <3,1,6,6>: Cost 4 vsldoi12 LHS, <1,6,6,7>
+ 2800076030U, // <3,1,6,7>: Cost 3 vsldoi12 LHS, <1,6,7,0>
+ 2756945166U, // <3,1,6,u>: Cost 3 vsldoi12 LHS, <1,6,u,7>
+ 3699081318U, // <3,1,7,0>: Cost 4 vsldoi4 <1,3,1,7>, LHS
+ 2297905162U, // <3,1,7,1>: Cost 3 vmrglw <2,6,3,7>, <0,0,1,1>
+ 2297907350U, // <3,1,7,2>: Cost 3 vmrglw <2,6,3,7>, <3,0,1,2>
+ 3365675182U, // <3,1,7,3>: Cost 4 vmrglw <1,6,3,7>, <0,2,1,3>
+ 3699084598U, // <3,1,7,4>: Cost 4 vsldoi4 <1,3,1,7>, RHS
+ 2297905490U, // <3,1,7,5>: Cost 3 vmrglw <2,6,3,7>, <0,4,1,5>
+ 2297905329U, // <3,1,7,6>: Cost 3 vmrglw <2,6,3,7>, <0,2,1,6>
+ 3368330447U, // <3,1,7,7>: Cost 4 vmrglw <2,1,3,7>, <1,6,1,7>
+ 2297905169U, // <3,1,7,u>: Cost 3 vmrglw <2,6,3,7>, <0,0,1,u>
+ 2619375876U, // <3,1,u,0>: Cost 3 vsldoi4 <0,3,1,u>, <0,3,1,u>
+ 1678558004U, // <3,1,u,1>: Cost 2 vsldoi12 LHS, <1,1,1,1>
+ 2289289366U, // <3,1,u,2>: Cost 3 vmrglw <1,2,3,u>, <3,0,1,2>
+ 1679000956U, // <3,1,u,3>: Cost 2 vsldoi12 LHS, <1,u,3,0>
+ 2619378998U, // <3,1,u,4>: Cost 3 vsldoi4 <0,3,1,u>, RHS
+ 2756945297U, // <3,1,u,5>: Cost 3 vsldoi12 LHS, <1,u,5,3>
+ 2297905329U, // <3,1,u,6>: Cost 3 vmrglw <2,6,3,7>, <0,2,1,6>
+ 2800076192U, // <3,1,u,7>: Cost 3 vsldoi12 LHS, <1,u,7,0>
+ 1683203497U, // <3,1,u,u>: Cost 2 vsldoi12 LHS, <1,u,u,0>
+ 3362964203U, // <3,2,0,0>: Cost 4 vmrglw <1,2,3,0>, <1,0,2,0>
+ 2289222380U, // <3,2,0,1>: Cost 3 vmrglw <1,2,3,0>, <1,0,2,1>
+ 2289222462U, // <3,2,0,2>: Cost 3 vmrglw <1,2,3,0>, <1,1,2,2>
+ 1215479910U, // <3,2,0,3>: Cost 2 vmrglw <1,2,3,0>, LHS
+ 3362964207U, // <3,2,0,4>: Cost 4 vmrglw <1,2,3,0>, <1,0,2,4>
+ 2289222708U, // <3,2,0,5>: Cost 3 vmrglw <1,2,3,0>, <1,4,2,5>
+ 2232600506U, // <3,2,0,6>: Cost 3 vmrghw <3,0,1,2>, <2,6,3,7>
+ 3396142296U, // <3,2,0,7>: Cost 4 vmrglw <6,7,3,0>, <1,6,2,7>
+ 1215479915U, // <3,2,0,u>: Cost 2 vmrglw <1,2,3,0>, LHS
+ 3699105894U, // <3,2,1,0>: Cost 4 vsldoi4 <1,3,2,1>, LHS
+ 3765633844U, // <3,2,1,1>: Cost 4 vsldoi8 <1,2,3,2>, <1,1,1,1>
+ 2691892120U, // <3,2,1,2>: Cost 3 vsldoi8 <1,2,3,2>, <1,2,3,2>
+ 2752300575U, // <3,2,1,3>: Cost 3 vsldoi12 LHS, <2,1,3,1>
+ 3699109174U, // <3,2,1,4>: Cost 4 vsldoi4 <1,3,2,1>, RHS
+ 3830687280U, // <3,2,1,5>: Cost 5 vsldoi12 LHS, <2,1,5,0>
+ 3830687289U, // <3,2,1,6>: Cost 4 vsldoi12 LHS, <2,1,6,0>
+ 3874260548U, // <3,2,1,7>: Cost 4 vsldoi12 LHS, <2,1,7,2>
+ 2752742988U, // <3,2,1,u>: Cost 3 vsldoi12 LHS, <2,1,u,1>
+ 2631344230U, // <3,2,2,0>: Cost 3 vsldoi4 <2,3,2,2>, LHS
+ 2697201184U, // <3,2,2,1>: Cost 3 vsldoi8 <2,1,3,2>, <2,1,3,2>
+ 1678558824U, // <3,2,2,2>: Cost 2 vsldoi12 LHS, <2,2,2,2>
+ 1678558834U, // <3,2,2,3>: Cost 2 vsldoi12 LHS, <2,2,3,3>
+ 2631347510U, // <3,2,2,4>: Cost 3 vsldoi4 <2,3,2,2>, RHS
+ 3368953613U, // <3,2,2,5>: Cost 4 vmrglw <2,2,3,2>, <2,4,2,5>
+ 2234304442U, // <3,2,2,6>: Cost 3 vmrghw <3,2,6,3>, <2,6,3,7>
+ 3368953777U, // <3,2,2,7>: Cost 4 vmrglw <2,2,3,2>, <2,6,2,7>
+ 1679001247U, // <3,2,2,u>: Cost 2 vsldoi12 LHS, <2,2,u,3>
+ 1678558886U, // <3,2,3,0>: Cost 2 vsldoi12 LHS, <2,3,0,1>
+ 2752300719U, // <3,2,3,1>: Cost 3 vsldoi12 LHS, <2,3,1,1>
+ 2752300729U, // <3,2,3,2>: Cost 3 vsldoi12 LHS, <2,3,2,2>
+ 1221476454U, // <3,2,3,3>: Cost 2 vmrglw <2,2,3,3>, LHS
+ 1678558926U, // <3,2,3,4>: Cost 2 vsldoi12 LHS, <2,3,4,5>
+ 2800076503U, // <3,2,3,5>: Cost 3 vsldoi12 LHS, <2,3,5,5>
+ 2234746810U, // <3,2,3,6>: Cost 3 vmrghw <3,3,3,3>, <2,6,3,7>
+ 2800076516U, // <3,2,3,7>: Cost 3 vsldoi12 LHS, <2,3,7,0>
+ 1678558958U, // <3,2,3,u>: Cost 2 vsldoi12 LHS, <2,3,u,1>
+ 3699130470U, // <3,2,4,0>: Cost 4 vsldoi4 <1,3,2,4>, LHS
+ 3362996972U, // <3,2,4,1>: Cost 4 vmrglw <1,2,3,4>, <1,0,2,1>
+ 2289256040U, // <3,2,4,2>: Cost 3 vmrglw <1,2,3,4>, <2,2,2,2>
+ 1215512678U, // <3,2,4,3>: Cost 2 vmrglw <1,2,3,4>, LHS
+ 3362998676U, // <3,2,4,4>: Cost 4 vmrglw <1,2,3,4>, <3,3,2,4>
+ 2691894582U, // <3,2,4,5>: Cost 3 vsldoi8 <1,2,3,2>, RHS
+ 2235582394U, // <3,2,4,6>: Cost 3 vmrghw <3,4,5,6>, <2,6,3,7>
+ 3734967544U, // <3,2,4,7>: Cost 4 vsldoi4 <7,3,2,4>, <7,3,2,4>
+ 1215512683U, // <3,2,4,u>: Cost 2 vmrglw <1,2,3,4>, LHS
+ 3705110630U, // <3,2,5,0>: Cost 4 vsldoi4 <2,3,2,5>, LHS
+ 3368313985U, // <3,2,5,1>: Cost 4 vmrglw <2,1,3,5>, <1,5,2,1>
+ 3368314472U, // <3,2,5,2>: Cost 4 vmrglw <2,1,3,5>, <2,2,2,2>
+ 2756945768U, // <3,2,5,3>: Cost 3 vsldoi12 LHS, <2,5,3,6>
+ 3705113910U, // <3,2,5,4>: Cost 4 vsldoi4 <2,3,2,5>, RHS
+ 3310061416U, // <3,2,5,5>: Cost 4 vmrghw <3,5,6,6>, <2,5,3,6>
+ 3310135226U, // <3,2,5,6>: Cost 4 vmrghw <3,5,7,6>, <2,6,3,7>
+ 3370305457U, // <3,2,5,7>: Cost 5 vmrglw <2,4,3,5>, <2,6,2,7>
+ 2752743317U, // <3,2,5,u>: Cost 3 vsldoi12 LHS, <2,5,u,6>
+ 2631376998U, // <3,2,6,0>: Cost 3 vsldoi4 <2,3,2,6>, LHS
+ 3705119540U, // <3,2,6,1>: Cost 4 vsldoi4 <2,3,2,6>, <1,1,1,1>
+ 2631378621U, // <3,2,6,2>: Cost 3 vsldoi4 <2,3,2,6>, <2,3,2,6>
+ 1678559162U, // <3,2,6,3>: Cost 2 vsldoi12 LHS, <2,6,3,7>
+ 2631380278U, // <3,2,6,4>: Cost 3 vsldoi4 <2,3,2,6>, RHS
+ 3370976956U, // <3,2,6,5>: Cost 4 vmrglw <2,5,3,6>, <2,3,2,5>
+ 2237065146U, // <3,2,6,6>: Cost 3 vmrghw <3,6,7,7>, <2,6,3,7>
+ 3798815594U, // <3,2,6,7>: Cost 4 vsldoi8 <6,7,3,2>, <6,7,3,2>
+ 1679001575U, // <3,2,6,u>: Cost 2 vsldoi12 LHS, <2,6,u,7>
+ 2800076778U, // <3,2,7,0>: Cost 3 vsldoi12 LHS, <2,7,0,1>
+ 3371647724U, // <3,2,7,1>: Cost 4 vmrglw <2,6,3,7>, <1,0,2,1>
+ 2297906792U, // <3,2,7,2>: Cost 3 vmrglw <2,6,3,7>, <2,2,2,2>
+ 1224163430U, // <3,2,7,3>: Cost 2 vmrglw <2,6,3,7>, LHS
+ 3705130294U, // <3,2,7,4>: Cost 4 vsldoi4 <2,3,2,7>, RHS
+ 3371648052U, // <3,2,7,5>: Cost 4 vmrglw <2,6,3,7>, <1,4,2,5>
+ 2297906877U, // <3,2,7,6>: Cost 3 vmrglw <2,6,3,7>, <2,3,2,6>
+ 3371648702U, // <3,2,7,7>: Cost 4 vmrglw <2,6,3,7>, <2,3,2,7>
+ 1224163435U, // <3,2,7,u>: Cost 2 vmrglw <2,6,3,7>, LHS
+ 1679001659U, // <3,2,u,0>: Cost 2 vsldoi12 LHS, <2,u,0,1>
+ 2752743492U, // <3,2,u,1>: Cost 3 vsldoi12 LHS, <2,u,1,1>
+ 1678558824U, // <3,2,u,2>: Cost 2 vsldoi12 LHS, <2,2,2,2>
+ 1678559320U, // <3,2,u,3>: Cost 2 vsldoi12 LHS, <2,u,3,3>
+ 1679001699U, // <3,2,u,4>: Cost 2 vsldoi12 LHS, <2,u,4,5>
+ 2691897498U, // <3,2,u,5>: Cost 3 vsldoi8 <1,2,3,2>, RHS
+ 2237908922U, // <3,2,u,6>: Cost 3 vmrghw <3,u,1,2>, <2,6,3,7>
+ 2800519289U, // <3,2,u,7>: Cost 3 vsldoi12 LHS, <2,u,7,0>
+ 1679001731U, // <3,2,u,u>: Cost 2 vsldoi12 LHS, <2,u,u,1>
+ 1215480726U, // <3,3,0,0>: Cost 2 vmrglw <1,2,3,0>, <1,2,3,0>
+ 1678559382U, // <3,3,0,1>: Cost 2 vsldoi12 LHS, <3,0,1,2>
+ 2631403200U, // <3,3,0,2>: Cost 3 vsldoi4 <2,3,3,0>, <2,3,3,0>
+ 2289223282U, // <3,3,0,3>: Cost 3 vmrglw <1,2,3,0>, <2,2,3,3>
+ 2752301232U, // <3,3,0,4>: Cost 3 vsldoi12 LHS, <3,0,4,1>
+ 3362965027U, // <3,3,0,5>: Cost 4 vmrglw <1,2,3,0>, <2,1,3,5>
+ 3362965352U, // <3,3,0,6>: Cost 4 vmrglw <1,2,3,0>, <2,5,3,6>
+ 2289223610U, // <3,3,0,7>: Cost 3 vmrglw <1,2,3,0>, <2,6,3,7>
+ 1678559445U, // <3,3,0,u>: Cost 2 vsldoi12 LHS, <3,0,u,2>
+ 3830687964U, // <3,3,1,0>: Cost 4 vsldoi12 LHS, <3,1,0,0>
+ 2752301286U, // <3,3,1,1>: Cost 3 vsldoi12 LHS, <3,1,1,1>
+ 2752301297U, // <3,3,1,2>: Cost 3 vsldoi12 LHS, <3,1,2,3>
+ 2305157532U, // <3,3,1,3>: Cost 3 vmrglw <3,u,3,1>, <3,3,3,3>
+ 3830688000U, // <3,3,1,4>: Cost 4 vsldoi12 LHS, <3,1,4,0>
+ 3830688009U, // <3,3,1,5>: Cost 4 vsldoi12 LHS, <3,1,5,0>
+ 3830688019U, // <3,3,1,6>: Cost 4 vsldoi12 LHS, <3,1,6,1>
+ 3362973626U, // <3,3,1,7>: Cost 4 vmrglw <1,2,3,1>, <2,6,3,7>
+ 2752743719U, // <3,3,1,u>: Cost 3 vsldoi12 LHS, <3,1,u,3>
+ 2631417958U, // <3,3,2,0>: Cost 3 vsldoi4 <2,3,3,2>, LHS
+ 3826043193U, // <3,3,2,1>: Cost 4 vsldoi12 LHS, <3,2,1,3>
+ 1624131186U, // <3,3,2,2>: Cost 2 vsldoi8 <2,2,3,3>, <2,2,3,3>
+ 2752301384U, // <3,3,2,3>: Cost 3 vsldoi12 LHS, <3,2,3,0>
+ 2631421238U, // <3,3,2,4>: Cost 3 vsldoi4 <2,3,3,2>, RHS
+ 3826485602U, // <3,3,2,5>: Cost 4 vsldoi12 LHS, <3,2,5,u>
+ 2752301414U, // <3,3,2,6>: Cost 3 vsldoi12 LHS, <3,2,6,3>
+ 2771249519U, // <3,3,2,7>: Cost 3 vsldoi12 <3,2,7,3>, <3,2,7,3>
+ 1628112984U, // <3,3,2,u>: Cost 2 vsldoi8 <2,u,3,3>, <2,u,3,3>
+ 1563656294U, // <3,3,3,0>: Cost 2 vsldoi4 <3,3,3,3>, LHS
+ 2301855911U, // <3,3,3,1>: Cost 3 vmrglw <3,3,3,3>, <3,0,3,1>
+ 2697873730U, // <3,3,3,2>: Cost 3 vsldoi8 <2,2,3,3>, <3,2,2,3>
+ 403488870U, // <3,3,3,3>: Cost 1 vspltisw3 LHS
+ 1563659574U, // <3,3,3,4>: Cost 2 vsldoi4 <3,3,3,3>, RHS
+ 2301856239U, // <3,3,3,5>: Cost 3 vmrglw <3,3,3,3>, <3,4,3,5>
+ 2697874067U, // <3,3,3,6>: Cost 3 vsldoi8 <2,2,3,3>, <3,6,3,7>
+ 2295220154U, // <3,3,3,7>: Cost 3 vmrglw <2,2,3,3>, <2,6,3,7>
+ 403488870U, // <3,3,3,u>: Cost 1 vspltisw3 LHS
+ 2289255318U, // <3,3,4,0>: Cost 3 vmrglw <1,2,3,4>, <1,2,3,0>
+ 2631435162U, // <3,3,4,1>: Cost 3 vsldoi4 <2,3,3,4>, <1,2,3,4>
+ 2631435972U, // <3,3,4,2>: Cost 3 vsldoi4 <2,3,3,4>, <2,3,3,4>
+ 2289256050U, // <3,3,4,3>: Cost 3 vmrglw <1,2,3,4>, <2,2,3,3>
+ 1215513498U, // <3,3,4,4>: Cost 2 vmrglw <1,2,3,4>, <1,2,3,4>
+ 1679002114U, // <3,3,4,5>: Cost 2 vsldoi12 LHS, <3,4,5,6>
+ 3362998120U, // <3,3,4,6>: Cost 4 vmrglw <1,2,3,4>, <2,5,3,6>
+ 2289256378U, // <3,3,4,7>: Cost 3 vmrglw <1,2,3,4>, <2,6,3,7>
+ 1679002141U, // <3,3,4,u>: Cost 2 vsldoi12 LHS, <3,4,u,6>
+ 3831130657U, // <3,3,5,0>: Cost 4 vsldoi12 LHS, <3,5,0,1>
+ 3376277671U, // <3,3,5,1>: Cost 4 vmrglw <3,4,3,5>, <3,0,3,1>
+ 3771617012U, // <3,3,5,2>: Cost 4 vsldoi8 <2,2,3,3>, <5,2,2,3>
+ 2302536092U, // <3,3,5,3>: Cost 3 vmrglw <3,4,3,5>, <3,3,3,3>
+ 3831130697U, // <3,3,5,4>: Cost 4 vsldoi12 LHS, <3,5,4,5>
+ 2294572579U, // <3,3,5,5>: Cost 3 vmrglw <2,1,3,5>, <2,1,3,5>
+ 2800519773U, // <3,3,5,6>: Cost 3 vsldoi12 LHS, <3,5,6,7>
+ 3368314810U, // <3,3,5,7>: Cost 4 vmrglw <2,1,3,5>, <2,6,3,7>
+ 2800519791U, // <3,3,5,u>: Cost 3 vsldoi12 LHS, <3,5,u,7>
+ 2800077432U, // <3,3,6,0>: Cost 3 vsldoi12 LHS, <3,6,0,7>
+ 3310291185U, // <3,3,6,1>: Cost 4 vmrghw <3,6,0,7>, <3,1,2,3>
+ 2789165706U, // <3,3,6,2>: Cost 3 vsldoi12 <6,2,7,3>, <3,6,2,7>
+ 2764982931U, // <3,3,6,3>: Cost 3 vsldoi12 <2,2,3,3>, <3,6,3,7>
+ 2800077468U, // <3,3,6,4>: Cost 3 vsldoi12 LHS, <3,6,4,7>
+ 3873819301U, // <3,3,6,5>: Cost 4 vsldoi12 LHS, <3,6,5,7>
+ 2297235304U, // <3,3,6,6>: Cost 3 vmrglw <2,5,3,6>, <2,5,3,6>
+ 2725081963U, // <3,3,6,7>: Cost 3 vsldoi8 <6,7,3,3>, <6,7,3,3>
+ 2725745596U, // <3,3,6,u>: Cost 3 vsldoi8 <6,u,3,3>, <6,u,3,3>
+ 2631458918U, // <3,3,7,0>: Cost 3 vsldoi4 <2,3,3,7>, LHS
+ 3705201460U, // <3,3,7,1>: Cost 4 vsldoi4 <2,3,3,7>, <1,1,1,1>
+ 2631460551U, // <3,3,7,2>: Cost 3 vsldoi4 <2,3,3,7>, <2,3,3,7>
+ 2297906802U, // <3,3,7,3>: Cost 3 vmrglw <2,6,3,7>, <2,2,3,3>
+ 2631462198U, // <3,3,7,4>: Cost 3 vsldoi4 <2,3,3,7>, RHS
+ 3371648547U, // <3,3,7,5>: Cost 4 vmrglw <2,6,3,7>, <2,1,3,5>
+ 3371648548U, // <3,3,7,6>: Cost 4 vmrglw <2,6,3,7>, <2,1,3,6>
+ 1224165306U, // <3,3,7,7>: Cost 2 vmrglw <2,6,3,7>, <2,6,3,7>
+ 1224165306U, // <3,3,7,u>: Cost 2 vmrglw <2,6,3,7>, <2,6,3,7>
+ 1215480726U, // <3,3,u,0>: Cost 2 vmrglw <1,2,3,0>, <1,2,3,0>
+ 1679002398U, // <3,3,u,1>: Cost 2 vsldoi12 LHS, <3,u,1,2>
+ 1659967368U, // <3,3,u,2>: Cost 2 vsldoi8 <u,2,3,3>, <u,2,3,3>
+ 403488870U, // <3,3,u,3>: Cost 1 vspltisw3 LHS
+ 1563659574U, // <3,3,u,4>: Cost 2 vsldoi4 <3,3,3,3>, RHS
+ 1679002438U, // <3,3,u,5>: Cost 2 vsldoi12 LHS, <3,u,5,6>
+ 2756946764U, // <3,3,u,6>: Cost 3 vsldoi12 LHS, <3,u,6,3>
+ 1224165306U, // <3,3,u,7>: Cost 2 vmrglw <2,6,3,7>, <2,6,3,7>
+ 403488870U, // <3,3,u,u>: Cost 1 vspltisw3 LHS
+ 2691907584U, // <3,4,0,0>: Cost 3 vsldoi8 <1,2,3,4>, <0,0,0,0>
+ 1618165862U, // <3,4,0,1>: Cost 2 vsldoi8 <1,2,3,4>, LHS
+ 2631476937U, // <3,4,0,2>: Cost 3 vsldoi4 <2,3,4,0>, <2,3,4,0>
+ 2232601732U, // <3,4,0,3>: Cost 3 vmrghw <3,0,1,2>, <4,3,5,0>
+ 2691907922U, // <3,4,0,4>: Cost 3 vsldoi8 <1,2,3,4>, <0,4,1,5>
+ 1158860086U, // <3,4,0,5>: Cost 2 vmrghw <3,0,1,2>, RHS
+ 3306343806U, // <3,4,0,6>: Cost 4 vmrghw <3,0,1,2>, <4,6,5,7>
+ 3366947484U, // <3,4,0,7>: Cost 4 vmrglw <1,u,3,0>, <3,6,4,7>
+ 1618166429U, // <3,4,0,u>: Cost 2 vsldoi8 <1,2,3,4>, LHS
+ 2631483494U, // <3,4,1,0>: Cost 3 vsldoi4 <2,3,4,1>, LHS
+ 2691908404U, // <3,4,1,1>: Cost 3 vsldoi8 <1,2,3,4>, <1,1,1,1>
+ 1618166682U, // <3,4,1,2>: Cost 2 vsldoi8 <1,2,3,4>, <1,2,3,4>
+ 3765650393U, // <3,4,1,3>: Cost 4 vsldoi8 <1,2,3,4>, <1,3,1,4>
+ 2631486774U, // <3,4,1,4>: Cost 3 vsldoi4 <2,3,4,1>, RHS
+ 2756946914U, // <3,4,1,5>: Cost 3 vsldoi12 LHS, <4,1,5,0>
+ 3765650639U, // <3,4,1,6>: Cost 4 vsldoi8 <1,2,3,4>, <1,6,1,7>
+ 3735090439U, // <3,4,1,7>: Cost 4 vsldoi4 <7,3,4,1>, <7,3,4,1>
+ 1622148480U, // <3,4,1,u>: Cost 2 vsldoi8 <1,u,3,4>, <1,u,3,4>
+ 3765650893U, // <3,4,2,0>: Cost 4 vsldoi8 <1,2,3,4>, <2,0,3,0>
+ 3831131154U, // <3,4,2,1>: Cost 4 vsldoi12 LHS, <4,2,1,3>
+ 2691909224U, // <3,4,2,2>: Cost 3 vsldoi8 <1,2,3,4>, <2,2,2,2>
+ 2691909286U, // <3,4,2,3>: Cost 3 vsldoi8 <1,2,3,4>, <2,3,0,1>
+ 2699208469U, // <3,4,2,4>: Cost 3 vsldoi8 <2,4,3,4>, <2,4,3,4>
+ 2233863478U, // <3,4,2,5>: Cost 3 vmrghw <3,2,0,3>, RHS
+ 2691909562U, // <3,4,2,6>: Cost 3 vsldoi8 <1,2,3,4>, <2,6,3,7>
+ 2701199368U, // <3,4,2,7>: Cost 3 vsldoi8 <2,7,3,4>, <2,7,3,4>
+ 2691909691U, // <3,4,2,u>: Cost 3 vsldoi8 <1,2,3,4>, <2,u,0,1>
+ 2691909782U, // <3,4,3,0>: Cost 3 vsldoi8 <1,2,3,4>, <3,0,1,2>
+ 3765651686U, // <3,4,3,1>: Cost 4 vsldoi8 <1,2,3,4>, <3,1,1,1>
+ 2691909972U, // <3,4,3,2>: Cost 3 vsldoi8 <1,2,3,4>, <3,2,4,3>
+ 2691910044U, // <3,4,3,3>: Cost 3 vsldoi8 <1,2,3,4>, <3,3,3,3>
+ 2691910096U, // <3,4,3,4>: Cost 3 vsldoi8 <1,2,3,4>, <3,4,0,1>
+ 1161006390U, // <3,4,3,5>: Cost 2 vmrghw <3,3,3,3>, RHS
+ 2691910300U, // <3,4,3,6>: Cost 3 vsldoi8 <1,2,3,4>, <3,6,4,7>
+ 3368962716U, // <3,4,3,7>: Cost 4 vmrglw <2,2,3,3>, <3,6,4,7>
+ 1161006633U, // <3,4,3,u>: Cost 2 vmrghw <3,3,3,3>, RHS
+ 2631508070U, // <3,4,4,0>: Cost 3 vsldoi4 <2,3,4,4>, LHS
+ 2631508890U, // <3,4,4,1>: Cost 3 vsldoi4 <2,3,4,4>, <1,2,3,4>
+ 2631509709U, // <3,4,4,2>: Cost 3 vsldoi4 <2,3,4,4>, <2,3,4,4>
+ 2289256788U, // <3,4,4,3>: Cost 3 vmrglw <1,2,3,4>, <3,2,4,3>
+ 1726336208U, // <3,4,4,4>: Cost 2 vsldoi12 LHS, <4,4,4,4>
+ 1618169142U, // <3,4,4,5>: Cost 2 vsldoi8 <1,2,3,4>, RHS
+ 3362998858U, // <3,4,4,6>: Cost 4 vmrglw <1,2,3,4>, <3,5,4,6>
+ 2289257116U, // <3,4,4,7>: Cost 3 vmrglw <1,2,3,4>, <3,6,4,7>
+ 1618169385U, // <3,4,4,u>: Cost 2 vsldoi8 <1,2,3,4>, RHS
+ 1557774438U, // <3,4,5,0>: Cost 2 vsldoi4 <2,3,4,5>, LHS
+ 2631516980U, // <3,4,5,1>: Cost 3 vsldoi4 <2,3,4,5>, <1,1,1,1>
+ 1557776078U, // <3,4,5,2>: Cost 2 vsldoi4 <2,3,4,5>, <2,3,4,5>
+ 2631518358U, // <3,4,5,3>: Cost 3 vsldoi4 <2,3,4,5>, <3,0,1,2>
+ 1557777718U, // <3,4,5,4>: Cost 2 vsldoi4 <2,3,4,5>, RHS
+ 2296563406U, // <3,4,5,5>: Cost 3 vmrglw <2,4,3,5>, <2,3,4,5>
+ 604818742U, // <3,4,5,6>: Cost 1 vsldoi12 LHS, RHS
+ 2661381387U, // <3,4,5,7>: Cost 3 vsldoi4 <7,3,4,5>, <7,3,4,5>
+ 604818760U, // <3,4,5,u>: Cost 1 vsldoi12 LHS, RHS
+ 3705266278U, // <3,4,6,0>: Cost 4 vsldoi4 <2,3,4,6>, LHS
+ 3831131482U, // <3,4,6,1>: Cost 4 vsldoi12 LHS, <4,6,1,7>
+ 2733715962U, // <3,4,6,2>: Cost 3 vsldoi8 <u,2,3,4>, <6,2,7,3>
+ 3844771180U, // <3,4,6,3>: Cost 4 vsldoi12 <3,2,4,3>, <4,6,3,7>
+ 2800078197U, // <3,4,6,4>: Cost 3 vsldoi12 LHS, <4,6,4,7>
+ 2236550454U, // <3,4,6,5>: Cost 3 vmrghw <3,6,0,7>, RHS
+ 2733716280U, // <3,4,6,6>: Cost 3 vsldoi8 <u,2,3,4>, <6,6,6,6>
+ 2725090156U, // <3,4,6,7>: Cost 3 vsldoi8 <6,7,3,4>, <6,7,3,4>
+ 2236550697U, // <3,4,6,u>: Cost 3 vmrghw <3,6,0,7>, RHS
+ 2733716474U, // <3,4,7,0>: Cost 3 vsldoi8 <u,2,3,4>, <7,0,1,2>
+ 3371647013U, // <3,4,7,1>: Cost 4 vmrglw <2,6,3,7>, <0,0,4,1>
+ 2727744688U, // <3,4,7,2>: Cost 3 vsldoi8 <7,2,3,4>, <7,2,3,4>
+ 3371649364U, // <3,4,7,3>: Cost 4 vmrglw <2,6,3,7>, <3,2,4,3>
+ 2733716838U, // <3,4,7,4>: Cost 3 vsldoi8 <u,2,3,4>, <7,4,5,6>
+ 2297906894U, // <3,4,7,5>: Cost 3 vmrglw <2,6,3,7>, <2,3,4,5>
+ 3371647180U, // <3,4,7,6>: Cost 4 vmrglw <2,6,3,7>, <0,2,4,6>
+ 2733717100U, // <3,4,7,7>: Cost 3 vsldoi8 <u,2,3,4>, <7,7,7,7>
+ 2297906897U, // <3,4,7,u>: Cost 3 vmrglw <2,6,3,7>, <2,3,4,u>
+ 1557799014U, // <3,4,u,0>: Cost 2 vsldoi4 <2,3,4,u>, LHS
+ 1618171694U, // <3,4,u,1>: Cost 2 vsldoi8 <1,2,3,4>, LHS
+ 1557800657U, // <3,4,u,2>: Cost 2 vsldoi4 <2,3,4,u>, <2,3,4,u>
+ 2691913660U, // <3,4,u,3>: Cost 3 vsldoi8 <1,2,3,4>, <u,3,0,1>
+ 1557802294U, // <3,4,u,4>: Cost 2 vsldoi4 <2,3,4,u>, RHS
+ 1618172058U, // <3,4,u,5>: Cost 2 vsldoi8 <1,2,3,4>, RHS
+ 604818985U, // <3,4,u,6>: Cost 1 vsldoi12 LHS, RHS
+ 2661405966U, // <3,4,u,7>: Cost 3 vsldoi4 <7,3,4,u>, <7,3,4,u>
+ 604819003U, // <3,4,u,u>: Cost 1 vsldoi12 LHS, RHS
+ 2643492966U, // <3,5,0,0>: Cost 3 vsldoi4 <4,3,5,0>, LHS
+ 2756947528U, // <3,5,0,1>: Cost 3 vsldoi12 LHS, <5,0,1,2>
+ 2331029019U, // <3,5,0,2>: Cost 3 vmrglw <u,2,3,0>, <4,u,5,2>
+ 2643495062U, // <3,5,0,3>: Cost 3 vsldoi4 <4,3,5,0>, <3,0,1,2>
+ 2756947554U, // <3,5,0,4>: Cost 3 vsldoi12 LHS, <5,0,4,1>
+ 2800078443U, // <3,5,0,5>: Cost 3 vsldoi12 LHS, <5,0,5,1>
+ 2289224194U, // <3,5,0,6>: Cost 3 vmrglw <1,2,3,0>, <3,4,5,6>
+ 3362964723U, // <3,5,0,7>: Cost 4 vmrglw <1,2,3,0>, <1,6,5,7>
+ 2756947590U, // <3,5,0,u>: Cost 3 vsldoi12 LHS, <5,0,u,1>
+ 2800078479U, // <3,5,1,0>: Cost 3 vsldoi12 LHS, <5,1,0,1>
+ 2333027218U, // <3,5,1,1>: Cost 3 vmrglw <u,5,3,1>, <4,0,5,1>
+ 2691916699U, // <3,5,1,2>: Cost 3 vsldoi8 <1,2,3,5>, <1,2,3,5>
+ 3832901294U, // <3,5,1,3>: Cost 4 vsldoi12 <1,2,5,3>, <5,1,3,5>
+ 2800078519U, // <3,5,1,4>: Cost 3 vsldoi12 LHS, <5,1,4,5>
+ 3830689467U, // <3,5,1,5>: Cost 4 vsldoi12 LHS, <5,1,5,0>
+ 3830689481U, // <3,5,1,6>: Cost 4 vsldoi12 LHS, <5,1,6,5>
+ 3873820365U, // <3,5,1,7>: Cost 4 vsldoi12 LHS, <5,1,7,0>
+ 2800078551U, // <3,5,1,u>: Cost 3 vsldoi12 LHS, <5,1,u,1>
+ 3770967487U, // <3,5,2,0>: Cost 4 vsldoi8 <2,1,3,5>, <2,0,1,4>
+ 2697225763U, // <3,5,2,1>: Cost 3 vsldoi8 <2,1,3,5>, <2,1,3,5>
+ 3830689523U, // <3,5,2,2>: Cost 4 vsldoi12 LHS, <5,2,2,2>
+ 2699216590U, // <3,5,2,3>: Cost 3 vsldoi8 <2,4,3,5>, <2,3,4,5>
+ 2699216662U, // <3,5,2,4>: Cost 3 vsldoi8 <2,4,3,5>, <2,4,3,5>
+ 2783047439U, // <3,5,2,5>: Cost 3 vsldoi12 <5,2,5,3>, <5,2,5,3>
+ 2783121176U, // <3,5,2,6>: Cost 3 vsldoi12 <5,2,6,3>, <5,2,6,3>
+ 3856936737U, // <3,5,2,7>: Cost 4 vsldoi12 <5,2,7,3>, <5,2,7,3>
+ 2701871194U, // <3,5,2,u>: Cost 3 vsldoi8 <2,u,3,5>, <2,u,3,5>
+ 2643517542U, // <3,5,3,0>: Cost 3 vsldoi4 <4,3,5,3>, LHS
+ 2331052946U, // <3,5,3,1>: Cost 3 vmrglw <u,2,3,3>, <4,0,5,1>
+ 3699345010U, // <3,5,3,2>: Cost 4 vsldoi4 <1,3,5,3>, <2,2,3,3>
+ 2705189276U, // <3,5,3,3>: Cost 3 vsldoi8 <3,4,3,5>, <3,3,3,3>
+ 2705189359U, // <3,5,3,4>: Cost 3 vsldoi8 <3,4,3,5>, <3,4,3,5>
+ 2331053274U, // <3,5,3,5>: Cost 3 vmrglw <u,2,3,3>, <4,4,5,5>
+ 2295220738U, // <3,5,3,6>: Cost 3 vmrglw <2,2,3,3>, <3,4,5,6>
+ 3368961267U, // <3,5,3,7>: Cost 4 vmrglw <2,2,3,3>, <1,6,5,7>
+ 2295220740U, // <3,5,3,u>: Cost 3 vmrglw <2,2,3,3>, <3,4,5,u>
+ 2643525734U, // <3,5,4,0>: Cost 3 vsldoi4 <4,3,5,4>, LHS
+ 2331061138U, // <3,5,4,1>: Cost 3 vmrglw <u,2,3,4>, <4,0,5,1>
+ 2235584280U, // <3,5,4,2>: Cost 3 vmrghw <3,4,5,6>, <5,2,6,3>
+ 2643528194U, // <3,5,4,3>: Cost 3 vsldoi4 <4,3,5,4>, <3,4,5,6>
+ 2735713498U, // <3,5,4,4>: Cost 3 vsldoi8 <u,5,3,5>, <4,4,5,5>
+ 2756947892U, // <3,5,4,5>: Cost 3 vsldoi12 LHS, <5,4,5,6>
+ 2289256962U, // <3,5,4,6>: Cost 3 vmrglw <1,2,3,4>, <3,4,5,6>
+ 3362997491U, // <3,5,4,7>: Cost 4 vmrglw <1,2,3,4>, <1,6,5,7>
+ 2756947919U, // <3,5,4,u>: Cost 3 vsldoi12 LHS, <5,4,u,6>
+ 2800078803U, // <3,5,5,0>: Cost 3 vsldoi12 LHS, <5,5,0,1>
+ 2800078812U, // <3,5,5,1>: Cost 3 vsldoi12 LHS, <5,5,1,1>
+ 2631591639U, // <3,5,5,2>: Cost 3 vsldoi4 <2,3,5,5>, <2,3,5,5>
+ 3832901616U, // <3,5,5,3>: Cost 4 vsldoi12 <1,2,5,3>, <5,5,3,3>
+ 2800078843U, // <3,5,5,4>: Cost 3 vsldoi12 LHS, <5,5,4,5>
+ 1726337028U, // <3,5,5,5>: Cost 2 vsldoi12 LHS, <5,5,5,5>
+ 2800078862U, // <3,5,5,6>: Cost 3 vsldoi12 LHS, <5,5,6,6>
+ 3368314099U, // <3,5,5,7>: Cost 4 vmrglw <2,1,3,5>, <1,6,5,7>
+ 1726337028U, // <3,5,5,u>: Cost 2 vsldoi12 LHS, <5,5,5,5>
+ 2800078884U, // <3,5,6,0>: Cost 3 vsldoi12 LHS, <5,6,0,1>
+ 2800078899U, // <3,5,6,1>: Cost 3 vsldoi12 LHS, <5,6,1,7>
+ 2631599832U, // <3,5,6,2>: Cost 3 vsldoi4 <2,3,5,6>, <2,3,5,6>
+ 2800078914U, // <3,5,6,3>: Cost 3 vsldoi12 LHS, <5,6,3,4>
+ 2800078924U, // <3,5,6,4>: Cost 3 vsldoi12 LHS, <5,6,4,5>
+ 2800078935U, // <3,5,6,5>: Cost 3 vsldoi12 LHS, <5,6,5,7>
+ 2297235970U, // <3,5,6,6>: Cost 3 vmrglw <2,5,3,6>, <3,4,5,6>
+ 1726337122U, // <3,5,6,7>: Cost 2 vsldoi12 LHS, <5,6,7,0>
+ 1726337131U, // <3,5,6,u>: Cost 2 vsldoi12 LHS, <5,6,u,0>
+ 3699376230U, // <3,5,7,0>: Cost 4 vsldoi4 <1,3,5,7>, LHS
+ 2333739922U, // <3,5,7,1>: Cost 3 vmrglw <u,6,3,7>, <4,0,5,1>
+ 3699378106U, // <3,5,7,2>: Cost 4 vsldoi4 <1,3,5,7>, <2,6,3,7>
+ 3371647915U, // <3,5,7,3>: Cost 4 vmrglw <2,6,3,7>, <1,2,5,3>
+ 3699379510U, // <3,5,7,4>: Cost 4 vsldoi4 <1,3,5,7>, RHS
+ 2333740250U, // <3,5,7,5>: Cost 3 vmrglw <u,6,3,7>, <4,4,5,5>
+ 2297907714U, // <3,5,7,6>: Cost 3 vmrglw <2,6,3,7>, <3,4,5,6>
+ 3370984691U, // <3,5,7,7>: Cost 4 vmrglw <2,5,3,7>, <1,6,5,7>
+ 2297907716U, // <3,5,7,u>: Cost 3 vmrglw <2,6,3,7>, <3,4,5,u>
+ 2800079046U, // <3,5,u,0>: Cost 3 vsldoi12 LHS, <5,u,0,1>
+ 2756948176U, // <3,5,u,1>: Cost 3 vsldoi12 LHS, <5,u,1,2>
+ 2331029019U, // <3,5,u,2>: Cost 3 vmrglw <u,2,3,0>, <4,u,5,2>
+ 2800079076U, // <3,5,u,3>: Cost 3 vsldoi12 LHS, <5,u,3,4>
+ 2800079085U, // <3,5,u,4>: Cost 3 vsldoi12 LHS, <5,u,4,4>
+ 1726337028U, // <3,5,u,5>: Cost 2 vsldoi12 LHS, <5,5,5,5>
+ 2289289730U, // <3,5,u,6>: Cost 3 vmrglw <1,2,3,u>, <3,4,5,6>
+ 1726337284U, // <3,5,u,7>: Cost 2 vsldoi12 LHS, <5,u,7,0>
+ 1726337293U, // <3,5,u,u>: Cost 2 vsldoi12 LHS, <5,u,u,0>
+ 3773628416U, // <3,6,0,0>: Cost 4 vsldoi8 <2,5,3,6>, <0,0,0,0>
+ 2699886694U, // <3,6,0,1>: Cost 3 vsldoi8 <2,5,3,6>, LHS
+ 2789167401U, // <3,6,0,2>: Cost 3 vsldoi12 <6,2,7,3>, <6,0,2,1>
+ 3362965862U, // <3,6,0,3>: Cost 4 vmrglw <1,2,3,0>, <3,2,6,3>
+ 3773628754U, // <3,6,0,4>: Cost 4 vsldoi8 <2,5,3,6>, <0,4,1,5>
+ 3723284326U, // <3,6,0,5>: Cost 4 vsldoi4 <5,3,6,0>, <5,3,6,0>
+ 2800079181U, // <3,6,0,6>: Cost 3 vsldoi12 LHS, <6,0,6,1>
+ 1215483190U, // <3,6,0,7>: Cost 2 vmrglw <1,2,3,0>, RHS
+ 1215483191U, // <3,6,0,u>: Cost 2 vmrglw <1,2,3,0>, RHS
+ 3873821032U, // <3,6,1,0>: Cost 4 vsldoi12 LHS, <6,1,0,1>
+ 3773629236U, // <3,6,1,1>: Cost 4 vsldoi8 <2,5,3,6>, <1,1,1,1>
+ 2691924892U, // <3,6,1,2>: Cost 3 vsldoi8 <1,2,3,6>, <1,2,3,6>
+ 3830690184U, // <3,6,1,3>: Cost 5 vsldoi12 LHS, <6,1,3,6>
+ 3873821072U, // <3,6,1,4>: Cost 4 vsldoi12 LHS, <6,1,4,5>
+ 3873821082U, // <3,6,1,5>: Cost 4 vsldoi12 LHS, <6,1,5,6>
+ 3403453240U, // <3,6,1,6>: Cost 4 vmrglw <u,0,3,1>, <6,6,6,6>
+ 2289233206U, // <3,6,1,7>: Cost 3 vmrglw <1,2,3,1>, RHS
+ 2289233207U, // <3,6,1,u>: Cost 3 vmrglw <1,2,3,1>, RHS
+ 2661498982U, // <3,6,2,0>: Cost 3 vsldoi4 <7,3,6,2>, LHS
+ 3770975780U, // <3,6,2,1>: Cost 4 vsldoi8 <2,1,3,6>, <2,1,3,6>
+ 2631640797U, // <3,6,2,2>: Cost 3 vsldoi4 <2,3,6,2>, <2,3,6,2>
+ 3771639485U, // <3,6,2,3>: Cost 4 vsldoi8 <2,2,3,6>, <2,3,2,6>
+ 2661502262U, // <3,6,2,4>: Cost 3 vsldoi4 <7,3,6,2>, RHS
+ 2699888488U, // <3,6,2,5>: Cost 3 vsldoi8 <2,5,3,6>, <2,5,3,6>
+ 2661503482U, // <3,6,2,6>: Cost 3 vsldoi4 <7,3,6,2>, <6,2,7,3>
+ 1715425786U, // <3,6,2,7>: Cost 2 vsldoi12 <6,2,7,3>, <6,2,7,3>
+ 1715499523U, // <3,6,2,u>: Cost 2 vsldoi12 <6,2,u,3>, <6,2,u,3>
+ 3773630614U, // <3,6,3,0>: Cost 4 vsldoi8 <2,5,3,6>, <3,0,1,2>
+ 3372942825U, // <3,6,3,1>: Cost 4 vmrglw <2,u,3,3>, <2,0,6,1>
+ 2234749434U, // <3,6,3,2>: Cost 3 vmrghw <3,3,3,3>, <6,2,7,3>
+ 3368962406U, // <3,6,3,3>: Cost 4 vmrglw <2,2,3,3>, <3,2,6,3>
+ 2699889154U, // <3,6,3,4>: Cost 3 vsldoi8 <2,5,3,6>, <3,4,5,6>
+ 3773631068U, // <3,6,3,5>: Cost 4 vsldoi8 <2,5,3,6>, <3,5,6,6>
+ 2331054904U, // <3,6,3,6>: Cost 3 vmrglw <u,2,3,3>, <6,6,6,6>
+ 1221479734U, // <3,6,3,7>: Cost 2 vmrglw <2,2,3,3>, RHS
+ 1221479735U, // <3,6,3,u>: Cost 2 vmrglw <2,2,3,3>, RHS
+ 2235584801U, // <3,6,4,0>: Cost 3 vmrghw <3,4,5,6>, <6,0,1,2>
+ 3717342106U, // <3,6,4,1>: Cost 4 vsldoi4 <4,3,6,4>, <1,2,3,4>
+ 2789167729U, // <3,6,4,2>: Cost 3 vsldoi12 <6,2,7,3>, <6,4,2,5>
+ 2235585074U, // <3,6,4,3>: Cost 3 vmrghw <3,4,5,6>, <6,3,4,5>
+ 2235585165U, // <3,6,4,4>: Cost 3 vmrghw <3,4,5,6>, <6,4,5,6>
+ 2699889974U, // <3,6,4,5>: Cost 3 vsldoi8 <2,5,3,6>, RHS
+ 2800079509U, // <3,6,4,6>: Cost 3 vsldoi12 LHS, <6,4,6,5>
+ 1215515958U, // <3,6,4,7>: Cost 2 vmrglw <1,2,3,4>, RHS
+ 1215515959U, // <3,6,4,u>: Cost 2 vmrglw <1,2,3,4>, RHS
+ 3873821356U, // <3,6,5,0>: Cost 4 vsldoi12 LHS, <6,5,0,1>
+ 3372959209U, // <3,6,5,1>: Cost 5 vmrglw <2,u,3,5>, <2,0,6,1>
+ 3862909629U, // <3,6,5,2>: Cost 4 vsldoi12 <6,2,7,3>, <6,5,2,0>
+ 3773632358U, // <3,6,5,3>: Cost 4 vsldoi8 <2,5,3,6>, <5,3,6,0>
+ 3873821396U, // <3,6,5,4>: Cost 4 vsldoi12 LHS, <6,5,4,5>
+ 3873821405U, // <3,6,5,5>: Cost 4 vsldoi12 LHS, <6,5,5,5>
+ 3862909672U, // <3,6,5,6>: Cost 4 vsldoi12 <6,2,7,3>, <6,5,6,7>
+ 2294574390U, // <3,6,5,7>: Cost 3 vmrglw <2,1,3,5>, RHS
+ 2294574391U, // <3,6,5,u>: Cost 3 vmrglw <2,1,3,5>, RHS
+ 2800079613U, // <3,6,6,0>: Cost 3 vsldoi12 LHS, <6,6,0,1>
+ 3873821446U, // <3,6,6,1>: Cost 4 vsldoi12 LHS, <6,6,1,1>
+ 2789167888U, // <3,6,6,2>: Cost 3 vsldoi12 <6,2,7,3>, <6,6,2,2>
+ 3844920090U, // <3,6,6,3>: Cost 4 vsldoi12 <3,2,6,3>, <6,6,3,3>
+ 2800079653U, // <3,6,6,4>: Cost 3 vsldoi12 LHS, <6,6,4,5>
+ 3723333484U, // <3,6,6,5>: Cost 4 vsldoi4 <5,3,6,6>, <5,3,6,6>
+ 1726337848U, // <3,6,6,6>: Cost 2 vsldoi12 LHS, <6,6,6,6>
+ 1726337858U, // <3,6,6,7>: Cost 2 vsldoi12 LHS, <6,6,7,7>
+ 1726337867U, // <3,6,6,u>: Cost 2 vsldoi12 LHS, <6,6,u,7>
+ 1726337870U, // <3,6,7,0>: Cost 2 vsldoi12 LHS, <6,7,0,1>
+ 2297906665U, // <3,6,7,1>: Cost 3 vmrglw <2,6,3,7>, <2,0,6,1>
+ 2792117090U, // <3,6,7,2>: Cost 3 vsldoi12 <6,7,2,3>, <6,7,2,3>
+ 2297907558U, // <3,6,7,3>: Cost 3 vmrglw <2,6,3,7>, <3,2,6,3>
+ 1726337910U, // <3,6,7,4>: Cost 2 vsldoi12 LHS, <6,7,4,5>
+ 2297906993U, // <3,6,7,5>: Cost 3 vmrglw <2,6,3,7>, <2,4,6,5>
+ 2297906832U, // <3,6,7,6>: Cost 3 vmrglw <2,6,3,7>, <2,2,6,6>
+ 1224166710U, // <3,6,7,7>: Cost 2 vmrglw <2,6,3,7>, RHS
+ 1224166711U, // <3,6,7,u>: Cost 2 vmrglw <2,6,3,7>, RHS
+ 1726337951U, // <3,6,u,0>: Cost 2 vsldoi12 LHS, <6,u,0,1>
+ 2699892526U, // <3,6,u,1>: Cost 3 vsldoi8 <2,5,3,6>, LHS
+ 2789168049U, // <3,6,u,2>: Cost 3 vsldoi12 <6,2,7,3>, <6,u,2,1>
+ 2792854460U, // <3,6,u,3>: Cost 3 vsldoi12 <6,u,3,3>, <6,u,3,3>
+ 1726337991U, // <3,6,u,4>: Cost 2 vsldoi12 LHS, <6,u,4,5>
+ 2699892890U, // <3,6,u,5>: Cost 3 vsldoi8 <2,5,3,6>, RHS
+ 1726337848U, // <3,6,u,6>: Cost 2 vsldoi12 LHS, <6,6,6,6>
+ 1215548726U, // <3,6,u,7>: Cost 2 vmrglw <1,2,3,u>, RHS
+ 1215548727U, // <3,6,u,u>: Cost 2 vmrglw <1,2,3,u>, RHS
+ 2700558336U, // <3,7,0,0>: Cost 3 vsldoi8 <2,6,3,7>, <0,0,0,0>
+ 1626816614U, // <3,7,0,1>: Cost 2 vsldoi8 <2,6,3,7>, LHS
+ 2700558513U, // <3,7,0,2>: Cost 3 vsldoi8 <2,6,3,7>, <0,2,1,6>
+ 2331030010U, // <3,7,0,3>: Cost 3 vmrglw <u,2,3,0>, <6,2,7,3>
+ 2700558674U, // <3,7,0,4>: Cost 3 vsldoi8 <2,6,3,7>, <0,4,1,5>
+ 2800079906U, // <3,7,0,5>: Cost 3 vsldoi12 LHS, <7,0,5,6>
+ 2655588936U, // <3,7,0,6>: Cost 3 vsldoi4 <6,3,7,0>, <6,3,7,0>
+ 2800079919U, // <3,7,0,7>: Cost 3 vsldoi12 LHS, <7,0,7,1>
+ 1626817181U, // <3,7,0,u>: Cost 2 vsldoi8 <2,6,3,7>, LHS
+ 3774300899U, // <3,7,1,0>: Cost 4 vsldoi8 <2,6,3,7>, <1,0,1,1>
+ 2700559156U, // <3,7,1,1>: Cost 3 vsldoi8 <2,6,3,7>, <1,1,1,1>
+ 2700559254U, // <3,7,1,2>: Cost 3 vsldoi8 <2,6,3,7>, <1,2,3,0>
+ 3774301148U, // <3,7,1,3>: Cost 4 vsldoi8 <2,6,3,7>, <1,3,1,7>
+ 3774301227U, // <3,7,1,4>: Cost 4 vsldoi8 <2,6,3,7>, <1,4,1,5>
+ 3774301295U, // <3,7,1,5>: Cost 4 vsldoi8 <2,6,3,7>, <1,5,0,1>
+ 3768329441U, // <3,7,1,6>: Cost 4 vsldoi8 <1,6,3,7>, <1,6,3,7>
+ 3403453250U, // <3,7,1,7>: Cost 4 vmrglw <u,0,3,1>, <6,6,7,7>
+ 2700559740U, // <3,7,1,u>: Cost 3 vsldoi8 <2,6,3,7>, <1,u,3,0>
+ 2700559849U, // <3,7,2,0>: Cost 3 vsldoi8 <2,6,3,7>, <2,0,6,1>
+ 3770983973U, // <3,7,2,1>: Cost 4 vsldoi8 <2,1,3,7>, <2,1,3,7>
+ 2700559976U, // <3,7,2,2>: Cost 3 vsldoi8 <2,6,3,7>, <2,2,2,2>
+ 2698569415U, // <3,7,2,3>: Cost 3 vsldoi8 <2,3,3,7>, <2,3,3,7>
+ 2700560177U, // <3,7,2,4>: Cost 3 vsldoi8 <2,6,3,7>, <2,4,6,5>
+ 3773638505U, // <3,7,2,5>: Cost 4 vsldoi8 <2,5,3,7>, <2,5,3,7>
+ 1626818490U, // <3,7,2,6>: Cost 2 vsldoi8 <2,6,3,7>, <2,6,3,7>
+ 2795140307U, // <3,7,2,7>: Cost 3 vsldoi12 <7,2,7,3>, <7,2,7,3>
+ 1628145756U, // <3,7,2,u>: Cost 2 vsldoi8 <2,u,3,7>, <2,u,3,7>
+ 2700560534U, // <3,7,3,0>: Cost 3 vsldoi8 <2,6,3,7>, <3,0,1,2>
+ 3774302438U, // <3,7,3,1>: Cost 4 vsldoi8 <2,6,3,7>, <3,1,1,1>
+ 2700560742U, // <3,7,3,2>: Cost 3 vsldoi8 <2,6,3,7>, <3,2,6,3>
+ 2700560796U, // <3,7,3,3>: Cost 3 vsldoi8 <2,6,3,7>, <3,3,3,3>
+ 2700560898U, // <3,7,3,4>: Cost 3 vsldoi8 <2,6,3,7>, <3,4,5,6>
+ 3774302821U, // <3,7,3,5>: Cost 4 vsldoi8 <2,6,3,7>, <3,5,7,6>
+ 2700561079U, // <3,7,3,6>: Cost 3 vsldoi8 <2,6,3,7>, <3,6,7,7>
+ 2700561091U, // <3,7,3,7>: Cost 3 vsldoi8 <2,6,3,7>, <3,7,0,1>
+ 2700561182U, // <3,7,3,u>: Cost 3 vsldoi8 <2,6,3,7>, <3,u,1,2>
+ 2655617126U, // <3,7,4,0>: Cost 3 vsldoi4 <6,3,7,4>, LHS
+ 3774303178U, // <3,7,4,1>: Cost 4 vsldoi8 <2,6,3,7>, <4,1,2,3>
+ 2655619002U, // <3,7,4,2>: Cost 3 vsldoi4 <6,3,7,4>, <2,6,3,7>
+ 2331062778U, // <3,7,4,3>: Cost 3 vmrglw <u,2,3,4>, <6,2,7,3>
+ 2655620406U, // <3,7,4,4>: Cost 3 vsldoi4 <6,3,7,4>, RHS
+ 1626819894U, // <3,7,4,5>: Cost 2 vsldoi8 <2,6,3,7>, RHS
+ 2655621708U, // <3,7,4,6>: Cost 3 vsldoi4 <6,3,7,4>, <6,3,7,4>
+ 2800080247U, // <3,7,4,7>: Cost 3 vsldoi12 LHS, <7,4,7,5>
+ 1626820137U, // <3,7,4,u>: Cost 2 vsldoi8 <2,6,3,7>, RHS
+ 3774303816U, // <3,7,5,0>: Cost 4 vsldoi8 <2,6,3,7>, <5,0,1,2>
+ 3873822093U, // <3,7,5,1>: Cost 4 vsldoi12 LHS, <7,5,1,0>
+ 3774303998U, // <3,7,5,2>: Cost 4 vsldoi8 <2,6,3,7>, <5,2,3,4>
+ 3862910368U, // <3,7,5,3>: Cost 4 vsldoi12 <6,2,7,3>, <7,5,3,1>
+ 3774304180U, // <3,7,5,4>: Cost 4 vsldoi8 <2,6,3,7>, <5,4,5,6>
+ 2800080310U, // <3,7,5,5>: Cost 3 vsldoi12 LHS, <7,5,5,5>
+ 2800080321U, // <3,7,5,6>: Cost 3 vsldoi12 LHS, <7,5,6,7>
+ 3873822147U, // <3,7,5,7>: Cost 4 vsldoi12 LHS, <7,5,7,0>
+ 2800080339U, // <3,7,5,u>: Cost 3 vsldoi12 LHS, <7,5,u,7>
+ 2800080348U, // <3,7,6,0>: Cost 3 vsldoi12 LHS, <7,6,0,7>
+ 3873822181U, // <3,7,6,1>: Cost 4 vsldoi12 LHS, <7,6,1,7>
+ 2789168622U, // <3,7,6,2>: Cost 3 vsldoi12 <6,2,7,3>, <7,6,2,7>
+ 2700563016U, // <3,7,6,3>: Cost 3 vsldoi8 <2,6,3,7>, <6,3,7,0>
+ 2800080384U, // <3,7,6,4>: Cost 3 vsldoi12 LHS, <7,6,4,7>
+ 3862910472U, // <3,7,6,5>: Cost 4 vsldoi12 <6,2,7,3>, <7,6,5,6>
+ 2700563256U, // <3,7,6,6>: Cost 3 vsldoi8 <2,6,3,7>, <6,6,6,6>
+ 2800080404U, // <3,7,6,7>: Cost 3 vsldoi12 LHS, <7,6,7,0>
+ 2793149988U, // <3,7,6,u>: Cost 3 vsldoi12 <6,u,7,3>, <7,6,u,7>
+ 2637725798U, // <3,7,7,0>: Cost 3 vsldoi4 <3,3,7,7>, LHS
+ 3371649227U, // <3,7,7,1>: Cost 4 vmrglw <2,6,3,7>, <3,0,7,1>
+ 2637727674U, // <3,7,7,2>: Cost 3 vsldoi4 <3,3,7,7>, <2,6,3,7>
+ 2297907567U, // <3,7,7,3>: Cost 3 vmrglw <2,6,3,7>, <3,2,7,3>
+ 2637729078U, // <3,7,7,4>: Cost 3 vsldoi4 <3,3,7,7>, RHS
+ 3371649312U, // <3,7,7,5>: Cost 4 vmrglw <2,6,3,7>, <3,1,7,5>
+ 2655646287U, // <3,7,7,6>: Cost 3 vsldoi4 <6,3,7,7>, <6,3,7,7>
+ 1726338668U, // <3,7,7,7>: Cost 2 vsldoi12 LHS, <7,7,7,7>
+ 1726338668U, // <3,7,7,u>: Cost 2 vsldoi12 LHS, <7,7,7,7>
+ 2700564179U, // <3,7,u,0>: Cost 3 vsldoi8 <2,6,3,7>, <u,0,1,2>
+ 1626822446U, // <3,7,u,1>: Cost 2 vsldoi8 <2,6,3,7>, LHS
+ 2700564357U, // <3,7,u,2>: Cost 3 vsldoi8 <2,6,3,7>, <u,2,3,0>
+ 2700564412U, // <3,7,u,3>: Cost 3 vsldoi8 <2,6,3,7>, <u,3,0,1>
+ 2700564543U, // <3,7,u,4>: Cost 3 vsldoi8 <2,6,3,7>, <u,4,5,6>
+ 1626822810U, // <3,7,u,5>: Cost 2 vsldoi8 <2,6,3,7>, RHS
+ 1662654672U, // <3,7,u,6>: Cost 2 vsldoi8 <u,6,3,7>, <u,6,3,7>
+ 1726338668U, // <3,7,u,7>: Cost 2 vsldoi12 LHS, <7,7,7,7>
+ 1626823013U, // <3,7,u,u>: Cost 2 vsldoi8 <2,6,3,7>, LHS
+ 1678557184U, // <3,u,0,0>: Cost 2 vsldoi12 LHS, <0,0,0,0>
+ 1679005395U, // <3,u,0,1>: Cost 2 vsldoi12 LHS, <u,0,1,2>
+ 2289221787U, // <3,u,0,2>: Cost 3 vmrglw <1,2,3,0>, <0,1,u,2>
+ 1215479964U, // <3,u,0,3>: Cost 2 vmrglw <1,2,3,0>, LHS
+ 2752747245U, // <3,u,0,4>: Cost 3 vsldoi12 LHS, <u,0,4,1>
+ 1158863002U, // <3,u,0,5>: Cost 2 vmrghw <3,0,1,2>, RHS
+ 2289224221U, // <3,u,0,6>: Cost 3 vmrglw <1,2,3,0>, <3,4,u,6>
+ 1215483208U, // <3,u,0,7>: Cost 2 vmrglw <1,2,3,0>, RHS
+ 1679005458U, // <3,u,0,u>: Cost 2 vsldoi12 LHS, <u,0,u,2>
+ 1558036582U, // <3,u,1,0>: Cost 2 vsldoi4 <2,3,u,1>, LHS
+ 1678558004U, // <3,u,1,1>: Cost 2 vsldoi12 LHS, <1,1,1,1>
+ 604821294U, // <3,u,1,2>: Cost 1 vsldoi12 LHS, LHS
+ 2752747317U, // <3,u,1,3>: Cost 3 vsldoi12 LHS, <u,1,3,1>
+ 1558039862U, // <3,u,1,4>: Cost 2 vsldoi4 <2,3,u,1>, RHS
+ 2756949830U, // <3,u,1,5>: Cost 3 vsldoi12 LHS, <u,1,5,0>
+ 2800080726U, // <3,u,1,6>: Cost 3 vsldoi12 LHS, <u,1,6,7>
+ 2289233224U, // <3,u,1,7>: Cost 3 vmrglw <1,2,3,1>, RHS
+ 604821348U, // <3,u,1,u>: Cost 1 vsldoi12 LHS, LHS
+ 2696586709U, // <3,u,2,0>: Cost 3 vsldoi8 <2,0,3,u>, <2,0,3,u>
+ 2757392246U, // <3,u,2,1>: Cost 3 vsldoi12 LHS, <u,2,1,3>
+ 1624172151U, // <3,u,2,2>: Cost 2 vsldoi8 <2,2,3,u>, <2,2,3,u>
+ 1679005576U, // <3,u,2,3>: Cost 2 vsldoi12 LHS, <u,2,3,3>
+ 2631789878U, // <3,u,2,4>: Cost 3 vsldoi4 <2,3,u,2>, RHS
+ 2699904874U, // <3,u,2,5>: Cost 3 vsldoi8 <2,5,3,u>, <2,5,3,u>
+ 1626826683U, // <3,u,2,6>: Cost 2 vsldoi8 <2,6,3,u>, <2,6,3,u>
+ 1726338988U, // <3,u,2,7>: Cost 2 vsldoi12 LHS, <u,2,7,3>
+ 1683208117U, // <3,u,2,u>: Cost 2 vsldoi12 LHS, <u,2,u,3>
+ 1679005628U, // <3,u,3,0>: Cost 2 vsldoi12 LHS, <u,3,0,1>
+ 1161008942U, // <3,u,3,1>: Cost 2 vmrghw <3,3,3,3>, LHS
+ 2752747471U, // <3,u,3,2>: Cost 3 vsldoi12 LHS, <u,3,2,2>
+ 403488870U, // <3,u,3,3>: Cost 1 vspltisw3 LHS
+ 1679005668U, // <3,u,3,4>: Cost 2 vsldoi12 LHS, <u,3,4,5>
+ 1161009306U, // <3,u,3,5>: Cost 2 vmrghw <3,3,3,3>, RHS
+ 2691943104U, // <3,u,3,6>: Cost 3 vsldoi8 <1,2,3,u>, <3,6,u,7>
+ 1221479752U, // <3,u,3,7>: Cost 2 vmrglw <2,2,3,3>, RHS
+ 403488870U, // <3,u,3,u>: Cost 1 vspltisw3 LHS
+ 2289255363U, // <3,u,4,0>: Cost 3 vmrglw <1,2,3,4>, <1,2,u,0>
+ 1161844526U, // <3,u,4,1>: Cost 2 vmrghw <3,4,5,6>, LHS
+ 2289256661U, // <3,u,4,2>: Cost 3 vmrglw <1,2,3,4>, <3,0,u,2>
+ 1215512732U, // <3,u,4,3>: Cost 2 vmrglw <1,2,3,4>, LHS
+ 1215513498U, // <3,u,4,4>: Cost 2 vmrglw <1,2,3,4>, <1,2,3,4>
+ 1679005759U, // <3,u,4,5>: Cost 2 vsldoi12 LHS, <u,4,5,6>
+ 2289256989U, // <3,u,4,6>: Cost 3 vmrglw <1,2,3,4>, <3,4,u,6>
+ 1215515976U, // <3,u,4,7>: Cost 2 vmrglw <1,2,3,4>, RHS
+ 1679005786U, // <3,u,4,u>: Cost 2 vsldoi12 LHS, <u,4,u,6>
+ 1558069350U, // <3,u,5,0>: Cost 2 vsldoi4 <2,3,u,5>, LHS
+ 2631811892U, // <3,u,5,1>: Cost 3 vsldoi4 <2,3,u,5>, <1,1,1,1>
+ 1558071026U, // <3,u,5,2>: Cost 2 vsldoi4 <2,3,u,5>, <2,3,u,5>
+ 2752747646U, // <3,u,5,3>: Cost 3 vsldoi12 LHS, <u,5,3,6>
+ 1558072630U, // <3,u,5,4>: Cost 2 vsldoi4 <2,3,u,5>, RHS
+ 1726337028U, // <3,u,5,5>: Cost 2 vsldoi12 LHS, <5,5,5,5>
+ 604821658U, // <3,u,5,6>: Cost 1 vsldoi12 LHS, RHS
+ 2294574408U, // <3,u,5,7>: Cost 3 vmrglw <2,1,3,5>, RHS
+ 604821676U, // <3,u,5,u>: Cost 1 vsldoi12 LHS, RHS
+ 2631819366U, // <3,u,6,0>: Cost 3 vsldoi4 <2,3,u,6>, LHS
+ 2757392574U, // <3,u,6,1>: Cost 3 vsldoi12 LHS, <u,6,1,7>
+ 2631821043U, // <3,u,6,2>: Cost 3 vsldoi4 <2,3,u,6>, <2,3,u,6>
+ 1679005904U, // <3,u,6,3>: Cost 2 vsldoi12 LHS, <u,6,3,7>
+ 2631822646U, // <3,u,6,4>: Cost 3 vsldoi4 <2,3,u,6>, RHS
+ 2236553370U, // <3,u,6,5>: Cost 3 vmrghw <3,6,0,7>, RHS
+ 1726337848U, // <3,u,6,6>: Cost 2 vsldoi12 LHS, <6,6,6,6>
+ 1726339309U, // <3,u,6,7>: Cost 2 vsldoi12 LHS, <u,6,7,0>
+ 1683208445U, // <3,u,6,u>: Cost 2 vsldoi12 LHS, <u,6,u,7>
+ 1726339328U, // <3,u,7,0>: Cost 2 vsldoi12 LHS, <u,7,0,1>
+ 2297905225U, // <3,u,7,1>: Cost 3 vmrglw <2,6,3,7>, <0,0,u,1>
+ 2631829236U, // <3,u,7,2>: Cost 3 vsldoi4 <2,3,u,7>, <2,3,u,7>
+ 1224163484U, // <3,u,7,3>: Cost 2 vmrglw <2,6,3,7>, LHS
+ 1726339368U, // <3,u,7,4>: Cost 2 vsldoi12 LHS, <u,7,4,5>
+ 2297905553U, // <3,u,7,5>: Cost 3 vmrglw <2,6,3,7>, <0,4,u,5>
+ 2297905392U, // <3,u,7,6>: Cost 3 vmrglw <2,6,3,7>, <0,2,u,6>
+ 1224166728U, // <3,u,7,7>: Cost 2 vmrglw <2,6,3,7>, RHS
+ 1224163489U, // <3,u,7,u>: Cost 2 vmrglw <2,6,3,7>, LHS
+ 1683208529U, // <3,u,u,0>: Cost 2 vsldoi12 LHS, <u,u,0,1>
+ 1679006043U, // <3,u,u,1>: Cost 2 vsldoi12 LHS, <u,u,1,2>
+ 604821861U, // <3,u,u,2>: Cost 1 vsldoi12 LHS, LHS
+ 403488870U, // <3,u,u,3>: Cost 1 vspltisw3 LHS
+ 1683208569U, // <3,u,u,4>: Cost 2 vsldoi12 LHS, <u,u,4,5>
+ 1679006083U, // <3,u,u,5>: Cost 2 vsldoi12 LHS, <u,u,5,6>
+ 604821901U, // <3,u,u,6>: Cost 1 vsldoi12 LHS, RHS
+ 1215548744U, // <3,u,u,7>: Cost 2 vmrglw <1,2,3,u>, RHS
+ 604821915U, // <3,u,u,u>: Cost 1 vsldoi12 LHS, LHS
+ 2759016448U, // <4,0,0,0>: Cost 3 vsldoi12 <1,2,3,4>, <0,0,0,0>
+ 1165115494U, // <4,0,0,1>: Cost 2 vmrghw <4,0,5,1>, LHS
+ 3717531337U, // <4,0,0,2>: Cost 4 vsldoi4 <4,4,0,0>, <2,3,4,0>
+ 3369675785U, // <4,0,0,3>: Cost 4 vmrglw <2,3,4,0>, <4,2,0,3>
+ 2751791144U, // <4,0,0,4>: Cost 3 vsldoi12 <0,0,4,4>, <0,0,4,4>
+ 2238857630U, // <4,0,0,5>: Cost 3 vmrghw <4,0,5,1>, <0,5,1,0>
+ 3312591341U, // <4,0,0,6>: Cost 4 vmrghw <4,0,5,0>, <0,6,0,7>
+ 3369676113U, // <4,0,0,7>: Cost 4 vmrglw <2,3,4,0>, <4,6,0,7>
+ 1165116061U, // <4,0,0,u>: Cost 2 vmrghw <4,0,5,1>, LHS
+ 2637824102U, // <4,0,1,0>: Cost 3 vsldoi4 <3,4,0,1>, LHS
+ 2637824922U, // <4,0,1,1>: Cost 3 vsldoi4 <3,4,0,1>, <1,2,3,4>
+ 1685274726U, // <4,0,1,2>: Cost 2 vsldoi12 <1,2,3,4>, LHS
+ 2637826512U, // <4,0,1,3>: Cost 3 vsldoi4 <3,4,0,1>, <3,4,0,1>
+ 2637827382U, // <4,0,1,4>: Cost 3 vsldoi4 <3,4,0,1>, RHS
+ 2661716070U, // <4,0,1,5>: Cost 3 vsldoi4 <7,4,0,1>, <5,6,7,4>
+ 3729486427U, // <4,0,1,6>: Cost 4 vsldoi4 <6,4,0,1>, <6,4,0,1>
+ 2661717300U, // <4,0,1,7>: Cost 3 vsldoi4 <7,4,0,1>, <7,4,0,1>
+ 1685274780U, // <4,0,1,u>: Cost 2 vsldoi12 <1,2,3,4>, LHS
+ 3711574118U, // <4,0,2,0>: Cost 4 vsldoi4 <3,4,0,2>, LHS
+ 2240200806U, // <4,0,2,1>: Cost 3 vmrghw <4,2,5,3>, LHS
+ 3771663992U, // <4,0,2,2>: Cost 4 vsldoi8 <2,2,4,0>, <2,2,4,0>
+ 2698585801U, // <4,0,2,3>: Cost 3 vsldoi8 <2,3,4,0>, <2,3,4,0>
+ 3373672105U, // <4,0,2,4>: Cost 4 vmrglw <3,0,4,2>, <2,3,0,4>
+ 3810813795U, // <4,0,2,5>: Cost 4 vsldoi8 <u,7,4,0>, <2,5,3,1>
+ 3772327866U, // <4,0,2,6>: Cost 4 vsldoi8 <2,3,4,0>, <2,6,3,7>
+ 3386280568U, // <4,0,2,7>: Cost 5 vmrglw <5,1,4,2>, <3,6,0,7>
+ 2701903966U, // <4,0,2,u>: Cost 3 vsldoi8 <2,u,4,0>, <2,u,4,0>
+ 3699638374U, // <4,0,3,0>: Cost 4 vsldoi4 <1,4,0,3>, LHS
+ 2753560832U, // <4,0,3,1>: Cost 3 vsldoi12 <0,3,1,4>, <0,3,1,4>
+ 3772328276U, // <4,0,3,2>: Cost 4 vsldoi8 <2,3,4,0>, <3,2,4,3>
+ 3827302674U, // <4,0,3,3>: Cost 4 vsldoi12 <0,3,1,4>, <0,3,3,4>
+ 3699641654U, // <4,0,3,4>: Cost 4 vsldoi4 <1,4,0,3>, RHS
+ 3779627588U, // <4,0,3,5>: Cost 4 vsldoi8 <3,5,4,0>, <3,5,4,0>
+ 3772328604U, // <4,0,3,6>: Cost 4 vsldoi8 <2,3,4,0>, <3,6,4,7>
+ 3780954854U, // <4,0,3,7>: Cost 4 vsldoi8 <3,7,4,0>, <3,7,4,0>
+ 2753560832U, // <4,0,3,u>: Cost 3 vsldoi12 <0,3,1,4>, <0,3,1,4>
+ 2725129106U, // <4,0,4,0>: Cost 3 vsldoi8 <6,7,4,0>, <4,0,5,1>
+ 1167720550U, // <4,0,4,1>: Cost 2 vmrghw <4,4,4,4>, LHS
+ 3839172953U, // <4,0,4,2>: Cost 4 vsldoi12 <2,3,0,4>, <0,4,2,3>
+ 3772329051U, // <4,0,4,3>: Cost 4 vsldoi8 <2,3,4,0>, <4,3,0,4>
+ 2241462610U, // <4,0,4,4>: Cost 3 vmrghw <4,4,4,4>, <0,4,1,5>
+ 2698587446U, // <4,0,4,5>: Cost 3 vsldoi8 <2,3,4,0>, RHS
+ 3772329297U, // <4,0,4,6>: Cost 4 vsldoi8 <2,3,4,0>, <4,6,0,7>
+ 3735483703U, // <4,0,4,7>: Cost 4 vsldoi4 <7,4,0,4>, <7,4,0,4>
+ 1167721117U, // <4,0,4,u>: Cost 2 vmrghw <4,4,4,4>, LHS
+ 1168556032U, // <4,0,5,0>: Cost 2 vmrghw RHS, <0,0,0,0>
+ 94814310U, // <4,0,5,1>: Cost 1 vmrghw RHS, LHS
+ 2242298029U, // <4,0,5,2>: Cost 3 vmrghw RHS, <0,2,1,2>
+ 2637859284U, // <4,0,5,3>: Cost 3 vsldoi4 <3,4,0,5>, <3,4,0,5>
+ 1168556370U, // <4,0,5,4>: Cost 2 vmrghw RHS, <0,4,1,5>
+ 2242306530U, // <4,0,5,5>: Cost 3 vmrghw RHS, <0,5,u,5>
+ 2242298358U, // <4,0,5,6>: Cost 3 vmrghw RHS, <0,6,1,7>
+ 2661750072U, // <4,0,5,7>: Cost 3 vsldoi4 <7,4,0,5>, <7,4,0,5>
+ 94814877U, // <4,0,5,u>: Cost 1 vmrghw RHS, LHS
+ 3316580362U, // <4,0,6,0>: Cost 4 vmrghw <4,6,5,1>, <0,0,1,1>
+ 2242846822U, // <4,0,6,1>: Cost 3 vmrghw <4,6,5,2>, LHS
+ 3798872570U, // <4,0,6,2>: Cost 4 vsldoi8 <6,7,4,0>, <6,2,7,3>
+ 3796218413U, // <4,0,6,3>: Cost 4 vsldoi8 <6,3,4,0>, <6,3,4,0>
+ 3834528273U, // <4,0,6,4>: Cost 4 vsldoi12 <1,5,0,4>, <0,6,4,7>
+ 3798872811U, // <4,0,6,5>: Cost 4 vsldoi8 <6,7,4,0>, <6,5,7,1>
+ 3316621876U, // <4,0,6,6>: Cost 4 vmrghw <4,6,5,6>, <0,6,u,6>
+ 2725131121U, // <4,0,6,7>: Cost 3 vsldoi8 <6,7,4,0>, <6,7,4,0>
+ 2242847389U, // <4,0,6,u>: Cost 3 vmrghw <4,6,5,2>, LHS
+ 3377692672U, // <4,0,7,0>: Cost 4 vmrglw <3,6,4,7>, <0,0,0,0>
+ 2243493990U, // <4,0,7,1>: Cost 3 vmrghw <4,7,5,0>, LHS
+ 3775648970U, // <4,0,7,2>: Cost 5 vsldoi8 <2,u,4,0>, <7,2,6,3>
+ 3802191110U, // <4,0,7,3>: Cost 4 vsldoi8 <7,3,4,0>, <7,3,4,0>
+ 3317236050U, // <4,0,7,4>: Cost 4 vmrghw <4,7,5,0>, <0,4,1,5>
+ 3803518376U, // <4,0,7,5>: Cost 4 vsldoi8 <7,5,4,0>, <7,5,4,0>
+ 3317236214U, // <4,0,7,6>: Cost 5 vmrghw <4,7,5,0>, <0,6,1,7>
+ 3798873708U, // <4,0,7,7>: Cost 4 vsldoi8 <6,7,4,0>, <7,7,7,7>
+ 2243494557U, // <4,0,7,u>: Cost 3 vmrghw <4,7,5,0>, LHS
+ 1170546688U, // <4,0,u,0>: Cost 2 vmrghw RHS, <0,0,0,0>
+ 96804966U, // <4,0,u,1>: Cost 1 vmrghw RHS, LHS
+ 1685275293U, // <4,0,u,2>: Cost 2 vsldoi12 <1,2,3,4>, LHS
+ 2637883863U, // <4,0,u,3>: Cost 3 vsldoi4 <3,4,0,u>, <3,4,0,u>
+ 1170547026U, // <4,0,u,4>: Cost 2 vmrghw RHS, <0,4,1,5>
+ 2698590362U, // <4,0,u,5>: Cost 3 vsldoi8 <2,3,4,0>, RHS
+ 2244289014U, // <4,0,u,6>: Cost 3 vmrghw RHS, <0,6,1,7>
+ 2661774651U, // <4,0,u,7>: Cost 3 vsldoi4 <7,4,0,u>, <7,4,0,u>
+ 96805533U, // <4,0,u,u>: Cost 1 vmrghw RHS, LHS
+ 2667749478U, // <4,1,0,0>: Cost 3 vsldoi4 <u,4,1,0>, LHS
+ 2689966182U, // <4,1,0,1>: Cost 3 vsldoi8 <0,u,4,1>, LHS
+ 2238571418U, // <4,1,0,2>: Cost 3 vmrghw <4,0,1,2>, <1,2,3,4>
+ 3711633880U, // <4,1,0,3>: Cost 4 vsldoi4 <3,4,1,0>, <3,4,1,0>
+ 2689966418U, // <4,1,0,4>: Cost 3 vsldoi8 <0,u,4,1>, <0,4,1,5>
+ 3361046866U, // <4,1,0,5>: Cost 4 vmrglw <0,u,4,0>, <0,4,1,5>
+ 3741495802U, // <4,1,0,6>: Cost 4 vsldoi4 <u,4,1,0>, <6,2,7,3>
+ 3741496314U, // <4,1,0,7>: Cost 4 vsldoi4 <u,4,1,0>, <7,0,1,2>
+ 2689966765U, // <4,1,0,u>: Cost 3 vsldoi8 <0,u,4,1>, <0,u,4,1>
+ 3764372222U, // <4,1,1,0>: Cost 4 vsldoi8 <1,0,4,1>, <1,0,4,1>
+ 2758206263U, // <4,1,1,1>: Cost 3 vsldoi12 <1,1,1,4>, <1,1,1,4>
+ 2698593178U, // <4,1,1,2>: Cost 3 vsldoi8 <2,3,4,1>, <1,2,3,4>
+ 3361057810U, // <4,1,1,3>: Cost 4 vmrglw <0,u,4,1>, <4,2,1,3>
+ 3827303250U, // <4,1,1,4>: Cost 4 vsldoi12 <0,3,1,4>, <1,1,4,4>
+ 2287313234U, // <4,1,1,5>: Cost 3 vmrglw <0,u,4,1>, <0,4,1,5>
+ 3763709171U, // <4,1,1,6>: Cost 4 vsldoi8 <0,u,4,1>, <1,6,5,7>
+ 3361058138U, // <4,1,1,7>: Cost 4 vmrglw <0,u,4,1>, <4,6,1,7>
+ 2239759744U, // <4,1,1,u>: Cost 3 vmrghw <4,1,u,3>, <1,u,3,4>
+ 2637906022U, // <4,1,2,0>: Cost 3 vsldoi4 <3,4,1,2>, LHS
+ 2637906842U, // <4,1,2,1>: Cost 3 vsldoi4 <3,4,1,2>, <1,2,3,4>
+ 3763709544U, // <4,1,2,2>: Cost 4 vsldoi8 <0,u,4,1>, <2,2,2,2>
+ 1685275546U, // <4,1,2,3>: Cost 2 vsldoi12 <1,2,3,4>, <1,2,3,4>
+ 2637909302U, // <4,1,2,4>: Cost 3 vsldoi4 <3,4,1,2>, RHS
+ 3361063250U, // <4,1,2,5>: Cost 4 vmrglw <0,u,4,2>, <0,4,1,5>
+ 3763709882U, // <4,1,2,6>: Cost 4 vsldoi8 <0,u,4,1>, <2,6,3,7>
+ 3735541054U, // <4,1,2,7>: Cost 4 vsldoi4 <7,4,1,2>, <7,4,1,2>
+ 1685644231U, // <4,1,2,u>: Cost 2 vsldoi12 <1,2,u,4>, <1,2,u,4>
+ 2702575792U, // <4,1,3,0>: Cost 3 vsldoi8 <3,0,4,1>, <3,0,4,1>
+ 3832759257U, // <4,1,3,1>: Cost 4 vsldoi12 <1,2,3,4>, <1,3,1,4>
+ 3833349090U, // <4,1,3,2>: Cost 4 vsldoi12 <1,3,2,4>, <1,3,2,4>
+ 3763710364U, // <4,1,3,3>: Cost 4 vsldoi8 <0,u,4,1>, <3,3,3,3>
+ 2707884546U, // <4,1,3,4>: Cost 3 vsldoi8 <3,u,4,1>, <3,4,5,6>
+ 3361071442U, // <4,1,3,5>: Cost 4 vmrglw <0,u,4,3>, <0,4,1,5>
+ 3772336796U, // <4,1,3,6>: Cost 4 vsldoi8 <2,3,4,1>, <3,6,4,7>
+ 3775654595U, // <4,1,3,7>: Cost 5 vsldoi8 <2,u,4,1>, <3,7,0,1>
+ 2707884856U, // <4,1,3,u>: Cost 3 vsldoi8 <3,u,4,1>, <3,u,4,1>
+ 2667782246U, // <4,1,4,0>: Cost 3 vsldoi4 <u,4,1,4>, LHS
+ 2241463092U, // <4,1,4,1>: Cost 3 vmrghw <4,4,4,4>, <1,1,1,1>
+ 2241553306U, // <4,1,4,2>: Cost 3 vmrghw <4,4,5,6>, <1,2,3,4>
+ 3827303484U, // <4,1,4,3>: Cost 4 vsldoi12 <0,3,1,4>, <1,4,3,4>
+ 2667785424U, // <4,1,4,4>: Cost 3 vsldoi4 <u,4,1,4>, <4,4,4,4>
