summaryrefslogtreecommitdiffstats
path: root/contrib/groff/src/utils
diff options
context:
space:
mode:
authorru <ru@FreeBSD.org>2005-10-20 10:45:19 +0000
committerru <ru@FreeBSD.org>2005-10-20 10:45:19 +0000
commit353ac0b339df3493d1950b6527988b77b76bd197 (patch)
tree8a188846a3f5bd2f2b8cb869cba64e3c470a2b26 /contrib/groff/src/utils
parentc40093b1f1b43dc237b9d272697cdd0842ec64ec (diff)
downloadFreeBSD-src-353ac0b339df3493d1950b6527988b77b76bd197.zip
FreeBSD-src-353ac0b339df3493d1950b6527988b77b76bd197.tar.gz
Virgin import of FSF groff v1.19.2
Diffstat (limited to 'contrib/groff/src/utils')
-rw-r--r--contrib/groff/src/utils/addftinfo/addftinfo.cpp2
-rw-r--r--contrib/groff/src/utils/addftinfo/guess.cpp2
-rw-r--r--contrib/groff/src/utils/addftinfo/guess.h2
-rw-r--r--contrib/groff/src/utils/afmtodit/Makefile.sub2
-rw-r--r--contrib/groff/src/utils/afmtodit/afmtodit.man44
-rw-r--r--contrib/groff/src/utils/afmtodit/afmtodit.pl12419
-rw-r--r--contrib/groff/src/utils/hpftodit/Makefile.sub6
-rw-r--r--contrib/groff/src/utils/hpftodit/hpftodit.cpp1131
-rw-r--r--contrib/groff/src/utils/hpftodit/hpftodit.man238
-rw-r--r--contrib/groff/src/utils/hpftodit/hpuni.cpp698
-rw-r--r--contrib/groff/src/utils/indxbib/Makefile.sub2
-rw-r--r--contrib/groff/src/utils/indxbib/indxbib.cpp34
-rw-r--r--contrib/groff/src/utils/indxbib/signal.c27
-rw-r--r--contrib/groff/src/utils/lkbib/lkbib.cpp2
-rw-r--r--contrib/groff/src/utils/lkbib/lkbib.man36
-rw-r--r--contrib/groff/src/utils/lookbib/lookbib.cpp6
-rw-r--r--contrib/groff/src/utils/lookbib/lookbib.man27
-rw-r--r--contrib/groff/src/utils/pfbtops/Makefile.sub1
-rw-r--r--contrib/groff/src/utils/pfbtops/pfbtops.c45
-rw-r--r--contrib/groff/src/utils/pfbtops/pfbtops.man21
-rw-r--r--contrib/groff/src/utils/tfmtodit/tfmtodit.cpp10
-rw-r--r--contrib/groff/src/utils/xtotroff/Makefile.in62
-rw-r--r--contrib/groff/src/utils/xtotroff/Makefile.sub8
-rw-r--r--contrib/groff/src/utils/xtotroff/xtotroff.c299
-rw-r--r--contrib/groff/src/utils/xtotroff/xtotroff.man109
25 files changed, 8727 insertions, 6506 deletions
diff --git a/contrib/groff/src/utils/addftinfo/addftinfo.cpp b/contrib/groff/src/utils/addftinfo/addftinfo.cpp
index 931d836..b2fd15d 100644
--- a/contrib/groff/src/utils/addftinfo/addftinfo.cpp
+++ b/contrib/groff/src/utils/addftinfo/addftinfo.cpp
@@ -16,7 +16,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
#include "lib.h"
diff --git a/contrib/groff/src/utils/addftinfo/guess.cpp b/contrib/groff/src/utils/addftinfo/guess.cpp
index dcfd4c9..7ae36dc 100644
--- a/contrib/groff/src/utils/addftinfo/guess.cpp
+++ b/contrib/groff/src/utils/addftinfo/guess.cpp
@@ -16,7 +16,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
#include "guess.h"
diff --git a/contrib/groff/src/utils/addftinfo/guess.h b/contrib/groff/src/utils/addftinfo/guess.h
index 4471dda..26f0883 100644
--- a/contrib/groff/src/utils/addftinfo/guess.h
+++ b/contrib/groff/src/utils/addftinfo/guess.h
@@ -16,7 +16,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
struct font_params {
int italic;
diff --git a/contrib/groff/src/utils/afmtodit/Makefile.sub b/contrib/groff/src/utils/afmtodit/Makefile.sub
index c1de91b..53afc74 100644
--- a/contrib/groff/src/utils/afmtodit/Makefile.sub
+++ b/contrib/groff/src/utils/afmtodit/Makefile.sub
@@ -12,7 +12,7 @@ afmtodit: afmtodit.pl
else \
sed -e "s|@VERSION@|$(version)$(revision)|" \
-e "s|@FONTDIR@|$(fontdir)|" \
- $(srcdir)/afmtodit.pl afmtodit; \
+ $(srcdir)/afmtodit.pl >afmtodit; \
fi
chmod +x afmtodit
diff --git a/contrib/groff/src/utils/afmtodit/afmtodit.man b/contrib/groff/src/utils/afmtodit/afmtodit.man
index 88198c9..978de34 100644
--- a/contrib/groff/src/utils/afmtodit/afmtodit.man
+++ b/contrib/groff/src/utils/afmtodit/afmtodit.man
@@ -1,5 +1,5 @@
.ig
-Copyright (C) 1989-2000, 2001, 2002, 2003 Free Software Foundation, Inc.
+Copyright (C) 1989-2000, 2001, 2002, 2003, 2005 Free Software Foundation, Inc.
Permission is granted to make and distribute verbatim copies of
this manual provided the copyright notice and this permission notice
@@ -21,8 +21,13 @@ the original English.
.\" Like TP, but if specified indent is more than half
.\" the current line-length - indent, use the default indent.
.de Tp
-.ie \\n(.$=0:((0\\$1)*2u>(\\n(.lu-\\n(.iu)) .TP
-.el .TP "\\$1"
+. ie \\n(.$=0:((0\\$1)*2u>(\\n(.lu-\\n(.iu)) .TP
+. el .TP "\\$1"
+..
+.
+.de OP
+. ie \\n(.$-1 .RI "[\ \fB\\$1\fP\ " "\\$2" "\ ]"
+. el .RB "[\ " "\\$1" "\ ]"
..
.
.
@@ -40,12 +45,7 @@ afmtodit \- create font files for use with groff \-Tps
.in +\w'\fBafmtodit 'u
.ti \niu
.B afmtodit
-.de OP
-.ie \\n(.$-1 .RI "[\ \fB\\$1\fP\ " "\\$2" "\ ]"
-.el .RB "[\ " "\\$1" "\ ]"
-..
-.
-.OP \-mnsv
+.OP \-mnsvx
.OP \-a n
.OP \-d desc_file
.OP \-e enc_file
@@ -66,7 +66,7 @@ creates a font file for use with groff and
.
.B afmtodit
is written in perl;
-you must have perl version 3 or newer installed in order to run
+you must have perl version 5.004 or newer installed in order to run
.BR afmtodit .
.
.LP
@@ -104,24 +104,26 @@ If the file isn't found in the current directory, it is searched in
the `devps/generate' subdirectory of the default font directory.
.
.LP
-If a PostScript character is in the encoding to be used for the font
-but is not mentioned in
+If a PostScript character is not named as
+.BI uni XXXX
+.RI ( XXXX
+are four uppercase hexadecimal digits), and is not mentioned in
.IR map_file ,
-or if a generic groff glyph name can't be deduced using the Adobe Glyph
-List (built into
-.BR afmtodit )
+and a generic groff glyph name can't be deduced using the
+Adobe Glyph List (AGL, built into
+.BR afmtodit ),
then
.B afmtodit
-will put it in the groff font file as an unnamed character,
-which can be accessed by the
+puts the PostScript character into the groff font file as an unnamed
+character which can only be accessed by the
.B \eN
escape sequence in
.BR troff .
.
If option
.B \-e
-is not specified, the encoding defined in the AFM file (i.e., entries with
-non-negative character codes) is used.
+is not specified, the encoding defined in the AFM file (i.e., entries
+with non-negative character codes) is used.
.
Please refer to section `Using Symbols' in the groff info file which
describes how groff glyph names are constructed.
@@ -293,6 +295,10 @@ command to the font file.
.B \-v
Print version.
.
+.TP
+.B \-x
+Don't use the built-in Adobe Glyph List.
+.
.
.SH FILES
.Tp \w'\fB@FONTDIR@/devps/download'u+2n
diff --git a/contrib/groff/src/utils/afmtodit/afmtodit.pl b/contrib/groff/src/utils/afmtodit/afmtodit.pl
index 72a486b..0ff85de 100644
--- a/contrib/groff/src/utils/afmtodit/afmtodit.pl
+++ b/contrib/groff/src/utils/afmtodit/afmtodit.pl
@@ -1,6 +1,7 @@
-#! /usr/bin/perl
+#! /usr/bin/perl -w
# -*- Perl -*-
-# Copyright (C) 1989-2000, 2001, 2002, 2003 Free Software Foundation, Inc.
+# Copyright (C) 1989-2000, 2001, 2002, 2003, 2004, 2005
+# Free Software Foundation, Inc.
# Written by James Clark (jjc@jclark.com)
#
# This file is part of groff.
@@ -17,6036 +18,6041 @@
#
# You should have received a copy of the GNU General Public License along
# with groff; see the file COPYING. If not, write to the Free Software
-# Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+# Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA.
-%unicode_decomposed = (
- "u00C0", "u0041_0300",
- "u00C1", "u0041_0301",
- "u00C2", "u0041_0302",
- "u00C3", "u0041_0303",
- "u00C4", "u0041_0308",
- "u00C5", "u0041_030A",
- "u00C7", "u0043_0327",
- "u00C8", "u0045_0300",
- "u00C9", "u0045_0301",
- "u00CA", "u0045_0302",
- "u00CB", "u0045_0308",
- "u00CC", "u0049_0300",
- "u00CD", "u0049_0301",
- "u00CE", "u0049_0302",
- "u00CF", "u0049_0308",
- "u00D1", "u004E_0303",
- "u00D2", "u004F_0300",
- "u00D3", "u004F_0301",
- "u00D4", "u004F_0302",
- "u00D5", "u004F_0303",
- "u00D6", "u004F_0308",
- "u00D9", "u0055_0300",
- "u00DA", "u0055_0301",
- "u00DB", "u0055_0302",
- "u00DC", "u0055_0308",
- "u00DD", "u0059_0301",
- "u00E0", "u0061_0300",
- "u00E1", "u0061_0301",
- "u00E2", "u0061_0302",
- "u00E3", "u0061_0303",
- "u00E4", "u0061_0308",
- "u00E5", "u0061_030A",
- "u00E7", "u0063_0327",
- "u00E8", "u0065_0300",
- "u00E9", "u0065_0301",
- "u00EA", "u0065_0302",
- "u00EB", "u0065_0308",
- "u00EC", "u0069_0300",
- "u00ED", "u0069_0301",
- "u00EE", "u0069_0302",
- "u00EF", "u0069_0308",
- "u00F1", "u006E_0303",
- "u00F2", "u006F_0300",
- "u00F3", "u006F_0301",
- "u00F4", "u006F_0302",
- "u00F5", "u006F_0303",
- "u00F6", "u006F_0308",
- "u00F9", "u0075_0300",
- "u00FA", "u0075_0301",
- "u00FB", "u0075_0302",
- "u00FC", "u0075_0308",
- "u00FD", "u0079_0301",
- "u00FF", "u0079_0308",
- "u0100", "u0041_0304",
- "u0101", "u0061_0304",
- "u0102", "u0041_0306",
- "u0103", "u0061_0306",
- "u0104", "u0041_0328",
- "u0105", "u0061_0328",
- "u0106", "u0043_0301",
- "u0107", "u0063_0301",
- "u0108", "u0043_0302",
- "u0109", "u0063_0302",
- "u010A", "u0043_0307",
- "u010B", "u0063_0307",
- "u010C", "u0043_030C",
- "u010D", "u0063_030C",
- "u010E", "u0044_030C",
- "u010F", "u0064_030C",
- "u0112", "u0045_0304",
- "u0113", "u0065_0304",
- "u0114", "u0045_0306",
- "u0115", "u0065_0306",
- "u0116", "u0045_0307",
- "u0117", "u0065_0307",
- "u0118", "u0045_0328",
- "u0119", "u0065_0328",
- "u011A", "u0045_030C",
- "u011B", "u0065_030C",
- "u011C", "u0047_0302",
- "u011D", "u0067_0302",
- "u011E", "u0047_0306",
- "u011F", "u0067_0306",
- "u0120", "u0047_0307",
- "u0121", "u0067_0307",
- "u0122", "u0047_0327",
- "u0123", "u0067_0327",
- "u0124", "u0048_0302",
- "u0125", "u0068_0302",
- "u0128", "u0049_0303",
- "u0129", "u0069_0303",
- "u012A", "u0049_0304",
- "u012B", "u0069_0304",
- "u012C", "u0049_0306",
- "u012D", "u0069_0306",
- "u012E", "u0049_0328",
- "u012F", "u0069_0328",
- "u0130", "u0049_0307",
- "u0134", "u004A_0302",
- "u0135", "u006A_0302",
- "u0136", "u004B_0327",
- "u0137", "u006B_0327",
- "u0139", "u004C_0301",
- "u013A", "u006C_0301",
- "u013B", "u004C_0327",
- "u013C", "u006C_0327",
- "u013D", "u004C_030C",
- "u013E", "u006C_030C",
- "u0143", "u004E_0301",
- "u0144", "u006E_0301",
- "u0145", "u004E_0327",
- "u0146", "u006E_0327",
- "u0147", "u004E_030C",
- "u0148", "u006E_030C",
- "u014C", "u004F_0304",
- "u014D", "u006F_0304",
- "u014E", "u004F_0306",
- "u014F", "u006F_0306",
- "u0150", "u004F_030B",
- "u0151", "u006F_030B",
- "u0154", "u0052_0301",
- "u0155", "u0072_0301",
- "u0156", "u0052_0327",
- "u0157", "u0072_0327",
- "u0158", "u0052_030C",
- "u0159", "u0072_030C",
- "u015A", "u0053_0301",
- "u015B", "u0073_0301",
- "u015C", "u0053_0302",
- "u015D", "u0073_0302",
- "u015E", "u0053_0327",
- "u015F", "u0073_0327",
- "u0160", "u0053_030C",
- "u0161", "u0073_030C",
- "u0162", "u0054_0327",
- "u0163", "u0074_0327",
- "u0164", "u0054_030C",
- "u0165", "u0074_030C",
- "u0168", "u0055_0303",
- "u0169", "u0075_0303",
- "u016A", "u0055_0304",
- "u016B", "u0075_0304",
- "u016C", "u0055_0306",
- "u016D", "u0075_0306",
- "u016E", "u0055_030A",
- "u016F", "u0075_030A",
- "u0170", "u0055_030B",
- "u0171", "u0075_030B",
- "u0172", "u0055_0328",
- "u0173", "u0075_0328",
- "u0174", "u0057_0302",
- "u0175", "u0077_0302",
- "u0176", "u0059_0302",
- "u0177", "u0079_0302",
- "u0178", "u0059_0308",
- "u0179", "u005A_0301",
- "u017A", "u007A_0301",
- "u017B", "u005A_0307",
- "u017C", "u007A_0307",
- "u017D", "u005A_030C",
- "u017E", "u007A_030C",
- "u01A0", "u004F_031B",
- "u01A1", "u006F_031B",
- "u01AF", "u0055_031B",
- "u01B0", "u0075_031B",
- "u01CD", "u0041_030C",
- "u01CE", "u0061_030C",
- "u01CF", "u0049_030C",
- "u01D0", "u0069_030C",
- "u01D1", "u004F_030C",
- "u01D2", "u006F_030C",
- "u01D3", "u0055_030C",
- "u01D4", "u0075_030C",
- "u01D5", "u0055_0308_0304",
- "u01D6", "u0075_0308_0304",
- "u01D7", "u0055_0308_0301",
- "u01D8", "u0075_0308_0301",
- "u01D9", "u0055_0308_030C",
- "u01DA", "u0075_0308_030C",
- "u01DB", "u0055_0308_0300",
- "u01DC", "u0075_0308_0300",
- "u01DE", "u0041_0308_0304",
- "u01DF", "u0061_0308_0304",
- "u01E0", "u0041_0307_0304",
- "u01E1", "u0061_0307_0304",
- "u01E2", "u00C6_0304",
- "u01E3", "u00E6_0304",
- "u01E6", "u0047_030C",
- "u01E7", "u0067_030C",
- "u01E8", "u004B_030C",
- "u01E9", "u006B_030C",
- "u01EA", "u004F_0328",
- "u01EB", "u006F_0328",
- "u01EC", "u004F_0328_0304",
- "u01ED", "u006F_0328_0304",
- "u01EE", "u01B7_030C",
- "u01EF", "u0292_030C",
- "u01F0", "u006A_030C",
- "u01F4", "u0047_0301",
- "u01F5", "u0067_0301",
- "u01F8", "u004E_0300",
- "u01F9", "u006E_0300",
- "u01FA", "u0041_030A_0301",
- "u01FB", "u0061_030A_0301",
- "u01FC", "u00C6_0301",
- "u01FD", "u00E6_0301",
- "u01FE", "u00D8_0301",
- "u01FF", "u00F8_0301",
- "u0200", "u0041_030F",
- "u0201", "u0061_030F",
- "u0202", "u0041_0311",
- "u0203", "u0061_0311",
- "u0204", "u0045_030F",
- "u0205", "u0065_030F",
- "u0206", "u0045_0311",
- "u0207", "u0065_0311",
- "u0208", "u0049_030F",
- "u0209", "u0069_030F",
- "u020A", "u0049_0311",
- "u020B", "u0069_0311",
- "u020C", "u004F_030F",
- "u020D", "u006F_030F",
- "u020E", "u004F_0311",
- "u020F", "u006F_0311",
- "u0210", "u0052_030F",
- "u0211", "u0072_030F",
- "u0212", "u0052_0311",
- "u0213", "u0072_0311",
- "u0214", "u0055_030F",
- "u0215", "u0075_030F",
- "u0216", "u0055_0311",
- "u0217", "u0075_0311",
- "u0218", "u0053_0326",
- "u0219", "u0073_0326",
- "u021A", "u0054_0326",
- "u021B", "u0074_0326",
- "u021E", "u0048_030C",
- "u021F", "u0068_030C",
- "u0226", "u0041_0307",
- "u0227", "u0061_0307",
- "u0228", "u0045_0327",
- "u0229", "u0065_0327",
- "u022A", "u004F_0308_0304",
- "u022B", "u006F_0308_0304",
- "u022C", "u004F_0303_0304",
- "u022D", "u006F_0303_0304",
- "u022E", "u004F_0307",
- "u022F", "u006F_0307",
- "u0230", "u004F_0307_0304",
- "u0231", "u006F_0307_0304",
- "u0232", "u0059_0304",
- "u0233", "u0079_0304",
- "u0340", "u0300",
- "u0341", "u0301",
- "u0343", "u0313",
- "u0344", "u0308_0301",
- "u0374", "u02B9",
- "u037E", "u003B",
- "u0385", "u00A8_0301",
- "u0386", "u0391_0301",
- "u0387", "u00B7",
- "u0388", "u0395_0301",
- "u0389", "u0397_0301",
- "u038A", "u0399_0301",
- "u038C", "u039F_0301",
- "u038E", "u03A5_0301",
- "u038F", "u03A9_0301",
- "u0390", "u03B9_0308_0301",
- "u03AA", "u0399_0308",
- "u03AB", "u03A5_0308",
- "u03AC", "u03B1_0301",
- "u03AD", "u03B5_0301",
- "u03AE", "u03B7_0301",
- "u03AF", "u03B9_0301",
- "u03B0", "u03C5_0308_0301",
- "u03CA", "u03B9_0308",
- "u03CB", "u03C5_0308",
- "u03CC", "u03BF_0301",
- "u03CD", "u03C5_0301",
- "u03CE", "u03C9_0301",
- "u03D3", "u03D2_0301",
- "u03D4", "u03D2_0308",
- "u0400", "u0415_0300",
- "u0401", "u0415_0308",
- "u0403", "u0413_0301",
- "u0407", "u0406_0308",
- "u040C", "u041A_0301",
- "u040D", "u0418_0300",
- "u040E", "u0423_0306",
- "u0419", "u0418_0306",
- "u0439", "u0438_0306",
- "u0450", "u0435_0300",
- "u0451", "u0435_0308",
- "u0453", "u0433_0301",
- "u0457", "u0456_0308",
- "u045C", "u043A_0301",
- "u045D", "u0438_0300",
- "u045E", "u0443_0306",
- "u0476", "u0474_030F",
- "u0477", "u0475_030F",
- "u04C1", "u0416_0306",
- "u04C2", "u0436_0306",
- "u04D0", "u0410_0306",
- "u04D1", "u0430_0306",
- "u04D2", "u0410_0308",
- "u04D3", "u0430_0308",
- "u04D6", "u0415_0306",
- "u04D7", "u0435_0306",
- "u04DA", "u04D8_0308",
- "u04DB", "u04D9_0308",
- "u04DC", "u0416_0308",
- "u04DD", "u0436_0308",
- "u04DE", "u0417_0308",
- "u04DF", "u0437_0308",
- "u04E2", "u0418_0304",
- "u04E3", "u0438_0304",
- "u04E4", "u0418_0308",
- "u04E5", "u0438_0308",
- "u04E6", "u041E_0308",
- "u04E7", "u043E_0308",
- "u04EA", "u04E8_0308",
- "u04EB", "u04E9_0308",
- "u04EC", "u042D_0308",
- "u04ED", "u044D_0308",
- "u04EE", "u0423_0304",
- "u04EF", "u0443_0304",
- "u04F0", "u0423_0308",
- "u04F1", "u0443_0308",
- "u04F2", "u0423_030B",
- "u04F3", "u0443_030B",
- "u04F4", "u0427_0308",
- "u04F5", "u0447_0308",
- "u04F8", "u042B_0308",
- "u04F9", "u044B_0308",
- "u0622", "u0627_0653",
- "u0623", "u0627_0654",
- "u0624", "u0648_0654",
- "u0625", "u0627_0655",
- "u0626", "u064A_0654",
- "u06C0", "u06D5_0654",
- "u06C2", "u06C1_0654",
- "u06D3", "u06D2_0654",
- "u0929", "u0928_093C",
- "u0931", "u0930_093C",
- "u0934", "u0933_093C",
- "u0958", "u0915_093C",
- "u0959", "u0916_093C",
- "u095A", "u0917_093C",
- "u095B", "u091C_093C",
- "u095C", "u0921_093C",
- "u095D", "u0922_093C",
- "u095E", "u092B_093C",
- "u095F", "u092F_093C",
- "u09CB", "u09C7_09BE",
- "u09CC", "u09C7_09D7",
- "u09DC", "u09A1_09BC",
- "u09DD", "u09A2_09BC",
- "u09DF", "u09AF_09BC",
- "u0A33", "u0A32_0A3C",
- "u0A36", "u0A38_0A3C",
- "u0A59", "u0A16_0A3C",
- "u0A5A", "u0A17_0A3C",
- "u0A5B", "u0A1C_0A3C",
- "u0A5E", "u0A2B_0A3C",
- "u0B48", "u0B47_0B56",
- "u0B4B", "u0B47_0B3E",
- "u0B4C", "u0B47_0B57",
- "u0B5C", "u0B21_0B3C",
- "u0B5D", "u0B22_0B3C",
- "u0B94", "u0B92_0BD7",
- "u0BCA", "u0BC6_0BBE",
- "u0BCB", "u0BC7_0BBE",
- "u0BCC", "u0BC6_0BD7",
- "u0C48", "u0C46_0C56",
- "u0CC0", "u0CBF_0CD5",
- "u0CC7", "u0CC6_0CD5",
- "u0CC8", "u0CC6_0CD6",
- "u0CCA", "u0CC6_0CC2",
- "u0CCB", "u0CC6_0CC2_0CD5",
- "u0D4A", "u0D46_0D3E",
- "u0D4B", "u0D47_0D3E",
- "u0D4C", "u0D46_0D57",
- "u0DDA", "u0DD9_0DCA",
- "u0DDC", "u0DD9_0DCF",
- "u0DDD", "u0DD9_0DCF_0DCA",
- "u0DDE", "u0DD9_0DDF",
- "u0F43", "u0F42_0FB7",
- "u0F4D", "u0F4C_0FB7",
- "u0F52", "u0F51_0FB7",
- "u0F57", "u0F56_0FB7",
- "u0F5C", "u0F5B_0FB7",
- "u0F69", "u0F40_0FB5",
- "u0F73", "u0F71_0F72",
- "u0F75", "u0F71_0F74",
- "u0F76", "u0FB2_0F80",
- "u0F78", "u0FB3_0F80",
- "u0F81", "u0F71_0F80",
- "u0F93", "u0F92_0FB7",
- "u0F9D", "u0F9C_0FB7",
- "u0FA2", "u0FA1_0FB7",
- "u0FA7", "u0FA6_0FB7",
- "u0FAC", "u0FAB_0FB7",
- "u0FB9", "u0F90_0FB5",
- "u1026", "u1025_102E",
- "u1E00", "u0041_0325",
- "u1E01", "u0061_0325",
- "u1E02", "u0042_0307",
- "u1E03", "u0062_0307",
- "u1E04", "u0042_0323",
- "u1E05", "u0062_0323",
- "u1E06", "u0042_0331",
- "u1E07", "u0062_0331",
- "u1E08", "u0043_0327_0301",
- "u1E09", "u0063_0327_0301",
- "u1E0A", "u0044_0307",
- "u1E0B", "u0064_0307",
- "u1E0C", "u0044_0323",
- "u1E0D", "u0064_0323",
- "u1E0E", "u0044_0331",
- "u1E0F", "u0064_0331",
- "u1E10", "u0044_0327",
- "u1E11", "u0064_0327",
- "u1E12", "u0044_032D",
- "u1E13", "u0064_032D",
- "u1E14", "u0045_0304_0300",
- "u1E15", "u0065_0304_0300",
- "u1E16", "u0045_0304_0301",
- "u1E17", "u0065_0304_0301",
- "u1E18", "u0045_032D",
- "u1E19", "u0065_032D",
- "u1E1A", "u0045_0330",
- "u1E1B", "u0065_0330",
- "u1E1C", "u0045_0327_0306",
- "u1E1D", "u0065_0327_0306",
- "u1E1E", "u0046_0307",
- "u1E1F", "u0066_0307",
- "u1E20", "u0047_0304",
- "u1E21", "u0067_0304",
- "u1E22", "u0048_0307",
- "u1E23", "u0068_0307",
- "u1E24", "u0048_0323",
- "u1E25", "u0068_0323",
- "u1E26", "u0048_0308",
- "u1E27", "u0068_0308",
- "u1E28", "u0048_0327",
- "u1E29", "u0068_0327",
- "u1E2A", "u0048_032E",
- "u1E2B", "u0068_032E",
- "u1E2C", "u0049_0330",
- "u1E2D", "u0069_0330",
- "u1E2E", "u0049_0308_0301",
- "u1E2F", "u0069_0308_0301",
- "u1E30", "u004B_0301",
- "u1E31", "u006B_0301",
- "u1E32", "u004B_0323",
- "u1E33", "u006B_0323",
- "u1E34", "u004B_0331",
- "u1E35", "u006B_0331",
- "u1E36", "u004C_0323",
- "u1E37", "u006C_0323",
- "u1E38", "u004C_0323_0304",
- "u1E39", "u006C_0323_0304",
- "u1E3A", "u004C_0331",
- "u1E3B", "u006C_0331",
- "u1E3C", "u004C_032D",
- "u1E3D", "u006C_032D",
- "u1E3E", "u004D_0301",
- "u1E3F", "u006D_0301",
- "u1E40", "u004D_0307",
- "u1E41", "u006D_0307",
- "u1E42", "u004D_0323",
- "u1E43", "u006D_0323",
- "u1E44", "u004E_0307",
- "u1E45", "u006E_0307",
- "u1E46", "u004E_0323",
- "u1E47", "u006E_0323",
- "u1E48", "u004E_0331",
- "u1E49", "u006E_0331",
- "u1E4A", "u004E_032D",
- "u1E4B", "u006E_032D",
- "u1E4C", "u004F_0303_0301",
- "u1E4D", "u006F_0303_0301",
- "u1E4E", "u004F_0303_0308",
- "u1E4F", "u006F_0303_0308",
- "u1E50", "u004F_0304_0300",
- "u1E51", "u006F_0304_0300",
- "u1E52", "u004F_0304_0301",
- "u1E53", "u006F_0304_0301",
- "u1E54", "u0050_0301",
- "u1E55", "u0070_0301",
- "u1E56", "u0050_0307",
- "u1E57", "u0070_0307",
- "u1E58", "u0052_0307",
- "u1E59", "u0072_0307",
- "u1E5A", "u0052_0323",
- "u1E5B", "u0072_0323",
- "u1E5C", "u0052_0323_0304",
- "u1E5D", "u0072_0323_0304",
- "u1E5E", "u0052_0331",
- "u1E5F", "u0072_0331",
- "u1E60", "u0053_0307",
- "u1E61", "u0073_0307",
- "u1E62", "u0053_0323",
- "u1E63", "u0073_0323",
- "u1E64", "u0053_0301_0307",
- "u1E65", "u0073_0301_0307",
- "u1E66", "u0053_030C_0307",
- "u1E67", "u0073_030C_0307",
- "u1E68", "u0053_0323_0307",
- "u1E69", "u0073_0323_0307",
- "u1E6A", "u0054_0307",
- "u1E6B", "u0074_0307",
- "u1E6C", "u0054_0323",
- "u1E6D", "u0074_0323",
- "u1E6E", "u0054_0331",
- "u1E6F", "u0074_0331",
- "u1E70", "u0054_032D",
- "u1E71", "u0074_032D",
- "u1E72", "u0055_0324",
- "u1E73", "u0075_0324",
- "u1E74", "u0055_0330",
- "u1E75", "u0075_0330",
- "u1E76", "u0055_032D",
- "u1E77", "u0075_032D",
- "u1E78", "u0055_0303_0301",
- "u1E79", "u0075_0303_0301",
- "u1E7A", "u0055_0304_0308",
- "u1E7B", "u0075_0304_0308",
- "u1E7C", "u0056_0303",
- "u1E7D", "u0076_0303",
- "u1E7E", "u0056_0323",
- "u1E7F", "u0076_0323",
- "u1E80", "u0057_0300",
- "u1E81", "u0077_0300",
- "u1E82", "u0057_0301",
- "u1E83", "u0077_0301",
- "u1E84", "u0057_0308",
- "u1E85", "u0077_0308",
- "u1E86", "u0057_0307",
- "u1E87", "u0077_0307",
- "u1E88", "u0057_0323",
- "u1E89", "u0077_0323",
- "u1E8A", "u0058_0307",
- "u1E8B", "u0078_0307",
- "u1E8C", "u0058_0308",
- "u1E8D", "u0078_0308",
- "u1E8E", "u0059_0307",
- "u1E8F", "u0079_0307",
- "u1E90", "u005A_0302",
- "u1E91", "u007A_0302",
- "u1E92", "u005A_0323",
- "u1E93", "u007A_0323",
- "u1E94", "u005A_0331",
- "u1E95", "u007A_0331",
- "u1E96", "u0068_0331",
- "u1E97", "u0074_0308",
- "u1E98", "u0077_030A",
- "u1E99", "u0079_030A",
- "u1E9B", "u017F_0307",
- "u1EA0", "u0041_0323",
- "u1EA1", "u0061_0323",
- "u1EA2", "u0041_0309",
- "u1EA3", "u0061_0309",
- "u1EA4", "u0041_0302_0301",
- "u1EA5", "u0061_0302_0301",
- "u1EA6", "u0041_0302_0300",
- "u1EA7", "u0061_0302_0300",
- "u1EA8", "u0041_0302_0309",
- "u1EA9", "u0061_0302_0309",
- "u1EAA", "u0041_0302_0303",
- "u1EAB", "u0061_0302_0303",
- "u1EAC", "u0041_0323_0302",
- "u1EAD", "u0061_0323_0302",
- "u1EAE", "u0041_0306_0301",
- "u1EAF", "u0061_0306_0301",
- "u1EB0", "u0041_0306_0300",
- "u1EB1", "u0061_0306_0300",
- "u1EB2", "u0041_0306_0309",
- "u1EB3", "u0061_0306_0309",
- "u1EB4", "u0041_0306_0303",
- "u1EB5", "u0061_0306_0303",
- "u1EB6", "u0041_0323_0306",
- "u1EB7", "u0061_0323_0306",
- "u1EB8", "u0045_0323",
- "u1EB9", "u0065_0323",
- "u1EBA", "u0045_0309",
- "u1EBB", "u0065_0309",
- "u1EBC", "u0045_0303",
- "u1EBD", "u0065_0303",
- "u1EBE", "u0045_0302_0301",
- "u1EBF", "u0065_0302_0301",
- "u1EC0", "u0045_0302_0300",
- "u1EC1", "u0065_0302_0300",
- "u1EC2", "u0045_0302_0309",
- "u1EC3", "u0065_0302_0309",
- "u1EC4", "u0045_0302_0303",
- "u1EC5", "u0065_0302_0303",
- "u1EC6", "u0045_0323_0302",
- "u1EC7", "u0065_0323_0302",
- "u1EC8", "u0049_0309",