+ 2689969462U, // <4,1,4,5>: Cost 3 vsldoi8 <0,u,4,1>, RHS
+ 3763711322U, // <4,1,4,6>: Cost 4 vsldoi8 <0,u,4,1>, <4,6,1,7>
+ 3867116636U, // <4,1,4,7>: Cost 4 vsldoi12 <7,0,1,4>, <1,4,7,0>
+ 2689969705U, // <4,1,4,u>: Cost 3 vsldoi8 <0,u,4,1>, RHS
+ 1546273106U, // <4,1,5,0>: Cost 2 vsldoi4 <0,4,1,5>, <0,4,1,5>
+ 1168556852U, // <4,1,5,1>: Cost 2 vmrghw RHS, <1,1,1,1>
+ 1168556950U, // <4,1,5,2>: Cost 2 vmrghw RHS, <1,2,3,0>
+ 2620016790U, // <4,1,5,3>: Cost 3 vsldoi4 <0,4,1,5>, <3,0,1,2>
+ 1546276150U, // <4,1,5,4>: Cost 2 vsldoi4 <0,4,1,5>, RHS
+ 2620018692U, // <4,1,5,5>: Cost 3 vsldoi4 <0,4,1,5>, <5,5,5,5>
+ 2242299087U, // <4,1,5,6>: Cost 3 vmrghw RHS, <1,6,1,7>
+ 2667795450U, // <4,1,5,7>: Cost 3 vsldoi4 <u,4,1,5>, <7,0,1,2>
+ 1546278702U, // <4,1,5,u>: Cost 2 vsldoi4 <0,4,1,5>, LHS
+ 3781628193U, // <4,1,6,0>: Cost 4 vsldoi8 <3,u,4,1>, <6,0,1,2>
+ 3832759503U, // <4,1,6,1>: Cost 4 vsldoi12 <1,2,3,4>, <1,6,1,7>
+ 3316261786U, // <4,1,6,2>: Cost 4 vmrghw <4,6,0,7>, <1,2,3,4>
+ 3781628466U, // <4,1,6,3>: Cost 4 vsldoi8 <3,u,4,1>, <6,3,4,5>
+ 3827303658U, // <4,1,6,4>: Cost 4 vsldoi12 <0,3,1,4>, <1,6,4,7>
+ 3361096018U, // <4,1,6,5>: Cost 4 vmrglw <0,u,4,6>, <0,4,1,5>
+ 3788264248U, // <4,1,6,6>: Cost 4 vsldoi8 <5,0,4,1>, <6,6,6,6>
+ 3788264270U, // <4,1,6,7>: Cost 4 vsldoi8 <5,0,4,1>, <6,7,0,1>
+ 3832759566U, // <4,1,6,u>: Cost 4 vsldoi12 <1,2,3,4>, <1,6,u,7>
+ 2726466580U, // <4,1,7,0>: Cost 3 vsldoi8 <7,0,4,1>, <7,0,4,1>
+ 3377692682U, // <4,1,7,1>: Cost 4 vmrglw <3,6,4,7>, <0,0,1,1>
+ 3377694870U, // <4,1,7,2>: Cost 4 vmrglw <3,6,4,7>, <3,0,1,2>
+ 3802199303U, // <4,1,7,3>: Cost 4 vsldoi8 <7,3,4,1>, <7,3,4,1>
+ 2731775334U, // <4,1,7,4>: Cost 3 vsldoi8 <7,u,4,1>, <7,4,5,6>
+ 3377693010U, // <4,1,7,5>: Cost 4 vmrglw <3,6,4,7>, <0,4,1,5>
+ 3365749804U, // <4,1,7,6>: Cost 5 vmrglw <1,6,4,7>, <1,4,1,6>
+ 3788265068U, // <4,1,7,7>: Cost 4 vsldoi8 <5,0,4,1>, <7,7,7,7>
+ 2731775644U, // <4,1,7,u>: Cost 3 vsldoi8 <7,u,4,1>, <7,u,4,1>
+ 1546297685U, // <4,1,u,0>: Cost 2 vsldoi4 <0,4,1,u>, <0,4,1,u>
+ 1170547508U, // <4,1,u,1>: Cost 2 vmrghw RHS, <1,1,1,1>
+ 1170547606U, // <4,1,u,2>: Cost 2 vmrghw RHS, <1,2,3,0>
+ 1689257344U, // <4,1,u,3>: Cost 2 vsldoi12 <1,u,3,4>, <1,u,3,4>
+ 1546300726U, // <4,1,u,4>: Cost 2 vsldoi4 <0,4,1,u>, RHS
+ 2284716370U, // <4,1,u,5>: Cost 3 vmrglw <0,4,4,u>, <0,4,1,5>
+ 2244289743U, // <4,1,u,6>: Cost 3 vmrghw RHS, <1,6,1,7>
+ 2667820026U, // <4,1,u,7>: Cost 3 vsldoi4 <u,4,1,u>, <7,0,1,2>
+ 1546303278U, // <4,1,u,u>: Cost 2 vsldoi4 <0,4,1,u>, LHS
+ 3729621094U, // <4,2,0,0>: Cost 4 vsldoi4 <6,4,2,0>, LHS
+ 3763716198U, // <4,2,0,1>: Cost 4 vsldoi8 <0,u,4,2>, LHS
+ 2238858856U, // <4,2,0,2>: Cost 3 vmrghw <4,0,5,1>, <2,2,2,2>
+ 2295930982U, // <4,2,0,3>: Cost 3 vmrglw <2,3,4,0>, LHS
+ 3763716434U, // <4,2,0,4>: Cost 4 vsldoi8 <0,u,4,2>, <0,4,1,5>
+ 2238859107U, // <4,2,0,5>: Cost 3 vmrghw <4,0,5,1>, <2,5,3,1>
+ 2238859194U, // <4,2,0,6>: Cost 3 vmrghw <4,0,5,1>, <2,6,3,7>
+ 3312601066U, // <4,2,0,7>: Cost 4 vmrghw <4,0,5,1>, <2,7,0,1>
+ 2295930987U, // <4,2,0,u>: Cost 3 vmrglw <2,3,4,0>, LHS
+ 3699769446U, // <4,2,1,0>: Cost 4 vsldoi4 <1,4,2,1>, LHS
+ 3313255971U, // <4,2,1,1>: Cost 4 vmrghw <4,1,5,0>, <2,1,3,5>
+ 3361056360U, // <4,2,1,2>: Cost 4 vmrglw <0,u,4,1>, <2,2,2,2>
+ 2287312998U, // <4,2,1,3>: Cost 3 vmrglw <0,u,4,1>, LHS
+ 3788932148U, // <4,2,1,4>: Cost 4 vsldoi8 <5,1,4,2>, <1,4,2,5>
+ 3313256290U, // <4,2,1,5>: Cost 4 vmrghw <4,1,5,0>, <2,5,3,0>
+ 3838289469U, // <4,2,1,6>: Cost 4 vsldoi12 <2,1,6,4>, <2,1,6,4>
+ 3369682865U, // <4,2,1,7>: Cost 5 vmrglw <2,3,4,1>, <2,6,2,7>
+ 2287313003U, // <4,2,1,u>: Cost 3 vmrglw <0,u,4,1>, LHS
+ 3838658133U, // <4,2,2,0>: Cost 4 vsldoi12 <2,2,2,4>, <2,2,0,1>
+ 3711722394U, // <4,2,2,1>: Cost 4 vsldoi4 <3,4,2,2>, <1,2,3,4>
+ 2759018088U, // <4,2,2,2>: Cost 3 vsldoi12 <1,2,3,4>, <2,2,2,2>
+ 2759018098U, // <4,2,2,3>: Cost 3 vsldoi12 <1,2,3,4>, <2,2,3,3>
+ 3838658168U, // <4,2,2,4>: Cost 4 vsldoi12 <2,2,2,4>, <2,2,4,0>
+ 3369027341U, // <4,2,2,5>: Cost 4 vmrglw <2,2,4,2>, <2,4,2,5>
+ 2240227258U, // <4,2,2,6>: Cost 3 vmrghw <4,2,5,6>, <2,6,3,7>
+ 3735614791U, // <4,2,2,7>: Cost 4 vsldoi4 <7,4,2,2>, <7,4,2,2>
+ 2759018143U, // <4,2,2,u>: Cost 3 vsldoi12 <1,2,3,4>, <2,2,u,3>
+ 2759018150U, // <4,2,3,0>: Cost 3 vsldoi12 <1,2,3,4>, <2,3,0,1>
+ 3831948975U, // <4,2,3,1>: Cost 4 vsldoi12 <1,1,1,4>, <2,3,1,1>
+ 3832759993U, // <4,2,3,2>: Cost 4 vsldoi12 <1,2,3,4>, <2,3,2,2>
+ 2759018180U, // <4,2,3,3>: Cost 3 vsldoi12 <1,2,3,4>, <2,3,3,4>
+ 2759018185U, // <4,2,3,4>: Cost 3 vsldoi12 <1,2,3,4>, <2,3,4,0>
+ 3839542998U, // <4,2,3,5>: Cost 4 vsldoi12 <2,3,5,4>, <2,3,5,4>
+ 3314640826U, // <4,2,3,6>: Cost 4 vmrghw <4,3,5,7>, <2,6,3,7>
+ 2765948648U, // <4,2,3,7>: Cost 3 vsldoi12 <2,3,7,4>, <2,3,7,4>
+ 2759018222U, // <4,2,3,u>: Cost 3 vsldoi12 <1,2,3,4>, <2,3,u,1>
+ 3838658295U, // <4,2,4,0>: Cost 4 vsldoi12 <2,2,2,4>, <2,4,0,1>
+ 3315205667U, // <4,2,4,1>: Cost 4 vmrghw <4,4,4,4>, <2,1,3,5>
+ 2241463912U, // <4,2,4,2>: Cost 3 vmrghw <4,4,4,4>, <2,2,2,2>
+ 1234829414U, // <4,2,4,3>: Cost 2 vmrglw <4,4,4,4>, LHS
+ 2241464085U, // <4,2,4,4>: Cost 3 vmrghw <4,4,4,4>, <2,4,3,4>
+ 2241546087U, // <4,2,4,5>: Cost 3 vmrghw <4,4,5,5>, <2,5,3,5>
+ 2241464250U, // <4,2,4,6>: Cost 3 vmrghw <4,4,4,4>, <2,6,3,7>
+ 3741602873U, // <4,2,4,7>: Cost 4 vsldoi4 <u,4,2,4>, <7,0,u,2>
+ 1234829419U, // <4,2,4,u>: Cost 2 vmrglw <4,4,4,4>, LHS
+ 2626060390U, // <4,2,5,0>: Cost 3 vsldoi4 <1,4,2,5>, LHS
+ 2626061364U, // <4,2,5,1>: Cost 3 vsldoi4 <1,4,2,5>, <1,4,2,5>
+ 1168557672U, // <4,2,5,2>: Cost 2 vmrghw RHS, <2,2,2,2>
+ 1222230118U, // <4,2,5,3>: Cost 2 vmrglw <2,3,4,5>, LHS
+ 2626063670U, // <4,2,5,4>: Cost 3 vsldoi4 <1,4,2,5>, RHS
+ 2242299752U, // <4,2,5,5>: Cost 3 vmrghw RHS, <2,5,3,6>
+ 1168558010U, // <4,2,5,6>: Cost 2 vmrghw RHS, <2,6,3,7>
+ 2242299882U, // <4,2,5,7>: Cost 3 vmrghw RHS, <2,7,0,1>
+ 1222230123U, // <4,2,5,u>: Cost 2 vmrglw <2,3,4,5>, LHS
+ 3711754342U, // <4,2,6,0>: Cost 4 vsldoi4 <3,4,2,6>, LHS
+ 3711755162U, // <4,2,6,1>: Cost 4 vsldoi4 <3,4,2,6>, <1,2,3,4>
+ 3838658481U, // <4,2,6,2>: Cost 4 vsldoi12 <2,2,2,4>, <2,6,2,7>
+ 2759018426U, // <4,2,6,3>: Cost 3 vsldoi12 <1,2,3,4>, <2,6,3,7>
+ 3838658499U, // <4,2,6,4>: Cost 4 vsldoi12 <2,2,2,4>, <2,6,4,7>
+ 3735646310U, // <4,2,6,5>: Cost 4 vsldoi4 <7,4,2,6>, <5,6,7,4>
+ 3316590522U, // <4,2,6,6>: Cost 4 vmrghw <4,6,5,2>, <2,6,3,7>
+ 3798889331U, // <4,2,6,7>: Cost 4 vsldoi8 <6,7,4,2>, <6,7,4,2>
+ 2759018471U, // <4,2,6,u>: Cost 3 vsldoi12 <1,2,3,4>, <2,6,u,7>
+ 3874564074U, // <4,2,7,0>: Cost 4 vsldoi12 <u,2,3,4>, <2,7,0,1>
+ 3800880230U, // <4,2,7,1>: Cost 4 vsldoi8 <7,1,4,2>, <7,1,4,2>
+ 3371722344U, // <4,2,7,2>: Cost 4 vmrglw <2,6,4,7>, <2,2,2,2>
+ 2303950950U, // <4,2,7,3>: Cost 3 vmrglw <3,6,4,7>, LHS
+ 3371722346U, // <4,2,7,4>: Cost 4 vmrglw <2,6,4,7>, <2,2,2,4>
+ 3371722509U, // <4,2,7,5>: Cost 5 vmrglw <2,6,4,7>, <2,4,2,5>
+ 3317237690U, // <4,2,7,6>: Cost 4 vmrghw <4,7,5,0>, <2,6,3,7>
+ 3317237738U, // <4,2,7,7>: Cost 4 vmrghw <4,7,5,0>, <2,7,0,1>
+ 2303950955U, // <4,2,7,u>: Cost 3 vmrglw <3,6,4,7>, LHS
+ 2759018555U, // <4,2,u,0>: Cost 3 vsldoi12 <1,2,3,4>, <2,u,0,1>
+ 2626085943U, // <4,2,u,1>: Cost 3 vsldoi4 <1,4,2,u>, <1,4,2,u>
+ 1170548328U, // <4,2,u,2>: Cost 2 vmrghw RHS, <2,2,2,2>
+ 1222254694U, // <4,2,u,3>: Cost 2 vmrglw <2,3,4,u>, LHS
+ 2759018595U, // <4,2,u,4>: Cost 3 vsldoi12 <1,2,3,4>, <2,u,4,5>
+ 2244290408U, // <4,2,u,5>: Cost 3 vmrghw RHS, <2,5,3,6>
+ 1170548666U, // <4,2,u,6>: Cost 2 vmrghw RHS, <2,6,3,7>
+ 2769266813U, // <4,2,u,7>: Cost 3 vsldoi12 <2,u,7,4>, <2,u,7,4>
+ 1222254699U, // <4,2,u,u>: Cost 2 vmrglw <2,3,4,u>, LHS
+ 2238859414U, // <4,3,0,0>: Cost 3 vmrghw <4,0,5,1>, <3,0,1,2>
+ 2759018646U, // <4,3,0,1>: Cost 3 vsldoi12 <1,2,3,4>, <3,0,1,2>
+ 3312314708U, // <4,3,0,2>: Cost 4 vmrghw <4,0,1,2>, <3,2,4,3>
+ 2238859676U, // <4,3,0,3>: Cost 3 vmrghw <4,0,5,1>, <3,3,3,3>
+ 2295931802U, // <4,3,0,4>: Cost 3 vmrglw <2,3,4,0>, <1,2,3,4>
+ 3735670886U, // <4,3,0,5>: Cost 4 vsldoi4 <7,4,3,0>, <5,6,7,4>
+ 3312315036U, // <4,3,0,6>: Cost 4 vmrghw <4,0,1,2>, <3,6,4,7>
+ 3369674682U, // <4,3,0,7>: Cost 4 vmrglw <2,3,4,0>, <2,6,3,7>
+ 2759018709U, // <4,3,0,u>: Cost 3 vsldoi12 <1,2,3,4>, <3,0,u,2>
+ 3361055638U, // <4,3,1,0>: Cost 4 vmrglw <0,u,4,1>, <1,2,3,0>
+ 3831949542U, // <4,3,1,1>: Cost 4 vsldoi12 <1,1,1,4>, <3,1,1,1>
+ 2703917978U, // <4,3,1,2>: Cost 3 vsldoi8 <3,2,4,3>, <1,2,3,4>
+ 3361056370U, // <4,3,1,3>: Cost 4 vmrglw <0,u,4,1>, <2,2,3,3>
+ 2295939994U, // <4,3,1,4>: Cost 3 vmrglw <2,3,4,1>, <1,2,3,4>
+ 3361056291U, // <4,3,1,5>: Cost 4 vmrglw <0,u,4,1>, <2,1,3,5>
+ 3378972520U, // <4,3,1,6>: Cost 4 vmrglw <3,u,4,1>, <2,5,3,6>
+ 3361056698U, // <4,3,1,7>: Cost 4 vmrglw <0,u,4,1>, <2,6,3,7>
+ 2703917978U, // <4,3,1,u>: Cost 3 vsldoi8 <3,2,4,3>, <1,2,3,4>
+ 3832760624U, // <4,3,2,0>: Cost 4 vsldoi12 <1,2,3,4>, <3,2,0,3>
+ 3711796122U, // <4,3,2,1>: Cost 4 vsldoi4 <3,4,3,2>, <1,2,3,4>
+ 3832760641U, // <4,3,2,2>: Cost 4 vsldoi12 <1,2,3,4>, <3,2,2,2>
+ 2770962764U, // <4,3,2,3>: Cost 3 vsldoi12 <3,2,3,4>, <3,2,3,4>
+ 2759018836U, // <4,3,2,4>: Cost 3 vsldoi12 <1,2,3,4>, <3,2,4,3>
+ 3827304802U, // <4,3,2,5>: Cost 5 vsldoi12 <0,3,1,4>, <3,2,5,u>
+ 3832760678U, // <4,3,2,6>: Cost 4 vsldoi12 <1,2,3,4>, <3,2,6,3>
+ 3859597679U, // <4,3,2,7>: Cost 4 vsldoi12 <5,6,7,4>, <3,2,7,3>
+ 2771331449U, // <4,3,2,u>: Cost 3 vsldoi12 <3,2,u,4>, <3,2,u,4>
+ 2240841878U, // <4,3,3,0>: Cost 3 vmrghw <4,3,5,0>, <3,0,1,2>
+ 3776997635U, // <4,3,3,1>: Cost 4 vsldoi8 <3,1,4,3>, <3,1,4,3>
+ 2703919444U, // <4,3,3,2>: Cost 3 vsldoi8 <3,2,4,3>, <3,2,4,3>
+ 2759018908U, // <4,3,3,3>: Cost 3 vsldoi12 <1,2,3,4>, <3,3,3,3>
+ 2759018918U, // <4,3,3,4>: Cost 3 vsldoi12 <1,2,3,4>, <3,3,4,4>
+ 3386951446U, // <4,3,3,5>: Cost 4 vmrglw <5,2,4,3>, <2,4,3,5>
+ 3777661596U, // <4,3,3,6>: Cost 4 vsldoi8 <3,2,4,3>, <3,6,4,7>
+ 3375007674U, // <4,3,3,7>: Cost 4 vmrglw <3,2,4,3>, <2,6,3,7>
+ 2707901242U, // <4,3,3,u>: Cost 3 vsldoi8 <3,u,4,3>, <3,u,4,3>
+ 2759018960U, // <4,3,4,0>: Cost 3 vsldoi12 <1,2,3,4>, <3,4,0,1>
+ 2759018970U, // <4,3,4,1>: Cost 3 vsldoi12 <1,2,3,4>, <3,4,1,2>
+ 2632099605U, // <4,3,4,2>: Cost 3 vsldoi4 <2,4,3,4>, <2,4,3,4>
+ 2241464732U, // <4,3,4,3>: Cost 3 vmrghw <4,4,4,4>, <3,3,3,3>
+ 2759019000U, // <4,3,4,4>: Cost 3 vsldoi12 <1,2,3,4>, <3,4,4,5>
+ 2753563138U, // <4,3,4,5>: Cost 3 vsldoi12 <0,3,1,4>, <3,4,5,6>
+ 3777662316U, // <4,3,4,6>: Cost 4 vsldoi8 <3,2,4,3>, <4,6,3,7>
+ 2308573114U, // <4,3,4,7>: Cost 3 vmrglw <4,4,4,4>, <2,6,3,7>
+ 2759019032U, // <4,3,4,u>: Cost 3 vsldoi12 <1,2,3,4>, <3,4,u,1>
+ 1168558230U, // <4,3,5,0>: Cost 2 vmrghw RHS, <3,0,1,2>
+ 2242300134U, // <4,3,5,1>: Cost 3 vmrghw RHS, <3,1,1,1>
+ 2632107798U, // <4,3,5,2>: Cost 3 vsldoi4 <2,4,3,5>, <2,4,3,5>
+ 1168558492U, // <4,3,5,3>: Cost 2 vmrghw RHS, <3,3,3,3>
+ 1168558594U, // <4,3,5,4>: Cost 2 vmrghw RHS, <3,4,5,6>
+ 2295973654U, // <4,3,5,5>: Cost 3 vmrglw <2,3,4,5>, <2,4,3,5>
+ 2242300536U, // <4,3,5,6>: Cost 3 vmrghw RHS, <3,6,0,7>
+ 2295973818U, // <4,3,5,7>: Cost 3 vmrglw <2,3,4,5>, <2,6,3,7>
+ 1168558878U, // <4,3,5,u>: Cost 2 vmrghw RHS, <3,u,1,2>
+ 3832760952U, // <4,3,6,0>: Cost 4 vsldoi12 <1,2,3,4>, <3,6,0,7>
+ 3711828890U, // <4,3,6,1>: Cost 4 vsldoi4 <3,4,3,6>, <1,2,3,4>
+ 3316484436U, // <4,3,6,2>: Cost 4 vmrghw <4,6,3,7>, <3,2,4,3>
+ 3711830512U, // <4,3,6,3>: Cost 4 vsldoi4 <3,4,3,6>, <3,4,3,6>
+ 2759019164U, // <4,3,6,4>: Cost 3 vsldoi12 <1,2,3,4>, <3,6,4,7>
+ 3361097251U, // <4,3,6,5>: Cost 5 vmrglw <0,u,4,6>, <2,1,3,5>
+ 3316624045U, // <4,3,6,6>: Cost 4 vmrghw <4,6,5,6>, <3,6,6,6>
+ 2773912244U, // <4,3,6,7>: Cost 3 vsldoi12 <3,6,7,4>, <3,6,7,4>
+ 2759019164U, // <4,3,6,u>: Cost 3 vsldoi12 <1,2,3,4>, <3,6,4,7>
+ 3377693590U, // <4,3,7,0>: Cost 4 vmrglw <3,6,4,7>, <1,2,3,0>
+ 3365751680U, // <4,3,7,1>: Cost 5 vmrglw <1,6,4,7>, <4,0,3,1>
+ 2727810232U, // <4,3,7,2>: Cost 3 vsldoi8 <7,2,4,3>, <7,2,4,3>
+ 3377694322U, // <4,3,7,3>: Cost 4 vmrglw <3,6,4,7>, <2,2,3,3>
+ 2303951770U, // <4,3,7,4>: Cost 3 vmrglw <3,6,4,7>, <1,2,3,4>
+ 3741700198U, // <4,3,7,5>: Cost 4 vsldoi4 <u,4,3,7>, <5,6,7,4>
+ 3377695216U, // <4,3,7,6>: Cost 4 vmrglw <3,6,4,7>, <3,4,3,6>
+ 3375703994U, // <4,3,7,7>: Cost 4 vmrglw <3,3,4,7>, <2,6,3,7>
+ 2731792030U, // <4,3,7,u>: Cost 3 vsldoi8 <7,u,4,3>, <7,u,4,3>
+ 1170548886U, // <4,3,u,0>: Cost 2 vmrghw RHS, <3,0,1,2>
+ 2759019294U, // <4,3,u,1>: Cost 3 vsldoi12 <1,2,3,4>, <3,u,1,2>
+ 2632132377U, // <4,3,u,2>: Cost 3 vsldoi4 <2,4,3,u>, <2,4,3,u>
+ 1170549148U, // <4,3,u,3>: Cost 2 vmrghw RHS, <3,3,3,3>
+ 1170549250U, // <4,3,u,4>: Cost 2 vmrghw RHS, <3,4,5,6>
+ 2759019334U, // <4,3,u,5>: Cost 3 vsldoi12 <1,2,3,4>, <3,u,5,6>
+ 2244291192U, // <4,3,u,6>: Cost 3 vmrghw RHS, <3,6,0,7>
+ 2295998394U, // <4,3,u,7>: Cost 3 vmrglw <2,3,4,u>, <2,6,3,7>
+ 1170549534U, // <4,3,u,u>: Cost 2 vmrghw RHS, <3,u,1,2>
+ 1165118354U, // <4,4,0,0>: Cost 2 vmrghw <4,0,5,1>, <4,0,5,1>
+ 1637482598U, // <4,4,0,1>: Cost 2 vsldoi8 <4,4,4,4>, LHS
+ 3711854285U, // <4,4,0,2>: Cost 4 vsldoi4 <3,4,4,0>, <2,3,4,4>
+ 3827305344U, // <4,4,0,3>: Cost 4 vsldoi12 <0,3,1,4>, <4,0,3,1>
+ 2711224658U, // <4,4,0,4>: Cost 3 vsldoi8 <4,4,4,4>, <0,4,1,5>
+ 1165118774U, // <4,4,0,5>: Cost 2 vmrghw <4,0,5,1>, RHS
+ 3312602489U, // <4,4,0,6>: Cost 4 vmrghw <4,0,5,1>, <4,6,5,2>
+ 3369675420U, // <4,4,0,7>: Cost 4 vmrglw <2,3,4,0>, <3,6,4,7>
+ 1165119017U, // <4,4,0,u>: Cost 2 vmrghw <4,0,5,1>, RHS
+ 3369682633U, // <4,4,1,0>: Cost 4 vmrglw <2,3,4,1>, <2,3,4,0>
+ 2287313581U, // <4,4,1,1>: Cost 3 vmrglw <0,u,4,1>, <0,u,4,1>
+ 2759019466U, // <4,4,1,2>: Cost 3 vsldoi12 <1,2,3,4>, <4,1,2,3>
+ 3369683284U, // <4,4,1,3>: Cost 4 vmrglw <2,3,4,1>, <3,2,4,3>
+ 2311204048U, // <4,4,1,4>: Cost 3 vmrglw <4,u,4,1>, <4,4,4,4>
+ 2239319350U, // <4,4,1,5>: Cost 3 vmrghw <4,1,2,3>, RHS
+ 3784967411U, // <4,4,1,6>: Cost 4 vsldoi8 <4,4,4,4>, <1,6,5,7>
+ 3369683612U, // <4,4,1,7>: Cost 4 vmrglw <2,3,4,1>, <3,6,4,7>
+ 2763000832U, // <4,4,1,u>: Cost 3 vsldoi12 <1,u,3,4>, <4,1,u,3>
+ 3711869030U, // <4,4,2,0>: Cost 4 vsldoi4 <3,4,4,2>, LHS
+ 3711869850U, // <4,4,2,1>: Cost 4 vsldoi4 <3,4,4,2>, <1,2,3,4>
+ 2240203830U, // <4,4,2,2>: Cost 3 vmrghw <4,2,5,3>, <4,2,5,3>
+ 2698618573U, // <4,4,2,3>: Cost 3 vsldoi8 <2,3,4,4>, <2,3,4,4>
+ 2711226133U, // <4,4,2,4>: Cost 3 vsldoi8 <4,4,4,4>, <2,4,3,4>
+ 2240204086U, // <4,4,2,5>: Cost 3 vmrghw <4,2,5,3>, RHS
+ 2711226298U, // <4,4,2,6>: Cost 3 vsldoi8 <4,4,4,4>, <2,6,3,7>
+ 3832761416U, // <4,4,2,7>: Cost 4 vsldoi12 <1,2,3,4>, <4,2,7,3>
+ 2701936738U, // <4,4,2,u>: Cost 3 vsldoi8 <2,u,4,4>, <2,u,4,4>
+ 2711226518U, // <4,4,3,0>: Cost 3 vsldoi8 <4,4,4,4>, <3,0,1,2>
+ 3777005828U, // <4,4,3,1>: Cost 4 vsldoi8 <3,1,4,4>, <3,1,4,4>
+ 3832761453U, // <4,4,3,2>: Cost 4 vsldoi12 <1,2,3,4>, <4,3,2,4>
+ 2301266260U, // <4,4,3,3>: Cost 3 vmrglw <3,2,4,3>, <3,2,4,3>
+ 2705254903U, // <4,4,3,4>: Cost 3 vsldoi8 <3,4,4,4>, <3,4,4,4>
+ 2240843062U, // <4,4,3,5>: Cost 3 vmrghw <4,3,5,0>, RHS
+ 3832761489U, // <4,4,3,6>: Cost 4 vsldoi12 <1,2,3,4>, <4,3,6,4>
+ 3375008412U, // <4,4,3,7>: Cost 4 vmrglw <3,2,4,3>, <3,6,4,7>
+ 2301266260U, // <4,4,3,u>: Cost 3 vmrglw <3,2,4,3>, <3,2,4,3>
+ 1570373734U, // <4,4,4,0>: Cost 2 vsldoi4 <4,4,4,4>, LHS
+ 2308574089U, // <4,4,4,1>: Cost 3 vmrglw <4,4,4,4>, <4,0,4,1>
+ 2644117096U, // <4,4,4,2>: Cost 3 vsldoi4 <4,4,4,4>, <2,2,2,2>
+ 2638146039U, // <4,4,4,3>: Cost 3 vsldoi4 <3,4,4,4>, <3,4,4,4>
+ 229035318U, // <4,4,4,4>: Cost 1 vspltisw0 RHS
+ 1167723830U, // <4,4,4,5>: Cost 2 vmrghw <4,4,4,4>, RHS
+ 2644120058U, // <4,4,4,6>: Cost 3 vsldoi4 <4,4,4,4>, <6,2,7,3>
+ 2662036827U, // <4,4,4,7>: Cost 3 vsldoi4 <7,4,4,4>, <7,4,4,4>
+ 229035318U, // <4,4,4,u>: Cost 1 vspltisw0 RHS
+ 1168558994U, // <4,4,5,0>: Cost 2 vmrghw RHS, <4,0,5,1>
+ 2638152602U, // <4,4,5,1>: Cost 3 vsldoi4 <3,4,4,5>, <1,2,3,4>
+ 2242300981U, // <4,4,5,2>: Cost 3 vmrghw RHS, <4,2,5,2>
+ 2638154232U, // <4,4,5,3>: Cost 3 vsldoi4 <3,4,4,5>, <3,4,4,5>
+ 1168559322U, // <4,4,5,4>: Cost 2 vmrghw RHS, <4,4,5,5>
+ 94817590U, // <4,4,5,5>: Cost 1 vmrghw RHS, RHS
+ 1685278006U, // <4,4,5,6>: Cost 2 vsldoi12 <1,2,3,4>, RHS
+ 2242309576U, // <4,4,5,7>: Cost 3 vmrghw RHS, <4,7,5,0>
+ 94817833U, // <4,4,5,u>: Cost 1 vmrghw RHS, RHS
+ 3316591506U, // <4,4,6,0>: Cost 4 vmrghw <4,6,5,2>, <4,0,5,1>
+ 3758428587U, // <4,4,6,1>: Cost 4 vsldoi8 <0,0,4,4>, <6,1,7,5>
+ 2711228922U, // <4,4,6,2>: Cost 3 vsldoi8 <4,4,4,4>, <6,2,7,3>
+ 3796251185U, // <4,4,6,3>: Cost 4 vsldoi8 <6,3,4,4>, <6,3,4,4>
+ 2711229085U, // <4,4,6,4>: Cost 3 vsldoi8 <4,4,4,4>, <6,4,7,4>
+ 2242850102U, // <4,4,6,5>: Cost 3 vmrghw <4,6,5,2>, RHS
+ 2242850169U, // <4,4,6,6>: Cost 3 vmrghw <4,6,5,2>, <4,6,5,2>
+ 2725163893U, // <4,4,6,7>: Cost 3 vsldoi8 <6,7,4,4>, <6,7,4,4>
+ 2242850345U, // <4,4,6,u>: Cost 3 vmrghw <4,6,5,2>, RHS
+ 2711229434U, // <4,4,7,0>: Cost 3 vsldoi8 <4,4,4,4>, <7,0,1,2>
+ 3377694410U, // <4,4,7,1>: Cost 4 vmrglw <3,6,4,7>, <2,3,4,1>
+ 3868593584U, // <4,4,7,2>: Cost 4 vsldoi12 <7,2,3,4>, <4,7,2,3>
+ 3377695060U, // <4,4,7,3>: Cost 4 vmrglw <3,6,4,7>, <3,2,4,3>
+ 2729145691U, // <4,4,7,4>: Cost 3 vsldoi8 <7,4,4,4>, <7,4,4,4>
+ 2243497270U, // <4,4,7,5>: Cost 3 vmrghw <4,7,5,0>, RHS
+ 3871542744U, // <4,4,7,6>: Cost 4 vsldoi12 <7,6,7,4>, <4,7,6,7>
+ 2303953564U, // <4,4,7,7>: Cost 3 vmrglw <3,6,4,7>, <3,6,4,7>
+ 2243497513U, // <4,4,7,u>: Cost 3 vmrghw <4,7,5,0>, RHS
+ 1170549650U, // <4,4,u,0>: Cost 2 vmrghw RHS, <4,0,5,1>
+ 1637488430U, // <4,4,u,1>: Cost 2 vsldoi8 <4,4,4,4>, LHS
+ 2244291637U, // <4,4,u,2>: Cost 3 vmrghw RHS, <4,2,5,2>
+ 2638178811U, // <4,4,u,3>: Cost 3 vsldoi4 <3,4,4,u>, <3,4,4,u>
+ 229035318U, // <4,4,u,4>: Cost 1 vspltisw0 RHS
+ 96808246U, // <4,4,u,5>: Cost 1 vmrghw RHS, RHS
+ 1685278249U, // <4,4,u,6>: Cost 2 vsldoi12 <1,2,3,4>, RHS
+ 2244292040U, // <4,4,u,7>: Cost 3 vmrghw RHS, <4,7,5,0>
+ 96808489U, // <4,4,u,u>: Cost 1 vmrghw RHS, RHS
+ 2698625024U, // <4,5,0,0>: Cost 3 vsldoi8 <2,3,4,5>, <0,0,0,0>
+ 1624883302U, // <4,5,0,1>: Cost 2 vsldoi8 <2,3,4,5>, LHS
+ 2638186190U, // <4,5,0,2>: Cost 3 vsldoi4 <3,4,5,0>, <2,3,4,5>
+ 2638187004U, // <4,5,0,3>: Cost 3 vsldoi4 <3,4,5,0>, <3,4,5,0>
+ 2687345005U, // <4,5,0,4>: Cost 3 vsldoi8 <0,4,4,5>, <0,4,4,5>
+ 2238861316U, // <4,5,0,5>: Cost 3 vmrghw <4,0,5,1>, <5,5,5,5>
+ 2662077302U, // <4,5,0,6>: Cost 3 vsldoi4 <7,4,5,0>, <6,7,4,5>
+ 2662077792U, // <4,5,0,7>: Cost 3 vsldoi4 <7,4,5,0>, <7,4,5,0>
+ 1624883869U, // <4,5,0,u>: Cost 2 vsldoi8 <2,3,4,5>, LHS
+ 3361057762U, // <4,5,1,0>: Cost 4 vmrglw <0,u,4,1>, <4,1,5,0>
+ 2691326803U, // <4,5,1,1>: Cost 3 vsldoi8 <1,1,4,5>, <1,1,4,5>
+ 2698625942U, // <4,5,1,2>: Cost 3 vsldoi8 <2,3,4,5>, <1,2,3,0>
+ 3361055659U, // <4,5,1,3>: Cost 4 vmrglw <0,u,4,1>, <1,2,5,3>
+ 3761087567U, // <4,5,1,4>: Cost 4 vsldoi8 <0,4,4,5>, <1,4,5,5>
+ 2693981335U, // <4,5,1,5>: Cost 3 vsldoi8 <1,5,4,5>, <1,5,4,5>
+ 2305231362U, // <4,5,1,6>: Cost 3 vmrglw <3,u,4,1>, <3,4,5,6>
+ 3361055987U, // <4,5,1,7>: Cost 4 vmrglw <0,u,4,1>, <1,6,5,7>
+ 2695972234U, // <4,5,1,u>: Cost 3 vsldoi8 <1,u,4,5>, <1,u,4,5>
+ 2638200934U, // <4,5,2,0>: Cost 3 vsldoi4 <3,4,5,2>, LHS
+ 3761088035U, // <4,5,2,1>: Cost 4 vsldoi8 <0,4,4,5>, <2,1,3,5>
+ 2697963133U, // <4,5,2,2>: Cost 3 vsldoi8 <2,2,4,5>, <2,2,4,5>
+ 1624884942U, // <4,5,2,3>: Cost 2 vsldoi8 <2,3,4,5>, <2,3,4,5>
+ 2698626838U, // <4,5,2,4>: Cost 3 vsldoi8 <2,3,4,5>, <2,4,3,5>
+ 3772368744U, // <4,5,2,5>: Cost 4 vsldoi8 <2,3,4,5>, <2,5,3,6>
+ 2698627002U, // <4,5,2,6>: Cost 3 vsldoi8 <2,3,4,5>, <2,6,3,7>
+ 3775023122U, // <4,5,2,7>: Cost 4 vsldoi8 <2,7,4,5>, <2,7,4,5>
+ 1628203107U, // <4,5,2,u>: Cost 2 vsldoi8 <2,u,4,5>, <2,u,4,5>
+ 2698627222U, // <4,5,3,0>: Cost 3 vsldoi8 <2,3,4,5>, <3,0,1,2>
+ 3765070057U, // <4,5,3,1>: Cost 4 vsldoi8 <1,1,4,5>, <3,1,1,4>
+ 2698627404U, // <4,5,3,2>: Cost 3 vsldoi8 <2,3,4,5>, <3,2,3,4>
+ 2698627484U, // <4,5,3,3>: Cost 3 vsldoi8 <2,3,4,5>, <3,3,3,3>
+ 2698627580U, // <4,5,3,4>: Cost 3 vsldoi8 <2,3,4,5>, <3,4,5,0>
+ 3779668553U, // <4,5,3,5>: Cost 4 vsldoi8 <3,5,4,5>, <3,5,4,5>
+ 2725169844U, // <4,5,3,6>: Cost 3 vsldoi8 <6,7,4,5>, <3,6,7,4>
+ 2707253995U, // <4,5,3,7>: Cost 3 vsldoi8 <3,7,4,5>, <3,7,4,5>
+ 2698627870U, // <4,5,3,u>: Cost 3 vsldoi8 <2,3,4,5>, <3,u,1,2>
+ 2638217318U, // <4,5,4,0>: Cost 3 vsldoi4 <3,4,5,4>, LHS
+ 2308574098U, // <4,5,4,1>: Cost 3 vmrglw <4,4,4,4>, <4,0,5,1>
+ 2698628150U, // <4,5,4,2>: Cost 3 vsldoi8 <2,3,4,5>, <4,2,5,3>
+ 2638219776U, // <4,5,4,3>: Cost 3 vsldoi4 <3,4,5,4>, <3,4,5,4>
+ 2698628314U, // <4,5,4,4>: Cost 3 vsldoi8 <2,3,4,5>, <4,4,5,5>
+ 1624886582U, // <4,5,4,5>: Cost 2 vsldoi8 <2,3,4,5>, RHS
+ 2698628478U, // <4,5,4,6>: Cost 3 vsldoi8 <2,3,4,5>, <4,6,5,7>
+ 2662110564U, // <4,5,4,7>: Cost 3 vsldoi4 <7,4,5,4>, <7,4,5,4>
+ 1624886825U, // <4,5,4,u>: Cost 2 vsldoi8 <2,3,4,5>, RHS
+ 1570455654U, // <4,5,5,0>: Cost 2 vsldoi4 <4,4,5,5>, LHS
+ 2312564250U, // <4,5,5,1>: Cost 3 vmrglw <5,1,4,5>, <4,u,5,1>
+ 2644199118U, // <4,5,5,2>: Cost 3 vsldoi4 <4,4,5,5>, <2,3,4,5>
+ 2295974966U, // <4,5,5,3>: Cost 3 vmrglw <2,3,4,5>, <4,2,5,3>
+ 1570458842U, // <4,5,5,4>: Cost 2 vsldoi4 <4,4,5,5>, <4,4,5,5>
+ 1168568324U, // <4,5,5,5>: Cost 2 vmrghw RHS, <5,5,5,5>
+ 1168568418U, // <4,5,5,6>: Cost 2 vmrghw RHS, <5,6,7,0>
+ 2295975294U, // <4,5,5,7>: Cost 3 vmrglw <2,3,4,5>, <4,6,5,7>
+ 1168716036U, // <4,5,5,u>: Cost 2 vmrghw RHS, <5,u,7,0>
+ 1564491878U, // <4,5,6,0>: Cost 2 vsldoi4 <3,4,5,6>, LHS
+ 2626290768U, // <4,5,6,1>: Cost 3 vsldoi4 <1,4,5,6>, <1,4,5,6>
+ 2632263465U, // <4,5,6,2>: Cost 3 vsldoi4 <2,4,5,6>, <2,4,5,6>
+ 1564494338U, // <4,5,6,3>: Cost 2 vsldoi4 <3,4,5,6>, <3,4,5,6>
+ 1564495158U, // <4,5,6,4>: Cost 2 vsldoi4 <3,4,5,6>, RHS
+ 2638237464U, // <4,5,6,5>: Cost 3 vsldoi4 <3,4,5,6>, <5,2,6,3>
+ 2656154253U, // <4,5,6,6>: Cost 3 vsldoi4 <6,4,5,6>, <6,4,5,6>
+ 27705344U, // <4,5,6,7>: Cost 0 copy RHS
+ 27705344U, // <4,5,6,u>: Cost 0 copy RHS
+ 2725172218U, // <4,5,7,0>: Cost 3 vsldoi8 <6,7,4,5>, <7,0,1,2>
+ 3859599489U, // <4,5,7,1>: Cost 4 vsldoi12 <5,6,7,4>, <5,7,1,4>
+ 2698630320U, // <4,5,7,2>: Cost 3 vsldoi8 <2,3,4,5>, <7,2,3,4>
+ 2728490251U, // <4,5,7,3>: Cost 3 vsldoi8 <7,3,4,5>, <7,3,4,5>
+ 2725172576U, // <4,5,7,4>: Cost 3 vsldoi8 <6,7,4,5>, <7,4,5,0>
+ 3317239812U, // <4,5,7,5>: Cost 4 vmrghw <4,7,5,0>, <5,5,5,5>
+ 2725172760U, // <4,5,7,6>: Cost 3 vsldoi8 <6,7,4,5>, <7,6,7,4>
+ 2725172844U, // <4,5,7,7>: Cost 3 vsldoi8 <6,7,4,5>, <7,7,7,7>
+ 2725172866U, // <4,5,7,u>: Cost 3 vsldoi8 <6,7,4,5>, <7,u,1,2>
+ 1564508262U, // <4,5,u,0>: Cost 2 vsldoi4 <3,4,5,u>, LHS
+ 1624889134U, // <4,5,u,1>: Cost 2 vsldoi8 <2,3,4,5>, LHS
+ 2698631045U, // <4,5,u,2>: Cost 3 vsldoi8 <2,3,4,5>, <u,2,3,0>
+ 1564510724U, // <4,5,u,3>: Cost 2 vsldoi4 <3,4,5,u>, <3,4,5,u>
+ 1564511542U, // <4,5,u,4>: Cost 2 vsldoi4 <3,4,5,u>, RHS
+ 1624889498U, // <4,5,u,5>: Cost 2 vsldoi8 <2,3,4,5>, RHS
+ 1170550882U, // <4,5,u,6>: Cost 2 vmrghw RHS, <5,6,7,0>
+ 27705344U, // <4,5,u,7>: Cost 0 copy RHS
+ 27705344U, // <4,5,u,u>: Cost 0 copy RHS
+ 3312595285U, // <4,6,0,0>: Cost 4 vmrghw <4,0,5,0>, <6,0,7,0>
+ 3763748966U, // <4,6,0,1>: Cost 4 vsldoi8 <0,u,4,6>, LHS
+ 2238861818U, // <4,6,0,2>: Cost 3 vmrghw <4,0,5,1>, <6,2,7,3>
+ 3767730432U, // <4,6,0,3>: Cost 4 vsldoi8 <1,5,4,6>, <0,3,1,4>
+ 3763749202U, // <4,6,0,4>: Cost 4 vsldoi8 <0,u,4,6>, <0,4,1,5>
+ 2238862059U, // <4,6,0,5>: Cost 3 vmrghw <4,0,5,1>, <6,5,7,1>
+ 2238862136U, // <4,6,0,6>: Cost 3 vmrghw <4,0,5,1>, <6,6,6,6>
+ 2295934262U, // <4,6,0,7>: Cost 3 vmrglw <2,3,4,0>, RHS
+ 2295934263U, // <4,6,0,u>: Cost 3 vmrglw <2,3,4,0>, RHS
+ 3378973999U, // <4,6,1,0>: Cost 4 vmrglw <3,u,4,1>, <4,5,6,0>
+ 3378974648U, // <4,6,1,1>: Cost 4 vmrglw <3,u,4,1>, <5,4,6,1>
+ 3779675034U, // <4,6,1,2>: Cost 4 vsldoi8 <3,5,4,6>, <1,2,3,4>
+ 3378974002U, // <4,6,1,3>: Cost 4 vmrglw <3,u,4,1>, <4,5,6,3>
+ 3378974003U, // <4,6,1,4>: Cost 4 vmrglw <3,u,4,1>, <4,5,6,4>
+ 3767731352U, // <4,6,1,5>: Cost 4 vsldoi8 <1,5,4,6>, <1,5,4,6>
+ 3378974734U, // <4,6,1,6>: Cost 4 vmrglw <3,u,4,1>, <5,5,6,6>
+ 2287316278U, // <4,6,1,7>: Cost 3 vmrglw <0,u,4,1>, RHS
+ 2287316279U, // <4,6,1,u>: Cost 3 vmrglw <0,u,4,1>, RHS
+ 3735904358U, // <4,6,2,0>: Cost 4 vsldoi4 <7,4,6,2>, LHS
+ 3763750435U, // <4,6,2,1>: Cost 5 vsldoi8 <0,u,4,6>, <2,1,3,5>
+ 3313938937U, // <4,6,2,2>: Cost 4 vmrghw <4,2,5,2>, <6,2,7,2>
+ 3772376782U, // <4,6,2,3>: Cost 4 vsldoi8 <2,3,4,6>, <2,3,4,5>
+ 3852890591U, // <4,6,2,4>: Cost 4 vsldoi12 <4,5,6,4>, <6,2,4,3>
+ 3735908454U, // <4,6,2,5>: Cost 4 vsldoi4 <7,4,6,2>, <5,6,7,4>
+ 3801573306U, // <4,6,2,6>: Cost 4 vsldoi8 <7,2,4,6>, <2,6,3,7>
+ 2785858042U, // <4,6,2,7>: Cost 3 vsldoi12 <5,6,7,4>, <6,2,7,3>
+ 2785858051U, // <4,6,2,u>: Cost 3 vsldoi12 <5,6,7,4>, <6,2,u,3>
+ 3863065101U, // <4,6,3,0>: Cost 4 vsldoi12 <6,3,0,4>, <6,3,0,4>
+ 3314586024U, // <4,6,3,1>: Cost 4 vmrghw <4,3,5,0>, <6,1,7,2>
+ 3863212575U, // <4,6,3,2>: Cost 4 vsldoi12 <6,3,2,4>, <6,3,2,4>
+ 3863286312U, // <4,6,3,3>: Cost 4 vsldoi12 <6,3,3,4>, <6,3,3,4>
+ 3767732738U, // <4,6,3,4>: Cost 4 vsldoi8 <1,5,4,6>, <3,4,5,6>
+ 3779676746U, // <4,6,3,5>: Cost 4 vsldoi8 <3,5,4,6>, <3,5,4,6>
+ 3398898488U, // <4,6,3,6>: Cost 4 vmrglw <7,2,4,3>, <6,6,6,6>
+ 2301267254U, // <4,6,3,7>: Cost 3 vmrglw <3,2,4,3>, RHS
+ 2301267255U, // <4,6,3,u>: Cost 3 vmrglw <3,2,4,3>, RHS
+ 3852890715U, // <4,6,4,0>: Cost 4 vsldoi12 <4,5,6,4>, <6,4,0,1>
+ 3315208615U, // <4,6,4,1>: Cost 4 vmrghw <4,4,4,4>, <6,1,7,1>
+ 2241466874U, // <4,6,4,2>: Cost 3 vmrghw <4,4,4,4>, <6,2,7,3>
+ 3852890745U, // <4,6,4,3>: Cost 4 vsldoi12 <4,5,6,4>, <6,4,3,4>
+ 2241467037U, // <4,6,4,4>: Cost 3 vmrghw <4,4,4,4>, <6,4,7,4>
+ 2241549039U, // <4,6,4,5>: Cost 3 vmrghw <4,4,5,5>, <6,5,7,5>
+ 2241467192U, // <4,6,4,6>: Cost 3 vmrghw <4,4,4,4>, <6,6,6,6>
+ 1234832694U, // <4,6,4,7>: Cost 2 vmrglw <4,4,4,4>, RHS
+ 1234832695U, // <4,6,4,u>: Cost 2 vmrglw <4,4,4,4>, RHS
+ 2242302241U, // <4,6,5,0>: Cost 3 vmrghw RHS, <6,0,1,2>
+ 2242310567U, // <4,6,5,1>: Cost 3 vmrghw RHS, <6,1,7,1>
+ 1168568826U, // <4,6,5,2>: Cost 2 vmrghw RHS, <6,2,7,3>
+ 2242302514U, // <4,6,5,3>: Cost 3 vmrghw RHS, <6,3,4,5>
+ 2242302605U, // <4,6,5,4>: Cost 3 vmrghw RHS, <6,4,5,6>
+ 2242310891U, // <4,6,5,5>: Cost 3 vmrghw RHS, <6,5,7,1>
+ 1168569144U, // <4,6,5,6>: Cost 2 vmrghw RHS, <6,6,6,6>
+ 1222233398U, // <4,6,5,7>: Cost 2 vmrglw <2,3,4,5>, RHS
+ 1222233399U, // <4,6,5,u>: Cost 2 vmrglw <2,3,4,5>, RHS
+ 3316576545U, // <4,6,6,0>: Cost 4 vmrghw <4,6,5,0>, <6,0,1,2>
+ 3316584871U, // <4,6,6,1>: Cost 4 vmrghw <4,6,5,1>, <6,1,7,1>
+ 2242851322U, // <4,6,6,2>: Cost 3 vmrghw <4,6,5,2>, <6,2,7,3>
+ 3316601394U, // <4,6,6,3>: Cost 4 vmrghw <4,6,5,3>, <6,3,4,5>
+ 3852890916U, // <4,6,6,4>: Cost 4 vsldoi12 <4,5,6,4>, <6,6,4,4>
+ 3316617963U, // <4,6,6,5>: Cost 4 vmrghw <4,6,5,5>, <6,5,7,1>
+ 2242884408U, // <4,6,6,6>: Cost 3 vmrghw <4,6,5,6>, <6,6,6,6>
+ 2785858370U, // <4,6,6,7>: Cost 3 vsldoi12 <5,6,7,4>, <6,6,7,7>
+ 2785858379U, // <4,6,6,u>: Cost 3 vsldoi12 <5,6,7,4>, <6,6,u,7>
+ 2785858382U, // <4,6,7,0>: Cost 3 vsldoi12 <5,6,7,4>, <6,7,0,1>
+ 3859600215U, // <4,6,7,1>: Cost 4 vsldoi12 <5,6,7,4>, <6,7,1,1>
+ 3317240314U, // <4,6,7,2>: Cost 4 vmrghw <4,7,5,0>, <6,2,7,3>
+ 2792199020U, // <4,6,7,3>: Cost 3 vsldoi12 <6,7,3,4>, <6,7,3,4>
+ 2785858422U, // <4,6,7,4>: Cost 3 vsldoi12 <5,6,7,4>, <6,7,4,5>
+ 3856651132U, // <4,6,7,5>: Cost 4 vsldoi12 <5,2,3,4>, <6,7,5,2>
+ 3317240632U, // <4,6,7,6>: Cost 4 vmrghw <4,7,5,0>, <6,6,6,6>
+ 2303954230U, // <4,6,7,7>: Cost 3 vmrglw <3,6,4,7>, RHS
+ 2303954231U, // <4,6,7,u>: Cost 3 vmrglw <3,6,4,7>, RHS
+ 2244292897U, // <4,6,u,0>: Cost 3 vmrghw RHS, <6,0,1,2>
+ 2244293031U, // <4,6,u,1>: Cost 3 vmrghw RHS, <6,1,7,1>
+ 1170551290U, // <4,6,u,2>: Cost 2 vmrghw RHS, <6,2,7,3>
+ 2244293170U, // <4,6,u,3>: Cost 3 vmrghw RHS, <6,3,4,5>
+ 2244293261U, // <4,6,u,4>: Cost 3 vmrghw RHS, <6,4,5,6>
+ 2244293355U, // <4,6,u,5>: Cost 3 vmrghw RHS, <6,5,7,1>
+ 1170551608U, // <4,6,u,6>: Cost 2 vmrghw RHS, <6,6,6,6>
+ 1222257974U, // <4,6,u,7>: Cost 2 vmrglw <2,3,4,u>, RHS
+ 1222257975U, // <4,6,u,u>: Cost 2 vmrglw <2,3,4,u>, RHS
+ 2238862330U, // <4,7,0,0>: Cost 3 vmrghw <4,0,5,1>, <7,0,1,2>
+ 2706604134U, // <4,7,0,1>: Cost 3 vsldoi8 <3,6,4,7>, LHS
+ 3312604308U, // <4,7,0,2>: Cost 4 vmrghw <4,0,5,1>, <7,2,0,3>
+ 3768402176U, // <4,7,0,3>: Cost 4 vsldoi8 <1,6,4,7>, <0,3,1,4>
+ 2238862648U, // <4,7,0,4>: Cost 3 vmrghw <4,0,5,1>, <7,4,0,5>
+ 3859600418U, // <4,7,0,5>: Cost 4 vsldoi12 <5,6,7,4>, <7,0,5,6>
+ 3729994393U, // <4,7,0,6>: Cost 4 vsldoi4 <6,4,7,0>, <6,4,7,0>
+ 2238862956U, // <4,7,0,7>: Cost 3 vmrghw <4,0,5,1>, <7,7,7,7>
+ 2706604701U, // <4,7,0,u>: Cost 3 vsldoi8 <3,6,4,7>, LHS
+ 3385610338U, // <4,7,1,0>: Cost 4 vmrglw <5,0,4,1>, <5,6,7,0>
+ 3780346676U, // <4,7,1,1>: Cost 4 vsldoi8 <3,6,4,7>, <1,1,1,1>
+ 2706604954U, // <4,7,1,2>: Cost 3 vsldoi8 <3,6,4,7>, <1,2,3,4>
+ 3385610746U, // <4,7,1,3>: Cost 4 vmrglw <5,0,4,1>, <6,2,7,3>
+ 3385610342U, // <4,7,1,4>: Cost 4 vmrglw <5,0,4,1>, <5,6,7,4>
+ 3385610667U, // <4,7,1,5>: Cost 4 vmrglw <5,0,4,1>, <6,1,7,5>
+ 3768403178U, // <4,7,1,6>: Cost 4 vsldoi8 <1,6,4,7>, <1,6,4,7>
+ 3385611074U, // <4,7,1,7>: Cost 4 vmrglw <5,0,4,1>, <6,6,7,7>
+ 2706604954U, // <4,7,1,u>: Cost 3 vsldoi8 <3,6,4,7>, <1,2,3,4>
+ 3859600532U, // <4,7,2,0>: Cost 4 vsldoi12 <5,6,7,4>, <7,2,0,3>
+ 3712091034U, // <4,7,2,1>: Cost 5 vsldoi4 <3,4,7,2>, <1,2,3,4>
+ 3774375528U, // <4,7,2,2>: Cost 4 vsldoi8 <2,6,4,7>, <2,2,2,2>
+ 2794853552U, // <4,7,2,3>: Cost 3 vsldoi12 <7,2,3,4>, <7,2,3,4>
+ 2785858744U, // <4,7,2,4>: Cost 3 vsldoi12 <5,6,7,4>, <7,2,4,3>
+ 3735982182U, // <4,7,2,5>: Cost 4 vsldoi4 <7,4,7,2>, <5,6,7,4>
+ 3774375875U, // <4,7,2,6>: Cost 4 vsldoi8 <2,6,4,7>, <2,6,4,7>
+ 3735983476U, // <4,7,2,7>: Cost 4 vsldoi4 <7,4,7,2>, <7,4,7,2>
+ 2795222237U, // <4,7,2,u>: Cost 3 vsldoi12 <7,2,u,4>, <7,2,u,4>
+ 3780348054U, // <4,7,3,0>: Cost 4 vsldoi8 <3,6,4,7>, <3,0,1,2>
+ 3730015130U, // <4,7,3,1>: Cost 4 vsldoi4 <6,4,7,3>, <1,2,3,4>
+ 3780348244U, // <4,7,3,2>: Cost 4 vsldoi8 <3,6,4,7>, <3,2,4,3>
+ 3778357673U, // <4,7,3,3>: Cost 4 vsldoi8 <3,3,4,7>, <3,3,4,7>
+ 2325155942U, // <4,7,3,4>: Cost 3 vmrglw <7,2,4,3>, <5,6,7,4>
+ 3779684939U, // <4,7,3,5>: Cost 5 vsldoi8 <3,5,4,7>, <3,5,4,7>
+ 2706606748U, // <4,7,3,6>: Cost 3 vsldoi8 <3,6,4,7>, <3,6,4,7>
+ 3398898498U, // <4,7,3,7>: Cost 4 vmrglw <7,2,4,3>, <6,6,7,7>
+ 2707934014U, // <4,7,3,u>: Cost 3 vsldoi8 <3,u,4,7>, <3,u,4,7>
+ 2785858868U, // <4,7,4,0>: Cost 3 vsldoi12 <5,6,7,4>, <7,4,0,1>
+ 3780348874U, // <4,7,4,1>: Cost 4 vsldoi8 <3,6,4,7>, <4,1,2,3>
+ 3780349000U, // <4,7,4,2>: Cost 4 vsldoi8 <3,6,4,7>, <4,2,7,3>
+ 2308575738U, // <4,7,4,3>: Cost 3 vmrglw <4,4,4,4>, <6,2,7,3>
+ 2656283856U, // <4,7,4,4>: Cost 3 vsldoi4 <6,4,7,4>, <4,4,4,4>
+ 2706607414U, // <4,7,4,5>: Cost 3 vsldoi8 <3,6,4,7>, RHS
+ 2656285341U, // <4,7,4,6>: Cost 3 vsldoi4 <6,4,7,4>, <6,4,7,4>
+ 2241468012U, // <4,7,4,7>: Cost 3 vmrghw <4,4,4,4>, <7,7,7,7>
+ 2706607657U, // <4,7,4,u>: Cost 3 vsldoi8 <3,6,4,7>, RHS
+ 1168569338U, // <4,7,5,0>: Cost 2 vmrghw RHS, <7,0,1,2>
+ 2242311242U, // <4,7,5,1>: Cost 3 vmrghw RHS, <7,1,1,1>
+ 2242303178U, // <4,7,5,2>: Cost 3 vmrghw RHS, <7,2,6,3>
+ 2242311395U, // <4,7,5,3>: Cost 3 vmrghw RHS, <7,3,0,1>
+ 1168569702U, // <4,7,5,4>: Cost 2 vmrghw RHS, <7,4,5,6>
+ 2242311606U, // <4,7,5,5>: Cost 3 vmrghw RHS, <7,5,5,5>
+ 2242311662U, // <4,7,5,6>: Cost 3 vmrghw RHS, <7,6,2,7>
+ 1168569964U, // <4,7,5,7>: Cost 2 vmrghw RHS, <7,7,7,7>
+ 1168569986U, // <4,7,5,u>: Cost 2 vmrghw RHS, <7,u,1,2>
+ 3316593658U, // <4,7,6,0>: Cost 4 vmrghw <4,6,5,2>, <7,0,1,2>
+ 3316593738U, // <4,7,6,1>: Cost 5 vmrghw <4,6,5,2>, <7,1,1,1>
+ 3316634800U, // <4,7,6,2>: Cost 4 vmrghw <4,6,5,7>, <7,2,3,4>
+ 3386978810U, // <4,7,6,3>: Cost 4 vmrglw <5,2,4,6>, <6,2,7,3>
+ 2785859072U, // <4,7,6,4>: Cost 3 vsldoi12 <5,6,7,4>, <7,6,4,7>
+ 3736014950U, // <4,7,6,5>: Cost 4 vsldoi4 <7,4,7,6>, <5,6,7,4>
+ 3316594158U, // <4,7,6,6>: Cost 4 vmrghw <4,6,5,2>, <7,6,2,7>
+ 2797803032U, // <4,7,6,7>: Cost 3 vsldoi12 <7,6,7,4>, <7,6,7,4>
+ 2797876769U, // <4,7,6,u>: Cost 3 vsldoi12 <7,6,u,4>, <7,6,u,4>
+ 2243499002U, // <4,7,7,0>: Cost 3 vmrghw <4,7,5,0>, <7,0,1,2>
+ 3718103962U, // <4,7,7,1>: Cost 4 vsldoi4 <4,4,7,7>, <1,2,3,4>
+ 3317257418U, // <4,7,7,2>: Cost 4 vmrghw <4,7,5,2>, <7,2,6,3>
+ 3377695816U, // <4,7,7,3>: Cost 4 vmrglw <3,6,4,7>, <4,2,7,3>
+ 2243532134U, // <4,7,7,4>: Cost 3 vmrghw <4,7,5,4>, <7,4,5,6>
+ 3317282230U, // <4,7,7,5>: Cost 4 vmrghw <4,7,5,5>, <7,5,5,5>
+ 2730497536U, // <4,7,7,6>: Cost 3 vsldoi8 <7,6,4,7>, <7,6,4,7>
+ 2243556972U, // <4,7,7,7>: Cost 3 vmrghw <4,7,5,7>, <7,7,7,7>
+ 2243565186U, // <4,7,7,u>: Cost 3 vmrghw <4,7,5,u>, <7,u,1,2>
+ 1170551802U, // <4,7,u,0>: Cost 2 vmrghw RHS, <7,0,1,2>
+ 2706609966U, // <4,7,u,1>: Cost 3 vsldoi8 <3,6,4,7>, LHS
+ 2244293797U, // <4,7,u,2>: Cost 3 vmrghw RHS, <7,2,2,2>
+ 2244293859U, // <4,7,u,3>: Cost 3 vmrghw RHS, <7,3,0,1>
+ 1170552166U, // <4,7,u,4>: Cost 2 vmrghw RHS, <7,4,5,6>
+ 2706610330U, // <4,7,u,5>: Cost 3 vsldoi8 <3,6,4,7>, RHS
+ 2244294126U, // <4,7,u,6>: Cost 3 vmrghw RHS, <7,6,2,7>
+ 1170552428U, // <4,7,u,7>: Cost 2 vmrghw RHS, <7,7,7,7>
+ 1170552450U, // <4,7,u,u>: Cost 2 vmrghw RHS, <7,u,1,2>
+ 1165118354U, // <4,u,0,0>: Cost 2 vmrghw <4,0,5,1>, <4,0,5,1>
+ 1624907878U, // <4,u,0,1>: Cost 2 vsldoi8 <2,3,4,u>, LHS
+ 2638407377U, // <4,u,0,2>: Cost 3 vsldoi4 <3,4,u,0>, <2,3,4,u>
+ 2295931036U, // <4,u,0,3>: Cost 3 vmrglw <2,3,4,0>, LHS
+ 2687369584U, // <4,u,0,4>: Cost 3 vsldoi8 <0,4,4,u>, <0,4,4,u>
+ 1165121690U, // <4,u,0,5>: Cost 2 vmrghw <4,0,5,1>, RHS
+ 2662298489U, // <4,u,0,6>: Cost 3 vsldoi4 <7,4,u,0>, <6,7,4,u>
+ 2295934280U, // <4,u,0,7>: Cost 3 vmrglw <2,3,4,0>, RHS
+ 1624908445U, // <4,u,0,u>: Cost 2 vsldoi8 <2,3,4,u>, LHS
+ 2638413926U, // <4,u,1,0>: Cost 3 vsldoi4 <3,4,u,1>, LHS
+ 2691351382U, // <4,u,1,1>: Cost 3 vsldoi8 <1,1,4,u>, <1,1,4,u>
+ 1685280558U, // <4,u,1,2>: Cost 2 vsldoi12 <1,2,3,4>, LHS
+ 2287313052U, // <4,u,1,3>: Cost 3 vmrglw <0,u,4,1>, LHS
+ 2299257799U, // <4,u,1,4>: Cost 3 vmrglw <2,u,4,1>, <1,2,u,4>
+ 2694005914U, // <4,u,1,5>: Cost 3 vsldoi8 <1,5,4,u>, <1,5,4,u>
+ 2305231362U, // <4,u,1,6>: Cost 3 vmrglw <3,u,4,1>, <3,4,5,6>
+ 2287316296U, // <4,u,1,7>: Cost 3 vmrglw <0,u,4,1>, RHS
+ 1685280612U, // <4,u,1,u>: Cost 2 vsldoi12 <1,2,3,4>, LHS
+ 2638422118U, // <4,u,2,0>: Cost 3 vsldoi4 <3,4,u,2>, LHS
+ 2240206638U, // <4,u,2,1>: Cost 3 vmrghw <4,2,5,3>, LHS
+ 2697987712U, // <4,u,2,2>: Cost 3 vsldoi8 <2,2,4,u>, <2,2,4,u>
+ 1624909521U, // <4,u,2,3>: Cost 2 vsldoi8 <2,3,4,u>, <2,3,4,u>
+ 2759391121U, // <4,u,2,4>: Cost 3 vsldoi12 <1,2,u,4>, <u,2,4,3>
+ 2240207002U, // <4,u,2,5>: Cost 3 vmrghw <4,2,5,3>, RHS
+ 2698651578U, // <4,u,2,6>: Cost 3 vsldoi8 <2,3,4,u>, <2,6,3,7>
+ 2785859500U, // <4,u,2,7>: Cost 3 vsldoi12 <5,6,7,4>, <u,2,7,3>
+ 1628227686U, // <4,u,2,u>: Cost 2 vsldoi8 <2,u,4,u>, <2,u,4,u>
+ 2759022524U, // <4,u,3,0>: Cost 3 vsldoi12 <1,2,3,4>, <u,3,0,1>
+ 2801342408U, // <4,u,3,1>: Cost 3 vsldoi12 <u,3,1,4>, <u,3,1,4>
+ 2703960409U, // <4,u,3,2>: Cost 3 vsldoi8 <3,2,4,u>, <3,2,4,u>
+ 2759022554U, // <4,u,3,3>: Cost 3 vsldoi12 <1,2,3,4>, <u,3,3,4>
+ 2759022564U, // <4,u,3,4>: Cost 3 vsldoi12 <1,2,3,4>, <u,3,4,5>
+ 2240845978U, // <4,u,3,5>: Cost 3 vmrghw <4,3,5,0>, RHS
+ 2706614941U, // <4,u,3,6>: Cost 3 vsldoi8 <3,6,4,u>, <3,6,4,u>
+ 2301267272U, // <4,u,3,7>: Cost 3 vmrglw <3,2,4,3>, RHS
+ 2759022596U, // <4,u,3,u>: Cost 3 vsldoi12 <1,2,3,4>, <u,3,u,1>
+ 1570668646U, // <4,u,4,0>: Cost 2 vsldoi4 <4,4,u,4>, LHS
+ 1167726382U, // <4,u,4,1>: Cost 2 vmrghw <4,4,4,4>, LHS
+ 2698652753U, // <4,u,4,2>: Cost 3 vsldoi8 <2,3,4,u>, <4,2,u,3>
+ 1234829468U, // <4,u,4,3>: Cost 2 vmrglw <4,4,4,4>, LHS
+ 229035318U, // <4,u,4,4>: Cost 1 vspltisw0 RHS
+ 1624911158U, // <4,u,4,5>: Cost 2 vsldoi8 <2,3,4,u>, RHS
+ 2698653081U, // <4,u,4,6>: Cost 3 vsldoi8 <2,3,4,u>, <4,6,u,7>
+ 1234832712U, // <4,u,4,7>: Cost 2 vmrglw <4,4,4,4>, RHS
+ 229035318U, // <4,u,4,u>: Cost 1 vspltisw0 RHS
+ 1168561875U, // <4,u,5,0>: Cost 2 vmrghw RHS, <u,0,1,2>
+ 94820142U, // <4,u,5,1>: Cost 1 vmrghw RHS, LHS
+ 1168562053U, // <4,u,5,2>: Cost 2 vmrghw RHS, <u,2,3,0>
+ 1222230172U, // <4,u,5,3>: Cost 2 vmrglw <2,3,4,5>, LHS
+ 1168562239U, // <4,u,5,4>: Cost 2 vmrghw RHS, <u,4,5,6>
+ 94820506U, // <4,u,5,5>: Cost 1 vmrghw RHS, RHS
+ 1685280922U, // <4,u,5,6>: Cost 2 vsldoi12 <1,2,3,4>, RHS
+ 1222233416U, // <4,u,5,7>: Cost 2 vmrglw <2,3,4,5>, RHS
+ 94820709U, // <4,u,5,u>: Cost 1 vmrghw RHS, LHS
+ 1564713062U, // <4,u,6,0>: Cost 2 vsldoi4 <3,4,u,6>, LHS
+ 2626511979U, // <4,u,6,1>: Cost 3 vsldoi4 <1,4,u,6>, <1,4,u,6>
+ 2632484676U, // <4,u,6,2>: Cost 3 vsldoi4 <2,4,u,6>, <2,4,u,6>
+ 1564715549U, // <4,u,6,3>: Cost 2 vsldoi4 <3,4,u,6>, <3,4,u,6>
+ 1564716342U, // <4,u,6,4>: Cost 2 vsldoi4 <3,4,u,6>, RHS
+ 2242853018U, // <4,u,6,5>: Cost 3 vmrghw <4,6,5,2>, RHS
+ 2656375464U, // <4,u,6,6>: Cost 3 vsldoi4 <6,4,u,6>, <6,4,u,6>
+ 27705344U, // <4,u,6,7>: Cost 0 copy RHS
+ 27705344U, // <4,u,6,u>: Cost 0 copy RHS
+ 2785859840U, // <4,u,7,0>: Cost 3 vsldoi12 <5,6,7,4>, <u,7,0,1>
+ 2243499822U, // <4,u,7,1>: Cost 3 vmrghw <4,7,5,0>, LHS
+ 2727851197U, // <4,u,7,2>: Cost 3 vsldoi8 <7,2,4,u>, <7,2,4,u>
+ 2303951004U, // <4,u,7,3>: Cost 3 vmrglw <3,6,4,7>, LHS
+ 2785859880U, // <4,u,7,4>: Cost 3 vsldoi12 <5,6,7,4>, <u,7,4,5>
+ 2243500186U, // <4,u,7,5>: Cost 3 vmrghw <4,7,5,0>, RHS
+ 2730505729U, // <4,u,7,6>: Cost 3 vsldoi8 <7,6,4,u>, <7,6,4,u>
+ 2303954248U, // <4,u,7,7>: Cost 3 vmrglw <3,6,4,7>, RHS
+ 2303951009U, // <4,u,7,u>: Cost 3 vmrglw <3,6,4,7>, LHS
+ 1564729446U, // <4,u,u,0>: Cost 2 vsldoi4 <3,4,u,u>, LHS
+ 96810798U, // <4,u,u,1>: Cost 1 vmrghw RHS, LHS
+ 1685281125U, // <4,u,u,2>: Cost 2 vsldoi12 <1,2,3,4>, LHS
+ 1222254748U, // <4,u,u,3>: Cost 2 vmrglw <2,3,4,u>, LHS
+ 229035318U, // <4,u,u,4>: Cost 1 vspltisw0 RHS
+ 96811162U, // <4,u,u,5>: Cost 1 vmrghw RHS, RHS
+ 1685281165U, // <4,u,u,6>: Cost 2 vsldoi12 <1,2,3,4>, RHS
+ 27705344U, // <4,u,u,7>: Cost 0 copy RHS
+ 27705344U, // <4,u,u,u>: Cost 0 copy RHS
+ 2754232320U, // <5,0,0,0>: Cost 3 vsldoi12 <0,4,1,5>, <0,0,0,0>
+ 2754232330U, // <5,0,0,1>: Cost 3 vsldoi12 <0,4,1,5>, <0,0,1,1>
+ 3718194894U, // <5,0,0,2>: Cost 4 vsldoi4 <4,5,0,0>, <2,3,4,5>
+ 3376385762U, // <5,0,0,3>: Cost 4 vmrglw <3,4,5,0>, <5,2,0,3>
+ 2754232357U, // <5,0,0,4>: Cost 3 vsldoi12 <0,4,1,5>, <0,0,4,1>
+ 3845816370U, // <5,0,0,5>: Cost 4 vsldoi12 <3,4,0,5>, <0,0,5,5>
+ 3782353389U, // <5,0,0,6>: Cost 4 vsldoi8 <4,0,5,0>, <0,6,0,7>
+ 3376386090U, // <5,0,0,7>: Cost 4 vmrglw <3,4,5,0>, <5,6,0,7>
+ 2757402697U, // <5,0,0,u>: Cost 3 vsldoi12 <0,u,u,5>, <0,0,u,1>
+ 2626543718U, // <5,0,1,0>: Cost 3 vsldoi4 <1,5,0,1>, LHS
+ 2626544751U, // <5,0,1,1>: Cost 3 vsldoi4 <1,5,0,1>, <1,5,0,1>
+ 1680490598U, // <5,0,1,2>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 3766428665U, // <5,0,1,3>: Cost 4 vsldoi8 <1,3,5,0>, <1,3,5,0>
+ 2626546998U, // <5,0,1,4>: Cost 3 vsldoi4 <1,5,0,1>, RHS
+ 2650435539U, // <5,0,1,5>: Cost 3 vsldoi4 <5,5,0,1>, <5,5,0,1>
+ 3783017715U, // <5,0,1,6>: Cost 4 vsldoi8 <4,1,5,0>, <1,6,5,7>
+ 3385019000U, // <5,0,1,7>: Cost 4 vmrglw <4,u,5,1>, <3,6,0,7>
+ 1680490652U, // <5,0,1,u>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 3376398336U, // <5,0,2,0>: Cost 4 vmrglw <3,4,5,2>, <0,0,0,0>
+ 2245877862U, // <5,0,2,1>: Cost 3 vmrghw <5,2,1,3>, LHS
+ 3773064808U, // <5,0,2,2>: Cost 4 vsldoi8 <2,4,5,0>, <2,2,2,2>
+ 2705295054U, // <5,0,2,3>: Cost 3 vsldoi8 <3,4,5,0>, <2,3,4,5>
+ 3827974343U, // <5,0,2,4>: Cost 4 vsldoi12 <0,4,1,5>, <0,2,4,1>
+ 3845816530U, // <5,0,2,5>: Cost 4 vsldoi12 <3,4,0,5>, <0,2,5,3>
+ 3779037114U, // <5,0,2,6>: Cost 4 vsldoi8 <3,4,5,0>, <2,6,3,7>
+ 3810887658U, // <5,0,2,7>: Cost 4 vsldoi8 <u,7,5,0>, <2,7,0,1>
+ 2245878429U, // <5,0,2,u>: Cost 3 vmrghw <5,2,1,3>, LHS
+ 2710603926U, // <5,0,3,0>: Cost 3 vsldoi8 <4,3,5,0>, <3,0,1,2>
+ 3827974396U, // <5,0,3,1>: Cost 4 vsldoi12 <0,4,1,5>, <0,3,1,0>
+ 3779037516U, // <5,0,3,2>: Cost 4 vsldoi8 <3,4,5,0>, <3,2,3,4>
+ 3779037596U, // <5,0,3,3>: Cost 4 vsldoi8 <3,4,5,0>, <3,3,3,3>
+ 2705295868U, // <5,0,3,4>: Cost 3 vsldoi8 <3,4,5,0>, <3,4,5,0>
+ 3379726804U, // <5,0,3,5>: Cost 4 vmrglw <4,0,5,3>, <3,4,0,5>
+ 3802925748U, // <5,0,3,6>: Cost 4 vsldoi8 <7,4,5,0>, <3,6,7,4>
+ 3363138168U, // <5,0,3,7>: Cost 5 vmrglw <1,2,5,3>, <3,6,0,7>
+ 2707950400U, // <5,0,3,u>: Cost 3 vsldoi8 <3,u,5,0>, <3,u,5,0>
+ 2626568294U, // <5,0,4,0>: Cost 3 vsldoi4 <1,5,0,4>, LHS
+ 1680490834U, // <5,0,4,1>: Cost 2 vsldoi12 <0,4,1,5>, <0,4,1,5>
+ 3828048219U, // <5,0,4,2>: Cost 4 vsldoi12 <0,4,2,5>, <0,4,2,5>
+ 2710604932U, // <5,0,4,3>: Cost 3 vsldoi8 <4,3,5,0>, <4,3,5,0>
+ 2754232685U, // <5,0,4,4>: Cost 3 vsldoi12 <0,4,1,5>, <0,4,4,5>
+ 2705296694U, // <5,0,4,5>: Cost 3 vsldoi8 <3,4,5,0>, RHS
+ 3779038590U, // <5,0,4,6>: Cost 4 vsldoi8 <3,4,5,0>, <4,6,5,7>
+ 2713259464U, // <5,0,4,7>: Cost 3 vsldoi8 <4,7,5,0>, <4,7,5,0>
+ 1680490834U, // <5,0,4,u>: Cost 2 vsldoi12 <0,4,1,5>, <0,4,1,5>
+ 2311307264U, // <5,0,5,0>: Cost 3 vmrglw <4,u,5,5>, <0,0,0,0>
+ 1174437990U, // <5,0,5,1>: Cost 2 vmrghw <5,5,5,5>, LHS
+ 3779038946U, // <5,0,5,2>: Cost 4 vsldoi8 <3,4,5,0>, <5,2,0,3>
+ 3845816752U, // <5,0,5,3>: Cost 4 vsldoi12 <3,4,0,5>, <0,5,3,0>
+ 2248180050U, // <5,0,5,4>: Cost 3 vmrghw <5,5,5,5>, <0,4,1,5>
+ 2248180194U, // <5,0,5,5>: Cost 3 vmrghw <5,5,5,5>, <0,5,u,5>
+ 3779039274U, // <5,0,5,6>: Cost 4 vsldoi8 <3,4,5,0>, <5,6,0,7>
+ 3385051768U, // <5,0,5,7>: Cost 4 vmrglw <4,u,5,5>, <3,6,0,7>
+ 1174438557U, // <5,0,5,u>: Cost 2 vmrghw <5,5,5,5>, LHS
+ 2302689280U, // <5,0,6,0>: Cost 3 vmrglw <3,4,5,6>, <0,0,0,0>
+ 1175208038U, // <5,0,6,1>: Cost 2 vmrghw <5,6,7,0>, LHS
+ 3787002362U, // <5,0,6,2>: Cost 4 vsldoi8 <4,7,5,0>, <6,2,7,3>
+ 3376432160U, // <5,0,6,3>: Cost 4 vmrglw <3,4,5,6>, <1,4,0,3>
+ 2248950098U, // <5,0,6,4>: Cost 3 vmrghw <5,6,7,0>, <0,4,1,5>
+ 2248950180U, // <5,0,6,5>: Cost 3 vmrghw <5,6,7,0>, <0,5,1,6>
+ 3376433702U, // <5,0,6,6>: Cost 4 vmrglw <3,4,5,6>, <3,5,0,6>
+ 2729186166U, // <5,0,6,7>: Cost 3 vsldoi8 <7,4,5,0>, <6,7,4,5>
+ 1175208605U, // <5,0,6,u>: Cost 2 vmrghw <5,6,7,0>, LHS
+ 2713261050U, // <5,0,7,0>: Cost 3 vsldoi8 <4,7,5,0>, <7,0,1,2>
+ 3365823599U, // <5,0,7,1>: Cost 4 vmrglw <1,6,5,7>, <1,5,0,1>
+ 3808900317U, // <5,0,7,2>: Cost 4 vsldoi8 <u,4,5,0>, <7,2,u,4>
+ 3784348899U, // <5,0,7,3>: Cost 4 vsldoi8 <4,3,5,0>, <7,3,0,1>
+ 2729186656U, // <5,0,7,4>: Cost 3 vsldoi8 <7,4,5,0>, <7,4,5,0>
+ 3787003268U, // <5,0,7,5>: Cost 4 vsldoi8 <4,7,5,0>, <7,5,0,0>
+ 3802928664U, // <5,0,7,6>: Cost 4 vsldoi8 <7,4,5,0>, <7,6,7,4>
+ 3787003431U, // <5,0,7,7>: Cost 4 vsldoi8 <4,7,5,0>, <7,7,0,1>
+ 2731841188U, // <5,0,7,u>: Cost 3 vsldoi8 <7,u,5,0>, <7,u,5,0>
+ 2626601062U, // <5,0,u,0>: Cost 3 vsldoi4 <1,5,0,u>, LHS
+ 1683145366U, // <5,0,u,1>: Cost 2 vsldoi12 <0,u,1,5>, <0,u,1,5>
+ 1680491165U, // <5,0,u,2>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 2705295054U, // <5,0,u,3>: Cost 3 vsldoi8 <3,4,5,0>, <2,3,4,5>
+ 2754233005U, // <5,0,u,4>: Cost 3 vsldoi12 <0,4,1,5>, <0,u,4,1>
+ 2705299610U, // <5,0,u,5>: Cost 3 vsldoi8 <3,4,5,0>, RHS
+ 3779041488U, // <5,0,u,6>: Cost 4 vsldoi8 <3,4,5,0>, <u,6,3,7>
+ 2737150252U, // <5,0,u,7>: Cost 3 vsldoi8 <u,7,5,0>, <u,7,5,0>
+ 1680491219U, // <5,0,u,u>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 2713927680U, // <5,1,0,0>: Cost 3 vsldoi8 <4,u,5,1>, <0,0,0,0>
+ 1640185958U, // <5,1,0,1>: Cost 2 vsldoi8 <4,u,5,1>, LHS
+ 2310607866U, // <5,1,0,2>: Cost 3 vmrglw <4,7,5,0>, <7,0,1,2>
+ 3787669756U, // <5,1,0,3>: Cost 4 vsldoi8 <4,u,5,1>, <0,3,1,0>
+ 2713928018U, // <5,1,0,4>: Cost 3 vsldoi8 <4,u,5,1>, <0,4,1,5>
+ 2306621778U, // <5,1,0,5>: Cost 3 vmrglw <4,1,5,0>, <0,4,1,5>
+ 3787670006U, // <5,1,0,6>: Cost 4 vsldoi8 <4,u,5,1>, <0,6,1,7>
+ 3736188301U, // <5,1,0,7>: Cost 4 vsldoi4 <7,5,1,0>, <7,5,1,0>
+ 1640186525U, // <5,1,0,u>: Cost 2 vsldoi8 <4,u,5,1>, LHS
+ 2650505318U, // <5,1,1,0>: Cost 3 vsldoi4 <5,5,1,1>, LHS
+ 2754233140U, // <5,1,1,1>: Cost 3 vsldoi12 <0,4,1,5>, <1,1,1,1>
+ 2311276694U, // <5,1,1,2>: Cost 3 vmrglw <4,u,5,1>, <3,0,1,2>
+ 2311278315U, // <5,1,1,3>: Cost 3 vmrglw <4,u,5,1>, <5,2,1,3>
+ 2758435667U, // <5,1,1,4>: Cost 3 vsldoi12 <1,1,4,5>, <1,1,4,5>
+ 2754233180U, // <5,1,1,5>: Cost 3 vsldoi12 <0,4,1,5>, <1,1,5,5>