- "u1EC9", "u0069_0309",
- "u1ECA", "u0049_0323",
- "u1ECB", "u0069_0323",
- "u1ECC", "u004F_0323",
- "u1ECD", "u006F_0323",
- "u1ECE", "u004F_0309",
- "u1ECF", "u006F_0309",
- "u1ED0", "u004F_0302_0301",
- "u1ED1", "u006F_0302_0301",
- "u1ED2", "u004F_0302_0300",
- "u1ED3", "u006F_0302_0300",
- "u1ED4", "u004F_0302_0309",
- "u1ED5", "u006F_0302_0309",
- "u1ED6", "u004F_0302_0303",
- "u1ED7", "u006F_0302_0303",
- "u1ED8", "u004F_0323_0302",
- "u1ED9", "u006F_0323_0302",
- "u1EDA", "u004F_031B_0301",
- "u1EDB", "u006F_031B_0301",
- "u1EDC", "u004F_031B_0300",
- "u1EDD", "u006F_031B_0300",
- "u1EDE", "u004F_031B_0309",
- "u1EDF", "u006F_031B_0309",
- "u1EE0", "u004F_031B_0303",
- "u1EE1", "u006F_031B_0303",
- "u1EE2", "u004F_031B_0323",
- "u1EE3", "u006F_031B_0323",
- "u1EE4", "u0055_0323",
- "u1EE5", "u0075_0323",
- "u1EE6", "u0055_0309",
- "u1EE7", "u0075_0309",
- "u1EE8", "u0055_031B_0301",
- "u1EE9", "u0075_031B_0301",
- "u1EEA", "u0055_031B_0300",
- "u1EEB", "u0075_031B_0300",
- "u1EEC", "u0055_031B_0309",
- "u1EED", "u0075_031B_0309",
- "u1EEE", "u0055_031B_0303",
- "u1EEF", "u0075_031B_0303",
- "u1EF0", "u0055_031B_0323",
- "u1EF1", "u0075_031B_0323",
- "u1EF2", "u0059_0300",
- "u1EF3", "u0079_0300",
- "u1EF4", "u0059_0323",
- "u1EF5", "u0079_0323",
- "u1EF6", "u0059_0309",
- "u1EF7", "u0079_0309",
- "u1EF8", "u0059_0303",
- "u1EF9", "u0079_0303",
- "u1F00", "u03B1_0313",
- "u1F01", "u03B1_0314",
- "u1F02", "u03B1_0313_0300",
- "u1F03", "u03B1_0314_0300",
- "u1F04", "u03B1_0313_0301",
- "u1F05", "u03B1_0314_0301",
- "u1F06", "u03B1_0313_0342",
- "u1F07", "u03B1_0314_0342",
- "u1F08", "u0391_0313",
- "u1F09", "u0391_0314",
- "u1F0A", "u0391_0313_0300",
- "u1F0B", "u0391_0314_0300",
- "u1F0C", "u0391_0313_0301",
- "u1F0D", "u0391_0314_0301",
- "u1F0E", "u0391_0313_0342",
- "u1F0F", "u0391_0314_0342",
- "u1F10", "u03B5_0313",
- "u1F11", "u03B5_0314",
- "u1F12", "u03B5_0313_0300",
- "u1F13", "u03B5_0314_0300",
- "u1F14", "u03B5_0313_0301",
- "u1F15", "u03B5_0314_0301",
- "u1F18", "u0395_0313",
- "u1F19", "u0395_0314",
- "u1F1A", "u0395_0313_0300",
- "u1F1B", "u0395_0314_0300",
- "u1F1C", "u0395_0313_0301",
- "u1F1D", "u0395_0314_0301",
- "u1F20", "u03B7_0313",
- "u1F21", "u03B7_0314",
- "u1F22", "u03B7_0313_0300",
- "u1F23", "u03B7_0314_0300",
- "u1F24", "u03B7_0313_0301",
- "u1F25", "u03B7_0314_0301",
- "u1F26", "u03B7_0313_0342",
- "u1F27", "u03B7_0314_0342",
- "u1F28", "u0397_0313",
- "u1F29", "u0397_0314",
- "u1F2A", "u0397_0313_0300",
- "u1F2B", "u0397_0314_0300",
- "u1F2C", "u0397_0313_0301",
- "u1F2D", "u0397_0314_0301",
- "u1F2E", "u0397_0313_0342",
- "u1F2F", "u0397_0314_0342",
- "u1F30", "u03B9_0313",
- "u1F31", "u03B9_0314",
- "u1F32", "u03B9_0313_0300",
- "u1F33", "u03B9_0314_0300",
- "u1F34", "u03B9_0313_0301",
- "u1F35", "u03B9_0314_0301",
- "u1F36", "u03B9_0313_0342",
- "u1F37", "u03B9_0314_0342",
- "u1F38", "u0399_0313",
- "u1F39", "u0399_0314",
- "u1F3A", "u0399_0313_0300",
- "u1F3B", "u0399_0314_0300",
- "u1F3C", "u0399_0313_0301",
- "u1F3D", "u0399_0314_0301",
- "u1F3E", "u0399_0313_0342",
- "u1F3F", "u0399_0314_0342",
- "u1F40", "u03BF_0313",
- "u1F41", "u03BF_0314",
- "u1F42", "u03BF_0313_0300",
- "u1F43", "u03BF_0314_0300",
- "u1F44", "u03BF_0313_0301",
- "u1F45", "u03BF_0314_0301",
- "u1F48", "u039F_0313",
- "u1F49", "u039F_0314",
- "u1F4A", "u039F_0313_0300",
- "u1F4B", "u039F_0314_0300",
- "u1F4C", "u039F_0313_0301",
- "u1F4D", "u039F_0314_0301",
- "u1F50", "u03C5_0313",
- "u1F51", "u03C5_0314",
- "u1F52", "u03C5_0313_0300",
- "u1F53", "u03C5_0314_0300",
- "u1F54", "u03C5_0313_0301",
- "u1F55", "u03C5_0314_0301",
- "u1F56", "u03C5_0313_0342",
- "u1F57", "u03C5_0314_0342",
- "u1F59", "u03A5_0314",
- "u1F5B", "u03A5_0314_0300",
- "u1F5D", "u03A5_0314_0301",
- "u1F5F", "u03A5_0314_0342",
- "u1F60", "u03C9_0313",
- "u1F61", "u03C9_0314",
- "u1F62", "u03C9_0313_0300",
- "u1F63", "u03C9_0314_0300",
- "u1F64", "u03C9_0313_0301",
- "u1F65", "u03C9_0314_0301",
- "u1F66", "u03C9_0313_0342",
- "u1F67", "u03C9_0314_0342",
- "u1F68", "u03A9_0313",
- "u1F69", "u03A9_0314",
- "u1F6A", "u03A9_0313_0300",
- "u1F6B", "u03A9_0314_0300",
- "u1F6C", "u03A9_0313_0301",
- "u1F6D", "u03A9_0314_0301",
- "u1F6E", "u03A9_0313_0342",
- "u1F6F", "u03A9_0314_0342",
- "u1F70", "u03B1_0300",
- "u1F71", "u03B1_0301",
- "u1F72", "u03B5_0300",
- "u1F73", "u03B5_0301",
- "u1F74", "u03B7_0300",
- "u1F75", "u03B7_0301",
- "u1F76", "u03B9_0300",
- "u1F77", "u03B9_0301",
- "u1F78", "u03BF_0300",
- "u1F79", "u03BF_0301",
- "u1F7A", "u03C5_0300",
- "u1F7B", "u03C5_0301",
- "u1F7C", "u03C9_0300",
- "u1F7D", "u03C9_0301",
- "u1F80", "u03B1_0313_0345",
- "u1F81", "u03B1_0314_0345",
- "u1F82", "u03B1_0313_0300_0345",
- "u1F83", "u03B1_0314_0300_0345",
- "u1F84", "u03B1_0313_0301_0345",
- "u1F85", "u03B1_0314_0301_0345",
- "u1F86", "u03B1_0313_0342_0345",
- "u1F87", "u03B1_0314_0342_0345",
- "u1F88", "u0391_0313_0345",
- "u1F89", "u0391_0314_0345",
- "u1F8A", "u0391_0313_0300_0345",
- "u1F8B", "u0391_0314_0300_0345",
- "u1F8C", "u0391_0313_0301_0345",
- "u1F8D", "u0391_0314_0301_0345",
- "u1F8E", "u0391_0313_0342_0345",
- "u1F8F", "u0391_0314_0342_0345",
- "u1F90", "u03B7_0313_0345",
- "u1F91", "u03B7_0314_0345",
- "u1F92", "u03B7_0313_0300_0345",
- "u1F93", "u03B7_0314_0300_0345",
- "u1F94", "u03B7_0313_0301_0345",
- "u1F95", "u03B7_0314_0301_0345",
- "u1F96", "u03B7_0313_0342_0345",
- "u1F97", "u03B7_0314_0342_0345",
- "u1F98", "u0397_0313_0345",
- "u1F99", "u0397_0314_0345",
- "u1F9A", "u0397_0313_0300_0345",
- "u1F9B", "u0397_0314_0300_0345",
- "u1F9C", "u0397_0313_0301_0345",
- "u1F9D", "u0397_0314_0301_0345",
- "u1F9E", "u0397_0313_0342_0345",
- "u1F9F", "u0397_0314_0342_0345",
- "u1FA0", "u03C9_0313_0345",
- "u1FA1", "u03C9_0314_0345",
- "u1FA2", "u03C9_0313_0300_0345",
- "u1FA3", "u03C9_0314_0300_0345",
- "u1FA4", "u03C9_0313_0301_0345",
- "u1FA5", "u03C9_0314_0301_0345",
- "u1FA6", "u03C9_0313_0342_0345",
- "u1FA7", "u03C9_0314_0342_0345",
- "u1FA8", "u03A9_0313_0345",
- "u1FA9", "u03A9_0314_0345",
- "u1FAA", "u03A9_0313_0300_0345",
- "u1FAB", "u03A9_0314_0300_0345",
- "u1FAC", "u03A9_0313_0301_0345",
- "u1FAD", "u03A9_0314_0301_0345",
- "u1FAE", "u03A9_0313_0342_0345",
- "u1FAF", "u03A9_0314_0342_0345",
- "u1FB0", "u03B1_0306",
- "u1FB1", "u03B1_0304",
- "u1FB2", "u03B1_0300_0345",
- "u1FB3", "u03B1_0345",
- "u1FB4", "u03B1_0301_0345",
- "u1FB6", "u03B1_0342",
- "u1FB7", "u03B1_0342_0345",
- "u1FB8", "u0391_0306",
- "u1FB9", "u0391_0304",
- "u1FBA", "u0391_0300",
- "u1FBB", "u0391_0301",
- "u1FBC", "u0391_0345",
- "u1FBE", "u03B9",
- "u1FC1", "u00A8_0342",
- "u1FC2", "u03B7_0300_0345",
- "u1FC3", "u03B7_0345",
- "u1FC4", "u03B7_0301_0345",
- "u1FC6", "u03B7_0342",
- "u1FC7", "u03B7_0342_0345",
- "u1FC8", "u0395_0300",
- "u1FC9", "u0395_0301",
- "u1FCA", "u0397_0300",
- "u1FCB", "u0397_0301",
- "u1FCC", "u0397_0345",
- "u1FCD", "u1FBF_0300",
- "u1FCE", "u1FBF_0301",
- "u1FCF", "u1FBF_0342",
- "u1FD0", "u03B9_0306",
- "u1FD1", "u03B9_0304",
- "u1FD2", "u03B9_0308_0300",
- "u1FD3", "u03B9_0308_0301",
- "u1FD6", "u03B9_0342",
- "u1FD7", "u03B9_0308_0342",
- "u1FD8", "u0399_0306",
- "u1FD9", "u0399_0304",
- "u1FDA", "u0399_0300",
- "u1FDB", "u0399_0301",
- "u1FDD", "u1FFE_0300",
- "u1FDE", "u1FFE_0301",
- "u1FDF", "u1FFE_0342",
- "u1FE0", "u03C5_0306",
- "u1FE1", "u03C5_0304",
- "u1FE2", "u03C5_0308_0300",
- "u1FE3", "u03C5_0308_0301",
- "u1FE4", "u03C1_0313",
- "u1FE5", "u03C1_0314",
- "u1FE6", "u03C5_0342",
- "u1FE7", "u03C5_0308_0342",
- "u1FE8", "u03A5_0306",
- "u1FE9", "u03A5_0304",
- "u1FEA", "u03A5_0300",
- "u1FEB", "u03A5_0301",
- "u1FEC", "u03A1_0314",
- "u1FED", "u00A8_0300",
- "u1FEE", "u00A8_0301",
- "u1FEF", "u0060",
- "u1FF2", "u03C9_0300_0345",
- "u1FF3", "u03C9_0345",
- "u1FF4", "u03C9_0301_0345",
- "u1FF6", "u03C9_0342",
- "u1FF7", "u03C9_0342_0345",
- "u1FF8", "u039F_0300",
- "u1FF9", "u039F_0301",
- "u1FFA", "u03A9_0300",
- "u1FFB", "u03A9_0301",
- "u1FFC", "u03A9_0345",
- "u1FFD", "u00B4",
- "u2000", "u2002",
- "u2001", "u2003",
- "u2126", "u03A9",
- "u212A", "u004B",
- "u212B", "u0041_030A",
- "u219A", "u2190_0338",
- "u219B", "u2192_0338",
- "u21AE", "u2194_0338",
- "u21CD", "u21D0_0338",
- "u21CE", "u21D4_0338",
- "u21CF", "u21D2_0338",
- "u2204", "u2203_0338",
- "u2209", "u2208_0338",
- "u220C", "u220B_0338",
- "u2224", "u2223_0338",
- "u2226", "u2225_0338",
- "u2241", "u223C_0338",
- "u2244", "u2243_0338",
- "u2247", "u2245_0338",
- "u2249", "u2248_0338",
- "u2260", "u003D_0338",
- "u2262", "u2261_0338",
- "u226D", "u224D_0338",
- "u226E", "u003C_0338",
- "u226F", "u003E_0338",
- "u2270", "u2264_0338",
- "u2271", "u2265_0338",
- "u2274", "u2272_0338",
- "u2275", "u2273_0338",
- "u2278", "u2276_0338",
- "u2279", "u2277_0338",
- "u2280", "u227A_0338",
- "u2281", "u227B_0338",
- "u2284", "u2282_0338",
- "u2285", "u2283_0338",
- "u2288", "u2286_0338",
- "u2289", "u2287_0338",
- "u22AC", "u22A2_0338",
- "u22AD", "u22A8_0338",
- "u22AE", "u22A9_0338",
- "u22AF", "u22AB_0338",
- "u22E0", "u227C_0338",
- "u22E1", "u227D_0338",
- "u22E2", "u2291_0338",
- "u22E3", "u2292_0338",
- "u22EA", "u22B2_0338",
- "u22EB", "u22B3_0338",
- "u22EC", "u22B4_0338",
- "u22ED", "u22B5_0338",
- "u2329", "u3008",
- "u232A", "u3009",
- "u2ADC", "u2ADD_0338",
- "u304C", "u304B_3099",
- "u304E", "u304D_3099",
- "u3050", "u304F_3099",
- "u3052", "u3051_3099",
- "u3054", "u3053_3099",
- "u3056", "u3055_3099",
- "u3058", "u3057_3099",
- "u305A", "u3059_3099",
- "u305C", "u305B_3099",
- "u305E", "u305D_3099",
- "u3060", "u305F_3099",
- "u3062", "u3061_3099",
- "u3065", "u3064_3099",
- "u3067", "u3066_3099",
- "u3069", "u3068_3099",
- "u3070", "u306F_3099",
- "u3071", "u306F_309A",
- "u3073", "u3072_3099",
- "u3074", "u3072_309A",
- "u3076", "u3075_3099",
- "u3077", "u3075_309A",
- "u3079", "u3078_3099",
- "u307A", "u3078_309A",
- "u307C", "u307B_3099",
- "u307D", "u307B_309A",
- "u3094", "u3046_3099",
- "u309E", "u309D_3099",
- "u30AC", "u30AB_3099",
- "u30AE", "u30AD_3099",
- "u30B0", "u30AF_3099",
- "u30B2", "u30B1_3099",
- "u30B4", "u30B3_3099",
- "u30B6", "u30B5_3099",
- "u30B8", "u30B7_3099",
- "u30BA", "u30B9_3099",
- "u30BC", "u30BB_3099",
- "u30BE", "u30BD_3099",
- "u30C0", "u30BF_3099",
- "u30C2", "u30C1_3099",
- "u30C5", "u30C4_3099",
- "u30C7", "u30C6_3099",
- "u30C9", "u30C8_3099",
- "u30D0", "u30CF_3099",
- "u30D1", "u30CF_309A",
- "u30D3", "u30D2_3099",
- "u30D4", "u30D2_309A",
- "u30D6", "u30D5_3099",
- "u30D7", "u30D5_309A",
- "u30D9", "u30D8_3099",
- "u30DA", "u30D8_309A",
- "u30DC", "u30DB_3099",
- "u30DD", "u30DB_309A",
- "u30F4", "u30A6_3099",
- "u30F7", "u30EF_3099",
- "u30F8", "u30F0_3099",
- "u30F9", "u30F1_3099",
- "u30FA", "u30F2_3099",
- "u30FE", "u30FD_3099",
- "uF900", "u8C48",
- "uF901", "u66F4",
- "uF902", "u8ECA",
- "uF903", "u8CC8",
- "uF904", "u6ED1",
- "uF905", "u4E32",
- "uF906", "u53E5",
- "uF907", "u9F9C",
- "uF908", "u9F9C",
- "uF909", "u5951",
- "uF90A", "u91D1",
- "uF90B", "u5587",
- "uF90C", "u5948",
- "uF90D", "u61F6",
- "uF90E", "u7669",
- "uF90F", "u7F85",
- "uF910", "u863F",
- "uF911", "u87BA",
- "uF912", "u88F8",
- "uF913", "u908F",
- "uF914", "u6A02",
- "uF915", "u6D1B",
- "uF916", "u70D9",
- "uF917", "u73DE",
- "uF918", "u843D",
- "uF919", "u916A",
- "uF91A", "u99F1",
- "uF91B", "u4E82",
- "uF91C", "u5375",
- "uF91D", "u6B04",
- "uF91E", "u721B",
- "uF91F", "u862D",
- "uF920", "u9E1E",
- "uF921", "u5D50",
- "uF922", "u6FEB",
- "uF923", "u85CD",
- "uF924", "u8964",
- "uF925", "u62C9",
- "uF926", "u81D8",
- "uF927", "u881F",
- "uF928", "u5ECA",
- "uF929", "u6717",
- "uF92A", "u6D6A",
- "uF92B", "u72FC",
- "uF92C", "u90CE",
- "uF92D", "u4F86",
- "uF92E", "u51B7",
- "uF92F", "u52DE",
- "uF930", "u64C4",
- "uF931", "u6AD3",
- "uF932", "u7210",
- "uF933", "u76E7",
- "uF934", "u8001",
- "uF935", "u8606",
- "uF936", "u865C",
- "uF937", "u8DEF",
- "uF938", "u9732",
- "uF939", "u9B6F",
- "uF93A", "u9DFA",
- "uF93B", "u788C",
- "uF93C", "u797F",
- "uF93D", "u7DA0",
- "uF93E", "u83C9",
- "uF93F", "u9304",
- "uF940", "u9E7F",
- "uF941", "u8AD6",
- "uF942", "u58DF",
- "uF943", "u5F04",
- "uF944", "u7C60",
- "uF945", "u807E",
- "uF946", "u7262",
- "uF947", "u78CA",
- "uF948", "u8CC2",
- "uF949", "u96F7",
- "uF94A", "u58D8",
- "uF94B", "u5C62",
- "uF94C", "u6A13",
- "uF94D", "u6DDA",
- "uF94E", "u6F0F",
- "uF94F", "u7D2F",
- "uF950", "u7E37",
- "uF951", "u964B",
- "uF952", "u52D2",
- "uF953", "u808B",
- "uF954", "u51DC",
- "uF955", "u51CC",
- "uF956", "u7A1C",
- "uF957", "u7DBE",
- "uF958", "u83F1",
- "uF959", "u9675",
- "uF95A", "u8B80",
- "uF95B", "u62CF",
- "uF95C", "u6A02",
- "uF95D", "u8AFE",
- "uF95E", "u4E39",
- "uF95F", "u5BE7",
- "uF960", "u6012",
- "uF961", "u7387",
- "uF962", "u7570",
- "uF963", "u5317",
- "uF964", "u78FB",
- "uF965", "u4FBF",
- "uF966", "u5FA9",
- "uF967", "u4E0D",
- "uF968", "u6CCC",
- "uF969", "u6578",
- "uF96A", "u7D22",
- "uF96B", "u53C3",
- "uF96C", "u585E",
- "uF96D", "u7701",
- "uF96E", "u8449",
- "uF96F", "u8AAA",
- "uF970", "u6BBA",
- "uF971", "u8FB0",
- "uF972", "u6C88",
- "uF973", "u62FE",
- "uF974", "u82E5",
- "uF975", "u63A0",
- "uF976", "u7565",
- "uF977", "u4EAE",
- "uF978", "u5169",
- "uF979", "u51C9",
- "uF97A", "u6881",
- "uF97B", "u7CE7",
- "uF97C", "u826F",
- "uF97D", "u8AD2",
- "uF97E", "u91CF",
- "uF97F", "u52F5",
- "uF980", "u5442",
- "uF981", "u5973",
- "uF982", "u5EEC",
- "uF983", "u65C5",
- "uF984", "u6FFE",
- "uF985", "u792A",
- "uF986", "u95AD",
- "uF987", "u9A6A",
- "uF988", "u9E97",
- "uF989", "u9ECE",
- "uF98A", "u529B",
- "uF98B", "u66C6",
- "uF98C", "u6B77",
- "uF98D", "u8F62",
- "uF98E", "u5E74",
- "uF98F", "u6190",
- "uF990", "u6200",
- "uF991", "u649A",
- "uF992", "u6F23",
- "uF993", "u7149",
- "uF994", "u7489",
- "uF995", "u79CA",
- "uF996", "u7DF4",
- "uF997", "u806F",
- "uF998", "u8F26",
- "uF999", "u84EE",
- "uF99A", "u9023",
- "uF99B", "u934A",
- "uF99C", "u5217",
- "uF99D", "u52A3",
- "uF99E", "u54BD",
- "uF99F", "u70C8",
- "uF9A0", "u88C2",
- "uF9A1", "u8AAA",
- "uF9A2", "u5EC9",
- "uF9A3", "u5FF5",
- "uF9A4", "u637B",
- "uF9A5", "u6BAE",
- "uF9A6", "u7C3E",
- "uF9A7", "u7375",
- "uF9A8", "u4EE4",
- "uF9A9", "u56F9",
- "uF9AA", "u5BE7",
- "uF9AB", "u5DBA",
- "uF9AC", "u601C",
- "uF9AD", "u73B2",
- "uF9AE", "u7469",
- "uF9AF", "u7F9A",
- "uF9B0", "u8046",
- "uF9B1", "u9234",
- "uF9B2", "u96F6",
- "uF9B3", "u9748",
- "uF9B4", "u9818",
- "uF9B5", "u4F8B",
- "uF9B6", "u79AE",
- "uF9B7", "u91B4",
- "uF9B8", "u96B8",
- "uF9B9", "u60E1",
- "uF9BA", "u4E86",
- "uF9BB", "u50DA",
- "uF9BC", "u5BEE",
- "uF9BD", "u5C3F",
- "uF9BE", "u6599",
- "uF9BF", "u6A02",
- "uF9C0", "u71CE",
- "uF9C1", "u7642",
- "uF9C2", "u84FC",
- "uF9C3", "u907C",
- "uF9C4", "u9F8D",
- "uF9C5", "u6688",
- "uF9C6", "u962E",
- "uF9C7", "u5289",
- "uF9C8", "u677B",
- "uF9C9", "u67F3",
- "uF9CA", "u6D41",
- "uF9CB", "u6E9C",
- "uF9CC", "u7409",
- "uF9CD", "u7559",
- "uF9CE", "u786B",
- "uF9CF", "u7D10",
- "uF9D0", "u985E",
- "uF9D1", "u516D",
- "uF9D2", "u622E",
- "uF9D3", "u9678",
- "uF9D4", "u502B",
- "uF9D5", "u5D19",
- "uF9D6", "u6DEA",
- "uF9D7", "u8F2A",
- "uF9D8", "u5F8B",
- "uF9D9", "u6144",
- "uF9DA", "u6817",
- "uF9DB", "u7387",
- "uF9DC", "u9686",
- "uF9DD", "u5229",
- "uF9DE", "u540F",
- "uF9DF", "u5C65",
- "uF9E0", "u6613",
- "uF9E1", "u674E",
- "uF9E2", "u68A8",
- "uF9E3", "u6CE5",
- "uF9E4", "u7406",
- "uF9E5", "u75E2",
- "uF9E6", "u7F79",
- "uF9E7", "u88CF",
- "uF9E8", "u88E1",
- "uF9E9", "u91CC",
- "uF9EA", "u96E2",
- "uF9EB", "u533F",
- "uF9EC", "u6EBA",
- "uF9ED", "u541D",
- "uF9EE", "u71D0",
- "uF9EF", "u7498",
- "uF9F0", "u85FA",
- "uF9F1", "u96A3",
- "uF9F2", "u9C57",
- "uF9F3", "u9E9F",
- "uF9F4", "u6797",
- "uF9F5", "u6DCB",
- "uF9F6", "u81E8",
- "uF9F7", "u7ACB",
- "uF9F8", "u7B20",
- "uF9F9", "u7C92",
- "uF9FA", "u72C0",
- "uF9FB", "u7099",
- "uF9FC", "u8B58",
- "uF9FD", "u4EC0",
- "uF9FE", "u8336",
- "uF9FF", "u523A",
- "uFA00", "u5207",
- "uFA01", "u5EA6",
- "uFA02", "u62D3",
- "uFA03", "u7CD6",
- "uFA04", "u5B85",
- "uFA05", "u6D1E",
- "uFA06", "u66B4",
- "uFA07", "u8F3B",
- "uFA08", "u884C",
- "uFA09", "u964D",
- "uFA0A", "u898B",
- "uFA0B", "u5ED3",
- "uFA0C", "u5140",
- "uFA0D", "u55C0",
- "uFA10", "u585A",
- "uFA12", "u6674",
- "uFA15", "u51DE",
- "uFA16", "u732A",
- "uFA17", "u76CA",
- "uFA18", "u793C",
- "uFA19", "u795E",
- "uFA1A", "u7965",
- "uFA1B", "u798F",
- "uFA1C", "u9756",
- "uFA1D", "u7CBE",
- "uFA1E", "u7FBD",
- "uFA20", "u8612",
- "uFA22", "u8AF8",
- "uFA25", "u9038",
- "uFA26", "u90FD",
- "uFA2A", "u98EF",
- "uFA2B", "u98FC",
- "uFA2C", "u9928",
- "uFA2D", "u9DB4",
- "uFA30", "u4FAE",
- "uFA31", "u50E7",
- "uFA32", "u514D",
- "uFA33", "u52C9",
- "uFA34", "u52E4",
- "uFA35", "u5351",
- "uFA36", "u559D",
- "uFA37", "u5606",
- "uFA38", "u5668",
- "uFA39", "u5840",
- "uFA3A", "u58A8",
- "uFA3B", "u5C64",
- "uFA3C", "u5C6E",
- "uFA3D", "u6094",
- "uFA3E", "u6168",
- "uFA3F", "u618E",
- "uFA40", "u61F2",
- "uFA41", "u654F",
- "uFA42", "u65E2",
- "uFA43", "u6691",
- "uFA44", "u6885",
- "uFA45", "u6D77",
- "uFA46", "u6E1A",
- "uFA47", "u6F22",
- "uFA48", "u716E",
- "uFA49", "u722B",
- "uFA4A", "u7422",
- "uFA4B", "u7891",
- "uFA4C", "u793E",
- "uFA4D", "u7949",
- "uFA4E", "u7948",
- "uFA4F", "u7950",
- "uFA50", "u7956",
- "uFA51", "u795D",
- "uFA52", "u798D",
- "uFA53", "u798E",
- "uFA54", "u7A40",
- "uFA55", "u7A81",
- "uFA56", "u7BC0",
- "uFA57", "u7DF4",
- "uFA58", "u7E09",
- "uFA59", "u7E41",
- "uFA5A", "u7F72",
- "uFA5B", "u8005",
- "uFA5C", "u81ED",
- "uFA5D", "u8279",
- "uFA5E", "u8279",
- "uFA5F", "u8457",
- "uFA60", "u8910",
- "uFA61", "u8996",
- "uFA62", "u8B01",
- "uFA63", "u8B39",
- "uFA64", "u8CD3",
- "uFA65", "u8D08",
- "uFA66", "u8FB6",
- "uFA67", "u9038",
- "uFA68", "u96E3",
- "uFA69", "u97FF",
- "uFA6A", "u983B",
- "uFB1D", "u05D9_05B4",
- "uFB1F", "u05F2_05B7",
- "uFB2A", "u05E9_05C1",
- "uFB2B", "u05E9_05C2",
- "uFB2C", "u05E9_05BC_05C1",
- "uFB2D", "u05E9_05BC_05C2",
- "uFB2E", "u05D0_05B7",
- "uFB2F", "u05D0_05B8",
- "uFB30", "u05D0_05BC",
- "uFB31", "u05D1_05BC",
- "uFB32", "u05D2_05BC",
- "uFB33", "u05D3_05BC",
- "uFB34", "u05D4_05BC",
- "uFB35", "u05D5_05BC",
- "uFB36", "u05D6_05BC",
- "uFB38", "u05D8_05BC",
- "uFB39", "u05D9_05BC",
- "uFB3A", "u05DA_05BC",
- "uFB3B", "u05DB_05BC",
- "uFB3C", "u05DC_05BC",
- "uFB3E", "u05DE_05BC",
- "uFB40", "u05E0_05BC",
- "uFB41", "u05E1_05BC",
- "uFB43", "u05E3_05BC",
- "uFB44", "u05E4_05BC",
- "uFB46", "u05E6_05BC",
- "uFB47", "u05E7_05BC",
- "uFB48", "u05E8_05BC",
- "uFB49", "u05E9_05BC",
- "uFB4A", "u05EA_05BC",
- "uFB4B", "u05D5_05B9",
- "uFB4C", "u05D1_05BF",
- "uFB4D", "u05DB_05BF",
- "uFB4E", "u05E4_05BF",
- "u1D15E", "u1D157_1D165",
- "u1D15F", "u1D158_1D165",
- "u1D160", "u1D158_1D165_1D16E",
- "u1D161", "u1D158_1D165_1D16F",
- "u1D162", "u1D158_1D165_1D170",
- "u1D163", "u1D158_1D165_1D171",
- "u1D164", "u1D158_1D165_1D172",
- "u1D1BB", "u1D1B9_1D165",
- "u1D1BC", "u1D1BA_1D165",
- "u1D1BD", "u1D1B9_1D165_1D16E",
- "u1D1BE", "u1D1BA_1D165_1D16E",
- "u1D1BF", "u1D1B9_1D165_1D16F",
- "u1D1C0", "u1D1BA_1D165_1D16F",
- "u2F800", "u4E3D",
- "u2F801", "u4E38",
- "u2F802", "u4E41",
- "u2F803", "u20122",
- "u2F804", "u4F60",
- "u2F805", "u4FAE",
- "u2F806", "u4FBB",
- "u2F807", "u5002",
- "u2F808", "u507A",
- "u2F809", "u5099",
- "u2F80A", "u50E7",
- "u2F80B", "u50CF",
- "u2F80C", "u349E",
- "u2F80D", "u2063A",
- "u2F80E", "u514D",
- "u2F80F", "u5154",
- "u2F810", "u5164",
- "u2F811", "u5177",
- "u2F812", "u2051C",
- "u2F813", "u34B9",
- "u2F814", "u5167",
- "u2F815", "u518D",
- "u2F816", "u2054B",
- "u2F817", "u5197",
- "u2F818", "u51A4",
- "u2F819", "u4ECC",
- "u2F81A", "u51AC",
- "u2F81B", "u51B5",
- "u2F81C", "u291DF",
- "u2F81D", "u51F5",
- "u2F81E", "u5203",
- "u2F81F", "u34DF",
- "u2F820", "u523B",
- "u2F821", "u5246",
- "u2F822", "u5272",
- "u2F823", "u5277",
- "u2F824", "u3515",
- "u2F825", "u52C7",
- "u2F826", "u52C9",
- "u2F827", "u52E4",
- "u2F828", "u52FA",
- "u2F829", "u5305",
- "u2F82A", "u5306",
- "u2F82B", "u5317",
- "u2F82C", "u5349",
- "u2F82D", "u5351",
- "u2F82E", "u535A",
- "u2F82F", "u5373",
- "u2F830", "u537D",
- "u2F831", "u537F",
- "u2F832", "u537F",
- "u2F833", "u537F",
- "u2F834", "u20A2C",
- "u2F835", "u7070",
- "u2F836", "u53CA",
- "u2F837", "u53DF",
- "u2F838", "u20B63",
- "u2F839", "u53EB",
- "u2F83A", "u53F1",
- "u2F83B", "u5406",
- "u2F83C", "u549E",
- "u2F83D", "u5438",
- "u2F83E", "u5448",
- "u2F83F", "u5468",
- "u2F840", "u54A2",
- "u2F841", "u54F6",
- "u2F842", "u5510",
- "u2F843", "u5553",
- "u2F844", "u5563",
- "u2F845", "u5584",
- "u2F846", "u5584",
- "u2F847", "u5599",
- "u2F848", "u55AB",
- "u2F849", "u55B3",
- "u2F84A", "u55C2",
- "u2F84B", "u5716",
- "u2F84C", "u5606",
- "u2F84D", "u5717",
- "u2F84E", "u5651",
- "u2F84F", "u5674",
- "u2F850", "u5207",
- "u2F851", "u58EE",
- "u2F852", "u57CE",
- "u2F853", "u57F4",
- "u2F854", "u580D",
- "u2F855", "u578B",
- "u2F856", "u5832",
- "u2F857", "u5831",
- "u2F858", "u58AC",
- "u2F859", "u214E4",
- "u2F85A", "u58F2",
- "u2F85B", "u58F7",
- "u2F85C", "u5906",
- "u2F85D", "u591A",
- "u2F85E", "u5922",
- "u2F85F", "u5962",
- "u2F860", "u216A8",
- "u2F861", "u216EA",
- "u2F862", "u59EC",
- "u2F863", "u5A1B",
- "u2F864", "u5A27",
- "u2F865", "u59D8",
- "u2F866", "u5A66",
- "u2F867", "u36EE",
- "u2F868", "u2136A",
- "u2F869", "u5B08",
- "u2F86A", "u5B3E",
- "u2F86B", "u5B3E",
- "u2F86C", "u219C8",
- "u2F86D", "u5BC3",
- "u2F86E", "u5BD8",
- "u2F86F", "u5BE7",
- "u2F870", "u5BF3",
- "u2F871", "u21B18",
- "u2F872", "u5BFF",
- "u2F873", "u5C06",
- "u2F874", "u5F33",
- "u2F875", "u5C22",
- "u2F876", "u3781",
- "u2F877", "u5C60",
- "u2F878", "u5C6E",
- "u2F879", "u5CC0",
- "u2F87A", "u5C8D",
- "u2F87B", "u21DE4",
- "u2F87C", "u5D43",
- "u2F87D", "u21DE6",
- "u2F87E", "u5D6E",
- "u2F87F", "u5D6B",
- "u2F880", "u5D7C",
- "u2F881", "u5DE1",
- "u2F882", "u5DE2",
- "u2F883", "u382F",
- "u2F884", "u5DFD",
- "u2F885", "u5E28",
- "u2F886", "u5E3D",
- "u2F887", "u5E69",
- "u2F888", "u3862",
- "u2F889", "u22183",
- "u2F88A", "u387C",
- "u2F88B", "u5EB0",
- "u2F88C", "u5EB3",
- "u2F88D", "u5EB6",
- "u2F88E", "u5ECA",
- "u2F88F", "u2A392",
- "u2F890", "u5EFE",
- "u2F891", "u22331",
- "u2F892", "u22331",
- "u2F893", "u8201",
- "u2F894", "u5F22",
- "u2F895", "u5F22",
- "u2F896", "u38C7",
- "u2F897", "u232B8",
- "u2F898", "u261DA",
- "u2F899", "u5F62",
- "u2F89A", "u5F6B",
- "u2F89B", "u38E3",
- "u2F89C", "u5F9A",
- "u2F89D", "u5FCD",
- "u2F89E", "u5FD7",
- "u2F89F", "u5FF9",
- "u2F8A0", "u6081",
- "u2F8A1", "u393A",
- "u2F8A2", "u391C",
- "u2F8A3", "u6094",
- "u2F8A4", "u226D4",
- "u2F8A5", "u60C7",
- "u2F8A6", "u6148",
- "u2F8A7", "u614C",
- "u2F8A8", "u614E",
- "u2F8A9", "u614C",
- "u2F8AA", "u617A",
- "u2F8AB", "u618E",
- "u2F8AC", "u61B2",
- "u2F8AD", "u61A4",
- "u2F8AE", "u61AF",
- "u2F8AF", "u61DE",
- "u2F8B0", "u61F2",