+ 3385016497U, // <5,1,1,6>: Cost 4 vmrglw <4,u,5,1>, <0,2,1,6>
+ 2311278643U, // <5,1,1,7>: Cost 3 vmrglw <4,u,5,1>, <5,6,1,7>
+ 2758730615U, // <5,1,1,u>: Cost 3 vsldoi12 <1,1,u,5>, <1,1,u,5>
+ 3700367462U, // <5,1,2,0>: Cost 4 vsldoi4 <1,5,1,2>, LHS
+ 3830629255U, // <5,1,2,1>: Cost 4 vsldoi12 <0,u,1,5>, <1,2,1,3>
+ 2713929320U, // <5,1,2,2>: Cost 3 vsldoi8 <4,u,5,1>, <2,2,2,2>
+ 2754233238U, // <5,1,2,3>: Cost 3 vsldoi12 <0,4,1,5>, <1,2,3,0>
+ 2759099300U, // <5,1,2,4>: Cost 3 vsldoi12 <1,2,4,5>, <1,2,4,5>
+ 2754233259U, // <5,1,2,5>: Cost 3 vsldoi12 <0,4,1,5>, <1,2,5,3>
+ 2713929658U, // <5,1,2,6>: Cost 3 vsldoi8 <4,u,5,1>, <2,6,3,7>
+ 3872359354U, // <5,1,2,7>: Cost 4 vsldoi12 <7,u,0,5>, <1,2,7,0>
+ 2754233283U, // <5,1,2,u>: Cost 3 vsldoi12 <0,4,1,5>, <1,2,u,0>
+ 2713929878U, // <5,1,3,0>: Cost 3 vsldoi8 <4,u,5,1>, <3,0,1,2>
+ 3363135498U, // <5,1,3,1>: Cost 4 vmrglw <1,2,5,3>, <0,0,1,1>
+ 3363137686U, // <5,1,3,2>: Cost 4 vmrglw <1,2,5,3>, <3,0,1,2>
+ 2713930140U, // <5,1,3,3>: Cost 3 vsldoi8 <4,u,5,1>, <3,3,3,3>
+ 2713930242U, // <5,1,3,4>: Cost 3 vsldoi8 <4,u,5,1>, <3,4,5,6>
+ 2289394002U, // <5,1,3,5>: Cost 3 vmrglw <1,2,5,3>, <0,4,1,5>
+ 3787672184U, // <5,1,3,6>: Cost 4 vsldoi8 <4,u,5,1>, <3,6,0,7>
+ 3787672259U, // <5,1,3,7>: Cost 4 vsldoi8 <4,u,5,1>, <3,7,0,1>
+ 2713930526U, // <5,1,3,u>: Cost 3 vsldoi8 <4,u,5,1>, <3,u,1,2>
+ 1634880402U, // <5,1,4,0>: Cost 2 vsldoi8 <4,0,5,1>, <4,0,5,1>
+ 2760205355U, // <5,1,4,1>: Cost 3 vsldoi12 <1,4,1,5>, <1,4,1,5>
+ 2760279092U, // <5,1,4,2>: Cost 3 vsldoi12 <1,4,2,5>, <1,4,2,5>
+ 3787672708U, // <5,1,4,3>: Cost 4 vsldoi8 <4,u,5,1>, <4,3,5,0>
+ 2713930960U, // <5,1,4,4>: Cost 3 vsldoi8 <4,u,5,1>, <4,4,4,4>
+ 1640189238U, // <5,1,4,5>: Cost 2 vsldoi8 <4,u,5,1>, RHS
+ 3786345848U, // <5,1,4,6>: Cost 4 vsldoi8 <4,6,5,1>, <4,6,5,1>
+ 3787009481U, // <5,1,4,7>: Cost 4 vsldoi8 <4,7,5,1>, <4,7,5,1>
+ 1640189466U, // <5,1,4,u>: Cost 2 vsldoi8 <4,u,5,1>, <4,u,5,1>
+ 2754233455U, // <5,1,5,0>: Cost 3 vsldoi12 <0,4,1,5>, <1,5,0,1>
+ 2713931407U, // <5,1,5,1>: Cost 3 vsldoi8 <4,u,5,1>, <5,1,0,1>
+ 2713931499U, // <5,1,5,2>: Cost 3 vsldoi8 <4,u,5,1>, <5,2,1,3>
+ 3827975305U, // <5,1,5,3>: Cost 4 vsldoi12 <0,4,1,5>, <1,5,3,0>
+ 2754233495U, // <5,1,5,4>: Cost 3 vsldoi12 <0,4,1,5>, <1,5,4,5>
+ 2288746834U, // <5,1,5,5>: Cost 3 vmrglw <1,1,5,5>, <0,4,1,5>
+ 2713931827U, // <5,1,5,6>: Cost 3 vsldoi8 <4,u,5,1>, <5,6,1,7>
+ 3787673725U, // <5,1,5,7>: Cost 4 vsldoi8 <4,u,5,1>, <5,7,1,0>
+ 2754233527U, // <5,1,5,u>: Cost 3 vsldoi12 <0,4,1,5>, <1,5,u,1>
+ 2668462182U, // <5,1,6,0>: Cost 3 vsldoi4 <u,5,1,6>, LHS
+ 2290746002U, // <5,1,6,1>: Cost 3 vmrglw <1,4,5,6>, <0,u,1,1>
+ 2302691478U, // <5,1,6,2>: Cost 3 vmrglw <3,4,5,6>, <3,0,1,2>
+ 3364488071U, // <5,1,6,3>: Cost 4 vmrglw <1,4,5,6>, <1,2,1,3>
+ 2302689536U, // <5,1,6,4>: Cost 3 vmrglw <3,4,5,6>, <0,3,1,4>
+ 2754233587U, // <5,1,6,5>: Cost 3 vsldoi12 <0,4,1,5>, <1,6,5,7>
+ 2713932600U, // <5,1,6,6>: Cost 3 vsldoi8 <4,u,5,1>, <6,6,6,6>
+ 2713932622U, // <5,1,6,7>: Cost 3 vsldoi8 <4,u,5,1>, <6,7,0,1>
+ 2302689297U, // <5,1,6,u>: Cost 3 vmrglw <3,4,5,6>, <0,0,1,u>
+ 2713932794U, // <5,1,7,0>: Cost 3 vsldoi8 <4,u,5,1>, <7,0,1,2>
+ 3365822474U, // <5,1,7,1>: Cost 4 vmrglw <1,6,5,7>, <0,0,1,1>
+ 3365824662U, // <5,1,7,2>: Cost 4 vmrglw <1,6,5,7>, <3,0,1,2>
+ 3787674851U, // <5,1,7,3>: Cost 4 vsldoi8 <4,u,5,1>, <7,3,0,1>
+ 2713933158U, // <5,1,7,4>: Cost 3 vsldoi8 <4,u,5,1>, <7,4,5,6>
+ 2292080978U, // <5,1,7,5>: Cost 3 vmrglw <1,6,5,7>, <0,4,1,5>
+ 3365823613U, // <5,1,7,6>: Cost 4 vmrglw <1,6,5,7>, <1,5,1,6>
+ 2713933420U, // <5,1,7,7>: Cost 3 vsldoi8 <4,u,5,1>, <7,7,7,7>
+ 2713933442U, // <5,1,7,u>: Cost 3 vsldoi8 <4,u,5,1>, <7,u,1,2>
+ 1658771190U, // <5,1,u,0>: Cost 2 vsldoi8 <u,0,5,1>, <u,0,5,1>
+ 1640191790U, // <5,1,u,1>: Cost 2 vsldoi8 <4,u,5,1>, LHS
+ 2762933624U, // <5,1,u,2>: Cost 3 vsldoi12 <1,u,2,5>, <1,u,2,5>
+ 2754233724U, // <5,1,u,3>: Cost 3 vsldoi12 <0,4,1,5>, <1,u,3,0>
+ 2763081098U, // <5,1,u,4>: Cost 3 vsldoi12 <1,u,4,5>, <1,u,4,5>
+ 1640192154U, // <5,1,u,5>: Cost 2 vsldoi8 <4,u,5,1>, RHS
+ 2713934032U, // <5,1,u,6>: Cost 3 vsldoi8 <4,u,5,1>, <u,6,3,7>
+ 2713934080U, // <5,1,u,7>: Cost 3 vsldoi8 <4,u,5,1>, <u,7,0,1>
+ 1640192357U, // <5,1,u,u>: Cost 2 vsldoi8 <4,u,5,1>, LHS
+ 3779051520U, // <5,2,0,0>: Cost 4 vsldoi8 <3,4,5,2>, <0,0,0,0>
+ 2705309798U, // <5,2,0,1>: Cost 3 vsldoi8 <3,4,5,2>, LHS
+ 3838813637U, // <5,2,0,2>: Cost 4 vsldoi12 <2,2,4,5>, <2,0,2,1>
+ 2302640230U, // <5,2,0,3>: Cost 3 vmrglw <3,4,5,0>, LHS
+ 3765117266U, // <5,2,0,4>: Cost 4 vsldoi8 <1,1,5,2>, <0,4,1,5>
+ 3381027892U, // <5,2,0,5>: Cost 4 vmrglw <4,2,5,0>, <1,4,2,5>
+ 3842794985U, // <5,2,0,6>: Cost 4 vsldoi12 <2,u,4,5>, <2,0,6,1>
+ 3408232554U, // <5,2,0,7>: Cost 4 vmrglw <u,7,5,0>, <0,1,2,7>
+ 2302640235U, // <5,2,0,u>: Cost 3 vmrglw <3,4,5,0>, LHS
+ 3700432998U, // <5,2,1,0>: Cost 4 vsldoi4 <1,5,2,1>, LHS
+ 3765117785U, // <5,2,1,1>: Cost 4 vsldoi8 <1,1,5,2>, <1,1,5,2>
+ 2311276136U, // <5,2,1,2>: Cost 3 vmrglw <4,u,5,1>, <2,2,2,2>
+ 1237532774U, // <5,2,1,3>: Cost 2 vmrglw <4,u,5,1>, LHS
+ 3700436278U, // <5,2,1,4>: Cost 4 vsldoi4 <1,5,2,1>, RHS
+ 3381036084U, // <5,2,1,5>: Cost 4 vmrglw <4,2,5,1>, <1,4,2,5>
+ 3385018045U, // <5,2,1,6>: Cost 4 vmrglw <4,u,5,1>, <2,3,2,6>
+ 3385017560U, // <5,2,1,7>: Cost 4 vmrglw <4,u,5,1>, <1,6,2,7>
+ 1237532779U, // <5,2,1,u>: Cost 2 vmrglw <4,u,5,1>, LHS
+ 3700441190U, // <5,2,2,0>: Cost 4 vsldoi4 <1,5,2,2>, LHS
+ 3700442242U, // <5,2,2,1>: Cost 4 vsldoi4 <1,5,2,2>, <1,5,2,2>
+ 2754233960U, // <5,2,2,2>: Cost 3 vsldoi12 <0,4,1,5>, <2,2,2,2>
+ 2754233970U, // <5,2,2,3>: Cost 3 vsldoi12 <0,4,1,5>, <2,2,3,3>
+ 2765071997U, // <5,2,2,4>: Cost 3 vsldoi12 <2,2,4,5>, <2,2,4,5>
+ 3834021508U, // <5,2,2,5>: Cost 4 vsldoi12 <1,4,2,5>, <2,2,5,3>
+ 3842795152U, // <5,2,2,6>: Cost 4 vsldoi12 <2,u,4,5>, <2,2,6,6>
+ 3376402492U, // <5,2,2,7>: Cost 4 vmrglw <3,4,5,2>, <5,6,2,7>
+ 2754234015U, // <5,2,2,u>: Cost 3 vsldoi12 <0,4,1,5>, <2,2,u,3>
+ 2754234022U, // <5,2,3,0>: Cost 3 vsldoi12 <0,4,1,5>, <2,3,0,1>
+ 3827975855U, // <5,2,3,1>: Cost 4 vsldoi12 <0,4,1,5>, <2,3,1,1>
+ 2644625102U, // <5,2,3,2>: Cost 3 vsldoi4 <4,5,2,3>, <2,3,4,5>
+ 2289393766U, // <5,2,3,3>: Cost 3 vmrglw <1,2,5,3>, LHS
+ 1691993806U, // <5,2,3,4>: Cost 2 vsldoi12 <2,3,4,5>, <2,3,4,5>
+ 2785052375U, // <5,2,3,5>: Cost 3 vsldoi12 <5,5,5,5>, <2,3,5,5>
+ 3854812897U, // <5,2,3,6>: Cost 4 vsldoi12 <4,u,5,5>, <2,3,6,6>
+ 3802942187U, // <5,2,3,7>: Cost 4 vsldoi8 <7,4,5,2>, <3,7,4,5>
+ 1692288754U, // <5,2,3,u>: Cost 2 vsldoi12 <2,3,u,5>, <2,3,u,5>
+ 3839846139U, // <5,2,4,0>: Cost 4 vsldoi12 <2,4,0,5>, <2,4,0,5>
+ 2709294052U, // <5,2,4,1>: Cost 3 vsldoi8 <4,1,5,2>, <4,1,5,2>
+ 2766251789U, // <5,2,4,2>: Cost 3 vsldoi12 <2,4,2,5>, <2,4,2,5>
+ 2765735702U, // <5,2,4,3>: Cost 3 vsldoi12 <2,3,4,5>, <2,4,3,5>
+ 3840141087U, // <5,2,4,4>: Cost 4 vsldoi12 <2,4,4,5>, <2,4,4,5>
+ 2705313078U, // <5,2,4,5>: Cost 3 vsldoi8 <3,4,5,2>, RHS
+ 2712612217U, // <5,2,4,6>: Cost 3 vsldoi8 <4,6,5,2>, <4,6,5,2>
+ 3787017674U, // <5,2,4,7>: Cost 4 vsldoi8 <4,7,5,2>, <4,7,5,2>
+ 2765735747U, // <5,2,4,u>: Cost 3 vsldoi12 <2,3,4,5>, <2,4,u,5>
+ 3834021704U, // <5,2,5,0>: Cost 4 vsldoi12 <1,4,2,5>, <2,5,0,1>
+ 3834021714U, // <5,2,5,1>: Cost 4 vsldoi12 <1,4,2,5>, <2,5,1,2>
+ 2311308904U, // <5,2,5,2>: Cost 3 vmrglw <4,u,5,5>, <2,2,2,2>
+ 1237565542U, // <5,2,5,3>: Cost 2 vmrglw <4,u,5,5>, LHS
+ 3834021744U, // <5,2,5,4>: Cost 4 vsldoi12 <1,4,2,5>, <2,5,4,5>
+ 3369124916U, // <5,2,5,5>: Cost 4 vmrglw <2,2,5,5>, <1,4,2,5>
+ 2248181690U, // <5,2,5,6>: Cost 3 vmrghw <5,5,5,5>, <2,6,3,7>
+ 3786354825U, // <5,2,5,7>: Cost 4 vsldoi8 <4,6,5,2>, <5,7,2,3>
+ 1237565547U, // <5,2,5,u>: Cost 2 vmrglw <4,u,5,5>, LHS
+ 3700473958U, // <5,2,6,0>: Cost 4 vsldoi4 <1,5,2,6>, LHS
+ 3700475014U, // <5,2,6,1>: Cost 4 vsldoi4 <1,5,2,6>, <1,5,2,6>
+ 2296718952U, // <5,2,6,2>: Cost 3 vmrglw <2,4,5,6>, <2,2,2,2>
+ 1228947558U, // <5,2,6,3>: Cost 2 vmrglw <3,4,5,6>, LHS
+ 3700477238U, // <5,2,6,4>: Cost 4 vsldoi4 <1,5,2,6>, RHS
+ 3834021836U, // <5,2,6,5>: Cost 4 vsldoi12 <1,4,2,5>, <2,6,5,7>
+ 2248951738U, // <5,2,6,6>: Cost 3 vmrghw <5,6,7,0>, <2,6,3,7>
+ 3370461105U, // <5,2,6,7>: Cost 4 vmrglw <2,4,5,6>, <2,6,2,7>
+ 1228947563U, // <5,2,6,u>: Cost 2 vmrglw <3,4,5,6>, LHS
+ 3786355706U, // <5,2,7,0>: Cost 4 vsldoi8 <4,6,5,2>, <7,0,1,2>
+ 3783038037U, // <5,2,7,1>: Cost 4 vsldoi8 <4,1,5,2>, <7,1,2,3>
+ 3365824104U, // <5,2,7,2>: Cost 4 vmrglw <1,6,5,7>, <2,2,2,2>
+ 2292080742U, // <5,2,7,3>: Cost 3 vmrglw <1,6,5,7>, LHS
+ 3842131986U, // <5,2,7,4>: Cost 4 vsldoi12 <2,7,4,5>, <2,7,4,5>
+ 3371795508U, // <5,2,7,5>: Cost 4 vmrglw <2,6,5,7>, <1,4,2,5>
+ 3786356206U, // <5,2,7,6>: Cost 4 vsldoi8 <4,6,5,2>, <7,6,2,7>
+ 3786356332U, // <5,2,7,7>: Cost 4 vsldoi8 <4,6,5,2>, <7,7,7,7>
+ 2292080747U, // <5,2,7,u>: Cost 3 vmrglw <1,6,5,7>, LHS
+ 2754234427U, // <5,2,u,0>: Cost 3 vsldoi12 <0,4,1,5>, <2,u,0,1>
+ 2705315630U, // <5,2,u,1>: Cost 3 vsldoi8 <3,4,5,2>, LHS
+ 2296735336U, // <5,2,u,2>: Cost 3 vmrglw <2,4,5,u>, <2,2,2,2>
+ 1228963942U, // <5,2,u,3>: Cost 2 vmrglw <3,4,5,u>, LHS
+ 1695311971U, // <5,2,u,4>: Cost 2 vsldoi12 <2,u,4,5>, <2,u,4,5>
+ 2705315994U, // <5,2,u,5>: Cost 3 vsldoi8 <3,4,5,2>, RHS
+ 2769201269U, // <5,2,u,6>: Cost 3 vsldoi12 <2,u,6,5>, <2,u,6,5>
+ 3370477489U, // <5,2,u,7>: Cost 4 vmrglw <2,4,5,u>, <2,6,2,7>
+ 1695606919U, // <5,2,u,u>: Cost 2 vsldoi12 <2,u,u,5>, <2,u,u,5>
+ 3827976331U, // <5,3,0,0>: Cost 4 vsldoi12 <0,4,1,5>, <3,0,0,0>
+ 2754234518U, // <5,3,0,1>: Cost 3 vsldoi12 <0,4,1,5>, <3,0,1,2>
+ 3706472290U, // <5,3,0,2>: Cost 4 vsldoi4 <2,5,3,0>, <2,5,3,0>
+ 3700500630U, // <5,3,0,3>: Cost 4 vsldoi4 <1,5,3,0>, <3,0,1,2>
+ 2754234544U, // <5,3,0,4>: Cost 3 vsldoi12 <0,4,1,5>, <3,0,4,1>
+ 3376383766U, // <5,3,0,5>: Cost 4 vmrglw <3,4,5,0>, <2,4,3,5>
+ 3769770513U, // <5,3,0,6>: Cost 5 vsldoi8 <1,u,5,3>, <0,6,4,7>
+ 3376383930U, // <5,3,0,7>: Cost 4 vmrglw <3,4,5,0>, <2,6,3,7>
+ 2754234581U, // <5,3,0,u>: Cost 3 vsldoi12 <0,4,1,5>, <3,0,u,2>
+ 2311275414U, // <5,3,1,0>: Cost 3 vmrglw <4,u,5,1>, <1,2,3,0>
+ 2305967971U, // <5,3,1,1>: Cost 3 vmrglw <4,0,5,1>, <2,5,3,1>
+ 2692047787U, // <5,3,1,2>: Cost 3 vsldoi8 <1,2,5,3>, <1,2,5,3>
+ 2311276146U, // <5,3,1,3>: Cost 3 vmrglw <4,u,5,1>, <2,2,3,3>
+ 2311275418U, // <5,3,1,4>: Cost 3 vmrglw <4,u,5,1>, <1,2,3,4>
+ 3765789807U, // <5,3,1,5>: Cost 4 vsldoi8 <1,2,5,3>, <1,5,0,1>
+ 3765789939U, // <5,3,1,6>: Cost 4 vsldoi8 <1,2,5,3>, <1,6,5,7>
+ 2311276474U, // <5,3,1,7>: Cost 3 vmrglw <4,u,5,1>, <2,6,3,7>
+ 2696029585U, // <5,3,1,u>: Cost 3 vsldoi8 <1,u,5,3>, <1,u,5,3>
+ 2311288709U, // <5,3,2,0>: Cost 3 vmrglw <4,u,5,2>, <u,2,3,0>
+ 3765790243U, // <5,3,2,1>: Cost 4 vsldoi8 <1,2,5,3>, <2,1,3,5>
+ 3827976513U, // <5,3,2,2>: Cost 4 vsldoi12 <0,4,1,5>, <3,2,2,2>
+ 2765736268U, // <5,3,2,3>: Cost 3 vsldoi12 <2,3,4,5>, <3,2,3,4>
+ 2246248962U, // <5,3,2,4>: Cost 3 vmrghw <5,2,6,3>, <3,4,5,6>
+ 3765790563U, // <5,3,2,5>: Cost 4 vsldoi8 <1,2,5,3>, <2,5,3,1>
+ 3827976550U, // <5,3,2,6>: Cost 4 vsldoi12 <0,4,1,5>, <3,2,6,3>
+ 3842795887U, // <5,3,2,7>: Cost 4 vsldoi12 <2,u,4,5>, <3,2,7,3>
+ 2769054073U, // <5,3,2,u>: Cost 3 vsldoi12 <2,u,4,5>, <3,2,u,4>
+ 3827976575U, // <5,3,3,0>: Cost 4 vsldoi12 <0,4,1,5>, <3,3,0,1>
+ 3765790963U, // <5,3,3,1>: Cost 4 vsldoi8 <1,2,5,3>, <3,1,2,5>
+ 3839478162U, // <5,3,3,2>: Cost 4 vsldoi12 <2,3,4,5>, <3,3,2,2>
+ 2754234780U, // <5,3,3,3>: Cost 3 vsldoi12 <0,4,1,5>, <3,3,3,3>
+ 2771708327U, // <5,3,3,4>: Cost 3 vsldoi12 <3,3,4,5>, <3,3,4,5>
+ 3363137059U, // <5,3,3,5>: Cost 4 vmrglw <1,2,5,3>, <2,1,3,5>
+ 3375081320U, // <5,3,3,6>: Cost 4 vmrglw <3,2,5,3>, <2,5,3,6>
+ 3363137466U, // <5,3,3,7>: Cost 4 vmrglw <1,2,5,3>, <2,6,3,7>
+ 2772003275U, // <5,3,3,u>: Cost 3 vsldoi12 <3,3,u,5>, <3,3,u,5>
+ 2772077012U, // <5,3,4,0>: Cost 3 vsldoi12 <3,4,0,5>, <3,4,0,5>
+ 3765791714U, // <5,3,4,1>: Cost 4 vsldoi8 <1,2,5,3>, <4,1,5,0>
+ 2709965878U, // <5,3,4,2>: Cost 3 vsldoi8 <4,2,5,3>, <4,2,5,3>
+ 2772298223U, // <5,3,4,3>: Cost 3 vsldoi12 <3,4,3,5>, <3,4,3,5>
+ 2772371960U, // <5,3,4,4>: Cost 3 vsldoi12 <3,4,4,5>, <3,4,4,5>
+ 2754234882U, // <5,3,4,5>: Cost 3 vsldoi12 <0,4,1,5>, <3,4,5,6>
+ 3839478282U, // <5,3,4,6>: Cost 4 vsldoi12 <2,3,4,5>, <3,4,6,5>
+ 3376416698U, // <5,3,4,7>: Cost 4 vmrglw <3,4,5,4>, <2,6,3,7>
+ 2754234909U, // <5,3,4,u>: Cost 3 vsldoi12 <0,4,1,5>, <3,4,u,6>
+ 2311308182U, // <5,3,5,0>: Cost 3 vmrglw <4,u,5,5>, <1,2,3,0>
+ 3765792421U, // <5,3,5,1>: Cost 4 vsldoi8 <1,2,5,3>, <5,1,2,5>
+ 2715938575U, // <5,3,5,2>: Cost 3 vsldoi8 <5,2,5,3>, <5,2,5,3>
+ 2311308914U, // <5,3,5,3>: Cost 3 vmrglw <4,u,5,5>, <2,2,3,3>
+ 2311308186U, // <5,3,5,4>: Cost 3 vmrglw <4,u,5,5>, <1,2,3,4>
+ 2248182354U, // <5,3,5,5>: Cost 3 vmrghw <5,5,5,5>, <3,5,5,5>
+ 3765792837U, // <5,3,5,6>: Cost 4 vsldoi8 <1,2,5,3>, <5,6,3,7>
+ 2311309242U, // <5,3,5,7>: Cost 3 vmrglw <4,u,5,5>, <2,6,3,7>
+ 2311308190U, // <5,3,5,u>: Cost 3 vmrglw <4,u,5,5>, <1,2,3,u>
+ 2632777830U, // <5,3,6,0>: Cost 3 vsldoi4 <2,5,3,6>, LHS
+ 3706520372U, // <5,3,6,1>: Cost 4 vsldoi4 <2,5,3,6>, <1,1,1,1>
+ 2632779624U, // <5,3,6,2>: Cost 3 vsldoi4 <2,5,3,6>, <2,5,3,6>
+ 2632780290U, // <5,3,6,3>: Cost 3 vsldoi4 <2,5,3,6>, <3,4,5,6>
+ 2632781110U, // <5,3,6,4>: Cost 3 vsldoi4 <2,5,3,6>, RHS
+ 2248952413U, // <5,3,6,5>: Cost 3 vmrghw <5,6,7,0>, <3,5,6,7>
+ 2302691176U, // <5,3,6,6>: Cost 3 vmrglw <3,4,5,6>, <2,5,3,6>
+ 2302691258U, // <5,3,6,7>: Cost 3 vmrglw <3,4,5,6>, <2,6,3,7>
+ 2632783662U, // <5,3,6,u>: Cost 3 vsldoi4 <2,5,3,6>, LHS
+ 3365823382U, // <5,3,7,0>: Cost 4 vmrglw <1,6,5,7>, <1,2,3,0>
+ 3706529011U, // <5,3,7,1>: Cost 4 vsldoi4 <2,5,3,7>, <1,6,5,7>
+ 3706529641U, // <5,3,7,2>: Cost 4 vsldoi4 <2,5,3,7>, <2,5,3,7>
+ 3365824114U, // <5,3,7,3>: Cost 4 vmrglw <1,6,5,7>, <2,2,3,3>
+ 2774362859U, // <5,3,7,4>: Cost 3 vsldoi12 <3,7,4,5>, <3,7,4,5>
+ 3365824035U, // <5,3,7,5>: Cost 4 vmrglw <1,6,5,7>, <2,1,3,5>
+ 3383740183U, // <5,3,7,6>: Cost 4 vmrglw <4,6,5,7>, <2,4,3,6>
+ 3363833786U, // <5,3,7,7>: Cost 4 vmrglw <1,3,5,7>, <2,6,3,7>
+ 2774657807U, // <5,3,7,u>: Cost 3 vsldoi12 <3,7,u,5>, <3,7,u,5>
+ 2632794214U, // <5,3,u,0>: Cost 3 vsldoi4 <2,5,3,u>, LHS
+ 2754235166U, // <5,3,u,1>: Cost 3 vsldoi12 <0,4,1,5>, <3,u,1,2>
+ 2632796010U, // <5,3,u,2>: Cost 3 vsldoi4 <2,5,3,u>, <2,5,3,u>
+ 2632796676U, // <5,3,u,3>: Cost 3 vsldoi4 <2,5,3,u>, <3,4,5,u>
+ 2632797494U, // <5,3,u,4>: Cost 3 vsldoi4 <2,5,3,u>, RHS
+ 2754235206U, // <5,3,u,5>: Cost 3 vsldoi12 <0,4,1,5>, <3,u,5,6>
+ 2302691176U, // <5,3,u,6>: Cost 3 vmrglw <3,4,5,6>, <2,5,3,6>
+ 2302707642U, // <5,3,u,7>: Cost 3 vmrglw <3,4,5,u>, <2,6,3,7>
+ 2754235229U, // <5,3,u,u>: Cost 3 vsldoi12 <0,4,1,5>, <3,u,u,2>
+ 3765133325U, // <5,4,0,0>: Cost 4 vsldoi8 <1,1,5,4>, <0,0,1,4>
+ 2705326182U, // <5,4,0,1>: Cost 3 vsldoi8 <3,4,5,4>, LHS
+ 3718489806U, // <5,4,0,2>: Cost 4 vsldoi4 <4,5,4,0>, <2,3,4,5>
+ 3718490624U, // <5,4,0,3>: Cost 4 vsldoi4 <4,5,4,0>, <3,4,5,4>
+ 2709307730U, // <5,4,0,4>: Cost 3 vsldoi8 <4,1,5,4>, <0,4,1,5>
+ 2302641870U, // <5,4,0,5>: Cost 3 vmrglw <3,4,5,0>, <2,3,4,5>
+ 3376383695U, // <5,4,0,6>: Cost 5 vmrglw <3,4,5,0>, <2,3,4,6>
+ 3384351018U, // <5,4,0,7>: Cost 4 vmrglw <4,7,5,0>, <u,7,4,7>
+ 2705326749U, // <5,4,0,u>: Cost 3 vsldoi8 <3,4,5,4>, LHS
+ 2305971057U, // <5,4,1,0>: Cost 3 vmrglw <4,0,5,1>, <6,7,4,0>
+ 3765134171U, // <5,4,1,1>: Cost 4 vsldoi8 <1,1,5,4>, <1,1,5,4>
+ 3766461338U, // <5,4,1,2>: Cost 4 vsldoi8 <1,3,5,4>, <1,2,3,4>
+ 3766461437U, // <5,4,1,3>: Cost 4 vsldoi8 <1,3,5,4>, <1,3,5,4>
+ 2311277776U, // <5,4,1,4>: Cost 3 vmrglw <4,u,5,1>, <4,4,4,4>
+ 2754235362U, // <5,4,1,5>: Cost 3 vsldoi12 <0,4,1,5>, <4,1,5,0>
+ 3783050483U, // <5,4,1,6>: Cost 4 vsldoi8 <4,1,5,4>, <1,6,5,7>
+ 3385019036U, // <5,4,1,7>: Cost 4 vmrglw <4,u,5,1>, <3,6,4,7>
+ 2311276241U, // <5,4,1,u>: Cost 3 vmrglw <4,u,5,1>, <2,3,4,u>
+ 3718504550U, // <5,4,2,0>: Cost 4 vsldoi4 <4,5,4,2>, LHS
+ 3783050787U, // <5,4,2,1>: Cost 4 vsldoi8 <4,1,5,4>, <2,1,3,5>
+ 3773097576U, // <5,4,2,2>: Cost 4 vsldoi8 <2,4,5,4>, <2,2,2,2>
+ 2705327822U, // <5,4,2,3>: Cost 3 vsldoi8 <3,4,5,4>, <2,3,4,5>
+ 3773097767U, // <5,4,2,4>: Cost 4 vsldoi8 <2,4,5,4>, <2,4,5,4>
+ 2765737014U, // <5,4,2,5>: Cost 3 vsldoi12 <2,3,4,5>, <4,2,5,3>
+ 3779069882U, // <5,4,2,6>: Cost 4 vsldoi8 <3,4,5,4>, <2,6,3,7>
+ 3376401052U, // <5,4,2,7>: Cost 5 vmrglw <3,4,5,2>, <3,6,4,7>
+ 2245881370U, // <5,4,2,u>: Cost 3 vmrghw <5,2,1,3>, <4,u,5,1>
+ 3779070102U, // <5,4,3,0>: Cost 4 vsldoi8 <3,4,5,4>, <3,0,1,2>
+ 3363135525U, // <5,4,3,1>: Cost 4 vmrglw <1,2,5,3>, <0,0,4,1>
+ 3779070284U, // <5,4,3,2>: Cost 4 vsldoi8 <3,4,5,4>, <3,2,3,4>
+ 3779070364U, // <5,4,3,3>: Cost 4 vsldoi8 <3,4,5,4>, <3,3,3,3>
+ 2705328640U, // <5,4,3,4>: Cost 3 vsldoi8 <3,4,5,4>, <3,4,5,4>
+ 2307311310U, // <5,4,3,5>: Cost 3 vmrglw <4,2,5,3>, <2,3,4,5>
+ 3866021012U, // <5,4,3,6>: Cost 4 vsldoi12 <6,7,4,5>, <4,3,6,7>
+ 3363138204U, // <5,4,3,7>: Cost 5 vmrglw <1,2,5,3>, <3,6,4,7>
+ 2707983172U, // <5,4,3,u>: Cost 3 vsldoi8 <3,u,5,4>, <3,u,5,4>
+ 2708646805U, // <5,4,4,0>: Cost 3 vsldoi8 <4,0,5,4>, <4,0,5,4>
+ 2709310438U, // <5,4,4,1>: Cost 3 vsldoi8 <4,1,5,4>, <4,1,5,4>
+ 3779071030U, // <5,4,4,2>: Cost 4 vsldoi8 <3,4,5,4>, <4,2,5,3>
+ 2710637704U, // <5,4,4,3>: Cost 3 vsldoi8 <4,3,5,4>, <4,3,5,4>
+ 2754235600U, // <5,4,4,4>: Cost 3 vsldoi12 <0,4,1,5>, <4,4,4,4>
+ 1704676570U, // <5,4,4,5>: Cost 2 vsldoi12 <4,4,5,5>, <4,4,5,5>
+ 3779071358U, // <5,4,4,6>: Cost 4 vsldoi8 <3,4,5,4>, <4,6,5,7>
+ 2713292236U, // <5,4,4,7>: Cost 3 vsldoi8 <4,7,5,4>, <4,7,5,4>
+ 1704897781U, // <5,4,4,u>: Cost 2 vsldoi12 <4,4,u,5>, <4,4,u,5>
+ 2626871398U, // <5,4,5,0>: Cost 3 vsldoi4 <1,5,4,5>, LHS
+ 2626872471U, // <5,4,5,1>: Cost 3 vsldoi4 <1,5,4,5>, <1,5,4,5>
+ 2765737230U, // <5,4,5,2>: Cost 3 vsldoi12 <2,3,4,5>, <4,5,2,3>
+ 3700615318U, // <5,4,5,3>: Cost 4 vsldoi4 <1,5,4,5>, <3,0,1,2>
+ 2626874678U, // <5,4,5,4>: Cost 3 vsldoi4 <1,5,4,5>, RHS
+ 1174441270U, // <5,4,5,5>: Cost 2 vmrghw <5,5,5,5>, RHS
+ 1680493878U, // <5,4,5,6>: Cost 2 vsldoi12 <0,4,1,5>, RHS
+ 3385051804U, // <5,4,5,7>: Cost 4 vmrglw <4,u,5,5>, <3,6,4,7>
+ 1680493896U, // <5,4,5,u>: Cost 2 vsldoi12 <0,4,1,5>, RHS
+ 2248952722U, // <5,4,6,0>: Cost 3 vmrghw <5,6,7,0>, <4,0,5,1>
+ 2302692152U, // <5,4,6,1>: Cost 3 vmrglw <3,4,5,6>, <3,u,4,1>
+ 3382406107U, // <5,4,6,2>: Cost 4 vmrglw <4,4,5,6>, <4,1,4,2>
+ 3700623874U, // <5,4,6,3>: Cost 4 vsldoi4 <1,5,4,6>, <3,4,5,6>
+ 2248953040U, // <5,4,6,4>: Cost 3 vmrghw <5,6,7,0>, <4,4,4,4>
+ 1175211318U, // <5,4,6,5>: Cost 2 vmrghw <5,6,7,0>, RHS
+ 3376432280U, // <5,4,6,6>: Cost 4 vmrglw <3,4,5,6>, <1,5,4,6>
+ 2729218934U, // <5,4,6,7>: Cost 3 vsldoi8 <7,4,5,4>, <6,7,4,5>
+ 1175211561U, // <5,4,6,u>: Cost 2 vmrghw <5,6,7,0>, RHS
+ 3787035642U, // <5,4,7,0>: Cost 4 vsldoi8 <4,7,5,4>, <7,0,1,2>
+ 3365822501U, // <5,4,7,1>: Cost 4 vmrglw <1,6,5,7>, <0,0,4,1>
+ 3808933085U, // <5,4,7,2>: Cost 4 vsldoi8 <u,4,5,4>, <7,2,u,4>
+ 3784381707U, // <5,4,7,3>: Cost 4 vsldoi8 <4,3,5,4>, <7,3,4,5>
+ 2713294182U, // <5,4,7,4>: Cost 3 vsldoi8 <4,7,5,4>, <7,4,5,6>
+ 2309998286U, // <5,4,7,5>: Cost 3 vmrglw <4,6,5,7>, <2,3,4,5>
+ 3383740111U, // <5,4,7,6>: Cost 4 vmrglw <4,6,5,7>, <2,3,4,6>
+ 3787036239U, // <5,4,7,7>: Cost 4 vsldoi8 <4,7,5,4>, <7,7,4,5>
+ 2731873960U, // <5,4,7,u>: Cost 3 vsldoi8 <7,u,5,4>, <7,u,5,4>
+ 2626895974U, // <5,4,u,0>: Cost 3 vsldoi4 <1,5,4,u>, LHS
+ 2626897050U, // <5,4,u,1>: Cost 3 vsldoi4 <1,5,4,u>, <1,5,4,u>
+ 2644813518U, // <5,4,u,2>: Cost 3 vsldoi4 <4,5,4,u>, <2,3,4,5>
+ 2705327822U, // <5,4,u,3>: Cost 3 vsldoi8 <3,4,5,4>, <2,3,4,5>
+ 2626899254U, // <5,4,u,4>: Cost 3 vsldoi4 <1,5,4,u>, RHS
+ 1707331102U, // <5,4,u,5>: Cost 2 vsldoi12 <4,u,5,5>, <4,u,5,5>
+ 1680494121U, // <5,4,u,6>: Cost 2 vsldoi12 <0,4,1,5>, RHS
+ 2737183024U, // <5,4,u,7>: Cost 3 vsldoi8 <u,7,5,4>, <u,7,5,4>
+ 1680494139U, // <5,4,u,u>: Cost 2 vsldoi12 <0,4,1,5>, RHS
+ 2302642684U, // <5,5,0,0>: Cost 3 vmrglw <3,4,5,0>, <3,4,5,0>
+ 1640218726U, // <5,5,0,1>: Cost 2 vsldoi8 <4,u,5,5>, LHS
+ 3376384510U, // <5,5,0,2>: Cost 4 vmrglw <3,4,5,0>, <3,4,5,2>
+ 3376385078U, // <5,5,0,3>: Cost 4 vmrglw <3,4,5,0>, <4,2,5,3>
+ 2754236002U, // <5,5,0,4>: Cost 3 vsldoi12 <0,4,1,5>, <5,0,4,1>
+ 2717942242U, // <5,5,0,5>: Cost 3 vsldoi8 <5,5,5,5>, <0,5,u,5>
+ 2244907106U, // <5,5,0,6>: Cost 3 vmrghw <5,0,6,1>, <5,6,7,0>
+ 3376385406U, // <5,5,0,7>: Cost 4 vmrglw <3,4,5,0>, <4,6,5,7>
+ 1640219293U, // <5,5,0,u>: Cost 2 vsldoi8 <4,u,5,5>, LHS
+ 2305969365U, // <5,5,1,0>: Cost 3 vmrglw <4,0,5,1>, <4,4,5,0>
+ 1237536282U, // <5,5,1,1>: Cost 2 vmrglw <4,u,5,1>, <4,u,5,1>
+ 2713961366U, // <5,5,1,2>: Cost 3 vsldoi8 <4,u,5,5>, <1,2,3,0>
+ 3766469630U, // <5,5,1,3>: Cost 4 vsldoi8 <1,3,5,5>, <1,3,5,5>
+ 2782326455U, // <5,5,1,4>: Cost 3 vsldoi12 <5,1,4,5>, <5,1,4,5>
+ 2311277786U, // <5,5,1,5>: Cost 3 vmrglw <4,u,5,1>, <4,4,5,5>
+ 2311277058U, // <5,5,1,6>: Cost 3 vmrglw <4,u,5,1>, <3,4,5,6>
+ 3385017587U, // <5,5,1,7>: Cost 4 vmrglw <4,u,5,1>, <1,6,5,7>
+ 1237536282U, // <5,5,1,u>: Cost 2 vmrglw <4,u,5,1>, <4,u,5,1>
+ 3376400892U, // <5,5,2,0>: Cost 4 vmrglw <3,4,5,2>, <3,4,5,0>
+ 3827977963U, // <5,5,2,1>: Cost 4 vsldoi12 <0,4,1,5>, <5,2,1,3>
+ 2302659070U, // <5,5,2,2>: Cost 3 vmrglw <3,4,5,2>, <3,4,5,2>
+ 2765737726U, // <5,5,2,3>: Cost 3 vsldoi12 <2,3,4,5>, <5,2,3,4>
+ 3839479558U, // <5,5,2,4>: Cost 4 vsldoi12 <2,3,4,5>, <5,2,4,3>
+ 2781073167U, // <5,5,2,5>: Cost 3 vsldoi12 <4,u,5,5>, <5,2,5,3>
+ 2713962426U, // <5,5,2,6>: Cost 3 vsldoi8 <4,u,5,5>, <2,6,3,7>
+ 3376401790U, // <5,5,2,7>: Cost 4 vmrglw <3,4,5,2>, <4,6,5,7>
+ 2769055531U, // <5,5,2,u>: Cost 3 vsldoi12 <2,u,4,5>, <5,2,u,4>
+ 2713962646U, // <5,5,3,0>: Cost 3 vsldoi8 <4,u,5,5>, <3,0,1,2>
+ 3765143786U, // <5,5,3,1>: Cost 4 vsldoi8 <1,1,5,5>, <3,1,1,5>
+ 3839479621U, // <5,5,3,2>: Cost 4 vsldoi12 <2,3,4,5>, <5,3,2,3>
+ 2289394603U, // <5,5,3,3>: Cost 3 vmrglw <1,2,5,3>, <1,2,5,3>
+ 2713963010U, // <5,5,3,4>: Cost 3 vsldoi8 <4,u,5,5>, <3,4,5,6>
+ 2313285150U, // <5,5,3,5>: Cost 3 vmrglw <5,2,5,3>, <4,u,5,5>
+ 3363138050U, // <5,5,3,6>: Cost 4 vmrglw <1,2,5,3>, <3,4,5,6>
+ 3363136755U, // <5,5,3,7>: Cost 4 vmrglw <1,2,5,3>, <1,6,5,7>
+ 2713963294U, // <5,5,3,u>: Cost 3 vsldoi8 <4,u,5,5>, <3,u,1,2>
+ 2713963410U, // <5,5,4,0>: Cost 3 vsldoi8 <4,u,5,5>, <4,0,5,1>
+ 3827978127U, // <5,5,4,1>: Cost 4 vsldoi12 <0,4,1,5>, <5,4,1,5>
+ 3839479704U, // <5,5,4,2>: Cost 4 vsldoi12 <2,3,4,5>, <5,4,2,5>
+ 3376417846U, // <5,5,4,3>: Cost 4 vmrglw <3,4,5,4>, <4,2,5,3>
+ 1637567706U, // <5,5,4,4>: Cost 2 vsldoi8 <4,4,5,5>, <4,4,5,5>
+ 1640222006U, // <5,5,4,5>: Cost 2 vsldoi8 <4,u,5,5>, RHS
+ 2310640998U, // <5,5,4,6>: Cost 3 vmrglw <4,7,5,4>, <7,4,5,6>
+ 3376418174U, // <5,5,4,7>: Cost 4 vmrglw <3,4,5,4>, <4,6,5,7>
+ 1640222238U, // <5,5,4,u>: Cost 2 vsldoi8 <4,u,5,5>, <4,u,5,5>
+ 1577091174U, // <5,5,5,0>: Cost 2 vsldoi4 <5,5,5,5>, LHS
+ 2311310226U, // <5,5,5,1>: Cost 3 vmrglw <4,u,5,5>, <4,0,5,1>
+ 2713964303U, // <5,5,5,2>: Cost 3 vsldoi8 <4,u,5,5>, <5,2,5,3>
+ 2311311119U, // <5,5,5,3>: Cost 3 vmrglw <4,u,5,5>, <5,2,5,3>
+ 1577094454U, // <5,5,5,4>: Cost 2 vsldoi4 <5,5,5,5>, RHS
+ 296144182U, // <5,5,5,5>: Cost 1 vspltisw1 RHS
+ 2311309826U, // <5,5,5,6>: Cost 3 vmrglw <4,u,5,5>, <3,4,5,6>
+ 2311311447U, // <5,5,5,7>: Cost 3 vmrglw <4,u,5,5>, <5,6,5,7>
+ 296144182U, // <5,5,5,u>: Cost 1 vspltisw1 RHS
+ 2248953460U, // <5,5,6,0>: Cost 3 vmrghw <5,6,7,0>, <5,0,6,1>
+ 2326580114U, // <5,5,6,1>: Cost 3 vmrglw <7,4,5,6>, <4,0,5,1>
+ 2713965050U, // <5,5,6,2>: Cost 3 vsldoi8 <4,u,5,5>, <6,2,7,3>
+ 3700697602U, // <5,5,6,3>: Cost 4 vsldoi4 <1,5,5,6>, <3,4,5,6>
+ 2785644620U, // <5,5,6,4>: Cost 3 vsldoi12 <5,6,4,5>, <5,6,4,5>
+ 2781073495U, // <5,5,6,5>: Cost 3 vsldoi12 <4,u,5,5>, <5,6,5,7>
+ 1228950018U, // <5,5,6,6>: Cost 2 vmrglw <3,4,5,6>, <3,4,5,6>
+ 2713965390U, // <5,5,6,7>: Cost 3 vsldoi8 <4,u,5,5>, <6,7,0,1>
+ 1228950018U, // <5,5,6,u>: Cost 2 vmrglw <3,4,5,6>, <3,4,5,6>
+ 2713965562U, // <5,5,7,0>: Cost 3 vsldoi8 <4,u,5,5>, <7,0,1,2>
+ 3383741330U, // <5,5,7,1>: Cost 4 vmrglw <4,6,5,7>, <4,0,5,1>
+ 3718620878U, // <5,5,7,2>: Cost 4 vsldoi4 <4,5,5,7>, <2,3,4,5>
+ 3365823403U, // <5,5,7,3>: Cost 4 vmrglw <1,6,5,7>, <1,2,5,3>
+ 2713965926U, // <5,5,7,4>: Cost 3 vsldoi8 <4,u,5,5>, <7,4,5,6>
+ 2717947318U, // <5,5,7,5>: Cost 3 vsldoi8 <5,5,5,5>, <7,5,5,5>
+ 3365825026U, // <5,5,7,6>: Cost 4 vmrglw <1,6,5,7>, <3,4,5,6>
+ 2292081907U, // <5,5,7,7>: Cost 3 vmrglw <1,6,5,7>, <1,6,5,7>
+ 2713966210U, // <5,5,7,u>: Cost 3 vsldoi8 <4,u,5,5>, <7,u,1,2>
+ 1577091174U, // <5,5,u,0>: Cost 2 vsldoi4 <5,5,5,5>, LHS
+ 1640224558U, // <5,5,u,1>: Cost 2 vsldoi8 <4,u,5,5>, LHS
+ 2713966469U, // <5,5,u,2>: Cost 3 vsldoi8 <4,u,5,5>, <u,2,3,0>
+ 2713966524U, // <5,5,u,3>: Cost 3 vsldoi8 <4,u,5,5>, <u,3,0,1>
+ 1577094454U, // <5,5,u,4>: Cost 2 vsldoi4 <5,5,5,5>, RHS
+ 296144182U, // <5,5,u,5>: Cost 1 vspltisw1 RHS
+ 1228950018U, // <5,5,u,6>: Cost 2 vmrglw <3,4,5,6>, <3,4,5,6>
+ 2713966848U, // <5,5,u,7>: Cost 3 vsldoi8 <4,u,5,5>, <u,7,0,1>
+ 296144182U, // <5,5,u,u>: Cost 1 vspltisw1 RHS
+ 2705342464U, // <5,6,0,0>: Cost 3 vsldoi8 <3,4,5,6>, <0,0,0,0>
+ 1631600742U, // <5,6,0,1>: Cost 2 vsldoi8 <3,4,5,6>, LHS
+ 3773112493U, // <5,6,0,2>: Cost 4 vsldoi8 <2,4,5,6>, <0,2,1,2>
+ 2705342720U, // <5,6,0,3>: Cost 3 vsldoi8 <3,4,5,6>, <0,3,1,4>
+ 2705342802U, // <5,6,0,4>: Cost 3 vsldoi8 <3,4,5,6>, <0,4,1,5>
+ 3779084708U, // <5,6,0,5>: Cost 4 vsldoi8 <3,4,5,6>, <0,5,1,6>
+ 3779084790U, // <5,6,0,6>: Cost 4 vsldoi8 <3,4,5,6>, <0,6,1,7>
+ 2302643510U, // <5,6,0,7>: Cost 3 vmrglw <3,4,5,0>, RHS
+ 1631601309U, // <5,6,0,u>: Cost 2 vsldoi8 <3,4,5,6>, LHS
+ 3767141092U, // <5,6,1,0>: Cost 4 vsldoi8 <1,4,5,6>, <1,0,1,2>
+ 2705343284U, // <5,6,1,1>: Cost 3 vsldoi8 <3,4,5,6>, <1,1,1,1>
+ 2705343382U, // <5,6,1,2>: Cost 3 vsldoi8 <3,4,5,6>, <1,2,3,0>
+ 3779085282U, // <5,6,1,3>: Cost 4 vsldoi8 <3,4,5,6>, <1,3,2,4>
+ 2693399632U, // <5,6,1,4>: Cost 3 vsldoi8 <1,4,5,6>, <1,4,5,6>
+ 3767805089U, // <5,6,1,5>: Cost 4 vsldoi8 <1,5,5,6>, <1,5,5,6>
+ 2311279416U, // <5,6,1,6>: Cost 3 vmrglw <4,u,5,1>, <6,6,6,6>
+ 1237536054U, // <5,6,1,7>: Cost 2 vmrglw <4,u,5,1>, RHS
+ 1237536055U, // <5,6,1,u>: Cost 2 vmrglw <4,u,5,1>, RHS
+ 3773113789U, // <5,6,2,0>: Cost 4 vsldoi8 <2,4,5,6>, <2,0,1,2>
+ 3779085855U, // <5,6,2,1>: Cost 4 vsldoi8 <3,4,5,6>, <2,1,3,1>
+ 2699372136U, // <5,6,2,2>: Cost 3 vsldoi8 <2,4,5,6>, <2,2,2,2>
+ 2705344166U, // <5,6,2,3>: Cost 3 vsldoi8 <3,4,5,6>, <2,3,0,1>
+ 2699372329U, // <5,6,2,4>: Cost 3 vsldoi8 <2,4,5,6>, <2,4,5,6>
+ 2705344360U, // <5,6,2,5>: Cost 3 vsldoi8 <3,4,5,6>, <2,5,3,6>
+ 2705344442U, // <5,6,2,6>: Cost 3 vsldoi8 <3,4,5,6>, <2,6,3,7>
+ 2302659894U, // <5,6,2,7>: Cost 3 vmrglw <3,4,5,2>, RHS
+ 2702026861U, // <5,6,2,u>: Cost 3 vsldoi8 <2,u,5,6>, <2,u,5,6>
+ 2705344662U, // <5,6,3,0>: Cost 3 vsldoi8 <3,4,5,6>, <3,0,1,2>
+ 3767142661U, // <5,6,3,1>: Cost 4 vsldoi8 <1,4,5,6>, <3,1,4,5>
+ 3773114689U, // <5,6,3,2>: Cost 4 vsldoi8 <2,4,5,6>, <3,2,2,2>
+ 2705344924U, // <5,6,3,3>: Cost 3 vsldoi8 <3,4,5,6>, <3,3,3,3>
+ 1631603202U, // <5,6,3,4>: Cost 2 vsldoi8 <3,4,5,6>, <3,4,5,6>
+ 3842945597U, // <5,6,3,5>: Cost 4 vsldoi12 <2,u,6,5>, <6,3,5,7>
+ 3779086962U, // <5,6,3,6>: Cost 4 vsldoi8 <3,4,5,6>, <3,6,0,1>
+ 2289397046U, // <5,6,3,7>: Cost 3 vmrglw <1,2,5,3>, RHS
+ 1634257734U, // <5,6,3,u>: Cost 2 vsldoi8 <3,u,5,6>, <3,u,5,6>
+ 2644926566U, // <5,6,4,0>: Cost 3 vsldoi4 <4,5,6,4>, LHS
+ 3779087306U, // <5,6,4,1>: Cost 4 vsldoi8 <3,4,5,6>, <4,1,2,3>
+ 2790142577U, // <5,6,4,2>: Cost 3 vsldoi12 <6,4,2,5>, <6,4,2,5>
+ 2644929026U, // <5,6,4,3>: Cost 3 vsldoi4 <4,5,6,4>, <3,4,5,6>
+ 2711317723U, // <5,6,4,4>: Cost 3 vsldoi8 <4,4,5,6>, <4,4,5,6>
+ 1631604022U, // <5,6,4,5>: Cost 2 vsldoi8 <3,4,5,6>, RHS
+ 2712644989U, // <5,6,4,6>: Cost 3 vsldoi8 <4,6,5,6>, <4,6,5,6>
+ 2302676278U, // <5,6,4,7>: Cost 3 vmrglw <3,4,5,4>, RHS
+ 1631604265U, // <5,6,4,u>: Cost 2 vsldoi8 <3,4,5,6>, RHS
+ 3842945708U, // <5,6,5,0>: Cost 4 vsldoi12 <2,u,6,5>, <6,5,0,1>
+ 3767144133U, // <5,6,5,1>: Cost 4 vsldoi8 <1,4,5,6>, <5,1,6,1>
+ 2705346328U, // <5,6,5,2>: Cost 3 vsldoi8 <3,4,5,6>, <5,2,6,3>
+ 3779088207U, // <5,6,5,3>: Cost 4 vsldoi8 <3,4,5,6>, <5,3,3,4>
+ 2717290420U, // <5,6,5,4>: Cost 3 vsldoi8 <5,4,5,6>, <5,4,5,6>
+ 2705346574U, // <5,6,5,5>: Cost 3 vsldoi8 <3,4,5,6>, <5,5,6,6>
+ 2705346596U, // <5,6,5,6>: Cost 3 vsldoi8 <3,4,5,6>, <5,6,0,1>
+ 1237568822U, // <5,6,5,7>: Cost 2 vmrglw <4,u,5,5>, RHS
+ 1237568823U, // <5,6,5,u>: Cost 2 vmrglw <4,u,5,5>, RHS
+ 2650914918U, // <5,6,6,0>: Cost 3 vsldoi4 <5,5,6,6>, LHS
+ 3364490949U, // <5,6,6,1>: Cost 4 vmrglw <1,4,5,6>, <5,1,6,1>
+ 2248954362U, // <5,6,6,2>: Cost 3 vmrghw <5,6,7,0>, <6,2,7,3>
+ 2302693144U, // <5,6,6,3>: Cost 3 vmrglw <3,4,5,6>, <5,2,6,3>
+ 2650918198U, // <5,6,6,4>: Cost 3 vsldoi4 <5,5,6,6>, RHS
+ 2650918926U, // <5,6,6,5>: Cost 3 vsldoi4 <5,5,6,6>, <5,5,6,6>
+ 2302693390U, // <5,6,6,6>: Cost 3 vmrglw <3,4,5,6>, <5,5,6,6>
+ 1228950838U, // <5,6,6,7>: Cost 2 vmrglw <3,4,5,6>, RHS
+ 1228950839U, // <5,6,6,u>: Cost 2 vmrglw <3,4,5,6>, RHS
+ 497467494U, // <5,6,7,0>: Cost 1 vsldoi4 RHS, LHS
+ 1571210036U, // <5,6,7,1>: Cost 2 vsldoi4 RHS, <1,1,1,1>
+ 1571210856U, // <5,6,7,2>: Cost 2 vsldoi4 RHS, <2,2,2,2>
+ 1571211414U, // <5,6,7,3>: Cost 2 vsldoi4 RHS, <3,0,1,2>
+ 497470774U, // <5,6,7,4>: Cost 1 vsldoi4 RHS, RHS
+ 1571213316U, // <5,6,7,5>: Cost 2 vsldoi4 RHS, <5,5,5,5>
+ 1571213818U, // <5,6,7,6>: Cost 2 vsldoi4 RHS, <6,2,7,3>
+ 1571214956U, // <5,6,7,7>: Cost 2 vsldoi4 RHS, <7,7,7,7>
+ 497473326U, // <5,6,7,u>: Cost 1 vsldoi4 RHS, LHS
+ 497475686U, // <5,6,u,0>: Cost 1 vsldoi4 RHS, LHS
+ 1631606574U, // <5,6,u,1>: Cost 2 vsldoi8 <3,4,5,6>, LHS
+ 1571219048U, // <5,6,u,2>: Cost 2 vsldoi4 RHS, <2,2,2,2>
+ 1571219606U, // <5,6,u,3>: Cost 2 vsldoi4 RHS, <3,0,1,2>
+ 497478967U, // <5,6,u,4>: Cost 1 vsldoi4 RHS, RHS
+ 1631606938U, // <5,6,u,5>: Cost 2 vsldoi8 <3,4,5,6>, RHS
+ 1571222010U, // <5,6,u,6>: Cost 2 vsldoi4 RHS, <6,2,7,3>
+ 1228967222U, // <5,6,u,7>: Cost 2 vmrglw <3,4,5,u>, RHS
+ 497481518U, // <5,6,u,u>: Cost 1 vsldoi4 RHS, LHS
+ 3768475648U, // <5,7,0,0>: Cost 4 vsldoi8 <1,6,5,7>, <0,0,0,0>
+ 2694733926U, // <5,7,0,1>: Cost 3 vsldoi8 <1,6,5,7>, LHS
+ 3718711395U, // <5,7,0,2>: Cost 4 vsldoi4 <4,5,7,0>, <2,u,4,5>
+ 3384349178U, // <5,7,0,3>: Cost 4 vmrglw <4,7,5,0>, <6,2,7,3>
+ 2694734162U, // <5,7,0,4>: Cost 3 vsldoi8 <1,6,5,7>, <0,4,1,5>
+ 3384347884U, // <5,7,0,5>: Cost 4 vmrglw <4,7,5,0>, <4,4,7,5>
+ 3730658026U, // <5,7,0,6>: Cost 4 vsldoi4 <6,5,7,0>, <6,5,7,0>
+ 3718714362U, // <5,7,0,7>: Cost 4 vsldoi4 <4,5,7,0>, <7,0,1,2>
+ 2694734493U, // <5,7,0,u>: Cost 3 vsldoi8 <1,6,5,7>, LHS
+ 2311278690U, // <5,7,1,0>: Cost 3 vmrglw <4,u,5,1>, <5,6,7,0>
+ 2305970923U, // <5,7,1,1>: Cost 3 vmrglw <4,0,5,1>, <6,5,7,1>
+ 3768476566U, // <5,7,1,2>: Cost 4 vsldoi8 <1,6,5,7>, <1,2,3,0>
+ 2311279098U, // <5,7,1,3>: Cost 3 vmrglw <4,u,5,1>, <6,2,7,3>
+ 2311278694U, // <5,7,1,4>: Cost 3 vmrglw <4,u,5,1>, <5,6,7,4>
+ 3768476783U, // <5,7,1,5>: Cost 4 vsldoi8 <1,6,5,7>, <1,5,0,1>
+ 2694735091U, // <5,7,1,6>: Cost 3 vsldoi8 <1,6,5,7>, <1,6,5,7>
+ 2311279426U, // <5,7,1,7>: Cost 3 vmrglw <4,u,5,1>, <6,6,7,7>
+ 2696062357U, // <5,7,1,u>: Cost 3 vsldoi8 <1,u,5,7>, <1,u,5,7>
+ 3383701602U, // <5,7,2,0>: Cost 4 vmrglw <4,6,5,2>, <5,6,7,0>
+ 3768477219U, // <5,7,2,1>: Cost 4 vsldoi8 <1,6,5,7>, <2,1,3,5>
+ 3768477288U, // <5,7,2,2>: Cost 4 vsldoi8 <1,6,5,7>, <2,2,2,2>
+ 2309960186U, // <5,7,2,3>: Cost 3 vmrglw <4,6,5,2>, <6,2,7,3>
+ 3383701606U, // <5,7,2,4>: Cost 4 vmrglw <4,6,5,2>, <5,6,7,4>
+ 3768477545U, // <5,7,2,5>: Cost 4 vsldoi8 <1,6,5,7>, <2,5,3,7>
+ 3766486970U, // <5,7,2,6>: Cost 4 vsldoi8 <1,3,5,7>, <2,6,3,7>
+ 3383702338U, // <5,7,2,7>: Cost 4 vmrglw <4,6,5,2>, <6,6,7,7>
+ 2309960186U, // <5,7,2,u>: Cost 3 vmrglw <4,6,5,2>, <6,2,7,3>
+ 3768477846U, // <5,7,3,0>: Cost 4 vsldoi8 <1,6,5,7>, <3,0,1,2>
+ 3768477975U, // <5,7,3,1>: Cost 4 vsldoi8 <1,6,5,7>, <3,1,6,5>
+ 3786393932U, // <5,7,3,2>: Cost 4 vsldoi8 <4,6,5,7>, <3,2,3,4>
+ 3768478108U, // <5,7,3,3>: Cost 4 vsldoi8 <1,6,5,7>, <3,3,3,3>
+ 2795599115U, // <5,7,3,4>: Cost 3 vsldoi12 <7,3,4,5>, <7,3,4,5>
+ 3385037470U, // <5,7,3,5>: Cost 4 vmrglw <4,u,5,3>, <6,4,7,5>
+ 3780422309U, // <5,7,3,6>: Cost 4 vsldoi8 <3,6,5,7>, <3,6,5,7>
+ 3848107301U, // <5,7,3,7>: Cost 4 vsldoi12 <3,7,4,5>, <7,3,7,4>
+ 2795894063U, // <5,7,3,u>: Cost 3 vsldoi12 <7,3,u,5>, <7,3,u,5>
+ 2795967800U, // <5,7,4,0>: Cost 3 vsldoi12 <7,4,0,5>, <7,4,0,5>
+ 3768478690U, // <5,7,4,1>: Cost 4 vsldoi8 <1,6,5,7>, <4,1,5,0>
+ 3718744163U, // <5,7,4,2>: Cost 4 vsldoi4 <4,5,7,4>, <2,u,4,5>
+ 3784404107U, // <5,7,4,3>: Cost 4 vsldoi8 <4,3,5,7>, <4,3,5,7>
+ 2796262748U, // <5,7,4,4>: Cost 3 vsldoi12 <7,4,4,5>, <7,4,4,5>
+ 2694737206U, // <5,7,4,5>: Cost 3 vsldoi8 <1,6,5,7>, RHS
+ 2712653182U, // <5,7,4,6>: Cost 3 vsldoi8 <4,6,5,7>, <4,6,5,7>
+ 2713316815U, // <5,7,4,7>: Cost 3 vsldoi8 <4,7,5,7>, <4,7,5,7>
+ 2694737449U, // <5,7,4,u>: Cost 3 vsldoi8 <1,6,5,7>, RHS
+ 2311311458U, // <5,7,5,0>: Cost 3 vmrglw <4,u,5,5>, <5,6,7,0>
+ 3768479433U, // <5,7,5,1>: Cost 4 vsldoi8 <1,6,5,7>, <5,1,6,5>
+ 3768479521U, // <5,7,5,2>: Cost 4 vsldoi8 <1,6,5,7>, <5,2,7,3>
+ 2311311866U, // <5,7,5,3>: Cost 3 vmrglw <4,u,5,5>, <6,2,7,3>
+ 2311311462U, // <5,7,5,4>: Cost 3 vmrglw <4,u,5,5>, <5,6,7,4>
+ 2248185270U, // <5,7,5,5>: Cost 3 vmrghw <5,5,5,5>, <7,5,5,5>
+ 2718625879U, // <5,7,5,6>: Cost 3 vsldoi8 <5,6,5,7>, <5,6,5,7>
+ 2311312194U, // <5,7,5,7>: Cost 3 vmrglw <4,u,5,5>, <6,6,7,7>
+ 2311311466U, // <5,7,5,u>: Cost 3 vmrglw <4,u,5,5>, <5,6,7,u>
+ 2248954874U, // <5,7,6,0>: Cost 3 vmrghw <5,6,7,0>, <7,0,1,2>
+ 3322696778U, // <5,7,6,1>: Cost 4 vmrghw <5,6,7,0>, <7,1,1,1>
+ 2248955028U, // <5,7,6,2>: Cost 3 vmrghw <5,6,7,0>, <7,2,0,3>
+ 2656963074U, // <5,7,6,3>: Cost 3 vsldoi4 <6,5,7,6>, <3,4,5,6>
+ 2248955238U, // <5,7,6,4>: Cost 3 vmrghw <5,6,7,0>, <7,4,5,6>
+ 2248955329U, // <5,7,6,5>: Cost 3 vmrghw <5,6,7,0>, <7,5,6,7>
+ 2656965360U, // <5,7,6,6>: Cost 3 vsldoi4 <6,5,7,6>, <6,5,7,6>
+ 2248955500U, // <5,7,6,7>: Cost 3 vmrghw <5,6,7,0>, <7,7,7,7>
+ 2248955522U, // <5,7,6,u>: Cost 3 vmrghw <5,6,7,0>, <7,u,1,2>
+ 3718766694U, // <5,7,7,0>: Cost 4 vsldoi4 <4,5,7,7>, LHS
+ 3724739827U, // <5,7,7,1>: Cost 4 vsldoi4 <5,5,7,7>, <1,6,5,7>
+ 3718768739U, // <5,7,7,2>: Cost 4 vsldoi4 <4,5,7,7>, <2,u,4,5>
+ 3365826337U, // <5,7,7,3>: Cost 4 vmrglw <1,6,5,7>, <5,2,7,3>
+ 2798253647U, // <5,7,7,4>: Cost 3 vsldoi12 <7,7,4,5>, <7,7,4,5>
+ 3365826258U, // <5,7,7,5>: Cost 4 vmrglw <1,6,5,7>, <5,1,7,5>
+ 3730715377U, // <5,7,7,6>: Cost 4 vsldoi4 <6,5,7,7>, <6,5,7,7>
+ 2310665836U, // <5,7,7,7>: Cost 3 vmrglw <4,7,5,7>, <7,7,7,7>
+ 2798548595U, // <5,7,7,u>: Cost 3 vsldoi12 <7,7,u,5>, <7,7,u,5>
+ 2311336034U, // <5,7,u,0>: Cost 3 vmrglw <4,u,5,u>, <5,6,7,0>
+ 2694739758U, // <5,7,u,1>: Cost 3 vsldoi8 <1,6,5,7>, LHS
+ 2248955028U, // <5,7,u,2>: Cost 3 vmrghw <5,6,7,0>, <7,2,0,3>
+ 2311336442U, // <5,7,u,3>: Cost 3 vmrglw <4,u,5,u>, <6,2,7,3>
+ 2311336038U, // <5,7,u,4>: Cost 3 vmrglw <4,u,5,u>, <5,6,7,4>
+ 2694740122U, // <5,7,u,5>: Cost 3 vsldoi8 <1,6,5,7>, RHS
+ 2656981746U, // <5,7,u,6>: Cost 3 vsldoi4 <6,5,7,u>, <6,5,7,u>
+ 2311336770U, // <5,7,u,7>: Cost 3 vmrglw <4,u,5,u>, <6,6,7,7>
+ 2694740325U, // <5,7,u,u>: Cost 3 vsldoi8 <1,6,5,7>, LHS
+ 2705358848U, // <5,u,0,0>: Cost 3 vsldoi8 <3,4,5,u>, <0,0,0,0>
+ 1631617126U, // <5,u,0,1>: Cost 2 vsldoi8 <3,4,5,u>, LHS
+ 2310607866U, // <5,u,0,2>: Cost 3 vmrglw <4,7,5,0>, <7,0,1,2>
+ 2302640284U, // <5,u,0,3>: Cost 3 vmrglw <3,4,5,0>, LHS
+ 2754238189U, // <5,u,0,4>: Cost 3 vsldoi12 <0,4,1,5>, <u,0,4,1>
+ 2305296114U, // <5,u,0,5>: Cost 3 vmrglw <3,u,5,0>, <2,3,u,5>
+ 2244907106U, // <5,u,0,6>: Cost 3 vmrghw <5,0,6,1>, <5,6,7,0>
+ 2302643528U, // <5,u,0,7>: Cost 3 vmrglw <3,4,5,0>, RHS
+ 1631617693U, // <5,u,0,u>: Cost 2 vsldoi8 <3,4,5,u>, LHS
+ 2627133542U, // <5,u,1,0>: Cost 3 vsldoi4 <1,5,u,1>, LHS
+ 1237536282U, // <5,u,1,1>: Cost 2 vmrglw <4,u,5,1>, <4,u,5,1>
+ 1680496430U, // <5,u,1,2>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 1237532828U, // <5,u,1,3>: Cost 2 vmrglw <4,u,5,1>, LHS
+ 2693416018U, // <5,u,1,4>: Cost 3 vsldoi8 <1,4,5,u>, <1,4,5,u>
+ 2756892486U, // <5,u,1,5>: Cost 3 vsldoi12 <0,u,1,5>, <u,1,5,0>
+ 2694743284U, // <5,u,1,6>: Cost 3 vsldoi8 <1,6,5,u>, <1,6,5,u>
+ 1237536072U, // <5,u,1,7>: Cost 2 vmrglw <4,u,5,1>, RHS
+ 1680496484U, // <5,u,1,u>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 2311288709U, // <5,u,2,0>: Cost 3 vmrglw <4,u,5,2>, <u,2,3,0>
+ 2245883694U, // <5,u,2,1>: Cost 3 vmrghw <5,2,1,3>, LHS
+ 2699388520U, // <5,u,2,2>: Cost 3 vsldoi8 <2,4,5,u>, <2,2,2,2>
+ 2754238344U, // <5,u,2,3>: Cost 3 vsldoi12 <0,4,1,5>, <u,2,3,3>
+ 2699388715U, // <5,u,2,4>: Cost 3 vsldoi8 <2,4,5,u>, <2,4,5,u>
+ 2757408666U, // <5,u,2,5>: Cost 3 vsldoi12 <0,u,u,5>, <u,2,5,3>
+ 2705360826U, // <5,u,2,6>: Cost 3 vsldoi8 <3,4,5,u>, <2,6,3,7>
+ 2302659912U, // <5,u,2,7>: Cost 3 vmrglw <3,4,5,2>, RHS
+ 2754238389U, // <5,u,2,u>: Cost 3 vsldoi12 <0,4,1,5>, <u,2,u,3>
+ 2754238396U, // <5,u,3,0>: Cost 3 vsldoi12 <0,4,1,5>, <u,3,0,1>
+ 3827980229U, // <5,u,3,1>: Cost 4 vsldoi12 <0,4,1,5>, <u,3,1,1>
+ 2644625102U, // <5,u,3,2>: Cost 3 vsldoi4 <4,5,2,3>, <2,3,4,5>
+ 2289393820U, // <5,u,3,3>: Cost 3 vmrglw <1,2,5,3>, LHS
+ 1631619588U, // <5,u,3,4>: Cost 2 vsldoi8 <3,4,5,u>, <3,4,5,u>
+ 2785056749U, // <5,u,3,5>: Cost 3 vsldoi12 <5,5,5,5>, <u,3,5,5>
+ 3363138077U, // <5,u,3,6>: Cost 4 vmrglw <1,2,5,3>, <3,4,u,6>
+ 2289397064U, // <5,u,3,7>: Cost 3 vmrglw <1,2,5,3>, RHS
+ 1634274120U, // <5,u,3,u>: Cost 2 vsldoi8 <3,u,5,u>, <3,u,5,u>
+ 1634937753U, // <5,u,4,0>: Cost 2 vsldoi8 <4,0,5,u>, <4,0,5,u>
+ 1728272410U, // <5,u,4,1>: Cost 2 vsldoi12 <u,4,1,5>, <u,4,1,5>
+ 2710006843U, // <5,u,4,2>: Cost 3 vsldoi8 <4,2,5,u>, <4,2,5,u>
+ 2765740076U, // <5,u,4,3>: Cost 3 vsldoi12 <2,3,4,5>, <u,4,3,5>
+ 1637592285U, // <5,u,4,4>: Cost 2 vsldoi8 <4,4,5,u>, <4,4,5,u>
+ 1631620406U, // <5,u,4,5>: Cost 2 vsldoi8 <3,4,5,u>, RHS
+ 2712661375U, // <5,u,4,6>: Cost 3 vsldoi8 <4,6,5,u>, <4,6,5,u>
+ 2302676296U, // <5,u,4,7>: Cost 3 vmrglw <3,4,5,4>, RHS
+ 1631620649U, // <5,u,4,u>: Cost 2 vsldoi8 <3,4,5,u>, RHS
+ 1577091174U, // <5,u,5,0>: Cost 2 vsldoi4 <5,5,5,5>, LHS
+ 1174443822U, // <5,u,5,1>: Cost 2 vmrghw <5,5,5,5>, LHS
+ 2766035058U, // <5,u,5,2>: Cost 3 vsldoi12 <2,3,u,5>, <u,5,2,3>
+ 1237565596U, // <5,u,5,3>: Cost 2 vmrglw <4,u,5,5>, LHS
+ 1577094454U, // <5,u,5,4>: Cost 2 vsldoi4 <5,5,5,5>, RHS
+ 296144182U, // <5,u,5,5>: Cost 1 vspltisw1 RHS
+ 1680496794U, // <5,u,5,6>: Cost 2 vsldoi12 <0,4,1,5>, RHS
+ 1237568840U, // <5,u,5,7>: Cost 2 vmrglw <4,u,5,5>, RHS
+ 296144182U, // <5,u,5,u>: Cost 1 vspltisw1 RHS
+ 2633146470U, // <5,u,6,0>: Cost 3 vsldoi4 <2,5,u,6>, LHS
+ 1175213870U, // <5,u,6,1>: Cost 2 vmrghw <5,6,7,0>, LHS
+ 2633148309U, // <5,u,6,2>: Cost 3 vsldoi4 <2,5,u,6>, <2,5,u,6>
+ 1228947612U, // <5,u,6,3>: Cost 2 vmrglw <3,4,5,6>, LHS
+ 2633149750U, // <5,u,6,4>: Cost 3 vsldoi4 <2,5,u,6>, RHS
+ 1175214234U, // <5,u,6,5>: Cost 2 vmrghw <5,6,7,0>, RHS
+ 1228950018U, // <5,u,6,6>: Cost 2 vmrglw <3,4,5,6>, <3,4,5,6>
+ 1228950856U, // <5,u,6,7>: Cost 2 vmrglw <3,4,5,6>, RHS
+ 1228947617U, // <5,u,6,u>: Cost 2 vmrglw <3,4,5,6>, LHS
+ 497614950U, // <5,u,7,0>: Cost 1 vsldoi4 RHS, LHS
+ 1571357492U, // <5,u,7,1>: Cost 2 vsldoi4 RHS, <1,1,1,1>
+ 1571358312U, // <5,u,7,2>: Cost 2 vsldoi4 RHS, <2,2,2,2>
+ 1571358870U, // <5,u,7,3>: Cost 2 vsldoi4 RHS, <3,0,1,2>
+ 497618248U, // <5,u,7,4>: Cost 1 vsldoi4 RHS, RHS
+ 1571360772U, // <5,u,7,5>: Cost 2 vsldoi4 RHS, <5,5,5,5>
+ 1571361274U, // <5,u,7,6>: Cost 2 vsldoi4 RHS, <6,2,7,3>
+ 1571361786U, // <5,u,7,7>: Cost 2 vsldoi4 RHS, <7,0,1,2>
+ 497620782U, // <5,u,7,u>: Cost 1 vsldoi4 RHS, LHS
+ 497623142U, // <5,u,u,0>: Cost 1 vsldoi4 RHS, LHS
+ 1631622958U, // <5,u,u,1>: Cost 2 vsldoi8 <3,4,5,u>, LHS
+ 1680496997U, // <5,u,u,2>: Cost 2 vsldoi12 <0,4,1,5>, LHS
+ 1228963996U, // <5,u,u,3>: Cost 2 vmrglw <3,4,5,u>, LHS
+ 497626441U, // <5,u,u,4>: Cost 1 vsldoi4 RHS, RHS
+ 296144182U, // <5,u,u,5>: Cost 1 vspltisw1 RHS
+ 1680497037U, // <5,u,u,6>: Cost 2 vsldoi12 <0,4,1,5>, RHS
+ 1228967240U, // <5,u,u,7>: Cost 2 vmrglw <3,4,5,u>, RHS
+ 497628974U, // <5,u,u,u>: Cost 1 vsldoi4 RHS, LHS
+ 2772451328U, // <6,0,0,0>: Cost 3 vsldoi12 <3,4,5,6>, <0,0,0,0>
+ 2772451338U, // <6,0,0,1>: Cost 3 vsldoi12 <3,4,5,6>, <0,0,1,1>
+ 3771146417U, // <6,0,0,2>: Cost 4 vsldoi8 <2,1,6,0>, <0,2,1,6>
+ 3383095739U, // <6,0,0,3>: Cost 4 vmrglw <4,5,6,0>, <6,2,0,3>
+ 3846193189U, // <6,0,0,4>: Cost 4 vsldoi12 <3,4,5,6>, <0,0,4,1>
+ 3724832803U, // <6,0,0,5>: Cost 4 vsldoi4 <5,6,0,0>, <5,6,0,0>
+ 3383095985U, // <6,0,0,6>: Cost 4 vmrglw <4,5,6,0>, <6,5,0,6>
+ 3383096067U, // <6,0,0,7>: Cost 4 vmrglw <4,5,6,0>, <6,6,0,7>
+ 2772451401U, // <6,0,0,u>: Cost 3 vsldoi12 <3,4,5,6>, <0,0,u,1>
+ 2651095142U, // <6,0,1,0>: Cost 3 vsldoi4 <5,6,0,1>, LHS
+ 2251612262U, // <6,0,1,1>: Cost 3 vmrghw <6,1,7,1>, LHS
+ 1698709606U, // <6,0,1,2>: Cost 2 vsldoi12 <3,4,5,6>, LHS
+ 2651097602U, // <6,0,1,3>: Cost 3 vsldoi4 <5,6,0,1>, <3,4,5,6>
+ 2651098422U, // <6,0,1,4>: Cost 3 vsldoi4 <5,6,0,1>, RHS
+ 2651099172U, // <6,0,1,5>: Cost 3 vsldoi4 <5,6,0,1>, <5,6,0,1>
+ 2657071869U, // <6,0,1,6>: Cost 3 vsldoi4 <6,6,0,1>, <6,6,0,1>
+ 3724841978U, // <6,0,1,7>: Cost 4 vsldoi4 <5,6,0,1>, <7,0,1,2>
+ 1698709660U, // <6,0,1,u>: Cost 2 vsldoi12 <3,4,5,6>, LHS
+ 2252292096U, // <6,0,2,0>: Cost 3 vmrghw <6,2,7,3>, <0,0,0,0>
+ 1178550374U, // <6,0,2,1>: Cost 2 vmrghw <6,2,7,3>, LHS
+ 3826655418U, // <6,0,2,2>: Cost 4 vsldoi12 <0,2,1,6>, <0,2,2,6>
+ 3777783485U, // <6,0,2,3>: Cost 4 vsldoi8 <3,2,6,0>, <2,3,2,6>
+ 2252292434U, // <6,0,2,4>: Cost 3 vmrghw <6,2,7,3>, <0,4,1,5>
+ 3785746280U, // <6,0,2,5>: Cost 4 vsldoi8 <4,5,6,0>, <2,5,3,6>
+ 2252292593U, // <6,0,2,6>: Cost 3 vmrghw <6,2,7,3>, <0,6,1,2>
+ 3736794583U, // <6,0,2,7>: Cost 4 vsldoi4 <7,6,0,2>, <7,6,0,2>
+ 1178550941U, // <6,0,2,u>: Cost 2 vmrghw <6,2,7,3>, LHS
+ 3375153152U, // <6,0,3,0>: Cost 4 vmrglw <3,2,6,3>, <0,0,0,0>
+ 2772451584U, // <6,0,3,1>: Cost 3 vsldoi12 <3,4,5,6>, <0,3,1,4>
+ 3777784163U, // <6,0,3,2>: Cost 4 vsldoi8 <3,2,6,0>, <3,2,6,0>
+ 3846193426U, // <6,0,3,3>: Cost 4 vsldoi12 <3,4,5,6>, <0,3,3,4>
+ 2712005122U, // <6,0,3,4>: Cost 3 vsldoi8 <4,5,6,0>, <3,4,5,6>
+ 3724857382U, // <6,0,3,5>: Cost 4 vsldoi4 <5,6,0,3>, <5,6,0,3>
+ 3802335864U, // <6,0,3,6>: Cost 4 vsldoi8 <7,3,6,0>, <3,6,0,7>
+ 3801672410U, // <6,0,3,7>: Cost 4 vsldoi8 <7,2,6,0>, <3,7,2,6>
+ 2772451647U, // <6,0,3,u>: Cost 3 vsldoi12 <3,4,5,6>, <0,3,u,4>
+ 3383123968U, // <6,0,4,0>: Cost 4 vmrglw <4,5,6,4>, <0,0,0,0>
+ 2772451666U, // <6,0,4,1>: Cost 3 vsldoi12 <3,4,5,6>, <0,4,1,5>
+ 3773803577U, // <6,0,4,2>: Cost 4 vsldoi8 <2,5,6,0>, <4,2,5,6>
+ 3724864002U, // <6,0,4,3>: Cost 4 vsldoi4 <5,6,0,4>, <3,4,5,6>
+ 3846193517U, // <6,0,4,4>: Cost 4 vsldoi12 <3,4,5,6>, <0,4,4,5>
+ 2712005935U, // <6,0,4,5>: Cost 3 vsldoi8 <4,5,6,0>, <4,5,6,0>
+ 3327009265U, // <6,0,4,6>: Cost 4 vmrghw <6,4,2,5>, <0,6,1,2>
+ 3383126648U, // <6,0,4,7>: Cost 5 vmrglw <4,5,6,4>, <3,6,0,7>
+ 2772451729U, // <6,0,4,u>: Cost 3 vsldoi12 <3,4,5,6>, <0,4,u,5>
+ 3373178880U, // <6,0,5,0>: Cost 4 vmrglw <2,u,6,5>, <0,0,0,0>
+ 2254266470U, // <6,0,5,1>: Cost 3 vmrghw <6,5,7,1>, LHS
+ 3785748248U, // <6,0,5,2>: Cost 4 vsldoi8 <4,5,6,0>, <5,2,6,3>
+ 3790393190U, // <6,0,5,3>: Cost 4 vsldoi8 <5,3,6,0>, <5,3,6,0>
+ 3328000338U, // <6,0,5,4>: Cost 4 vmrghw <6,5,7,0>, <0,4,1,5>
+ 3785748494U, // <6,0,5,5>: Cost 4 vsldoi8 <4,5,6,0>, <5,5,6,6>
+ 3785748516U, // <6,0,5,6>: Cost 4 vsldoi8 <4,5,6,0>, <5,6,0,1>
+ 3379153528U, // <6,0,5,7>: Cost 4 vmrglw <3,u,6,5>, <3,6,0,7>
+ 2254267037U, // <6,0,5,u>: Cost 3 vmrghw <6,5,7,1>, LHS
+ 2254897152U, // <6,0,6,0>: Cost 3 vmrghw <6,6,6,6>, <0,0,0,0>
+ 1181155430U, // <6,0,6,1>: Cost 2 vmrghw <6,6,6,6>, LHS
+ 3785748923U, // <6,0,6,2>: Cost 4 vsldoi8 <4,5,6,0>, <6,2,0,3>
+ 3785749042U, // <6,0,6,3>: Cost 4 vsldoi8 <4,5,6,0>, <6,3,4,5>
+ 2254897490U, // <6,0,6,4>: Cost 3 vmrghw <6,6,6,6>, <0,4,1,5>
+ 3785749169U, // <6,0,6,5>: Cost 4 vsldoi8 <4,5,6,0>, <6,5,0,6>
+ 2724614962U, // <6,0,6,6>: Cost 3 vsldoi8 <6,6,6,0>, <6,6,6,0>
+ 3787739982U, // <6,0,6,7>: Cost 4 vsldoi8 <4,u,6,0>, <6,7,0,1>