- "u2F8B1", "u61F6",
- "u2F8B2", "u6210",
- "u2F8B3", "u621B",
- "u2F8B4", "u625D",
- "u2F8B5", "u62B1",
- "u2F8B6", "u62D4",
- "u2F8B7", "u6350",
- "u2F8B8", "u22B0C",
- "u2F8B9", "u633D",
- "u2F8BA", "u62FC",
- "u2F8BB", "u6368",
- "u2F8BC", "u6383",
- "u2F8BD", "u63E4",
- "u2F8BE", "u22BF1",
- "u2F8BF", "u6422",
- "u2F8C0", "u63C5",
- "u2F8C1", "u63A9",
- "u2F8C2", "u3A2E",
- "u2F8C3", "u6469",
- "u2F8C4", "u647E",
- "u2F8C5", "u649D",
- "u2F8C6", "u6477",
- "u2F8C7", "u3A6C",
- "u2F8C8", "u654F",
- "u2F8C9", "u656C",
- "u2F8CA", "u2300A",
- "u2F8CB", "u65E3",
- "u2F8CC", "u66F8",
- "u2F8CD", "u6649",
- "u2F8CE", "u3B19",
- "u2F8CF", "u6691",
- "u2F8D0", "u3B08",
- "u2F8D1", "u3AE4",
- "u2F8D2", "u5192",
- "u2F8D3", "u5195",
- "u2F8D4", "u6700",
- "u2F8D5", "u669C",
- "u2F8D6", "u80AD",
- "u2F8D7", "u43D9",
- "u2F8D8", "u6717",
- "u2F8D9", "u671B",
- "u2F8DA", "u6721",
- "u2F8DB", "u675E",
- "u2F8DC", "u6753",
- "u2F8DD", "u233C3",
- "u2F8DE", "u3B49",
- "u2F8DF", "u67FA",
- "u2F8E0", "u6785",
- "u2F8E1", "u6852",
- "u2F8E2", "u6885",
- "u2F8E3", "u2346D",
- "u2F8E4", "u688E",
- "u2F8E5", "u681F",
- "u2F8E6", "u6914",
- "u2F8E7", "u3B9D",
- "u2F8E8", "u6942",
- "u2F8E9", "u69A3",
- "u2F8EA", "u69EA",
- "u2F8EB", "u6AA8",
- "u2F8EC", "u236A3",
- "u2F8ED", "u6ADB",
- "u2F8EE", "u3C18",
- "u2F8EF", "u6B21",
- "u2F8F0", "u238A7",
- "u2F8F1", "u6B54",
- "u2F8F2", "u3C4E",
- "u2F8F3", "u6B72",
- "u2F8F4", "u6B9F",
- "u2F8F5", "u6BBA",
- "u2F8F6", "u6BBB",
- "u2F8F7", "u23A8D",
- "u2F8F8", "u21D0B",
- "u2F8F9", "u23AFA",
- "u2F8FA", "u6C4E",
- "u2F8FB", "u23CBC",
- "u2F8FC", "u6CBF",
- "u2F8FD", "u6CCD",
- "u2F8FE", "u6C67",
- "u2F8FF", "u6D16",
- "u2F900", "u6D3E",
- "u2F901", "u6D77",
- "u2F902", "u6D41",
- "u2F903", "u6D69",
- "u2F904", "u6D78",
- "u2F905", "u6D85",
- "u2F906", "u23D1E",
- "u2F907", "u6D34",
- "u2F908", "u6E2F",
- "u2F909", "u6E6E",
- "u2F90A", "u3D33",
- "u2F90B", "u6ECB",
- "u2F90C", "u6EC7",
- "u2F90D", "u23ED1",
- "u2F90E", "u6DF9",
- "u2F90F", "u6F6E",
- "u2F910", "u23F5E",
- "u2F911", "u23F8E",
- "u2F912", "u6FC6",
- "u2F913", "u7039",
- "u2F914", "u701E",
- "u2F915", "u701B",
- "u2F916", "u3D96",
- "u2F917", "u704A",
- "u2F918", "u707D",
- "u2F919", "u7077",
- "u2F91A", "u70AD",
- "u2F91B", "u20525",
- "u2F91C", "u7145",
- "u2F91D", "u24263",
- "u2F91E", "u719C",
- "u2F91F", "u43AB",
- "u2F920", "u7228",
- "u2F921", "u7235",
- "u2F922", "u7250",
- "u2F923", "u24608",
- "u2F924", "u7280",
- "u2F925", "u7295",
- "u2F926", "u24735",
- "u2F927", "u24814",
- "u2F928", "u737A",
- "u2F929", "u738B",
- "u2F92A", "u3EAC",
- "u2F92B", "u73A5",
- "u2F92C", "u3EB8",
- "u2F92D", "u3EB8",
- "u2F92E", "u7447",
- "u2F92F", "u745C",
- "u2F930", "u7471",
- "u2F931", "u7485",
- "u2F932", "u74CA",
- "u2F933", "u3F1B",
- "u2F934", "u7524",
- "u2F935", "u24C36",
- "u2F936", "u753E",
- "u2F937", "u24C92",
- "u2F938", "u7570",
- "u2F939", "u2219F",
- "u2F93A", "u7610",
- "u2F93B", "u24FA1",
- "u2F93C", "u24FB8",
- "u2F93D", "u25044",
- "u2F93E", "u3FFC",
- "u2F93F", "u4008",
- "u2F940", "u76F4",
- "u2F941", "u250F3",
- "u2F942", "u250F2",
- "u2F943", "u25119",
- "u2F944", "u25133",
- "u2F945", "u771E",
- "u2F946", "u771F",
- "u2F947", "u771F",
- "u2F948", "u774A",
- "u2F949", "u4039",
- "u2F94A", "u778B",
- "u2F94B", "u4046",
- "u2F94C", "u4096",
- "u2F94D", "u2541D",
- "u2F94E", "u784E",
- "u2F94F", "u788C",
- "u2F950", "u78CC",
- "u2F951", "u40E3",
- "u2F952", "u25626",
- "u2F953", "u7956",
- "u2F954", "u2569A",
- "u2F955", "u256C5",
- "u2F956", "u798F",
- "u2F957", "u79EB",
- "u2F958", "u412F",
- "u2F959", "u7A40",
- "u2F95A", "u7A4A",
- "u2F95B", "u7A4F",
- "u2F95C", "u2597C",
- "u2F95D", "u25AA7",
- "u2F95E", "u25AA7",
- "u2F95F", "u7AAE",
- "u2F960", "u4202",
- "u2F961", "u25BAB",
- "u2F962", "u7BC6",
- "u2F963", "u7BC9",
- "u2F964", "u4227",
- "u2F965", "u25C80",
- "u2F966", "u7CD2",
- "u2F967", "u42A0",
- "u2F968", "u7CE8",
- "u2F969", "u7CE3",
- "u2F96A", "u7D00",
- "u2F96B", "u25F86",
- "u2F96C", "u7D63",
- "u2F96D", "u4301",
- "u2F96E", "u7DC7",
- "u2F96F", "u7E02",
- "u2F970", "u7E45",
- "u2F971", "u4334",
- "u2F972", "u26228",
- "u2F973", "u26247",
- "u2F974", "u4359",
- "u2F975", "u262D9",
- "u2F976", "u7F7A",
- "u2F977", "u2633E",
- "u2F978", "u7F95",
- "u2F979", "u7FFA",
- "u2F97A", "u8005",
- "u2F97B", "u264DA",
- "u2F97C", "u26523",
- "u2F97D", "u8060",
- "u2F97E", "u265A8",
- "u2F97F", "u8070",
- "u2F980", "u2335F",
- "u2F981", "u43D5",
- "u2F982", "u80B2",
- "u2F983", "u8103",
- "u2F984", "u440B",
- "u2F985", "u813E",
- "u2F986", "u5AB5",
- "u2F987", "u267A7",
- "u2F988", "u267B5",
- "u2F989", "u23393",
- "u2F98A", "u2339C",
- "u2F98B", "u8201",
- "u2F98C", "u8204",
- "u2F98D", "u8F9E",
- "u2F98E", "u446B",
- "u2F98F", "u8291",
- "u2F990", "u828B",
- "u2F991", "u829D",
- "u2F992", "u52B3",
- "u2F993", "u82B1",
- "u2F994", "u82B3",
- "u2F995", "u82BD",
- "u2F996", "u82E6",
- "u2F997", "u26B3C",
- "u2F998", "u82E5",
- "u2F999", "u831D",
- "u2F99A", "u8363",
- "u2F99B", "u83AD",
- "u2F99C", "u8323",
- "u2F99D", "u83BD",
- "u2F99E", "u83E7",
- "u2F99F", "u8457",
- "u2F9A0", "u8353",
- "u2F9A1", "u83CA",
- "u2F9A2", "u83CC",
- "u2F9A3", "u83DC",
- "u2F9A4", "u26C36",
- "u2F9A5", "u26D6B",
- "u2F9A6", "u26CD5",
- "u2F9A7", "u452B",
- "u2F9A8", "u84F1",
- "u2F9A9", "u84F3",
- "u2F9AA", "u8516",
- "u2F9AB", "u273CA",
- "u2F9AC", "u8564",
- "u2F9AD", "u26F2C",
- "u2F9AE", "u455D",
- "u2F9AF", "u4561",
- "u2F9B0", "u26FB1",
- "u2F9B1", "u270D2",
- "u2F9B2", "u456B",
- "u2F9B3", "u8650",
- "u2F9B4", "u865C",
- "u2F9B5", "u8667",
- "u2F9B6", "u8669",
- "u2F9B7", "u86A9",
- "u2F9B8", "u8688",
- "u2F9B9", "u870E",
- "u2F9BA", "u86E2",
- "u2F9BB", "u8779",
- "u2F9BC", "u8728",
- "u2F9BD", "u876B",
- "u2F9BE", "u8786",
- "u2F9BF", "u4D57",
- "u2F9C0", "u87E1",
- "u2F9C1", "u8801",
- "u2F9C2", "u45F9",
- "u2F9C3", "u8860",
- "u2F9C4", "u8863",
- "u2F9C5", "u27667",
- "u2F9C6", "u88D7",
- "u2F9C7", "u88DE",
- "u2F9C8", "u4635",
- "u2F9C9", "u88FA",
- "u2F9CA", "u34BB",
- "u2F9CB", "u278AE",
- "u2F9CC", "u27966",
- "u2F9CD", "u46BE",
- "u2F9CE", "u46C7",
- "u2F9CF", "u8AA0",
- "u2F9D0", "u8AED",
- "u2F9D1", "u8B8A",
- "u2F9D2", "u8C55",
- "u2F9D3", "u27CA8",
- "u2F9D4", "u8CAB",
- "u2F9D5", "u8CC1",
- "u2F9D6", "u8D1B",
- "u2F9D7", "u8D77",
- "u2F9D8", "u27F2F",
- "u2F9D9", "u20804",
- "u2F9DA", "u8DCB",
- "u2F9DB", "u8DBC",
- "u2F9DC", "u8DF0",
- "u2F9DD", "u208DE",
- "u2F9DE", "u8ED4",
- "u2F9DF", "u8F38",
- "u2F9E0", "u285D2",
- "u2F9E1", "u285ED",
- "u2F9E2", "u9094",
- "u2F9E3", "u90F1",
- "u2F9E4", "u9111",
- "u2F9E5", "u2872E",
- "u2F9E6", "u911B",
- "u2F9E7", "u9238",
- "u2F9E8", "u92D7",
- "u2F9E9", "u92D8",
- "u2F9EA", "u927C",
- "u2F9EB", "u93F9",
- "u2F9EC", "u9415",
- "u2F9ED", "u28BFA",
- "u2F9EE", "u958B",
- "u2F9EF", "u4995",
- "u2F9F0", "u95B7",
- "u2F9F1", "u28D77",
- "u2F9F2", "u49E6",
- "u2F9F3", "u96C3",
- "u2F9F4", "u5DB2",
- "u2F9F5", "u9723",
- "u2F9F6", "u29145",
- "u2F9F7", "u2921A",
- "u2F9F8", "u4A6E",
- "u2F9F9", "u4A76",
- "u2F9FA", "u97E0",
- "u2F9FB", "u2940A",
- "u2F9FC", "u4AB2",
- "u2F9FD", "u29496",
- "u2F9FE", "u980B",
- "u2F9FF", "u980B",
- "u2FA00", "u9829",
- "u2FA01", "u295B6",
- "u2FA02", "u98E2",
- "u2FA03", "u4B33",
- "u2FA04", "u9929",
- "u2FA05", "u99A7",
- "u2FA06", "u99C2",
- "u2FA07", "u99FE",
- "u2FA08", "u4BCE",
- "u2FA09", "u29B30",
- "u2FA0A", "u9B12",
- "u2FA0B", "u9C40",
- "u2FA0C", "u9CFD",
- "u2FA0D", "u4CCE",
- "u2FA0E", "u4CED",
- "u2FA0F", "u9D67",
- "u2FA10", "u2A0CE",
- "u2FA11", "u4CF8",
- "u2FA12", "u2A105",
- "u2FA13", "u2A20E",
- "u2FA14", "u2A291",
- "u2FA15", "u9EBB",
- "u2FA16", "u4D56",
- "u2FA17", "u9EF9",
- "u2FA18", "u9EFE",
- "u2FA19", "u9F05",
- "u2FA1A", "u9F0F",
- "u2FA1B", "u9F16",
- "u2FA1C", "u9F3B",
- "u2FA1D", "u2A600",
+use strict;
+
+my %unicode_decomposed = (
+ "00C0", "0041_0300",
+ "00C1", "0041_0301",
+ "00C2", "0041_0302",
+ "00C3", "0041_0303",
+ "00C4", "0041_0308",
+ "00C5", "0041_030A",
+ "00C7", "0043_0327",
+ "00C8", "0045_0300",
+ "00C9", "0045_0301",
+ "00CA", "0045_0302",
+ "00CB", "0045_0308",
+ "00CC", "0049_0300",
+ "00CD", "0049_0301",
+ "00CE", "0049_0302",
+ "00CF", "0049_0308",
+ "00D1", "004E_0303",
+ "00D2", "004F_0300",
+ "00D3", "004F_0301",
+ "00D4", "004F_0302",
+ "00D5", "004F_0303",
+ "00D6", "004F_0308",
+ "00D9", "0055_0300",
+ "00DA", "0055_0301",
+ "00DB", "0055_0302",
+ "00DC", "0055_0308",
+ "00DD", "0059_0301",
+ "00E0", "0061_0300",
+ "00E1", "0061_0301",
+ "00E2", "0061_0302",
+ "00E3", "0061_0303",
+ "00E4", "0061_0308",
+ "00E5", "0061_030A",
+ "00E7", "0063_0327",
+ "00E8", "0065_0300",
+ "00E9", "0065_0301",
+ "00EA", "0065_0302",
+ "00EB", "0065_0308",
+ "00EC", "0069_0300",
+ "00ED", "0069_0301",
+ "00EE", "0069_0302",
+ "00EF", "0069_0308",
+ "00F1", "006E_0303",
+ "00F2", "006F_0300",
+ "00F3", "006F_0301",
+ "00F4", "006F_0302",
+ "00F5", "006F_0303",
+ "00F6", "006F_0308",
+ "00F9", "0075_0300",
+ "00FA", "0075_0301",
+ "00FB", "0075_0302",
+ "00FC", "0075_0308",
+ "00FD", "0079_0301",
+ "00FF", "0079_0308",
+ "0100", "0041_0304",
+ "0101", "0061_0304",
+ "0102", "0041_0306",
+ "0103", "0061_0306",
+ "0104", "0041_0328",
+ "0105", "0061_0328",
+ "0106", "0043_0301",
+ "0107", "0063_0301",
+ "0108", "0043_0302",
+ "0109", "0063_0302",
+ "010A", "0043_0307",
+ "010B", "0063_0307",
+ "010C", "0043_030C",
+ "010D", "0063_030C",
+ "010E", "0044_030C",
+ "010F", "0064_030C",
+ "0112", "0045_0304",
+ "0113", "0065_0304",
+ "0114", "0045_0306",
+ "0115", "0065_0306",
+ "0116", "0045_0307",
+ "0117", "0065_0307",
+ "0118", "0045_0328",
+ "0119", "0065_0328",
+ "011A", "0045_030C",
+ "011B", "0065_030C",
+ "011C", "0047_0302",
+ "011D", "0067_0302",
+ "011E", "0047_0306",
+ "011F", "0067_0306",
+ "0120", "0047_0307",
+ "0121", "0067_0307",
+ "0122", "0047_0327",
+ "0123", "0067_0327",
+ "0124", "0048_0302",
+ "0125", "0068_0302",
+ "0128", "0049_0303",
+ "0129", "0069_0303",
+ "012A", "0049_0304",
+ "012B", "0069_0304",
+ "012C", "0049_0306",
+ "012D", "0069_0306",
+ "012E", "0049_0328",
+ "012F", "0069_0328",
+ "0130", "0049_0307",
+ "0134", "004A_0302",
+ "0135", "006A_0302",
+ "0136", "004B_0327",
+ "0137", "006B_0327",
+ "0139", "004C_0301",
+ "013A", "006C_0301",
+ "013B", "004C_0327",
+ "013C", "006C_0327",
+ "013D", "004C_030C",
+ "013E", "006C_030C",
+ "0143", "004E_0301",
+ "0144", "006E_0301",
+ "0145", "004E_0327",
+ "0146", "006E_0327",
+ "0147", "004E_030C",
+ "0148", "006E_030C",
+ "014C", "004F_0304",
+ "014D", "006F_0304",
+ "014E", "004F_0306",
+ "014F", "006F_0306",
+ "0150", "004F_030B",
+ "0151", "006F_030B",
+ "0154", "0052_0301",
+ "0155", "0072_0301",
+ "0156", "0052_0327",
+ "0157", "0072_0327",
+ "0158", "0052_030C",
+ "0159", "0072_030C",
+ "015A", "0053_0301",
+ "015B", "0073_0301",
+ "015C", "0053_0302",
+ "015D", "0073_0302",
+ "015E", "0053_0327",
+ "015F", "0073_0327",
+ "0160", "0053_030C",
+ "0161", "0073_030C",
+ "0162", "0054_0327",
+ "0163", "0074_0327",
+ "0164", "0054_030C",
+ "0165", "0074_030C",
+ "0168", "0055_0303",
+ "0169", "0075_0303",
+ "016A", "0055_0304",
+ "016B", "0075_0304",
+ "016C", "0055_0306",
+ "016D", "0075_0306",
+ "016E", "0055_030A",
+ "016F", "0075_030A",
+ "0170", "0055_030B",
+ "0171", "0075_030B",
+ "0172", "0055_0328",
+ "0173", "0075_0328",
+ "0174", "0057_0302",
+ "0175", "0077_0302",
+ "0176", "0059_0302",
+ "0177", "0079_0302",
+ "0178", "0059_0308",
+ "0179", "005A_0301",
+ "017A", "007A_0301",
+ "017B", "005A_0307",
+ "017C", "007A_0307",
+ "017D", "005A_030C",
+ "017E", "007A_030C",
+ "01A0", "004F_031B",
+ "01A1", "006F_031B",
+ "01AF", "0055_031B",
+ "01B0", "0075_031B",
+ "01CD", "0041_030C",
+ "01CE", "0061_030C",
+ "01CF", "0049_030C",
+ "01D0", "0069_030C",
+ "01D1", "004F_030C",
+ "01D2", "006F_030C",
+ "01D3", "0055_030C",
+ "01D4", "0075_030C",
+ "01D5", "0055_0308_0304",
+ "01D6", "0075_0308_0304",
+ "01D7", "0055_0308_0301",
+ "01D8", "0075_0308_0301",
+ "01D9", "0055_0308_030C",
+ "01DA", "0075_0308_030C",
+ "01DB", "0055_0308_0300",
+ "01DC", "0075_0308_0300",
+ "01DE", "0041_0308_0304",
+ "01DF", "0061_0308_0304",
+ "01E0", "0041_0307_0304",
+ "01E1", "0061_0307_0304",
+ "01E2", "00C6_0304",
+ "01E3", "00E6_0304",
+ "01E6", "0047_030C",
+ "01E7", "0067_030C",
+ "01E8", "004B_030C",
+ "01E9", "006B_030C",
+ "01EA", "004F_0328",
+ "01EB", "006F_0328",
+ "01EC", "004F_0328_0304",
+ "01ED", "006F_0328_0304",
+ "01EE", "01B7_030C",
+ "01EF", "0292_030C",
+ "01F0", "006A_030C",
+ "01F4", "0047_0301",
+ "01F5", "0067_0301",
+ "01F8", "004E_0300",
+ "01F9", "006E_0300",
+ "01FA", "0041_030A_0301",
+ "01FB", "0061_030A_0301",
+ "01FC", "00C6_0301",
+ "01FD", "00E6_0301",
+ "01FE", "00D8_0301",
+ "01FF", "00F8_0301",
+ "0200", "0041_030F",
+ "0201", "0061_030F",
+ "0202", "0041_0311",
+ "0203", "0061_0311",
+ "0204", "0045_030F",
+ "0205", "0065_030F",
+ "0206", "0045_0311",
+ "0207", "0065_0311",
+ "0208", "0049_030F",
+ "0209", "0069_030F",
+ "020A", "0049_0311",
+ "020B", "0069_0311",
+ "020C", "004F_030F",
+ "020D", "006F_030F",
+ "020E", "004F_0311",
+ "020F", "006F_0311",
+ "0210", "0052_030F",
+ "0211", "0072_030F",
+ "0212", "0052_0311",
+ "0213", "0072_0311",
+ "0214", "0055_030F",
+ "0215", "0075_030F",
+ "0216", "0055_0311",
+ "0217", "0075_0311",
+ "0218", "0053_0326",
+ "0219", "0073_0326",
+ "021A", "0054_0326",
+ "021B", "0074_0326",
+ "021E", "0048_030C",
+ "021F", "0068_030C",
+ "0226", "0041_0307",
+ "0227", "0061_0307",
+ "0228", "0045_0327",
+ "0229", "0065_0327",
+ "022A", "004F_0308_0304",
+ "022B", "006F_0308_0304",
+ "022C", "004F_0303_0304",
+ "022D", "006F_0303_0304",
+ "022E", "004F_0307",
+ "022F", "006F_0307",
+ "0230", "004F_0307_0304",
+ "0231", "006F_0307_0304",
+ "0232", "0059_0304",
+ "0233", "0079_0304",
+ "0340", "0300",
+ "0341", "0301",
+ "0343", "0313",
+ "0344", "0308_0301",
+ "0374", "02B9",
+ "037E", "003B",
+ "0385", "00A8_0301",
+ "0386", "0391_0301",
+ "0387", "00B7",
+ "0388", "0395_0301",
+ "0389", "0397_0301",
+ "038A", "0399_0301",
+ "038C", "039F_0301",
+ "038E", "03A5_0301",
+ "038F", "03A9_0301",
+ "0390", "03B9_0308_0301",
+ "03AA", "0399_0308",
+ "03AB", "03A5_0308",
+ "03AC", "03B1_0301",
+ "03AD", "03B5_0301",
+ "03AE", "03B7_0301",
+ "03AF", "03B9_0301",
+ "03B0", "03C5_0308_0301",
+ "03CA", "03B9_0308",
+ "03CB", "03C5_0308",
+ "03CC", "03BF_0301",
+ "03CD", "03C5_0301",
+ "03CE", "03C9_0301",
+ "03D3", "03D2_0301",
+ "03D4", "03D2_0308",
+ "0400", "0415_0300",
+ "0401", "0415_0308",
+ "0403", "0413_0301",
+ "0407", "0406_0308",
+ "040C", "041A_0301",
+ "040D", "0418_0300",
+ "040E", "0423_0306",
+ "0419", "0418_0306",
+ "0439", "0438_0306",
+ "0450", "0435_0300",
+ "0451", "0435_0308",
+ "0453", "0433_0301",
+ "0457", "0456_0308",
+ "045C", "043A_0301",
+ "045D", "0438_0300",
+ "045E", "0443_0306",
+ "0476", "0474_030F",
+ "0477", "0475_030F",
+ "04C1", "0416_0306",
+ "04C2", "0436_0306",
+ "04D0", "0410_0306",
+ "04D1", "0430_0306",
+ "04D2", "0410_0308",
+ "04D3", "0430_0308",
+ "04D6", "0415_0306",
+ "04D7", "0435_0306",
+ "04DA", "04D8_0308",
+ "04DB", "04D9_0308",
+ "04DC", "0416_0308",
+ "04DD", "0436_0308",
+ "04DE", "0417_0308",
+ "04DF", "0437_0308",
+ "04E2", "0418_0304",
+ "04E3", "0438_0304",
+ "04E4", "0418_0308",
+ "04E5", "0438_0308",
+ "04E6", "041E_0308",
+ "04E7", "043E_0308",
+ "04EA", "04E8_0308",
+ "04EB", "04E9_0308",
+ "04EC", "042D_0308",
+ "04ED", "044D_0308",
+ "04EE", "0423_0304",
+ "04EF", "0443_0304",
+ "04F0", "0423_0308",
+ "04F1", "0443_0308",
+ "04F2", "0423_030B",
+ "04F3", "0443_030B",
+ "04F4", "0427_0308",
+ "04F5", "0447_0308",
+ "04F8", "042B_0308",
+ "04F9", "044B_0308",
+ "0622", "0627_0653",
+ "0623", "0627_0654",
+ "0624", "0648_0654",
+ "0625", "0627_0655",
+ "0626", "064A_0654",
+ "06C0", "06D5_0654",
+ "06C2", "06C1_0654",
+ "06D3", "06D2_0654",
+ "0929", "0928_093C",
+ "0931", "0930_093C",
+ "0934", "0933_093C",
+ "0958", "0915_093C",
+ "0959", "0916_093C",
+ "095A", "0917_093C",
+ "095B", "091C_093C",
+ "095C", "0921_093C",
+ "095D", "0922_093C",
+ "095E", "092B_093C",
+ "095F", "092F_093C",
+ "09CB", "09C7_09BE",
+ "09CC", "09C7_09D7",
+ "09DC", "09A1_09BC",
+ "09DD", "09A2_09BC",
+ "09DF", "09AF_09BC",
+ "0A33", "0A32_0A3C",
+ "0A36", "0A38_0A3C",
+ "0A59", "0A16_0A3C",
+ "0A5A", "0A17_0A3C",
+ "0A5B", "0A1C_0A3C",
+ "0A5E", "0A2B_0A3C",
+ "0B48", "0B47_0B56",
+ "0B4B", "0B47_0B3E",
+ "0B4C", "0B47_0B57",
+ "0B5C", "0B21_0B3C",
+ "0B5D", "0B22_0B3C",
+ "0B94", "0B92_0BD7",
+ "0BCA", "0BC6_0BBE",
+ "0BCB", "0BC7_0BBE",
+ "0BCC", "0BC6_0BD7",
+ "0C48", "0C46_0C56",
+ "0CC0", "0CBF_0CD5",
+ "0CC7", "0CC6_0CD5",
+ "0CC8", "0CC6_0CD6",
+ "0CCA", "0CC6_0CC2",
+ "0CCB", "0CC6_0CC2_0CD5",
+ "0D4A", "0D46_0D3E",
+ "0D4B", "0D47_0D3E",
+ "0D4C", "0D46_0D57",
+ "0DDA", "0DD9_0DCA",
+ "0DDC", "0DD9_0DCF",
+ "0DDD", "0DD9_0DCF_0DCA",
+ "0DDE", "0DD9_0DDF",
+ "0F43", "0F42_0FB7",
+ "0F4D", "0F4C_0FB7",
+ "0F52", "0F51_0FB7",
+ "0F57", "0F56_0FB7",
+ "0F5C", "0F5B_0FB7",
+ "0F69", "0F40_0FB5",
+ "0F73", "0F71_0F72",
+ "0F75", "0F71_0F74",
+ "0F76", "0FB2_0F80",
+ "0F78", "0FB3_0F80",
+ "0F81", "0F71_0F80",
+ "0F93", "0F92_0FB7",
+ "0F9D", "0F9C_0FB7",
+ "0FA2", "0FA1_0FB7",
+ "0FA7", "0FA6_0FB7",
+ "0FAC", "0FAB_0FB7",
+ "0FB9", "0F90_0FB5",
+ "1026", "1025_102E",
+ "1E00", "0041_0325",
+ "1E01", "0061_0325",
+ "1E02", "0042_0307",
+ "1E03", "0062_0307",
+ "1E04", "0042_0323",
+ "1E05", "0062_0323",
+ "1E06", "0042_0331",
+ "1E07", "0062_0331",
+ "1E08", "0043_0327_0301",
+ "1E09", "0063_0327_0301",
+ "1E0A", "0044_0307",
+ "1E0B", "0064_0307",
+ "1E0C", "0044_0323",
+ "1E0D", "0064_0323",
+ "1E0E", "0044_0331",
+ "1E0F", "0064_0331",
+ "1E10", "0044_0327",
+ "1E11", "0064_0327",
+ "1E12", "0044_032D",
+ "1E13", "0064_032D",
+ "1E14", "0045_0304_0300",
+ "1E15", "0065_0304_0300",
+ "1E16", "0045_0304_0301",
+ "1E17", "0065_0304_0301",
+ "1E18", "0045_032D",
+ "1E19", "0065_032D",
+ "1E1A", "0045_0330",
+ "1E1B", "0065_0330",
+ "1E1C", "0045_0327_0306",
+ "1E1D", "0065_0327_0306",
+ "1E1E", "0046_0307",
+ "1E1F", "0066_0307",
+ "1E20", "0047_0304",
+ "1E21", "0067_0304",
+ "1E22", "0048_0307",
+ "1E23", "0068_0307",
+ "1E24", "0048_0323",
+ "1E25", "0068_0323",
+ "1E26", "0048_0308",
+ "1E27", "0068_0308",
+ "1E28", "0048_0327",
+ "1E29", "0068_0327",
+ "1E2A", "0048_032E",
+ "1E2B", "0068_032E",
+ "1E2C", "0049_0330",
+ "1E2D", "0069_0330",
+ "1E2E", "0049_0308_0301",
+ "1E2F", "0069_0308_0301",
+ "1E30", "004B_0301",
+ "1E31", "006B_0301",
+ "1E32", "004B_0323",
+ "1E33", "006B_0323",
+ "1E34", "004B_0331",
+ "1E35", "006B_0331",
+ "1E36", "004C_0323",
+ "1E37", "006C_0323",
+ "1E38", "004C_0323_0304",
+ "1E39", "006C_0323_0304",
+ "1E3A", "004C_0331",
+ "1E3B", "006C_0331",
+ "1E3C", "004C_032D",
+ "1E3D", "006C_032D",
+ "1E3E", "004D_0301",
+ "1E3F", "006D_0301",
+ "1E40", "004D_0307",
+ "1E41", "006D_0307",
+ "1E42", "004D_0323",
+ "1E43", "006D_0323",
+ "1E44", "004E_0307",
+ "1E45", "006E_0307",
+ "1E46", "004E_0323",
+ "1E47", "006E_0323",
+ "1E48", "004E_0331",
+ "1E49", "006E_0331",
+ "1E4A", "004E_032D",
+ "1E4B", "006E_032D",
+ "1E4C", "004F_0303_0301",
+ "1E4D", "006F_0303_0301",
+ "1E4E", "004F_0303_0308",
+ "1E4F", "006F_0303_0308",
+ "1E50", "004F_0304_0300",
+ "1E51", "006F_0304_0300",
+ "1E52", "004F_0304_0301",
+ "1E53", "006F_0304_0301",
+ "1E54", "0050_0301",
+ "1E55", "0070_0301",
+ "1E56", "0050_0307",
+ "1E57", "0070_0307",
+ "1E58", "0052_0307",
+ "1E59", "0072_0307",
+ "1E5A", "0052_0323",
+ "1E5B", "0072_0323",
+ "1E5C", "0052_0323_0304",
+ "1E5D", "0072_0323_0304",
+ "1E5E", "0052_0331",
+ "1E5F", "0072_0331",
+ "1E60", "0053_0307",
+ "1E61", "0073_0307",
+ "1E62", "0053_0323",
+ "1E63", "0073_0323",
+ "1E64", "0053_0301_0307",
+ "1E65", "0073_0301_0307",
+ "1E66", "0053_030C_0307",
+ "1E67", "0073_030C_0307",
+ "1E68", "0053_0323_0307",
+ "1E69", "0073_0323_0307",
+ "1E6A", "0054_0307",
+ "1E6B", "0074_0307",
+ "1E6C", "0054_0323",
+ "1E6D", "0074_0323",
+ "1E6E", "0054_0331",
+ "1E6F", "0074_0331",
+ "1E70", "0054_032D",
+ "1E71", "0074_032D",
+ "1E72", "0055_0324",
+ "1E73", "0075_0324",
+ "1E74", "0055_0330",
+ "1E75", "0075_0330",
+ "1E76", "0055_032D",
+ "1E77", "0075_032D",
+ "1E78", "0055_0303_0301",
+ "1E79", "0075_0303_0301",
+ "1E7A", "0055_0304_0308",
+ "1E7B", "0075_0304_0308",
+ "1E7C", "0056_0303",
+ "1E7D", "0076_0303",
+ "1E7E", "0056_0323",
+ "1E7F", "0076_0323",
+ "1E80", "0057_0300",
+ "1E81", "0077_0300",
+ "1E82", "0057_0301",
+ "1E83", "0077_0301",
+ "1E84", "0057_0308",
+ "1E85", "0077_0308",
+ "1E86", "0057_0307",
+ "1E87", "0077_0307",
+ "1E88", "0057_0323",
+ "1E89", "0077_0323",
+ "1E8A", "0058_0307",
+ "1E8B", "0078_0307",
+ "1E8C", "0058_0308",
+ "1E8D", "0078_0308",
+ "1E8E", "0059_0307",
+ "1E8F", "0079_0307",
+ "1E90", "005A_0302",
+ "1E91", "007A_0302",
+ "1E92", "005A_0323",
+ "1E93", "007A_0323",
+ "1E94", "005A_0331",
+ "1E95", "007A_0331",
+ "1E96", "0068_0331",
+ "1E97", "0074_0308",
+ "1E98", "0077_030A",
+ "1E99", "0079_030A",
+ "1E9B", "017F_0307",
+ "1EA0", "0041_0323",
+ "1EA1", "0061_0323",
+ "1EA2", "0041_0309",
+ "1EA3", "0061_0309",
+ "1EA4", "0041_0302_0301",
+ "1EA5", "0061_0302_0301",
+ "1EA6", "0041_0302_0300",
+ "1EA7", "0061_0302_0300",
+ "1EA8", "0041_0302_0309",
+ "1EA9", "0061_0302_0309",
+ "1EAA", "0041_0302_0303",
+ "1EAB", "0061_0302_0303",
+ "1EAC", "0041_0323_0302",
+ "1EAD", "0061_0323_0302",
+ "1EAE", "0041_0306_0301",
+ "1EAF", "0061_0306_0301",
+ "1EB0", "0041_0306_0300",
+ "1EB1", "0061_0306_0300",
+ "1EB2", "0041_0306_0309",
+ "1EB3", "0061_0306_0309",
+ "1EB4", "0041_0306_0303",
+ "1EB5", "0061_0306_0303",
+ "1EB6", "0041_0323_0306",
+ "1EB7", "0061_0323_0306",
+ "1EB8", "0045_0323",
+ "1EB9", "0065_0323",
+ "1EBA", "0045_0309",
+ "1EBB", "0065_0309",
+ "1EBC", "0045_0303",
+ "1EBD", "0065_0303",
+ "1EBE", "0045_0302_0301",
+ "1EBF", "0065_0302_0301",
+ "1EC0", "0045_0302_0300",
+ "1EC1", "0065_0302_0300",
+ "1EC2", "0045_0302_0309",
+ "1EC3", "0065_0302_0309",
+ "1EC4", "0045_0302_0303",
+ "1EC5", "0065_0302_0303",
+ "1EC6", "0045_0323_0302",
+ "1EC7", "0065_0323_0302",
+ "1EC8", "0049_0309",
+ "1EC9", "0069_0309",
+ "1ECA", "0049_0323",
+ "1ECB", "0069_0323",
+ "1ECC", "004F_0323",
+ "1ECD", "006F_0323",
+ "1ECE", "004F_0309",
+ "1ECF", "006F_0309",
+ "1ED0", "004F_0302_0301",
+ "1ED1", "006F_0302_0301",
+ "1ED2", "004F_0302_0300",
+ "1ED3", "006F_0302_0300",
+ "1ED4", "004F_0302_0309",
+ "1ED5", "006F_0302_0309",
+ "1ED6", "004F_0302_0303",
+ "1ED7", "006F_0302_0303",
+ "1ED8", "004F_0323_0302",
+ "1ED9", "006F_0323_0302",
+ "1EDA", "004F_031B_0301",
+ "1EDB", "006F_031B_0301",
+ "1EDC", "004F_031B_0300",
+ "1EDD", "006F_031B_0300",
+ "1EDE", "004F_031B_0309",
+ "1EDF", "006F_031B_0309",
+ "1EE0", "004F_031B_0303",
+ "1EE1", "006F_031B_0303",