+ 1181155997U, // <6,0,6,u>: Cost 2 vmrghw <6,6,6,6>, LHS
+ 1235664896U, // <6,0,7,0>: Cost 2 vmrglw RHS, <0,0,0,0>
+ 1235666598U, // <6,0,7,1>: Cost 2 vmrglw RHS, <2,3,0,1>
+ 3712943720U, // <6,0,7,2>: Cost 4 vsldoi4 <3,6,0,7>, <2,2,2,2>
+ 2639202936U, // <6,0,7,3>: Cost 3 vsldoi4 <3,6,0,7>, <3,6,0,7>
+ 2639203638U, // <6,0,7,4>: Cost 3 vsldoi4 <3,6,0,7>, RHS
+ 2309409236U, // <6,0,7,5>: Cost 3 vmrglw RHS, <3,4,0,5>
+ 3712946517U, // <6,0,7,6>: Cost 4 vsldoi4 <3,6,0,7>, <6,0,7,0>
+ 2309409400U, // <6,0,7,7>: Cost 3 vmrglw RHS, <3,6,0,7>
+ 1235666605U, // <6,0,7,u>: Cost 2 vmrglw RHS, <2,3,0,u>
+ 1235673088U, // <6,0,u,0>: Cost 2 vmrglw RHS, <0,0,0,0>
+ 1235674790U, // <6,0,u,1>: Cost 2 vmrglw RHS, <2,3,0,1>
+ 1698710173U, // <6,0,u,2>: Cost 2 vsldoi12 <3,4,5,6>, LHS
+ 2639211129U, // <6,0,u,3>: Cost 3 vsldoi4 <3,6,0,u>, <3,6,0,u>
+ 2639211830U, // <6,0,u,4>: Cost 3 vsldoi4 <3,6,0,u>, RHS
+ 2712008858U, // <6,0,u,5>: Cost 3 vsldoi8 <4,5,6,0>, RHS
+ 2657129220U, // <6,0,u,6>: Cost 3 vsldoi4 <6,6,0,u>, <6,6,0,u>
+ 2309417592U, // <6,0,u,7>: Cost 3 vmrglw RHS, <3,6,0,7>
+ 1698710227U, // <6,0,u,u>: Cost 2 vsldoi12 <3,4,5,6>, LHS
+ 3775799296U, // <6,1,0,0>: Cost 4 vsldoi8 <2,u,6,1>, <0,0,0,0>
+ 2702057574U, // <6,1,0,1>: Cost 3 vsldoi8 <2,u,6,1>, LHS
+ 3373143763U, // <6,1,0,2>: Cost 4 vmrglw <2,u,6,0>, <u,0,1,2>
+ 3695045122U, // <6,1,0,3>: Cost 4 vsldoi4 <0,6,1,0>, <3,4,5,6>
+ 3775799634U, // <6,1,0,4>: Cost 4 vsldoi8 <2,u,6,1>, <0,4,1,5>
+ 3383091538U, // <6,1,0,5>: Cost 4 vmrglw <4,5,6,0>, <0,4,1,5>
+ 3368493233U, // <6,1,0,6>: Cost 4 vmrglw <2,1,6,0>, <0,2,1,6>
+ 3362522319U, // <6,1,0,7>: Cost 5 vmrglw <1,1,6,0>, <1,6,1,7>
+ 2702058141U, // <6,1,0,u>: Cost 3 vsldoi8 <2,u,6,1>, LHS
+ 3834250027U, // <6,1,1,0>: Cost 4 vsldoi12 <1,4,5,6>, <1,1,0,1>
+ 2772452148U, // <6,1,1,1>: Cost 3 vsldoi12 <3,4,5,6>, <1,1,1,1>
+ 3832038210U, // <6,1,1,2>: Cost 4 vsldoi12 <1,1,2,6>, <1,1,2,6>
+ 3373150660U, // <6,1,1,3>: Cost 4 vmrglw <2,u,6,1>, <6,2,1,3>
+ 3834250067U, // <6,1,1,4>: Cost 4 vsldoi12 <1,4,5,6>, <1,1,4,5>
+ 3373146450U, // <6,1,1,5>: Cost 4 vmrglw <2,u,6,1>, <0,4,1,5>
+ 3826656102U, // <6,1,1,6>: Cost 4 vsldoi12 <0,2,1,6>, <1,1,6,6>
+ 3362530511U, // <6,1,1,7>: Cost 4 vmrglw <1,1,6,1>, <1,6,1,7>
+ 2772452148U, // <6,1,1,u>: Cost 3 vsldoi12 <3,4,5,6>, <1,1,1,1>
+ 2669092966U, // <6,1,2,0>: Cost 3 vsldoi4 <u,6,1,2>, LHS
+ 2252292916U, // <6,1,2,1>: Cost 3 vmrghw <6,2,7,3>, <1,1,1,1>
+ 2252293014U, // <6,1,2,2>: Cost 3 vmrghw <6,2,7,3>, <1,2,3,0>
+ 2772452246U, // <6,1,2,3>: Cost 3 vsldoi12 <3,4,5,6>, <1,2,3,0>
+ 2669096246U, // <6,1,2,4>: Cost 3 vsldoi4 <u,6,1,2>, RHS
+ 3846194091U, // <6,1,2,5>: Cost 4 vsldoi12 <3,4,5,6>, <1,2,5,3>
+ 2702059450U, // <6,1,2,6>: Cost 3 vsldoi8 <2,u,6,1>, <2,6,3,7>
+ 3870081978U, // <6,1,2,7>: Cost 4 vsldoi12 <7,4,5,6>, <1,2,7,0>
+ 2702059633U, // <6,1,2,u>: Cost 3 vsldoi8 <2,u,6,1>, <2,u,6,1>
+ 3775801494U, // <6,1,3,0>: Cost 4 vsldoi8 <2,u,6,1>, <3,0,1,2>
+ 3777128723U, // <6,1,3,1>: Cost 4 vsldoi8 <3,1,6,1>, <3,1,6,1>
+ 3775801702U, // <6,1,3,2>: Cost 4 vsldoi8 <2,u,6,1>, <3,2,6,3>
+ 3775801756U, // <6,1,3,3>: Cost 4 vsldoi8 <2,u,6,1>, <3,3,3,3>
+ 3775801858U, // <6,1,3,4>: Cost 4 vsldoi8 <2,u,6,1>, <3,4,5,6>
+ 3375153490U, // <6,1,3,5>: Cost 4 vmrglw <3,2,6,3>, <0,4,1,5>
+ 3826656265U, // <6,1,3,6>: Cost 4 vsldoi12 <0,2,1,6>, <1,3,6,7>
+ 3775802051U, // <6,1,3,7>: Cost 4 vsldoi8 <2,u,6,1>, <3,7,0,1>
+ 3775802142U, // <6,1,3,u>: Cost 4 vsldoi8 <2,u,6,1>, <3,u,1,2>
+ 3846194206U, // <6,1,4,0>: Cost 4 vsldoi12 <3,4,5,6>, <1,4,0,1>
+ 3846194219U, // <6,1,4,1>: Cost 4 vsldoi12 <3,4,5,6>, <1,4,1,5>
+ 3846194228U, // <6,1,4,2>: Cost 4 vsldoi12 <3,4,5,6>, <1,4,2,5>
+ 3846194236U, // <6,1,4,3>: Cost 4 vsldoi12 <3,4,5,6>, <1,4,3,4>
+ 3846194246U, // <6,1,4,4>: Cost 4 vsldoi12 <3,4,5,6>, <1,4,4,5>
+ 2760508496U, // <6,1,4,5>: Cost 3 vsldoi12 <1,4,5,6>, <1,4,5,6>
+ 3368526001U, // <6,1,4,6>: Cost 4 vmrglw <2,1,6,4>, <0,2,1,6>
+ 3870082144U, // <6,1,4,7>: Cost 4 vsldoi12 <7,4,5,6>, <1,4,7,4>
+ 2760729707U, // <6,1,4,u>: Cost 3 vsldoi12 <1,4,u,6>, <1,4,u,6>
+ 2714668660U, // <6,1,5,0>: Cost 3 vsldoi8 <5,0,6,1>, <5,0,6,1>
+ 3834619005U, // <6,1,5,1>: Cost 4 vsldoi12 <1,5,1,6>, <1,5,1,6>
+ 3834692742U, // <6,1,5,2>: Cost 4 vsldoi12 <1,5,2,6>, <1,5,2,6>
+ 3846194317U, // <6,1,5,3>: Cost 4 vsldoi12 <3,4,5,6>, <1,5,3,4>
+ 3834840216U, // <6,1,5,4>: Cost 4 vsldoi12 <1,5,4,6>, <1,5,4,6>
+ 3834913953U, // <6,1,5,5>: Cost 4 vsldoi12 <1,5,5,6>, <1,5,5,6>
+ 2719977570U, // <6,1,5,6>: Cost 3 vsldoi8 <5,u,6,1>, <5,6,7,0>
+ 3367208143U, // <6,1,5,7>: Cost 4 vmrglw <1,u,6,5>, <1,6,1,7>
+ 2719977724U, // <6,1,5,u>: Cost 3 vsldoi8 <5,u,6,1>, <5,u,6,1>
+ 2669125734U, // <6,1,6,0>: Cost 3 vsldoi4 <u,6,1,6>, LHS
+ 2254897972U, // <6,1,6,1>: Cost 3 vmrghw <6,6,6,6>, <1,1,1,1>
+ 2254898070U, // <6,1,6,2>: Cost 3 vmrghw <6,6,6,6>, <1,2,3,0>
+ 3775803929U, // <6,1,6,3>: Cost 4 vsldoi8 <2,u,6,1>, <6,3,1,7>
+ 2669129014U, // <6,1,6,4>: Cost 3 vsldoi4 <u,6,1,6>, RHS
+ 2322006354U, // <6,1,6,5>: Cost 3 vmrglw <6,6,6,6>, <0,4,1,5>
+ 2725950264U, // <6,1,6,6>: Cost 3 vsldoi8 <6,u,6,1>, <6,6,6,6>
+ 3793720142U, // <6,1,6,7>: Cost 4 vsldoi8 <5,u,6,1>, <6,7,0,1>
+ 2254898556U, // <6,1,6,u>: Cost 3 vmrghw <6,6,6,6>, <1,u,3,0>
+ 2627330150U, // <6,1,7,0>: Cost 3 vsldoi4 <1,6,1,7>, LHS
+ 1235664906U, // <6,1,7,1>: Cost 2 vmrglw RHS, <0,0,1,1>
+ 1235667094U, // <6,1,7,2>: Cost 2 vmrglw RHS, <3,0,1,2>
+ 2309406894U, // <6,1,7,3>: Cost 3 vmrglw RHS, <0,2,1,3>
+ 2627333430U, // <6,1,7,4>: Cost 3 vsldoi4 <1,6,1,7>, RHS
+ 1235665234U, // <6,1,7,5>: Cost 2 vmrglw RHS, <0,4,1,5>
+ 2309406897U, // <6,1,7,6>: Cost 3 vmrglw RHS, <0,2,1,6>
+ 2309407222U, // <6,1,7,7>: Cost 3 vmrglw RHS, <0,6,1,7>
+ 1235664913U, // <6,1,7,u>: Cost 2 vmrglw RHS, <0,0,1,u>
+ 2627338342U, // <6,1,u,0>: Cost 3 vsldoi4 <1,6,1,u>, LHS
+ 1235673098U, // <6,1,u,1>: Cost 2 vmrglw RHS, <0,0,1,1>
+ 1235675286U, // <6,1,u,2>: Cost 2 vmrglw RHS, <3,0,1,2>
+ 2772452732U, // <6,1,u,3>: Cost 3 vsldoi12 <3,4,5,6>, <1,u,3,0>
+ 2627341622U, // <6,1,u,4>: Cost 3 vsldoi4 <1,6,1,u>, RHS
+ 1235673426U, // <6,1,u,5>: Cost 2 vmrglw RHS, <0,4,1,5>
+ 2309415089U, // <6,1,u,6>: Cost 3 vmrglw RHS, <0,2,1,6>
+ 2309415414U, // <6,1,u,7>: Cost 3 vmrglw RHS, <0,6,1,7>
+ 1235673105U, // <6,1,u,u>: Cost 2 vmrglw RHS, <0,0,1,u>
+ 3324683725U, // <6,2,0,0>: Cost 4 vmrghw <6,0,7,0>, <2,0,3,0>
+ 2725290086U, // <6,2,0,1>: Cost 3 vsldoi8 <6,7,6,2>, LHS
+ 3771162801U, // <6,2,0,2>: Cost 4 vsldoi8 <2,1,6,2>, <0,2,1,6>
+ 2309349478U, // <6,2,0,3>: Cost 3 vmrglw <4,5,6,0>, LHS
+ 3730951478U, // <6,2,0,4>: Cost 4 vsldoi4 <6,6,2,0>, RHS
+ 3840738784U, // <6,2,0,5>: Cost 4 vsldoi12 <2,5,3,6>, <2,0,5,1>
+ 3842655721U, // <6,2,0,6>: Cost 4 vsldoi12 <2,u,2,6>, <2,0,6,1>
+ 3736925671U, // <6,2,0,7>: Cost 4 vsldoi4 <7,6,2,0>, <7,6,2,0>
+ 2309349483U, // <6,2,0,u>: Cost 3 vmrglw <4,5,6,0>, LHS
+ 3367840468U, // <6,2,1,0>: Cost 4 vmrglw <2,0,6,1>, <3,7,2,0>
+ 3325355551U, // <6,2,1,1>: Cost 4 vmrghw <6,1,7,1>, <2,1,3,1>
+ 3373147752U, // <6,2,1,2>: Cost 4 vmrglw <2,u,6,1>, <2,2,2,2>
+ 2299404390U, // <6,2,1,3>: Cost 3 vmrglw <2,u,6,1>, LHS
+ 3701099830U, // <6,2,1,4>: Cost 5 vsldoi4 <1,6,2,1>, RHS
+ 3767846054U, // <6,2,1,5>: Cost 4 vsldoi8 <1,5,6,2>, <1,5,6,2>
+ 3826656825U, // <6,2,1,6>: Cost 4 vsldoi12 <0,2,1,6>, <2,1,6,0>
+ 3373147838U, // <6,2,1,7>: Cost 5 vmrglw <2,u,6,1>, <2,3,2,7>
+ 2299404395U, // <6,2,1,u>: Cost 3 vmrglw <2,u,6,1>, LHS
+ 2657222758U, // <6,2,2,0>: Cost 3 vsldoi4 <6,6,2,2>, LHS
+ 3771164219U, // <6,2,2,1>: Cost 4 vsldoi8 <2,1,6,2>, <2,1,6,2>
+ 2766481000U, // <6,2,2,2>: Cost 3 vsldoi12 <2,4,5,6>, <2,2,2,2>
+ 2772452978U, // <6,2,2,3>: Cost 3 vsldoi12 <3,4,5,6>, <2,2,3,3>
+ 2657226038U, // <6,2,2,4>: Cost 3 vsldoi4 <6,6,2,2>, RHS
+ 3790407528U, // <6,2,2,5>: Cost 4 vsldoi8 <5,3,6,2>, <2,5,3,6>
+ 2252294074U, // <6,2,2,6>: Cost 3 vmrghw <6,2,7,3>, <2,6,3,7>
+ 2252294148U, // <6,2,2,7>: Cost 3 vmrghw <6,2,7,3>, <2,7,3,0>
+ 2772453023U, // <6,2,2,u>: Cost 3 vsldoi12 <3,4,5,6>, <2,2,u,3>
+ 2772453030U, // <6,2,3,0>: Cost 3 vsldoi12 <3,4,5,6>, <2,3,0,1>
+ 3834250930U, // <6,2,3,1>: Cost 4 vsldoi12 <1,4,5,6>, <2,3,1,4>
+ 2765596349U, // <6,2,3,2>: Cost 3 vsldoi12 <2,3,2,6>, <2,3,2,6>
+ 2301411430U, // <6,2,3,3>: Cost 3 vmrglw <3,2,6,3>, LHS
+ 2772453070U, // <6,2,3,4>: Cost 3 vsldoi12 <3,4,5,6>, <2,3,4,5>
+ 2765817560U, // <6,2,3,5>: Cost 3 vsldoi12 <2,3,5,6>, <2,3,5,6>
+ 2252933050U, // <6,2,3,6>: Cost 3 vmrghw <6,3,7,0>, <2,6,3,7>
+ 2796340968U, // <6,2,3,7>: Cost 3 vsldoi12 <7,4,5,6>, <2,3,7,4>
+ 2766038771U, // <6,2,3,u>: Cost 3 vsldoi12 <2,3,u,6>, <2,3,u,6>
+ 3725008998U, // <6,2,4,0>: Cost 4 vsldoi4 <5,6,2,4>, LHS
+ 3368530217U, // <6,2,4,1>: Cost 5 vmrglw <2,1,6,4>, <6,0,2,1>
+ 3840222989U, // <6,2,4,2>: Cost 4 vsldoi12 <2,4,5,6>, <2,4,2,5>
+ 2309382246U, // <6,2,4,3>: Cost 3 vmrglw <4,5,6,4>, LHS
+ 3725012278U, // <6,2,4,4>: Cost 4 vsldoi4 <5,6,2,4>, RHS
+ 2766481193U, // <6,2,4,5>: Cost 3 vsldoi12 <2,4,5,6>, <2,4,5,6>
+ 3842656049U, // <6,2,4,6>: Cost 4 vsldoi12 <2,u,2,6>, <2,4,6,5>
+ 3327010820U, // <6,2,4,7>: Cost 4 vmrghw <6,4,2,5>, <2,7,3,0>
+ 2766702404U, // <6,2,4,u>: Cost 3 vsldoi12 <2,4,u,6>, <2,4,u,6>
+ 3713073254U, // <6,2,5,0>: Cost 4 vsldoi4 <3,6,2,5>, LHS
+ 3789082310U, // <6,2,5,1>: Cost 4 vsldoi8 <5,1,6,2>, <5,1,6,2>
+ 3840665439U, // <6,2,5,2>: Cost 4 vsldoi12 <2,5,2,6>, <2,5,2,6>
+ 2766997352U, // <6,2,5,3>: Cost 3 vsldoi12 <2,5,3,6>, <2,5,3,6>
+ 3713076534U, // <6,2,5,4>: Cost 4 vsldoi4 <3,6,2,5>, RHS
+ 3791736842U, // <6,2,5,5>: Cost 4 vsldoi8 <5,5,6,2>, <5,5,6,2>
+ 3373180605U, // <6,2,5,6>: Cost 4 vmrglw <2,u,6,5>, <2,3,2,6>
+ 3793064108U, // <6,2,5,7>: Cost 4 vsldoi8 <5,7,6,2>, <5,7,6,2>
+ 2767366037U, // <6,2,5,u>: Cost 3 vsldoi12 <2,5,u,6>, <2,5,u,6>
+ 3701137510U, // <6,2,6,0>: Cost 4 vsldoi4 <1,6,2,6>, LHS
+ 3701138647U, // <6,2,6,1>: Cost 4 vsldoi4 <1,6,2,6>, <1,6,2,6>
+ 2254898792U, // <6,2,6,2>: Cost 3 vmrghw <6,6,6,6>, <2,2,2,2>
+ 1248264294U, // <6,2,6,3>: Cost 2 vmrglw <6,6,6,6>, LHS
+ 3701140790U, // <6,2,6,4>: Cost 4 vsldoi4 <1,6,2,6>, RHS
+ 3725029435U, // <6,2,6,5>: Cost 4 vsldoi4 <5,6,2,6>, <5,6,2,6>
+ 2254899130U, // <6,2,6,6>: Cost 3 vmrghw <6,6,6,6>, <2,6,3,7>
+ 2725294981U, // <6,2,6,7>: Cost 3 vsldoi8 <6,7,6,2>, <6,7,6,2>
+ 1248264299U, // <6,2,6,u>: Cost 2 vmrglw <6,6,6,6>, LHS
+ 2633375846U, // <6,2,7,0>: Cost 3 vsldoi4 <2,6,2,7>, LHS
+ 2309407468U, // <6,2,7,1>: Cost 3 vmrglw RHS, <1,0,2,1>
+ 1235666536U, // <6,2,7,2>: Cost 2 vmrglw RHS, <2,2,2,2>
+ 161923174U, // <6,2,7,3>: Cost 1 vmrglw RHS, LHS
+ 2633379126U, // <6,2,7,4>: Cost 3 vsldoi4 <2,6,2,7>, RHS
+ 2309407796U, // <6,2,7,5>: Cost 3 vmrglw RHS, <1,4,2,5>
+ 2309408445U, // <6,2,7,6>: Cost 3 vmrglw RHS, <2,3,2,6>
+ 2309407960U, // <6,2,7,7>: Cost 3 vmrglw RHS, <1,6,2,7>
+ 161923179U, // <6,2,7,u>: Cost 1 vmrglw RHS, LHS
+ 2633384038U, // <6,2,u,0>: Cost 3 vsldoi4 <2,6,2,u>, LHS
+ 2309415660U, // <6,2,u,1>: Cost 3 vmrglw RHS, <1,0,2,1>
+ 1235674728U, // <6,2,u,2>: Cost 2 vmrglw RHS, <2,2,2,2>
+ 161931366U, // <6,2,u,3>: Cost 1 vmrglw RHS, LHS
+ 2633387318U, // <6,2,u,4>: Cost 3 vsldoi4 <2,6,2,u>, RHS
+ 2769135725U, // <6,2,u,5>: Cost 3 vsldoi12 <2,u,5,6>, <2,u,5,6>
+ 2309416637U, // <6,2,u,6>: Cost 3 vmrglw RHS, <2,3,2,6>
+ 2309416152U, // <6,2,u,7>: Cost 3 vmrglw RHS, <1,6,2,7>
+ 161931371U, // <6,2,u,u>: Cost 1 vmrglw RHS, LHS
+ 3777806336U, // <6,3,0,0>: Cost 4 vsldoi8 <3,2,6,3>, <0,0,0,0>
+ 2704064614U, // <6,3,0,1>: Cost 3 vsldoi8 <3,2,6,3>, LHS
+ 3765862577U, // <6,3,0,2>: Cost 4 vsldoi8 <1,2,6,3>, <0,2,1,6>
+ 3843393708U, // <6,3,0,3>: Cost 4 vsldoi12 <3,0,3,6>, <3,0,3,6>
+ 2250516994U, // <6,3,0,4>: Cost 3 vmrghw <6,0,1,2>, <3,4,5,6>
+ 3725054014U, // <6,3,0,5>: Cost 4 vsldoi4 <5,6,3,0>, <5,6,3,0>
+ 3383093096U, // <6,3,0,6>: Cost 4 vmrglw <4,5,6,0>, <2,5,3,6>
+ 3368495034U, // <6,3,0,7>: Cost 4 vmrglw <2,1,6,0>, <2,6,3,7>
+ 2704065181U, // <6,3,0,u>: Cost 3 vsldoi8 <3,2,6,3>, LHS
+ 2251622550U, // <6,3,1,0>: Cost 3 vmrghw <6,1,7,2>, <3,0,1,2>
+ 3777807156U, // <6,3,1,1>: Cost 4 vsldoi8 <3,2,6,3>, <1,1,1,1>
+ 3765863348U, // <6,3,1,2>: Cost 4 vsldoi8 <1,2,6,3>, <1,2,6,3>
+ 3373147762U, // <6,3,1,3>: Cost 4 vmrglw <2,u,6,1>, <2,2,3,3>
+ 3834251525U, // <6,3,1,4>: Cost 4 vsldoi12 <1,4,5,6>, <3,1,4,5>
+ 3373147683U, // <6,3,1,5>: Cost 5 vmrglw <2,u,6,1>, <2,1,3,5>
+ 3391727545U, // <6,3,1,6>: Cost 4 vmrglw <6,0,6,1>, <2,6,3,6>
+ 2299406266U, // <6,3,1,7>: Cost 3 vmrglw <2,u,6,1>, <2,6,3,7>
+ 2251622550U, // <6,3,1,u>: Cost 3 vmrghw <6,1,7,2>, <3,0,1,2>
+ 2252294294U, // <6,3,2,0>: Cost 3 vmrghw <6,2,7,3>, <3,0,1,2>
+ 3326036198U, // <6,3,2,1>: Cost 4 vmrghw <6,2,7,3>, <3,1,1,1>
+ 3771836045U, // <6,3,2,2>: Cost 4 vsldoi8 <2,2,6,3>, <2,2,6,3>
+ 2252294556U, // <6,3,2,3>: Cost 3 vmrghw <6,2,7,3>, <3,3,3,3>
+ 2252294658U, // <6,3,2,4>: Cost 3 vmrghw <6,2,7,3>, <3,4,5,6>
+ 3840739677U, // <6,3,2,5>: Cost 4 vsldoi12 <2,5,3,6>, <3,2,5,3>
+ 2704066490U, // <6,3,2,6>: Cost 3 vsldoi8 <3,2,6,3>, <2,6,3,7>
+ 3368511418U, // <6,3,2,7>: Cost 4 vmrglw <2,1,6,2>, <2,6,3,7>
+ 2252294942U, // <6,3,2,u>: Cost 3 vmrghw <6,2,7,3>, <3,u,1,2>
+ 3707158630U, // <6,3,3,0>: Cost 4 vsldoi4 <2,6,3,3>, LHS
+ 3765864692U, // <6,3,3,1>: Cost 5 vsldoi8 <1,2,6,3>, <3,1,2,6>
+ 2704066918U, // <6,3,3,2>: Cost 3 vsldoi8 <3,2,6,3>, <3,2,6,3>
+ 2772453788U, // <6,3,3,3>: Cost 3 vsldoi12 <3,4,5,6>, <3,3,3,3>
+ 2772453799U, // <6,3,3,4>: Cost 3 vsldoi12 <3,4,5,6>, <3,3,4,5>
+ 3789752888U, // <6,3,3,5>: Cost 4 vsldoi8 <5,2,6,3>, <3,5,2,6>
+ 3840739770U, // <6,3,3,6>: Cost 4 vsldoi12 <2,5,3,6>, <3,3,6,6>
+ 2301413306U, // <6,3,3,7>: Cost 3 vmrglw <3,2,6,3>, <2,6,3,7>
+ 2775108043U, // <6,3,3,u>: Cost 3 vsldoi12 <3,u,5,6>, <3,3,u,5>
+ 2651340902U, // <6,3,4,0>: Cost 3 vsldoi4 <5,6,3,4>, LHS
+ 3846195674U, // <6,3,4,1>: Cost 4 vsldoi12 <3,4,5,6>, <3,4,1,2>
+ 3845974503U, // <6,3,4,2>: Cost 4 vsldoi12 <3,4,2,6>, <3,4,2,6>
+ 2651343362U, // <6,3,4,3>: Cost 3 vsldoi4 <5,6,3,4>, <3,4,5,6>
+ 2651344182U, // <6,3,4,4>: Cost 3 vsldoi4 <5,6,3,4>, RHS
+ 1698712066U, // <6,3,4,5>: Cost 2 vsldoi12 <3,4,5,6>, <3,4,5,6>
+ 3383125864U, // <6,3,4,6>: Cost 4 vmrglw <4,5,6,4>, <2,5,3,6>
+ 3368527802U, // <6,3,4,7>: Cost 4 vmrglw <2,1,6,4>, <2,6,3,7>
+ 1698933277U, // <6,3,4,u>: Cost 2 vsldoi12 <3,4,u,6>, <3,4,u,6>
+ 3373179798U, // <6,3,5,0>: Cost 4 vmrglw <2,u,6,5>, <1,2,3,0>
+ 3707176179U, // <6,3,5,1>: Cost 5 vsldoi4 <2,6,3,5>, <1,6,5,7>
+ 2716012312U, // <6,3,5,2>: Cost 3 vsldoi8 <5,2,6,3>, <5,2,6,3>
+ 3373180530U, // <6,3,5,3>: Cost 4 vmrglw <2,u,6,5>, <2,2,3,3>
+ 2254309890U, // <6,3,5,4>: Cost 3 vmrghw <6,5,7,6>, <3,4,5,6>
+ 3785773070U, // <6,3,5,5>: Cost 4 vsldoi8 <4,5,6,3>, <5,5,6,6>
+ 3840739932U, // <6,3,5,6>: Cost 4 vsldoi12 <2,5,3,6>, <3,5,6,6>
+ 2299439034U, // <6,3,5,7>: Cost 3 vmrglw <2,u,6,5>, <2,6,3,7>
+ 2719994110U, // <6,3,5,u>: Cost 3 vsldoi8 <5,u,6,3>, <5,u,6,3>
+ 2254899350U, // <6,3,6,0>: Cost 3 vmrghw <6,6,6,6>, <3,0,1,2>
+ 3328641254U, // <6,3,6,1>: Cost 4 vmrghw <6,6,6,6>, <3,1,1,1>
+ 2633443257U, // <6,3,6,2>: Cost 3 vsldoi4 <2,6,3,6>, <2,6,3,6>
+ 2254899612U, // <6,3,6,3>: Cost 3 vmrghw <6,6,6,6>, <3,3,3,3>
+ 2254899714U, // <6,3,6,4>: Cost 3 vmrghw <6,6,6,6>, <3,4,5,6>
+ 3785773772U, // <6,3,6,5>: Cost 4 vsldoi8 <4,5,6,3>, <6,5,3,6>
+ 2725966648U, // <6,3,6,6>: Cost 3 vsldoi8 <6,u,6,3>, <6,6,6,6>
+ 2322007994U, // <6,3,6,7>: Cost 3 vmrglw <6,6,6,6>, <2,6,3,7>
+ 2254899998U, // <6,3,6,u>: Cost 3 vmrghw <6,6,6,6>, <3,u,1,2>
+ 1559707750U, // <6,3,7,0>: Cost 2 vsldoi4 <2,6,3,7>, LHS
+ 2633450292U, // <6,3,7,1>: Cost 3 vsldoi4 <2,6,3,7>, <1,1,1,1>
+ 1559709626U, // <6,3,7,2>: Cost 2 vsldoi4 <2,6,3,7>, <2,6,3,7>
+ 1235666546U, // <6,3,7,3>: Cost 2 vmrglw RHS, <2,2,3,3>
+ 1559711030U, // <6,3,7,4>: Cost 2 vsldoi4 <2,6,3,7>, RHS
+ 2309408291U, // <6,3,7,5>: Cost 3 vmrglw RHS, <2,1,3,5>
+ 2633454152U, // <6,3,7,6>: Cost 3 vsldoi4 <2,6,3,7>, <6,3,7,0>
+ 1235666874U, // <6,3,7,7>: Cost 2 vmrglw RHS, <2,6,3,7>
+ 1559713582U, // <6,3,7,u>: Cost 2 vsldoi4 <2,6,3,7>, LHS
+ 1559715942U, // <6,3,u,0>: Cost 2 vsldoi4 <2,6,3,u>, LHS
+ 2633458484U, // <6,3,u,1>: Cost 3 vsldoi4 <2,6,3,u>, <1,1,1,1>
+ 1559717819U, // <6,3,u,2>: Cost 2 vsldoi4 <2,6,3,u>, <2,6,3,u>
+ 1235674738U, // <6,3,u,3>: Cost 2 vmrglw RHS, <2,2,3,3>
+ 1559719222U, // <6,3,u,4>: Cost 2 vsldoi4 <2,6,3,u>, RHS
+ 1701366598U, // <6,3,u,5>: Cost 2 vsldoi12 <3,u,5,6>, <3,u,5,6>
+ 2633462353U, // <6,3,u,6>: Cost 3 vsldoi4 <2,6,3,u>, <6,3,u,0>
+ 1235675066U, // <6,3,u,7>: Cost 2 vmrglw RHS, <2,6,3,7>
+ 1559721774U, // <6,3,u,u>: Cost 2 vsldoi4 <2,6,3,u>, LHS
+ 3785777152U, // <6,4,0,0>: Cost 4 vsldoi8 <4,5,6,4>, <0,0,0,0>
+ 2712035430U, // <6,4,0,1>: Cost 3 vsldoi8 <4,5,6,4>, LHS
+ 3771179185U, // <6,4,0,2>: Cost 4 vsldoi8 <2,1,6,4>, <0,2,1,6>
+ 3846196096U, // <6,4,0,3>: Cost 4 vsldoi12 <3,4,5,6>, <4,0,3,1>
+ 3785777490U, // <6,4,0,4>: Cost 4 vsldoi8 <4,5,6,4>, <0,4,1,5>
+ 2250517814U, // <6,4,0,5>: Cost 3 vmrghw <6,0,1,2>, RHS
+ 3324259703U, // <6,4,0,6>: Cost 4 vmrghw <6,0,1,2>, <4,6,5,0>
+ 3383092458U, // <6,4,0,7>: Cost 5 vmrglw <4,5,6,0>, <1,6,4,7>
+ 2712035997U, // <6,4,0,u>: Cost 3 vsldoi8 <4,5,6,4>, LHS
+ 3325356946U, // <6,4,1,0>: Cost 4 vmrghw <6,1,7,1>, <4,0,5,1>
+ 3785777972U, // <6,4,1,1>: Cost 4 vsldoi8 <4,5,6,4>, <1,1,1,1>
+ 3846196170U, // <6,4,1,2>: Cost 4 vsldoi12 <3,4,5,6>, <4,1,2,3>
+ 3325365380U, // <6,4,1,3>: Cost 4 vmrghw <6,1,7,2>, <4,3,5,0>
+ 3852168155U, // <6,4,1,4>: Cost 4 vsldoi12 <4,4,5,6>, <4,1,4,2>
+ 2251615542U, // <6,4,1,5>: Cost 3 vmrghw <6,1,7,1>, RHS
+ 3325357432U, // <6,4,1,6>: Cost 4 vmrghw <6,1,7,1>, <4,6,5,1>
+ 3870084088U, // <6,4,1,7>: Cost 4 vsldoi12 <7,4,5,6>, <4,1,7,4>
+ 2251615785U, // <6,4,1,u>: Cost 3 vmrghw <6,1,7,1>, RHS
+ 2252295058U, // <6,4,2,0>: Cost 3 vmrghw <6,2,7,3>, <4,0,5,1>
+ 3771180605U, // <6,4,2,1>: Cost 4 vsldoi8 <2,1,6,4>, <2,1,6,4>
+ 3785778792U, // <6,4,2,2>: Cost 4 vsldoi8 <4,5,6,4>, <2,2,2,2>
+ 3777816253U, // <6,4,2,3>: Cost 4 vsldoi8 <3,2,6,4>, <2,3,2,6>
+ 2252295376U, // <6,4,2,4>: Cost 3 vmrghw <6,2,7,3>, <4,4,4,4>
+ 1178553654U, // <6,4,2,5>: Cost 2 vmrghw <6,2,7,3>, RHS
+ 2252295545U, // <6,4,2,6>: Cost 3 vmrghw <6,2,7,3>, <4,6,5,2>
+ 3326037448U, // <6,4,2,7>: Cost 4 vmrghw <6,2,7,3>, <4,7,5,0>
+ 1178553897U, // <6,4,2,u>: Cost 2 vmrghw <6,2,7,3>, RHS
+ 3785779350U, // <6,4,3,0>: Cost 4 vsldoi8 <4,5,6,4>, <3,0,1,2>
+ 3383118648U, // <6,4,3,1>: Cost 4 vmrglw <4,5,6,3>, <3,u,4,1>
+ 3777816935U, // <6,4,3,2>: Cost 4 vsldoi8 <3,2,6,4>, <3,2,6,4>
+ 3785779612U, // <6,4,3,3>: Cost 4 vsldoi8 <4,5,6,4>, <3,3,3,3>
+ 2712037890U, // <6,4,3,4>: Cost 3 vsldoi8 <4,5,6,4>, <3,4,5,6>
+ 2252754230U, // <6,4,3,5>: Cost 3 vmrghw <6,3,4,5>, RHS
+ 3784452764U, // <6,4,3,6>: Cost 4 vsldoi8 <4,3,6,4>, <3,6,4,7>
+ 3801705178U, // <6,4,3,7>: Cost 4 vsldoi8 <7,2,6,4>, <3,7,2,6>
+ 2252754473U, // <6,4,3,u>: Cost 3 vmrghw <6,3,4,5>, RHS
+ 3787770770U, // <6,4,4,0>: Cost 4 vsldoi8 <4,u,6,4>, <4,0,5,1>
+ 3383126840U, // <6,4,4,1>: Cost 4 vmrglw <4,5,6,4>, <3,u,4,1>
+ 3327380534U, // <6,4,4,2>: Cost 4 vmrghw <6,4,7,5>, <4,2,5,3>
+ 3784453265U, // <6,4,4,3>: Cost 4 vsldoi8 <4,3,6,4>, <4,3,6,4>
+ 2253630672U, // <6,4,4,4>: Cost 3 vmrghw <6,4,7,4>, <4,4,4,4>
+ 2778426587U, // <6,4,4,5>: Cost 3 vsldoi12 <4,4,5,6>, <4,4,5,6>
+ 3383128789U, // <6,4,4,6>: Cost 4 vmrglw <4,5,6,4>, <6,5,4,6>
+ 3381799580U, // <6,4,4,7>: Cost 4 vmrglw <4,3,6,4>, <3,6,4,7>
+ 2778647798U, // <6,4,4,u>: Cost 3 vsldoi12 <4,4,u,6>, <4,4,u,6>
+ 2651422822U, // <6,4,5,0>: Cost 3 vsldoi4 <5,6,4,5>, LHS
+ 3701277928U, // <6,4,5,1>: Cost 4 vsldoi4 <1,6,4,5>, <1,6,4,5>
+ 3701278650U, // <6,4,5,2>: Cost 4 vsldoi4 <1,6,4,5>, <2,6,3,7>
+ 2651425282U, // <6,4,5,3>: Cost 3 vsldoi4 <5,6,4,5>, <3,4,5,6>
+ 2651426102U, // <6,4,5,4>: Cost 3 vsldoi4 <5,6,4,5>, RHS
+ 2651426892U, // <6,4,5,5>: Cost 3 vsldoi4 <5,6,4,5>, <5,6,4,5>
+ 1698712886U, // <6,4,5,6>: Cost 2 vsldoi12 <3,4,5,6>, RHS
+ 3725169658U, // <6,4,5,7>: Cost 4 vsldoi4 <5,6,4,5>, <7,0,1,2>
+ 1698712904U, // <6,4,5,u>: Cost 2 vsldoi12 <3,4,5,6>, RHS
+ 2254900114U, // <6,4,6,0>: Cost 3 vmrghw <6,6,6,6>, <4,0,5,1>
+ 3389115192U, // <6,4,6,1>: Cost 4 vmrglw <5,5,6,6>, <3,u,4,1>
+ 3785781727U, // <6,4,6,2>: Cost 4 vsldoi8 <4,5,6,4>, <6,2,4,3>
+ 3785781810U, // <6,4,6,3>: Cost 4 vsldoi8 <4,5,6,4>, <6,3,4,5>
+ 2254900432U, // <6,4,6,4>: Cost 3 vmrghw <6,6,6,6>, <4,4,4,4>
+ 1181158710U, // <6,4,6,5>: Cost 2 vmrghw <6,6,6,6>, RHS
+ 2254900605U, // <6,4,6,6>: Cost 3 vmrghw <6,6,6,6>, <4,6,5,6>
+ 3787772750U, // <6,4,6,7>: Cost 4 vsldoi8 <4,u,6,4>, <6,7,0,1>
+ 1181158953U, // <6,4,6,u>: Cost 2 vmrghw <6,6,6,6>, RHS
+ 2639495270U, // <6,4,7,0>: Cost 3 vsldoi4 <3,6,4,7>, LHS
+ 2639496090U, // <6,4,7,1>: Cost 3 vsldoi4 <3,6,4,7>, <1,2,3,4>
+ 3707267011U, // <6,4,7,2>: Cost 4 vsldoi4 <2,6,4,7>, <2,6,4,7>
+ 2639497884U, // <6,4,7,3>: Cost 3 vsldoi4 <3,6,4,7>, <3,6,4,7>
+ 1237658832U, // <6,4,7,4>: Cost 2 vmrglw RHS, <4,4,4,4>
+ 1235666638U, // <6,4,7,5>: Cost 2 vmrglw RHS, <2,3,4,5>
+ 3713241753U, // <6,4,7,6>: Cost 4 vsldoi4 <3,6,4,7>, <6,4,7,0>
+ 2309409436U, // <6,4,7,7>: Cost 3 vmrglw RHS, <3,6,4,7>
+ 1235666641U, // <6,4,7,u>: Cost 2 vmrglw RHS, <2,3,4,u>
+ 2639503462U, // <6,4,u,0>: Cost 3 vsldoi4 <3,6,4,u>, LHS
+ 2639504282U, // <6,4,u,1>: Cost 3 vsldoi4 <3,6,4,u>, <1,2,3,4>
+ 3701303226U, // <6,4,u,2>: Cost 4 vsldoi4 <1,6,4,u>, <2,6,3,7>
+ 2639506077U, // <6,4,u,3>: Cost 3 vsldoi4 <3,6,4,u>, <3,6,4,u>
+ 1235676368U, // <6,4,u,4>: Cost 2 vmrglw RHS, <4,4,4,4>
+ 1235674830U, // <6,4,u,5>: Cost 2 vmrglw RHS, <2,3,4,5>
+ 1698713129U, // <6,4,u,6>: Cost 2 vsldoi12 <3,4,5,6>, RHS
+ 2309417628U, // <6,4,u,7>: Cost 3 vmrglw RHS, <3,6,4,7>
+ 1698713147U, // <6,4,u,u>: Cost 2 vsldoi12 <3,4,5,6>, RHS
+ 3775832064U, // <6,5,0,0>: Cost 4 vsldoi8 <2,u,6,5>, <0,0,0,0>
+ 2702090342U, // <6,5,0,1>: Cost 3 vsldoi8 <2,u,6,5>, LHS
+ 3775832241U, // <6,5,0,2>: Cost 4 vsldoi8 <2,u,6,5>, <0,2,1,6>
+ 3719227906U, // <6,5,0,3>: Cost 4 vsldoi4 <4,6,5,0>, <3,4,5,6>
+ 3775832402U, // <6,5,0,4>: Cost 4 vsldoi8 <2,u,6,5>, <0,4,1,5>
+ 3385085146U, // <6,5,0,5>: Cost 4 vmrglw <4,u,6,0>, <4,4,5,5>
+ 2309351938U, // <6,5,0,6>: Cost 3 vmrglw <4,5,6,0>, <3,4,5,6>
+ 3376459134U, // <6,5,0,7>: Cost 5 vmrglw <3,4,6,0>, <4,6,5,7>
+ 2702090909U, // <6,5,0,u>: Cost 3 vsldoi8 <2,u,6,5>, LHS
+ 3719233546U, // <6,5,1,0>: Cost 4 vsldoi4 <4,6,5,1>, <0,0,1,1>
+ 3775832884U, // <6,5,1,1>: Cost 4 vsldoi8 <2,u,6,5>, <1,1,1,1>
+ 3775832982U, // <6,5,1,2>: Cost 4 vsldoi8 <2,u,6,5>, <1,2,3,0>
+ 3846196909U, // <6,5,1,3>: Cost 4 vsldoi12 <3,4,5,6>, <5,1,3,4>
+ 3719236984U, // <6,5,1,4>: Cost 4 vsldoi4 <4,6,5,1>, <4,6,5,1>
+ 3856150209U, // <6,5,1,5>: Cost 4 vsldoi12 <5,1,5,6>, <5,1,5,6>
+ 3834252997U, // <6,5,1,6>: Cost 4 vsldoi12 <1,4,5,6>, <5,1,6,1>
+ 3870084817U, // <6,5,1,7>: Cost 4 vsldoi12 <7,4,5,6>, <5,1,7,4>
+ 3769861532U, // <6,5,1,u>: Cost 4 vsldoi8 <1,u,6,5>, <1,u,6,5>
+ 2645500006U, // <6,5,2,0>: Cost 3 vsldoi4 <4,6,5,2>, LHS
+ 3719242548U, // <6,5,2,1>: Cost 4 vsldoi4 <4,6,5,2>, <1,1,1,1>
+ 3775833704U, // <6,5,2,2>: Cost 4 vsldoi8 <2,u,6,5>, <2,2,2,2>
+ 3775833766U, // <6,5,2,3>: Cost 4 vsldoi8 <2,u,6,5>, <2,3,0,1>
+ 2645503353U, // <6,5,2,4>: Cost 3 vsldoi4 <4,6,5,2>, <4,6,5,2>
+ 2252296196U, // <6,5,2,5>: Cost 3 vmrghw <6,2,7,3>, <5,5,5,5>
+ 2702092218U, // <6,5,2,6>: Cost 3 vsldoi8 <2,u,6,5>, <2,6,3,7>
+ 3719246842U, // <6,5,2,7>: Cost 4 vsldoi4 <4,6,5,2>, <7,0,1,2>
+ 2702092405U, // <6,5,2,u>: Cost 3 vsldoi8 <2,u,6,5>, <2,u,6,5>
+ 3775834262U, // <6,5,3,0>: Cost 4 vsldoi8 <2,u,6,5>, <3,0,1,2>
+ 3777161495U, // <6,5,3,1>: Cost 4 vsldoi8 <3,1,6,5>, <3,1,6,5>
+ 3775834470U, // <6,5,3,2>: Cost 4 vsldoi8 <2,u,6,5>, <3,2,6,3>
+ 3775834524U, // <6,5,3,3>: Cost 4 vsldoi8 <2,u,6,5>, <3,3,3,3>
+ 3775834626U, // <6,5,3,4>: Cost 4 vsldoi8 <2,u,6,5>, <3,4,5,6>
+ 3385109722U, // <6,5,3,5>: Cost 4 vmrglw <4,u,6,3>, <4,4,5,5>
+ 2309376514U, // <6,5,3,6>: Cost 3 vmrglw <4,5,6,3>, <3,4,5,6>
+ 3775834819U, // <6,5,3,7>: Cost 4 vsldoi8 <2,u,6,5>, <3,7,0,1>
+ 2309376514U, // <6,5,3,u>: Cost 3 vmrglw <4,5,6,3>, <3,4,5,6>
+ 3719258214U, // <6,5,4,0>: Cost 4 vsldoi4 <4,6,5,4>, LHS
+ 3385117586U, // <6,5,4,1>: Cost 4 vmrglw <4,u,6,4>, <4,0,5,1>
+ 3327242008U, // <6,5,4,2>: Cost 4 vmrghw <6,4,5,6>, <5,2,6,3>
+ 3719260674U, // <6,5,4,3>: Cost 4 vsldoi4 <4,6,5,4>, <3,4,5,6>
+ 3719261563U, // <6,5,4,4>: Cost 4 vsldoi4 <4,6,5,4>, <4,6,5,4>
+ 2702093622U, // <6,5,4,5>: Cost 3 vsldoi8 <2,u,6,5>, RHS
+ 2309384706U, // <6,5,4,6>: Cost 3 vmrglw <4,5,6,4>, <3,4,5,6>
+ 3870085060U, // <6,5,4,7>: Cost 4 vsldoi12 <7,4,5,6>, <5,4,7,4>
+ 2702093865U, // <6,5,4,u>: Cost 3 vsldoi8 <2,u,6,5>, RHS
+ 3719266406U, // <6,5,5,0>: Cost 4 vsldoi4 <4,6,5,5>, LHS
+ 3789106889U, // <6,5,5,1>: Cost 4 vsldoi8 <5,1,6,5>, <5,1,6,5>
+ 3785789208U, // <6,5,5,2>: Cost 4 vsldoi8 <4,5,6,5>, <5,2,6,3>
+ 3373183950U, // <6,5,5,3>: Cost 4 vmrglw <2,u,6,5>, <6,u,5,3>
+ 2717355964U, // <6,5,5,4>: Cost 3 vsldoi8 <5,4,6,5>, <5,4,6,5>
+ 2791772164U, // <6,5,5,5>: Cost 3 vsldoi12 <6,6,6,6>, <5,5,5,5>
+ 2772455438U, // <6,5,5,6>: Cost 3 vsldoi12 <3,4,5,6>, <5,5,6,6>
+ 3373183549U, // <6,5,5,7>: Cost 4 vmrglw <2,u,6,5>, <6,3,5,7>
+ 2720010496U, // <6,5,5,u>: Cost 3 vsldoi8 <5,u,6,5>, <5,u,6,5>
+ 2772455460U, // <6,5,6,0>: Cost 3 vsldoi12 <3,4,5,6>, <5,6,0,1>
+ 2322008978U, // <6,5,6,1>: Cost 3 vmrglw <6,6,6,6>, <4,0,5,1>
+ 3840225335U, // <6,5,6,2>: Cost 4 vsldoi12 <2,4,5,6>, <5,6,2,2>
+ 2772455490U, // <6,5,6,3>: Cost 3 vsldoi12 <3,4,5,6>, <5,6,3,4>
+ 2772455500U, // <6,5,6,4>: Cost 3 vsldoi12 <3,4,5,6>, <5,6,4,5>
+ 2254901252U, // <6,5,6,5>: Cost 3 vmrghw <6,6,6,6>, <5,5,5,5>
+ 2772455520U, // <6,5,6,6>: Cost 3 vsldoi12 <3,4,5,6>, <5,6,6,7>
+ 2785874024U, // <6,5,6,7>: Cost 3 vsldoi12 <5,6,7,6>, <5,6,7,6>
+ 2772455532U, // <6,5,6,u>: Cost 3 vsldoi12 <3,4,5,6>, <5,6,u,1>
+ 2627625062U, // <6,5,7,0>: Cost 3 vsldoi4 <1,6,5,7>, LHS
+ 1235667858U, // <6,5,7,1>: Cost 2 vmrglw RHS, <4,0,5,1>
+ 2309409278U, // <6,5,7,2>: Cost 3 vmrglw RHS, <3,4,5,2>
+ 2309407659U, // <6,5,7,3>: Cost 3 vmrglw RHS, <1,2,5,3>
+ 2627628342U, // <6,5,7,4>: Cost 3 vsldoi4 <1,6,5,7>, RHS
+ 1235668186U, // <6,5,7,5>: Cost 2 vmrglw RHS, <4,4,5,5>
+ 1235667458U, // <6,5,7,6>: Cost 2 vmrglw RHS, <3,4,5,6>
+ 2309407987U, // <6,5,7,7>: Cost 3 vmrglw RHS, <1,6,5,7>
+ 1235667460U, // <6,5,7,u>: Cost 2 vmrglw RHS, <3,4,5,u>
+ 2627633254U, // <6,5,u,0>: Cost 3 vsldoi4 <1,6,5,u>, LHS
+ 1235676050U, // <6,5,u,1>: Cost 2 vmrglw RHS, <4,0,5,1>
+ 2309417470U, // <6,5,u,2>: Cost 3 vmrglw RHS, <3,4,5,2>
+ 2309415851U, // <6,5,u,3>: Cost 3 vmrglw RHS, <1,2,5,3>
+ 2627636534U, // <6,5,u,4>: Cost 3 vsldoi4 <1,6,5,u>, RHS
+ 1235676378U, // <6,5,u,5>: Cost 2 vmrglw RHS, <4,4,5,5>
+ 1235675650U, // <6,5,u,6>: Cost 2 vmrglw RHS, <3,4,5,6>
+ 2309416179U, // <6,5,u,7>: Cost 3 vmrglw RHS, <1,6,5,7>
+ 1235675652U, // <6,5,u,u>: Cost 2 vmrglw RHS, <3,4,5,u>
+ 2309352751U, // <6,6,0,0>: Cost 3 vmrglw <4,5,6,0>, <4,5,6,0>
+ 1650917478U, // <6,6,0,1>: Cost 2 vsldoi8 <6,6,6,6>, LHS
+ 2250584570U, // <6,6,0,2>: Cost 3 vmrghw <6,0,2,1>, <6,2,7,3>
+ 3846197554U, // <6,6,0,3>: Cost 4 vsldoi12 <3,4,5,6>, <6,0,3,1>
+ 2724659538U, // <6,6,0,4>: Cost 3 vsldoi8 <6,6,6,6>, <0,4,1,5>
+ 3725275225U, // <6,6,0,5>: Cost 4 vsldoi4 <5,6,6,0>, <5,6,6,0>
+ 2791772493U, // <6,6,0,6>: Cost 3 vsldoi12 <6,6,6,6>, <6,0,6,1>
+ 2309352758U, // <6,6,0,7>: Cost 3 vmrglw <4,5,6,0>, RHS
+ 1650918045U, // <6,6,0,u>: Cost 2 vsldoi8 <6,6,6,6>, LHS
+ 3325358368U, // <6,6,1,0>: Cost 4 vmrghw <6,1,7,1>, <6,0,1,1>
+ 2299406449U, // <6,6,1,1>: Cost 3 vmrglw <2,u,6,1>, <2,u,6,1>
+ 2724660118U, // <6,6,1,2>: Cost 3 vsldoi8 <6,6,6,6>, <1,2,3,0>
+ 3373148518U, // <6,6,1,3>: Cost 4 vmrglw <2,u,6,1>, <3,2,6,3>
+ 3834253712U, // <6,6,1,4>: Cost 4 vsldoi12 <1,4,5,6>, <6,1,4,5>
+ 3373147953U, // <6,6,1,5>: Cost 4 vmrglw <2,u,6,1>, <2,4,6,5>
+ 2323297080U, // <6,6,1,6>: Cost 3 vmrglw <6,u,6,1>, <6,6,6,6>
+ 2299407670U, // <6,6,1,7>: Cost 3 vmrglw <2,u,6,1>, RHS
+ 2299407671U, // <6,6,1,u>: Cost 3 vmrglw <2,u,6,1>, RHS
+ 2252296489U, // <6,6,2,0>: Cost 3 vmrghw <6,2,7,3>, <6,0,2,1>
+ 3326038394U, // <6,6,2,1>: Cost 4 vmrghw <6,2,7,3>, <6,1,2,1>
+ 1178554874U, // <6,6,2,2>: Cost 2 vmrghw <6,2,7,3>, <6,2,7,3>
+ 2724660902U, // <6,6,2,3>: Cost 3 vsldoi8 <6,6,6,6>, <2,3,0,1>
+ 2252296817U, // <6,6,2,4>: Cost 3 vmrghw <6,2,7,3>, <6,4,2,5>
+ 3840741864U, // <6,6,2,5>: Cost 4 vsldoi12 <2,5,3,6>, <6,2,5,3>
+ 2252296976U, // <6,6,2,6>: Cost 3 vmrghw <6,2,7,3>, <6,6,2,2>
+ 2785874426U, // <6,6,2,7>: Cost 3 vsldoi12 <5,6,7,6>, <6,2,7,3>
+ 1178554874U, // <6,6,2,u>: Cost 2 vmrghw <6,2,7,3>, <6,2,7,3>
+ 2724661398U, // <6,6,3,0>: Cost 3 vsldoi8 <6,6,6,6>, <3,0,1,2>
+ 3375154665U, // <6,6,3,1>: Cost 4 vmrglw <3,2,6,3>, <2,0,6,1>
+ 3375154909U, // <6,6,3,2>: Cost 4 vmrglw <3,2,6,3>, <2,3,6,2>
+ 2301413734U, // <6,6,3,3>: Cost 3 vmrglw <3,2,6,3>, <3,2,6,3>
+ 2772455986U, // <6,6,3,4>: Cost 3 vsldoi12 <3,4,5,6>, <6,3,4,5>
+ 3375154993U, // <6,6,3,5>: Cost 4 vmrglw <3,2,6,3>, <2,4,6,5>
+ 2323313464U, // <6,6,3,6>: Cost 3 vmrglw <6,u,6,3>, <6,6,6,6>
+ 2301414710U, // <6,6,3,7>: Cost 3 vmrglw <3,2,6,3>, RHS
+ 2301414711U, // <6,6,3,u>: Cost 3 vmrglw <3,2,6,3>, RHS
+ 2724662162U, // <6,6,4,0>: Cost 3 vsldoi8 <6,6,6,6>, <4,0,5,1>
+ 3326939559U, // <6,6,4,1>: Cost 4 vmrghw <6,4,1,5>, <6,1,7,1>
+ 2253271546U, // <6,6,4,2>: Cost 3 vmrghw <6,4,2,5>, <6,2,7,3>
+ 3383127346U, // <6,6,4,3>: Cost 4 vmrglw <4,5,6,4>, <4,5,6,3>
+ 2309385523U, // <6,6,4,4>: Cost 3 vmrglw <4,5,6,4>, <4,5,6,4>
+ 1650920758U, // <6,6,4,5>: Cost 2 vsldoi8 <6,6,6,6>, RHS
+ 2724662653U, // <6,6,4,6>: Cost 3 vsldoi8 <6,6,6,6>, <4,6,5,6>
+ 2309385526U, // <6,6,4,7>: Cost 3 vmrglw <4,5,6,4>, RHS
+ 1650921001U, // <6,6,4,u>: Cost 2 vsldoi8 <6,6,6,6>, RHS
+ 3725312102U, // <6,6,5,0>: Cost 4 vsldoi4 <5,6,6,5>, LHS
+ 3373180393U, // <6,6,5,1>: Cost 4 vmrglw <2,u,6,5>, <2,0,6,1>
+ 3791769368U, // <6,6,5,2>: Cost 4 vsldoi8 <5,5,6,6>, <5,2,6,3>
+ 3373181286U, // <6,6,5,3>: Cost 4 vmrglw <2,u,6,5>, <3,2,6,3>
+ 3725315382U, // <6,6,5,4>: Cost 4 vsldoi4 <5,6,6,5>, RHS
+ 2299439221U, // <6,6,5,5>: Cost 3 vmrglw <2,u,6,5>, <2,u,6,5>
+ 2724663394U, // <6,6,5,6>: Cost 3 vsldoi8 <6,6,6,6>, <5,6,7,0>
+ 2299440438U, // <6,6,5,7>: Cost 3 vmrglw <2,u,6,5>, RHS
+ 2299440439U, // <6,6,5,u>: Cost 3 vmrglw <2,u,6,5>, RHS
+ 1583808614U, // <6,6,6,0>: Cost 2 vsldoi4 <6,6,6,6>, LHS
+ 2322010445U, // <6,6,6,1>: Cost 3 vmrglw <6,6,6,6>, <6,0,6,1>
+ 2254574074U, // <6,6,6,2>: Cost 3 vmrghw <6,6,2,2>, <6,2,7,3>
+ 2322010609U, // <6,6,6,3>: Cost 3 vmrglw <6,6,6,6>, <6,2,6,3>
+ 1583811894U, // <6,6,6,4>: Cost 2 vsldoi4 <6,6,6,6>, RHS
+ 2322010773U, // <6,6,6,5>: Cost 3 vmrglw <6,6,6,6>, <6,4,6,5>
+ 363253046U, // <6,6,6,6>: Cost 1 vspltisw2 RHS
+ 1248267574U, // <6,6,6,7>: Cost 2 vmrglw <6,6,6,6>, RHS
+ 363253046U, // <6,6,6,u>: Cost 1 vspltisw2 RHS
+ 2309410095U, // <6,6,7,0>: Cost 3 vmrglw RHS, <4,5,6,0>
+ 2309408233U, // <6,6,7,1>: Cost 3 vmrglw RHS, <2,0,6,1>
+ 2311402373U, // <6,6,7,2>: Cost 3 vmrglw RHS, <6,7,6,2>
+ 2309409126U, // <6,6,7,3>: Cost 3 vmrglw RHS, <3,2,6,3>
+ 2309410099U, // <6,6,7,4>: Cost 3 vmrglw RHS, <4,5,6,4>
+ 2309408561U, // <6,6,7,5>: Cost 3 vmrglw RHS, <2,4,6,5>
+ 1237660472U, // <6,6,7,6>: Cost 2 vmrglw RHS, <6,6,6,6>
+ 161926454U, // <6,6,7,7>: Cost 1 vmrglw RHS, RHS
+ 161926455U, // <6,6,7,u>: Cost 1 vmrglw RHS, RHS
+ 1583808614U, // <6,6,u,0>: Cost 2 vsldoi4 <6,6,6,6>, LHS
+ 1650923310U, // <6,6,u,1>: Cost 2 vsldoi8 <6,6,6,6>, LHS
+ 1178554874U, // <6,6,u,2>: Cost 2 vmrghw <6,2,7,3>, <6,2,7,3>
+ 2309417318U, // <6,6,u,3>: Cost 3 vmrglw RHS, <3,2,6,3>
+ 1583811894U, // <6,6,u,4>: Cost 2 vsldoi4 <6,6,6,6>, RHS
+ 1650923674U, // <6,6,u,5>: Cost 2 vsldoi8 <6,6,6,6>, RHS
+ 363253046U, // <6,6,u,6>: Cost 1 vspltisw2 RHS
+ 161934646U, // <6,6,u,7>: Cost 1 vmrglw RHS, RHS
+ 161934647U, // <6,6,u,u>: Cost 1 vmrglw RHS, RHS
+ 1638318080U, // <6,7,0,0>: Cost 2 vsldoi8 RHS, <0,0,0,0>
+ 564576358U, // <6,7,0,1>: Cost 1 vsldoi8 RHS, LHS
+ 2712060077U, // <6,7,0,2>: Cost 3 vsldoi8 RHS, <0,2,1,2>
+ 2712060156U, // <6,7,0,3>: Cost 3 vsldoi8 RHS, <0,3,1,0>
+ 1638318418U, // <6,7,0,4>: Cost 2 vsldoi8 RHS, <0,4,1,5>
+ 1577865314U, // <6,7,0,5>: Cost 2 vsldoi4 <5,6,7,0>, <5,6,7,0>
+ 2712060406U, // <6,7,0,6>: Cost 3 vsldoi8 RHS, <0,6,1,7>
+ 2651608058U, // <6,7,0,7>: Cost 3 vsldoi4 <5,6,7,0>, <7,0,1,2>
+ 564576925U, // <6,7,0,u>: Cost 1 vsldoi8 RHS, LHS
+ 2712060643U, // <6,7,1,0>: Cost 3 vsldoi8 RHS, <1,0,1,1>
+ 1638318900U, // <6,7,1,1>: Cost 2 vsldoi8 RHS, <1,1,1,1>
+ 1638318998U, // <6,7,1,2>: Cost 2 vsldoi8 RHS, <1,2,3,0>
+ 3766559753U, // <6,7,1,3>: Cost 4 vsldoi8 <1,3,6,7>, <1,3,6,7>
+ 2712060971U, // <6,7,1,4>: Cost 3 vsldoi8 RHS, <1,4,1,5>
+ 2712061039U, // <6,7,1,5>: Cost 3 vsldoi8 RHS, <1,5,0,1>
+ 2712061135U, // <6,7,1,6>: Cost 3 vsldoi8 RHS, <1,6,1,7>
+ 3373148612U, // <6,7,1,7>: Cost 4 vmrglw <2,u,6,1>, <3,3,7,7>
+ 1638319484U, // <6,7,1,u>: Cost 2 vsldoi8 RHS, <1,u,3,0>
+ 2712061373U, // <6,7,2,0>: Cost 3 vsldoi8 RHS, <2,0,1,2>
+ 2712061471U, // <6,7,2,1>: Cost 3 vsldoi8 RHS, <2,1,3,1>
+ 1638319720U, // <6,7,2,2>: Cost 2 vsldoi8 RHS, <2,2,2,2>
+ 1638319782U, // <6,7,2,3>: Cost 2 vsldoi8 RHS, <2,3,0,1>
+ 2712061709U, // <6,7,2,4>: Cost 3 vsldoi8 RHS, <2,4,2,5>
+ 2712061800U, // <6,7,2,5>: Cost 3 vsldoi8 RHS, <2,5,3,6>
+ 1638320058U, // <6,7,2,6>: Cost 2 vsldoi8 RHS, <2,6,3,7>
+ 2252297836U, // <6,7,2,7>: Cost 3 vmrghw <6,2,7,3>, <7,7,7,7>
+ 1638320187U, // <6,7,2,u>: Cost 2 vsldoi8 RHS, <2,u,0,1>
+ 1638320278U, // <6,7,3,0>: Cost 2 vsldoi8 RHS, <3,0,1,2>
+ 2712062182U, // <6,7,3,1>: Cost 3 vsldoi8 RHS, <3,1,1,1>
+ 2712062256U, // <6,7,3,2>: Cost 3 vsldoi8 RHS, <3,2,0,3>
+ 1638320540U, // <6,7,3,3>: Cost 2 vsldoi8 RHS, <3,3,3,3>
+ 1638320642U, // <6,7,3,4>: Cost 2 vsldoi8 RHS, <3,4,5,6>
+ 2712062546U, // <6,7,3,5>: Cost 3 vsldoi8 RHS, <3,5,5,5>
+ 2712062584U, // <6,7,3,6>: Cost 3 vsldoi8 RHS, <3,6,0,7>
+ 2712062659U, // <6,7,3,7>: Cost 3 vsldoi8 RHS, <3,7,0,1>
+ 1638320926U, // <6,7,3,u>: Cost 2 vsldoi8 RHS, <3,u,1,2>
+ 1638321042U, // <6,7,4,0>: Cost 2 vsldoi8 RHS, <4,0,5,1>
+ 2712062922U, // <6,7,4,1>: Cost 3 vsldoi8 RHS, <4,1,2,3>
+ 2712063029U, // <6,7,4,2>: Cost 3 vsldoi8 RHS, <4,2,5,2>
+ 2712063108U, // <6,7,4,3>: Cost 3 vsldoi8 RHS, <4,3,5,0>
+ 1638321360U, // <6,7,4,4>: Cost 2 vsldoi8 RHS, <4,4,4,4>
+ 564579638U, // <6,7,4,5>: Cost 1 vsldoi8 RHS, RHS
+ 2712063357U, // <6,7,4,6>: Cost 3 vsldoi8 RHS, <4,6,5,6>
+ 2712063439U, // <6,7,4,7>: Cost 3 vsldoi8 RHS, <4,7,5,7>
+ 564579881U, // <6,7,4,u>: Cost 1 vsldoi8 RHS, RHS
+ 2712063560U, // <6,7,5,0>: Cost 3 vsldoi8 RHS, <5,0,1,2>
+ 2714054287U, // <6,7,5,1>: Cost 3 vsldoi8 RHS, <5,1,0,1>
+ 2712063742U, // <6,7,5,2>: Cost 3 vsldoi8 RHS, <5,2,3,4>
+ 3373181295U, // <6,7,5,3>: Cost 4 vmrglw <2,u,6,5>, <3,2,7,3>
+ 2712063924U, // <6,7,5,4>: Cost 3 vsldoi8 RHS, <5,4,5,6>
+ 1638322180U, // <6,7,5,5>: Cost 2 vsldoi8 RHS, <5,5,5,5>
+ 1638322274U, // <6,7,5,6>: Cost 2 vsldoi8 RHS, <5,6,7,0>
+ 3373181380U, // <6,7,5,7>: Cost 4 vmrglw <2,u,6,5>, <3,3,7,7>
+ 1640313092U, // <6,7,5,u>: Cost 2 vsldoi8 RHS, <5,u,7,0>
+ 2712064289U, // <6,7,6,0>: Cost 3 vsldoi8 RHS, <6,0,1,2>
+ 2712064423U, // <6,7,6,1>: Cost 3 vsldoi8 RHS, <6,1,7,1>
+ 1638322682U, // <6,7,6,2>: Cost 2 vsldoi8 RHS, <6,2,7,3>
+ 2712064562U, // <6,7,6,3>: Cost 3 vsldoi8 RHS, <6,3,4,5>
+ 2712064653U, // <6,7,6,4>: Cost 3 vsldoi8 RHS, <6,4,5,6>
+ 2712064747U, // <6,7,6,5>: Cost 3 vsldoi8 RHS, <6,5,7,1>
+ 1638323000U, // <6,7,6,6>: Cost 2 vsldoi8 RHS, <6,6,6,6>
+ 1638323022U, // <6,7,6,7>: Cost 2 vsldoi8 RHS, <6,7,0,1>
+ 1638323168U, // <6,7,6,u>: Cost 2 vsldoi8 RHS, <6,u,7,3>
+ 1237659746U, // <6,7,7,0>: Cost 2 vmrglw RHS, <5,6,7,0>
+ 2309411158U, // <6,7,7,1>: Cost 3 vmrglw RHS, <6,0,7,1>
+ 2639718330U, // <6,7,7,2>: Cost 3 vsldoi4 <3,6,7,7>, <2,6,3,7>
+ 1235669498U, // <6,7,7,3>: Cost 2 vmrglw RHS, <6,2,7,3>
+ 1237659750U, // <6,7,7,4>: Cost 2 vmrglw RHS, <5,6,7,4>
+ 2309411243U, // <6,7,7,5>: Cost 3 vmrglw RHS, <6,1,7,5>
+ 1583895362U, // <6,7,7,6>: Cost 2 vsldoi4 <6,6,7,7>, <6,6,7,7>
+ 1235669826U, // <6,7,7,7>: Cost 2 vmrglw RHS, <6,6,7,7>
+ 1235669503U, // <6,7,7,u>: Cost 2 vmrglw RHS, <6,2,7,u>
+ 1638323923U, // <6,7,u,0>: Cost 2 vsldoi8 RHS, <u,0,1,2>
+ 564582190U, // <6,7,u,1>: Cost 1 vsldoi8 RHS, LHS
+ 1638324101U, // <6,7,u,2>: Cost 2 vsldoi8 RHS, <u,2,3,0>
+ 1638324156U, // <6,7,u,3>: Cost 2 vsldoi8 RHS, <u,3,0,1>
+ 1638324287U, // <6,7,u,4>: Cost 2 vsldoi8 RHS, <u,4,5,6>
+ 564582554U, // <6,7,u,5>: Cost 1 vsldoi8 RHS, RHS
+ 1638324432U, // <6,7,u,6>: Cost 2 vsldoi8 RHS, <u,6,3,7>
+ 1235678018U, // <6,7,u,7>: Cost 2 vmrglw RHS, <6,6,7,7>
+ 564582757U, // <6,7,u,u>: Cost 1 vsldoi8 RHS, LHS
+ 1638326272U, // <6,u,0,0>: Cost 2 vsldoi8 RHS, <0,0,0,0>
+ 564584550U, // <6,u,0,1>: Cost 1 vsldoi8 RHS, LHS
+ 2712068269U, // <6,u,0,2>: Cost 3 vsldoi8 RHS, <0,2,1,2>
+ 2309349532U, // <6,u,0,3>: Cost 3 vmrglw <4,5,6,0>, LHS
+ 1638326610U, // <6,u,0,4>: Cost 2 vsldoi8 RHS, <0,4,1,5>
+ 1577939051U, // <6,u,0,5>: Cost 2 vsldoi4 <5,6,u,0>, <5,6,u,0>
+ 2712068598U, // <6,u,0,6>: Cost 3 vsldoi8 RHS, <0,6,1,7>
+ 2309352776U, // <6,u,0,7>: Cost 3 vmrglw <4,5,6,0>, RHS
+ 564585117U, // <6,u,0,u>: Cost 1 vsldoi8 RHS, LHS
+ 2712068835U, // <6,u,1,0>: Cost 3 vsldoi8 RHS, <1,0,1,1>
+ 1638327092U, // <6,u,1,1>: Cost 2 vsldoi8 RHS, <1,1,1,1>
+ 1698715438U, // <6,u,1,2>: Cost 2 vsldoi12 <3,4,5,6>, LHS
+ 2299404444U, // <6,u,1,3>: Cost 3 vmrglw <2,u,6,1>, LHS
+ 2712069163U, // <6,u,1,4>: Cost 3 vsldoi8 RHS, <1,4,1,5>
+ 2712069231U, // <6,u,1,5>: Cost 3 vsldoi8 RHS, <1,5,0,1>
+ 2712069327U, // <6,u,1,6>: Cost 3 vsldoi8 RHS, <1,6,1,7>
+ 2299407688U, // <6,u,1,7>: Cost 3 vmrglw <2,u,6,1>, RHS
+ 1698715492U, // <6,u,1,u>: Cost 2 vsldoi12 <3,4,5,6>, LHS
+ 2712069565U, // <6,u,2,0>: Cost 3 vsldoi8 RHS, <2,0,1,2>
+ 1178556206U, // <6,u,2,1>: Cost 2 vmrghw <6,2,7,3>, LHS
+ 1638327912U, // <6,u,2,2>: Cost 2 vsldoi8 RHS, <2,2,2,2>
+ 1638327974U, // <6,u,2,3>: Cost 2 vsldoi8 RHS, <2,3,0,1>
+ 2712069901U, // <6,u,2,4>: Cost 3 vsldoi8 RHS, <2,4,2,5>
+ 1178556570U, // <6,u,2,5>: Cost 2 vmrghw <6,2,7,3>, RHS
+ 1638328250U, // <6,u,2,6>: Cost 2 vsldoi8 RHS, <2,6,3,7>
+ 2252298496U, // <6,u,2,7>: Cost 3 vmrghw <6,2,7,3>, <u,7,0,1>
+ 1638328379U, // <6,u,2,u>: Cost 2 vsldoi8 RHS, <2,u,0,1>
+ 1638328470U, // <6,u,3,0>: Cost 2 vsldoi8 RHS, <3,0,1,2>
+ 2712070374U, // <6,u,3,1>: Cost 3 vsldoi8 RHS, <3,1,1,1>
+ 2704107883U, // <6,u,3,2>: Cost 3 vsldoi8 <3,2,6,u>, <3,2,6,u>
+ 1638328732U, // <6,u,3,3>: Cost 2 vsldoi8 RHS, <3,3,3,3>
+ 1638328834U, // <6,u,3,4>: Cost 2 vsldoi8 RHS, <3,4,5,6>
+ 2712070738U, // <6,u,3,5>: Cost 3 vsldoi8 RHS, <3,5,5,5>
+ 2712070776U, // <6,u,3,6>: Cost 3 vsldoi8 RHS, <3,6,0,7>
+ 2301414728U, // <6,u,3,7>: Cost 3 vmrglw <3,2,6,3>, RHS
+ 1638329118U, // <6,u,3,u>: Cost 2 vsldoi8 RHS, <3,u,1,2>
+ 1638329234U, // <6,u,4,0>: Cost 2 vsldoi8 RHS, <4,0,5,1>
+ 2712071114U, // <6,u,4,1>: Cost 3 vsldoi8 RHS, <4,1,2,3>
+ 2712071221U, // <6,u,4,2>: Cost 3 vsldoi8 RHS, <4,2,5,2>
+ 2309382300U, // <6,u,4,3>: Cost 3 vmrglw <4,5,6,4>, LHS
+ 1638329552U, // <6,u,4,4>: Cost 2 vsldoi8 RHS, <4,4,4,4>
+ 564587831U, // <6,u,4,5>: Cost 1 vsldoi8 RHS, RHS
+ 2712071545U, // <6,u,4,6>: Cost 3 vsldoi8 RHS, <4,6,5,2>
+ 2309385544U, // <6,u,4,7>: Cost 3 vmrglw <4,5,6,4>, RHS
+ 564588073U, // <6,u,4,u>: Cost 1 vsldoi8 RHS, RHS
+ 2712071752U, // <6,u,5,0>: Cost 3 vsldoi8 RHS, <5,0,1,2>
+ 2714062479U, // <6,u,5,1>: Cost 3 vsldoi8 RHS, <5,1,0,1>
+ 2712071934U, // <6,u,5,2>: Cost 3 vsldoi8 RHS, <5,2,3,4>
+ 2299437212U, // <6,u,5,3>: Cost 3 vmrglw <2,u,6,5>, LHS
+ 2712072116U, // <6,u,5,4>: Cost 3 vsldoi8 RHS, <5,4,5,6>
+ 1638330372U, // <6,u,5,5>: Cost 2 vsldoi8 RHS, <5,5,5,5>
+ 1698715802U, // <6,u,5,6>: Cost 2 vsldoi12 <3,4,5,6>, RHS
+ 2299440456U, // <6,u,5,7>: Cost 3 vmrglw <2,u,6,5>, RHS
+ 1698715820U, // <6,u,5,u>: Cost 2 vsldoi12 <3,4,5,6>, RHS
+ 1583808614U, // <6,u,6,0>: Cost 2 vsldoi4 <6,6,6,6>, LHS
+ 1181161262U, // <6,u,6,1>: Cost 2 vmrghw <6,6,6,6>, LHS
+ 1638330874U, // <6,u,6,2>: Cost 2 vsldoi8 RHS, <6,2,7,3>
+ 1248264348U, // <6,u,6,3>: Cost 2 vmrglw <6,6,6,6>, LHS
+ 1583811894U, // <6,u,6,4>: Cost 2 vsldoi4 <6,6,6,6>, RHS
+ 1181161626U, // <6,u,6,5>: Cost 2 vmrghw <6,6,6,6>, RHS
+ 363253046U, // <6,u,6,6>: Cost 1 vspltisw2 RHS
+ 1638331214U, // <6,u,6,7>: Cost 2 vsldoi8 RHS, <6,7,0,1>
+ 363253046U, // <6,u,6,u>: Cost 1 vspltisw2 RHS
+ 1560076390U, // <6,u,7,0>: Cost 2 vsldoi4 <2,6,u,7>, LHS
+ 1235664969U, // <6,u,7,1>: Cost 2 vmrglw RHS, <0,0,u,1>
+ 1560078311U, // <6,u,7,2>: Cost 2 vsldoi4 <2,6,u,7>, <2,6,u,7>
+ 161923228U, // <6,u,7,3>: Cost 1 vmrglw RHS, LHS
+ 1560079670U, // <6,u,7,4>: Cost 2 vsldoi4 <2,6,u,7>, RHS
+ 1235665297U, // <6,u,7,5>: Cost 2 vmrglw RHS, <0,4,u,5>
+ 1235667485U, // <6,u,7,6>: Cost 2 vmrglw RHS, <3,4,u,6>
+ 161926472U, // <6,u,7,7>: Cost 1 vmrglw RHS, RHS
+ 161923233U, // <6,u,7,u>: Cost 1 vmrglw RHS, LHS
+ 1560084582U, // <6,u,u,0>: Cost 2 vsldoi4 <2,6,u,u>, LHS
+ 564590382U, // <6,u,u,1>: Cost 1 vsldoi8 RHS, LHS
+ 1560086504U, // <6,u,u,2>: Cost 2 vsldoi4 <2,6,u,u>, <2,6,u,u>
+ 161931420U, // <6,u,u,3>: Cost 1 vmrglw RHS, LHS
+ 1560087862U, // <6,u,u,4>: Cost 2 vsldoi4 <2,6,u,u>, RHS
+ 564590746U, // <6,u,u,5>: Cost 1 vsldoi8 RHS, RHS
+ 363253046U, // <6,u,u,6>: Cost 1 vspltisw2 RHS
+ 161934664U, // <6,u,u,7>: Cost 1 vmrglw RHS, RHS
+ 161931425U, // <6,u,u,u>: Cost 1 vmrglw RHS, LHS
+ 1705426944U, // <7,0,0,0>: Cost 2 vsldoi12 RHS, <0,0,0,0>
+ 1705426954U, // <7,0,0,1>: Cost 2 vsldoi12 RHS, <0,0,1,1>
+ 3713550266U, // <7,0,0,2>: Cost 4 vsldoi4 <3,7,0,0>, <2,6,3,7>
+ 2316063892U, // <7,0,0,3>: Cost 3 vmrglw <5,6,7,0>, <7,2,0,3>
+ 2779168805U, // <7,0,0,4>: Cost 3 vsldoi12 RHS, <0,0,4,1>
+ 2663698530U, // <7,0,0,5>: Cost 3 vsldoi4 <7,7,0,0>, <5,6,7,0>
+ 2657727309U, // <7,0,0,6>: Cost 3 vsldoi4 <6,7,0,0>, <6,7,0,0>
+ 2316064220U, // <7,0,0,7>: Cost 3 vmrglw <5,6,7,0>, <7,6,0,7>
+ 1705427017U, // <7,0,0,u>: Cost 2 vsldoi12 RHS, <0,0,u,1>
+ 1583988838U, // <7,0,1,0>: Cost 2 vsldoi4 <6,7,0,1>, LHS
+ 2779168859U, // <7,0,1,1>: Cost 3 vsldoi12 RHS, <0,1,1,1>
+ 631685222U, // <7,0,1,2>: Cost 1 vsldoi12 RHS, LHS
+ 2639817411U, // <7,0,1,3>: Cost 3 vsldoi4 <3,7,0,1>, <3,7,0,1>
+ 1583992118U, // <7,0,1,4>: Cost 2 vsldoi4 <6,7,0,1>, RHS
+ 2657734660U, // <7,0,1,5>: Cost 3 vsldoi4 <6,7,0,1>, <5,5,5,5>
+ 1583993678U, // <7,0,1,6>: Cost 2 vsldoi4 <6,7,0,1>, <6,7,0,1>
+ 2657735672U, // <7,0,1,7>: Cost 3 vsldoi4 <6,7,0,1>, <7,0,1,0>
+ 631685276U, // <7,0,1,u>: Cost 1 vsldoi12 RHS, LHS
+ 2779168933U, // <7,0,2,0>: Cost 3 vsldoi12 RHS, <0,2,0,3>
+ 2767667377U, // <7,0,2,1>: Cost 3 vsldoi12 <2,6,3,7>, <0,2,1,6>
+ 2718713448U, // <7,0,2,2>: Cost 3 vsldoi8 <5,6,7,0>, <2,2,2,2>
+ 2718713510U, // <7,0,2,3>: Cost 3 vsldoi8 <5,6,7,0>, <2,3,0,1>
+ 3841409228U, // <7,0,2,4>: Cost 4 vsldoi12 <2,6,3,7>, <0,2,4,6>
+ 3852910802U, // <7,0,2,5>: Cost 4 vsldoi12 RHS, <0,2,5,3>
+ 2718713786U, // <7,0,2,6>: Cost 3 vsldoi8 <5,6,7,0>, <2,6,3,7>
+ 3847160036U, // <7,0,2,7>: Cost 4 vsldoi12 <3,6,0,7>, <0,2,7,3>
+ 2767667440U, // <7,0,2,u>: Cost 3 vsldoi12 <2,6,3,7>, <0,2,u,6>
+ 2718714006U, // <7,0,3,0>: Cost 3 vsldoi8 <5,6,7,0>, <3,0,1,2>
+ 2779169020U, // <7,0,3,1>: Cost 3 vsldoi12 RHS, <0,3,1,0>
+ 3852910853U, // <7,0,3,2>: Cost 4 vsldoi12 RHS, <0,3,2,0>
+ 2718714268U, // <7,0,3,3>: Cost 3 vsldoi8 <5,6,7,0>, <3,3,3,3>
+ 2718714370U, // <7,0,3,4>: Cost 3 vsldoi8 <5,6,7,0>, <3,4,5,6>
+ 2718714461U, // <7,0,3,5>: Cost 3 vsldoi8 <5,6,7,0>, <3,5,6,7>
+ 2706770608U, // <7,0,3,6>: Cost 3 vsldoi8 <3,6,7,0>, <3,6,7,0>
+ 3847160114U, // <7,0,3,7>: Cost 4 vsldoi12 <3,6,0,7>, <0,3,7,0>
+ 2779169083U, // <7,0,3,u>: Cost 3 vsldoi12 RHS, <0,3,u,0>
+ 2718714770U, // <7,0,4,0>: Cost 3 vsldoi8 <5,6,7,0>, <4,0,5,1>
+ 1705427282U, // <7,0,4,1>: Cost 2 vsldoi12 RHS, <0,4,1,5>
+ 3713583034U, // <7,0,4,2>: Cost 4 vsldoi4 <3,7,0,4>, <2,6,3,7>
+ 3713583814U, // <7,0,4,3>: Cost 4 vsldoi4 <3,7,0,4>, <3,7,0,4>
+ 2779169133U, // <7,0,4,4>: Cost 3 vsldoi12 RHS, <0,4,4,5>
+ 1644973366U, // <7,0,4,5>: Cost 2 vsldoi8 <5,6,7,0>, RHS
+ 2657760081U, // <7,0,4,6>: Cost 3 vsldoi4 <6,7,0,4>, <6,7,0,4>
+ 2259468868U, // <7,0,4,7>: Cost 3 vmrghw <7,4,5,6>, <0,7,1,4>
+ 1705427345U, // <7,0,4,u>: Cost 2 vsldoi12 RHS, <0,4,u,5>
+ 2718715508U, // <7,0,5,0>: Cost 3 vsldoi8 <5,6,7,0>, <5,0,6,1>
+ 2260123750U, // <7,0,5,1>: Cost 3 vmrghw <7,5,5,5>, LHS
+ 3792457451U, // <7,0,5,2>: Cost 4 vsldoi8 <5,6,7,0>, <5,2,1,3>