+ "1EE2", "004F_031B_0323",
+ "1EE3", "006F_031B_0323",
+ "1EE4", "0055_0323",
+ "1EE5", "0075_0323",
+ "1EE6", "0055_0309",
+ "1EE7", "0075_0309",
+ "1EE8", "0055_031B_0301",
+ "1EE9", "0075_031B_0301",
+ "1EEA", "0055_031B_0300",
+ "1EEB", "0075_031B_0300",
+ "1EEC", "0055_031B_0309",
+ "1EED", "0075_031B_0309",
+ "1EEE", "0055_031B_0303",
+ "1EEF", "0075_031B_0303",
+ "1EF0", "0055_031B_0323",
+ "1EF1", "0075_031B_0323",
+ "1EF2", "0059_0300",
+ "1EF3", "0079_0300",
+ "1EF4", "0059_0323",
+ "1EF5", "0079_0323",
+ "1EF6", "0059_0309",
+ "1EF7", "0079_0309",
+ "1EF8", "0059_0303",
+ "1EF9", "0079_0303",
+ "1F00", "03B1_0313",
+ "1F01", "03B1_0314",
+ "1F02", "03B1_0313_0300",
+ "1F03", "03B1_0314_0300",
+ "1F04", "03B1_0313_0301",
+ "1F05", "03B1_0314_0301",
+ "1F06", "03B1_0313_0342",
+ "1F07", "03B1_0314_0342",
+ "1F08", "0391_0313",
+ "1F09", "0391_0314",
+ "1F0A", "0391_0313_0300",
+ "1F0B", "0391_0314_0300",
+ "1F0C", "0391_0313_0301",
+ "1F0D", "0391_0314_0301",
+ "1F0E", "0391_0313_0342",
+ "1F0F", "0391_0314_0342",
+ "1F10", "03B5_0313",
+ "1F11", "03B5_0314",
+ "1F12", "03B5_0313_0300",
+ "1F13", "03B5_0314_0300",
+ "1F14", "03B5_0313_0301",
+ "1F15", "03B5_0314_0301",
+ "1F18", "0395_0313",
+ "1F19", "0395_0314",
+ "1F1A", "0395_0313_0300",
+ "1F1B", "0395_0314_0300",
+ "1F1C", "0395_0313_0301",
+ "1F1D", "0395_0314_0301",
+ "1F20", "03B7_0313",
+ "1F21", "03B7_0314",
+ "1F22", "03B7_0313_0300",
+ "1F23", "03B7_0314_0300",
+ "1F24", "03B7_0313_0301",
+ "1F25", "03B7_0314_0301",
+ "1F26", "03B7_0313_0342",
+ "1F27", "03B7_0314_0342",
+ "1F28", "0397_0313",
+ "1F29", "0397_0314",
+ "1F2A", "0397_0313_0300",
+ "1F2B", "0397_0314_0300",
+ "1F2C", "0397_0313_0301",
+ "1F2D", "0397_0314_0301",
+ "1F2E", "0397_0313_0342",
+ "1F2F", "0397_0314_0342",
+ "1F30", "03B9_0313",
+ "1F31", "03B9_0314",
+ "1F32", "03B9_0313_0300",
+ "1F33", "03B9_0314_0300",
+ "1F34", "03B9_0313_0301",
+ "1F35", "03B9_0314_0301",
+ "1F36", "03B9_0313_0342",
+ "1F37", "03B9_0314_0342",
+ "1F38", "0399_0313",
+ "1F39", "0399_0314",
+ "1F3A", "0399_0313_0300",
+ "1F3B", "0399_0314_0300",
+ "1F3C", "0399_0313_0301",
+ "1F3D", "0399_0314_0301",
+ "1F3E", "0399_0313_0342",
+ "1F3F", "0399_0314_0342",
+ "1F40", "03BF_0313",
+ "1F41", "03BF_0314",
+ "1F42", "03BF_0313_0300",
+ "1F43", "03BF_0314_0300",
+ "1F44", "03BF_0313_0301",
+ "1F45", "03BF_0314_0301",
+ "1F48", "039F_0313",
+ "1F49", "039F_0314",
+ "1F4A", "039F_0313_0300",
+ "1F4B", "039F_0314_0300",
+ "1F4C", "039F_0313_0301",
+ "1F4D", "039F_0314_0301",
+ "1F50", "03C5_0313",
+ "1F51", "03C5_0314",
+ "1F52", "03C5_0313_0300",
+ "1F53", "03C5_0314_0300",
+ "1F54", "03C5_0313_0301",
+ "1F55", "03C5_0314_0301",
+ "1F56", "03C5_0313_0342",
+ "1F57", "03C5_0314_0342",
+ "1F59", "03A5_0314",
+ "1F5B", "03A5_0314_0300",
+ "1F5D", "03A5_0314_0301",
+ "1F5F", "03A5_0314_0342",
+ "1F60", "03C9_0313",
+ "1F61", "03C9_0314",
+ "1F62", "03C9_0313_0300",
+ "1F63", "03C9_0314_0300",
+ "1F64", "03C9_0313_0301",
+ "1F65", "03C9_0314_0301",
+ "1F66", "03C9_0313_0342",
+ "1F67", "03C9_0314_0342",
+ "1F68", "03A9_0313",
+ "1F69", "03A9_0314",
+ "1F6A", "03A9_0313_0300",
+ "1F6B", "03A9_0314_0300",
+ "1F6C", "03A9_0313_0301",
+ "1F6D", "03A9_0314_0301",
+ "1F6E", "03A9_0313_0342",
+ "1F6F", "03A9_0314_0342",
+ "1F70", "03B1_0300",
+ "1F71", "03B1_0301",
+ "1F72", "03B5_0300",
+ "1F73", "03B5_0301",
+ "1F74", "03B7_0300",
+ "1F75", "03B7_0301",
+ "1F76", "03B9_0300",
+ "1F77", "03B9_0301",
+ "1F78", "03BF_0300",
+ "1F79", "03BF_0301",
+ "1F7A", "03C5_0300",
+ "1F7B", "03C5_0301",
+ "1F7C", "03C9_0300",
+ "1F7D", "03C9_0301",
+ "1F80", "03B1_0313_0345",
+ "1F81", "03B1_0314_0345",
+ "1F82", "03B1_0313_0300_0345",
+ "1F83", "03B1_0314_0300_0345",
+ "1F84", "03B1_0313_0301_0345",
+ "1F85", "03B1_0314_0301_0345",
+ "1F86", "03B1_0313_0342_0345",
+ "1F87", "03B1_0314_0342_0345",
+ "1F88", "0391_0313_0345",
+ "1F89", "0391_0314_0345",
+ "1F8A", "0391_0313_0300_0345",
+ "1F8B", "0391_0314_0300_0345",
+ "1F8C", "0391_0313_0301_0345",
+ "1F8D", "0391_0314_0301_0345",
+ "1F8E", "0391_0313_0342_0345",
+ "1F8F", "0391_0314_0342_0345",
+ "1F90", "03B7_0313_0345",
+ "1F91", "03B7_0314_0345",
+ "1F92", "03B7_0313_0300_0345",
+ "1F93", "03B7_0314_0300_0345",
+ "1F94", "03B7_0313_0301_0345",
+ "1F95", "03B7_0314_0301_0345",
+ "1F96", "03B7_0313_0342_0345",
+ "1F97", "03B7_0314_0342_0345",
+ "1F98", "0397_0313_0345",
+ "1F99", "0397_0314_0345",
+ "1F9A", "0397_0313_0300_0345",
+ "1F9B", "0397_0314_0300_0345",
+ "1F9C", "0397_0313_0301_0345",
+ "1F9D", "0397_0314_0301_0345",
+ "1F9E", "0397_0313_0342_0345",
+ "1F9F", "0397_0314_0342_0345",
+ "1FA0", "03C9_0313_0345",
+ "1FA1", "03C9_0314_0345",
+ "1FA2", "03C9_0313_0300_0345",
+ "1FA3", "03C9_0314_0300_0345",
+ "1FA4", "03C9_0313_0301_0345",
+ "1FA5", "03C9_0314_0301_0345",
+ "1FA6", "03C9_0313_0342_0345",
+ "1FA7", "03C9_0314_0342_0345",
+ "1FA8", "03A9_0313_0345",
+ "1FA9", "03A9_0314_0345",
+ "1FAA", "03A9_0313_0300_0345",
+ "1FAB", "03A9_0314_0300_0345",
+ "1FAC", "03A9_0313_0301_0345",
+ "1FAD", "03A9_0314_0301_0345",
+ "1FAE", "03A9_0313_0342_0345",
+ "1FAF", "03A9_0314_0342_0345",
+ "1FB0", "03B1_0306",
+ "1FB1", "03B1_0304",
+ "1FB2", "03B1_0300_0345",
+ "1FB3", "03B1_0345",
+ "1FB4", "03B1_0301_0345",
+ "1FB6", "03B1_0342",
+ "1FB7", "03B1_0342_0345",
+ "1FB8", "0391_0306",
+ "1FB9", "0391_0304",
+ "1FBA", "0391_0300",
+ "1FBB", "0391_0301",
+ "1FBC", "0391_0345",
+ "1FBE", "03B9",
+ "1FC1", "00A8_0342",
+ "1FC2", "03B7_0300_0345",
+ "1FC3", "03B7_0345",
+ "1FC4", "03B7_0301_0345",
+ "1FC6", "03B7_0342",
+ "1FC7", "03B7_0342_0345",
+ "1FC8", "0395_0300",
+ "1FC9", "0395_0301",
+ "1FCA", "0397_0300",
+ "1FCB", "0397_0301",
+ "1FCC", "0397_0345",
+ "1FCD", "1FBF_0300",
+ "1FCE", "1FBF_0301",
+ "1FCF", "1FBF_0342",
+ "1FD0", "03B9_0306",
+ "1FD1", "03B9_0304",
+ "1FD2", "03B9_0308_0300",
+ "1FD3", "03B9_0308_0301",
+ "1FD6", "03B9_0342",
+ "1FD7", "03B9_0308_0342",
+ "1FD8", "0399_0306",
+ "1FD9", "0399_0304",
+ "1FDA", "0399_0300",
+ "1FDB", "0399_0301",
+ "1FDD", "1FFE_0300",
+ "1FDE", "1FFE_0301",
+ "1FDF", "1FFE_0342",
+ "1FE0", "03C5_0306",
+ "1FE1", "03C5_0304",
+ "1FE2", "03C5_0308_0300",
+ "1FE3", "03C5_0308_0301",
+ "1FE4", "03C1_0313",
+ "1FE5", "03C1_0314",
+ "1FE6", "03C5_0342",
+ "1FE7", "03C5_0308_0342",
+ "1FE8", "03A5_0306",
+ "1FE9", "03A5_0304",
+ "1FEA", "03A5_0300",
+ "1FEB", "03A5_0301",
+ "1FEC", "03A1_0314",
+ "1FED", "00A8_0300",
+ "1FEE", "00A8_0301",
+ "1FEF", "0060",
+ "1FF2", "03C9_0300_0345",
+ "1FF3", "03C9_0345",
+ "1FF4", "03C9_0301_0345",
+ "1FF6", "03C9_0342",
+ "1FF7", "03C9_0342_0345",
+ "1FF8", "039F_0300",
+ "1FF9", "039F_0301",
+ "1FFA", "03A9_0300",
+ "1FFB", "03A9_0301",
+ "1FFC", "03A9_0345",
+ "1FFD", "00B4",
+ "2000", "2002",
+ "2001", "2003",
+ "2126", "03A9",
+ "212A", "004B",
+ "212B", "0041_030A",
+ "219A", "2190_0338",
+ "219B", "2192_0338",
+ "21AE", "2194_0338",
+ "21CD", "21D0_0338",
+ "21CE", "21D4_0338",
+ "21CF", "21D2_0338",
+ "2204", "2203_0338",
+ "2209", "2208_0338",
+ "220C", "220B_0338",
+ "2224", "2223_0338",
+ "2226", "2225_0338",
+ "2241", "223C_0338",
+ "2244", "2243_0338",
+ "2247", "2245_0338",
+ "2249", "2248_0338",
+ "2260", "003D_0338",
+ "2262", "2261_0338",
+ "226D", "224D_0338",
+ "226E", "003C_0338",
+ "226F", "003E_0338",
+ "2270", "2264_0338",
+ "2271", "2265_0338",
+ "2274", "2272_0338",
+ "2275", "2273_0338",
+ "2278", "2276_0338",
+ "2279", "2277_0338",
+ "2280", "227A_0338",
+ "2281", "227B_0338",
+ "2284", "2282_0338",
+ "2285", "2283_0338",
+ "2288", "2286_0338",
+ "2289", "2287_0338",
+ "22AC", "22A2_0338",
+ "22AD", "22A8_0338",
+ "22AE", "22A9_0338",
+ "22AF", "22AB_0338",
+ "22E0", "227C_0338",
+ "22E1", "227D_0338",
+ "22E2", "2291_0338",
+ "22E3", "2292_0338",
+ "22EA", "22B2_0338",
+ "22EB", "22B3_0338",
+ "22EC", "22B4_0338",
+ "22ED", "22B5_0338",
+ "2329", "3008",
+ "232A", "3009",
+ "2ADC", "2ADD_0338",
+ "304C", "304B_3099",
+ "304E", "304D_3099",
+ "3050", "304F_3099",
+ "3052", "3051_3099",
+ "3054", "3053_3099",
+ "3056", "3055_3099",
+ "3058", "3057_3099",
+ "305A", "3059_3099",
+ "305C", "305B_3099",
+ "305E", "305D_3099",
+ "3060", "305F_3099",
+ "3062", "3061_3099",
+ "3065", "3064_3099",
+ "3067", "3066_3099",
+ "3069", "3068_3099",
+ "3070", "306F_3099",
+ "3071", "306F_309A",
+ "3073", "3072_3099",
+ "3074", "3072_309A",
+ "3076", "3075_3099",
+ "3077", "3075_309A",
+ "3079", "3078_3099",
+ "307A", "3078_309A",
+ "307C", "307B_3099",
+ "307D", "307B_309A",
+ "3094", "3046_3099",
+ "309E", "309D_3099",
+ "30AC", "30AB_3099",
+ "30AE", "30AD_3099",
+ "30B0", "30AF_3099",
+ "30B2", "30B1_3099",
+ "30B4", "30B3_3099",
+ "30B6", "30B5_3099",
+ "30B8", "30B7_3099",
+ "30BA", "30B9_3099",
+ "30BC", "30BB_3099",
+ "30BE", "30BD_3099",
+ "30C0", "30BF_3099",
+ "30C2", "30C1_3099",
+ "30C5", "30C4_3099",
+ "30C7", "30C6_3099",
+ "30C9", "30C8_3099",
+ "30D0", "30CF_3099",
+ "30D1", "30CF_309A",
+ "30D3", "30D2_3099",
+ "30D4", "30D2_309A",
+ "30D6", "30D5_3099",
+ "30D7", "30D5_309A",
+ "30D9", "30D8_3099",
+ "30DA", "30D8_309A",
+ "30DC", "30DB_3099",
+ "30DD", "30DB_309A",
+ "30F4", "30A6_3099",
+ "30F7", "30EF_3099",
+ "30F8", "30F0_3099",
+ "30F9", "30F1_3099",
+ "30FA", "30F2_3099",
+ "30FE", "30FD_3099",
+ "F900", "8C48",
+ "F901", "66F4",
+ "F902", "8ECA",
+ "F903", "8CC8",
+ "F904", "6ED1",
+ "F905", "4E32",
+ "F906", "53E5",
+ "F907", "9F9C",
+ "F908", "9F9C",
+ "F909", "5951",
+ "F90A", "91D1",
+ "F90B", "5587",
+ "F90C", "5948",
+ "F90D", "61F6",
+ "F90E", "7669",
+ "F90F", "7F85",
+ "F910", "863F",
+ "F911", "87BA",
+ "F912", "88F8",
+ "F913", "908F",
+ "F914", "6A02",
+ "F915", "6D1B",
+ "F916", "70D9",
+ "F917", "73DE",
+ "F918", "843D",
+ "F919", "916A",
+ "F91A", "99F1",
+ "F91B", "4E82",
+ "F91C", "5375",
+ "F91D", "6B04",
+ "F91E", "721B",
+ "F91F", "862D",
+ "F920", "9E1E",
+ "F921", "5D50",
+ "F922", "6FEB",
+ "F923", "85CD",
+ "F924", "8964",
+ "F925", "62C9",
+ "F926", "81D8",
+ "F927", "881F",
+ "F928", "5ECA",
+ "F929", "6717",
+ "F92A", "6D6A",
+ "F92B", "72FC",
+ "F92C", "90CE",
+ "F92D", "4F86",
+ "F92E", "51B7",
+ "F92F", "52DE",
+ "F930", "64C4",
+ "F931", "6AD3",
+ "F932", "7210",
+ "F933", "76E7",
+ "F934", "8001",
+ "F935", "8606",
+ "F936", "865C",
+ "F937", "8DEF",
+ "F938", "9732",
+ "F939", "9B6F",
+ "F93A", "9DFA",
+ "F93B", "788C",
+ "F93C", "797F",
+ "F93D", "7DA0",
+ "F93E", "83C9",
+ "F93F", "9304",
+ "F940", "9E7F",
+ "F941", "8AD6",
+ "F942", "58DF",
+ "F943", "5F04",
+ "F944", "7C60",
+ "F945", "807E",
+ "F946", "7262",
+ "F947", "78CA",
+ "F948", "8CC2",
+ "F949", "96F7",
+ "F94A", "58D8",
+ "F94B", "5C62",
+ "F94C", "6A13",
+ "F94D", "6DDA",
+ "F94E", "6F0F",
+ "F94F", "7D2F",
+ "F950", "7E37",
+ "F951", "964B",
+ "F952", "52D2",
+ "F953", "808B",
+ "F954", "51DC",
+ "F955", "51CC",
+ "F956", "7A1C",
+ "F957", "7DBE",
+ "F958", "83F1",
+ "F959", "9675",
+ "F95A", "8B80",
+ "F95B", "62CF",
+ "F95C", "6A02",
+ "F95D", "8AFE",
+ "F95E", "4E39",
+ "F95F", "5BE7",
+ "F960", "6012",
+ "F961", "7387",
+ "F962", "7570",
+ "F963", "5317",
+ "F964", "78FB",
+ "F965", "4FBF",
+ "F966", "5FA9",
+ "F967", "4E0D",
+ "F968", "6CCC",
+ "F969", "6578",
+ "F96A", "7D22",
+ "F96B", "53C3",
+ "F96C", "585E",
+ "F96D", "7701",
+ "F96E", "8449",
+ "F96F", "8AAA",
+ "F970", "6BBA",
+ "F971", "8FB0",
+ "F972", "6C88",
+ "F973", "62FE",
+ "F974", "82E5",
+ "F975", "63A0",