+ 3852911024U, // <7,0,5,3>: Cost 4 vsldoi12 RHS, <0,5,3,0>
+ 2718715836U, // <7,0,5,4>: Cost 3 vsldoi8 <5,6,7,0>, <5,4,6,5>
+ 2718715908U, // <7,0,5,5>: Cost 3 vsldoi8 <5,6,7,0>, <5,5,5,5>
+ 1644974178U, // <7,0,5,6>: Cost 2 vsldoi8 <5,6,7,0>, <5,6,7,0>
+ 3792457853U, // <7,0,5,7>: Cost 4 vsldoi8 <5,6,7,0>, <5,7,1,0>
+ 1646301444U, // <7,0,5,u>: Cost 2 vsldoi8 <5,u,7,0>, <5,u,7,0>
+ 2720706901U, // <7,0,6,0>: Cost 3 vsldoi8 <6,0,7,0>, <6,0,7,0>
+ 2779169270U, // <7,0,6,1>: Cost 3 vsldoi12 RHS, <0,6,1,7>
+ 2718716410U, // <7,0,6,2>: Cost 3 vsldoi8 <5,6,7,0>, <6,2,7,3>
+ 2722697800U, // <7,0,6,3>: Cost 3 vsldoi8 <6,3,7,0>, <6,3,7,0>
+ 3852911121U, // <7,0,6,4>: Cost 4 vsldoi12 RHS, <0,6,4,7>
+ 3852911130U, // <7,0,6,5>: Cost 4 vsldoi12 RHS, <0,6,5,7>
+ 2718716728U, // <7,0,6,6>: Cost 3 vsldoi8 <5,6,7,0>, <6,6,6,6>
+ 2718716750U, // <7,0,6,7>: Cost 3 vsldoi8 <5,6,7,0>, <6,7,0,1>
+ 2779169333U, // <7,0,6,u>: Cost 3 vsldoi12 RHS, <0,6,u,7>
+ 2718716922U, // <7,0,7,0>: Cost 3 vsldoi8 <5,6,7,0>, <7,0,1,2>
+ 1187872870U, // <7,0,7,1>: Cost 2 vmrghw <7,7,7,7>, LHS
+ 2718717076U, // <7,0,7,2>: Cost 3 vsldoi8 <5,6,7,0>, <7,2,0,3>
+ 3847160408U, // <7,0,7,3>: Cost 4 vsldoi12 <3,6,0,7>, <0,7,3,6>
+ 2718717286U, // <7,0,7,4>: Cost 3 vsldoi8 <5,6,7,0>, <7,4,5,6>
+ 2718717377U, // <7,0,7,5>: Cost 3 vsldoi8 <5,6,7,0>, <7,5,6,7>
+ 2718717404U, // <7,0,7,6>: Cost 3 vsldoi8 <5,6,7,0>, <7,6,0,7>
+ 2718717478U, // <7,0,7,7>: Cost 3 vsldoi8 <5,6,7,0>, <7,7,0,0>
+ 1187873437U, // <7,0,7,u>: Cost 2 vmrghw <7,7,7,7>, LHS
+ 1584046182U, // <7,0,u,0>: Cost 2 vsldoi4 <6,7,0,u>, LHS
+ 1705427602U, // <7,0,u,1>: Cost 2 vsldoi12 RHS, <0,u,1,1>
+ 631685789U, // <7,0,u,2>: Cost 1 vsldoi12 RHS, LHS
+ 2639874762U, // <7,0,u,3>: Cost 3 vsldoi4 <3,7,0,u>, <3,7,0,u>
+ 1584049462U, // <7,0,u,4>: Cost 2 vsldoi4 <6,7,0,u>, RHS
+ 1644976282U, // <7,0,u,5>: Cost 2 vsldoi8 <5,6,7,0>, RHS
+ 1584051029U, // <7,0,u,6>: Cost 2 vsldoi4 <6,7,0,u>, <6,7,0,u>
+ 2718718208U, // <7,0,u,7>: Cost 3 vsldoi8 <5,6,7,0>, <u,7,0,1>
+ 631685843U, // <7,0,u,u>: Cost 1 vsldoi12 RHS, LHS
+ 2721374218U, // <7,1,0,0>: Cost 3 vsldoi8 <6,1,7,1>, <0,0,1,1>
+ 2779169507U, // <7,1,0,1>: Cost 3 vsldoi12 RHS, <1,0,1,1>
+ 2779169516U, // <7,1,0,2>: Cost 3 vsldoi12 RHS, <1,0,2,1>
+ 3852911348U, // <7,1,0,3>: Cost 4 vsldoi12 RHS, <1,0,3,0>
+ 2669743414U, // <7,1,0,4>: Cost 3 vsldoi4 <u,7,1,0>, RHS
+ 2316058962U, // <7,1,0,5>: Cost 3 vmrglw <5,6,7,0>, <0,4,1,5>
+ 2316059044U, // <7,1,0,6>: Cost 3 vmrglw <5,6,7,0>, <0,5,1,6>
+ 2669745146U, // <7,1,0,7>: Cost 3 vsldoi4 <u,7,1,0>, <7,0,1,2>
+ 2779169570U, // <7,1,0,u>: Cost 3 vsldoi12 RHS, <1,0,u,1>
+ 2779169579U, // <7,1,1,0>: Cost 3 vsldoi12 RHS, <1,1,0,1>
+ 1705427764U, // <7,1,1,1>: Cost 2 vsldoi12 RHS, <1,1,1,1>
+ 2779169598U, // <7,1,1,2>: Cost 3 vsldoi12 RHS, <1,1,2,2>
+ 3713632972U, // <7,1,1,3>: Cost 4 vsldoi4 <3,7,1,1>, <3,7,1,1>
+ 2779169619U, // <7,1,1,4>: Cost 3 vsldoi12 RHS, <1,1,4,5>
+ 2779169628U, // <7,1,1,5>: Cost 3 vsldoi12 RHS, <1,1,5,5>
+ 2657809239U, // <7,1,1,6>: Cost 3 vsldoi4 <6,7,1,1>, <6,7,1,1>
+ 3835290474U, // <7,1,1,7>: Cost 4 vsldoi12 <1,6,1,7>, <1,1,7,1>
+ 1705427764U, // <7,1,1,u>: Cost 2 vsldoi12 RHS, <1,1,1,1>
+ 2779169660U, // <7,1,2,0>: Cost 3 vsldoi12 RHS, <1,2,0,1>
+ 2779169671U, // <7,1,2,1>: Cost 3 vsldoi12 RHS, <1,2,1,3>
+ 2779169680U, // <7,1,2,2>: Cost 3 vsldoi12 RHS, <1,2,2,3>
+ 1705427862U, // <7,1,2,3>: Cost 2 vsldoi12 RHS, <1,2,3,0>
+ 2779169700U, // <7,1,2,4>: Cost 3 vsldoi12 RHS, <1,2,4,5>
+ 2779169707U, // <7,1,2,5>: Cost 3 vsldoi12 RHS, <1,2,5,3>
+ 2657817432U, // <7,1,2,6>: Cost 3 vsldoi4 <6,7,1,2>, <6,7,1,2>
+ 2803057594U, // <7,1,2,7>: Cost 3 vsldoi12 RHS, <1,2,7,0>
+ 1705427907U, // <7,1,2,u>: Cost 2 vsldoi12 RHS, <1,2,u,0>
+ 3776538827U, // <7,1,3,0>: Cost 4 vsldoi8 <3,0,7,1>, <3,0,7,1>
+ 2319400970U, // <7,1,3,1>: Cost 3 vmrglw <6,2,7,3>, <0,0,1,1>
+ 2316085398U, // <7,1,3,2>: Cost 3 vmrglw <5,6,7,3>, <3,0,1,2>
+ 3852911591U, // <7,1,3,3>: Cost 4 vsldoi12 RHS, <1,3,3,0>
+ 3852911600U, // <7,1,3,4>: Cost 4 vsldoi12 RHS, <1,3,4,0>
+ 2319401298U, // <7,1,3,5>: Cost 3 vmrglw <6,2,7,3>, <0,4,1,5>
+ 3833668617U, // <7,1,3,6>: Cost 4 vsldoi12 <1,3,6,7>, <1,3,6,7>
+ 3367265487U, // <7,1,3,7>: Cost 4 vmrglw <1,u,7,3>, <1,6,1,7>
+ 2319400977U, // <7,1,3,u>: Cost 3 vmrglw <6,2,7,3>, <0,0,1,u>
+ 2724031378U, // <7,1,4,0>: Cost 3 vsldoi8 <6,5,7,1>, <4,0,5,1>
+ 2779169835U, // <7,1,4,1>: Cost 3 vsldoi12 RHS, <1,4,1,5>
+ 2779169844U, // <7,1,4,2>: Cost 3 vsldoi12 RHS, <1,4,2,5>
+ 3852911672U, // <7,1,4,3>: Cost 4 vsldoi12 RHS, <1,4,3,0>
+ 2669776182U, // <7,1,4,4>: Cost 3 vsldoi4 <u,7,1,4>, RHS
+ 2779169872U, // <7,1,4,5>: Cost 3 vsldoi12 RHS, <1,4,5,6>
+ 3835290712U, // <7,1,4,6>: Cost 4 vsldoi12 <1,6,1,7>, <1,4,6,5>
+ 2669778278U, // <7,1,4,7>: Cost 3 vsldoi4 <u,7,1,4>, <7,4,5,6>
+ 2779169898U, // <7,1,4,u>: Cost 3 vsldoi12 RHS, <1,4,u,5>
+ 2779169903U, // <7,1,5,0>: Cost 3 vsldoi12 RHS, <1,5,0,1>
+ 3835585661U, // <7,1,5,1>: Cost 4 vsldoi12 <1,6,5,7>, <1,5,1,6>
+ 3841410182U, // <7,1,5,2>: Cost 4 vsldoi12 <2,6,3,7>, <1,5,2,6>
+ 3852911753U, // <7,1,5,3>: Cost 4 vsldoi12 RHS, <1,5,3,0>
+ 2779169943U, // <7,1,5,4>: Cost 3 vsldoi12 RHS, <1,5,4,5>
+ 2318754130U, // <7,1,5,5>: Cost 3 vmrglw <6,1,7,5>, <0,4,1,5>
+ 2718724195U, // <7,1,5,6>: Cost 3 vsldoi8 <5,6,7,1>, <5,6,7,1>
+ 3859178670U, // <7,1,5,7>: Cost 4 vsldoi12 <5,6,1,7>, <1,5,7,1>
+ 2779169975U, // <7,1,5,u>: Cost 3 vsldoi12 RHS, <1,5,u,1>
+ 2720715094U, // <7,1,6,0>: Cost 3 vsldoi8 <6,0,7,1>, <6,0,7,1>
+ 2761549007U, // <7,1,6,1>: Cost 3 vsldoi12 <1,6,1,7>, <1,6,1,7>
+ 2779170008U, // <7,1,6,2>: Cost 3 vsldoi12 RHS, <1,6,2,7>
+ 3835438305U, // <7,1,6,3>: Cost 4 vsldoi12 <1,6,3,7>, <1,6,3,7>
+ 3835512042U, // <7,1,6,4>: Cost 4 vsldoi12 <1,6,4,7>, <1,6,4,7>
+ 2761843955U, // <7,1,6,5>: Cost 3 vsldoi12 <1,6,5,7>, <1,6,5,7>
+ 3835659516U, // <7,1,6,6>: Cost 4 vsldoi12 <1,6,6,7>, <1,6,6,7>
+ 2803057918U, // <7,1,6,7>: Cost 3 vsldoi12 RHS, <1,6,7,0>
+ 2762065166U, // <7,1,6,u>: Cost 3 vsldoi12 <1,6,u,7>, <1,6,u,7>
+ 2669797478U, // <7,1,7,0>: Cost 3 vsldoi4 <u,7,1,7>, LHS
+ 2322087946U, // <7,1,7,1>: Cost 3 vmrglw <6,6,7,7>, <0,0,1,1>
+ 2317448186U, // <7,1,7,2>: Cost 3 vmrglw <5,u,7,7>, <7,0,1,2>
+ 3395829934U, // <7,1,7,3>: Cost 4 vmrglw <6,6,7,7>, <0,2,1,3>
+ 2669800758U, // <7,1,7,4>: Cost 3 vsldoi4 <u,7,1,7>, RHS
+ 2322088274U, // <7,1,7,5>: Cost 3 vmrglw <6,6,7,7>, <0,4,1,5>
+ 3375923377U, // <7,1,7,6>: Cost 4 vmrglw <3,3,7,7>, <0,2,1,6>
+ 2731996780U, // <7,1,7,7>: Cost 3 vsldoi8 <7,u,7,1>, <7,7,7,7>
+ 2322087953U, // <7,1,7,u>: Cost 3 vmrglw <6,6,7,7>, <0,0,1,u>
+ 2779170146U, // <7,1,u,0>: Cost 3 vsldoi12 RHS, <1,u,0,1>
+ 1705427764U, // <7,1,u,1>: Cost 2 vsldoi12 RHS, <1,1,1,1>
+ 2779170164U, // <7,1,u,2>: Cost 3 vsldoi12 RHS, <1,u,2,1>
+ 1705428348U, // <7,1,u,3>: Cost 2 vsldoi12 RHS, <1,u,3,0>
+ 2779170186U, // <7,1,u,4>: Cost 3 vsldoi12 RHS, <1,u,4,5>
+ 2763171221U, // <7,1,u,5>: Cost 3 vsldoi12 <1,u,5,7>, <1,u,5,7>
+ 2657866590U, // <7,1,u,6>: Cost 3 vsldoi4 <6,7,1,u>, <6,7,1,u>
+ 2803058080U, // <7,1,u,7>: Cost 3 vsldoi12 RHS, <1,u,7,0>
+ 1705428393U, // <7,1,u,u>: Cost 2 vsldoi12 RHS, <1,u,u,0>
+ 3713695846U, // <7,2,0,0>: Cost 4 vsldoi4 <3,7,2,0>, LHS
+ 2779170237U, // <7,2,0,1>: Cost 3 vsldoi12 RHS, <2,0,1,2>
+ 2779170245U, // <7,2,0,2>: Cost 3 vsldoi12 RHS, <2,0,2,1>
+ 1242316902U, // <7,2,0,3>: Cost 2 vmrglw <5,6,7,0>, LHS
+ 3713699126U, // <7,2,0,4>: Cost 4 vsldoi4 <3,7,2,0>, RHS
+ 3852912096U, // <7,2,0,5>: Cost 4 vsldoi12 RHS, <2,0,5,1>
+ 2767668713U, // <7,2,0,6>: Cost 3 vsldoi12 <2,6,3,7>, <2,0,6,1>
+ 2256488426U, // <7,2,0,7>: Cost 3 vmrghw <7,0,1,2>, <2,7,0,1>
+ 1242316907U, // <7,2,0,u>: Cost 2 vmrglw <5,6,7,0>, LHS
+ 3852912132U, // <7,2,1,0>: Cost 4 vsldoi12 RHS, <2,1,0,1>
+ 3852912141U, // <7,2,1,1>: Cost 4 vsldoi12 RHS, <2,1,1,1>
+ 3852912149U, // <7,2,1,2>: Cost 4 vsldoi12 RHS, <2,1,2,0>
+ 2779170335U, // <7,2,1,3>: Cost 3 vsldoi12 RHS, <2,1,3,1>
+ 3852912172U, // <7,2,1,4>: Cost 4 vsldoi12 RHS, <2,1,4,5>
+ 3840747062U, // <7,2,1,5>: Cost 5 vsldoi12 <2,5,3,7>, <2,1,5,6>
+ 3841410617U, // <7,2,1,6>: Cost 4 vsldoi12 <2,6,3,7>, <2,1,6,0>
+ 3795125538U, // <7,2,1,7>: Cost 4 vsldoi8 <6,1,7,2>, <1,7,2,0>
+ 2779170380U, // <7,2,1,u>: Cost 3 vsldoi12 RHS, <2,1,u,1>
+ 2779170389U, // <7,2,2,0>: Cost 3 vsldoi12 RHS, <2,2,0,1>
+ 3852912222U, // <7,2,2,1>: Cost 4 vsldoi12 RHS, <2,2,1,1>
+ 1705428584U, // <7,2,2,2>: Cost 2 vsldoi12 RHS, <2,2,2,2>
+ 1705428594U, // <7,2,2,3>: Cost 2 vsldoi12 RHS, <2,2,3,3>
+ 2779170429U, // <7,2,2,4>: Cost 3 vsldoi12 RHS, <2,2,4,5>
+ 3852912259U, // <7,2,2,5>: Cost 4 vsldoi12 RHS, <2,2,5,2>
+ 2767668880U, // <7,2,2,6>: Cost 3 vsldoi12 <2,6,3,7>, <2,2,6,6>
+ 3841336981U, // <7,2,2,7>: Cost 4 vsldoi12 <2,6,2,7>, <2,2,7,2>
+ 1705428639U, // <7,2,2,u>: Cost 2 vsldoi12 RHS, <2,2,u,3>
+ 1705428646U, // <7,2,3,0>: Cost 2 vsldoi12 RHS, <2,3,0,1>
+ 2779170479U, // <7,2,3,1>: Cost 3 vsldoi12 RHS, <2,3,1,1>
+ 2767668925U, // <7,2,3,2>: Cost 3 vsldoi12 <2,6,3,7>, <2,3,2,6>
+ 1245659238U, // <7,2,3,3>: Cost 2 vmrglw <6,2,7,3>, LHS
+ 1705428686U, // <7,2,3,4>: Cost 2 vsldoi12 RHS, <2,3,4,5>
+ 2779170519U, // <7,2,3,5>: Cost 3 vsldoi12 RHS, <2,3,5,5>
+ 2657899362U, // <7,2,3,6>: Cost 3 vsldoi4 <6,7,2,3>, <6,7,2,3>
+ 2319406574U, // <7,2,3,7>: Cost 3 vmrglw <6,2,7,3>, <7,6,2,7>
+ 1705428718U, // <7,2,3,u>: Cost 2 vsldoi12 RHS, <2,3,u,1>
+ 3713728614U, // <7,2,4,0>: Cost 4 vsldoi4 <3,7,2,4>, LHS
+ 3852912388U, // <7,2,4,1>: Cost 4 vsldoi12 RHS, <2,4,1,5>
+ 2779170573U, // <7,2,4,2>: Cost 3 vsldoi12 RHS, <2,4,2,5>
+ 1242349670U, // <7,2,4,3>: Cost 2 vmrglw <5,6,7,4>, LHS
+ 3713731894U, // <7,2,4,4>: Cost 4 vsldoi4 <3,7,2,4>, RHS
+ 2779170601U, // <7,2,4,5>: Cost 3 vsldoi12 RHS, <2,4,5,6>
+ 2767669041U, // <7,2,4,6>: Cost 3 vsldoi12 <2,6,3,7>, <2,4,6,5>
+ 3389834456U, // <7,2,4,7>: Cost 4 vmrglw <5,6,7,4>, <1,6,2,7>
+ 1242349675U, // <7,2,4,u>: Cost 2 vmrglw <5,6,7,4>, LHS
+ 3852912456U, // <7,2,5,0>: Cost 4 vsldoi12 RHS, <2,5,0,1>
+ 3852912466U, // <7,2,5,1>: Cost 4 vsldoi12 RHS, <2,5,1,2>
+ 3852912475U, // <7,2,5,2>: Cost 4 vsldoi12 RHS, <2,5,2,2>
+ 2779170664U, // <7,2,5,3>: Cost 3 vsldoi12 RHS, <2,5,3,6>
+ 3852912496U, // <7,2,5,4>: Cost 4 vsldoi12 RHS, <2,5,4,5>
+ 3792474116U, // <7,2,5,5>: Cost 4 vsldoi8 <5,6,7,2>, <5,5,5,5>
+ 2718732388U, // <7,2,5,6>: Cost 3 vsldoi8 <5,6,7,2>, <5,6,7,2>
+ 3841337228U, // <7,2,5,7>: Cost 5 vsldoi12 <2,6,2,7>, <2,5,7,6>
+ 2779170709U, // <7,2,5,u>: Cost 3 vsldoi12 RHS, <2,5,u,6>
+ 2640003174U, // <7,2,6,0>: Cost 3 vsldoi4 <3,7,2,6>, LHS
+ 2721386920U, // <7,2,6,1>: Cost 3 vsldoi8 <6,1,7,2>, <6,1,7,2>
+ 2767595441U, // <7,2,6,2>: Cost 3 vsldoi12 <2,6,2,7>, <2,6,2,7>
+ 1693927354U, // <7,2,6,3>: Cost 2 vsldoi12 <2,6,3,7>, <2,6,3,7>
+ 2640006454U, // <7,2,6,4>: Cost 3 vsldoi4 <3,7,2,6>, RHS
+ 3841558476U, // <7,2,6,5>: Cost 4 vsldoi12 <2,6,5,7>, <2,6,5,7>
+ 2657923941U, // <7,2,6,6>: Cost 3 vsldoi4 <6,7,2,6>, <6,7,2,6>
+ 3841337310U, // <7,2,6,7>: Cost 4 vsldoi12 <2,6,2,7>, <2,6,7,7>
+ 1694296039U, // <7,2,6,u>: Cost 2 vsldoi12 <2,6,u,7>, <2,6,u,7>
+ 2803058666U, // <7,2,7,0>: Cost 3 vsldoi12 RHS, <2,7,0,1>
+ 3852912632U, // <7,2,7,1>: Cost 4 vsldoi12 RHS, <2,7,1,6>
+ 2322089576U, // <7,2,7,2>: Cost 3 vmrglw <6,6,7,7>, <2,2,2,2>
+ 1248346214U, // <7,2,7,3>: Cost 2 vmrglw <6,6,7,7>, LHS
+ 3841337362U, // <7,2,7,4>: Cost 4 vsldoi12 <2,6,2,7>, <2,7,4,5>
+ 3395830836U, // <7,2,7,5>: Cost 4 vmrglw <6,6,7,7>, <1,4,2,5>
+ 2261616570U, // <7,2,7,6>: Cost 3 vmrghw <7,7,7,7>, <2,6,3,7>
+ 3371943857U, // <7,2,7,7>: Cost 4 vmrglw <2,6,7,7>, <2,6,2,7>
+ 1248346219U, // <7,2,7,u>: Cost 2 vmrglw <6,6,7,7>, LHS
+ 1705429051U, // <7,2,u,0>: Cost 2 vsldoi12 RHS, <2,u,0,1>
+ 2779170884U, // <7,2,u,1>: Cost 3 vsldoi12 RHS, <2,u,1,1>
+ 1705428584U, // <7,2,u,2>: Cost 2 vsldoi12 RHS, <2,2,2,2>
+ 1695254620U, // <7,2,u,3>: Cost 2 vsldoi12 <2,u,3,7>, <2,u,3,7>
+ 1705429091U, // <7,2,u,4>: Cost 2 vsldoi12 RHS, <2,u,4,5>
+ 2779170924U, // <7,2,u,5>: Cost 3 vsldoi12 RHS, <2,u,5,5>
+ 2767669361U, // <7,2,u,6>: Cost 3 vsldoi12 <2,6,3,7>, <2,u,6,1>
+ 2803058809U, // <7,2,u,7>: Cost 3 vsldoi12 RHS, <2,u,7,0>
+ 1695623305U, // <7,2,u,u>: Cost 2 vsldoi12 <2,u,u,7>, <2,u,u,7>
+ 2779170955U, // <7,3,0,0>: Cost 3 vsldoi12 RHS, <3,0,0,0>
+ 1705429142U, // <7,3,0,1>: Cost 2 vsldoi12 RHS, <3,0,1,2>
+ 2634057732U, // <7,3,0,2>: Cost 3 vsldoi4 <2,7,3,0>, <2,7,3,0>
+ 2779170983U, // <7,3,0,3>: Cost 3 vsldoi12 RHS, <3,0,3,1>
+ 2779170992U, // <7,3,0,4>: Cost 3 vsldoi12 RHS, <3,0,4,1>
+ 3852912829U, // <7,3,0,5>: Cost 4 vsldoi12 RHS, <3,0,5,5>
+ 2657948520U, // <7,3,0,6>: Cost 3 vsldoi4 <6,7,3,0>, <6,7,3,0>
+ 2316060602U, // <7,3,0,7>: Cost 3 vmrglw <5,6,7,0>, <2,6,3,7>
+ 1705429205U, // <7,3,0,u>: Cost 2 vsldoi12 RHS, <3,0,u,2>
+ 3852912860U, // <7,3,1,0>: Cost 4 vsldoi12 RHS, <3,1,0,0>
+ 2779171046U, // <7,3,1,1>: Cost 3 vsldoi12 RHS, <3,1,1,1>
+ 2779171057U, // <7,3,1,2>: Cost 3 vsldoi12 RHS, <3,1,2,3>
+ 3852912887U, // <7,3,1,3>: Cost 4 vsldoi12 RHS, <3,1,3,0>
+ 3852912896U, // <7,3,1,4>: Cost 4 vsldoi12 RHS, <3,1,4,0>
+ 3852912905U, // <7,3,1,5>: Cost 4 vsldoi12 RHS, <3,1,5,0>
+ 3835291923U, // <7,3,1,6>: Cost 4 vsldoi12 <1,6,1,7>, <3,1,6,1>
+ 3841411356U, // <7,3,1,7>: Cost 4 vsldoi12 <2,6,3,7>, <3,1,7,1>
+ 2779171111U, // <7,3,1,u>: Cost 3 vsldoi12 RHS, <3,1,u,3>
+ 2779171120U, // <7,3,2,0>: Cost 3 vsldoi12 RHS, <3,2,0,3>
+ 3852912952U, // <7,3,2,1>: Cost 4 vsldoi12 RHS, <3,2,1,2>
+ 2779171137U, // <7,3,2,2>: Cost 3 vsldoi12 RHS, <3,2,2,2>
+ 2779171144U, // <7,3,2,3>: Cost 3 vsldoi12 RHS, <3,2,3,0>
+ 2779171156U, // <7,3,2,4>: Cost 3 vsldoi12 RHS, <3,2,4,3>
+ 3852912989U, // <7,3,2,5>: Cost 4 vsldoi12 RHS, <3,2,5,3>
+ 2767669606U, // <7,3,2,6>: Cost 3 vsldoi12 <2,6,3,7>, <3,2,6,3>
+ 2767669615U, // <7,3,2,7>: Cost 3 vsldoi12 <2,6,3,7>, <3,2,7,3>
+ 2779171189U, // <7,3,2,u>: Cost 3 vsldoi12 RHS, <3,2,u,0>
+ 2779171198U, // <7,3,3,0>: Cost 3 vsldoi12 RHS, <3,3,0,0>
+ 3852913032U, // <7,3,3,1>: Cost 4 vsldoi12 RHS, <3,3,1,1>
+ 2704140655U, // <7,3,3,2>: Cost 3 vsldoi8 <3,2,7,3>, <3,2,7,3>
+ 1705429404U, // <7,3,3,3>: Cost 2 vsldoi12 RHS, <3,3,3,3>
+ 2779171238U, // <7,3,3,4>: Cost 3 vsldoi12 RHS, <3,3,4,4>
+ 3852913070U, // <7,3,3,5>: Cost 4 vsldoi12 RHS, <3,3,5,3>
+ 2657973099U, // <7,3,3,6>: Cost 3 vsldoi4 <6,7,3,3>, <6,7,3,3>
+ 2767669700U, // <7,3,3,7>: Cost 3 vsldoi12 <2,6,3,7>, <3,3,7,7>
+ 1705429404U, // <7,3,3,u>: Cost 2 vsldoi12 RHS, <3,3,3,3>
+ 2779171280U, // <7,3,4,0>: Cost 3 vsldoi12 RHS, <3,4,0,1>
+ 2779171290U, // <7,3,4,1>: Cost 3 vsldoi12 RHS, <3,4,1,2>
+ 2634090504U, // <7,3,4,2>: Cost 3 vsldoi4 <2,7,3,4>, <2,7,3,4>
+ 2779171311U, // <7,3,4,3>: Cost 3 vsldoi12 RHS, <3,4,3,5>
+ 2779171319U, // <7,3,4,4>: Cost 3 vsldoi12 RHS, <3,4,4,4>
+ 1705429506U, // <7,3,4,5>: Cost 2 vsldoi12 RHS, <3,4,5,6>
+ 2722057593U, // <7,3,4,6>: Cost 3 vsldoi8 <6,2,7,3>, <4,6,5,2>
+ 2316093370U, // <7,3,4,7>: Cost 3 vmrglw <5,6,7,4>, <2,6,3,7>
+ 1705429533U, // <7,3,4,u>: Cost 2 vsldoi12 RHS, <3,4,u,6>
+ 3852913185U, // <7,3,5,0>: Cost 4 vsldoi12 RHS, <3,5,0,1>
+ 3795799695U, // <7,3,5,1>: Cost 4 vsldoi8 <6,2,7,3>, <5,1,0,1>
+ 3852913203U, // <7,3,5,2>: Cost 4 vsldoi12 RHS, <3,5,2,1>
+ 3852913214U, // <7,3,5,3>: Cost 4 vsldoi12 RHS, <3,5,3,3>
+ 3852913225U, // <7,3,5,4>: Cost 4 vsldoi12 RHS, <3,5,4,5>
+ 2779171410U, // <7,3,5,5>: Cost 3 vsldoi12 RHS, <3,5,5,5>
+ 2718740581U, // <7,3,5,6>: Cost 3 vsldoi8 <5,6,7,3>, <5,6,7,3>
+ 3841411685U, // <7,3,5,7>: Cost 4 vsldoi12 <2,6,3,7>, <3,5,7,6>
+ 2720067847U, // <7,3,5,u>: Cost 3 vsldoi8 <5,u,7,3>, <5,u,7,3>
+ 2773420664U, // <7,3,6,0>: Cost 3 vsldoi12 <3,6,0,7>, <3,6,0,7>
+ 3847236225U, // <7,3,6,1>: Cost 4 vsldoi12 <3,6,1,7>, <3,6,1,7>
+ 1648316922U, // <7,3,6,2>: Cost 2 vsldoi8 <6,2,7,3>, <6,2,7,3>
+ 2773641875U, // <7,3,6,3>: Cost 3 vsldoi12 <3,6,3,7>, <3,6,3,7>
+ 2773715612U, // <7,3,6,4>: Cost 3 vsldoi12 <3,6,4,7>, <3,6,4,7>
+ 3847531173U, // <7,3,6,5>: Cost 4 vsldoi12 <3,6,5,7>, <3,6,5,7>
+ 2722059024U, // <7,3,6,6>: Cost 3 vsldoi8 <6,2,7,3>, <6,6,2,2>
+ 2767669943U, // <7,3,6,7>: Cost 3 vsldoi12 <2,6,3,7>, <3,6,7,7>
+ 1652298720U, // <7,3,6,u>: Cost 2 vsldoi8 <6,u,7,3>, <6,u,7,3>
+ 2767669955U, // <7,3,7,0>: Cost 3 vsldoi12 <2,6,3,7>, <3,7,0,1>
+ 3841411788U, // <7,3,7,1>: Cost 4 vsldoi12 <2,6,3,7>, <3,7,1,1>
+ 2767669978U, // <7,3,7,2>: Cost 3 vsldoi12 <2,6,3,7>, <3,7,2,6>
+ 2722059546U, // <7,3,7,3>: Cost 3 vsldoi8 <6,2,7,3>, <7,3,6,2>
+ 2767669995U, // <7,3,7,4>: Cost 3 vsldoi12 <2,6,3,7>, <3,7,4,5>
+ 3852913396U, // <7,3,7,5>: Cost 4 vsldoi12 RHS, <3,7,5,5>
+ 2722059758U, // <7,3,7,6>: Cost 3 vsldoi8 <6,2,7,3>, <7,6,2,7>
+ 2302183354U, // <7,3,7,7>: Cost 3 vmrglw <3,3,7,7>, <2,6,3,7>
+ 2767670027U, // <7,3,7,u>: Cost 3 vsldoi12 <2,6,3,7>, <3,7,u,1>
+ 2774747930U, // <7,3,u,0>: Cost 3 vsldoi12 <3,u,0,7>, <3,u,0,7>
+ 1705429790U, // <7,3,u,1>: Cost 2 vsldoi12 RHS, <3,u,1,2>
+ 1660262316U, // <7,3,u,2>: Cost 2 vsldoi8 <u,2,7,3>, <u,2,7,3>
+ 1705429404U, // <7,3,u,3>: Cost 2 vsldoi12 RHS, <3,3,3,3>
+ 2775042878U, // <7,3,u,4>: Cost 3 vsldoi12 <3,u,4,7>, <3,u,4,7>
+ 1705429830U, // <7,3,u,5>: Cost 2 vsldoi12 RHS, <3,u,5,6>
+ 2779171660U, // <7,3,u,6>: Cost 3 vsldoi12 RHS, <3,u,6,3>
+ 2767670101U, // <7,3,u,7>: Cost 3 vsldoi12 <2,6,3,7>, <3,u,7,3>
+ 1705429853U, // <7,3,u,u>: Cost 2 vsldoi12 RHS, <3,u,u,2>
+ 2718744576U, // <7,4,0,0>: Cost 3 vsldoi8 <5,6,7,4>, <0,0,0,0>
+ 1645002854U, // <7,4,0,1>: Cost 2 vsldoi8 <5,6,7,4>, LHS
+ 3852913527U, // <7,4,0,2>: Cost 4 vsldoi12 RHS, <4,0,2,1>
+ 3852913536U, // <7,4,0,3>: Cost 4 vsldoi12 RHS, <4,0,3,1>
+ 2316061904U, // <7,4,0,4>: Cost 3 vmrglw <5,6,7,0>, <4,4,4,4>
+ 1705429906U, // <7,4,0,5>: Cost 2 vsldoi12 RHS, <4,0,5,1>
+ 2658022257U, // <7,4,0,6>: Cost 3 vsldoi4 <6,7,4,0>, <6,7,4,0>
+ 2256489928U, // <7,4,0,7>: Cost 3 vmrghw <7,0,1,2>, <4,7,5,0>
+ 1707420589U, // <7,4,0,u>: Cost 2 vsldoi12 RHS, <4,0,u,1>
+ 3852913590U, // <7,4,1,0>: Cost 4 vsldoi12 RHS, <4,1,0,1>
+ 2718745396U, // <7,4,1,1>: Cost 3 vsldoi8 <5,6,7,4>, <1,1,1,1>
+ 2779171786U, // <7,4,1,2>: Cost 3 vsldoi12 RHS, <4,1,2,3>
+ 3852913616U, // <7,4,1,3>: Cost 4 vsldoi12 RHS, <4,1,3,0>
+ 3852913627U, // <7,4,1,4>: Cost 4 vsldoi12 RHS, <4,1,4,2>
+ 2779171810U, // <7,4,1,5>: Cost 3 vsldoi12 RHS, <4,1,5,0>
+ 3792487631U, // <7,4,1,6>: Cost 4 vsldoi8 <5,6,7,4>, <1,6,1,7>
+ 3394456220U, // <7,4,1,7>: Cost 4 vmrglw <6,4,7,1>, <3,6,4,7>
+ 2779171837U, // <7,4,1,u>: Cost 3 vsldoi12 RHS, <4,1,u,0>
+ 3852913673U, // <7,4,2,0>: Cost 4 vsldoi12 RHS, <4,2,0,3>
+ 3852913682U, // <7,4,2,1>: Cost 4 vsldoi12 RHS, <4,2,1,3>
+ 2718746216U, // <7,4,2,2>: Cost 3 vsldoi8 <5,6,7,4>, <2,2,2,2>
+ 2718746278U, // <7,4,2,3>: Cost 3 vsldoi8 <5,6,7,4>, <2,3,0,1>
+ 2779171885U, // <7,4,2,4>: Cost 3 vsldoi12 RHS, <4,2,4,3>
+ 2779171893U, // <7,4,2,5>: Cost 3 vsldoi12 RHS, <4,2,5,2>
+ 2718746554U, // <7,4,2,6>: Cost 3 vsldoi8 <5,6,7,4>, <2,6,3,7>
+ 3847457864U, // <7,4,2,7>: Cost 4 vsldoi12 <3,6,4,7>, <4,2,7,3>
+ 2779171921U, // <7,4,2,u>: Cost 3 vsldoi12 RHS, <4,2,u,3>
+ 2718746774U, // <7,4,3,0>: Cost 3 vsldoi8 <5,6,7,4>, <3,0,1,2>
+ 3852913762U, // <7,4,3,1>: Cost 4 vsldoi12 RHS, <4,3,1,2>
+ 3852913772U, // <7,4,3,2>: Cost 4 vsldoi12 RHS, <4,3,2,3>
+ 2718747036U, // <7,4,3,3>: Cost 3 vsldoi8 <5,6,7,4>, <3,3,3,3>
+ 2718747138U, // <7,4,3,4>: Cost 3 vsldoi8 <5,6,7,4>, <3,4,5,6>
+ 2779171972U, // <7,4,3,5>: Cost 3 vsldoi12 RHS, <4,3,5,0>
+ 2706803380U, // <7,4,3,6>: Cost 3 vsldoi8 <3,6,7,4>, <3,6,7,4>
+ 3847457946U, // <7,4,3,7>: Cost 4 vsldoi12 <3,6,4,7>, <4,3,7,4>
+ 2781162655U, // <7,4,3,u>: Cost 3 vsldoi12 RHS, <4,3,u,0>
+ 2718747538U, // <7,4,4,0>: Cost 3 vsldoi8 <5,6,7,4>, <4,0,5,1>
+ 3852913842U, // <7,4,4,1>: Cost 4 vsldoi12 RHS, <4,4,1,1>
+ 3852913852U, // <7,4,4,2>: Cost 4 vsldoi12 RHS, <4,4,2,2>
+ 2316096696U, // <7,4,4,3>: Cost 3 vmrglw <5,6,7,4>, <7,2,4,3>
+ 1705430224U, // <7,4,4,4>: Cost 2 vsldoi12 RHS, <4,4,4,4>
+ 1705430234U, // <7,4,4,5>: Cost 2 vsldoi12 RHS, <4,4,5,5>
+ 2658055029U, // <7,4,4,6>: Cost 3 vsldoi4 <6,7,4,4>, <6,7,4,4>
+ 2316097024U, // <7,4,4,7>: Cost 3 vmrglw <5,6,7,4>, <7,6,4,7>
+ 1707420917U, // <7,4,4,u>: Cost 2 vsldoi12 RHS, <4,4,u,5>
+ 1584316518U, // <7,4,5,0>: Cost 2 vsldoi4 <6,7,4,5>, LHS
+ 2658059060U, // <7,4,5,1>: Cost 3 vsldoi4 <6,7,4,5>, <1,1,1,1>
+ 2640144314U, // <7,4,5,2>: Cost 3 vsldoi4 <3,7,4,5>, <2,6,3,7>
+ 2640145131U, // <7,4,5,3>: Cost 3 vsldoi4 <3,7,4,5>, <3,7,4,5>
+ 1584319798U, // <7,4,5,4>: Cost 2 vsldoi4 <6,7,4,5>, RHS
+ 2779172134U, // <7,4,5,5>: Cost 3 vsldoi12 RHS, <4,5,5,0>
+ 631688502U, // <7,4,5,6>: Cost 1 vsldoi12 RHS, RHS
+ 2658063354U, // <7,4,5,7>: Cost 3 vsldoi4 <6,7,4,5>, <7,0,1,2>
+ 631688520U, // <7,4,5,u>: Cost 1 vsldoi12 RHS, RHS
+ 3852914001U, // <7,4,6,0>: Cost 4 vsldoi12 RHS, <4,6,0,7>
+ 3852914010U, // <7,4,6,1>: Cost 4 vsldoi12 RHS, <4,6,1,7>
+ 2718749178U, // <7,4,6,2>: Cost 3 vsldoi8 <5,6,7,4>, <6,2,7,3>
+ 2722730572U, // <7,4,6,3>: Cost 3 vsldoi8 <6,3,7,4>, <6,3,7,4>
+ 2723394205U, // <7,4,6,4>: Cost 3 vsldoi8 <6,4,7,4>, <6,4,7,4>
+ 2779172221U, // <7,4,6,5>: Cost 3 vsldoi12 RHS, <4,6,5,6>
+ 2718749496U, // <7,4,6,6>: Cost 3 vsldoi8 <5,6,7,4>, <6,6,6,6>
+ 2718749518U, // <7,4,6,7>: Cost 3 vsldoi8 <5,6,7,4>, <6,7,0,1>
+ 2779172249U, // <7,4,6,u>: Cost 3 vsldoi12 RHS, <4,6,u,7>
+ 2718749690U, // <7,4,7,0>: Cost 3 vsldoi8 <5,6,7,4>, <7,0,1,2>
+ 3847458214U, // <7,4,7,1>: Cost 4 vsldoi12 <3,6,4,7>, <4,7,1,2>
+ 2718749880U, // <7,4,7,2>: Cost 3 vsldoi8 <5,6,7,4>, <7,2,4,3>
+ 3847458236U, // <7,4,7,3>: Cost 4 vsldoi12 <3,6,4,7>, <4,7,3,6>
+ 2718750004U, // <7,4,7,4>: Cost 3 vsldoi8 <5,6,7,4>, <7,4,0,1>
+ 1187876150U, // <7,4,7,5>: Cost 2 vmrghw <7,7,7,7>, RHS
+ 2718750208U, // <7,4,7,6>: Cost 3 vsldoi8 <5,6,7,4>, <7,6,4,7>
+ 2718750286U, // <7,4,7,7>: Cost 3 vsldoi8 <5,6,7,4>, <7,7,4,4>
+ 1187876393U, // <7,4,7,u>: Cost 2 vmrghw <7,7,7,7>, RHS
+ 1584341094U, // <7,4,u,0>: Cost 2 vsldoi4 <6,7,4,u>, LHS
+ 1645008686U, // <7,4,u,1>: Cost 2 vsldoi8 <5,6,7,4>, LHS
+ 2640168890U, // <7,4,u,2>: Cost 3 vsldoi4 <3,7,4,u>, <2,6,3,7>
+ 2640169710U, // <7,4,u,3>: Cost 3 vsldoi4 <3,7,4,u>, <3,7,4,u>
+ 1584344374U, // <7,4,u,4>: Cost 2 vsldoi4 <6,7,4,u>, RHS
+ 1705430554U, // <7,4,u,5>: Cost 2 vsldoi12 RHS, <4,u,5,1>
+ 631688745U, // <7,4,u,6>: Cost 1 vsldoi12 RHS, RHS
+ 2718750976U, // <7,4,u,7>: Cost 3 vsldoi8 <5,6,7,4>, <u,7,0,1>
+ 631688763U, // <7,4,u,u>: Cost 1 vsldoi12 RHS, RHS
+ 2646147174U, // <7,5,0,0>: Cost 3 vsldoi4 <4,7,5,0>, LHS
+ 2779172424U, // <7,5,0,1>: Cost 3 vsldoi12 RHS, <5,0,1,2>
+ 3852914258U, // <7,5,0,2>: Cost 4 vsldoi12 RHS, <5,0,2,3>
+ 3852914268U, // <7,5,0,3>: Cost 4 vsldoi12 RHS, <5,0,3,4>
+ 2779172450U, // <7,5,0,4>: Cost 3 vsldoi12 RHS, <5,0,4,1>
+ 2316061914U, // <7,5,0,5>: Cost 3 vmrglw <5,6,7,0>, <4,4,5,5>
+ 2316061186U, // <7,5,0,6>: Cost 3 vmrglw <5,6,7,0>, <3,4,5,6>
+ 2646152186U, // <7,5,0,7>: Cost 3 vsldoi4 <4,7,5,0>, <7,0,1,2>
+ 2779172486U, // <7,5,0,u>: Cost 3 vsldoi12 RHS, <5,0,u,1>
+ 2781163151U, // <7,5,1,0>: Cost 3 vsldoi12 RHS, <5,1,0,1>
+ 2321378194U, // <7,5,1,1>: Cost 3 vmrglw <6,5,7,1>, <4,0,5,1>
+ 3852914339U, // <7,5,1,2>: Cost 4 vsldoi12 RHS, <5,1,2,3>
+ 3852914350U, // <7,5,1,3>: Cost 4 vsldoi12 RHS, <5,1,3,5>
+ 2781163191U, // <7,5,1,4>: Cost 3 vsldoi12 RHS, <5,1,4,5>
+ 3852914363U, // <7,5,1,5>: Cost 4 vsldoi12 RHS, <5,1,5,0>
+ 3835588297U, // <7,5,1,6>: Cost 4 vsldoi12 <1,6,5,7>, <5,1,6,5>
+ 3835588306U, // <7,5,1,7>: Cost 4 vsldoi12 <1,6,5,7>, <5,1,7,5>
+ 2781163223U, // <7,5,1,u>: Cost 3 vsldoi12 RHS, <5,1,u,1>
+ 3852914400U, // <7,5,2,0>: Cost 4 vsldoi12 RHS, <5,2,0,1>
+ 2781163243U, // <7,5,2,1>: Cost 3 vsldoi12 RHS, <5,2,1,3>
+ 3852914419U, // <7,5,2,2>: Cost 4 vsldoi12 RHS, <5,2,2,2>
+ 2779172606U, // <7,5,2,3>: Cost 3 vsldoi12 RHS, <5,2,3,4>
+ 3780552497U, // <7,5,2,4>: Cost 4 vsldoi8 <3,6,7,5>, <2,4,6,5>
+ 2781163279U, // <7,5,2,5>: Cost 3 vsldoi12 RHS, <5,2,5,3>
+ 2779172632U, // <7,5,2,6>: Cost 3 vsldoi12 RHS, <5,2,6,3>
+ 3835588385U, // <7,5,2,7>: Cost 4 vsldoi12 <1,6,5,7>, <5,2,7,3>
+ 2779172650U, // <7,5,2,u>: Cost 3 vsldoi12 RHS, <5,2,u,3>
+ 3852914481U, // <7,5,3,0>: Cost 4 vsldoi12 RHS, <5,3,0,1>
+ 2319403922U, // <7,5,3,1>: Cost 3 vmrglw <6,2,7,3>, <4,0,5,1>
+ 2319404409U, // <7,5,3,2>: Cost 3 vmrglw <6,2,7,3>, <4,6,5,2>
+ 3852914510U, // <7,5,3,3>: Cost 4 vsldoi12 RHS, <5,3,3,3>
+ 3779226131U, // <7,5,3,4>: Cost 4 vsldoi8 <3,4,7,5>, <3,4,7,5>
+ 2319404250U, // <7,5,3,5>: Cost 3 vmrglw <6,2,7,3>, <4,4,5,5>
+ 2319403522U, // <7,5,3,6>: Cost 3 vmrglw <6,2,7,3>, <3,4,5,6>
+ 3852914547U, // <7,5,3,7>: Cost 4 vsldoi12 RHS, <5,3,7,4>
+ 2319403524U, // <7,5,3,u>: Cost 3 vmrglw <6,2,7,3>, <3,4,5,u>
+ 2646179942U, // <7,5,4,0>: Cost 3 vsldoi4 <4,7,5,4>, LHS
+ 2316094354U, // <7,5,4,1>: Cost 3 vmrglw <5,6,7,4>, <4,0,5,1>
+ 3852914582U, // <7,5,4,2>: Cost 4 vsldoi12 RHS, <5,4,2,3>
+ 3852914592U, // <7,5,4,3>: Cost 4 vsldoi12 RHS, <5,4,3,4>
+ 2646183372U, // <7,5,4,4>: Cost 3 vsldoi4 <4,7,5,4>, <4,7,5,4>
+ 2779172788U, // <7,5,4,5>: Cost 3 vsldoi12 RHS, <5,4,5,6>
+ 2316093954U, // <7,5,4,6>: Cost 3 vmrglw <5,6,7,4>, <3,4,5,6>
+ 2646185318U, // <7,5,4,7>: Cost 3 vsldoi4 <4,7,5,4>, <7,4,5,6>
+ 2779172815U, // <7,5,4,u>: Cost 3 vsldoi12 RHS, <5,4,u,6>
+ 2781163475U, // <7,5,5,0>: Cost 3 vsldoi12 RHS, <5,5,0,1>
+ 2781163484U, // <7,5,5,1>: Cost 3 vsldoi12 RHS, <5,5,1,1>
+ 3852914662U, // <7,5,5,2>: Cost 4 vsldoi12 RHS, <5,5,2,2>
+ 3852914672U, // <7,5,5,3>: Cost 4 vsldoi12 RHS, <5,5,3,3>
+ 2781163515U, // <7,5,5,4>: Cost 3 vsldoi12 RHS, <5,5,4,5>
+ 1705431044U, // <7,5,5,5>: Cost 2 vsldoi12 RHS, <5,5,5,5>
+ 2779172878U, // <7,5,5,6>: Cost 3 vsldoi12 RHS, <5,5,6,6>
+ 3835588632U, // <7,5,5,7>: Cost 4 vsldoi12 <1,6,5,7>, <5,5,7,7>
+ 1705431044U, // <7,5,5,u>: Cost 2 vsldoi12 RHS, <5,5,5,5>
+ 2779172900U, // <7,5,6,0>: Cost 3 vsldoi12 RHS, <5,6,0,1>
+ 2781163571U, // <7,5,6,1>: Cost 3 vsldoi12 RHS, <5,6,1,7>
+ 3852914743U, // <7,5,6,2>: Cost 4 vsldoi12 RHS, <5,6,2,2>
+ 2779172930U, // <7,5,6,3>: Cost 3 vsldoi12 RHS, <5,6,3,4>
+ 2779172940U, // <7,5,6,4>: Cost 3 vsldoi12 RHS, <5,6,4,5>
+ 2781163607U, // <7,5,6,5>: Cost 3 vsldoi12 RHS, <5,6,5,7>
+ 2779172960U, // <7,5,6,6>: Cost 3 vsldoi12 RHS, <5,6,6,7>
+ 1705431138U, // <7,5,6,7>: Cost 2 vsldoi12 RHS, <5,6,7,0>
+ 1705578603U, // <7,5,6,u>: Cost 2 vsldoi12 RHS, <5,6,u,0>
+ 2646204518U, // <7,5,7,0>: Cost 3 vsldoi4 <4,7,5,7>, LHS
+ 2322090898U, // <7,5,7,1>: Cost 3 vmrglw <6,6,7,7>, <4,0,5,1>
+ 3719947880U, // <7,5,7,2>: Cost 4 vsldoi4 <4,7,5,7>, <2,2,2,2>
+ 3719948438U, // <7,5,7,3>: Cost 4 vsldoi4 <4,7,5,7>, <3,0,1,2>
+ 2646207951U, // <7,5,7,4>: Cost 3 vsldoi4 <4,7,5,7>, <4,7,5,7>
+ 2322091226U, // <7,5,7,5>: Cost 3 vmrglw <6,6,7,7>, <4,4,5,5>
+ 2322090498U, // <7,5,7,6>: Cost 3 vmrglw <6,6,7,7>, <3,4,5,6>
+ 2646210156U, // <7,5,7,7>: Cost 3 vsldoi4 <4,7,5,7>, <7,7,7,7>
+ 2646210350U, // <7,5,7,u>: Cost 3 vsldoi4 <4,7,5,7>, LHS
+ 2779173062U, // <7,5,u,0>: Cost 3 vsldoi12 RHS, <5,u,0,1>
+ 2779173072U, // <7,5,u,1>: Cost 3 vsldoi12 RHS, <5,u,1,2>
+ 2319404409U, // <7,5,u,2>: Cost 3 vmrglw <6,2,7,3>, <4,6,5,2>
+ 2779173092U, // <7,5,u,3>: Cost 3 vsldoi12 RHS, <5,u,3,4>
+ 2779173101U, // <7,5,u,4>: Cost 3 vsldoi12 RHS, <5,u,4,4>
+ 1705431044U, // <7,5,u,5>: Cost 2 vsldoi12 RHS, <5,5,5,5>
+ 2779173118U, // <7,5,u,6>: Cost 3 vsldoi12 RHS, <5,u,6,3>
+ 1705578756U, // <7,5,u,7>: Cost 2 vsldoi12 RHS, <5,u,7,0>
+ 1707421965U, // <7,5,u,u>: Cost 2 vsldoi12 RHS, <5,u,u,0>
+ 3852914966U, // <7,6,0,0>: Cost 4 vsldoi12 RHS, <6,0,0,0>
+ 2779173153U, // <7,6,0,1>: Cost 3 vsldoi12 RHS, <6,0,1,2>
+ 2256491002U, // <7,6,0,2>: Cost 3 vmrghw <7,0,1,2>, <6,2,7,3>
+ 3852914994U, // <7,6,0,3>: Cost 4 vsldoi12 RHS, <6,0,3,1>
+ 3852915003U, // <7,6,0,4>: Cost 4 vsldoi12 RHS, <6,0,4,1>
+ 2316062652U, // <7,6,0,5>: Cost 3 vmrglw <5,6,7,0>, <5,4,6,5>
+ 2316063544U, // <7,6,0,6>: Cost 3 vmrglw <5,6,7,0>, <6,6,6,6>
+ 1242320182U, // <7,6,0,7>: Cost 2 vmrglw <5,6,7,0>, RHS
+ 1242320183U, // <7,6,0,u>: Cost 2 vmrglw <5,6,7,0>, RHS
+ 3852915048U, // <7,6,1,0>: Cost 4 vsldoi12 RHS, <6,1,0,1>
+ 3377866217U, // <7,6,1,1>: Cost 4 vmrglw <3,6,7,1>, <2,0,6,1>
+ 3852915068U, // <7,6,1,2>: Cost 4 vsldoi12 RHS, <6,1,2,3>
+ 3833672072U, // <7,6,1,3>: Cost 5 vsldoi12 <1,3,6,7>, <6,1,3,6>
+ 3852915088U, // <7,6,1,4>: Cost 4 vsldoi12 RHS, <6,1,4,5>
+ 3395122056U, // <7,6,1,5>: Cost 4 vmrglw <6,5,7,1>, <6,7,6,5>
+ 3389813560U, // <7,6,1,6>: Cost 4 vmrglw <5,6,7,1>, <6,6,6,6>
+ 2779173287U, // <7,6,1,7>: Cost 3 vsldoi12 RHS, <6,1,7,1>
+ 2779320752U, // <7,6,1,u>: Cost 3 vsldoi12 RHS, <6,1,u,1>
+ 2658181222U, // <7,6,2,0>: Cost 3 vsldoi4 <6,7,6,2>, LHS
+ 3852915140U, // <7,6,2,1>: Cost 4 vsldoi12 RHS, <6,2,1,3>
+ 2257973754U, // <7,6,2,2>: Cost 3 vmrghw <7,2,3,3>, <6,2,7,3>
+ 3841413589U, // <7,6,2,3>: Cost 4 vsldoi12 <2,6,3,7>, <6,2,3,2>
+ 2658184502U, // <7,6,2,4>: Cost 3 vsldoi4 <6,7,6,2>, RHS
+ 3852915176U, // <7,6,2,5>: Cost 4 vsldoi12 RHS, <6,2,5,3>
+ 2658186117U, // <7,6,2,6>: Cost 3 vsldoi4 <6,7,6,2>, <6,7,6,2>
+ 1705431546U, // <7,6,2,7>: Cost 2 vsldoi12 RHS, <6,2,7,3>
+ 1705579011U, // <7,6,2,u>: Cost 2 vsldoi12 RHS, <6,2,u,3>
+ 3714015334U, // <7,6,3,0>: Cost 4 vsldoi4 <3,7,6,3>, LHS
+ 3777243425U, // <7,6,3,1>: Cost 4 vsldoi8 <3,1,7,6>, <3,1,7,6>
+ 2319405957U, // <7,6,3,2>: Cost 3 vmrglw <6,2,7,3>, <6,7,6,2>
+ 3375229286U, // <7,6,3,3>: Cost 4 vmrglw <3,2,7,3>, <3,2,6,3>
+ 2779173426U, // <7,6,3,4>: Cost 3 vsldoi12 RHS, <6,3,4,5>
+ 3375228721U, // <7,6,3,5>: Cost 4 vmrglw <3,2,7,3>, <2,4,6,5>
+ 2319405880U, // <7,6,3,6>: Cost 3 vmrglw <6,2,7,3>, <6,6,6,6>
+ 1245662518U, // <7,6,3,7>: Cost 2 vmrglw <6,2,7,3>, RHS
+ 1245662519U, // <7,6,3,u>: Cost 2 vmrglw <6,2,7,3>, RHS
+ 3852915291U, // <7,6,4,0>: Cost 4 vsldoi12 RHS, <6,4,0,1>
+ 3389834729U, // <7,6,4,1>: Cost 4 vmrglw <5,6,7,4>, <2,0,6,1>
+ 2259472890U, // <7,6,4,2>: Cost 3 vmrghw <7,4,5,6>, <6,2,7,3>
+ 3852915321U, // <7,6,4,3>: Cost 4 vsldoi12 RHS, <6,4,3,4>
+ 3852915330U, // <7,6,4,4>: Cost 4 vsldoi12 RHS, <6,4,4,4>
+ 2779173517U, // <7,6,4,5>: Cost 3 vsldoi12 RHS, <6,4,5,6>
+ 2316096312U, // <7,6,4,6>: Cost 3 vmrglw <5,6,7,4>, <6,6,6,6>
+ 1242352950U, // <7,6,4,7>: Cost 2 vmrglw <5,6,7,4>, RHS
+ 1242352951U, // <7,6,4,u>: Cost 2 vmrglw <5,6,7,4>, RHS
+ 3852915372U, // <7,6,5,0>: Cost 4 vsldoi12 RHS, <6,5,0,1>
+ 3835294392U, // <7,6,5,1>: Cost 5 vsldoi12 <1,6,1,7>, <6,5,1,4>
+ 3852915395U, // <7,6,5,2>: Cost 4 vsldoi12 RHS, <6,5,2,6>
+ 3852915404U, // <7,6,5,3>: Cost 4 vsldoi12 RHS, <6,5,3,6>
+ 3852915412U, // <7,6,5,4>: Cost 4 vsldoi12 RHS, <6,5,4,5>
+ 3377899313U, // <7,6,5,5>: Cost 4 vmrglw <3,6,7,5>, <2,4,6,5>
+ 2718765160U, // <7,6,5,6>: Cost 3 vsldoi8 <5,6,7,6>, <5,6,7,6>
+ 2779173611U, // <7,6,5,7>: Cost 3 vsldoi12 RHS, <6,5,7,1>
+ 2779321076U, // <7,6,5,u>: Cost 3 vsldoi12 RHS, <6,5,u,1>
+ 2658213990U, // <7,6,6,0>: Cost 3 vsldoi4 <6,7,6,6>, LHS
+ 3852915462U, // <7,6,6,1>: Cost 4 vsldoi12 RHS, <6,6,1,1>
+ 2718765562U, // <7,6,6,2>: Cost 3 vsldoi8 <5,6,7,6>, <6,2,7,3>
+ 3714042622U, // <7,6,6,3>: Cost 4 vsldoi4 <3,7,6,6>, <3,7,6,6>
+ 2658217270U, // <7,6,6,4>: Cost 3 vsldoi4 <6,7,6,6>, RHS
+ 2724074224U, // <7,6,6,5>: Cost 3 vsldoi8 <6,5,7,6>, <6,5,7,6>
+ 1705431864U, // <7,6,6,6>: Cost 2 vsldoi12 RHS, <6,6,6,6>
+ 1705431874U, // <7,6,6,7>: Cost 2 vsldoi12 RHS, <6,6,7,7>
+ 1705579339U, // <7,6,6,u>: Cost 2 vsldoi12 RHS, <6,6,u,7>
+ 1705431886U, // <7,6,7,0>: Cost 2 vsldoi12 RHS, <6,7,0,1>
+ 2779173719U, // <7,6,7,1>: Cost 3 vsldoi12 RHS, <6,7,1,1>
+ 2779173729U, // <7,6,7,2>: Cost 3 vsldoi12 RHS, <6,7,2,2>
+ 2779173736U, // <7,6,7,3>: Cost 3 vsldoi12 RHS, <6,7,3,0>
+ 1705431926U, // <7,6,7,4>: Cost 2 vsldoi12 RHS, <6,7,4,5>
+ 2779173759U, // <7,6,7,5>: Cost 3 vsldoi12 RHS, <6,7,5,5>
+ 2779173765U, // <7,6,7,6>: Cost 3 vsldoi12 RHS, <6,7,6,2>
+ 1248349494U, // <7,6,7,7>: Cost 2 vmrglw <6,6,7,7>, RHS
+ 1705431958U, // <7,6,7,u>: Cost 2 vsldoi12 RHS, <6,7,u,1>
+ 1705579423U, // <7,6,u,0>: Cost 2 vsldoi12 RHS, <6,u,0,1>
+ 2779173801U, // <7,6,u,1>: Cost 3 vsldoi12 RHS, <6,u,1,2>
+ 2779321266U, // <7,6,u,2>: Cost 3 vsldoi12 RHS, <6,u,2,2>
+ 2779321273U, // <7,6,u,3>: Cost 3 vsldoi12 RHS, <6,u,3,0>
+ 1705579463U, // <7,6,u,4>: Cost 2 vsldoi12 RHS, <6,u,4,5>
+ 2779173841U, // <7,6,u,5>: Cost 3 vsldoi12 RHS, <6,u,5,6>
+ 1705431864U, // <7,6,u,6>: Cost 2 vsldoi12 RHS, <6,6,6,6>
+ 1705432032U, // <7,6,u,7>: Cost 2 vsldoi12 RHS, <6,u,7,3>
+ 1705579495U, // <7,6,u,u>: Cost 2 vsldoi12 RHS, <6,u,u,1>
+ 1242320994U, // <7,7,0,0>: Cost 2 vmrglw <5,6,7,0>, <5,6,7,0>
+ 1705432058U, // <7,7,0,1>: Cost 2 vsldoi12 RHS, <7,0,1,2>
+ 3841414146U, // <7,7,0,2>: Cost 4 vsldoi12 <2,6,3,7>, <7,0,2,1>
+ 2316063226U, // <7,7,0,3>: Cost 3 vmrglw <5,6,7,0>, <6,2,7,3>
+ 2779173908U, // <7,7,0,4>: Cost 3 vsldoi12 RHS, <7,0,4,1>
+ 2658242658U, // <7,7,0,5>: Cost 3 vsldoi4 <6,7,7,0>, <5,6,7,0>
+ 2658243468U, // <7,7,0,6>: Cost 3 vsldoi4 <6,7,7,0>, <6,7,7,0>
+ 2316063554U, // <7,7,0,7>: Cost 3 vmrglw <5,6,7,0>, <6,6,7,7>
+ 1705432121U, // <7,7,0,u>: Cost 2 vsldoi12 RHS, <7,0,u,2>
+ 3852915777U, // <7,7,1,0>: Cost 4 vsldoi12 RHS, <7,1,0,1>
+ 2779173962U, // <7,7,1,1>: Cost 3 vsldoi12 RHS, <7,1,1,1>
+ 2779173973U, // <7,7,1,2>: Cost 3 vsldoi12 RHS, <7,1,2,3>
+ 3389813242U, // <7,7,1,3>: Cost 4 vmrglw <5,6,7,1>, <6,2,7,3>
+ 3852915813U, // <7,7,1,4>: Cost 4 vsldoi12 RHS, <7,1,4,1>
+ 3852915821U, // <7,7,1,5>: Cost 4 vsldoi12 RHS, <7,1,5,0>
+ 3835294839U, // <7,7,1,6>: Cost 4 vsldoi12 <1,6,1,7>, <7,1,6,1>
+ 2329343596U, // <7,7,1,7>: Cost 3 vmrglw <7,u,7,1>, <7,7,7,7>
+ 2779174027U, // <7,7,1,u>: Cost 3 vsldoi12 RHS, <7,1,u,3>
+ 2803061908U, // <7,7,2,0>: Cost 3 vsldoi12 RHS, <7,2,0,3>
+ 3852915869U, // <7,7,2,1>: Cost 4 vsldoi12 RHS, <7,2,1,3>
+ 2779174053U, // <7,7,2,2>: Cost 3 vsldoi12 RHS, <7,2,2,2>
+ 2779174060U, // <7,7,2,3>: Cost 3 vsldoi12 RHS, <7,2,3,0>
+ 2803061944U, // <7,7,2,4>: Cost 3 vsldoi12 RHS, <7,2,4,3>
+ 3852915905U, // <7,7,2,5>: Cost 4 vsldoi12 RHS, <7,2,5,3>
+ 2767672522U, // <7,7,2,6>: Cost 3 vsldoi12 <2,6,3,7>, <7,2,6,3>
+ 2791855315U, // <7,7,2,7>: Cost 3 vsldoi12 <6,6,7,7>, <7,2,7,3>
+ 2768999644U, // <7,7,2,u>: Cost 3 vsldoi12 <2,u,3,7>, <7,2,u,3>
+ 2779174115U, // <7,7,3,0>: Cost 3 vsldoi12 RHS, <7,3,0,1>
+ 3852915948U, // <7,7,3,1>: Cost 4 vsldoi12 RHS, <7,3,1,1>
+ 3841414394U, // <7,7,3,2>: Cost 4 vsldoi12 <2,6,3,7>, <7,3,2,6>
+ 1245663738U, // <7,7,3,3>: Cost 2 vmrglw <6,2,7,3>, <6,2,7,3>
+ 2779174155U, // <7,7,3,4>: Cost 3 vsldoi12 RHS, <7,3,4,5>
+ 3852915988U, // <7,7,3,5>: Cost 4 vsldoi12 RHS, <7,3,5,5>
+ 2706827959U, // <7,7,3,6>: Cost 3 vsldoi8 <3,6,7,7>, <3,6,7,7>
+ 2319405890U, // <7,7,3,7>: Cost 3 vmrglw <6,2,7,3>, <6,6,7,7>
+ 1245663738U, // <7,7,3,u>: Cost 2 vmrglw <6,2,7,3>, <6,2,7,3>
+ 2779174200U, // <7,7,4,0>: Cost 3 vsldoi12 RHS, <7,4,0,5>
+ 3852916030U, // <7,7,4,1>: Cost 4 vsldoi12 RHS, <7,4,1,2>
+ 3714099130U, // <7,7,4,2>: Cost 4 vsldoi4 <3,7,7,4>, <2,6,3,7>
+ 2316095994U, // <7,7,4,3>: Cost 3 vmrglw <5,6,7,4>, <6,2,7,3>
+ 1242353766U, // <7,7,4,4>: Cost 2 vmrglw <5,6,7,4>, <5,6,7,4>
+ 1705432422U, // <7,7,4,5>: Cost 2 vsldoi12 RHS, <7,4,5,6>
+ 2658276240U, // <7,7,4,6>: Cost 3 vsldoi4 <6,7,7,4>, <6,7,7,4>
+ 2316096322U, // <7,7,4,7>: Cost 3 vmrglw <5,6,7,4>, <6,6,7,7>
+ 1705432449U, // <7,7,4,u>: Cost 2 vsldoi12 RHS, <7,4,u,6>
+ 3852916101U, // <7,7,5,0>: Cost 4 vsldoi12 RHS, <7,5,0,1>
+ 3854906765U, // <7,7,5,1>: Cost 4 vsldoi12 RHS, <7,5,1,0>
+ 3852916121U, // <7,7,5,2>: Cost 4 vsldoi12 RHS, <7,5,2,3>
+ 3389846010U, // <7,7,5,3>: Cost 4 vmrglw <5,6,7,5>, <6,2,7,3>
+ 3852916141U, // <7,7,5,4>: Cost 4 vsldoi12 RHS, <7,5,4,5>
+ 2779174326U, // <7,7,5,5>: Cost 3 vsldoi12 RHS, <7,5,5,5>
+ 2779174337U, // <7,7,5,6>: Cost 3 vsldoi12 RHS, <7,5,6,7>
+ 2329376364U, // <7,7,5,7>: Cost 3 vmrglw <7,u,7,5>, <7,7,7,7>
+ 2779321811U, // <7,7,5,u>: Cost 3 vsldoi12 RHS, <7,5,u,7>
+ 2658287718U, // <7,7,6,0>: Cost 3 vsldoi4 <6,7,7,6>, LHS
+ 3852916197U, // <7,7,6,1>: Cost 4 vsldoi12 RHS, <7,6,1,7>
+ 2779174382U, // <7,7,6,2>: Cost 3 vsldoi12 RHS, <7,6,2,7>
+ 2316112378U, // <7,7,6,3>: Cost 3 vmrglw <5,6,7,6>, <6,2,7,3>
+ 2658290998U, // <7,7,6,4>: Cost 3 vsldoi4 <6,7,7,6>, RHS
+ 3852916233U, // <7,7,6,5>: Cost 4 vsldoi12 RHS, <7,6,5,7>
+ 1651004226U, // <7,7,6,6>: Cost 2 vsldoi8 <6,6,7,7>, <6,6,7,7>
+ 2779174420U, // <7,7,6,7>: Cost 3 vsldoi12 RHS, <7,6,7,0>
+ 1652331492U, // <7,7,6,u>: Cost 2 vsldoi8 <6,u,7,7>, <6,u,7,7>
+ 1590526054U, // <7,7,7,0>: Cost 2 vsldoi4 <7,7,7,7>, LHS
+ 2328728623U, // <7,7,7,1>: Cost 3 vmrglw <7,7,7,7>, <7,0,7,1>
+ 2724746451U, // <7,7,7,2>: Cost 3 vsldoi8 <6,6,7,7>, <7,2,7,3>
+ 2322092538U, // <7,7,7,3>: Cost 3 vmrglw <6,6,7,7>, <6,2,7,3>
+ 1590529334U, // <7,7,7,4>: Cost 2 vsldoi4 <7,7,7,7>, RHS
+ 2328728951U, // <7,7,7,5>: Cost 3 vmrglw <7,7,7,7>, <7,4,7,5>
+ 2724746770U, // <7,7,7,6>: Cost 3 vsldoi8 <6,6,7,7>, <7,6,6,7>
+ 430361910U, // <7,7,7,7>: Cost 1 vspltisw3 RHS
+ 430361910U, // <7,7,7,u>: Cost 1 vspltisw3 RHS
+ 1242320994U, // <7,7,u,0>: Cost 2 vmrglw <5,6,7,0>, <5,6,7,0>
+ 1705580162U, // <7,7,u,1>: Cost 2 vsldoi12 RHS, <7,u,1,2>
+ 2779321996U, // <7,7,u,2>: Cost 3 vsldoi12 RHS, <7,u,2,3>
+ 1245663738U, // <7,7,u,3>: Cost 2 vmrglw <6,2,7,3>, <6,2,7,3>
+ 1242353766U, // <7,7,u,4>: Cost 2 vmrglw <5,6,7,4>, <5,6,7,4>
+ 1705580202U, // <7,7,u,5>: Cost 2 vsldoi12 RHS, <7,u,5,6>
+ 1662949620U, // <7,7,u,6>: Cost 2 vsldoi8 <u,6,7,7>, <u,6,7,7>
+ 430361910U, // <7,7,u,7>: Cost 1 vspltisw3 RHS
+ 430361910U, // <7,7,u,u>: Cost 1 vspltisw3 RHS
+ 1705426944U, // <7,u,0,0>: Cost 2 vsldoi12 RHS, <0,0,0,0>
+ 1705432787U, // <7,u,0,1>: Cost 2 vsldoi12 RHS, <u,0,1,2>
+ 2316060885U, // <7,u,0,2>: Cost 3 vmrglw <5,6,7,0>, <3,0,u,2>
+ 1242316956U, // <7,u,0,3>: Cost 2 vmrglw <5,6,7,0>, LHS
+ 2779174637U, // <7,u,0,4>: Cost 3 vsldoi12 RHS, <u,0,4,1>
+ 1182750874U, // <7,u,0,5>: Cost 2 vmrghw <7,0,1,2>, RHS
+ 2316061213U, // <7,u,0,6>: Cost 3 vmrglw <5,6,7,0>, <3,4,u,6>
+ 1242320200U, // <7,u,0,7>: Cost 2 vmrglw <5,6,7,0>, RHS
+ 1705432850U, // <7,u,0,u>: Cost 2 vsldoi12 RHS, <u,0,u,2>
+ 1584578662U, // <7,u,1,0>: Cost 2 vsldoi4 <6,7,u,1>, LHS
+ 1705427764U, // <7,u,1,1>: Cost 2 vsldoi12 RHS, <1,1,1,1>
+ 631691054U, // <7,u,1,2>: Cost 1 vsldoi12 RHS, LHS
+ 2640407307U, // <7,u,1,3>: Cost 3 vsldoi4 <3,7,u,1>, <3,7,u,1>
+ 1584581942U, // <7,u,1,4>: Cost 2 vsldoi4 <6,7,u,1>, RHS
+ 2779174726U, // <7,u,1,5>: Cost 3 vsldoi12 RHS, <u,1,5,0>
+ 1584583574U, // <7,u,1,6>: Cost 2 vsldoi4 <6,7,u,1>, <6,7,u,1>
+ 2779322201U, // <7,u,1,7>: Cost 3 vsldoi12 RHS, <u,1,7,1>
+ 631691108U, // <7,u,1,u>: Cost 1 vsldoi12 RHS, LHS
+ 2779174763U, // <7,u,2,0>: Cost 3 vsldoi12 RHS, <u,2,0,1>
+ 2779174774U, // <7,u,2,1>: Cost 3 vsldoi12 RHS, <u,2,1,3>
+ 1705428584U, // <7,u,2,2>: Cost 2 vsldoi12 RHS, <2,2,2,2>
+ 1705432965U, // <7,u,2,3>: Cost 2 vsldoi12 RHS, <u,2,3,0>
+ 2779174801U, // <7,u,2,4>: Cost 3 vsldoi12 RHS, <u,2,4,3>
+ 2779174810U, // <7,u,2,5>: Cost 3 vsldoi12 RHS, <u,2,5,3>
+ 2767673251U, // <7,u,2,6>: Cost 3 vsldoi12 <2,6,3,7>, <u,2,6,3>
+ 1705580460U, // <7,u,2,7>: Cost 2 vsldoi12 RHS, <u,2,7,3>
+ 1705433010U, // <7,u,2,u>: Cost 2 vsldoi12 RHS, <u,2,u,0>
+ 1705433020U, // <7,u,3,0>: Cost 2 vsldoi12 RHS, <u,3,0,1>
+ 2779174853U, // <7,u,3,1>: Cost 3 vsldoi12 RHS, <u,3,1,1>
+ 2767673299U, // <7,u,3,2>: Cost 3 vsldoi12 <2,6,3,7>, <u,3,2,6>
+ 1245659292U, // <7,u,3,3>: Cost 2 vmrglw <6,2,7,3>, LHS
+ 1705433060U, // <7,u,3,4>: Cost 2 vsldoi12 RHS, <u,3,4,5>
+ 2779174893U, // <7,u,3,5>: Cost 3 vsldoi12 RHS, <u,3,5,5>
+ 2706836152U, // <7,u,3,6>: Cost 3 vsldoi8 <3,6,7,u>, <3,6,7,u>
+ 1245662536U, // <7,u,3,7>: Cost 2 vmrglw <6,2,7,3>, RHS
+ 1705433092U, // <7,u,3,u>: Cost 2 vsldoi12 RHS, <u,3,u,1>
+ 2779174925U, // <7,u,4,0>: Cost 3 vsldoi12 RHS, <u,4,0,1>
+ 1185732398U, // <7,u,4,1>: Cost 2 vmrghw <7,4,5,6>, LHS
+ 2316093653U, // <7,u,4,2>: Cost 3 vmrglw <5,6,7,4>, <3,0,u,2>
+ 1242349724U, // <7,u,4,3>: Cost 2 vmrglw <5,6,7,4>, LHS
+ 1705430224U, // <7,u,4,4>: Cost 2 vsldoi12 RHS, <4,4,4,4>
+ 1705433151U, // <7,u,4,5>: Cost 2 vsldoi12 RHS, <u,4,5,6>
+ 2316093981U, // <7,u,4,6>: Cost 3 vmrglw <5,6,7,4>, <3,4,u,6>
+ 1242352968U, // <7,u,4,7>: Cost 2 vmrglw <5,6,7,4>, RHS
+ 1705433178U, // <7,u,4,u>: Cost 2 vsldoi12 RHS, <u,4,u,6>
+ 1584611430U, // <7,u,5,0>: Cost 2 vsldoi4 <6,7,u,5>, LHS
+ 2781165670U, // <7,u,5,1>: Cost 3 vsldoi12 RHS, <u,5,1,0>
+ 2640439226U, // <7,u,5,2>: Cost 3 vsldoi4 <3,7,u,5>, <2,6,3,7>
+ 2640440079U, // <7,u,5,3>: Cost 3 vsldoi4 <3,7,u,5>, <3,7,u,5>
+ 1584614710U, // <7,u,5,4>: Cost 2 vsldoi4 <6,7,u,5>, RHS
+ 1705431044U, // <7,u,5,5>: Cost 2 vsldoi12 RHS, <5,5,5,5>
+ 631691418U, // <7,u,5,6>: Cost 1 vsldoi12 RHS, RHS
+ 2779322525U, // <7,u,5,7>: Cost 3 vsldoi12 RHS, <u,5,7,1>
+ 631691436U, // <7,u,5,u>: Cost 1 vsldoi12 RHS, RHS
+ 2779175087U, // <7,u,6,0>: Cost 3 vsldoi12 RHS, <u,6,0,1>
+ 2779175102U, // <7,u,6,1>: Cost 3 vsldoi12 RHS, <u,6,1,7>
+ 1648357887U, // <7,u,6,2>: Cost 2 vsldoi8 <6,2,7,u>, <6,2,7,u>
+ 1705433296U, // <7,u,6,3>: Cost 2 vsldoi12 RHS, <u,6,3,7>
+ 2779175127U, // <7,u,6,4>: Cost 3 vsldoi12 RHS, <u,6,4,5>
+ 2779175138U, // <7,u,6,5>: Cost 3 vsldoi12 RHS, <u,6,5,7>
+ 1651012419U, // <7,u,6,6>: Cost 2 vsldoi8 <6,6,7,u>, <6,6,7,u>
+ 1705580788U, // <7,u,6,7>: Cost 2 vsldoi12 RHS, <u,6,7,7>
+ 1705433341U, // <7,u,6,u>: Cost 2 vsldoi12 RHS, <u,6,u,7>
+ 1705580800U, // <7,u,7,0>: Cost 2 vsldoi12 RHS, <u,7,0,1>
+ 1187878702U, // <7,u,7,1>: Cost 2 vmrghw <7,7,7,7>, LHS
+ 2768042263U, // <7,u,7,2>: Cost 3 vsldoi12 <2,6,u,7>, <u,7,2,6>
+ 1248346268U, // <7,u,7,3>: Cost 2 vmrglw <6,6,7,7>, LHS
+ 1705580840U, // <7,u,7,4>: Cost 2 vsldoi12 RHS, <u,7,4,5>
+ 1187879066U, // <7,u,7,5>: Cost 2 vmrghw <7,7,7,7>, RHS
+ 2779322679U, // <7,u,7,6>: Cost 3 vsldoi12 RHS, <u,7,6,2>
+ 430361910U, // <7,u,7,7>: Cost 1 vspltisw3 RHS
+ 430361910U, // <7,u,7,u>: Cost 1 vspltisw3 RHS
+ 1705433425U, // <7,u,u,0>: Cost 2 vsldoi12 RHS, <u,u,0,1>
+ 1705433435U, // <7,u,u,1>: Cost 2 vsldoi12 RHS, <u,u,1,2>
+ 631691621U, // <7,u,u,2>: Cost 1 vsldoi12 RHS, LHS
+ 1705433451U, // <7,u,u,3>: Cost 2 vsldoi12 RHS, <u,u,3,0>
+ 1705433465U, // <7,u,u,4>: Cost 2 vsldoi12 RHS, <u,u,4,5>
+ 1705433475U, // <7,u,u,5>: Cost 2 vsldoi12 RHS, <u,u,5,6>
+ 631691661U, // <7,u,u,6>: Cost 1 vsldoi12 RHS, RHS
+ 430361910U, // <7,u,u,7>: Cost 1 vspltisw3 RHS
+ 631691675U, // <7,u,u,u>: Cost 1 vsldoi12 RHS, LHS
+ 202162278U, // <u,0,0,0>: Cost 1 vspltisw0 LHS
+ 1678598154U, // <u,0,0,1>: Cost 2 vsldoi12 LHS, <0,0,1,1>
+ 2634500154U, // <u,0,0,2>: Cost 3 vsldoi4 <2,u,0,0>, <2,u,0,0>
+ 2289596269U, // <u,0,0,3>: Cost 3 vmrglw <1,2,u,0>, <u,2,0,3>
+ 1548815670U, // <u,0,0,4>: Cost 2 vsldoi4 <0,u,0,0>, RHS
+ 2663698530U, // <u,0,0,5>: Cost 3 vsldoi4 <7,7,0,0>, <5,6,7,0>
+ 2658390942U, // <u,0,0,6>: Cost 3 vsldoi4 <6,u,0,0>, <6,u,0,0>
+ 2289596597U, // <u,0,0,7>: Cost 3 vmrglw <1,2,u,0>, <u,6,0,7>
+ 202162278U, // <u,0,0,u>: Cost 1 vspltisw0 LHS
+ 1560764518U, // <u,0,1,0>: Cost 2 vsldoi4 <2,u,0,1>, LHS
+ 115720294U, // <u,0,1,1>: Cost 1 vmrghw LHS, LHS
+ 604856427U, // <u,0,1,2>: Cost 1 vsldoi12 LHS, LHS
+ 2634508438U, // <u,0,1,3>: Cost 3 vsldoi4 <2,u,0,1>, <3,0,1,2>
+ 1560767798U, // <u,0,1,4>: Cost 2 vsldoi4 <2,u,0,1>, RHS
+ 2652426438U, // <u,0,1,5>: Cost 3 vsldoi4 <5,u,0,1>, <5,u,0,1>
+ 1584657311U, // <u,0,1,6>: Cost 2 vsldoi4 <6,u,0,1>, <6,u,0,1>
+ 2658399226U, // <u,0,1,7>: Cost 3 vsldoi4 <6,u,0,1>, <7,0,1,2>
+ 604856476U, // <u,0,1,u>: Cost 1 vsldoi12 LHS, LHS
+ 2696889850U, // <u,0,2,0>: Cost 3 vsldoi8 <2,0,u,0>, <2,0,u,0>
+ 1190174822U, // <u,0,2,1>: Cost 2 vmrghw <u,2,3,0>, LHS
+ 2692245096U, // <u,0,2,2>: Cost 3 vsldoi8 <1,2,u,0>, <2,2,2,2>
+ 2692245158U, // <u,0,2,3>: Cost 3 vsldoi8 <1,2,u,0>, <2,3,0,1>
+ 2263916882U, // <u,0,2,4>: Cost 3 vmrghw <u,2,3,0>, <0,4,1,5>
+ 2299709908U, // <u,0,2,5>: Cost 3 vmrglw <3,0,1,2>, <3,4,0,5>
+ 2692245434U, // <u,0,2,6>: Cost 3 vsldoi8 <1,2,u,0>, <2,6,3,7>
+ 2701535281U, // <u,0,2,7>: Cost 3 vsldoi8 <2,7,u,0>, <2,7,u,0>
+ 1190175389U, // <u,0,2,u>: Cost 2 vmrghw <u,2,3,0>, LHS
+ 1209237504U, // <u,0,3,0>: Cost 2 vmrglw LHS, <0,0,0,0>
+ 1209239206U, // <u,0,3,1>: Cost 2 vmrglw LHS, <2,3,0,1>
+ 2704189813U, // <u,0,3,2>: Cost 3 vsldoi8 <3,2,u,0>, <3,2,u,0>
+ 2692245916U, // <u,0,3,3>: Cost 3 vsldoi8 <1,2,u,0>, <3,3,3,3>
+ 2282981033U, // <u,0,3,4>: Cost 3 vmrglw LHS, <2,3,0,4>
+ 2664386658U, // <u,0,3,5>: Cost 3 vsldoi4 <7,u,0,3>, <5,6,7,0>
+ 2691877496U, // <u,0,3,6>: Cost 3 vsldoi8 <1,2,3,0>, <3,6,0,7>
+ 2664388218U, // <u,0,3,7>: Cost 3 vsldoi4 <7,u,0,3>, <7,u,0,3>
+ 1209239213U, // <u,0,3,u>: Cost 2 vmrglw LHS, <2,3,0,u>
+ 2289623040U, // <u,0,4,0>: Cost 3 vmrglw <1,2,u,4>, <0,0,0,0>
+ 1678598482U, // <u,0,4,1>: Cost 2 vsldoi12 LHS, <0,4,1,5>
+ 2634532926U, // <u,0,4,2>: Cost 3 vsldoi4 <2,u,0,4>, <2,u,0,4>
+ 2235580672U, // <u,0,4,3>: Cost 3 vmrghw <3,4,5,6>, <0,3,1,4>
+ 1143619922U, // <u,0,4,4>: Cost 2 vmrghw <0,4,1,5>, <0,4,1,5>
+ 1618505014U, // <u,0,4,5>: Cost 2 vsldoi8 <1,2,u,0>, RHS
+ 2658423714U, // <u,0,4,6>: Cost 3 vsldoi4 <6,u,0,4>, <6,u,0,4>
+ 2713259464U, // <u,0,4,7>: Cost 3 vsldoi8 <4,7,5,0>, <4,7,5,0>
+ 1683243409U, // <u,0,4,u>: Cost 2 vsldoi12 LHS, <0,4,u,5>
+ 1192443904U, // <u,0,5,0>: Cost 2 vmrghw RHS, <0,0,0,0>
+ 118702182U, // <u,0,5,1>: Cost 1 vmrghw RHS, LHS
+ 2266185901U, // <u,0,5,2>: Cost 3 vmrghw RHS, <0,2,1,2>
+ 2640513816U, // <u,0,5,3>: Cost 3 vsldoi4 <3,u,0,5>, <3,u,0,5>
+ 1192444242U, // <u,0,5,4>: Cost 2 vmrghw RHS, <0,4,1,5>
+ 2718789636U, // <u,0,5,5>: Cost 3 vsldoi8 <5,6,u,0>, <5,5,5,5>
+ 1645047915U, // <u,0,5,6>: Cost 2 vsldoi8 <5,6,u,0>, <5,6,u,0>
+ 2664404604U, // <u,0,5,7>: Cost 3 vsldoi4 <7,u,0,5>, <7,u,0,5>
+ 118702749U, // <u,0,5,u>: Cost 1 vmrghw RHS, LHS
+ 2302910464U, // <u,0,6,0>: Cost 3 vmrglw <3,4,u,6>, <0,0,0,0>
+ 1192886374U, // <u,0,6,1>: Cost 2 vmrghw <u,6,3,7>, LHS
+ 2718790138U, // <u,0,6,2>: Cost 3 vsldoi8 <5,6,u,0>, <6,2,7,3>
+ 2722771537U, // <u,0,6,3>: Cost 3 vsldoi8 <6,3,u,0>, <6,3,u,0>
+ 2266628434U, // <u,0,6,4>: Cost 3 vmrghw <u,6,3,7>, <0,4,1,5>
+ 2248950180U, // <u,0,6,5>: Cost 3 vmrghw <5,6,7,0>, <0,5,1,6>
+ 2718790456U, // <u,0,6,6>: Cost 3 vsldoi8 <5,6,u,0>, <6,6,6,6>
+ 2718790478U, // <u,0,6,7>: Cost 3 vsldoi8 <5,6,u,0>, <6,7,0,1>
+ 1192886941U, // <u,0,6,u>: Cost 2 vmrghw <u,6,3,7>, LHS
+ 1235812352U, // <u,0,7,0>: Cost 2 vmrglw RHS, <0,0,0,0>
+ 1235814054U, // <u,0,7,1>: Cost 2 vmrglw RHS, <2,3,0,1>
+ 2728080601U, // <u,0,7,2>: Cost 3 vsldoi8 <7,2,u,0>, <7,2,u,0>
+ 2640530202U, // <u,0,7,3>: Cost 3 vsldoi4 <3,u,0,7>, <3,u,0,7>
+ 2640530742U, // <u,0,7,4>: Cost 3 vsldoi4 <3,u,0,7>, RHS
+ 2309556692U, // <u,0,7,5>: Cost 3 vmrglw RHS, <3,4,0,5>
+ 2730735133U, // <u,0,7,6>: Cost 3 vsldoi8 <7,6,u,0>, <7,6,u,0>
+ 2309556856U, // <u,0,7,7>: Cost 3 vmrglw RHS, <3,6,0,7>
+ 1235814061U, // <u,0,7,u>: Cost 2 vmrglw RHS, <2,3,0,u>
+ 202162278U, // <u,0,u,0>: Cost 1 vspltisw0 LHS
+ 120365158U, // <u,0,u,1>: Cost 1 vmrghw LHS, LHS
+ 604856989U, // <u,0,u,2>: Cost 1 vsldoi12 LHS, LHS
+ 2692249532U, // <u,0,u,3>: Cost 3 vsldoi8 <1,2,u,0>, <u,3,0,1>
+ 1560825142U, // <u,0,u,4>: Cost 2 vsldoi4 <2,u,0,u>, RHS
+ 1618507930U, // <u,0,u,5>: Cost 2 vsldoi8 <1,2,u,0>, RHS
+ 1584714662U, // <u,0,u,6>: Cost 2 vsldoi4 <6,u,0,u>, <6,u,0,u>
+ 2309565048U, // <u,0,u,7>: Cost 3 vmrglw RHS, <3,6,0,7>
+ 604857043U, // <u,0,u,u>: Cost 1 vsldoi12 LHS, LHS
+ 1611210825U, // <u,1,0,0>: Cost 2 vsldoi8 <0,0,u,1>, <0,0,u,1>
+ 1616519270U, // <u,1,0,1>: Cost 2 vsldoi8 <0,u,u,1>, LHS
+ 2287605459U, // <u,1,0,2>: Cost 3 vmrglw <0,u,u,0>, <u,0,1,2>
+ 2640546588U, // <u,1,0,3>: Cost 3 vsldoi4 <3,u,1,0>, <3,u,1,0>
+ 2622631222U, // <u,1,0,4>: Cost 3 vsldoi4 <0,u,1,0>, RHS
+ 2289590610U, // <u,1,0,5>: Cost 3 vmrglw <1,2,u,0>, <0,4,1,5>
+ 2664436630U, // <u,1,0,6>: Cost 3 vsldoi4 <7,u,1,0>, <6,7,u,1>
+ 2664437376U, // <u,1,0,7>: Cost 3 vsldoi4 <7,u,1,0>, <7,u,1,0>
+ 1616519889U, // <u,1,0,u>: Cost 2 vsldoi8 <0,u,u,1>, <0,u,u,1>
+ 1548894866U, // <u,1,1,0>: Cost 2 vsldoi4 <0,u,1,1>, <0,u,1,1>
+ 269271142U, // <u,1,1,1>: Cost 1 vspltisw1 LHS
+ 1189462934U, // <u,1,1,2>: Cost 2 vmrghw LHS, <1,2,3,0>
+ 2622638230U, // <u,1,1,3>: Cost 3 vsldoi4 <0,u,1,1>, <3,0,1,2>
+ 1548897590U, // <u,1,1,4>: Cost 2 vsldoi4 <0,u,1,1>, RHS
+ 2756985692U, // <u,1,1,5>: Cost 3 vsldoi12 LHS, <1,1,5,5>
+ 2658472872U, // <u,1,1,6>: Cost 3 vsldoi4 <6,u,1,1>, <6,u,1,1>
+ 2287614142U, // <u,1,1,7>: Cost 3 vmrglw <0,u,u,1>, <u,6,1,7>
+ 269271142U, // <u,1,1,u>: Cost 1 vspltisw1 LHS
+ 1566818406U, // <u,1,2,0>: Cost 2 vsldoi4 <3,u,1,2>, LHS
+ 2756985735U, // <u,1,2,1>: Cost 3 vsldoi12 LHS, <1,2,1,3>
+ 1148371862U, // <u,1,2,2>: Cost 2 vmrghw <1,2,3,0>, <1,2,3,0>
+ 835584U, // <u,1,2,3>: Cost 0 copy LHS
+ 1566821686U, // <u,1,2,4>: Cost 2 vsldoi4 <3,u,1,2>, RHS
+ 2756985771U, // <u,1,2,5>: Cost 3 vsldoi12 LHS, <1,2,5,3>
+ 2690262970U, // <u,1,2,6>: Cost 3 vsldoi8 <0,u,u,1>, <2,6,3,7>
+ 1590711938U, // <u,1,2,7>: Cost 2 vsldoi4 <7,u,1,2>, <7,u,1,2>
+ 835584U, // <u,1,2,u>: Cost 0 copy LHS
+ 2282979337U, // <u,1,3,0>: Cost 3 vmrglw LHS, <0,0,1,0>
+ 1209237514U, // <u,1,3,1>: Cost 2 vmrglw LHS, <0,0,1,1>
+ 1209239702U, // <u,1,3,2>: Cost 2 vmrglw LHS, <3,0,1,2>
+ 2282979502U, // <u,1,3,3>: Cost 3 vmrglw LHS, <0,2,1,3>
+ 2282979341U, // <u,1,3,4>: Cost 3 vmrglw LHS, <0,0,1,4>
+ 1209237842U, // <u,1,3,5>: Cost 2 vmrglw LHS, <0,4,1,5>
+ 2282979505U, // <u,1,3,6>: Cost 3 vmrglw LHS, <0,2,1,6>
+ 2287625423U, // <u,1,3,7>: Cost 3 vmrglw LHS, <1,6,1,7>
+ 1209237521U, // <u,1,3,u>: Cost 2 vmrglw LHS, <0,0,1,u>
+ 1635101613U, // <u,1,4,0>: Cost 2 vsldoi8 <4,0,u,1>, <4,0,u,1>
+ 2289623050U, // <u,1,4,1>: Cost 3 vmrglw <1,2,u,4>, <0,0,1,1>
+ 2289625238U, // <u,1,4,2>: Cost 3 vmrglw <1,2,u,4>, <3,0,1,2>
+ 2640579360U, // <u,1,4,3>: Cost 3 vsldoi4 <3,u,1,4>, <3,u,1,4>
+ 2622663990U, // <u,1,4,4>: Cost 3 vsldoi4 <0,u,1,4>, RHS
+ 1616522550U, // <u,1,4,5>: Cost 2 vsldoi8 <0,u,u,1>, RHS
+ 2664469398U, // <u,1,4,6>: Cost 3 vsldoi4 <7,u,1,4>, <6,7,u,1>
+ 2664470148U, // <u,1,4,7>: Cost 3 vsldoi4 <7,u,1,4>, <7,u,1,4>
+ 1616522793U, // <u,1,4,u>: Cost 2 vsldoi8 <0,u,u,1>, RHS
+ 1548927638U, // <u,1,5,0>: Cost 2 vsldoi4 <0,u,1,5>, <0,u,1,5>
+ 1192444724U, // <u,1,5,1>: Cost 2 vmrghw RHS, <1,1,1,1>
+ 1192444822U, // <u,1,5,2>: Cost 2 vmrghw RHS, <1,2,3,0>
+ 2622670998U, // <u,1,5,3>: Cost 3 vsldoi4 <0,u,1,5>, <3,0,1,2>
+ 1548930358U, // <u,1,5,4>: Cost 2 vsldoi4 <0,u,1,5>, RHS
+ 1210728786U, // <u,1,5,5>: Cost 2 vmrglw <0,4,1,5>, <0,4,1,5>
+ 2714153058U, // <u,1,5,6>: Cost 3 vsldoi8 <4,u,u,1>, <5,6,7,0>
+ 2670449658U, // <u,1,5,7>: Cost 3 vsldoi4 <u,u,1,5>, <7,0,1,2>
+ 1548932910U, // <u,1,5,u>: Cost 2 vsldoi4 <0,u,1,5>, LHS
+ 2622677655U, // <u,1,6,0>: Cost 3 vsldoi4 <0,u,1,6>, <0,u,1,6>
+ 2756986063U, // <u,1,6,1>: Cost 3 vsldoi12 LHS, <1,6,1,7>
+ 2302912662U, // <u,1,6,2>: Cost 3 vmrglw <3,4,u,6>, <3,0,1,2>
+ 3696421014U, // <u,1,6,3>: Cost 4 vsldoi4 <0,u,1,6>, <3,0,1,2>
+ 2622680374U, // <u,1,6,4>: Cost 3 vsldoi4 <0,u,1,6>, RHS
+ 2756986099U, // <u,1,6,5>: Cost 3 vsldoi12 LHS, <1,6,5,7>
+ 2714153784U, // <u,1,6,6>: Cost 3 vsldoi8 <4,u,u,1>, <6,6,6,6>
+ 1651692438U, // <u,1,6,7>: Cost 2 vsldoi8 <6,7,u,1>, <6,7,u,1>
+ 1652356071U, // <u,1,6,u>: Cost 2 vsldoi8 <6,u,u,1>, <6,u,u,1>
+ 2628657254U, // <u,1,7,0>: Cost 3 vsldoi4 <1,u,1,7>, LHS
+ 1235812362U, // <u,1,7,1>: Cost 2 vmrglw RHS, <0,0,1,1>
+ 1235814550U, // <u,1,7,2>: Cost 2 vmrglw RHS, <3,0,1,2>
+ 2309554350U, // <u,1,7,3>: Cost 3 vmrglw RHS, <0,2,1,3>
+ 2628660534U, // <u,1,7,4>: Cost 3 vsldoi4 <1,u,1,7>, RHS
+ 1235812690U, // <u,1,7,5>: Cost 2 vmrglw RHS, <0,4,1,5>
+ 2309554353U, // <u,1,7,6>: Cost 3 vmrglw RHS, <0,2,1,6>
+ 2309554678U, // <u,1,7,7>: Cost 3 vmrglw RHS, <0,6,1,7>
+ 1235812369U, // <u,1,7,u>: Cost 2 vmrglw RHS, <0,0,1,u>
+ 1548952217U, // <u,1,u,0>: Cost 2 vsldoi4 <0,u,1,u>, <0,u,1,u>
+ 269271142U, // <u,1,u,1>: Cost 1 vspltisw1 LHS
+ 1209280662U, // <u,1,u,2>: Cost 2 vmrglw LHS, <3,0,1,2>
+ 835584U, // <u,1,u,3>: Cost 0 copy LHS
+ 1548954934U, // <u,1,u,4>: Cost 2 vsldoi4 <0,u,1,u>, RHS
+ 1209278802U, // <u,1,u,5>: Cost 2 vmrglw LHS, <0,4,1,5>
+ 2283020465U, // <u,1,u,6>: Cost 3 vmrglw LHS, <0,2,1,6>
+ 1590761096U, // <u,1,u,7>: Cost 2 vsldoi4 <7,u,1,u>, <7,u,1,u>
+ 835584U, // <u,1,u,u>: Cost 0 copy LHS
+ 2702876672U, // <u,2,0,0>: Cost 3 vsldoi8 <3,0,u,2>, <0,0,0,0>
+ 1629134950U, // <u,2,0,1>: Cost 2 vsldoi8 <3,0,u,2>, LHS
+ 2289591912U, // <u,2,0,2>: Cost 3 vmrglw <1,2,u,0>, <2,2,2,2>
+ 1215848550U, // <u,2,0,3>: Cost 2 vmrglw <1,2,u,0>, LHS
+ 2702877010U, // <u,2,0,4>: Cost 3 vsldoi8 <3,0,u,2>, <0,4,1,5>
+ 2289222708U, // <u,2,0,5>: Cost 3 vmrglw <1,2,3,0>, <1,4,2,5>
+ 2779178473U, // <u,2,0,6>: Cost 3 vsldoi12 RHS, <2,0,6,1>
+ 2726249024U, // <u,2,0,7>: Cost 3 vsldoi8 <7,0,1,2>, <0,7,1,0>
+ 1215848555U, // <u,2,0,u>: Cost 2 vmrglw <1,2,u,0>, LHS
+ 2690933539U, // <u,2,1,0>: Cost 3 vsldoi8 <1,0,u,2>, <1,0,u,2>
+ 2628683124U, // <u,2,1,1>: Cost 3 vsldoi4 <1,u,2,1>, <1,u,2,1>
+ 1189463656U, // <u,2,1,2>: Cost 2 vmrghw LHS, <2,2,2,2>
+ 1213866086U, // <u,2,1,3>: Cost 2 vmrglw <0,u,u,1>, LHS
+ 2628685110U, // <u,2,1,4>: Cost 3 vsldoi4 <1,u,2,1>, RHS
+ 2263205736U, // <u,2,1,5>: Cost 3 vmrghw LHS, <2,5,3,6>
+ 1189463994U, // <u,2,1,6>: Cost 2 vmrghw LHS, <2,6,3,7>
+ 2263205866U, // <u,2,1,7>: Cost 3 vmrghw LHS, <2,7,0,1>
+ 1213866091U, // <u,2,1,u>: Cost 2 vmrglw <0,u,u,1>, LHS
+ 1556938854U, // <u,2,2,0>: Cost 2 vsldoi4 <2,2,2,2>, LHS
+ 2697569869U, // <u,2,2,1>: Cost 3 vsldoi8 <2,1,u,2>, <2,1,u,2>
+ 336380006U, // <u,2,2,2>: Cost 1 vspltisw2 LHS
+ 1678599794U, // <u,2,2,3>: Cost 2 vsldoi12 LHS, <2,2,3,3>
+ 1556942134U, // <u,2,2,4>: Cost 2 vsldoi4 <2,2,2,2>, RHS
+ 2295138061U, // <u,2,2,5>: Cost 3 vmrglw <2,2,2,2>, <2,4,2,5>
+ 2702878650U, // <u,2,2,6>: Cost 3 vsldoi8 <3,0,u,2>, <2,6,3,7>
+ 2300229831U, // <u,2,2,7>: Cost 3 vmrglw <3,0,u,2>, <u,6,2,7>
+ 336380006U, // <u,2,2,u>: Cost 1 vspltisw2 LHS
+ 475243165U, // <u,2,3,0>: Cost 1 vsldoi4 LHS, LHS
+ 1548985140U, // <u,2,3,1>: Cost 2 vsldoi4 LHS, <1,1,1,1>
+ 1209239144U, // <u,2,3,2>: Cost 2 vmrglw LHS, <2,2,2,2>
+ 135495782U, // <u,2,3,3>: Cost 1 vmrglw LHS, LHS
+ 475245878U, // <u,2,3,4>: Cost 1 vsldoi4 LHS, RHS
+ 1596764164U, // <u,2,3,5>: Cost 2 vsldoi4 LHS, <5,5,5,5>
+ 1596764666U, // <u,2,3,6>: Cost 2 vsldoi4 LHS, <6,2,7,3>
+ 1596765178U, // <u,2,3,7>: Cost 2 vsldoi4 LHS, <7,0,1,2>
+ 135495787U, // <u,2,3,u>: Cost 1 vmrglw LHS, LHS
+ 2708851630U, // <u,2,4,0>: Cost 3 vsldoi8 <4,0,u,2>, <4,0,u,2>
+ 2217362979U, // <u,2,4,1>: Cost 3 vmrghw <0,4,1,5>, <2,1,3,5>
+ 2289624680U, // <u,2,4,2>: Cost 3 vmrglw <1,2,u,4>, <2,2,2,2>
+ 1215881318U, // <u,2,4,3>: Cost 2 vmrglw <1,2,u,4>, LHS
+ 2726767824U, // <u,2,4,4>: Cost 3 vsldoi8 <7,0,u,2>, <4,4,4,4>
+ 1629138230U, // <u,2,4,5>: Cost 2 vsldoi8 <3,0,u,2>, RHS
+ 2779178801U, // <u,2,4,6>: Cost 3 vsldoi12 RHS, <2,4,6,5>
+ 2726251976U, // <u,2,4,7>: Cost 3 vsldoi8 <7,0,1,2>, <4,7,5,0>
+ 1215881323U, // <u,2,4,u>: Cost 2 vmrglw <1,2,u,4>, LHS
+ 2628714598U, // <u,2,5,0>: Cost 3 vsldoi4 <1,u,2,5>, LHS
+ 2628715896U, // <u,2,5,1>: Cost 3 vsldoi4 <1,u,2,5>, <1,u,2,5>
+ 1192445544U, // <u,2,5,2>: Cost 2 vmrghw RHS, <2,2,2,2>
+ 1213898854U, // <u,2,5,3>: Cost 2 vmrglw <0,u,u,5>, LHS
+ 2628717878U, // <u,2,5,4>: Cost 3 vsldoi4 <1,u,2,5>, RHS
+ 2726768644U, // <u,2,5,5>: Cost 3 vsldoi8 <7,0,u,2>, <5,5,5,5>
+ 1192445882U, // <u,2,5,6>: Cost 2 vmrghw RHS, <2,6,3,7>
+ 2266187754U, // <u,2,5,7>: Cost 3 vmrghw RHS, <2,7,0,1>
+ 1213898859U, // <u,2,5,u>: Cost 2 vmrglw <0,u,u,5>, LHS
+ 2634694758U, // <u,2,6,0>: Cost 3 vsldoi4 <2,u,2,6>, LHS
+ 2721460657U, // <u,2,6,1>: Cost 3 vsldoi8 <6,1,u,2>, <6,1,u,2>
+ 2296940136U, // <u,2,6,2>: Cost 3 vmrglw <2,4,u,6>, <2,2,2,2>
+ 1678600122U, // <u,2,6,3>: Cost 2 vsldoi12 LHS, <2,6,3,7>
+ 2634698038U, // <u,2,6,4>: Cost 3 vsldoi4 <2,u,2,6>, RHS
+ 3370682125U, // <u,2,6,5>: Cost 4 vmrglw <2,4,u,6>, <2,4,2,5>
+ 1157056442U, // <u,2,6,6>: Cost 2 vmrghw <2,6,3,7>, <2,6,3,7>
+ 2725442455U, // <u,2,6,7>: Cost 3 vsldoi8 <6,7,u,2>, <6,7,u,2>
+ 1678600167U, // <u,2,6,u>: Cost 2 vsldoi12 LHS, <2,6,u,7>
+ 1653027897U, // <u,2,7,0>: Cost 2 vsldoi8 <7,0,u,2>, <7,0,u,2>
+ 2309554924U, // <u,2,7,1>: Cost 3 vmrglw RHS, <1,0,2,1>
+ 1235813992U, // <u,2,7,2>: Cost 2 vmrglw RHS, <2,2,2,2>
+ 162070630U, // <u,2,7,3>: Cost 1 vmrglw RHS, LHS
+ 2634706230U, // <u,2,7,4>: Cost 3 vsldoi4 <2,u,2,7>, RHS
+ 2309555252U, // <u,2,7,5>: Cost 3 vmrglw RHS, <1,4,2,5>
+ 2309555901U, // <u,2,7,6>: Cost 3 vmrglw RHS, <2,3,2,6>
+ 2309555416U, // <u,2,7,7>: Cost 3 vmrglw RHS, <1,6,2,7>
+ 162070635U, // <u,2,7,u>: Cost 1 vmrglw RHS, LHS
+ 475284130U, // <u,2,u,0>: Cost 1 vsldoi4 LHS, LHS
+ 1549026100U, // <u,2,u,1>: Cost 2 vsldoi4 LHS, <1,1,1,1>
+ 336380006U, // <u,2,u,2>: Cost 1 vspltisw2 LHS
+ 135536742U, // <u,2,u,3>: Cost 1 vmrglw LHS, LHS
+ 475286838U, // <u,2,u,4>: Cost 1 vsldoi4 LHS, RHS
+ 1629141146U, // <u,2,u,5>: Cost 2 vsldoi8 <3,0,u,2>, RHS
+ 1194108858U, // <u,2,u,6>: Cost 2 vmrghw LHS, <2,6,3,7>
+ 1596806138U, // <u,2,u,7>: Cost 2 vsldoi4 LHS, <7,0,1,2>
+ 135536747U, // <u,2,u,u>: Cost 1 vmrglw LHS, LHS
+ 1611890688U, // <u,3,0,0>: Cost 2 vsldoi8 LHS, <0,0,0,0>
+ 538149020U, // <u,3,0,1>: Cost 1 vsldoi8 LHS, LHS
+ 2685632685U, // <u,3,0,2>: Cost 3 vsldoi8 LHS, <0,2,1,2>
+ 2685632764U, // <u,3,0,3>: Cost 3 vsldoi8 LHS, <0,3,1,0>
+ 1611891026U, // <u,3,0,4>: Cost 2 vsldoi8 LHS, <0,4,1,5>
+ 2733408722U, // <u,3,0,5>: Cost 3 vsldoi8 LHS, <0,5,6,7>
+ 2658612153U, // <u,3,0,6>: Cost 3 vsldoi4 <6,u,3,0>, <6,u,3,0>
+ 2289592250U, // <u,3,0,7>: Cost 3 vmrglw <1,2,u,0>, <2,6,3,7>
+ 538149533U, // <u,3,0,u>: Cost 1 vsldoi8 LHS, LHS
+ 1189464214U, // <u,3,1,0>: Cost 2 vmrghw LHS, <3,0,1,2>
+ 1611891508U, // <u,3,1,1>: Cost 2 vsldoi8 LHS, <1,1,1,1>
+ 1611891606U, // <u,3,1,2>: Cost 2 vsldoi8 LHS, <1,2,3,0>
+ 1189464476U, // <u,3,1,3>: Cost 2 vmrghw LHS, <3,3,3,3>
+ 1189464578U, // <u,3,1,4>: Cost 2 vmrghw LHS, <3,4,5,6>
+ 2690278511U, // <u,3,1,5>: Cost 3 vsldoi8 LHS, <1,5,0,1>
+ 2690278607U, // <u,3,1,6>: Cost 3 vsldoi8 LHS, <1,6,1,7>
+ 2287609786U, // <u,3,1,7>: Cost 3 vmrglw <0,u,u,1>, <2,6,3,7>
+ 1611892092U, // <u,3,1,u>: Cost 2 vsldoi8 LHS, <1,u,3,0>
+ 2685634042U, // <u,3,2,0>: Cost 3 vsldoi8 LHS, <2,0,u,0>
+ 2685634079U, // <u,3,2,1>: Cost 3 vsldoi8 LHS, <2,1,3,1>
+ 1611892328U, // <u,3,2,2>: Cost 2 vsldoi8 LHS, <2,2,2,2>
+ 1611892390U, // <u,3,2,3>: Cost 2 vsldoi8 LHS, <2,3,0,1>
+ 2685634371U, // <u,3,2,4>: Cost 3 vsldoi8 LHS, <2,4,u,5>
+ 2685634453U, // <u,3,2,5>: Cost 3 vsldoi8 LHS, <2,5,u,6>
+ 1611892666U, // <u,3,2,6>: Cost 2 vsldoi8 LHS, <2,6,3,7>
+ 2300225466U, // <u,3,2,7>: Cost 3 vmrglw <3,0,u,2>, <2,6,3,7>
+ 1611892795U, // <u,3,2,u>: Cost 2 vsldoi8 LHS, <2,u,0,1>
+ 1209238422U, // <u,3,3,0>: Cost 2 vmrglw LHS, <1,2,3,0>
+ 2282980247U, // <u,3,3,1>: Cost 3 vmrglw LHS, <1,2,3,1>
+ 1561004120U, // <u,3,3,2>: Cost 2 vsldoi4 <2,u,3,3>, <2,u,3,3>
+ 403488870U, // <u,3,3,3>: Cost 1 vspltisw3 LHS
+ 1209238426U, // <u,3,3,4>: Cost 2 vmrglw LHS, <1,2,3,4>
+ 2282980899U, // <u,3,3,5>: Cost 3 vmrglw LHS, <2,1,3,5>
+ 2282985598U, // <u,3,3,6>: Cost 3 vmrglw LHS, <u,5,3,6>
+ 1209239482U, // <u,3,3,7>: Cost 2 vmrglw LHS, <2,6,3,7>
+ 403488870U, // <u,3,3,u>: Cost 1 vspltisw3 LHS
+ 1555038310U, // <u,3,4,0>: Cost 2 vsldoi4 <1,u,3,4>, LHS
+ 1555039616U, // <u,3,4,1>: Cost 2 vsldoi4 <1,u,3,4>, <1,u,3,4>
+ 2628781672U, // <u,3,4,2>: Cost 3 vsldoi4 <1,u,3,4>, <2,2,2,2>
+ 2289624690U, // <u,3,4,3>: Cost 3 vmrglw <1,2,u,4>, <2,2,3,3>
+ 1555041590U, // <u,3,4,4>: Cost 2 vsldoi4 <1,u,3,4>, RHS
+ 538152246U, // <u,3,4,5>: Cost 1 vsldoi8 LHS, RHS
+ 2658644925U, // <u,3,4,6>: Cost 3 vsldoi4 <6,u,3,4>, <6,u,3,4>
+ 2289625018U, // <u,3,4,7>: Cost 3 vmrglw <1,2,u,4>, <2,6,3,7>
+ 538152489U, // <u,3,4,u>: Cost 1 vsldoi8 LHS, RHS
+ 1192446102U, // <u,3,5,0>: Cost 2 vmrghw RHS, <3,0,1,2>
+ 2733411983U, // <u,3,5,1>: Cost 3 vsldoi8 LHS, <5,1,0,1>
+ 2634762330U, // <u,3,5,2>: Cost 3 vsldoi4 <2,u,3,5>, <2,u,3,5>
+ 1192446364U, // <u,3,5,3>: Cost 2 vmrghw RHS, <3,3,3,3>
+ 1192446466U, // <u,3,5,4>: Cost 2 vmrghw RHS, <3,4,5,6>
+ 1659670532U, // <u,3,5,5>: Cost 2 vsldoi8 LHS, <5,5,5,5>
+ 1659670626U, // <u,3,5,6>: Cost 2 vsldoi8 LHS, <5,6,7,0>
+ 2287642554U, // <u,3,5,7>: Cost 3 vmrglw <0,u,u,5>, <2,6,3,7>
+ 1659670788U, // <u,3,5,u>: Cost 2 vsldoi8 LHS, <5,u,7,0>
+ 2634768486U, // <u,3,6,0>: Cost 3 vsldoi4 <2,u,3,6>, LHS
+ 2733412775U, // <u,3,6,1>: Cost 3 vsldoi8 LHS, <6,1,7,1>
+ 1648390659U, // <u,3,6,2>: Cost 2 vsldoi8 <6,2,u,3>, <6,2,u,3>
+ 2634770973U, // <u,3,6,3>: Cost 3 vsldoi4 <2,u,3,6>, <3,4,u,6>
+ 2634771766U, // <u,3,6,4>: Cost 3 vsldoi4 <2,u,3,6>, RHS
+ 2733413099U, // <u,3,6,5>: Cost 3 vsldoi8 LHS, <6,5,7,1>
+ 1659671352U, // <u,3,6,6>: Cost 2 vsldoi8 LHS, <6,6,6,6>
+ 1659671374U, // <u,3,6,7>: Cost 2 vsldoi8 LHS, <6,7,0,1>
+ 1652372457U, // <u,3,6,u>: Cost 2 vsldoi8 <6,u,u,3>, <6,u,u,3>
+ 1561034854U, // <u,3,7,0>: Cost 2 vsldoi4 <2,u,3,7>, LHS
+ 2634777396U, // <u,3,7,1>: Cost 3 vsldoi4 <2,u,3,7>, <1,1,1,1>
+ 1561036892U, // <u,3,7,2>: Cost 2 vsldoi4 <2,u,3,7>, <2,u,3,7>
+ 1235814002U, // <u,3,7,3>: Cost 2 vmrglw RHS, <2,2,3,3>
+ 1561038134U, // <u,3,7,4>: Cost 2 vsldoi4 <2,u,3,7>, RHS
+ 2309555747U, // <u,3,7,5>: Cost 3 vmrglw RHS, <2,1,3,5>
+ 2309556072U, // <u,3,7,6>: Cost 3 vmrglw RHS, <2,5,3,6>
+ 1235814330U, // <u,3,7,7>: Cost 2 vmrglw RHS, <2,6,3,7>
+ 1561040686U, // <u,3,7,u>: Cost 2 vsldoi4 <2,u,3,7>, LHS
+ 1611896531U, // <u,3,u,0>: Cost 2 vsldoi8 LHS, <u,0,1,2>
+ 538154798U, // <u,3,u,1>: Cost 1 vsldoi8 LHS, LHS
+ 1611896712U, // <u,3,u,2>: Cost 2 vsldoi8 LHS, <u,2,3,3>
+ 403488870U, // <u,3,u,3>: Cost 1 vspltisw3 LHS
+ 1611896895U, // <u,3,u,4>: Cost 2 vsldoi8 LHS, <u,4,5,6>
+ 538155162U, // <u,3,u,5>: Cost 1 vsldoi8 LHS, RHS
+ 1611897040U, // <u,3,u,6>: Cost 2 vsldoi8 LHS, <u,6,3,7>
+ 1209280442U, // <u,3,u,7>: Cost 2 vmrglw LHS, <2,6,3,7>
+ 538155365U, // <u,3,u,u>: Cost 1 vsldoi8 LHS, LHS
+ 1165118354U, // <u,4,0,0>: Cost 2 vmrghw <4,0,5,1>, <4,0,5,1>
+ 1618534502U, // <u,4,0,1>: Cost 2 vsldoi8 <1,2,u,4>, LHS
+ 2634795102U, // <u,4,0,2>: Cost 3 vsldoi4 <2,u,4,0>, <2,u,4,0>
+ 2686451968U, // <u,4,0,3>: Cost 3 vsldoi8 <0,3,1,4>, <0,3,1,4>
+ 2692276562U, // <u,4,0,4>: Cost 3 vsldoi8 <1,2,u,4>, <0,4,1,5>
+ 1705438098U, // <u,4,0,5>: Cost 2 vsldoi12 RHS, <4,0,5,1>
+ 2658685890U, // <u,4,0,6>: Cost 3 vsldoi4 <6,u,4,0>, <6,u,4,0>
+ 2256489928U, // <u,4,0,7>: Cost 3 vmrghw <7,0,1,2>, <4,7,5,0>
+ 1618535069U, // <u,4,0,u>: Cost 2 vsldoi8 <1,2,u,4>, LHS
+ 1189464978U, // <u,4,1,0>: Cost 2 vmrghw LHS, <4,0,5,1>
+ 2692277044U, // <u,4,1,1>: Cost 3 vsldoi8 <1,2,u,4>, <1,1,1,1>
+ 1618535367U, // <u,4,1,2>: Cost 2 vsldoi8 <1,2,u,4>, <1,2,u,4>
+ 2640775992U, // <u,4,1,3>: Cost 3 vsldoi4 <3,u,4,1>, <3,u,4,1>
+ 1189465296U, // <u,4,1,4>: Cost 2 vmrghw LHS, <4,4,4,4>
+ 115723574U, // <u,4,1,5>: Cost 1 vmrghw LHS, RHS
+ 2263207289U, // <u,4,1,6>: Cost 3 vmrghw LHS, <4,6,5,2>
+ 2664666780U, // <u,4,1,7>: Cost 3 vsldoi4 <7,u,4,1>, <7,u,4,1>
+ 115723817U, // <u,4,1,u>: Cost 1 vmrghw LHS, RHS
+ 2263919506U, // <u,4,2,0>: Cost 3 vmrghw <u,2,3,0>, <4,0,5,1>
+ 2222115812U, // <u,4,2,1>: Cost 3 vmrghw <1,2,3,0>, <4,1,5,2>
+ 2692277864U, // <u,4,2,2>: Cost 3 vsldoi8 <1,2,u,4>, <2,2,2,2>
+ 2692277926U, // <u,4,2,3>: Cost 3 vsldoi8 <1,2,u,4>, <2,3,0,1>
+ 2324114640U, // <u,4,2,4>: Cost 3 vmrglw <7,0,u,2>, <4,4,4,4>
+ 1190178102U, // <u,4,2,5>: Cost 2 vmrghw <u,2,3,0>, RHS
+ 2692278202U, // <u,4,2,6>: Cost 3 vsldoi8 <1,2,u,4>, <2,6,3,7>
+ 2701568053U, // <u,4,2,7>: Cost 3 vsldoi8 <2,7,u,4>, <2,7,u,4>
+ 1190178345U, // <u,4,2,u>: Cost 2 vmrghw <u,2,3,0>, RHS
+ 2692278422U, // <u,4,3,0>: Cost 3 vsldoi8 <1,2,u,4>, <3,0,1,2>
+ 2282981552U, // <u,4,3,1>: Cost 3 vmrglw LHS, <3,0,4,1>
+ 2704222585U, // <u,4,3,2>: Cost 3 vsldoi8 <3,2,u,4>, <3,2,u,4>
+ 2692278684U, // <u,4,3,3>: Cost 3 vsldoi8 <1,2,u,4>, <3,3,3,3>
+ 1257016528U, // <u,4,3,4>: Cost 2 vmrglw LHS, <4,4,4,4>
+ 1209239246U, // <u,4,3,5>: Cost 2 vmrglw LHS, <2,3,4,5>
+ 2691910300U, // <u,4,3,6>: Cost 3 vsldoi8 <1,2,3,4>, <3,6,4,7>
+ 2664683166U, // <u,4,3,7>: Cost 3 vsldoi4 <7,u,4,3>, <7,u,4,3>
+ 1209239249U, // <u,4,3,u>: Cost 2 vmrglw LHS, <2,3,4,u>
+ 1573027942U, // <u,4,4,0>: Cost 2 vsldoi4 <4,u,4,4>, LHS
+ 2634826695U, // <u,4,4,1>: Cost 3 vsldoi4 <2,u,4,4>, <1,2,u,4>
+ 2634827874U, // <u,4,4,2>: Cost 3 vsldoi4 <2,u,4,4>, <2,u,4,4>
+ 2289629073U, // <u,4,4,3>: Cost 3 vmrglw <1,2,u,4>, <u,2,4,3>
+ 229035318U, // <u,4,4,4>: Cost 1 vspltisw0 RHS
+ 1618537782U, // <u,4,4,5>: Cost 2 vsldoi8 <1,2,u,4>, RHS
+ 2658718662U, // <u,4,4,6>: Cost 3 vsldoi4 <6,u,4,4>, <6,u,4,4>
+ 2289629401U, // <u,4,4,7>: Cost 3 vmrglw <1,2,u,4>, <u,6,4,7>
+ 229035318U, // <u,4,4,u>: Cost 1 vspltisw0 RHS
+ 1561092198U, // <u,4,5,0>: Cost 2 vsldoi4 <2,u,4,5>, LHS
+ 2628863370U, // <u,4,5,1>: Cost 3 vsldoi4 <1,u,4,5>, <1,u,4,5>
+ 1561094243U, // <u,4,5,2>: Cost 2 vsldoi4 <2,u,4,5>, <2,u,4,5>
+ 2634836118U, // <u,4,5,3>: Cost 3 vsldoi4 <2,u,4,5>, <3,0,1,2>
+ 1561095478U, // <u,4,5,4>: Cost 2 vsldoi4 <2,u,4,5>, RHS
+ 118705462U, // <u,4,5,5>: Cost 1 vmrghw RHS, RHS
+ 604859702U, // <u,4,5,6>: Cost 1 vsldoi12 LHS, RHS
+ 2658726906U, // <u,4,5,7>: Cost 3 vsldoi4 <6,u,4,5>, <7,0,1,2>
+ 604859720U, // <u,4,5,u>: Cost 1 vsldoi12 LHS, RHS
+ 2266631058U, // <u,4,6,0>: Cost 3 vmrghw <u,6,3,7>, <4,0,5,1>
+ 2302692152U, // <u,4,6,1>: Cost 3 vmrglw <3,4,5,6>, <3,u,4,1>
+ 2718822906U, // <u,4,6,2>: Cost 3 vsldoi8 <5,6,u,4>, <6,2,7,3>
+ 2722804309U, // <u,4,6,3>: Cost 3 vsldoi8 <6,3,u,4>, <6,3,u,4>
+ 2723467942U, // <u,4,6,4>: Cost 3 vsldoi8 <6,4,u,4>, <6,4,u,4>
+ 1192889654U, // <u,4,6,5>: Cost 2 vmrghw <u,6,3,7>, RHS
+ 2718823224U, // <u,4,6,6>: Cost 3 vsldoi8 <5,6,u,4>, <6,6,6,6>
+ 2718823246U, // <u,4,6,7>: Cost 3 vsldoi8 <5,6,u,4>, <6,7,0,1>
+ 1192889897U, // <u,4,6,u>: Cost 2 vmrghw <u,6,3,7>, RHS
+ 2640822374U, // <u,4,7,0>: Cost 3 vsldoi4 <3,u,4,7>, LHS
+ 2640823194U, // <u,4,7,1>: Cost 3 vsldoi4 <3,u,4,7>, <1,2,3,4>
+ 2728113373U, // <u,4,7,2>: Cost 3 vsldoi8 <7,2,u,4>, <7,2,u,4>
+ 2640825150U, // <u,4,7,3>: Cost 3 vsldoi4 <3,u,4,7>, <3,u,4,7>
+ 1235815632U, // <u,4,7,4>: Cost 2 vmrglw RHS, <4,4,4,4>
+ 1235814094U, // <u,4,7,5>: Cost 2 vmrglw RHS, <2,3,4,5>
+ 2730767905U, // <u,4,7,6>: Cost 3 vsldoi8 <7,6,u,4>, <7,6,u,4>
+ 2309556892U, // <u,4,7,7>: Cost 3 vmrglw RHS, <3,6,4,7>
+ 1235814097U, // <u,4,7,u>: Cost 2 vmrglw RHS, <2,3,4,u>
+ 1561116774U, // <u,4,u,0>: Cost 2 vsldoi4 <2,u,4,u>, LHS
+ 1618540334U, // <u,4,u,1>: Cost 2 vsldoi8 <1,2,u,4>, LHS
+ 1561118822U, // <u,4,u,2>: Cost 2 vsldoi4 <2,u,4,u>, <2,u,4,u>
+ 2692282300U, // <u,4,u,3>: Cost 3 vsldoi8 <1,2,u,4>, <u,3,0,1>
+ 229035318U, // <u,4,u,4>: Cost 1 vspltisw0 RHS
+ 120368438U, // <u,4,u,5>: Cost 1 vmrghw LHS, RHS
+ 604859945U, // <u,4,u,6>: Cost 1 vsldoi12 LHS, RHS
+ 2309565084U, // <u,4,u,7>: Cost 3 vmrglw RHS, <3,6,4,7>
+ 604859963U, // <u,4,u,u>: Cost 1 vsldoi12 LHS, RHS
+ 2690293760U, // <u,5,0,0>: Cost 3 vsldoi8 <0,u,u,5>, <0,0,0,0>
+ 1616552038U, // <u,5,0,1>: Cost 2 vsldoi8 <0,u,u,5>, LHS
+ 2640840434U, // <u,5,0,2>: Cost 3 vsldoi4 <3,u,5,0>, <2,3,u,5>
+ 2640841536U, // <u,5,0,3>: Cost 3 vsldoi4 <3,u,5,0>, <3,u,5,0>
+ 1613381970U, // <u,5,0,4>: Cost 2 vsldoi8 <0,4,1,5>, <0,4,1,5>
+ 2316135642U, // <u,5,0,5>: Cost 3 vmrglw <5,6,u,0>, <4,4,5,5>
+ 2289592834U, // <u,5,0,6>: Cost 3 vmrglw <1,2,u,0>, <3,4,5,6>
+ 2664732324U, // <u,5,0,7>: Cost 3 vsldoi4 <7,u,5,0>, <7,u,5,0>
+ 1616552661U, // <u,5,0,u>: Cost 2 vsldoi8 <0,u,u,5>, <0,u,u,5>
+ 1573077094U, // <u,5,1,0>: Cost 2 vsldoi4 <4,u,5,1>, LHS
+ 1237536282U, // <u,5,1,1>: Cost 2 vmrglw <4,u,5,1>, <4,u,5,1>
+ 2690294678U, // <u,5,1,2>: Cost 3 vsldoi8 <0,u,u,5>, <1,2,3,0>
+ 2646821014U, // <u,5,1,3>: Cost 3 vsldoi4 <4,u,5,1>, <3,0,1,2>
+ 1573080602U, // <u,5,1,4>: Cost 2 vsldoi4 <4,u,5,1>, <4,u,5,1>
+ 1189466116U, // <u,5,1,5>: Cost 2 vmrghw LHS, <5,5,5,5>
+ 1189466210U, // <u,5,1,6>: Cost 2 vmrghw LHS, <5,6,7,0>
+ 2646823930U, // <u,5,1,7>: Cost 3 vsldoi4 <4,u,5,1>, <7,0,1,2>
+ 1573082926U, // <u,5,1,u>: Cost 2 vsldoi4 <4,u,5,1>, LHS
+ 2640855142U, // <u,5,2,0>: Cost 3 vsldoi4 <3,u,5,2>, LHS
+ 2697594448U, // <u,5,2,1>: Cost 3 vsldoi8 <2,1,u,5>, <2,1,u,5>
+ 2690295400U, // <u,5,2,2>: Cost 3 vsldoi8 <0,u,u,5>, <2,2,2,2>
+ 1625179890U, // <u,5,2,3>: Cost 2 vsldoi8 <2,3,u,5>, <2,3,u,5>
+ 2699585347U, // <u,5,2,4>: Cost 3 vsldoi8 <2,4,u,5>, <2,4,u,5>
+ 2781171471U, // <u,5,2,5>: Cost 3 vsldoi12 RHS, <5,2,5,3>
+ 2690295738U, // <u,5,2,6>: Cost 3 vsldoi8 <0,u,u,5>, <2,6,3,7>
+ 3775318070U, // <u,5,2,7>: Cost 4 vsldoi8 <2,7,u,5>, <2,7,u,5>
+ 1628498055U, // <u,5,2,u>: Cost 2 vsldoi8 <2,u,u,5>, <2,u,u,5>
+ 2287627234U, // <u,5,3,0>: Cost 3 vmrglw LHS, <4,1,5,0>
+ 1257016210U, // <u,5,3,1>: Cost 2 vmrglw LHS, <4,0,5,1>
+ 2646836942U, // <u,5,3,2>: Cost 3 vsldoi4 <4,u,5,3>, <2,3,4,5>
+ 2287625131U, // <u,5,3,3>: Cost 3 vmrglw LHS, <1,2,5,3>
+ 2287627238U, // <u,5,3,4>: Cost 3 vmrglw LHS, <4,1,5,4>
+ 1257016538U, // <u,5,3,5>: Cost 2 vmrglw LHS, <4,4,5,5>
+ 1209240066U, // <u,5,3,6>: Cost 2 vmrglw LHS, <3,4,5,6>
+ 2287625459U, // <u,5,3,7>: Cost 3 vmrglw LHS, <1,6,5,7>
+ 1209240068U, // <u,5,3,u>: Cost 2 vmrglw LHS, <3,4,5,u>
+ 2640871526U, // <u,5,4,0>: Cost 3 vsldoi4 <3,u,5,4>, LHS
+ 2316168082U, // <u,5,4,1>: Cost 3 vmrglw <5,6,u,4>, <4,0,5,1>
+ 2640873202U, // <u,5,4,2>: Cost 3 vsldoi4 <3,u,5,4>, <2,3,u,5>
+ 2640874308U, // <u,5,4,3>: Cost 3 vsldoi4 <3,u,5,4>, <3,u,5,4>
+ 1637788917U, // <u,5,4,4>: Cost 2 vsldoi8 <4,4,u,5>, <4,4,u,5>
+ 1616555318U, // <u,5,4,5>: Cost 2 vsldoi8 <0,u,u,5>, RHS
+ 2287638591U, // <u,5,4,6>: Cost 3 vmrglw <0,u,u,4>, <u,4,5,6>
+ 2664765096U, // <u,5,4,7>: Cost 3 vsldoi4 <7,u,5,4>, <7,u,5,4>
+ 1616555561U, // <u,5,4,u>: Cost 2 vsldoi8 <0,u,u,5>, RHS
+ 1573109862U, // <u,5,5,0>: Cost 2 vsldoi4 <4,u,5,5>, LHS
+ 2646852404U, // <u,5,5,1>: Cost 3 vsldoi4 <4,u,5,5>, <1,1,1,1>
+ 2646853224U, // <u,5,5,2>: Cost 3 vsldoi4 <4,u,5,5>, <2,2,2,2>
+ 2287646618U, // <u,5,5,3>: Cost 3 vmrglw <0,u,u,5>, <u,2,5,3>
+ 1573113374U, // <u,5,5,4>: Cost 2 vsldoi4 <4,u,5,5>, <4,u,5,5>
+ 296144182U, // <u,5,5,5>: Cost 1 vspltisw1 RHS
+ 1192448098U, // <u,5,5,6>: Cost 2 vmrghw RHS, <5,6,7,0>
+ 2287646946U, // <u,5,5,7>: Cost 3 vmrglw <0,u,u,5>, <u,6,5,7>
+ 296144182U, // <u,5,5,u>: Cost 1 vspltisw1 RHS
+ 1567146086U, // <u,5,6,0>: Cost 2 vsldoi4 <3,u,5,6>, LHS
+ 2628945300U, // <u,5,6,1>: Cost 3 vsldoi4 <1,u,5,6>, <1,u,5,6>
+ 2634917997U, // <u,5,6,2>: Cost 3 vsldoi4 <2,u,5,6>, <2,u,5,6>
+ 1567148870U, // <u,5,6,3>: Cost 2 vsldoi4 <3,u,5,6>, <3,u,5,6>
+ 1567149366U, // <u,5,6,4>: Cost 2 vsldoi4 <3,u,5,6>, RHS
+ 2781171799U, // <u,5,6,5>: Cost 3 vsldoi12 RHS, <5,6,5,7>
+ 1228950018U, // <u,5,6,6>: Cost 2 vmrglw <3,4,5,6>, <3,4,5,6>
+ 27705344U, // <u,5,6,7>: Cost 0 copy RHS
+ 27705344U, // <u,5,6,u>: Cost 0 copy RHS
+ 2628952166U, // <u,5,7,0>: Cost 3 vsldoi4 <1,u,5,7>, LHS
+ 1235815314U, // <u,5,7,1>: Cost 2 vmrglw RHS, <4,0,5,1>
+ 2309556734U, // <u,5,7,2>: Cost 3 vmrglw RHS, <3,4,5,2>
+ 2309555115U, // <u,5,7,3>: Cost 3 vmrglw RHS, <1,2,5,3>
+ 2628955446U, // <u,5,7,4>: Cost 3 vsldoi4 <1,u,5,7>, RHS
+ 1235815642U, // <u,5,7,5>: Cost 2 vmrglw RHS, <4,4,5,5>
+ 1235814914U, // <u,5,7,6>: Cost 2 vmrglw RHS, <3,4,5,6>
+ 2309555443U, // <u,5,7,7>: Cost 3 vmrglw RHS, <1,6,5,7>
+ 1235814916U, // <u,5,7,u>: Cost 2 vmrglw RHS, <3,4,5,u>
+ 1567162470U, // <u,5,u,0>: Cost 2 vsldoi4 <3,u,5,u>, LHS
+ 1616557870U, // <u,5,u,1>: Cost 2 vsldoi8 <0,u,u,5>, LHS
+ 2690299781U, // <u,5,u,2>: Cost 3 vsldoi8 <0,u,u,5>, <u,2,3,0>
+ 1567165256U, // <u,5,u,3>: Cost 2 vsldoi4 <3,u,5,u>, <3,u,5,u>
+ 1567165750U, // <u,5,u,4>: Cost 2 vsldoi4 <3,u,5,u>, RHS
+ 296144182U, // <u,5,u,5>: Cost 1 vspltisw1 RHS
+ 1209281026U, // <u,5,u,6>: Cost 2 vmrglw LHS, <3,4,5,6>
+ 27705344U, // <u,5,u,7>: Cost 0 copy RHS
+ 27705344U, // <u,5,u,u>: Cost 0 copy RHS
+ 2705563648U, // <u,6,0,0>: Cost 3 vsldoi8 <3,4,u,6>, <0,0,0,0>
+ 1631821926U, // <u,6,0,1>: Cost 2 vsldoi8 <3,4,u,6>, LHS
+ 2262462970U, // <u,6,0,2>: Cost 3 vmrghw <u,0,1,2>, <6,2,7,3>
+ 2646886941U, // <u,6,0,3>: Cost 3 vsldoi4 <4,u,6,0>, <3,4,u,6>
+ 2705563986U, // <u,6,0,4>: Cost 3 vsldoi8 <3,4,u,6>, <0,4,1,5>
+ 2316062652U, // <u,6,0,5>: Cost 3 vmrglw <5,6,7,0>, <5,4,6,5>
+ 2316137272U, // <u,6,0,6>: Cost 3 vmrglw <5,6,u,0>, <6,6,6,6>
+ 1215851830U, // <u,6,0,7>: Cost 2 vmrglw <1,2,u,0>, RHS
+ 1215851831U, // <u,6,0,u>: Cost 2 vmrglw <1,2,u,0>, RHS
+ 2634948710U, // <u,6,1,0>: Cost 3 vsldoi4 <2,u,6,1>, LHS
+ 2705564468U, // <u,6,1,1>: Cost 3 vsldoi8 <3,4,u,6>, <1,1,1,1>
+ 1189466618U, // <u,6,1,2>: Cost 2 vmrghw LHS, <6,2,7,3>
+ 2263208498U, // <u,6,1,3>: Cost 3 vmrghw LHS, <6,3,4,5>
+ 2693620843U, // <u,6,1,4>: Cost 3 vsldoi8 <1,4,u,6>, <1,4,u,6>
+ 2652868860U, // <u,6,1,5>: Cost 3 vsldoi4 <5,u,6,1>, <5,u,6,1>
+ 1189466936U, // <u,6,1,6>: Cost 2 vmrghw LHS, <6,6,6,6>
+ 1213869366U, // <u,6,1,7>: Cost 2 vmrglw <0,u,u,1>, RHS
+ 1213869367U, // <u,6,1,u>: Cost 2 vmrglw <0,u,u,1>, RHS
+ 2658844774U, // <u,6,2,0>: Cost 3 vsldoi4 <6,u,6,2>, LHS
+ 3771344465U, // <u,6,2,1>: Cost 4 vsldoi8 <2,1,u,6>, <2,1,u,6>
+ 1178554874U, // <u,6,2,2>: Cost 2 vmrghw <6,2,7,3>, <6,2,7,3>
+ 2698929907U, // <u,6,2,3>: Cost 3 vsldoi8 <2,3,u,6>, <2,3,u,6>
+ 2699593540U, // <u,6,2,4>: Cost 3 vsldoi8 <2,4,u,6>, <2,4,u,6>
+ 2700257173U, // <u,6,2,5>: Cost 3 vsldoi8 <2,5,u,6>, <2,5,u,6>
+ 2705565626U, // <u,6,2,6>: Cost 3 vsldoi8 <3,4,u,6>, <2,6,3,7>
+ 1226485046U, // <u,6,2,7>: Cost 2 vmrglw <3,0,u,2>, RHS
+ 1226485047U, // <u,6,2,u>: Cost 2 vmrglw <3,0,u,2>, RHS
+ 2705565846U, // <u,6,3,0>: Cost 3 vsldoi8 <3,4,u,6>, <3,0,1,2>
+ 2330756585U, // <u,6,3,1>: Cost 3 vmrglw LHS, <2,0,6,1>
+ 2330756829U, // <u,6,3,2>: Cost 3 vmrglw LHS, <2,3,6,2>
+ 2282981734U, // <u,6,3,3>: Cost 3 vmrglw LHS, <3,2,6,3>
+ 1631824413U, // <u,6,3,4>: Cost 2 vsldoi8 <3,4,u,6>, <3,4,u,6>
+ 2652885246U, // <u,6,3,5>: Cost 3 vsldoi4 <5,u,6,3>, <5,u,6,3>
+ 1257018168U, // <u,6,3,6>: Cost 2 vmrglw LHS, <6,6,6,6>
+ 135499062U, // <u,6,3,7>: Cost 1 vmrglw LHS, RHS
+ 135499063U, // <u,6,3,u>: Cost 1 vmrglw LHS, RHS
+ 2646917222U, // <u,6,4,0>: Cost 3 vsldoi4 <4,u,6,4>, LHS
+ 2217365931U, // <u,6,4,1>: Cost 3 vmrghw <0,4,1,5>, <6,1,7,5>
+ 2790167156U, // <u,6,4,2>: Cost 3 vsldoi12 <6,4,2,u>, <6,4,2,u>
+ 2646919709U, // <u,6,4,3>: Cost 3 vsldoi4 <4,u,6,4>, <3,4,u,6>
+ 2711538934U, // <u,6,4,4>: Cost 3 vsldoi8 <4,4,u,6>, <4,4,u,6>
+ 1631825206U, // <u,6,4,5>: Cost 2 vsldoi8 <3,4,u,6>, RHS
+ 2316170040U, // <u,6,4,6>: Cost 3 vmrglw <5,6,u,4>, <6,6,6,6>
+ 1215884598U, // <u,6,4,7>: Cost 2 vmrglw <1,2,u,4>, RHS
+ 1215884599U, // <u,6,4,u>: Cost 2 vmrglw <1,2,u,4>, RHS
+ 2634981478U, // <u,6,5,0>: Cost 3 vsldoi4 <2,u,6,5>, LHS
+ 2266190247U, // <u,6,5,1>: Cost 3 vmrghw RHS, <6,1,7,1>
+ 1192448506U, // <u,6,5,2>: Cost 2 vmrghw RHS, <6,2,7,3>
+ 2266190386U, // <u,6,5,3>: Cost 3 vmrghw RHS, <6,3,4,5>
+ 2634984758U, // <u,6,5,4>: Cost 3 vsldoi4 <2,u,6,5>, RHS
+ 2652901632U, // <u,6,5,5>: Cost 3 vsldoi4 <5,u,6,5>, <5,u,6,5>
+ 1192448824U, // <u,6,5,6>: Cost 2 vmrghw RHS, <6,6,6,6>
+ 1213902134U, // <u,6,5,7>: Cost 2 vmrglw <0,u,u,5>, RHS
+ 1213902135U, // <u,6,5,u>: Cost 2 vmrglw <0,u,u,5>, RHS
+ 1583808614U, // <u,6,6,0>: Cost 2 vsldoi4 <6,6,6,6>, LHS
+ 2322010445U, // <u,6,6,1>: Cost 3 vmrglw <6,6,6,6>, <6,0,6,1>
+ 2718839290U, // <u,6,6,2>: Cost 3 vsldoi8 <5,6,u,6>, <6,2,7,3>
+ 2670823965U, // <u,6,6,3>: Cost 3 vsldoi4 <u,u,6,6>, <3,4,u,6>
+ 1583811894U, // <u,6,6,4>: Cost 2 vsldoi4 <6,6,6,6>, RHS
+ 2724147961U, // <u,6,6,5>: Cost 3 vsldoi8 <6,5,u,6>, <6,5,u,6>
+ 363253046U, // <u,6,6,6>: Cost 1 vspltisw2 RHS
+ 1229172022U, // <u,6,6,7>: Cost 2 vmrglw <3,4,u,6>, RHS
+ 363253046U, // <u,6,6,u>: Cost 1 vspltisw2 RHS
+ 499458150U, // <u,6,7,0>: Cost 1 vsldoi4 RHS, LHS
+ 1573200692U, // <u,6,7,1>: Cost 2 vsldoi4 RHS, <1,1,1,1>
+ 1573201512U, // <u,6,7,2>: Cost 2 vsldoi4 RHS, <2,2,2,2>
+ 1573202070U, // <u,6,7,3>: Cost 2 vsldoi4 RHS, <3,0,1,2>
+ 499461673U, // <u,6,7,4>: Cost 1 vsldoi4 RHS, RHS
+ 1573203972U, // <u,6,7,5>: Cost 2 vsldoi4 RHS, <5,5,5,5>
+ 1235817272U, // <u,6,7,6>: Cost 2 vmrglw RHS, <6,6,6,6>
+ 162073910U, // <u,6,7,7>: Cost 1 vmrglw RHS, RHS
+ 162073911U, // <u,6,7,u>: Cost 1 vmrglw RHS, RHS
+ 499466342U, // <u,6,u,0>: Cost 1 vsldoi4 RHS, LHS
+ 1631827758U, // <u,6,u,1>: Cost 2 vsldoi8 <3,4,u,6>, LHS
+ 1573209704U, // <u,6,u,2>: Cost 2 vsldoi4 RHS, <2,2,2,2>
+ 1573210262U, // <u,6,u,3>: Cost 2 vsldoi4 RHS, <3,0,1,2>
+ 499469866U, // <u,6,u,4>: Cost 1 vsldoi4 RHS, RHS
+ 1631828122U, // <u,6,u,5>: Cost 2 vsldoi8 <3,4,u,6>, RHS
+ 363253046U, // <u,6,u,6>: Cost 1 vspltisw2 RHS
+ 135540022U, // <u,6,u,7>: Cost 1 vmrglw LHS, RHS
+ 135540023U, // <u,6,u,u>: Cost 1 vmrglw LHS, RHS
+ 1638465536U, // <u,7,0,0>: Cost 2 vsldoi8 RHS, <0,0,0,0>
+ 564723814U, // <u,7,0,1>: Cost 1 vsldoi8 RHS, LHS
+ 2712207533U, // <u,7,0,2>: Cost 3 vsldoi8 RHS, <0,2,1,2>
+ 2712207612U, // <u,7,0,3>: Cost 3 vsldoi8 RHS, <0,3,1,0>
+ 1638465874U, // <u,7,0,4>: Cost 2 vsldoi8 RHS, <0,4,1,5>
+ 1579192580U, // <u,7,0,5>: Cost 2 vsldoi4 <5,u,7,0>, <5,u,7,0>
+ 2712207862U, // <u,7,0,6>: Cost 3 vsldoi8 RHS, <0,6,1,7>
+ 2316137282U, // <u,7,0,7>: Cost 3 vmrglw <5,6,u,0>, <6,6,7,7>
+ 564724381U, // <u,7,0,u>: Cost 1 vsldoi8 RHS, LHS
+ 1189467130U, // <u,7,1,0>: Cost 2 vmrghw LHS, <7,0,1,2>
+ 1638466356U, // <u,7,1,1>: Cost 2 vsldoi8 RHS, <1,1,1,1>
+ 1638466454U, // <u,7,1,2>: Cost 2 vsldoi8 RHS, <1,2,3,0>
+ 2311500282U, // <u,7,1,3>: Cost 3 vmrglw <4,u,u,1>, <6,2,7,3>
+ 1189467494U, // <u,7,1,4>: Cost 2 vmrghw LHS, <7,4,5,6>
+ 2712208495U, // <u,7,1,5>: Cost 3 vsldoi8 RHS, <1,5,0,1>
+ 2694956302U, // <u,7,1,6>: Cost 3 vsldoi8 <1,6,u,7>, <1,6,u,7>
+ 1189467756U, // <u,7,1,7>: Cost 2 vmrghw LHS, <7,7,7,7>
+ 1638466940U, // <u,7,1,u>: Cost 2 vsldoi8 RHS, <1,u,3,0>
+ 2712208829U, // <u,7,2,0>: Cost 3 vsldoi8 RHS, <2,0,1,2>
+ 2712208927U, // <u,7,2,1>: Cost 3 vsldoi8 RHS, <2,1,3,1>
+ 1638467176U, // <u,7,2,2>: Cost 2 vsldoi8 RHS, <2,2,2,2>
+ 1638467238U, // <u,7,2,3>: Cost 2 vsldoi8 RHS, <2,3,0,1>
+ 2712209165U, // <u,7,2,4>: Cost 3 vsldoi8 RHS, <2,4,2,5>
+ 2712209256U, // <u,7,2,5>: Cost 3 vsldoi8 RHS, <2,5,3,6>
+ 1627187175U, // <u,7,2,6>: Cost 2 vsldoi8 <2,6,u,7>, <2,6,u,7>
+ 2324116290U, // <u,7,2,7>: Cost 3 vmrglw <7,0,u,2>, <6,6,7,7>
+ 1628514441U, // <u,7,2,u>: Cost 2 vsldoi8 <2,u,u,7>, <2,u,u,7>
+ 1638467734U, // <u,7,3,0>: Cost 2 vsldoi8 RHS, <3,0,1,2>
+ 2712209638U, // <u,7,3,1>: Cost 3 vsldoi8 RHS, <3,1,1,1>
+ 2700929387U, // <u,7,3,2>: Cost 3 vsldoi8 <2,6,u,7>, <3,2,6,u>
+ 1638467996U, // <u,7,3,3>: Cost 2 vsldoi8 RHS, <3,3,3,3>
+ 1638468098U, // <u,7,3,4>: Cost 2 vsldoi8 RHS, <3,4,5,6>
+ 2712210002U, // <u,7,3,5>: Cost 3 vsldoi8 RHS, <3,5,5,5>
+ 1585189856U, // <u,7,3,6>: Cost 2 vsldoi4 <6,u,7,3>, <6,u,7,3>
+ 1257018178U, // <u,7,3,7>: Cost 2 vmrglw LHS, <6,6,7,7>
+ 1638468382U, // <u,7,3,u>: Cost 2 vsldoi8 RHS, <3,u,1,2>
+ 1638468498U, // <u,7,4,0>: Cost 2 vsldoi8 RHS, <4,0,5,1>
+ 2712210378U, // <u,7,4,1>: Cost 3 vsldoi8 RHS, <4,1,2,3>
+ 2712210485U, // <u,7,4,2>: Cost 3 vsldoi8 RHS, <4,2,5,2>
+ 2712210564U, // <u,7,4,3>: Cost 3 vsldoi8 RHS, <4,3,5,0>
+ 1638468816U, // <u,7,4,4>: Cost 2 vsldoi8 RHS, <4,4,4,4>
+ 564727112U, // <u,7,4,5>: Cost 1 vsldoi8 RHS, RHS
+ 2712210809U, // <u,7,4,6>: Cost 3 vsldoi8 RHS, <4,6,5,2>
+ 2712210888U, // <u,7,4,7>: Cost 3 vsldoi8 RHS, <4,7,5,0>
+ 564727337U, // <u,7,4,u>: Cost 1 vsldoi8 RHS, RHS
+ 1192449018U, // <u,7,5,0>: Cost 2 vmrghw RHS, <7,0,1,2>
+ 2714201743U, // <u,7,5,1>: Cost 3 vsldoi8 RHS, <5,1,0,1>
+ 2712211198U, // <u,7,5,2>: Cost 3 vsldoi8 RHS, <5,2,3,4>
+ 2311533050U, // <u,7,5,3>: Cost 3 vmrglw <4,u,u,5>, <6,2,7,3>
+ 1192449382U, // <u,7,5,4>: Cost 2 vmrghw RHS, <7,4,5,6>
+ 1638469636U, // <u,7,5,5>: Cost 2 vsldoi8 RHS, <5,5,5,5>
+ 1638469730U, // <u,7,5,6>: Cost 2 vsldoi8 RHS, <5,6,7,0>
+ 1192449644U, // <u,7,5,7>: Cost 2 vmrghw RHS, <7,7,7,7>
+ 1638469892U, // <u,7,5,u>: Cost 2 vsldoi8 RHS, <5,u,7,0>
+ 2712211745U, // <u,7,6,0>: Cost 3 vsldoi8 RHS, <6,0,1,2>
+ 2712211879U, // <u,7,6,1>: Cost 3 vsldoi8 RHS, <6,1,7,1>
+ 1638470138U, // <u,7,6,2>: Cost 2 vsldoi8 RHS, <6,2,7,3>
+ 2712212018U, // <u,7,6,3>: Cost 3 vsldoi8 RHS, <6,3,4,5>
+ 2712212109U, // <u,7,6,4>: Cost 3 vsldoi8 RHS, <6,4,5,6>
+ 2712212203U, // <u,7,6,5>: Cost 3 vsldoi8 RHS, <6,5,7,1>
+ 1638470456U, // <u,7,6,6>: Cost 2 vsldoi8 RHS, <6,6,6,6>
+ 1638470478U, // <u,7,6,7>: Cost 2 vsldoi8 RHS, <6,7,0,1>
+ 1638470559U, // <u,7,6,u>: Cost 2 vsldoi8 RHS, <6,u,0,1>
+ 1235816546U, // <u,7,7,0>: Cost 2 vmrglw RHS, <5,6,7,0>
+ 2309558371U, // <u,7,7,1>: Cost 3 vmrglw RHS, <5,6,7,1>
+ 2641045434U, // <u,7,7,2>: Cost 3 vsldoi4 <3,u,7,7>, <2,6,3,7>
+ 1235816954U, // <u,7,7,3>: Cost 2 vmrglw RHS, <6,2,7,3>
+ 1235816550U, // <u,7,7,4>: Cost 2 vmrglw RHS, <5,6,7,4>
+ 2309558375U, // <u,7,7,5>: Cost 3 vmrglw RHS, <5,6,7,5>
+ 1585222628U, // <u,7,7,6>: Cost 2 vsldoi4 <6,u,7,7>, <6,u,7,7>
+ 430361910U, // <u,7,7,7>: Cost 1 vspltisw3 RHS
+ 430361910U, // <u,7,7,u>: Cost 1 vspltisw3 RHS
+ 1638471379U, // <u,7,u,0>: Cost 2 vsldoi8 RHS, <u,0,1,2>
+ 564729646U, // <u,7,u,1>: Cost 1 vsldoi8 RHS, LHS
+ 1638471557U, // <u,7,u,2>: Cost 2 vsldoi8 RHS, <u,2,3,0>
+ 1638471612U, // <u,7,u,3>: Cost 2 vsldoi8 RHS, <u,3,0,1>
+ 1638471743U, // <u,7,u,4>: Cost 2 vsldoi8 RHS, <u,4,5,6>
+ 564730010U, // <u,7,u,5>: Cost 1 vsldoi8 RHS, RHS
+ 1638471888U, // <u,7,u,6>: Cost 2 vsldoi8 RHS, <u,6,3,7>
+ 430361910U, // <u,7,u,7>: Cost 1 vspltisw3 RHS
+ 564730213U, // <u,7,u,u>: Cost 1 vsldoi8 RHS, LHS
+ 202162278U, // <u,u,0,0>: Cost 1 vspltisw0 LHS
+ 538189985U, // <u,u,0,1>: Cost 1 vsldoi8 LHS, LHS
+ 2685673645U, // <u,u,0,2>: Cost 3 vsldoi8 LHS, <0,2,1,2>
+ 1215848604U, // <u,u,0,3>: Cost 2 vmrglw <1,2,u,0>, LHS
+ 1611931986U, // <u,u,0,4>: Cost 2 vsldoi8 LHS, <0,4,1,5>
+ 1579266317U, // <u,u,0,5>: Cost 2 vsldoi4 <5,u,u,0>, <5,u,u,0>
+ 2289592861U, // <u,u,0,6>: Cost 3 vmrglw <1,2,u,0>, <3,4,u,6>
+ 1215851848U, // <u,u,0,7>: Cost 2 vmrglw <1,2,u,0>, RHS
+ 538190493U, // <u,u,0,u>: Cost 1 vsldoi8 LHS, LHS
+ 1549411025U, // <u,u,1,0>: Cost 2 vsldoi4 <0,u,u,1>, <0,u,u,1>
+ 115726126U, // <u,u,1,1>: Cost 1 vmrghw LHS, LHS
+ 604862254U, // <u,u,1,2>: Cost 1 vsldoi12 LHS, LHS
+ 1213866140U, // <u,u,1,3>: Cost 2 vmrglw <0,u,u,1>, LHS
+ 1549413686U, // <u,u,1,4>: Cost 2 vsldoi4 <0,u,u,1>, RHS
+ 115726490U, // <u,u,1,5>: Cost 1 vmrghw LHS, RHS
+ 1585247207U, // <u,u,1,6>: Cost 2 vsldoi4 <6,u,u,1>, <6,u,u,1>
+ 1213869384U, // <u,u,1,7>: Cost 2 vmrglw <0,u,u,1>, RHS
+ 604862308U, // <u,u,1,u>: Cost 1 vsldoi12 LHS, LHS
+ 1567334502U, // <u,u,2,0>: Cost 2 vsldoi4 <3,u,u,2>, LHS
+ 1190180654U, // <u,u,2,1>: Cost 2 vmrghw <u,2,3,0>, LHS
+ 336380006U, // <u,u,2,2>: Cost 1 vspltisw2 LHS
+ 835584U, // <u,u,2,3>: Cost 0 copy LHS
+ 1567337782U, // <u,u,2,4>: Cost 2 vsldoi4 <3,u,u,2>, RHS
+ 1190181018U, // <u,u,2,5>: Cost 2 vmrghw <u,2,3,0>, RHS
+ 1611933626U, // <u,u,2,6>: Cost 2 vsldoi8 LHS, <2,6,3,7>
+ 1226485064U, // <u,u,2,7>: Cost 2 vmrglw <3,0,u,2>, RHS
+ 835584U, // <u,u,2,u>: Cost 0 copy LHS
+ 475685587U, // <u,u,3,0>: Cost 1 vsldoi4 LHS, LHS
+ 1209239278U, // <u,u,3,1>: Cost 2 vmrglw LHS, <2,3,u,1>
+ 1209239765U, // <u,u,3,2>: Cost 2 vmrglw LHS, <3,0,u,2>
+ 135495836U, // <u,u,3,3>: Cost 1 vmrglw LHS, LHS
+ 475688246U, // <u,u,3,4>: Cost 1 vsldoi4 LHS, RHS
+ 1209239282U, // <u,u,3,5>: Cost 2 vmrglw LHS, <2,3,u,5>
+ 1209240093U, // <u,u,3,6>: Cost 2 vmrglw LHS, <3,4,u,6>
+ 135499080U, // <u,u,3,7>: Cost 1 vmrglw LHS, RHS
+ 135495841U, // <u,u,3,u>: Cost 1 vmrglw LHS, LHS
+ 1555406950U, // <u,u,4,0>: Cost 2 vsldoi4 <1,u,u,4>, LHS
+ 1555408301U, // <u,u,4,1>: Cost 2 vsldoi4 <1,u,u,4>, <1,u,u,4>
+ 2289625301U, // <u,u,4,2>: Cost 3 vmrglw <1,2,u,4>, <3,0,u,2>
+ 1215881372U, // <u,u,4,3>: Cost 2 vmrglw <1,2,u,4>, LHS
+ 229035318U, // <u,u,4,4>: Cost 1 vspltisw0 RHS
+ 538193206U, // <u,u,4,5>: Cost 1 vsldoi8 LHS, RHS
+ 2289625629U, // <u,u,4,6>: Cost 3 vmrglw <1,2,u,4>, <3,4,u,6>
+ 1215884616U, // <u,u,4,7>: Cost 2 vmrglw <1,2,u,4>, RHS
+ 538193449U, // <u,u,4,u>: Cost 1 vsldoi8 LHS, RHS
+ 1549443797U, // <u,u,5,0>: Cost 2 vsldoi4 <0,u,u,5>, <0,u,u,5>
+ 118708014U, // <u,u,5,1>: Cost 1 vmrghw RHS, LHS
+ 1561389191U, // <u,u,5,2>: Cost 2 vsldoi4 <2,u,u,5>, <2,u,u,5>
+ 1213898908U, // <u,u,5,3>: Cost 2 vmrglw <0,u,u,5>, LHS
+ 1549446454U, // <u,u,5,4>: Cost 2 vsldoi4 <0,u,u,5>, RHS
+ 118708378U, // <u,u,5,5>: Cost 1 vmrghw RHS, RHS
+ 604862618U, // <u,u,5,6>: Cost 1 vsldoi12 LHS, RHS
+ 1213902152U, // <u,u,5,7>: Cost 2 vmrglw <0,u,u,5>, RHS
+ 604862636U, // <u,u,5,u>: Cost 1 vsldoi12 LHS, RHS
+ 1567367270U, // <u,u,6,0>: Cost 2 vsldoi4 <3,u,u,6>, LHS
+ 1192892206U, // <u,u,6,1>: Cost 2 vmrghw <u,6,3,7>, LHS
+ 1638478330U, // <u,u,6,2>: Cost 2 vsldoi8 RHS, <6,2,7,3>
+ 1679046864U, // <u,u,6,3>: Cost 2 vsldoi12 LHS, <u,6,3,7>
+ 1567370550U, // <u,u,6,4>: Cost 2 vsldoi4 <3,u,u,6>, RHS
+ 1192892570U, // <u,u,6,5>: Cost 2 vmrghw <u,6,3,7>, RHS
+ 363253046U, // <u,u,6,6>: Cost 1 vspltisw2 RHS
+ 27705344U, // <u,u,6,7>: Cost 0 copy RHS
+ 27705344U, // <u,u,6,u>: Cost 0 copy RHS
+ 499605606U, // <u,u,7,0>: Cost 1 vsldoi4 RHS, LHS
+ 1235812425U, // <u,u,7,1>: Cost 2 vmrglw RHS, <0,0,u,1>
+ 1561405577U, // <u,u,7,2>: Cost 2 vsldoi4 <2,u,u,7>, <2,u,u,7>
+ 162070684U, // <u,u,7,3>: Cost 1 vmrglw RHS, LHS
+ 499609147U, // <u,u,7,4>: Cost 1 vsldoi4 RHS, RHS
+ 1235812753U, // <u,u,7,5>: Cost 2 vmrglw RHS, <0,4,u,5>
+ 1235814941U, // <u,u,7,6>: Cost 2 vmrglw RHS, <3,4,u,6>
+ 162073928U, // <u,u,7,7>: Cost 1 vmrglw RHS, RHS
+ 162070689U, // <u,u,7,u>: Cost 1 vmrglw RHS, LHS
+ 475726552U, // <u,u,u,0>: Cost 1 vsldoi4 LHS, LHS
+ 538195758U, // <u,u,u,1>: Cost 1 vsldoi8 LHS, LHS
+ 604862821U, // <u,u,u,2>: Cost 1 vsldoi12 LHS, LHS
+ 835584U, // <u,u,u,3>: Cost 0 copy LHS
+ 475729206U, // <u,u,u,4>: Cost 1 vsldoi4 LHS, RHS
+ 538196122U, // <u,u,u,5>: Cost 1 vsldoi8 LHS, RHS
+ 604862861U, // <u,u,u,6>: Cost 1 vsldoi12 LHS, RHS
+ 27705344U, // <u,u,u,7>: Cost 0 copy RHS
+ 835584U, // <u,u,u,u>: Cost 0 copy LHS
+ 0
+};
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.cpp b/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.cpp
new file mode 100644
index 0000000..1d61a3a
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.cpp
@@ -0,0 +1,618 @@
+//===-- PPCRegisterInfo.cpp - PowerPC Register Information ----------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the PowerPC implementation of the TargetRegisterInfo
+// class.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "reginfo"
+#include "PPCRegisterInfo.h"
+#include "PPC.h"
+#include "PPCFrameLowering.h"
+#include "PPCInstrBuilder.h"
+#include "PPCMachineFunctionInfo.h"
+#include "PPCSubtarget.h"
+#include "llvm/ADT/BitVector.h"
+#include "llvm/ADT/STLExtras.h"
+#include "llvm/CodeGen/MachineFrameInfo.h"
+#include "llvm/CodeGen/MachineFunction.h"
+#include "llvm/CodeGen/MachineInstrBuilder.h"
+#include "llvm/CodeGen/MachineModuleInfo.h"
+#include "llvm/CodeGen/MachineRegisterInfo.h"
+#include "llvm/CodeGen/RegisterScavenging.h"
+#include "llvm/CodeGen/ValueTypes.h"
+#include "llvm/IR/CallingConv.h"
+#include "llvm/IR/Constants.h"
+#include "llvm/IR/Function.h"
+#include "llvm/IR/Type.h"
+#include "llvm/Support/CommandLine.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Support/ErrorHandling.h"
+#include "llvm/Support/MathExtras.h"
+#include "llvm/Support/raw_ostream.h"
+#include "llvm/Target/TargetFrameLowering.h"
+#include "llvm/Target/TargetInstrInfo.h"
+#include "llvm/Target/TargetMachine.h"
+#include "llvm/Target/TargetOptions.h"
+#include <cstdlib>
+
+#define GET_REGINFO_TARGET_DESC
+#include "PPCGenRegisterInfo.inc"
+
+using namespace llvm;
+
+PPCRegisterInfo::PPCRegisterInfo(const PPCSubtarget &ST,
+ const TargetInstrInfo &tii)
+ : PPCGenRegisterInfo(ST.isPPC64() ? PPC::LR8 : PPC::LR,
+ ST.isPPC64() ? 0 : 1,
+ ST.isPPC64() ? 0 : 1),
+ Subtarget(ST), TII(tii) {
+ ImmToIdxMap[PPC::LD] = PPC::LDX; ImmToIdxMap[PPC::STD] = PPC::STDX;
+ ImmToIdxMap[PPC::LBZ] = PPC::LBZX; ImmToIdxMap[PPC::STB] = PPC::STBX;
+ ImmToIdxMap[PPC::LHZ] = PPC::LHZX; ImmToIdxMap[PPC::LHA] = PPC::LHAX;
+ ImmToIdxMap[PPC::LWZ] = PPC::LWZX; ImmToIdxMap[PPC::LWA] = PPC::LWAX;
+ ImmToIdxMap[PPC::LFS] = PPC::LFSX; ImmToIdxMap[PPC::LFD] = PPC::LFDX;
+ ImmToIdxMap[PPC::STH] = PPC::STHX; ImmToIdxMap[PPC::STW] = PPC::STWX;
+ ImmToIdxMap[PPC::STFS] = PPC::STFSX; ImmToIdxMap[PPC::STFD] = PPC::STFDX;
+ ImmToIdxMap[PPC::ADDI] = PPC::ADD4;
+
+ // 64-bit
+ ImmToIdxMap[PPC::LHA8] = PPC::LHAX8; ImmToIdxMap[PPC::LBZ8] = PPC::LBZX8;
+ ImmToIdxMap[PPC::LHZ8] = PPC::LHZX8; ImmToIdxMap[PPC::LWZ8] = PPC::LWZX8;
+ ImmToIdxMap[PPC::STB8] = PPC::STBX8; ImmToIdxMap[PPC::STH8] = PPC::STHX8;
+ ImmToIdxMap[PPC::STW8] = PPC::STWX8; ImmToIdxMap[PPC::STDU] = PPC::STDUX;
+ ImmToIdxMap[PPC::ADDI8] = PPC::ADD8;
+}
+
+/// getPointerRegClass - Return the register class to use to hold pointers.
+/// This is used for addressing modes.
+const TargetRegisterClass *
+PPCRegisterInfo::getPointerRegClass(const MachineFunction &MF, unsigned Kind)
+ const {
+ if (Kind == 1) {
+ if (Subtarget.isPPC64())
+ return &PPC::G8RC_NOX0RegClass;
+ return &PPC::GPRC_NOR0RegClass;
+ }
+
+ if (Subtarget.isPPC64())
+ return &PPC::G8RCRegClass;
+ return &PPC::GPRCRegClass;
+}
+
+const uint16_t*
+PPCRegisterInfo::getCalleeSavedRegs(const MachineFunction *MF) const {
+ if (Subtarget.isDarwinABI())
+ return Subtarget.isPPC64() ? CSR_Darwin64_SaveList :
+ CSR_Darwin32_SaveList;
+
+ return Subtarget.isPPC64() ? CSR_SVR464_SaveList : CSR_SVR432_SaveList;
+}
+
+const uint32_t*
+PPCRegisterInfo::getCallPreservedMask(CallingConv::ID CC) const {
+ if (Subtarget.isDarwinABI())
+ return Subtarget.isPPC64() ? CSR_Darwin64_RegMask :
+ CSR_Darwin32_RegMask;
+
+ return Subtarget.isPPC64() ? CSR_SVR464_RegMask : CSR_SVR432_RegMask;
+}
+
+const uint32_t*
+PPCRegisterInfo::getNoPreservedMask() const {
+ // The naming here is inverted: The CSR_NoRegs_Altivec has the
+ // Altivec registers masked so that they're not saved and restored around
+ // instructions with this preserved mask.
+
+ if (!Subtarget.hasAltivec())
+ return CSR_NoRegs_Altivec_RegMask;
+
+ if (Subtarget.isDarwin())
+ return CSR_NoRegs_Darwin_RegMask;
+ return CSR_NoRegs_RegMask;
+}
+
+BitVector PPCRegisterInfo::getReservedRegs(const MachineFunction &MF) const {
+ BitVector Reserved(getNumRegs());
+ const PPCFrameLowering *PPCFI =
+ static_cast<const PPCFrameLowering*>(MF.getTarget().getFrameLowering());
+
+ // The ZERO register is not really a register, but the representation of r0
+ // when used in instructions that treat r0 as the constant 0.
+ Reserved.set(PPC::ZERO);
+ Reserved.set(PPC::ZERO8);
+
+ // The FP register is also not really a register, but is the representation
+ // of the frame pointer register used by ISD::FRAMEADDR.
+ Reserved.set(PPC::FP);
+ Reserved.set(PPC::FP8);
+
+ Reserved.set(PPC::R1);
+ Reserved.set(PPC::LR);
+ Reserved.set(PPC::LR8);
+ Reserved.set(PPC::RM);
+
+ // The SVR4 ABI reserves r2 and r13
+ if (Subtarget.isSVR4ABI()) {
+ Reserved.set(PPC::R2); // System-reserved register
+ Reserved.set(PPC::R13); // Small Data Area pointer register
+ }
+
+ // On PPC64, r13 is the thread pointer. Never allocate this register.
+ if (Subtarget.isPPC64()) {
+ Reserved.set(PPC::R13);
+
+ Reserved.set(PPC::X1);
+ Reserved.set(PPC::X13);
+
+ if (PPCFI->needsFP(MF))
+ Reserved.set(PPC::X31);
+
+ // The 64-bit SVR4 ABI reserves r2 for the TOC pointer.
+ if (Subtarget.isSVR4ABI()) {
+ Reserved.set(PPC::X2);
+ }
+ }
+
+ if (PPCFI->needsFP(MF))
+ Reserved.set(PPC::R31);
+
+ return Reserved;
+}
+
+unsigned
+PPCRegisterInfo::getRegPressureLimit(const TargetRegisterClass *RC,
+ MachineFunction &MF) const {
+ const TargetFrameLowering *TFI = MF.getTarget().getFrameLowering();
+ const unsigned DefaultSafety = 1;
+
+ switch (RC->getID()) {
+ default:
+ return 0;
+ case PPC::G8RC_NOX0RegClassID:
+ case PPC::GPRC_NOR0RegClassID:
+ case PPC::G8RCRegClassID:
+ case PPC::GPRCRegClassID: {
+ unsigned FP = TFI->hasFP(MF) ? 1 : 0;
+ return 32 - FP - DefaultSafety;
+ }
+ case PPC::F8RCRegClassID:
+ case PPC::F4RCRegClassID:
+ case PPC::VRRCRegClassID:
+ return 32 - DefaultSafety;
+ case PPC::CRRCRegClassID:
+ return 8 - DefaultSafety;
+ }
+}
+
+//===----------------------------------------------------------------------===//
+// Stack Frame Processing methods
+//===----------------------------------------------------------------------===//
+
+/// lowerDynamicAlloc - Generate the code for allocating an object in the
+/// current frame. The sequence of code with be in the general form
+///
+/// addi R0, SP, \#frameSize ; get the address of the previous frame
+/// stwxu R0, SP, Rnegsize ; add and update the SP with the negated size
+/// addi Rnew, SP, \#maxCalFrameSize ; get the top of the allocation
+///
+void PPCRegisterInfo::lowerDynamicAlloc(MachineBasicBlock::iterator II) const {
+ // Get the instruction.
+ MachineInstr &MI = *II;
+ // Get the instruction's basic block.
+ MachineBasicBlock &MBB = *MI.getParent();
+ // Get the basic block's function.
+ MachineFunction &MF = *MBB.getParent();
+ // Get the frame info.
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ // Determine whether 64-bit pointers are used.
+ bool LP64 = Subtarget.isPPC64();
+ DebugLoc dl = MI.getDebugLoc();
+
+ // Get the maximum call stack size.
+ unsigned maxCallFrameSize = MFI->getMaxCallFrameSize();
+ // Get the total frame size.
+ unsigned FrameSize = MFI->getStackSize();
+
+ // Get stack alignments.
+ unsigned TargetAlign = MF.getTarget().getFrameLowering()->getStackAlignment();
+ unsigned MaxAlign = MFI->getMaxAlignment();
+ if (MaxAlign > TargetAlign)
+ report_fatal_error("Dynamic alloca with large aligns not supported");
+
+ // Determine the previous frame's address. If FrameSize can't be
+ // represented as 16 bits or we need special alignment, then we load the
+ // previous frame's address from 0(SP). Why not do an addis of the hi?
+ // Because R0 is our only safe tmp register and addi/addis treat R0 as zero.
+ // Constructing the constant and adding would take 3 instructions.
+ // Fortunately, a frame greater than 32K is rare.
+ const TargetRegisterClass *G8RC = &PPC::G8RCRegClass;
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+ unsigned Reg = MF.getRegInfo().createVirtualRegister(LP64 ? G8RC : GPRC);
+
+ if (MaxAlign < TargetAlign && isInt<16>(FrameSize)) {
+ BuildMI(MBB, II, dl, TII.get(PPC::ADDI), Reg)
+ .addReg(PPC::R31)
+ .addImm(FrameSize);
+ } else if (LP64) {
+ BuildMI(MBB, II, dl, TII.get(PPC::LD), Reg)
+ .addImm(0)
+ .addReg(PPC::X1);
+ } else {
+ BuildMI(MBB, II, dl, TII.get(PPC::LWZ), Reg)
+ .addImm(0)
+ .addReg(PPC::R1);
+ }
+
+ // Grow the stack and update the stack pointer link, then determine the
+ // address of new allocated space.
+ if (LP64) {
+ BuildMI(MBB, II, dl, TII.get(PPC::STDUX), PPC::X1)
+ .addReg(Reg, RegState::Kill)
+ .addReg(PPC::X1)
+ .addReg(MI.getOperand(1).getReg());
+ if (!MI.getOperand(1).isKill())
+ BuildMI(MBB, II, dl, TII.get(PPC::ADDI8), MI.getOperand(0).getReg())
+ .addReg(PPC::X1)
+ .addImm(maxCallFrameSize);
+ else
+ // Implicitly kill the register.
+ BuildMI(MBB, II, dl, TII.get(PPC::ADDI8), MI.getOperand(0).getReg())
+ .addReg(PPC::X1)
+ .addImm(maxCallFrameSize)
+ .addReg(MI.getOperand(1).getReg(), RegState::ImplicitKill);
+ } else {
+ BuildMI(MBB, II, dl, TII.get(PPC::STWUX), PPC::R1)
+ .addReg(Reg, RegState::Kill)
+ .addReg(PPC::R1)
+ .addReg(MI.getOperand(1).getReg());
+
+ if (!MI.getOperand(1).isKill())
+ BuildMI(MBB, II, dl, TII.get(PPC::ADDI), MI.getOperand(0).getReg())
+ .addReg(PPC::R1)
+ .addImm(maxCallFrameSize);
+ else
+ // Implicitly kill the register.
+ BuildMI(MBB, II, dl, TII.get(PPC::ADDI), MI.getOperand(0).getReg())
+ .addReg(PPC::R1)
+ .addImm(maxCallFrameSize)
+ .addReg(MI.getOperand(1).getReg(), RegState::ImplicitKill);
+ }
+
+ // Discard the DYNALLOC instruction.
+ MBB.erase(II);
+}
+
+/// lowerCRSpilling - Generate the code for spilling a CR register. Instead of
+/// reserving a whole register (R0), we scrounge for one here. This generates
+/// code like this:
+///
+/// mfcr rA ; Move the conditional register into GPR rA.
+/// rlwinm rA, rA, SB, 0, 31 ; Shift the bits left so they are in CR0's slot.
+/// stw rA, FI ; Store rA to the frame.
+///
+void PPCRegisterInfo::lowerCRSpilling(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const {
+ // Get the instruction.
+ MachineInstr &MI = *II; // ; SPILL_CR <SrcReg>, <offset>
+ // Get the instruction's basic block.
+ MachineBasicBlock &MBB = *MI.getParent();
+ MachineFunction &MF = *MBB.getParent();
+ DebugLoc dl = MI.getDebugLoc();
+
+ bool LP64 = Subtarget.isPPC64();
+ const TargetRegisterClass *G8RC = &PPC::G8RCRegClass;
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+
+ unsigned Reg = MF.getRegInfo().createVirtualRegister(LP64 ? G8RC : GPRC);
+ unsigned SrcReg = MI.getOperand(0).getReg();
+
+ // We need to store the CR in the low 4-bits of the saved value. First, issue
+ // an MFCRpsued to save all of the CRBits and, if needed, kill the SrcReg.
+ BuildMI(MBB, II, dl, TII.get(LP64 ? PPC::MFCR8pseud : PPC::MFCRpseud), Reg)
+ .addReg(SrcReg, getKillRegState(MI.getOperand(0).isKill()));
+
+ // If the saved register wasn't CR0, shift the bits left so that they are in
+ // CR0's slot.
+ if (SrcReg != PPC::CR0) {
+ unsigned Reg1 = Reg;
+ Reg = MF.getRegInfo().createVirtualRegister(LP64 ? G8RC : GPRC);
+
+ // rlwinm rA, rA, ShiftBits, 0, 31.
+ BuildMI(MBB, II, dl, TII.get(LP64 ? PPC::RLWINM8 : PPC::RLWINM), Reg)
+ .addReg(Reg1, RegState::Kill)
+ .addImm(getEncodingValue(SrcReg) * 4)
+ .addImm(0)
+ .addImm(31);
+ }
+
+ addFrameReference(BuildMI(MBB, II, dl, TII.get(LP64 ? PPC::STW8 : PPC::STW))
+ .addReg(Reg, RegState::Kill),
+ FrameIndex);
+
+ // Discard the pseudo instruction.
+ MBB.erase(II);
+}
+
+void PPCRegisterInfo::lowerCRRestore(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const {
+ // Get the instruction.
+ MachineInstr &MI = *II; // ; <DestReg> = RESTORE_CR <offset>
+ // Get the instruction's basic block.
+ MachineBasicBlock &MBB = *MI.getParent();
+ MachineFunction &MF = *MBB.getParent();
+ DebugLoc dl = MI.getDebugLoc();
+
+ bool LP64 = Subtarget.isPPC64();
+ const TargetRegisterClass *G8RC = &PPC::G8RCRegClass;
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+
+ unsigned Reg = MF.getRegInfo().createVirtualRegister(LP64 ? G8RC : GPRC);
+ unsigned DestReg = MI.getOperand(0).getReg();
+ assert(MI.definesRegister(DestReg) &&
+ "RESTORE_CR does not define its destination");
+
+ addFrameReference(BuildMI(MBB, II, dl, TII.get(LP64 ? PPC::LWZ8 : PPC::LWZ),
+ Reg), FrameIndex);
+
+ // If the reloaded register isn't CR0, shift the bits right so that they are
+ // in the right CR's slot.
+ if (DestReg != PPC::CR0) {
+ unsigned Reg1 = Reg;
+ Reg = MF.getRegInfo().createVirtualRegister(LP64 ? G8RC : GPRC);
+
+ unsigned ShiftBits = getEncodingValue(DestReg)*4;
+ // rlwinm r11, r11, 32-ShiftBits, 0, 31.
+ BuildMI(MBB, II, dl, TII.get(LP64 ? PPC::RLWINM8 : PPC::RLWINM), Reg)
+ .addReg(Reg1, RegState::Kill).addImm(32-ShiftBits).addImm(0)
+ .addImm(31);
+ }
+
+ BuildMI(MBB, II, dl, TII.get(LP64 ? PPC::MTCRF8 : PPC::MTCRF), DestReg)
+ .addReg(Reg, RegState::Kill);
+
+ // Discard the pseudo instruction.
+ MBB.erase(II);
+}
+
+void PPCRegisterInfo::lowerVRSAVESpilling(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const {
+ // Get the instruction.
+ MachineInstr &MI = *II; // ; SPILL_VRSAVE <SrcReg>, <offset>
+ // Get the instruction's basic block.
+ MachineBasicBlock &MBB = *MI.getParent();
+ MachineFunction &MF = *MBB.getParent();
+ DebugLoc dl = MI.getDebugLoc();
+
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+ unsigned Reg = MF.getRegInfo().createVirtualRegister(GPRC);
+ unsigned SrcReg = MI.getOperand(0).getReg();
+
+ BuildMI(MBB, II, dl, TII.get(PPC::MFVRSAVEv), Reg)
+ .addReg(SrcReg, getKillRegState(MI.getOperand(0).isKill()));
+
+ addFrameReference(BuildMI(MBB, II, dl, TII.get(PPC::STW))
+ .addReg(Reg, RegState::Kill),
+ FrameIndex);
+
+ // Discard the pseudo instruction.
+ MBB.erase(II);
+}
+
+void PPCRegisterInfo::lowerVRSAVERestore(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const {
+ // Get the instruction.
+ MachineInstr &MI = *II; // ; <DestReg> = RESTORE_VRSAVE <offset>
+ // Get the instruction's basic block.
+ MachineBasicBlock &MBB = *MI.getParent();
+ MachineFunction &MF = *MBB.getParent();
+ DebugLoc dl = MI.getDebugLoc();
+
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+ unsigned Reg = MF.getRegInfo().createVirtualRegister(GPRC);
+ unsigned DestReg = MI.getOperand(0).getReg();
+ assert(MI.definesRegister(DestReg) &&
+ "RESTORE_VRSAVE does not define its destination");
+
+ addFrameReference(BuildMI(MBB, II, dl, TII.get(PPC::LWZ),
+ Reg), FrameIndex);
+
+ BuildMI(MBB, II, dl, TII.get(PPC::MTVRSAVEv), DestReg)
+ .addReg(Reg, RegState::Kill);
+
+ // Discard the pseudo instruction.
+ MBB.erase(II);
+}
+
+bool
+PPCRegisterInfo::hasReservedSpillSlot(const MachineFunction &MF,
+ unsigned Reg, int &FrameIdx) const {
+
+ // For the nonvolatile condition registers (CR2, CR3, CR4) in an SVR4
+ // ABI, return true to prevent allocating an additional frame slot.
+ // For 64-bit, the CR save area is at SP+8; the value of FrameIdx = 0
+ // is arbitrary and will be subsequently ignored. For 32-bit, we have
+ // previously created the stack slot if needed, so return its FrameIdx.
+ if (Subtarget.isSVR4ABI() && PPC::CR2 <= Reg && Reg <= PPC::CR4) {
+ if (Subtarget.isPPC64())
+ FrameIdx = 0;
+ else {
+ const PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ FrameIdx = FI->getCRSpillFrameIndex();
+ }
+ return true;
+ }
+ return false;
+}
+
+void
+PPCRegisterInfo::eliminateFrameIndex(MachineBasicBlock::iterator II,
+ int SPAdj, unsigned FIOperandNum,
+ RegScavenger *RS) const {
+ assert(SPAdj == 0 && "Unexpected");
+
+ // Get the instruction.
+ MachineInstr &MI = *II;
+ // Get the instruction's basic block.
+ MachineBasicBlock &MBB = *MI.getParent();
+ // Get the basic block's function.
+ MachineFunction &MF = *MBB.getParent();
+ // Get the frame info.
+ MachineFrameInfo *MFI = MF.getFrameInfo();
+ const TargetFrameLowering *TFI = MF.getTarget().getFrameLowering();
+ DebugLoc dl = MI.getDebugLoc();
+
+ // Take into account whether it's an add or mem instruction
+ unsigned OffsetOperandNo = (FIOperandNum == 2) ? 1 : 2;
+ if (MI.isInlineAsm())
+ OffsetOperandNo = FIOperandNum-1;
+
+ // Get the frame index.
+ int FrameIndex = MI.getOperand(FIOperandNum).getIndex();
+
+ // Get the frame pointer save index. Users of this index are primarily
+ // DYNALLOC instructions.
+ PPCFunctionInfo *FI = MF.getInfo<PPCFunctionInfo>();
+ int FPSI = FI->getFramePointerSaveIndex();
+ // Get the instruction opcode.
+ unsigned OpC = MI.getOpcode();
+
+ // Special case for dynamic alloca.
+ if (FPSI && FrameIndex == FPSI &&
+ (OpC == PPC::DYNALLOC || OpC == PPC::DYNALLOC8)) {
+ lowerDynamicAlloc(II);
+ return;
+ }
+
+ // Special case for pseudo-ops SPILL_CR and RESTORE_CR, etc.
+ if (OpC == PPC::SPILL_CR) {
+ lowerCRSpilling(II, FrameIndex);
+ return;
+ } else if (OpC == PPC::RESTORE_CR) {
+ lowerCRRestore(II, FrameIndex);
+ return;
+ } else if (OpC == PPC::SPILL_VRSAVE) {
+ lowerVRSAVESpilling(II, FrameIndex);
+ return;
+ } else if (OpC == PPC::RESTORE_VRSAVE) {
+ lowerVRSAVERestore(II, FrameIndex);
+ return;
+ }
+
+ // Replace the FrameIndex with base register with GPR1 (SP) or GPR31 (FP).
+
+ bool is64Bit = Subtarget.isPPC64();
+ MI.getOperand(FIOperandNum).ChangeToRegister(TFI->hasFP(MF) ?
+ (is64Bit ? PPC::X31 : PPC::R31) :
+ (is64Bit ? PPC::X1 : PPC::R1),
+ false);
+
+ // Figure out if the offset in the instruction is shifted right two bits. This
+ // is true for instructions like "STD", which the machine implicitly adds two
+ // low zeros to.
+ bool isIXAddr = false;
+ switch (OpC) {
+ case PPC::LWA:
+ case PPC::LD:
+ case PPC::STD:
+ isIXAddr = true;
+ break;
+ }
+
+ // If the instruction is not present in ImmToIdxMap, then it has no immediate
+ // form (and must be r+r).
+ bool noImmForm = !MI.isInlineAsm() && !ImmToIdxMap.count(OpC);
+
+ // Now add the frame object offset to the offset from r1.
+ int Offset = MFI->getObjectOffset(FrameIndex);
+ if (!isIXAddr)
+ Offset += MI.getOperand(OffsetOperandNo).getImm();
+ else
+ Offset += MI.getOperand(OffsetOperandNo).getImm() << 2;
+
+ // If we're not using a Frame Pointer that has been set to the value of the
+ // SP before having the stack size subtracted from it, then add the stack size
+ // to Offset to get the correct offset.
+ // Naked functions have stack size 0, although getStackSize may not reflect that
+ // because we didn't call all the pieces that compute it for naked functions.
+ if (!MF.getFunction()->getAttributes().
+ hasAttribute(AttributeSet::FunctionIndex, Attribute::Naked))
+ Offset += MFI->getStackSize();
+
+ // If we can, encode the offset directly into the instruction. If this is a
+ // normal PPC "ri" instruction, any 16-bit value can be safely encoded. If
+ // this is a PPC64 "ix" instruction, only a 16-bit value with the low two bits
+ // clear can be encoded. This is extremely uncommon, because normally you
+ // only "std" to a stack slot that is at least 4-byte aligned, but it can
+ // happen in invalid code.
+ if (OpC == PPC::DBG_VALUE || // DBG_VALUE is always Reg+Imm
+ (!noImmForm &&
+ isInt<16>(Offset) && (!isIXAddr || (Offset & 3) == 0))) {
+ if (isIXAddr)
+ Offset >>= 2; // The actual encoded value has the low two bits zero.
+ MI.getOperand(OffsetOperandNo).ChangeToImmediate(Offset);
+ return;
+ }
+
+ // The offset doesn't fit into a single register, scavenge one to build the
+ // offset in.
+
+ const TargetRegisterClass *G8RC = &PPC::G8RCRegClass;
+ const TargetRegisterClass *GPRC = &PPC::GPRCRegClass;
+ const TargetRegisterClass *RC = is64Bit ? G8RC : GPRC;
+ unsigned SRegHi = MF.getRegInfo().createVirtualRegister(RC),
+ SReg = MF.getRegInfo().createVirtualRegister(RC);
+
+ // Insert a set of rA with the full offset value before the ld, st, or add
+ BuildMI(MBB, II, dl, TII.get(is64Bit ? PPC::LIS8 : PPC::LIS), SRegHi)
+ .addImm(Offset >> 16);
+ BuildMI(MBB, II, dl, TII.get(is64Bit ? PPC::ORI8 : PPC::ORI), SReg)
+ .addReg(SRegHi, RegState::Kill)
+ .addImm(Offset);
+
+ // Convert into indexed form of the instruction:
+ //
+ // sth 0:rA, 1:imm 2:(rB) ==> sthx 0:rA, 2:rB, 1:r0
+ // addi 0:rA 1:rB, 2, imm ==> add 0:rA, 1:rB, 2:r0
+ unsigned OperandBase;
+
+ if (noImmForm)
+ OperandBase = 1;
+ else if (OpC != TargetOpcode::INLINEASM) {
+ assert(ImmToIdxMap.count(OpC) &&
+ "No indexed form of load or store available!");
+ unsigned NewOpcode = ImmToIdxMap.find(OpC)->second;
+ MI.setDesc(TII.get(NewOpcode));
+ OperandBase = 1;
+ } else {
+ OperandBase = OffsetOperandNo;
+ }
+
+ unsigned StackReg = MI.getOperand(FIOperandNum).getReg();
+ MI.getOperand(OperandBase).ChangeToRegister(StackReg, false);
+ MI.getOperand(OperandBase + 1).ChangeToRegister(SReg, false, false, true);
+}
+
+unsigned PPCRegisterInfo::getFrameRegister(const MachineFunction &MF) const {
+ const TargetFrameLowering *TFI = MF.getTarget().getFrameLowering();
+
+ if (!Subtarget.isPPC64())
+ return TFI->hasFP(MF) ? PPC::R31 : PPC::R1;
+ else
+ return TFI->hasFP(MF) ? PPC::X31 : PPC::X1;
+}
+
+unsigned PPCRegisterInfo::getEHExceptionRegister() const {
+ return !Subtarget.isPPC64() ? PPC::R3 : PPC::X3;
+}
+
+unsigned PPCRegisterInfo::getEHHandlerRegister() const {
+ return !Subtarget.isPPC64() ? PPC::R4 : PPC::X4;
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.h b/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.h
new file mode 100644
index 0000000..7e6683e
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.h
@@ -0,0 +1,90 @@
+//===-- PPCRegisterInfo.h - PowerPC Register Information Impl ---*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file contains the PowerPC implementation of the TargetRegisterInfo
+// class.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPC32_REGISTERINFO_H
+#define POWERPC32_REGISTERINFO_H
+
+#include "llvm/ADT/DenseMap.h"
+#include "PPC.h"
+
+#define GET_REGINFO_HEADER
+#include "PPCGenRegisterInfo.inc"
+
+namespace llvm {
+class PPCSubtarget;
+class TargetInstrInfo;
+class Type;
+
+class PPCRegisterInfo : public PPCGenRegisterInfo {
+ DenseMap<unsigned, unsigned> ImmToIdxMap;
+ const PPCSubtarget &Subtarget;
+ const TargetInstrInfo &TII;
+public:
+ PPCRegisterInfo(const PPCSubtarget &SubTarget, const TargetInstrInfo &tii);
+
+ /// getPointerRegClass - Return the register class to use to hold pointers.
+ /// This is used for addressing modes.
+ virtual const TargetRegisterClass *
+ getPointerRegClass(const MachineFunction &MF, unsigned Kind=0) const;
+
+ unsigned getRegPressureLimit(const TargetRegisterClass *RC,
+ MachineFunction &MF) const;
+
+ /// Code Generation virtual methods...
+ const uint16_t *getCalleeSavedRegs(const MachineFunction* MF = 0) const;
+ const uint32_t *getCallPreservedMask(CallingConv::ID CC) const;
+ const uint32_t *getNoPreservedMask() const;
+
+ BitVector getReservedRegs(const MachineFunction &MF) const;
+
+ /// We require the register scavenger.
+ bool requiresRegisterScavenging(const MachineFunction &MF) const {
+ return true;
+ }
+
+ bool requiresFrameIndexScavenging(const MachineFunction &MF) const {
+ return true;
+ }
+
+ bool trackLivenessAfterRegAlloc(const MachineFunction &MF) const {
+ return true;
+ }
+
+ void lowerDynamicAlloc(MachineBasicBlock::iterator II) const;
+ void lowerCRSpilling(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const;
+ void lowerCRRestore(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const;
+ void lowerVRSAVESpilling(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const;
+ void lowerVRSAVERestore(MachineBasicBlock::iterator II,
+ unsigned FrameIndex) const;
+
+ bool hasReservedSpillSlot(const MachineFunction &MF, unsigned Reg,
+ int &FrameIdx) const;
+ void eliminateFrameIndex(MachineBasicBlock::iterator II,
+ int SPAdj, unsigned FIOperandNum,
+ RegScavenger *RS = NULL) const;
+
+ // Debug information queries.
+ unsigned getFrameRegister(const MachineFunction &MF) const;
+
+ // Exception handling queries.
+ unsigned getEHExceptionRegister() const;
+ unsigned getEHHandlerRegister() const;
+};
+
+} // end namespace llvm
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.td b/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.td
new file mode 100644
index 0000000..57a25f5
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCRegisterInfo.td
@@ -0,0 +1,232 @@
+//===-- PPCRegisterInfo.td - The PowerPC Register File -----*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+//
+//===----------------------------------------------------------------------===//
+
+let Namespace = "PPC" in {
+def sub_lt : SubRegIndex;
+def sub_gt : SubRegIndex;
+def sub_eq : SubRegIndex;
+def sub_un : SubRegIndex;
+def sub_32 : SubRegIndex;
+}
+
+
+class PPCReg<string n> : Register<n> {
+ let Namespace = "PPC";
+}
+
+// We identify all our registers with a 5-bit ID, for consistency's sake.
+
+// GPR - One of the 32 32-bit general-purpose registers
+class GPR<bits<5> num, string n> : PPCReg<n> {
+ let HWEncoding{4-0} = num;
+}
+
+// GP8 - One of the 32 64-bit general-purpose registers
+class GP8<GPR SubReg, string n> : PPCReg<n> {
+ let HWEncoding = SubReg.HWEncoding;
+ let SubRegs = [SubReg];
+ let SubRegIndices = [sub_32];
+}
+
+// SPR - One of the 32-bit special-purpose registers
+class SPR<bits<10> num, string n> : PPCReg<n> {
+ let HWEncoding{9-0} = num;
+}
+
+// FPR - One of the 32 64-bit floating-point registers
+class FPR<bits<5> num, string n> : PPCReg<n> {
+ let HWEncoding{4-0} = num;
+}
+
+// VR - One of the 32 128-bit vector registers
+class VR<bits<5> num, string n> : PPCReg<n> {
+ let HWEncoding{4-0} = num;
+}
+
+// CR - One of the 8 4-bit condition registers
+class CR<bits<3> num, string n, list<Register> subregs> : PPCReg<n> {
+ let HWEncoding{2-0} = num;
+ let SubRegs = subregs;
+}
+
+// CRBIT - One of the 32 1-bit condition register fields
+class CRBIT<bits<5> num, string n> : PPCReg<n> {
+ let HWEncoding{4-0} = num;
+}
+
+// General-purpose registers
+foreach Index = 0-31 in {
+ def R#Index : GPR<Index, "r"#Index>, DwarfRegNum<[-2, Index]>;
+}
+
+// 64-bit General-purpose registers
+foreach Index = 0-31 in {
+ def X#Index : GP8<!cast<GPR>("R"#Index), "r"#Index>,
+ DwarfRegNum<[Index, -2]>;
+}
+
+// Floating-point registers
+foreach Index = 0-31 in {
+ def F#Index : FPR<Index, "f"#Index>,
+ DwarfRegNum<[!add(Index, 32), !add(Index, 32)]>;
+}
+
+// Vector registers
+foreach Index = 0-31 in {
+ def V#Index : VR<Index, "v"#Index>,
+ DwarfRegNum<[!add(Index, 77), !add(Index, 77)]>;
+}
+
+// The reprsentation of r0 when treated as the constant 0.
+def ZERO : GPR<0, "0">;
+def ZERO8 : GP8<ZERO, "0">;
+
+// Representations of the frame pointer used by ISD::FRAMEADDR.
+def FP : GPR<0 /* arbitrary */, "**FRAME POINTER**">;
+def FP8 : GP8<FP, "**FRAME POINTER**">;
+
+// Condition register bits
+def CR0LT : CRBIT< 0, "0">;
+def CR0GT : CRBIT< 1, "1">;
+def CR0EQ : CRBIT< 2, "2">;
+def CR0UN : CRBIT< 3, "3">;
+def CR1LT : CRBIT< 4, "4">;
+def CR1GT : CRBIT< 5, "5">;
+def CR1EQ : CRBIT< 6, "6">;
+def CR1UN : CRBIT< 7, "7">;
+def CR2LT : CRBIT< 8, "8">;
+def CR2GT : CRBIT< 9, "9">;
+def CR2EQ : CRBIT<10, "10">;
+def CR2UN : CRBIT<11, "11">;
+def CR3LT : CRBIT<12, "12">;
+def CR3GT : CRBIT<13, "13">;
+def CR3EQ : CRBIT<14, "14">;
+def CR3UN : CRBIT<15, "15">;
+def CR4LT : CRBIT<16, "16">;
+def CR4GT : CRBIT<17, "17">;
+def CR4EQ : CRBIT<18, "18">;
+def CR4UN : CRBIT<19, "19">;
+def CR5LT : CRBIT<20, "20">;
+def CR5GT : CRBIT<21, "21">;
+def CR5EQ : CRBIT<22, "22">;
+def CR5UN : CRBIT<23, "23">;
+def CR6LT : CRBIT<24, "24">;
+def CR6GT : CRBIT<25, "25">;
+def CR6EQ : CRBIT<26, "26">;
+def CR6UN : CRBIT<27, "27">;
+def CR7LT : CRBIT<28, "28">;
+def CR7GT : CRBIT<29, "29">;
+def CR7EQ : CRBIT<30, "30">;
+def CR7UN : CRBIT<31, "31">;
+
+// Condition registers
+let SubRegIndices = [sub_lt, sub_gt, sub_eq, sub_un] in {
+def CR0 : CR<0, "cr0", [CR0LT, CR0GT, CR0EQ, CR0UN]>, DwarfRegNum<[68, 68]>;
+def CR1 : CR<1, "cr1", [CR1LT, CR1GT, CR1EQ, CR1UN]>, DwarfRegNum<[69, 69]>;
+def CR2 : CR<2, "cr2", [CR2LT, CR2GT, CR2EQ, CR2UN]>, DwarfRegNum<[70, 70]>;
+def CR3 : CR<3, "cr3", [CR3LT, CR3GT, CR3EQ, CR3UN]>, DwarfRegNum<[71, 71]>;
+def CR4 : CR<4, "cr4", [CR4LT, CR4GT, CR4EQ, CR4UN]>, DwarfRegNum<[72, 72]>;
+def CR5 : CR<5, "cr5", [CR5LT, CR5GT, CR5EQ, CR5UN]>, DwarfRegNum<[73, 73]>;
+def CR6 : CR<6, "cr6", [CR6LT, CR6GT, CR6EQ, CR6UN]>, DwarfRegNum<[74, 74]>;
+def CR7 : CR<7, "cr7", [CR7LT, CR7GT, CR7EQ, CR7UN]>, DwarfRegNum<[75, 75]>;
+}
+
+// Link register
+def LR : SPR<8, "lr">, DwarfRegNum<[-2, 65]>;
+//let Aliases = [LR] in
+def LR8 : SPR<8, "lr">, DwarfRegNum<[65, -2]>;
+
+// Count register
+def CTR : SPR<9, "ctr">, DwarfRegNum<[-2, 66]>;
+def CTR8 : SPR<9, "ctr">, DwarfRegNum<[66, -2]>;
+
+// VRsave register
+def VRSAVE: SPR<256, "VRsave">, DwarfRegNum<[109]>;
+
+// Carry bit. In the architecture this is really bit 0 of the XER register
+// (which really is SPR register 1); this is the only bit interesting to a
+// compiler.
+def CARRY: SPR<1, "ca">;
+
+// FP rounding mode: bits 30 and 31 of the FP status and control register
+// This is not allocated as a normal register; it appears only in
+// Uses and Defs. The ABI says it needs to be preserved by a function,
+// but this is not achieved by saving and restoring it as with
+// most registers, it has to be done in code; to make this work all the
+// return and call instructions are described as Uses of RM, so instructions
+// that do nothing but change RM will not get deleted.
+// Also, in the architecture it is not really a SPR; 512 is arbitrary.
+def RM: SPR<512, "**ROUNDING MODE**">;
+
+/// Register classes
+// Allocate volatiles first
+// then nonvolatiles in reverse order since stmw/lmw save from rN to r31
+def GPRC : RegisterClass<"PPC", [i32], 32, (add (sequence "R%u", 2, 12),
+ (sequence "R%u", 30, 13),
+ R31, R0, R1, FP)>;
+
+def G8RC : RegisterClass<"PPC", [i64], 64, (add (sequence "X%u", 2, 12),
+ (sequence "X%u", 30, 14),
+ X31, X13, X0, X1, FP8)>;
+
+// For some instructions r0 is special (representing the value 0 instead of
+// the value in the r0 register), and we use these register subclasses to
+// prevent r0 from being allocated for use by those instructions.
+def GPRC_NOR0 : RegisterClass<"PPC", [i32], 32, (add (sub GPRC, R0), ZERO)>;
+def G8RC_NOX0 : RegisterClass<"PPC", [i64], 64, (add (sub G8RC, X0), ZERO8)>;
+
+// Allocate volatiles first, then non-volatiles in reverse order. With the SVR4
+// ABI the size of the Floating-point register save area is determined by the
+// allocated non-volatile register with the lowest register number, as FP
+// register N is spilled to offset 8 * (32 - N) below the back chain word of the
+// previous stack frame. By allocating non-volatiles in reverse order we make
+// sure that the Floating-point register save area is always as small as
+// possible because there aren't any unused spill slots.
+def F8RC : RegisterClass<"PPC", [f64], 64, (add (sequence "F%u", 0, 13),
+ (sequence "F%u", 31, 14))>;
+def F4RC : RegisterClass<"PPC", [f32], 32, (add F8RC)>;
+
+def VRRC : RegisterClass<"PPC", [v16i8,v8i16,v4i32,v4f32], 128,
+ (add V2, V3, V4, V5, V0, V1, V6, V7, V8, V9, V10, V11,
+ V12, V13, V14, V15, V16, V17, V18, V19, V31, V30,
+ V29, V28, V27, V26, V25, V24, V23, V22, V21, V20)>;
+
+def CRBITRC : RegisterClass<"PPC", [i32], 32,
+ (add CR0LT, CR0GT, CR0EQ, CR0UN,
+ CR1LT, CR1GT, CR1EQ, CR1UN,
+ CR2LT, CR2GT, CR2EQ, CR2UN,
+ CR3LT, CR3GT, CR3EQ, CR3UN,
+ CR4LT, CR4GT, CR4EQ, CR4UN,
+ CR5LT, CR5GT, CR5EQ, CR5UN,
+ CR6LT, CR6GT, CR6EQ, CR6UN,
+ CR7LT, CR7GT, CR7EQ, CR7UN)>
+{
+ let CopyCost = -1;
+}
+
+def CRRC : RegisterClass<"PPC", [i32], 32, (add CR0, CR1, CR5, CR6,
+ CR7, CR2, CR3, CR4)>;
+
+// The CTR registers are not allocatable because they're used by the
+// decrement-and-branch instructions, and thus need to stay live across
+// multiple basic blocks.
+def CTRRC : RegisterClass<"PPC", [i32], 32, (add CTR)> {
+ let isAllocatable = 0;
+}
+def CTRRC8 : RegisterClass<"PPC", [i64], 64, (add CTR8)> {
+ let isAllocatable = 0;
+}
+
+def VRSAVERC : RegisterClass<"PPC", [i32], 32, (add VRSAVE)>;
+def CARRYRC : RegisterClass<"PPC", [i32], 32, (add CARRY)> {
+ let CopyCost = -1;
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCRelocations.h b/contrib/llvm/lib/Target/PowerPC/PPCRelocations.h
new file mode 100644
index 0000000..0b392f9
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCRelocations.h
@@ -0,0 +1,56 @@
+//===-- PPCRelocations.h - PPC Code Relocations -----------------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the PowerPC 32-bit target-specific relocation types.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPCRELOCATIONS_H
+#define PPCRELOCATIONS_H
+
+#include "llvm/CodeGen/MachineRelocation.h"
+
+// Hack to rid us of a PPC pre-processor symbol which is erroneously
+// defined in a PowerPC header file (bug in Linux/PPC)
+#ifdef PPC
+#undef PPC
+#endif
+
+namespace llvm {
+ namespace PPC {
+ enum RelocationType {
+ // reloc_vanilla - A standard relocation, where the address of the
+ // relocated object completely overwrites the address of the relocation.
+ reloc_vanilla,
+
+ // reloc_pcrel_bx - PC relative relocation, for the b or bl instructions.
+ reloc_pcrel_bx,
+
+ // reloc_pcrel_bcx - PC relative relocation, for BLT,BLE,BEQ,BGE,BGT,BNE,
+ // and other bcx instructions.
+ reloc_pcrel_bcx,
+
+ // reloc_absolute_high - Absolute relocation, for the loadhi instruction
+ // (which is really addis). Add the high 16-bits of the specified global
+ // address into the low 16-bits of the instruction.
+ reloc_absolute_high,
+
+ // reloc_absolute_low - Absolute relocation, for the la instruction (which
+ // is really an addi). Add the low 16-bits of the specified global
+ // address into the low 16-bits of the instruction.
+ reloc_absolute_low,
+
+ // reloc_absolute_low_ix - Absolute relocation for the 64-bit load/store
+ // instruction which have two implicit zero bits.
+ reloc_absolute_low_ix
+ };
+ }
+}
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCSchedule.td b/contrib/llvm/lib/Target/PowerPC/PPCSchedule.td
new file mode 100644
index 0000000..660c0c3
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCSchedule.td
@@ -0,0 +1,519 @@
+//===-- PPCSchedule.td - PowerPC Scheduling Definitions ----*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+//===----------------------------------------------------------------------===//
+// Functional units across PowerPC chips sets
+//
+def BPU : FuncUnit; // Branch unit
+def SLU : FuncUnit; // Store/load unit
+def SRU : FuncUnit; // special register unit
+def IU1 : FuncUnit; // integer unit 1 (simple)
+def IU2 : FuncUnit; // integer unit 2 (complex)
+def FPU1 : FuncUnit; // floating point unit 1
+def FPU2 : FuncUnit; // floating point unit 2
+def VPU : FuncUnit; // vector permutation unit
+def VIU1 : FuncUnit; // vector integer unit 1 (simple)
+def VIU2 : FuncUnit; // vector integer unit 2 (complex)
+def VFPU : FuncUnit; // vector floating point unit
+
+//===----------------------------------------------------------------------===//
+// Instruction Itinerary classes used for PowerPC
+//
+def IntSimple : InstrItinClass;
+def IntGeneral : InstrItinClass;
+def IntCompare : InstrItinClass;
+def IntDivD : InstrItinClass;
+def IntDivW : InstrItinClass;
+def IntMFFS : InstrItinClass;
+def IntMFVSCR : InstrItinClass;
+def IntMTFSB0 : InstrItinClass;
+def IntMTSRD : InstrItinClass;
+def IntMulHD : InstrItinClass;
+def IntMulHW : InstrItinClass;
+def IntMulHWU : InstrItinClass;
+def IntMulLI : InstrItinClass;
+def IntRFID : InstrItinClass;
+def IntRotateD : InstrItinClass;
+def IntRotateDI : InstrItinClass;
+def IntRotate : InstrItinClass;
+def IntShift : InstrItinClass;
+def IntTrapD : InstrItinClass;
+def IntTrapW : InstrItinClass;
+def BrB : InstrItinClass;
+def BrCR : InstrItinClass;
+def BrMCR : InstrItinClass;
+def BrMCRX : InstrItinClass;
+def LdStDCBA : InstrItinClass;
+def LdStDCBF : InstrItinClass;
+def LdStDCBI : InstrItinClass;
+def LdStLoad : InstrItinClass;
+def LdStLoadUpd : InstrItinClass;
+def LdStStore : InstrItinClass;
+def LdStStoreUpd : InstrItinClass;
+def LdStDSS : InstrItinClass;
+def LdStICBI : InstrItinClass;
+def LdStLD : InstrItinClass;
+def LdStLDU : InstrItinClass;
+def LdStLDARX : InstrItinClass;
+def LdStLFD : InstrItinClass;
+def LdStLFDU : InstrItinClass;
+def LdStLHA : InstrItinClass;
+def LdStLHAU : InstrItinClass;
+def LdStLMW : InstrItinClass;
+def LdStLVecX : InstrItinClass;
+def LdStLWA : InstrItinClass;
+def LdStLWARX : InstrItinClass;
+def LdStSLBIA : InstrItinClass;
+def LdStSLBIE : InstrItinClass;
+def LdStSTD : InstrItinClass;
+def LdStSTDCX : InstrItinClass;
+def LdStSTDU : InstrItinClass;
+def LdStSTFD : InstrItinClass;
+def LdStSTFDU : InstrItinClass;
+def LdStSTVEBX : InstrItinClass;
+def LdStSTWCX : InstrItinClass;
+def LdStSync : InstrItinClass;
+def SprISYNC : InstrItinClass;
+def SprMFSR : InstrItinClass;
+def SprMTMSR : InstrItinClass;
+def SprMTSR : InstrItinClass;
+def SprTLBSYNC : InstrItinClass;
+def SprMFCR : InstrItinClass;
+def SprMFMSR : InstrItinClass;
+def SprMFSPR : InstrItinClass;
+def SprMFTB : InstrItinClass;
+def SprMTSPR : InstrItinClass;
+def SprMTSRIN : InstrItinClass;
+def SprRFI : InstrItinClass;
+def SprSC : InstrItinClass;
+def FPGeneral : InstrItinClass;
+def FPAddSub : InstrItinClass;
+def FPCompare : InstrItinClass;
+def FPDivD : InstrItinClass;
+def FPDivS : InstrItinClass;
+def FPFused : InstrItinClass;
+def FPRes : InstrItinClass;
+def FPSqrt : InstrItinClass;
+def VecGeneral : InstrItinClass;
+def VecFP : InstrItinClass;
+def VecFPCompare : InstrItinClass;
+def VecComplex : InstrItinClass;
+def VecPerm : InstrItinClass;
+def VecFPRound : InstrItinClass;
+def VecVSL : InstrItinClass;
+def VecVSR : InstrItinClass;
+
+//===----------------------------------------------------------------------===//
+// Processor instruction itineraries.
+
+include "PPCScheduleG3.td"
+include "PPCSchedule440.td"
+include "PPCScheduleG4.td"
+include "PPCScheduleG4Plus.td"
+include "PPCScheduleG5.td"
+include "PPCScheduleA2.td"
+include "PPCScheduleE500mc.td"
+include "PPCScheduleE5500.td"
+
+//===----------------------------------------------------------------------===//
+// Instruction to itinerary class map - When add new opcodes to the supported
+// set, refer to the following table to determine which itinerary class the
+// opcode belongs.
+//
+// opcode itinerary class
+// ====== ===============
+// add IntSimple
+// addc IntGeneral
+// adde IntGeneral
+// addi IntSimple
+// addic IntGeneral
+// addic. IntGeneral
+// addis IntSimple
+// addme IntGeneral
+// addze IntGeneral
+// and IntSimple
+// andc IntSimple
+// andi. IntGeneral
+// andis. IntGeneral
+// b BrB
+// bc BrB
+// bcctr BrB
+// bclr BrB
+// cmp IntCompare
+// cmpi IntCompare
+// cmpl IntCompare
+// cmpli IntCompare
+// cntlzd IntRotateD
+// cntlzw IntGeneral
+// crand BrCR
+// crandc BrCR
+// creqv BrCR
+// crnand BrCR
+// crnor BrCR
+// cror BrCR
+// crorc BrCR
+// crxor BrCR
+// dcba LdStDCBA
+// dcbf LdStDCBF
+// dcbi LdStDCBI
+// dcbst LdStDCBF
+// dcbt LdStLoad
+// dcbtst LdStLoad
+// dcbz LdStDCBF
+// divd IntDivD
+// divdu IntDivD
+// divw IntDivW
+// divwu IntDivW
+// dss LdStDSS
+// dst LdStDSS
+// dstst LdStDSS
+// eciwx LdStLoad
+// ecowx LdStLoad
+// eieio LdStLoad
+// eqv IntSimple
+// extsb IntSimple
+// extsh IntSimple
+// extsw IntSimple
+// fabs FPGeneral
+// fadd FPAddSub
+// fadds FPGeneral
+// fcfid FPGeneral
+// fcmpo FPCompare
+// fcmpu FPCompare
+// fctid FPGeneral
+// fctidz FPGeneral
+// fctiw FPGeneral
+// fctiwz FPGeneral
+// fdiv FPDivD
+// fdivs FPDivS
+// fmadd FPFused
+// fmadds FPGeneral
+// fmr FPGeneral
+// fmsub FPFused
+// fmsubs FPGeneral
+// fmul FPFused
+// fmuls FPGeneral
+// fnabs FPGeneral
+// fneg FPGeneral
+// fnmadd FPFused
+// fnmadds FPGeneral
+// fnmsub FPFused
+// fnmsubs FPGeneral
+// fres FPRes
+// frsp FPGeneral
+// frsqrte FPGeneral
+// fsel FPGeneral
+// fsqrt FPSqrt
+// fsqrts FPSqrt
+// fsub FPAddSub
+// fsubs FPGeneral
+// icbi LdStICBI
+// isync SprISYNC
+// lbz LdStLoad
+// lbzu LdStLoadUpd
+// lbzux LdStLoadUpd
+// lbzx LdStLoad
+// ld LdStLD
+// ldarx LdStLDARX
+// ldu LdStLDU
+// ldux LdStLDU
+// ldx LdStLD
+// lfd LdStLFD
+// lfdu LdStLFDU
+// lfdux LdStLFDU
+// lfdx LdStLFD
+// lfs LdStLFD
+// lfsu LdStLFDU
+// lfsux LdStLFDU
+// lfsx LdStLFD
+// lha LdStLHA
+// lhau LdStLHAU
+// lhaux LdStLHAU
+// lhax LdStLHA
+// lhbrx LdStLoad
+// lhz LdStLoad
+// lhzu LdStLoadUpd
+// lhzux LdStLoadUpd
+// lhzx LdStLoad
+// lmw LdStLMW
+// lswi LdStLMW
+// lswx LdStLMW
+// lvebx LdStLVecX
+// lvehx LdStLVecX
+// lvewx LdStLVecX
+// lvsl LdStLVecX
+// lvsr LdStLVecX
+// lvx LdStLVecX
+// lvxl LdStLVecX
+// lwa LdStLWA
+// lwarx LdStLWARX
+// lwaux LdStLHAU
+// lwax LdStLHA
+// lwbrx LdStLoad
+// lwz LdStLoad
+// lwzu LdStLoadUpd
+// lwzux LdStLoadUpd
+// lwzx LdStLoad
+// mcrf BrMCR
+// mcrfs FPGeneral
+// mcrxr BrMCRX
+// mfcr SprMFCR
+// mffs IntMFFS
+// mfmsr SprMFMSR
+// mfspr SprMFSPR
+// mfsr SprMFSR
+// mfsrin SprMFSR
+// mftb SprMFTB
+// mfvscr IntMFVSCR
+// mtcrf BrMCRX
+// mtfsb0 IntMTFSB0
+// mtfsb1 IntMTFSB0
+// mtfsf IntMTFSB0
+// mtfsfi IntMTFSB0
+// mtmsr SprMTMSR
+// mtmsrd LdStLD
+// mtspr SprMTSPR
+// mtsr SprMTSR
+// mtsrd IntMTSRD
+// mtsrdin IntMTSRD
+// mtsrin SprMTSRIN
+// mtvscr IntMFVSCR
+// mulhd IntMulHD
+// mulhdu IntMulHD
+// mulhw IntMulHW
+// mulhwu IntMulHWU
+// mulld IntMulHD
+// mulli IntMulLI
+// mullw IntMulHW
+// nand IntSimple
+// neg IntSimple
+// nor IntSimple
+// or IntSimple
+// orc IntSimple
+// ori IntSimple
+// oris IntSimple
+// rfi SprRFI
+// rfid IntRFID
+// rldcl IntRotateD
+// rldcr IntRotateD
+// rldic IntRotateDI
+// rldicl IntRotateDI
+// rldicr IntRotateDI
+// rldimi IntRotateDI
+// rlwimi IntRotate
+// rlwinm IntGeneral
+// rlwnm IntGeneral
+// sc SprSC
+// slbia LdStSLBIA
+// slbie LdStSLBIE
+// sld IntRotateD
+// slw IntGeneral
+// srad IntRotateD
+// sradi IntRotateDI
+// sraw IntShift
+// srawi IntShift
+// srd IntRotateD
+// srw IntGeneral
+// stb LdStStore
+// stbu LdStStoreUpd
+// stbux LdStStoreUpd
+// stbx LdStStore
+// std LdStSTD
+// stdcx. LdStSTDCX
+// stdu LdStSTDU
+// stdux LdStSTDU
+// stdx LdStSTD
+// stfd LdStSTFD
+// stfdu LdStSTFDU
+// stfdux LdStSTFDU
+// stfdx LdStSTFD
+// stfiwx LdStSTFD
+// stfs LdStSTFD
+// stfsu LdStSTFDU
+// stfsux LdStSTFDU
+// stfsx LdStSTFD
+// sth LdStStore
+// sthbrx LdStStore
+// sthu LdStStoreUpd
+// sthux LdStStoreUpd
+// sthx LdStStore
+// stmw LdStLMW
+// stswi LdStLMW
+// stswx LdStLMW
+// stvebx LdStSTVEBX
+// stvehx LdStSTVEBX
+// stvewx LdStSTVEBX
+// stvx LdStSTVEBX
+// stvxl LdStSTVEBX
+// stw LdStStore
+// stwbrx LdStStore
+// stwcx. LdStSTWCX
+// stwu LdStStoreUpd
+// stwux LdStStoreUpd
+// stwx LdStStore
+// subf IntGeneral
+// subfc IntGeneral
+// subfe IntGeneral
+// subfic IntGeneral
+// subfme IntGeneral
+// subfze IntGeneral
+// sync LdStSync
+// td IntTrapD
+// tdi IntTrapD
+// tlbia LdStSLBIA
+// tlbie LdStDCBF
+// tlbsync SprTLBSYNC
+// tw IntTrapW
+// twi IntTrapW
+// vaddcuw VecGeneral
+// vaddfp VecFP
+// vaddsbs VecGeneral
+// vaddshs VecGeneral
+// vaddsws VecGeneral
+// vaddubm VecGeneral
+// vaddubs VecGeneral
+// vadduhm VecGeneral
+// vadduhs VecGeneral
+// vadduwm VecGeneral
+// vadduws VecGeneral
+// vand VecGeneral
+// vandc VecGeneral
+// vavgsb VecGeneral
+// vavgsh VecGeneral
+// vavgsw VecGeneral
+// vavgub VecGeneral
+// vavguh VecGeneral
+// vavguw VecGeneral
+// vcfsx VecFP
+// vcfux VecFP
+// vcmpbfp VecFPCompare
+// vcmpeqfp VecFPCompare
+// vcmpequb VecGeneral
+// vcmpequh VecGeneral
+// vcmpequw VecGeneral
+// vcmpgefp VecFPCompare
+// vcmpgtfp VecFPCompare
+// vcmpgtsb VecGeneral
+// vcmpgtsh VecGeneral
+// vcmpgtsw VecGeneral
+// vcmpgtub VecGeneral
+// vcmpgtuh VecGeneral
+// vcmpgtuw VecGeneral
+// vctsxs VecFP
+// vctuxs VecFP
+// vexptefp VecFP
+// vlogefp VecFP
+// vmaddfp VecFP
+// vmaxfp VecFPCompare
+// vmaxsb VecGeneral
+// vmaxsh VecGeneral
+// vmaxsw VecGeneral
+// vmaxub VecGeneral
+// vmaxuh VecGeneral
+// vmaxuw VecGeneral
+// vmhaddshs VecComplex
+// vmhraddshs VecComplex
+// vminfp VecFPCompare
+// vminsb VecGeneral
+// vminsh VecGeneral
+// vminsw VecGeneral
+// vminub VecGeneral
+// vminuh VecGeneral
+// vminuw VecGeneral
+// vmladduhm VecComplex
+// vmrghb VecPerm
+// vmrghh VecPerm
+// vmrghw VecPerm
+// vmrglb VecPerm
+// vmrglh VecPerm
+// vmrglw VecPerm
+// vmsubfp VecFP
+// vmsummbm VecComplex
+// vmsumshm VecComplex
+// vmsumshs VecComplex
+// vmsumubm VecComplex
+// vmsumuhm VecComplex
+// vmsumuhs VecComplex
+// vmulesb VecComplex
+// vmulesh VecComplex
+// vmuleub VecComplex
+// vmuleuh VecComplex
+// vmulosb VecComplex
+// vmulosh VecComplex
+// vmuloub VecComplex
+// vmulouh VecComplex
+// vnor VecGeneral
+// vor VecGeneral
+// vperm VecPerm
+// vpkpx VecPerm
+// vpkshss VecPerm
+// vpkshus VecPerm
+// vpkswss VecPerm
+// vpkswus VecPerm
+// vpkuhum VecPerm
+// vpkuhus VecPerm
+// vpkuwum VecPerm
+// vpkuwus VecPerm
+// vrefp VecFPRound
+// vrfim VecFPRound
+// vrfin VecFPRound
+// vrfip VecFPRound
+// vrfiz VecFPRound
+// vrlb VecGeneral
+// vrlh VecGeneral
+// vrlw VecGeneral
+// vrsqrtefp VecFP
+// vsel VecGeneral
+// vsl VecVSL
+// vslb VecGeneral
+// vsldoi VecPerm
+// vslh VecGeneral
+// vslo VecPerm
+// vslw VecGeneral
+// vspltb VecPerm
+// vsplth VecPerm
+// vspltisb VecPerm
+// vspltish VecPerm
+// vspltisw VecPerm
+// vspltw VecPerm
+// vsr VecVSR
+// vsrab VecGeneral
+// vsrah VecGeneral
+// vsraw VecGeneral
+// vsrb VecGeneral
+// vsrh VecGeneral
+// vsro VecPerm
+// vsrw VecGeneral
+// vsubcuw VecGeneral
+// vsubfp VecFP
+// vsubsbs VecGeneral
+// vsubshs VecGeneral
+// vsubsws VecGeneral
+// vsububm VecGeneral
+// vsububs VecGeneral
+// vsubuhm VecGeneral
+// vsubuhs VecGeneral
+// vsubuwm VecGeneral
+// vsubuws VecGeneral
+// vsum2sws VecComplex
+// vsum4sbs VecComplex
+// vsum4shs VecComplex
+// vsum4ubs VecComplex
+// vsumsws VecComplex
+// vupkhpx VecPerm
+// vupkhsb VecPerm
+// vupkhsh VecPerm
+// vupklpx VecPerm
+// vupklsb VecPerm
+// vupklsh VecPerm
+// vxor VecGeneral
+// xor IntSimple
+// xori IntSimple
+// xoris IntSimple
+//
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCSchedule440.td b/contrib/llvm/lib/Target/PowerPC/PPCSchedule440.td
new file mode 100644
index 0000000..37b6eac
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCSchedule440.td
@@ -0,0 +1,663 @@
+//===-- PPCSchedule440.td - PPC 440 Scheduling Definitions -*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+// Primary reference:
+// PowerPC 440x6 Embedded Processor Core User's Manual.
+// IBM (as updated in) 2010.
+
+// The basic PPC 440 does not include a floating-point unit; the pipeline
+// timings here are constructed to match the FP2 unit shipped with the
+// PPC-440- and PPC-450-based Blue Gene (L and P) supercomputers.
+// References:
+// S. Chatterjee, et al. Design and exploitation of a high-performance
+// SIMD floating-point unit for Blue Gene/L.
+// IBM J. Res. & Dev. 49 (2/3) March/May 2005.
+// also:
+// Carlos Sosa and Brant Knudson. IBM System Blue Gene Solution:
+// Blue Gene/P Application Development.
+// IBM (as updated in) 2009.
+
+//===----------------------------------------------------------------------===//
+// Functional units on the PowerPC 440/450 chip sets
+//
+def IFTH1 : FuncUnit; // Fetch unit 1
+def IFTH2 : FuncUnit; // Fetch unit 2
+def PDCD1 : FuncUnit; // Decode unit 1
+def PDCD2 : FuncUnit; // Decode unit 2
+def DISS1 : FuncUnit; // Issue unit 1
+def DISS2 : FuncUnit; // Issue unit 2
+def LRACC : FuncUnit; // Register access and dispatch for
+ // the simple integer (J-pipe) and
+ // load/store (L-pipe) pipelines
+def IRACC : FuncUnit; // Register access and dispatch for
+ // the complex integer (I-pipe) pipeline
+def FRACC : FuncUnit; // Register access and dispatch for
+ // the floating-point execution (F-pipe) pipeline
+def IEXE1 : FuncUnit; // Execution stage 1 for the I pipeline
+def IEXE2 : FuncUnit; // Execution stage 2 for the I pipeline
+def IWB : FuncUnit; // Write-back unit for the I pipeline
+def JEXE1 : FuncUnit; // Execution stage 1 for the J pipeline
+def JEXE2 : FuncUnit; // Execution stage 2 for the J pipeline
+def JWB : FuncUnit; // Write-back unit for the J pipeline
+def AGEN : FuncUnit; // Address generation for the L pipeline
+def CRD : FuncUnit; // D-cache access for the L pipeline
+def LWB : FuncUnit; // Write-back unit for the L pipeline
+def FEXE1 : FuncUnit; // Execution stage 1 for the F pipeline
+def FEXE2 : FuncUnit; // Execution stage 2 for the F pipeline
+def FEXE3 : FuncUnit; // Execution stage 3 for the F pipeline
+def FEXE4 : FuncUnit; // Execution stage 4 for the F pipeline
+def FEXE5 : FuncUnit; // Execution stage 5 for the F pipeline
+def FEXE6 : FuncUnit; // Execution stage 6 for the F pipeline
+def FWB : FuncUnit; // Write-back unit for the F pipeline
+
+def LWARX_Hold : FuncUnit; // This is a pseudo-unit which is used
+ // to make sure that no lwarx/stwcx.
+ // instructions are issued while another
+ // lwarx/stwcx. is in the L pipe.
+
+def GPR_Bypass : Bypass; // The bypass for general-purpose regs.
+def FPR_Bypass : Bypass; // The bypass for floating-point regs.
+
+// Notes:
+// Instructions are held in the FRACC, LRACC and IRACC pipeline
+// stages until their source operands become ready. Exceptions:
+// - Store instructions will hold in the AGEN stage
+// - The integer multiply-accumulate instruction will hold in
+// the IEXE1 stage
+//
+// For most I-pipe operations, the result is available at the end of
+// the IEXE1 stage. Operations such as multiply and divide must
+// continue to execute in IEXE2 and IWB. Divide resides in IWB for
+// 33 cycles (multiply also calculates its result in IWB). For all
+// J-pipe instructions, the result is available
+// at the end of the JEXE1 stage. Loads have a 3-cycle latency
+// (data is not available until after the LWB stage).
+//
+// The L1 cache hit latency is four cycles for floating point loads
+// and three cycles for integer loads.
+//
+// The stwcx. instruction requires both the LRACC and the IRACC
+// dispatch stages. It must be issued from DISS0.
+//
+// All lwarx/stwcx. instructions hold in LRACC if another
+// uncommitted lwarx/stwcx. is in AGEN, CRD, or LWB.
+//
+// msync (a.k.a. sync) and mbar will hold in LWB until all load/store
+// resources are empty. AGEN and CRD are held empty until the msync/mbar
+// commits.
+//
+// Most floating-point instructions, computational and move,
+// have a 5-cycle latency. Divide takes longer (30 cycles). Instructions that
+// update the CR take 2 cycles. Stores take 3 cycles and, as mentioned above,
+// loads take 4 cycles (for L1 hit).
+
+//
+// This file defines the itinerary class data for the PPC 440 processor.
+//
+//===----------------------------------------------------------------------===//
+
+
+def PPC440Itineraries : ProcessorItineraries<
+ [IFTH1, IFTH2, PDCD1, PDCD2, DISS1, DISS2, FRACC,
+ IRACC, IEXE1, IEXE2, IWB, LRACC, JEXE1, JEXE2, JWB, AGEN, CRD, LWB,
+ FEXE1, FEXE2, FEXE3, FEXE4, FEXE5, FEXE6, FWB, LWARX_Hold],
+ [GPR_Bypass, FPR_Bypass], [
+ InstrItinData<IntSimple , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC, LRACC]>,
+ InstrStage<1, [IEXE1, JEXE1]>,
+ InstrStage<1, [IEXE2, JEXE2]>,
+ InstrStage<1, [IWB, JWB]>],
+ [6, 4, 4],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntGeneral , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC, LRACC]>,
+ InstrStage<1, [IEXE1, JEXE1]>,
+ InstrStage<1, [IEXE2, JEXE2]>,
+ InstrStage<1, [IWB, JWB]>],
+ [6, 4, 4],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntCompare , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC, LRACC]>,
+ InstrStage<1, [IEXE1, JEXE1]>,
+ InstrStage<1, [IEXE2, JEXE2]>,
+ InstrStage<1, [IWB, JWB]>],
+ [6, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntDivW , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<33, [IWB]>],
+ [40, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMFFS , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [7, 4, 4],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [7, 4, 4],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHW , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHWU , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulLI , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotate , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC, LRACC]>,
+ InstrStage<1, [IEXE1, JEXE1]>,
+ InstrStage<1, [IEXE2, JEXE2]>,
+ InstrStage<1, [IWB, JWB]>],
+ [6, 4, 4],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntShift , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC, LRACC]>,
+ InstrStage<1, [IEXE1, JEXE1]>,
+ InstrStage<1, [IEXE2, JEXE2]>,
+ InstrStage<1, [IWB, JWB]>],
+ [6, 4, 4],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntTrapW , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [6, 4],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<BrB , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<BrCR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<BrMCR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<BrMCRX , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4, 4],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBA , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBF , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBI , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLoad , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [9, 5],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [9, 5],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStStore , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStICBI , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFD , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5, 5],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFDU , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5, 5],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLFD , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [9, 5, 5],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLFDU , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [9, 5, 5],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLHA , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLHAU , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLMW , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLWARX , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1]>,
+ InstrStage<1, [IRACC], 0>,
+ InstrStage<4, [LWARX_Hold], 0>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTD , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTDU , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<2, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTDCX , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1]>,
+ InstrStage<1, [IRACC], 0>,
+ InstrStage<4, [LWARX_Hold], 0>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTWCX , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1]>,
+ InstrStage<1, [IRACC], 0>,
+ InstrStage<4, [LWARX_Hold], 0>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<1, [AGEN]>,
+ InstrStage<1, [CRD]>,
+ InstrStage<1, [LWB]>],
+ [8, 5],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSync , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [LRACC]>,
+ InstrStage<3, [AGEN], 1>,
+ InstrStage<2, [CRD], 1>,
+ InstrStage<1, [LWB]>]>,
+ InstrItinData<SprISYNC , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC], 0>,
+ InstrStage<1, [LRACC], 0>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [FEXE1], 0>,
+ InstrStage<1, [AGEN], 0>,
+ InstrStage<1, [JEXE1], 0>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [FEXE2], 0>,
+ InstrStage<1, [CRD], 0>,
+ InstrStage<1, [JEXE2], 0>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<6, [FEXE3], 0>,
+ InstrStage<6, [LWB], 0>,
+ InstrStage<6, [JWB], 0>,
+ InstrStage<6, [IWB]>]>,
+ InstrItinData<SprMFSR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [6, 4],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMTMSR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [6, 4],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMTSR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<3, [IWB]>],
+ [9, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>]>,
+ InstrItinData<SprMFCR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMFMSR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [7, 4],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMFSPR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<3, [IWB]>],
+ [10, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMFTB , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<3, [IWB]>],
+ [10, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSPR , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<3, [IWB]>],
+ [10, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSRIN , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<3, [IWB]>],
+ [10, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprRFI , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprSC , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [IRACC]>,
+ InstrStage<1, [IEXE1]>,
+ InstrStage<1, [IEXE2]>,
+ InstrStage<1, [IWB]>],
+ [8, 4],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<FPGeneral , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<1, [FWB]>],
+ [10, 4, 4],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPAddSub , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<1, [FWB]>],
+ [10, 4, 4],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPCompare , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<1, [FWB]>],
+ [10, 4, 4],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivD , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<25, [FWB]>],
+ [35, 4, 4],
+ [NoBypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivS , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<13, [FWB]>],
+ [23, 4, 4],
+ [NoBypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPFused , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<1, [FWB]>],
+ [10, 4, 4, 4],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPRes , [InstrStage<1, [IFTH1, IFTH2]>,
+ InstrStage<1, [PDCD1, PDCD2]>,
+ InstrStage<1, [DISS1, DISS2]>,
+ InstrStage<1, [FRACC]>,
+ InstrStage<1, [FEXE1]>,
+ InstrStage<1, [FEXE2]>,
+ InstrStage<1, [FEXE3]>,
+ InstrStage<1, [FEXE4]>,
+ InstrStage<1, [FEXE5]>,
+ InstrStage<1, [FEXE6]>,
+ InstrStage<1, [FWB]>],
+ [10, 4],
+ [FPR_Bypass, FPR_Bypass]>
+]>;
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleA2.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleA2.td
new file mode 100644
index 0000000..ae084aa
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleA2.td
@@ -0,0 +1,766 @@
+//===- PPCScheduleA2.td - PPC A2 Scheduling Definitions --*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+// Primary reference:
+// A2 Processor User's Manual.
+// IBM (as updated in) 2010.
+
+//===----------------------------------------------------------------------===//
+// Functional units on the PowerPC A2 chip sets
+//
+def IU0to3_0 : FuncUnit; // Fetch unit 1 to 4 slot 1
+def IU0to3_1 : FuncUnit; // Fetch unit 1 to 4 slot 2
+def IU0to3_2 : FuncUnit; // Fetch unit 1 to 4 slot 3
+def IU0to3_3 : FuncUnit; // Fetch unit 1 to 4 slot 4
+def IU4_0 : FuncUnit; // Instruction buffer slot 1
+def IU4_1 : FuncUnit; // Instruction buffer slot 2
+def IU4_2 : FuncUnit; // Instruction buffer slot 3
+def IU4_3 : FuncUnit; // Instruction buffer slot 4
+def IU4_4 : FuncUnit; // Instruction buffer slot 5
+def IU4_5 : FuncUnit; // Instruction buffer slot 6
+def IU4_6 : FuncUnit; // Instruction buffer slot 7
+def IU4_7 : FuncUnit; // Instruction buffer slot 8
+def IU5 : FuncUnit; // Dependency resolution
+def IU6 : FuncUnit; // Instruction issue
+def RF0 : FuncUnit;
+def XRF1 : FuncUnit;
+def XEX1 : FuncUnit; // Execution stage 1 for the XU pipeline
+def XEX2 : FuncUnit; // Execution stage 2 for the XU pipeline
+def XEX3 : FuncUnit; // Execution stage 3 for the XU pipeline
+def XEX4 : FuncUnit; // Execution stage 4 for the XU pipeline
+def XEX5 : FuncUnit; // Execution stage 5 for the XU pipeline
+def XEX6 : FuncUnit; // Execution stage 6 for the XU pipeline
+def FRF1 : FuncUnit;
+def FEX1 : FuncUnit; // Execution stage 1 for the FU pipeline
+def FEX2 : FuncUnit; // Execution stage 2 for the FU pipeline
+def FEX3 : FuncUnit; // Execution stage 3 for the FU pipeline
+def FEX4 : FuncUnit; // Execution stage 4 for the FU pipeline
+def FEX5 : FuncUnit; // Execution stage 5 for the FU pipeline
+def FEX6 : FuncUnit; // Execution stage 6 for the FU pipeline
+
+def CR_Bypass : Bypass; // The bypass for condition regs.
+//def GPR_Bypass : Bypass; // The bypass for general-purpose regs.
+//def FPR_Bypass : Bypass; // The bypass for floating-point regs.
+
+//
+// This file defines the itinerary class data for the PPC A2 processor.
+//
+//===----------------------------------------------------------------------===//
+
+
+def PPCA2Itineraries : ProcessorItineraries<
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3,
+ IU4_0, IU4_1, IU4_2, IU4_3, IU4_4, IU4_5, IU4_6, IU4_7,
+ IU5, IU6, RF0, XRF1, XEX1, XEX2, XEX3, XEX4, XEX5, XEX6,
+ FRF1, FEX1, FEX2, FEX3, FEX4, FEX5, FEX6],
+ [CR_Bypass, GPR_Bypass, FPR_Bypass], [
+ InstrItinData<IntSimple , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntGeneral , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntCompare , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [CR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntDivW , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<38, [XEX6]>],
+ [53, 7, 7],
+ [NoBypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMFFS , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHW , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHWU , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulLI , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotate , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotateD , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotateDI , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntShift , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntTrapW , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntTrapD , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<BrB , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<BrCR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [CR_Bypass, CR_Bypass, CR_Bypass]>,
+ InstrItinData<BrMCR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [CR_Bypass, CR_Bypass, CR_Bypass]>,
+ InstrItinData<BrMCRX , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7, 7],
+ [CR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBA , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 11],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBF , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 11],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBI , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 11],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLoad , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLDU , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStStore , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStICBI , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFD , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7, 7],
+ [NoBypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<LdStSTFDU , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7, 7],
+ [NoBypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<LdStLFD , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7, 7],
+ [FPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLFDU , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7, 7],
+ [FPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLHA , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLHAU , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLMW , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [14, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLWARX , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<13, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [26, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTD , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTDU , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [13, 7],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTDCX , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<13, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [26, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTWCX , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<13, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [26, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSync , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<12, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>]>,
+ InstrItinData<SprISYNC , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<14, [XEX6]>]>,
+ InstrItinData<SprMFSR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7],
+ [GPR_Bypass, NoBypass]>,
+ InstrItinData<SprMTMSR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<14, [XEX6]>]>,
+ InstrItinData<SprMFCR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [10, 7],
+ [GPR_Bypass, CR_Bypass]>,
+ InstrItinData<SprMFMSR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7],
+ [GPR_Bypass, NoBypass]>,
+ InstrItinData<SprMFSPR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMFTB , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<14, [XEX6]>],
+ [29, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSPR , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<1, [XEX6]>],
+ [15, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSRIN , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<14, [XEX6]>],
+ [29, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprRFI , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<14, [XEX6]>],
+ [29, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprSC , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [XRF1]>,
+ InstrStage<1, [XEX1]>, InstrStage<1, [XEX2]>,
+ InstrStage<1, [XEX3]>, InstrStage<1, [XEX4]>,
+ InstrStage<1, [XEX5]>, InstrStage<14, [XEX6]>],
+ [29, 7],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<FPGeneral , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [FRF1]>,
+ InstrStage<1, [FEX1]>, InstrStage<1, [FEX2]>,
+ InstrStage<1, [FEX3]>, InstrStage<1, [FEX4]>,
+ InstrStage<1, [FEX5]>, InstrStage<1, [FEX6]>],
+ [15, 7, 7],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPAddSub , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [FRF1]>,
+ InstrStage<1, [FEX1]>, InstrStage<1, [FEX2]>,
+ InstrStage<1, [FEX3]>, InstrStage<1, [FEX4]>,
+ InstrStage<1, [FEX5]>, InstrStage<1, [FEX6]>],
+ [15, 7, 7],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPCompare , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [FRF1]>,
+ InstrStage<1, [FEX1]>, InstrStage<1, [FEX2]>,
+ InstrStage<1, [FEX3]>, InstrStage<1, [FEX4]>,
+ InstrStage<1, [FEX5]>, InstrStage<1, [FEX6]>],
+ [13, 7, 7],
+ [CR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivD , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<71, [FRF1], 0>,
+ InstrStage<71, [FEX1], 0>,
+ InstrStage<71, [FEX2], 0>,
+ InstrStage<71, [FEX3], 0>,
+ InstrStage<71, [FEX4], 0>,
+ InstrStage<71, [FEX5], 0>,
+ InstrStage<71, [FEX6]>],
+ [86, 7, 7],
+ [NoBypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivS , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<58, [FRF1], 0>,
+ InstrStage<58, [FEX1], 0>,
+ InstrStage<58, [FEX2], 0>,
+ InstrStage<58, [FEX3], 0>,
+ InstrStage<58, [FEX4], 0>,
+ InstrStage<58, [FEX5], 0>,
+ InstrStage<58, [FEX6]>],
+ [73, 7, 7],
+ [NoBypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPSqrt , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<68, [FRF1], 0>,
+ InstrStage<68, [FEX1], 0>,
+ InstrStage<68, [FEX2], 0>,
+ InstrStage<68, [FEX3], 0>,
+ InstrStage<68, [FEX4], 0>,
+ InstrStage<68, [FEX5], 0>,
+ InstrStage<68, [FEX6]>],
+ [86, 7], // FIXME: should be [86, 7] for double
+ // and [82, 7] for single. Likewise,
+ // the FEX? cycle count should be 68
+ // for double and 64 for single.
+ [NoBypass, FPR_Bypass]>,
+ InstrItinData<FPFused , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [FRF1]>,
+ InstrStage<1, [FEX1]>, InstrStage<1, [FEX2]>,
+ InstrStage<1, [FEX3]>, InstrStage<1, [FEX4]>,
+ InstrStage<1, [FEX5]>, InstrStage<1, [FEX6]>],
+ [15, 7, 7, 7],
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPRes , [InstrStage<4,
+ [IU0to3_0, IU0to3_1, IU0to3_2, IU0to3_3]>,
+ InstrStage<1, [IU4_0, IU4_1, IU4_2, IU4_3,
+ IU4_4, IU4_5, IU4_6, IU4_7]>,
+ InstrStage<1, [IU5]>, InstrStage<1, [IU6]>,
+ InstrStage<1, [RF0]>, InstrStage<1, [FRF1]>,
+ InstrStage<1, [FEX1]>, InstrStage<1, [FEX2]>,
+ InstrStage<1, [FEX3]>, InstrStage<1, [FEX4]>,
+ InstrStage<1, [FEX5]>, InstrStage<1, [FEX6]>],
+ [15, 7],
+ [FPR_Bypass, FPR_Bypass]>
+]>;
+
+// ===---------------------------------------------------------------------===//
+// A2 machine model for scheduling and other instruction cost heuristics.
+
+def PPCA2Model : SchedMachineModel {
+ let IssueWidth = 1; // 2 micro-ops are dispatched per cycle.
+ let MinLatency = -1; // OperandCycles are interpreted as MinLatency.
+ let LoadLatency = 6; // Optimistic load latency assuming bypass.
+ // This is overriden by OperandCycles if the
+ // Itineraries are queried instead.
+ let MispredictPenalty = 6;
+
+ let Itineraries = PPCA2Itineraries;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleE500mc.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleE500mc.td
new file mode 100644
index 0000000..9bb779a
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleE500mc.td
@@ -0,0 +1,265 @@
+//===-- PPCScheduleE500mc.td - e500mc Scheduling Defs ------*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the itinerary class data for the Freescale e500mc 32-bit
+// Power processor.
+//
+// All information is derived from the "e500mc Core Reference Manual",
+// Freescale Document Number E500MCRM, Rev. 1, 03/2012.
+//
+//===----------------------------------------------------------------------===//
+// Relevant functional units in the Freescale e500mc core:
+//
+// * Decode & Dispatch
+// Can dispatch up to 2 instructions per clock cycle to either the GPR Issue
+// queues (GIQx), FP Issue Queue (FIQ), or Branch issue queue (BIQ).
+def DIS0 : FuncUnit; // Dispatch stage - insn 1
+def DIS1 : FuncUnit; // Dispatch stage - insn 2
+
+// * Execute
+// 6 pipelined execution units: SFX0, SFX1, BU, FPU, LSU, CFX.
+// Some instructions can only execute in SFX0 but not SFX1.
+// The CFX has a bypass path, allowing non-divide instructions to execute
+// while a divide instruction is executed.
+def SFX0 : FuncUnit; // Simple unit 0
+def SFX1 : FuncUnit; // Simple unit 1
+def BU : FuncUnit; // Branch unit
+def CFX_DivBypass
+ : FuncUnit; // CFX divide bypass path
+def CFX_0 : FuncUnit; // CFX pipeline
+def LSU_0 : FuncUnit; // LSU pipeline
+def FPU_0 : FuncUnit; // FPU pipeline
+
+def PPCE500mcItineraries : ProcessorItineraries<
+ [DIS0, DIS1, SFX0, SFX1, BU, CFX_DivBypass, CFX_0, LSU_0, FPU_0],
+ [CR_Bypass, GPR_Bypass, FPR_Bypass], [
+ InstrItinData<IntSimple , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1, 1], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntGeneral , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1, 1], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntCompare , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [5, 1, 1], // Latency = 1 or 2
+ [CR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntDivW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<14, [CFX_DivBypass]>],
+ [17, 1, 1], // Latency=4..35, Repeat= 4..35
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMFFS , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<8, [FPU_0]>],
+ [11], // Latency = 8
+ [FPR_Bypass]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<8, [FPU_0]>],
+ [11, 1, 1], // Latency = 8
+ [NoBypass, NoBypass, NoBypass]>,
+ InstrItinData<IntMulHW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0]>],
+ [7, 1, 1], // Latency = 4, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHWU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0]>],
+ [7, 1, 1], // Latency = 4, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulLI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0]>],
+ [7, 1, 1], // Latency = 4, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotate , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1, 1], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntShift , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1, 1], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntTrapW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [SFX0]>],
+ [5, 1], // Latency = 2, Repeat rate = 2
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<BrB , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [BU]>],
+ [4, 1], // Latency = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<BrCR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [BU]>],
+ [4, 1, 1], // Latency = 1
+ [CR_Bypass, CR_Bypass, CR_Bypass]>,
+ InstrItinData<BrMCR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [BU]>],
+ [4, 1], // Latency = 1
+ [CR_Bypass, CR_Bypass]>,
+ InstrItinData<BrMCRX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1, 1], // Latency = 1
+ [CR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBA , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBF , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLoad , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStStore , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [NoBypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStICBI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFDU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLFD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 1, 1], // Latency = 4
+ [FPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLFDU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 1, 1], // Latency = 4
+ [FPR_Bypass, GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLHA , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLHAU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLMW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 1], // Latency = r+3
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLWARX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<3, [LSU_0]>],
+ [6, 1, 1], // Latency = 3, Repeat rate = 3
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTWCX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [6, 1], // Latency = 3
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSync , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>]>,
+ InstrItinData<SprMFSR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [SFX0]>],
+ [7, 1],
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMTMSR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [SFX0, SFX1]>],
+ [5, 1], // Latency = 2, Repeat rate = 4
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMTSR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0]>],
+ [5, 1],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0], 0>]>,
+ InstrItinData<SprMFCR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<5, [SFX0]>],
+ [8, 1],
+ [GPR_Bypass, CR_Bypass]>,
+ InstrItinData<SprMFMSR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [SFX0]>],
+ [7, 1], // Latency = 4, Repeat rate = 4
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMFSPR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1], // Latency = 1, Repeat rate = 1
+ [GPR_Bypass, CR_Bypass]>,
+ InstrItinData<SprMFTB , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [SFX0]>],
+ [7, 1], // Latency = 4, Repeat rate = 4
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSPR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [4, 1], // Latency = 1, Repeat rate = 1
+ [CR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMTSRIN , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0]>],
+ [4, 1],
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<FPGeneral , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [FPU_0]>],
+ [11, 1, 1], // Latency = 8, Repeat rate = 2
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPAddSub , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [FPU_0]>],
+ [13, 1, 1], // Latency = 10, Repeat rate = 4
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPCompare , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [FPU_0]>],
+ [11, 1, 1], // Latency = 8, Repeat rate = 2
+ [CR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<68, [FPU_0]>],
+ [71, 1, 1], // Latency = 68, Repeat rate = 68
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivS , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<38, [FPU_0]>],
+ [41, 1, 1], // Latency = 38, Repeat rate = 38
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPFused , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [FPU_0]>],
+ [13, 1, 1, 1], // Latency = 10, Repeat rate = 4
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPRes , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<38, [FPU_0]>],
+ [41, 1], // Latency = 38, Repeat rate = 38
+ [FPR_Bypass, FPR_Bypass]>
+]>;
+
+// ===---------------------------------------------------------------------===//
+// e500mc machine model for scheduling and other instruction cost heuristics.
+
+def PPCE500mcModel : SchedMachineModel {
+ let IssueWidth = 2; // 2 micro-ops are dispatched per cycle.
+ let MinLatency = -1; // OperandCycles are interpreted as MinLatency.
+ let LoadLatency = 5; // Optimistic load latency assuming bypass.
+ // This is overriden by OperandCycles if the
+ // Itineraries are queried instead.
+
+ let Itineraries = PPCE500mcItineraries;
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleE5500.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleE5500.td
new file mode 100644
index 0000000..d7e11ac
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleE5500.td
@@ -0,0 +1,309 @@
+//===-- PPCScheduleE500mc.td - e5500 Scheduling Defs -------*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the itinerary class data for the Freescale e5500 64-bit
+// Power processor.
+//
+// All information is derived from the "e5500 Core Reference Manual",
+// Freescale Document Number e5500RM, Rev. 1, 03/2012.
+//
+//===----------------------------------------------------------------------===//
+// Relevant functional units in the Freescale e5500 core
+// (These are the same as for the e500mc)
+//
+// * Decode & Dispatch
+// Can dispatch up to 2 instructions per clock cycle to either the GPR Issue
+// queues (GIQx), FP Issue Queue (FIQ), or Branch issue queue (BIQ).
+// def DIS0 : FuncUnit;
+// def DIS1 : FuncUnit;
+
+// * Execute
+// 6 pipelined execution units: SFX0, SFX1, BU, FPU, LSU, CFX.
+// The CFX has a bypass path, allowing non-divide instructions to execute
+// while a divide instruction is being executed.
+// def SFX0 : FuncUnit; // Simple unit 0
+// def SFX1 : FuncUnit; // Simple unit 1
+// def BU : FuncUnit; // Branch unit
+// def CFX_DivBypass
+// : FuncUnit; // CFX divide bypass path
+// def CFX_0 : FuncUnit; // CFX pipeline stage 0
+
+def CFX_1 : FuncUnit; // CFX pipeline stage 1
+
+// def LSU_0 : FuncUnit; // LSU pipeline
+// def FPU_0 : FuncUnit; // FPU pipeline
+
+
+def PPCE5500Itineraries : ProcessorItineraries<
+ [DIS0, DIS1, SFX0, SFX1, BU, CFX_DivBypass, CFX_0, CFX_1,
+ LSU_0, FPU_0],
+ [CR_Bypass, GPR_Bypass, FPR_Bypass], [
+ InstrItinData<IntSimple , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [5, 2, 2], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntGeneral , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [5, 2, 2], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntCompare , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [6, 2, 2], // Latency = 1 or 2
+ [CR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntDivD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<26, [CFX_DivBypass]>],
+ [30, 2, 2], // Latency= 4..26, Repeat rate= 4..26
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntDivW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<16, [CFX_DivBypass]>],
+ [20, 2, 2], // Latency= 4..16, Repeat rate= 4..16
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMFFS , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [FPU_0]>],
+ [11], // Latency = 7, Repeat rate = 1
+ [FPR_Bypass]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<7, [FPU_0]>],
+ [11, 2, 2], // Latency = 7, Repeat rate = 7
+ [NoBypass, NoBypass, NoBypass]>,
+ InstrItinData<IntMulHD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<2, [CFX_1]>],
+ [9, 2, 2], // Latency = 4..7, Repeat rate = 2..4
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<1, [CFX_1]>],
+ [8, 2, 2], // Latency = 4, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulHWU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<1, [CFX_1]>],
+ [8, 2, 2], // Latency = 4, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntMulLI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0], 0>,
+ InstrStage<2, [CFX_1]>],
+ [8, 2, 2], // Latency = 4 or 5, Repeat = 2
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotate , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [5, 2, 2], // Latency = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotateD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [SFX0, SFX1]>],
+ [6, 2, 2], // Latency = 2, Repeat rate = 2
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntRotateDI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [5, 2, 2], // Latency = 1, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntShift , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [SFX0, SFX1]>],
+ [6, 2, 2], // Latency = 2, Repeat rate = 2
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<IntTrapW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [SFX0]>],
+ [6, 2], // Latency = 2, Repeat rate = 2
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<BrB , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [BU]>],
+ [5, 2], // Latency = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<BrCR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [BU]>],
+ [5, 2, 2], // Latency = 1
+ [CR_Bypass, CR_Bypass, CR_Bypass]>,
+ InstrItinData<BrMCR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [BU]>],
+ [5, 2], // Latency = 1
+ [CR_Bypass, CR_Bypass]>,
+ InstrItinData<BrMCRX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0]>],
+ [5, 2, 2], // Latency = 1
+ [CR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBA , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBF , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStDCBI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLoad , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLDARX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<3, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLDU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStStore , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStICBI , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTFDU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLFD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [8, 2, 2], // Latency = 4, Repeat rate = 1
+ [FPR_Bypass, GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLFDU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [8, 2, 2], // Latency = 4, Repeat rate = 1
+ [FPR_Bypass, GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLHA , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStLHAU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [GPR_Bypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStLMW , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [LSU_0]>],
+ [8, 2], // Latency = r+3, Repeat rate = r+3
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStLWARX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<3, [LSU_0]>],
+ [7, 2, 2], // Latency = 3, Repeat rate = 3
+ [GPR_Bypass, GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<LdStSTD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTDCX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSTDU , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass],
+ 2>, // 2 micro-ops
+ InstrItinData<LdStSTWCX , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>],
+ [7, 2], // Latency = 3, Repeat rate = 1
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<LdStSync , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0]>]>,
+ InstrItinData<SprMTMSR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [CFX_0]>],
+ [6, 2], // Latency = 2, Repeat rate = 4
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [LSU_0], 0>]>,
+ InstrItinData<SprMFCR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<5, [CFX_0]>],
+ [9, 2], // Latency = 5, Repeat rate = 5
+ [GPR_Bypass, CR_Bypass]>,
+ InstrItinData<SprMFMSR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [SFX0]>],
+ [8, 2], // Latency = 4, Repeat rate = 4
+ [GPR_Bypass, GPR_Bypass]>,
+ InstrItinData<SprMFSPR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [CFX_0]>],
+ [5], // Latency = 1, Repeat rate = 1
+ [GPR_Bypass]>,
+ InstrItinData<SprMFTB , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<4, [CFX_0]>],
+ [8, 2], // Latency = 4, Repeat rate = 4
+ [NoBypass, GPR_Bypass]>,
+ InstrItinData<SprMTSPR , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [SFX0, SFX1]>],
+ [5], // Latency = 1, Repeat rate = 1
+ [GPR_Bypass]>,
+ InstrItinData<FPGeneral , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [FPU_0]>],
+ [11, 2, 2], // Latency = 7, Repeat rate = 1
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPAddSub , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [FPU_0]>],
+ [11, 2, 2], // Latency = 7, Repeat rate = 1
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPCompare , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [FPU_0]>],
+ [11, 2, 2], // Latency = 7, Repeat rate = 1
+ [CR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivD , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<31, [FPU_0]>],
+ [39, 2, 2], // Latency = 35, Repeat rate = 31
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPDivS , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<16, [FPU_0]>],
+ [24, 2, 2], // Latency = 20, Repeat rate = 16
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPFused , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<1, [FPU_0]>],
+ [11, 2, 2, 2], // Latency = 7, Repeat rate = 1
+ [FPR_Bypass, FPR_Bypass, FPR_Bypass, FPR_Bypass]>,
+ InstrItinData<FPRes , [InstrStage<1, [DIS0, DIS1], 0>,
+ InstrStage<2, [FPU_0]>],
+ [12, 2], // Latency = 8, Repeat rate = 2
+ [FPR_Bypass, FPR_Bypass]>
+]>;
+
+// ===---------------------------------------------------------------------===//
+// e5500 machine model for scheduling and other instruction cost heuristics.
+
+def PPCE5500Model : SchedMachineModel {
+ let IssueWidth = 2; // 2 micro-ops are dispatched per cycle.
+ let MinLatency = -1; // OperandCycles are interpreted as MinLatency.
+ let LoadLatency = 6; // Optimistic load latency assuming bypass.
+ // This is overriden by OperandCycles if the
+ // Itineraries are queried instead.
+
+ let Itineraries = PPCE5500Itineraries;
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleG3.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG3.td
new file mode 100644
index 0000000..72a0a39
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG3.td
@@ -0,0 +1,71 @@
+//===-- PPCScheduleG3.td - PPC G3 Scheduling Definitions ---*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the itinerary class data for the G3 (750) processor.
+//
+//===----------------------------------------------------------------------===//
+
+
+def G3Itineraries : ProcessorItineraries<
+ [IU1, IU2, FPU1, BPU, SRU, SLU], [], [
+ InstrItinData<IntSimple , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntGeneral , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntCompare , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntDivW , [InstrStage<19, [IU1]>]>,
+ InstrItinData<IntMFFS , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<3, [FPU1]>]>,
+ InstrItinData<IntMulHW , [InstrStage<5, [IU1]>]>,
+ InstrItinData<IntMulHWU , [InstrStage<6, [IU1]>]>,
+ InstrItinData<IntMulLI , [InstrStage<3, [IU1]>]>,
+ InstrItinData<IntRotate , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntShift , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntTrapW , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<BrB , [InstrStage<1, [BPU]>]>,
+ InstrItinData<BrCR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<BrMCR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<BrMCRX , [InstrStage<1, [SRU]>]>,
+ InstrItinData<LdStDCBA , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStDCBF , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStDCBI , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLoad , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStStore , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStICBI , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTFD , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStSTFDU , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLFD , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLFDU , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLHA , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLHAU , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLMW , [InstrStage<34, [SLU]>]>,
+ InstrItinData<LdStLWARX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTWCX , [InstrStage<8, [SLU]>]>,
+ InstrItinData<LdStSync , [InstrStage<3, [SLU]>]>,
+ InstrItinData<SprISYNC , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprMFSR , [InstrStage<3, [SRU]>]>,
+ InstrItinData<SprMTMSR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMTSR , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<3, [SRU]>]>,
+ InstrItinData<SprMFCR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMFMSR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMFSPR , [InstrStage<3, [SRU]>]>,
+ InstrItinData<SprMFTB , [InstrStage<3, [SRU]>]>,
+ InstrItinData<SprMTSPR , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprMTSRIN , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprRFI , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprSC , [InstrStage<2, [SRU]>]>,
+ InstrItinData<FPGeneral , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPAddSub , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPCompare , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPDivD , [InstrStage<31, [FPU1]>]>,
+ InstrItinData<FPDivS , [InstrStage<17, [FPU1]>]>,
+ InstrItinData<FPFused , [InstrStage<2, [FPU1]>]>,
+ InstrItinData<FPRes , [InstrStage<10, [FPU1]>]>
+]>;
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleG4.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG4.td
new file mode 100644
index 0000000..fc9120d
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG4.td
@@ -0,0 +1,81 @@
+//===-- PPCScheduleG4.td - PPC G4 Scheduling Definitions ---*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the itinerary class data for the G4 (7400) processor.
+//
+//===----------------------------------------------------------------------===//
+
+def G4Itineraries : ProcessorItineraries<
+ [IU1, IU2, SLU, SRU, BPU, FPU1, VIU1, VIU2, VPU, VFPU], [], [
+ InstrItinData<IntSimple , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntGeneral , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntCompare , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntDivW , [InstrStage<19, [IU1]>]>,
+ InstrItinData<IntMFFS , [InstrStage<3, [FPU1]>]>,
+ InstrItinData<IntMFVSCR , [InstrStage<1, [VIU1]>]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<3, [FPU1]>]>,
+ InstrItinData<IntMulHW , [InstrStage<5, [IU1]>]>,
+ InstrItinData<IntMulHWU , [InstrStage<6, [IU1]>]>,
+ InstrItinData<IntMulLI , [InstrStage<3, [IU1]>]>,
+ InstrItinData<IntRotate , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntShift , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntTrapW , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<BrB , [InstrStage<1, [BPU]>]>,
+ InstrItinData<BrCR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<BrMCR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<BrMCRX , [InstrStage<1, [SRU]>]>,
+ InstrItinData<LdStDCBF , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStDCBI , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLoad , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStStore , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStDSS , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStICBI , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStSTFD , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStSTFDU , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLFD , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLFDU , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLHA , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLHAU , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLMW , [InstrStage<34, [SLU]>]>,
+ InstrItinData<LdStLVecX , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStLWARX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTVEBX , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStSTWCX , [InstrStage<5, [SLU]>]>,
+ InstrItinData<LdStSync , [InstrStage<8, [SLU]>]>,
+ InstrItinData<SprISYNC , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprMFSR , [InstrStage<3, [SRU]>]>,
+ InstrItinData<SprMTMSR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMTSR , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<8, [SRU]>]>,
+ InstrItinData<SprMFCR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMFMSR , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMFSPR , [InstrStage<3, [SRU]>]>,
+ InstrItinData<SprMFTB , [InstrStage<1, [SRU]>]>,
+ InstrItinData<SprMTSPR , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprMTSRIN , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprRFI , [InstrStage<2, [SRU]>]>,
+ InstrItinData<SprSC , [InstrStage<2, [SRU]>]>,
+ InstrItinData<FPGeneral , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPAddSub , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPCompare , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPDivD , [InstrStage<31, [FPU1]>]>,
+ InstrItinData<FPDivS , [InstrStage<17, [FPU1]>]>,
+ InstrItinData<FPFused , [InstrStage<1, [FPU1]>]>,
+ InstrItinData<FPRes , [InstrStage<10, [FPU1]>]>,
+ InstrItinData<VecGeneral , [InstrStage<1, [VIU1]>]>,
+ InstrItinData<VecFP , [InstrStage<4, [VFPU]>]>,
+ InstrItinData<VecFPCompare, [InstrStage<1, [VIU1]>]>,
+ InstrItinData<VecComplex , [InstrStage<3, [VIU2]>]>,
+ InstrItinData<VecPerm , [InstrStage<1, [VPU]>]>,
+ InstrItinData<VecFPRound , [InstrStage<4, [VFPU]>]>,
+ InstrItinData<VecVSL , [InstrStage<1, [VIU1]>]>,
+ InstrItinData<VecVSR , [InstrStage<1, [VIU1]>]>
+]>;
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleG4Plus.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG4Plus.td
new file mode 100644
index 0000000..a4e82ce
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG4Plus.td
@@ -0,0 +1,88 @@
+//===-- PPCScheduleG4Plus.td - PPC G4+ Scheduling Defs. ----*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the itinerary class data for the G4+ (7450) processor.
+//
+//===----------------------------------------------------------------------===//
+
+def IU3 : FuncUnit; // integer unit 3 (7450 simple)
+def IU4 : FuncUnit; // integer unit 4 (7450 simple)
+
+def G4PlusItineraries : ProcessorItineraries<
+ [IU1, IU2, IU3, IU4, BPU, SLU, FPU1, VFPU, VIU1, VIU2, VPU], [], [
+ InstrItinData<IntSimple , [InstrStage<1, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<IntGeneral , [InstrStage<1, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<IntCompare , [InstrStage<1, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<IntDivW , [InstrStage<23, [IU2]>]>,
+ InstrItinData<IntMFFS , [InstrStage<5, [FPU1]>]>,
+ InstrItinData<IntMFVSCR , [InstrStage<2, [VFPU]>]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<5, [FPU1]>]>,
+ InstrItinData<IntMulHW , [InstrStage<4, [IU2]>]>,
+ InstrItinData<IntMulHWU , [InstrStage<4, [IU2]>]>,
+ InstrItinData<IntMulLI , [InstrStage<3, [IU2]>]>,
+ InstrItinData<IntRotate , [InstrStage<1, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<IntShift , [InstrStage<2, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<IntTrapW , [InstrStage<2, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<BrB , [InstrStage<1, [BPU]>]>,
+ InstrItinData<BrCR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<BrMCR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<BrMCRX , [InstrStage<2, [IU2]>]>,
+ InstrItinData<LdStDCBF , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStDCBI , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLoad , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStStore , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStDSS , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStICBI , [InstrStage<3, [IU2]>]>,
+ InstrItinData<LdStSTFD , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTFDU , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLFD , [InstrStage<4, [SLU]>]>,
+ InstrItinData<LdStLFDU , [InstrStage<4, [SLU]>]>,
+ InstrItinData<LdStLHA , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLHAU , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLMW , [InstrStage<37, [SLU]>]>,
+ InstrItinData<LdStLVecX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLWA , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLWARX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTD , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTDCX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTDU , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTVEBX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTWCX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSync , [InstrStage<35, [SLU]>]>,
+ InstrItinData<SprISYNC , [InstrStage<0, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<SprMFSR , [InstrStage<4, [IU2]>]>,
+ InstrItinData<SprMTMSR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<SprMTSR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<3, [SLU]>]>,
+ InstrItinData<SprMFCR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<SprMFMSR , [InstrStage<3, [IU2]>]>,
+ InstrItinData<SprMFSPR , [InstrStage<4, [IU2]>]>,
+ InstrItinData<SprMFTB , [InstrStage<5, [IU2]>]>,
+ InstrItinData<SprMTSPR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<SprMTSRIN , [InstrStage<2, [IU2]>]>,
+ InstrItinData<SprRFI , [InstrStage<1, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<SprSC , [InstrStage<0, [IU1, IU2, IU3, IU4]>]>,
+ InstrItinData<FPGeneral , [InstrStage<5, [FPU1]>]>,
+ InstrItinData<FPAddSub , [InstrStage<5, [FPU1]>]>,
+ InstrItinData<FPCompare , [InstrStage<5, [FPU1]>]>,
+ InstrItinData<FPDivD , [InstrStage<35, [FPU1]>]>,
+ InstrItinData<FPDivS , [InstrStage<21, [FPU1]>]>,
+ InstrItinData<FPFused , [InstrStage<5, [FPU1]>]>,
+ InstrItinData<FPRes , [InstrStage<14, [FPU1]>]>,
+ InstrItinData<VecGeneral , [InstrStage<1, [VIU1]>]>,
+ InstrItinData<VecFP , [InstrStage<4, [VFPU]>]>,
+ InstrItinData<VecFPCompare, [InstrStage<2, [VFPU]>]>,
+ InstrItinData<VecComplex , [InstrStage<4, [VIU2]>]>,
+ InstrItinData<VecPerm , [InstrStage<2, [VPU]>]>,
+ InstrItinData<VecFPRound , [InstrStage<4, [VIU1]>]>,
+ InstrItinData<VecVSL , [InstrStage<2, [VPU]>]>,
+ InstrItinData<VecVSR , [InstrStage<2, [VPU]>]>
+]>;
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCScheduleG5.td b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG5.td
new file mode 100644
index 0000000..c64998d
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCScheduleG5.td
@@ -0,0 +1,109 @@
+//===-- PPCScheduleG5.td - PPC G5 Scheduling Definitions ---*- tablegen -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the itinerary class data for the G5 (970) processor.
+//
+//===----------------------------------------------------------------------===//
+
+def G5Itineraries : ProcessorItineraries<
+ [IU1, IU2, SLU, BPU, FPU1, FPU2, VFPU, VIU1, VIU2, VPU], [], [
+ InstrItinData<IntSimple , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<IntGeneral , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<IntCompare , [InstrStage<3, [IU1, IU2]>]>,
+ InstrItinData<IntDivD , [InstrStage<68, [IU1]>]>,
+ InstrItinData<IntDivW , [InstrStage<36, [IU1]>]>,
+ InstrItinData<IntMFFS , [InstrStage<6, [IU2]>]>,
+ InstrItinData<IntMFVSCR , [InstrStage<1, [VFPU]>]>,
+ InstrItinData<IntMTFSB0 , [InstrStage<6, [FPU1, FPU2]>]>,
+ InstrItinData<IntMulHD , [InstrStage<7, [IU1, IU2]>]>,
+ InstrItinData<IntMulHW , [InstrStage<5, [IU1, IU2]>]>,
+ InstrItinData<IntMulHWU , [InstrStage<5, [IU1, IU2]>]>,
+ InstrItinData<IntMulLI , [InstrStage<4, [IU1, IU2]>]>,
+ InstrItinData<IntRFID , [InstrStage<1, [IU2]>]>,
+ InstrItinData<IntRotateD , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<IntRotateDI , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<IntRotate , [InstrStage<4, [IU1, IU2]>]>,
+ InstrItinData<IntShift , [InstrStage<2, [IU1, IU2]>]>,
+ InstrItinData<IntTrapD , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<IntTrapW , [InstrStage<1, [IU1, IU2]>]>,
+ InstrItinData<BrB , [InstrStage<1, [BPU]>]>,
+ InstrItinData<BrCR , [InstrStage<4, [BPU]>]>,
+ InstrItinData<BrMCR , [InstrStage<2, [BPU]>]>,
+ InstrItinData<BrMCRX , [InstrStage<3, [BPU]>]>,
+ InstrItinData<LdStDCBF , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLoad , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLoadUpd , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStStore , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStStoreUpd, [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStDSS , [InstrStage<10, [SLU]>]>,
+ InstrItinData<LdStICBI , [InstrStage<40, [SLU]>]>,
+ InstrItinData<LdStSTFD , [InstrStage<4, [SLU]>]>,
+ InstrItinData<LdStSTFDU , [InstrStage<4, [SLU]>]>,
+ InstrItinData<LdStLD , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLDU , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLDARX , [InstrStage<11, [SLU]>]>,
+ InstrItinData<LdStLFD , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLFDU , [InstrStage<5, [SLU]>]>,
+ InstrItinData<LdStLHA , [InstrStage<5, [SLU]>]>,
+ InstrItinData<LdStLHAU , [InstrStage<5, [SLU]>]>,
+ InstrItinData<LdStLMW , [InstrStage<64, [SLU]>]>,
+ InstrItinData<LdStLVecX , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStLWA , [InstrStage<5, [SLU]>]>,
+ InstrItinData<LdStLWARX , [InstrStage<11, [SLU]>]>,
+ InstrItinData<LdStSLBIA , [InstrStage<40, [SLU]>]>, // needs work
+ InstrItinData<LdStSLBIE , [InstrStage<2, [SLU]>]>,
+ InstrItinData<LdStSTD , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTDU , [InstrStage<3, [SLU]>]>,
+ InstrItinData<LdStSTDCX , [InstrStage<11, [SLU]>]>,
+ InstrItinData<LdStSTVEBX , [InstrStage<5, [SLU]>]>,
+ InstrItinData<LdStSTWCX , [InstrStage<11, [SLU]>]>,
+ InstrItinData<LdStSync , [InstrStage<35, [SLU]>]>,
+ InstrItinData<SprISYNC , [InstrStage<40, [SLU]>]>, // needs work
+ InstrItinData<SprMFSR , [InstrStage<3, [SLU]>]>,
+ InstrItinData<SprMTMSR , [InstrStage<3, [SLU]>]>,
+ InstrItinData<SprMTSR , [InstrStage<3, [SLU]>]>,
+ InstrItinData<SprTLBSYNC , [InstrStage<3, [SLU]>]>,
+ InstrItinData<SprMFCR , [InstrStage<2, [IU2]>]>,
+ InstrItinData<SprMFMSR , [InstrStage<3, [IU2]>]>,
+ InstrItinData<SprMFSPR , [InstrStage<3, [IU2]>]>,
+ InstrItinData<SprMFTB , [InstrStage<10, [IU2]>]>,
+ InstrItinData<SprMTSPR , [InstrStage<8, [IU2]>]>,
+ InstrItinData<SprSC , [InstrStage<1, [IU2]>]>,
+ InstrItinData<FPGeneral , [InstrStage<6, [FPU1, FPU2]>]>,
+ InstrItinData<FPAddSub , [InstrStage<6, [FPU1, FPU2]>]>,
+ InstrItinData<FPCompare , [InstrStage<8, [FPU1, FPU2]>]>,
+ InstrItinData<FPDivD , [InstrStage<33, [FPU1, FPU2]>]>,
+ InstrItinData<FPDivS , [InstrStage<33, [FPU1, FPU2]>]>,
+ InstrItinData<FPFused , [InstrStage<6, [FPU1, FPU2]>]>,
+ InstrItinData<FPRes , [InstrStage<6, [FPU1, FPU2]>]>,
+ InstrItinData<FPSqrt , [InstrStage<40, [FPU1, FPU2]>]>,
+ InstrItinData<VecGeneral , [InstrStage<2, [VIU1]>]>,
+ InstrItinData<VecFP , [InstrStage<8, [VFPU]>]>,
+ InstrItinData<VecFPCompare, [InstrStage<2, [VFPU]>]>,
+ InstrItinData<VecComplex , [InstrStage<5, [VIU2]>]>,
+ InstrItinData<VecPerm , [InstrStage<3, [VPU]>]>,
+ InstrItinData<VecFPRound , [InstrStage<8, [VFPU]>]>,
+ InstrItinData<VecVSL , [InstrStage<2, [VIU1]>]>,
+ InstrItinData<VecVSR , [InstrStage<3, [VPU]>]>
+]>;
+
+// ===---------------------------------------------------------------------===//
+// e5500 machine model for scheduling and other instruction cost heuristics.
+
+def G5Model : SchedMachineModel {
+ let IssueWidth = 4; // 4 (non-branch) instructions are dispatched per cycle.
+ let MinLatency = 0; // Out-of-order dispatch.
+ let LoadLatency = 3; // Optimistic load latency assuming bypass.
+ // This is overriden by OperandCycles if the
+ // Itineraries are queried instead.
+ let MispredictPenalty = 16;
+
+ let Itineraries = G5Itineraries;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.cpp b/contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.cpp
new file mode 100644
index 0000000..d4258b4
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.cpp
@@ -0,0 +1,23 @@
+//===-- PPCSelectionDAGInfo.cpp - PowerPC SelectionDAG Info ---------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements the PPCSelectionDAGInfo class.
+//
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "powerpc-selectiondag-info"
+#include "PPCTargetMachine.h"
+using namespace llvm;
+
+PPCSelectionDAGInfo::PPCSelectionDAGInfo(const PPCTargetMachine &TM)
+ : TargetSelectionDAGInfo(TM) {
+}
+
+PPCSelectionDAGInfo::~PPCSelectionDAGInfo() {
+}
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.h b/contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.h
new file mode 100644
index 0000000..341b69c
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCSelectionDAGInfo.h
@@ -0,0 +1,31 @@
+//===-- PPCSelectionDAGInfo.h - PowerPC SelectionDAG Info -------*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file defines the PowerPC subclass for TargetSelectionDAGInfo.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPCCSELECTIONDAGINFO_H
+#define POWERPCCSELECTIONDAGINFO_H
+
+#include "llvm/Target/TargetSelectionDAGInfo.h"
+
+namespace llvm {
+
+class PPCTargetMachine;
+
+class PPCSelectionDAGInfo : public TargetSelectionDAGInfo {
+public:
+ explicit PPCSelectionDAGInfo(const PPCTargetMachine &TM);
+ ~PPCSelectionDAGInfo();
+};
+
+}
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCSubtarget.cpp b/contrib/llvm/lib/Target/PowerPC/PPCSubtarget.cpp
new file mode 100644
index 0000000..a8f2b3f
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCSubtarget.cpp
@@ -0,0 +1,159 @@
+//===-- PowerPCSubtarget.cpp - PPC Subtarget Information ------------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file implements the PPC specific subclass of TargetSubtargetInfo.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCSubtarget.h"
+#include "PPC.h"
+#include "PPCRegisterInfo.h"
+#include "llvm/IR/GlobalValue.h"
+#include "llvm/Support/Host.h"
+#include "llvm/Support/TargetRegistry.h"
+#include "llvm/Target/TargetMachine.h"
+#include <cstdlib>
+
+#define GET_SUBTARGETINFO_TARGET_DESC
+#define GET_SUBTARGETINFO_CTOR
+#include "PPCGenSubtargetInfo.inc"
+
+using namespace llvm;
+
+PPCSubtarget::PPCSubtarget(const std::string &TT, const std::string &CPU,
+ const std::string &FS, bool is64Bit)
+ : PPCGenSubtargetInfo(TT, CPU, FS)
+ , StackAlignment(16)
+ , DarwinDirective(PPC::DIR_NONE)
+ , HasMFOCRF(false)
+ , Has64BitSupport(false)
+ , Use64BitRegs(false)
+ , IsPPC64(is64Bit)
+ , HasAltivec(false)
+ , HasQPX(false)
+ , HasFSQRT(false)
+ , HasFRE(false)
+ , HasFRES(false)
+ , HasFRSQRTE(false)
+ , HasFRSQRTES(false)
+ , HasRecipPrec(false)
+ , HasSTFIWX(false)
+ , HasLFIWAX(false)
+ , HasFPRND(false)
+ , HasFPCVT(false)
+ , HasISEL(false)
+ , HasPOPCNTD(false)
+ , HasLDBRX(false)
+ , IsBookE(false)
+ , HasLazyResolverStubs(false)
+ , IsJITCodeModel(false)
+ , TargetTriple(TT) {
+
+ // Determine default and user specified characteristics
+ std::string CPUName = CPU;
+ if (CPUName.empty())
+ CPUName = "generic";
+#if (defined(__APPLE__) || defined(__linux__)) && \
+ (defined(__ppc__) || defined(__powerpc__))
+ if (CPUName == "generic")
+ CPUName = sys::getHostCPUName();
+#endif
+
+ // Initialize scheduling itinerary for the specified CPU.
+ InstrItins = getInstrItineraryForCPU(CPUName);
+
+ // Make sure 64-bit features are available when CPUname is generic
+ std::string FullFS = FS;
+
+ // If we are generating code for ppc64, verify that options make sense.
+ if (is64Bit) {
+ Has64BitSupport = true;
+ // Silently force 64-bit register use on ppc64.
+ Use64BitRegs = true;
+ if (!FullFS.empty())
+ FullFS = "+64bit," + FullFS;
+ else
+ FullFS = "+64bit";
+ }
+
+ // Parse features string.
+ ParseSubtargetFeatures(CPUName, FullFS);
+
+ // If the user requested use of 64-bit regs, but the cpu selected doesn't
+ // support it, ignore.
+ if (use64BitRegs() && !has64BitSupport())
+ Use64BitRegs = false;
+
+ // Set up darwin-specific properties.
+ if (isDarwin())
+ HasLazyResolverStubs = true;
+
+ // QPX requires a 32-byte aligned stack. Note that we need to do this if
+ // we're compiling for a BG/Q system regardless of whether or not QPX
+ // is enabled because external functions will assume this alignment.
+ if (hasQPX() || isBGQ())
+ StackAlignment = 32;
+}
+
+/// SetJITMode - This is called to inform the subtarget info that we are
+/// producing code for the JIT.
+void PPCSubtarget::SetJITMode() {
+ // JIT mode doesn't want lazy resolver stubs, it knows exactly where
+ // everything is. This matters for PPC64, which codegens in PIC mode without
+ // stubs.
+ HasLazyResolverStubs = false;
+
+ // Calls to external functions need to use indirect calls
+ IsJITCodeModel = true;
+}
+
+
+/// hasLazyResolverStub - Return true if accesses to the specified global have
+/// to go through a dyld lazy resolution stub. This means that an extra load
+/// is required to get the address of the global.
+bool PPCSubtarget::hasLazyResolverStub(const GlobalValue *GV,
+ const TargetMachine &TM) const {
+ // We never have stubs if HasLazyResolverStubs=false or if in static mode.
+ if (!HasLazyResolverStubs || TM.getRelocationModel() == Reloc::Static)
+ return false;
+ // If symbol visibility is hidden, the extra load is not needed if
+ // the symbol is definitely defined in the current translation unit.
+ bool isDecl = GV->isDeclaration() && !GV->isMaterializable();
+ if (GV->hasHiddenVisibility() && !isDecl && !GV->hasCommonLinkage())
+ return false;
+ return GV->hasWeakLinkage() || GV->hasLinkOnceLinkage() ||
+ GV->hasCommonLinkage() || isDecl;
+}
+
+bool PPCSubtarget::enablePostRAScheduler(
+ CodeGenOpt::Level OptLevel,
+ TargetSubtargetInfo::AntiDepBreakMode& Mode,
+ RegClassVector& CriticalPathRCs) const {
+ // FIXME: It would be best to use TargetSubtargetInfo::ANTIDEP_ALL here,
+ // but we can't because we can't reassign the cr registers. There is a
+ // dependence between the cr register and the RLWINM instruction used
+ // to extract its value which the anti-dependency breaker can't currently
+ // see. Maybe we should make a late-expanded pseudo to encode this dependency.
+ // (the relevant code is in PPCDAGToDAGISel::SelectSETCC)
+
+ Mode = TargetSubtargetInfo::ANTIDEP_CRITICAL;
+
+ CriticalPathRCs.clear();
+
+ if (isPPC64())
+ CriticalPathRCs.push_back(&PPC::G8RCRegClass);
+ else
+ CriticalPathRCs.push_back(&PPC::GPRCRegClass);
+
+ CriticalPathRCs.push_back(&PPC::F8RCRegClass);
+ CriticalPathRCs.push_back(&PPC::VRRCRegClass);
+
+ return OptLevel >= CodeGenOpt::Default;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCSubtarget.h b/contrib/llvm/lib/Target/PowerPC/PPCSubtarget.h
new file mode 100644
index 0000000..65b4d21
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCSubtarget.h
@@ -0,0 +1,200 @@
+//===-- PPCSubtarget.h - Define Subtarget for the PPC ----------*- C++ -*--===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file declares the PowerPC specific subclass of TargetSubtargetInfo.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef POWERPCSUBTARGET_H
+#define POWERPCSUBTARGET_H
+
+#include "llvm/ADT/Triple.h"
+#include "llvm/MC/MCInstrItineraries.h"
+#include "llvm/Target/TargetSubtargetInfo.h"
+#include <string>
+
+#define GET_SUBTARGETINFO_HEADER
+#include "PPCGenSubtargetInfo.inc"
+
+// GCC #defines PPC on Linux but we use it as our namespace name
+#undef PPC
+
+namespace llvm {
+class StringRef;
+
+namespace PPC {
+ // -m directive values.
+ enum {
+ DIR_NONE,
+ DIR_32,
+ DIR_440,
+ DIR_601,
+ DIR_602,
+ DIR_603,
+ DIR_7400,
+ DIR_750,
+ DIR_970,
+ DIR_A2,
+ DIR_E500mc,
+ DIR_E5500,
+ DIR_PWR3,
+ DIR_PWR4,
+ DIR_PWR5,
+ DIR_PWR5X,
+ DIR_PWR6,
+ DIR_PWR6X,
+ DIR_PWR7,
+ DIR_64
+ };
+}
+
+class GlobalValue;
+class TargetMachine;
+
+class PPCSubtarget : public PPCGenSubtargetInfo {
+protected:
+ /// stackAlignment - The minimum alignment known to hold of the stack frame on
+ /// entry to the function and which must be maintained by every function.
+ unsigned StackAlignment;
+
+ /// Selected instruction itineraries (one entry per itinerary class.)
+ InstrItineraryData InstrItins;
+
+ /// Which cpu directive was used.
+ unsigned DarwinDirective;
+
+ /// Used by the ISel to turn in optimizations for POWER4-derived architectures
+ bool HasMFOCRF;
+ bool Has64BitSupport;
+ bool Use64BitRegs;
+ bool IsPPC64;
+ bool HasAltivec;
+ bool HasQPX;
+ bool HasFSQRT;
+ bool HasFRE, HasFRES, HasFRSQRTE, HasFRSQRTES;
+ bool HasRecipPrec;
+ bool HasSTFIWX;
+ bool HasLFIWAX;
+ bool HasFPRND;
+ bool HasFPCVT;
+ bool HasISEL;
+ bool HasPOPCNTD;
+ bool HasLDBRX;
+ bool IsBookE;
+ bool HasLazyResolverStubs;
+ bool IsJITCodeModel;
+
+ /// TargetTriple - What processor and OS we're targeting.
+ Triple TargetTriple;
+
+public:
+ /// This constructor initializes the data members to match that
+ /// of the specified triple.
+ ///
+ PPCSubtarget(const std::string &TT, const std::string &CPU,
+ const std::string &FS, bool is64Bit);
+
+ /// ParseSubtargetFeatures - Parses features string setting specified
+ /// subtarget options. Definition of function is auto generated by tblgen.
+ void ParseSubtargetFeatures(StringRef CPU, StringRef FS);
+
+ /// SetJITMode - This is called to inform the subtarget info that we are
+ /// producing code for the JIT.
+ void SetJITMode();
+
+ /// getStackAlignment - Returns the minimum alignment known to hold of the
+ /// stack frame on entry to the function and which must be maintained by every
+ /// function for this subtarget.
+ unsigned getStackAlignment() const { return StackAlignment; }
+
+ /// getDarwinDirective - Returns the -m directive specified for the cpu.
+ ///
+ unsigned getDarwinDirective() const { return DarwinDirective; }
+
+ /// getInstrItins - Return the instruction itineraies based on subtarget
+ /// selection.
+ const InstrItineraryData &getInstrItineraryData() const { return InstrItins; }
+
+ /// getDataLayoutString - Return the pointer size and type alignment
+ /// properties of this subtarget.
+ const char *getDataLayoutString() const {
+ // Note, the alignment values for f64 and i64 on ppc64 in Darwin
+ // documentation are wrong; these are correct (i.e. "what gcc does").
+ if (isPPC64() && isSVR4ABI()) {
+ if (TargetTriple.getOS() == llvm::Triple::FreeBSD)
+ return "E-p:64:64-f64:64:64-i64:64:64-f128:64:64-v128:128:128-n32:64";
+ else
+ return "E-p:64:64-f64:64:64-i64:64:64-f128:128:128-v128:128:128-n32:64";
+ }
+
+ return isPPC64() ? "E-p:64:64-f64:64:64-i64:64:64-f128:64:128-n32:64"
+ : "E-p:32:32-f64:64:64-i64:64:64-f128:64:128-n32";
+ }
+
+ /// isPPC64 - Return true if we are generating code for 64-bit pointer mode.
+ ///
+ bool isPPC64() const { return IsPPC64; }
+
+ /// has64BitSupport - Return true if the selected CPU supports 64-bit
+ /// instructions, regardless of whether we are in 32-bit or 64-bit mode.
+ bool has64BitSupport() const { return Has64BitSupport; }
+
+ /// use64BitRegs - Return true if in 64-bit mode or if we should use 64-bit
+ /// registers in 32-bit mode when possible. This can only true if
+ /// has64BitSupport() returns true.
+ bool use64BitRegs() const { return Use64BitRegs; }
+
+ /// hasLazyResolverStub - Return true if accesses to the specified global have
+ /// to go through a dyld lazy resolution stub. This means that an extra load
+ /// is required to get the address of the global.
+ bool hasLazyResolverStub(const GlobalValue *GV,
+ const TargetMachine &TM) const;
+
+ // isJITCodeModel - True if we're generating code for the JIT
+ bool isJITCodeModel() const { return IsJITCodeModel; }
+
+ // Specific obvious features.
+ bool hasFSQRT() const { return HasFSQRT; }
+ bool hasFRE() const { return HasFRE; }
+ bool hasFRES() const { return HasFRES; }
+ bool hasFRSQRTE() const { return HasFRSQRTE; }
+ bool hasFRSQRTES() const { return HasFRSQRTES; }
+ bool hasRecipPrec() const { return HasRecipPrec; }
+ bool hasSTFIWX() const { return HasSTFIWX; }
+ bool hasLFIWAX() const { return HasLFIWAX; }
+ bool hasFPRND() const { return HasFPRND; }
+ bool hasFPCVT() const { return HasFPCVT; }
+ bool hasAltivec() const { return HasAltivec; }
+ bool hasQPX() const { return HasQPX; }
+ bool hasMFOCRF() const { return HasMFOCRF; }
+ bool hasISEL() const { return HasISEL; }
+ bool hasPOPCNTD() const { return HasPOPCNTD; }
+ bool hasLDBRX() const { return HasLDBRX; }
+ bool isBookE() const { return IsBookE; }
+
+ const Triple &getTargetTriple() const { return TargetTriple; }
+
+ /// isDarwin - True if this is any darwin platform.
+ bool isDarwin() const { return TargetTriple.isMacOSX(); }
+ /// isBGP - True if this is a BG/P platform.
+ bool isBGP() const { return TargetTriple.getVendor() == Triple::BGP; }
+ /// isBGQ - True if this is a BG/Q platform.
+ bool isBGQ() const { return TargetTriple.getVendor() == Triple::BGQ; }
+
+ bool isDarwinABI() const { return isDarwin(); }
+ bool isSVR4ABI() const { return !isDarwin(); }
+
+ /// enablePostRAScheduler - True at 'More' optimization.
+ bool enablePostRAScheduler(CodeGenOpt::Level OptLevel,
+ TargetSubtargetInfo::AntiDepBreakMode& Mode,
+ RegClassVector& CriticalPathRCs) const;
+};
+} // End llvm namespace
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.cpp b/contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.cpp
new file mode 100644
index 0000000..fe851c1
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.cpp
@@ -0,0 +1,137 @@
+//===-- PPCTargetMachine.cpp - Define TargetMachine for PowerPC -----------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// Top-level implementation for the PowerPC target.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPCTargetMachine.h"
+#include "PPC.h"
+#include "llvm/CodeGen/Passes.h"
+#include "llvm/MC/MCStreamer.h"
+#include "llvm/PassManager.h"
+#include "llvm/Support/CommandLine.h"
+#include "llvm/Support/FormattedStream.h"
+#include "llvm/Support/TargetRegistry.h"
+#include "llvm/Target/TargetOptions.h"
+using namespace llvm;
+
+static cl::
+opt<bool> DisableCTRLoops("disable-ppc-ctrloops", cl::Hidden,
+ cl::desc("Disable CTR loops for PPC"));
+
+extern "C" void LLVMInitializePowerPCTarget() {
+ // Register the targets
+ RegisterTargetMachine<PPC32TargetMachine> A(ThePPC32Target);
+ RegisterTargetMachine<PPC64TargetMachine> B(ThePPC64Target);
+}
+
+PPCTargetMachine::PPCTargetMachine(const Target &T, StringRef TT,
+ StringRef CPU, StringRef FS,
+ const TargetOptions &Options,
+ Reloc::Model RM, CodeModel::Model CM,
+ CodeGenOpt::Level OL,
+ bool is64Bit)
+ : LLVMTargetMachine(T, TT, CPU, FS, Options, RM, CM, OL),
+ Subtarget(TT, CPU, FS, is64Bit),
+ DL(Subtarget.getDataLayoutString()), InstrInfo(*this),
+ FrameLowering(Subtarget), JITInfo(*this, is64Bit),
+ TLInfo(*this), TSInfo(*this),
+ InstrItins(Subtarget.getInstrItineraryData()) {
+
+ // The binutils for the BG/P are too old for CFI.
+ if (Subtarget.isBGP())
+ setMCUseCFI(false);
+}
+
+void PPC32TargetMachine::anchor() { }
+
+PPC32TargetMachine::PPC32TargetMachine(const Target &T, StringRef TT,
+ StringRef CPU, StringRef FS,
+ const TargetOptions &Options,
+ Reloc::Model RM, CodeModel::Model CM,
+ CodeGenOpt::Level OL)
+ : PPCTargetMachine(T, TT, CPU, FS, Options, RM, CM, OL, false) {
+}
+
+void PPC64TargetMachine::anchor() { }
+
+PPC64TargetMachine::PPC64TargetMachine(const Target &T, StringRef TT,
+ StringRef CPU, StringRef FS,
+ const TargetOptions &Options,
+ Reloc::Model RM, CodeModel::Model CM,
+ CodeGenOpt::Level OL)
+ : PPCTargetMachine(T, TT, CPU, FS, Options, RM, CM, OL, true) {
+}
+
+
+//===----------------------------------------------------------------------===//
+// Pass Pipeline Configuration
+//===----------------------------------------------------------------------===//
+
+namespace {
+/// PPC Code Generator Pass Configuration Options.
+class PPCPassConfig : public TargetPassConfig {
+public:
+ PPCPassConfig(PPCTargetMachine *TM, PassManagerBase &PM)
+ : TargetPassConfig(TM, PM) {}
+
+ PPCTargetMachine &getPPCTargetMachine() const {
+ return getTM<PPCTargetMachine>();
+ }
+
+ virtual bool addPreRegAlloc();
+ virtual bool addInstSelector();
+ virtual bool addPreEmitPass();
+};
+} // namespace
+
+TargetPassConfig *PPCTargetMachine::createPassConfig(PassManagerBase &PM) {
+ return new PPCPassConfig(this, PM);
+}
+
+bool PPCPassConfig::addPreRegAlloc() {
+ if (!DisableCTRLoops && getOptLevel() != CodeGenOpt::None)
+ addPass(createPPCCTRLoops());
+
+ return false;
+}
+
+bool PPCPassConfig::addInstSelector() {
+ // Install an instruction selector.
+ addPass(createPPCISelDag(getPPCTargetMachine()));
+ return false;
+}
+
+bool PPCPassConfig::addPreEmitPass() {
+ // Must run branch selection immediately preceding the asm printer.
+ addPass(createPPCBranchSelectionPass());
+ return false;
+}
+
+bool PPCTargetMachine::addCodeEmitter(PassManagerBase &PM,
+ JITCodeEmitter &JCE) {
+ // Inform the subtarget that we are in JIT mode. FIXME: does this break macho
+ // writing?
+ Subtarget.SetJITMode();
+
+ // Machine code emitter pass for PowerPC.
+ PM.add(createPPCJITCodeEmitterPass(*this, JCE));
+
+ return false;
+}
+
+void PPCTargetMachine::addAnalysisPasses(PassManagerBase &PM) {
+ // Add first the target-independent BasicTTI pass, then our PPC pass. This
+ // allows the PPC pass to delegate to the target independent layer when
+ // appropriate.
+ PM.add(createBasicTargetTransformInfoPass(getTargetLowering()));
+ PM.add(createPPCTargetTransformInfoPass(this));
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.h b/contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.h
new file mode 100644
index 0000000..606ccb3
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCTargetMachine.h
@@ -0,0 +1,100 @@
+//===-- PPCTargetMachine.h - Define TargetMachine for PowerPC ---*- C++ -*-===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+//
+// This file declares the PowerPC specific subclass of TargetMachine.
+//
+//===----------------------------------------------------------------------===//
+
+#ifndef PPC_TARGETMACHINE_H
+#define PPC_TARGETMACHINE_H
+
+#include "PPCFrameLowering.h"
+#include "PPCISelLowering.h"
+#include "PPCInstrInfo.h"
+#include "PPCJITInfo.h"
+#include "PPCSelectionDAGInfo.h"
+#include "PPCSubtarget.h"
+#include "llvm/IR/DataLayout.h"
+#include "llvm/Target/TargetMachine.h"
+
+namespace llvm {
+
+/// PPCTargetMachine - Common code between 32-bit and 64-bit PowerPC targets.
+///
+class PPCTargetMachine : public LLVMTargetMachine {
+ PPCSubtarget Subtarget;
+ const DataLayout DL; // Calculates type size & alignment
+ PPCInstrInfo InstrInfo;
+ PPCFrameLowering FrameLowering;
+ PPCJITInfo JITInfo;
+ PPCTargetLowering TLInfo;
+ PPCSelectionDAGInfo TSInfo;
+ InstrItineraryData InstrItins;
+
+public:
+ PPCTargetMachine(const Target &T, StringRef TT,
+ StringRef CPU, StringRef FS, const TargetOptions &Options,
+ Reloc::Model RM, CodeModel::Model CM,
+ CodeGenOpt::Level OL, bool is64Bit);
+
+ virtual const PPCInstrInfo *getInstrInfo() const { return &InstrInfo; }
+ virtual const PPCFrameLowering *getFrameLowering() const {
+ return &FrameLowering;
+ }
+ virtual PPCJITInfo *getJITInfo() { return &JITInfo; }
+ virtual const PPCTargetLowering *getTargetLowering() const {
+ return &TLInfo;
+ }
+ virtual const PPCSelectionDAGInfo* getSelectionDAGInfo() const {
+ return &TSInfo;
+ }
+ virtual const PPCRegisterInfo *getRegisterInfo() const {
+ return &InstrInfo.getRegisterInfo();
+ }
+
+ virtual const DataLayout *getDataLayout() const { return &DL; }
+ virtual const PPCSubtarget *getSubtargetImpl() const { return &Subtarget; }
+ virtual const InstrItineraryData *getInstrItineraryData() const {
+ return &InstrItins;
+ }
+
+ // Pass Pipeline Configuration
+ virtual TargetPassConfig *createPassConfig(PassManagerBase &PM);
+ virtual bool addCodeEmitter(PassManagerBase &PM,
+ JITCodeEmitter &JCE);
+
+ /// \brief Register PPC analysis passes with a pass manager.
+ virtual void addAnalysisPasses(PassManagerBase &PM);
+};
+
+/// PPC32TargetMachine - PowerPC 32-bit target machine.
+///
+class PPC32TargetMachine : public PPCTargetMachine {
+ virtual void anchor();
+public:
+ PPC32TargetMachine(const Target &T, StringRef TT,
+ StringRef CPU, StringRef FS, const TargetOptions &Options,
+ Reloc::Model RM, CodeModel::Model CM,
+ CodeGenOpt::Level OL);
+};
+
+/// PPC64TargetMachine - PowerPC 64-bit target machine.
+///
+class PPC64TargetMachine : public PPCTargetMachine {
+ virtual void anchor();
+public:
+ PPC64TargetMachine(const Target &T, StringRef TT,
+ StringRef CPU, StringRef FS, const TargetOptions &Options,
+ Reloc::Model RM, CodeModel::Model CM,
+ CodeGenOpt::Level OL);
+};
+
+} // end namespace llvm
+
+#endif
diff --git a/contrib/llvm/lib/Target/PowerPC/PPCTargetTransformInfo.cpp b/contrib/llvm/lib/Target/PowerPC/PPCTargetTransformInfo.cpp
new file mode 100644
index 0000000..2504ba7
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/PPCTargetTransformInfo.cpp
@@ -0,0 +1,240 @@
+//===-- PPCTargetTransformInfo.cpp - PPC specific TTI pass ----------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+/// \file
+/// This file implements a TargetTransformInfo analysis pass specific to the
+/// PPC target machine. It uses the target's detailed information to provide
+/// more precise answers to certain TTI queries, while letting the target
+/// independent and default TTI implementations handle the rest.
+///
+//===----------------------------------------------------------------------===//
+
+#define DEBUG_TYPE "ppctti"
+#include "PPC.h"
+#include "PPCTargetMachine.h"
+#include "llvm/Analysis/TargetTransformInfo.h"
+#include "llvm/Support/Debug.h"
+#include "llvm/Target/TargetLowering.h"
+#include "llvm/Target/CostTable.h"
+using namespace llvm;
+
+// Declare the pass initialization routine locally as target-specific passes
+// don't havve a target-wide initialization entry point, and so we rely on the
+// pass constructor initialization.
+namespace llvm {
+void initializePPCTTIPass(PassRegistry &);
+}
+
+namespace {
+
+class PPCTTI : public ImmutablePass, public TargetTransformInfo {
+ const PPCTargetMachine *TM;
+ const PPCSubtarget *ST;
+ const PPCTargetLowering *TLI;
+
+ /// Estimate the overhead of scalarizing an instruction. Insert and Extract
+ /// are set if the result needs to be inserted and/or extracted from vectors.
+ unsigned getScalarizationOverhead(Type *Ty, bool Insert, bool Extract) const;
+
+public:
+ PPCTTI() : ImmutablePass(ID), TM(0), ST(0), TLI(0) {
+ llvm_unreachable("This pass cannot be directly constructed");
+ }
+
+ PPCTTI(const PPCTargetMachine *TM)
+ : ImmutablePass(ID), TM(TM), ST(TM->getSubtargetImpl()),
+ TLI(TM->getTargetLowering()) {
+ initializePPCTTIPass(*PassRegistry::getPassRegistry());
+ }
+
+ virtual void initializePass() {
+ pushTTIStack(this);
+ }
+
+ virtual void finalizePass() {
+ popTTIStack();
+ }
+
+ virtual void getAnalysisUsage(AnalysisUsage &AU) const {
+ TargetTransformInfo::getAnalysisUsage(AU);
+ }
+
+ /// Pass identification.
+ static char ID;
+
+ /// Provide necessary pointer adjustments for the two base classes.
+ virtual void *getAdjustedAnalysisPointer(const void *ID) {
+ if (ID == &TargetTransformInfo::ID)
+ return (TargetTransformInfo*)this;
+ return this;
+ }
+
+ /// \name Scalar TTI Implementations
+ /// @{
+ virtual PopcntSupportKind getPopcntSupport(unsigned TyWidth) const;
+
+ /// @}
+
+ /// \name Vector TTI Implementations
+ /// @{
+
+ virtual unsigned getNumberOfRegisters(bool Vector) const;
+ virtual unsigned getRegisterBitWidth(bool Vector) const;
+ virtual unsigned getMaximumUnrollFactor() const;
+ virtual unsigned getArithmeticInstrCost(unsigned Opcode, Type *Ty,
+ OperandValueKind,
+ OperandValueKind) const;
+ virtual unsigned getShuffleCost(ShuffleKind Kind, Type *Tp,
+ int Index, Type *SubTp) const;
+ virtual unsigned getCastInstrCost(unsigned Opcode, Type *Dst,
+ Type *Src) const;
+ virtual unsigned getCmpSelInstrCost(unsigned Opcode, Type *ValTy,
+ Type *CondTy) const;
+ virtual unsigned getVectorInstrCost(unsigned Opcode, Type *Val,
+ unsigned Index) const;
+ virtual unsigned getMemoryOpCost(unsigned Opcode, Type *Src,
+ unsigned Alignment,
+ unsigned AddressSpace) const;
+
+ /// @}
+};
+
+} // end anonymous namespace
+
+INITIALIZE_AG_PASS(PPCTTI, TargetTransformInfo, "ppctti",
+ "PPC Target Transform Info", true, true, false)
+char PPCTTI::ID = 0;
+
+ImmutablePass *
+llvm::createPPCTargetTransformInfoPass(const PPCTargetMachine *TM) {
+ return new PPCTTI(TM);
+}
+
+
+//===----------------------------------------------------------------------===//
+//
+// PPC cost model.
+//
+//===----------------------------------------------------------------------===//
+
+PPCTTI::PopcntSupportKind PPCTTI::getPopcntSupport(unsigned TyWidth) const {
+ assert(isPowerOf2_32(TyWidth) && "Ty width must be power of 2");
+ if (ST->hasPOPCNTD() && TyWidth <= 64)
+ return PSK_FastHardware;
+ return PSK_Software;
+}
+
+unsigned PPCTTI::getNumberOfRegisters(bool Vector) const {
+ if (Vector && !ST->hasAltivec())
+ return 0;
+ return 32;
+}
+
+unsigned PPCTTI::getRegisterBitWidth(bool Vector) const {
+ if (Vector) {
+ if (ST->hasAltivec()) return 128;
+ return 0;
+ }
+
+ if (ST->isPPC64())
+ return 64;
+ return 32;
+
+}
+
+unsigned PPCTTI::getMaximumUnrollFactor() const {
+ unsigned Directive = ST->getDarwinDirective();
+ // The 440 has no SIMD support, but floating-point instructions
+ // have a 5-cycle latency, so unroll by 5x for latency hiding.
+ if (Directive == PPC::DIR_440)
+ return 5;
+
+ // The A2 has no SIMD support, but floating-point instructions
+ // have a 6-cycle latency, so unroll by 6x for latency hiding.
+ if (Directive == PPC::DIR_A2)
+ return 6;
+
+ // FIXME: For lack of any better information, do no harm...
+ if (Directive == PPC::DIR_E500mc || Directive == PPC::DIR_E5500)
+ return 1;
+
+ // For most things, modern systems have two execution units (and
+ // out-of-order execution).
+ return 2;
+}
+
+unsigned PPCTTI::getArithmeticInstrCost(unsigned Opcode, Type *Ty,
+ OperandValueKind Op1Info,
+ OperandValueKind Op2Info) const {
+ assert(TLI->InstructionOpcodeToISD(Opcode) && "Invalid opcode");
+
+ // Fallback to the default implementation.
+ return TargetTransformInfo::getArithmeticInstrCost(Opcode, Ty, Op1Info,
+ Op2Info);
+}
+
+unsigned PPCTTI::getShuffleCost(ShuffleKind Kind, Type *Tp, int Index,
+ Type *SubTp) const {
+ return TargetTransformInfo::getShuffleCost(Kind, Tp, Index, SubTp);
+}
+
+unsigned PPCTTI::getCastInstrCost(unsigned Opcode, Type *Dst, Type *Src) const {
+ assert(TLI->InstructionOpcodeToISD(Opcode) && "Invalid opcode");
+
+ return TargetTransformInfo::getCastInstrCost(Opcode, Dst, Src);
+}
+
+unsigned PPCTTI::getCmpSelInstrCost(unsigned Opcode, Type *ValTy,
+ Type *CondTy) const {
+ return TargetTransformInfo::getCmpSelInstrCost(Opcode, ValTy, CondTy);
+}
+
+unsigned PPCTTI::getVectorInstrCost(unsigned Opcode, Type *Val,
+ unsigned Index) const {
+ assert(Val->isVectorTy() && "This must be a vector type");
+
+ int ISD = TLI->InstructionOpcodeToISD(Opcode);
+ assert(ISD && "Invalid opcode");
+
+ // Estimated cost of a load-hit-store delay. This was obtained
+ // experimentally as a minimum needed to prevent unprofitable
+ // vectorization for the paq8p benchmark. It may need to be
+ // raised further if other unprofitable cases remain.
+ unsigned LHSPenalty = 12;
+
+ // Vector element insert/extract with Altivec is very expensive,
+ // because they require store and reload with the attendant
+ // processor stall for load-hit-store. Until VSX is available,
+ // these need to be estimated as very costly.
+ if (ISD == ISD::EXTRACT_VECTOR_ELT ||
+ ISD == ISD::INSERT_VECTOR_ELT)
+ return LHSPenalty +
+ TargetTransformInfo::getVectorInstrCost(Opcode, Val, Index);
+
+ return TargetTransformInfo::getVectorInstrCost(Opcode, Val, Index);
+}
+
+unsigned PPCTTI::getMemoryOpCost(unsigned Opcode, Type *Src, unsigned Alignment,
+ unsigned AddressSpace) const {
+ // Legalize the type.
+ std::pair<unsigned, MVT> LT = TLI->getTypeLegalizationCost(Src);
+ assert((Opcode == Instruction::Load || Opcode == Instruction::Store) &&
+ "Invalid Opcode");
+
+ // Each load/store unit costs 1.
+ unsigned Cost = LT.first * 1;
+
+ // PPC in general does not support unaligned loads and stores. They'll need
+ // to be decomposed based on the alignment factor.
+ unsigned SrcBytes = LT.second.getStoreSize();
+ if (SrcBytes && Alignment && Alignment < SrcBytes)
+ Cost *= (SrcBytes/Alignment);
+
+ return Cost;
+}
+
diff --git a/contrib/llvm/lib/Target/PowerPC/TargetInfo/PowerPCTargetInfo.cpp b/contrib/llvm/lib/Target/PowerPC/TargetInfo/PowerPCTargetInfo.cpp
new file mode 100644
index 0000000..fa44331
--- /dev/null
+++ b/contrib/llvm/lib/Target/PowerPC/TargetInfo/PowerPCTargetInfo.cpp
@@ -0,0 +1,23 @@
+//===-- PowerPCTargetInfo.cpp - PowerPC Target Implementation -------------===//
+//
+// The LLVM Compiler Infrastructure
+//
+// This file is distributed under the University of Illinois Open Source
+// License. See LICENSE.TXT for details.
+//
+//===----------------------------------------------------------------------===//
+
+#include "PPC.h"
+#include "llvm/IR/Module.h"
+#include "llvm/Support/TargetRegistry.h"
+using namespace llvm;
+
+Target llvm::ThePPC32Target, llvm::ThePPC64Target;
+
+extern "C" void LLVMInitializePowerPCTargetInfo() {
+ RegisterTarget<Triple::ppc, /*HasJIT=*/true>
+ X(ThePPC32Target, "ppc32", "PowerPC 32");
+
+ RegisterTarget<Triple::ppc64, /*HasJIT=*/true>
+ Y(ThePPC64Target, "ppc64", "PowerPC 64");
+}
OpenPOWER on IntegriCloud