+ "F976", "7565",
+ "F977", "4EAE",
+ "F978", "5169",
+ "F979", "51C9",
+ "F97A", "6881",
+ "F97B", "7CE7",
+ "F97C", "826F",
+ "F97D", "8AD2",
+ "F97E", "91CF",
+ "F97F", "52F5",
+ "F980", "5442",
+ "F981", "5973",
+ "F982", "5EEC",
+ "F983", "65C5",
+ "F984", "6FFE",
+ "F985", "792A",
+ "F986", "95AD",
+ "F987", "9A6A",
+ "F988", "9E97",
+ "F989", "9ECE",
+ "F98A", "529B",
+ "F98B", "66C6",
+ "F98C", "6B77",
+ "F98D", "8F62",
+ "F98E", "5E74",
+ "F98F", "6190",
+ "F990", "6200",
+ "F991", "649A",
+ "F992", "6F23",
+ "F993", "7149",
+ "F994", "7489",
+ "F995", "79CA",
+ "F996", "7DF4",
+ "F997", "806F",
+ "F998", "8F26",
+ "F999", "84EE",
+ "F99A", "9023",
+ "F99B", "934A",
+ "F99C", "5217",
+ "F99D", "52A3",
+ "F99E", "54BD",
+ "F99F", "70C8",
+ "F9A0", "88C2",
+ "F9A1", "8AAA",
+ "F9A2", "5EC9",
+ "F9A3", "5FF5",
+ "F9A4", "637B",
+ "F9A5", "6BAE",
+ "F9A6", "7C3E",
+ "F9A7", "7375",
+ "F9A8", "4EE4",
+ "F9A9", "56F9",
+ "F9AA", "5BE7",
+ "F9AB", "5DBA",
+ "F9AC", "601C",
+ "F9AD", "73B2",
+ "F9AE", "7469",
+ "F9AF", "7F9A",
+ "F9B0", "8046",
+ "F9B1", "9234",
+ "F9B2", "96F6",
+ "F9B3", "9748",
+ "F9B4", "9818",
+ "F9B5", "4F8B",
+ "F9B6", "79AE",
+ "F9B7", "91B4",
+ "F9B8", "96B8",
+ "F9B9", "60E1",
+ "F9BA", "4E86",
+ "F9BB", "50DA",
+ "F9BC", "5BEE",
+ "F9BD", "5C3F",
+ "F9BE", "6599",
+ "F9BF", "6A02",
+ "F9C0", "71CE",
+ "F9C1", "7642",
+ "F9C2", "84FC",
+ "F9C3", "907C",
+ "F9C4", "9F8D",
+ "F9C5", "6688",
+ "F9C6", "962E",
+ "F9C7", "5289",
+ "F9C8", "677B",
+ "F9C9", "67F3",
+ "F9CA", "6D41",
+ "F9CB", "6E9C",
+ "F9CC", "7409",
+ "F9CD", "7559",
+ "F9CE", "786B",
+ "F9CF", "7D10",
+ "F9D0", "985E",
+ "F9D1", "516D",
+ "F9D2", "622E",
+ "F9D3", "9678",
+ "F9D4", "502B",
+ "F9D5", "5D19",
+ "F9D6", "6DEA",
+ "F9D7", "8F2A",
+ "F9D8", "5F8B",
+ "F9D9", "6144",
+ "F9DA", "6817",
+ "F9DB", "7387",
+ "F9DC", "9686",
+ "F9DD", "5229",
+ "F9DE", "540F",
+ "F9DF", "5C65",
+ "F9E0", "6613",
+ "F9E1", "674E",
+ "F9E2", "68A8",
+ "F9E3", "6CE5",
+ "F9E4", "7406",
+ "F9E5", "75E2",
+ "F9E6", "7F79",
+ "F9E7", "88CF",
+ "F9E8", "88E1",
+ "F9E9", "91CC",
+ "F9EA", "96E2",
+ "F9EB", "533F",
+ "F9EC", "6EBA",
+ "F9ED", "541D",
+ "F9EE", "71D0",
+ "F9EF", "7498",
+ "F9F0", "85FA",
+ "F9F1", "96A3",
+ "F9F2", "9C57",
+ "F9F3", "9E9F",
+ "F9F4", "6797",
+ "F9F5", "6DCB",
+ "F9F6", "81E8",
+ "F9F7", "7ACB",
+ "F9F8", "7B20",
+ "F9F9", "7C92",
+ "F9FA", "72C0",
+ "F9FB", "7099",
+ "F9FC", "8B58",
+ "F9FD", "4EC0",
+ "F9FE", "8336",
+ "F9FF", "523A",
+ "FA00", "5207",
+ "FA01", "5EA6",
+ "FA02", "62D3",
+ "FA03", "7CD6",
+ "FA04", "5B85",
+ "FA05", "6D1E",
+ "FA06", "66B4",
+ "FA07", "8F3B",
+ "FA08", "884C",
+ "FA09", "964D",
+ "FA0A", "898B",
+ "FA0B", "5ED3",
+ "FA0C", "5140",
+ "FA0D", "55C0",
+ "FA10", "585A",
+ "FA12", "6674",
+ "FA15", "51DE",
+ "FA16", "732A",
+ "FA17", "76CA",
+ "FA18", "793C",
+ "FA19", "795E",
+ "FA1A", "7965",
+ "FA1B", "798F",
+ "FA1C", "9756",
+ "FA1D", "7CBE",
+ "FA1E", "7FBD",
+ "FA20", "8612",
+ "FA22", "8AF8",
+ "FA25", "9038",
+ "FA26", "90FD",
+ "FA2A", "98EF",
+ "FA2B", "98FC",
+ "FA2C", "9928",
+ "FA2D", "9DB4",
+ "FA30", "4FAE",
+ "FA31", "50E7",
+ "FA32", "514D",
+ "FA33", "52C9",
+ "FA34", "52E4",
+ "FA35", "5351",
+ "FA36", "559D",
+ "FA37", "5606",
+ "FA38", "5668",
+ "FA39", "5840",
+ "FA3A", "58A8",
+ "FA3B", "5C64",
+ "FA3C", "5C6E",
+ "FA3D", "6094",
+ "FA3E", "6168",
+ "FA3F", "618E",
+ "FA40", "61F2",
+ "FA41", "654F",
+ "FA42", "65E2",
+ "FA43", "6691",
+ "FA44", "6885",
+ "FA45", "6D77",
+ "FA46", "6E1A",
+ "FA47", "6F22",
+ "FA48", "716E",
+ "FA49", "722B",
+ "FA4A", "7422",
+ "FA4B", "7891",
+ "FA4C", "793E",
+ "FA4D", "7949",
+ "FA4E", "7948",
+ "FA4F", "7950",
+ "FA50", "7956",
+ "FA51", "795D",
+ "FA52", "798D",
+ "FA53", "798E",
+ "FA54", "7A40",
+ "FA55", "7A81",
+ "FA56", "7BC0",
+ "FA57", "7DF4",
+ "FA58", "7E09",
+ "FA59", "7E41",
+ "FA5A", "7F72",
+ "FA5B", "8005",
+ "FA5C", "81ED",
+ "FA5D", "8279",
+ "FA5E", "8279",
+ "FA5F", "8457",
+ "FA60", "8910",
+ "FA61", "8996",
+ "FA62", "8B01",
+ "FA63", "8B39",
+ "FA64", "8CD3",
+ "FA65", "8D08",
+ "FA66", "8FB6",
+ "FA67", "9038",
+ "FA68", "96E3",
+ "FA69", "97FF",
+ "FA6A", "983B",
+ "FB1D", "05D9_05B4",
+ "FB1F", "05F2_05B7",
+ "FB2A", "05E9_05C1",
+ "FB2B", "05E9_05C2",
+ "FB2C", "05E9_05BC_05C1",
+ "FB2D", "05E9_05BC_05C2",
+ "FB2E", "05D0_05B7",
+ "FB2F", "05D0_05B8",
+ "FB30", "05D0_05BC",
+ "FB31", "05D1_05BC",
+ "FB32", "05D2_05BC",
+ "FB33", "05D3_05BC",
+ "FB34", "05D4_05BC",
+ "FB35", "05D5_05BC",
+ "FB36", "05D6_05BC",
+ "FB38", "05D8_05BC",
+ "FB39", "05D9_05BC",
+ "FB3A", "05DA_05BC",
+ "FB3B", "05DB_05BC",
+ "FB3C", "05DC_05BC",
+ "FB3E", "05DE_05BC",
+ "FB40", "05E0_05BC",
+ "FB41", "05E1_05BC",
+ "FB43", "05E3_05BC",
+ "FB44", "05E4_05BC",
+ "FB46", "05E6_05BC",
+ "FB47", "05E7_05BC",
+ "FB48", "05E8_05BC",
+ "FB49", "05E9_05BC",
+ "FB4A", "05EA_05BC",
+ "FB4B", "05D5_05B9",
+ "FB4C", "05D1_05BF",
+ "FB4D", "05DB_05BF",
+ "FB4E", "05E4_05BF",
+ "1D15E", "1D157_1D165",
+ "1D15F", "1D158_1D165",
+ "1D160", "1D158_1D165_1D16E",
+ "1D161", "1D158_1D165_1D16F",
+ "1D162", "1D158_1D165_1D170",
+ "1D163", "1D158_1D165_1D171",
+ "1D164", "1D158_1D165_1D172",
+ "1D1BB", "1D1B9_1D165",
+ "1D1BC", "1D1BA_1D165",
+ "1D1BD", "1D1B9_1D165_1D16E",
+ "1D1BE", "1D1BA_1D165_1D16E",
+ "1D1BF", "1D1B9_1D165_1D16F",
+ "1D1C0", "1D1BA_1D165_1D16F",
+ "2F800", "4E3D",
+ "2F801", "4E38",
+ "2F802", "4E41",
+ "2F803", "20122",
+ "2F804", "4F60",
+ "2F805", "4FAE",
+ "2F806", "4FBB",
+ "2F807", "5002",
+ "2F808", "507A",
+ "2F809", "5099",
+ "2F80A", "50E7",
+ "2F80B", "50CF",
+ "2F80C", "349E",
+ "2F80D", "2063A",
+ "2F80E", "514D",
+ "2F80F", "5154",
+ "2F810", "5164",
+ "2F811", "5177",
+ "2F812", "2051C",
+ "2F813", "34B9",
+ "2F814", "5167",
+ "2F815", "518D",
+ "2F816", "2054B",
+ "2F817", "5197",
+ "2F818", "51A4",
+ "2F819", "4ECC",
+ "2F81A", "51AC",
+ "2F81B", "51B5",
+ "2F81C", "291DF",
+ "2F81D", "51F5",
+ "2F81E", "5203",
+ "2F81F", "34DF",
+ "2F820", "523B",
+ "2F821", "5246",
+ "2F822", "5272",
+ "2F823", "5277",
+ "2F824", "3515",
+ "2F825", "52C7",
+ "2F826", "52C9",
+ "2F827", "52E4",
+ "2F828", "52FA",
+ "2F829", "5305",
+ "2F82A", "5306",
+ "2F82B", "5317",
+ "2F82C", "5349",
+ "2F82D", "5351",
+ "2F82E", "535A",
+ "2F82F", "5373",
+ "2F830", "537D",
+ "2F831", "537F",
+ "2F832", "537F",
+ "2F833", "537F",
+ "2F834", "20A2C",
+ "2F835", "7070",
+ "2F836", "53CA",
+ "2F837", "53DF",
+ "2F838", "20B63",
+ "2F839", "53EB",
+ "2F83A", "53F1",
+ "2F83B", "5406",
+ "2F83C", "549E",
+ "2F83D", "5438",
+ "2F83E", "5448",
+ "2F83F", "5468",
+ "2F840", "54A2",
+ "2F841", "54F6",
+ "2F842", "5510",
+ "2F843", "5553",
+ "2F844", "5563",
+ "2F845", "5584",
+ "2F846", "5584",
+ "2F847", "5599",
+ "2F848", "55AB",
+ "2F849", "55B3",
+ "2F84A", "55C2",
+ "2F84B", "5716",
+ "2F84C", "5606",
+ "2F84D", "5717",
+ "2F84E", "5651",
+ "2F84F", "5674",
+ "2F850", "5207",
+ "2F851", "58EE",
+ "2F852", "57CE",
+ "2F853", "57F4",
+ "2F854", "580D",
+ "2F855", "578B",
+ "2F856", "5832",
+ "2F857", "5831",
+ "2F858", "58AC",
+ "2F859", "214E4",
+ "2F85A", "58F2",
+ "2F85B", "58F7",
+ "2F85C", "5906",
+ "2F85D", "591A",
+ "2F85E", "5922",
+ "2F85F", "5962",
+ "2F860", "216A8",
+ "2F861", "216EA",
+ "2F862", "59EC",
+ "2F863", "5A1B",
+ "2F864", "5A27",
+ "2F865", "59D8",
+ "2F866", "5A66",
+ "2F867", "36EE",
+ "2F868", "2136A",
+ "2F869", "5B08",
+ "2F86A", "5B3E",
+ "2F86B", "5B3E",
+ "2F86C", "219C8",
+ "2F86D", "5BC3",
+ "2F86E", "5BD8",
+ "2F86F", "5BE7",
+ "2F870", "5BF3",
+ "2F871", "21B18",
+ "2F872", "5BFF",
+ "2F873", "5C06",
+ "2F874", "5F33",
+ "2F875", "5C22",
+ "2F876", "3781",
+ "2F877", "5C60",
+ "2F878", "5C6E",
+ "2F879", "5CC0",
+ "2F87A", "5C8D",
+ "2F87B", "21DE4",
+ "2F87C", "5D43",
+ "2F87D", "21DE6",
+ "2F87E", "5D6E",
+ "2F87F", "5D6B",
+ "2F880", "5D7C",
+ "2F881", "5DE1",
+ "2F882", "5DE2",
+ "2F883", "382F",
+ "2F884", "5DFD",
+ "2F885", "5E28",
+ "2F886", "5E3D",
+ "2F887", "5E69",
+ "2F888", "3862",
+ "2F889", "22183",
+ "2F88A", "387C",
+ "2F88B", "5EB0",
+ "2F88C", "5EB3",
+ "2F88D", "5EB6",
+ "2F88E", "5ECA",
+ "2F88F", "2A392",
+ "2F890", "5EFE",
+ "2F891", "22331",
+ "2F892", "22331",
+ "2F893", "8201",
+ "2F894", "5F22",
+ "2F895", "5F22",
+ "2F896", "38C7",
+ "2F897", "232B8",
+ "2F898", "261DA",
+ "2F899", "5F62",
+ "2F89A", "5F6B",
+ "2F89B", "38E3",
+ "2F89C", "5F9A",
+ "2F89D", "5FCD",
+ "2F89E", "5FD7",
+ "2F89F", "5FF9",
+ "2F8A0", "6081",
+ "2F8A1", "393A",
+ "2F8A2", "391C",
+ "2F8A3", "6094",
+ "2F8A4", "226D4",
+ "2F8A5", "60C7",
+ "2F8A6", "6148",
+ "2F8A7", "614C",
+ "2F8A8", "614E",
+ "2F8A9", "614C",
+ "2F8AA", "617A",
+ "2F8AB", "618E",
+ "2F8AC", "61B2",
+ "2F8AD", "61A4",
+ "2F8AE", "61AF",
+ "2F8AF", "61DE",
+ "2F8B0", "61F2",
+ "2F8B1", "61F6",
+ "2F8B2", "6210",
+ "2F8B3", "621B",
+ "2F8B4", "625D",
+ "2F8B5", "62B1",
+ "2F8B6", "62D4",
+ "2F8B7", "6350",
+ "2F8B8", "22B0C",
+ "2F8B9", "633D",
+ "2F8BA", "62FC",
+ "2F8BB", "6368",
+ "2F8BC", "6383",
+ "2F8BD", "63E4",
+ "2F8BE", "22BF1",
+ "2F8BF", "6422",
+ "2F8C0", "63C5",
+ "2F8C1", "63A9",
+ "2F8C2", "3A2E",
+ "2F8C3", "6469",
+ "2F8C4", "647E",
+ "2F8C5", "649D",
+ "2F8C6", "6477",
+ "2F8C7", "3A6C",
+ "2F8C8", "654F",
+ "2F8C9", "656C",
+ "2F8CA", "2300A",
+ "2F8CB", "65E3",
+ "2F8CC", "66F8",
+ "2F8CD", "6649",
+ "2F8CE", "3B19",
+ "2F8CF", "6691",
+ "2F8D0", "3B08",
+ "2F8D1", "3AE4",
+ "2F8D2", "5192",
+ "2F8D3", "5195",
+ "2F8D4", "6700",
+ "2F8D5", "669C",
+ "2F8D6", "80AD",
+ "2F8D7", "43D9",
+ "2F8D8", "6717",
+ "2F8D9", "671B",
+ "2F8DA", "6721",
+ "2F8DB", "675E",
+ "2F8DC", "6753",
+ "2F8DD", "233C3",
+ "2F8DE", "3B49",
+ "2F8DF", "67FA",
+ "2F8E0", "6785",
+ "2F8E1", "6852",
+ "2F8E2", "6885",
+ "2F8E3", "2346D",
+ "2F8E4", "688E",
+ "2F8E5", "681F",
+ "2F8E6", "6914",
+ "2F8E7", "3B9D",
+ "2F8E8", "6942",
+ "2F8E9", "69A3",
+ "2F8EA", "69EA",
+ "2F8EB", "6AA8",
+ "2F8EC", "236A3",
+ "2F8ED", "6ADB",
+ "2F8EE", "3C18",
+ "2F8EF", "6B21",
+ "2F8F0", "238A7",
+ "2F8F1", "6B54",
+ "2F8F2", "3C4E",
+ "2F8F3", "6B72",
+ "2F8F4", "6B9F",
+ "2F8F5", "6BBA",
+ "2F8F6", "6BBB",
+ "2F8F7", "23A8D",
+ "2F8F8", "21D0B",
+ "2F8F9", "23AFA",
+ "2F8FA", "6C4E",
+ "2F8FB", "23CBC",
+ "2F8FC", "6CBF",
+ "2F8FD", "6CCD",
+ "2F8FE", "6C67",
+ "2F8FF", "6D16",
+ "2F900", "6D3E",
+ "2F901", "6D77",
+ "2F902", "6D41",
+ "2F903", "6D69",
+ "2F904", "6D78",
+ "2F905", "6D85",
+ "2F906", "23D1E",
+ "2F907", "6D34",
+ "2F908", "6E2F",
+ "2F909", "6E6E",
+ "2F90A", "3D33",
+ "2F90B", "6ECB",
+ "2F90C", "6EC7",
+ "2F90D", "23ED1",
+ "2F90E", "6DF9",
+ "2F90F", "6F6E",
+ "2F910", "23F5E",
+ "2F911", "23F8E",
+ "2F912", "6FC6",
+ "2F913", "7039",
+ "2F914", "701E",
+ "2F915", "701B",
+ "2F916", "3D96",
+ "2F917", "704A",
+ "2F918", "707D",
+ "2F919", "7077",
+ "2F91A", "70AD",
+ "2F91B", "20525",
+ "2F91C", "7145",
+ "2F91D", "24263",
+ "2F91E", "719C",
+ "2F91F", "43AB",
+ "2F920", "7228",
+ "2F921", "7235",
+ "2F922", "7250",
+ "2F923", "24608",
+ "2F924", "7280",
+ "2F925", "7295",
+ "2F926", "24735",
+ "2F927", "24814",
+ "2F928", "737A",
+ "2F929", "738B",
+ "2F92A", "3EAC",
+ "2F92B", "73A5",
+ "2F92C", "3EB8",
+ "2F92D", "3EB8",
+ "2F92E", "7447",
+ "2F92F", "745C",
+ "2F930", "7471",
+ "2F931", "7485",
+ "2F932", "74CA",
+ "2F933", "3F1B",
+ "2F934", "7524",
+ "2F935", "24C36",
+ "2F936", "753E",
+ "2F937", "24C92",
+ "2F938", "7570",
+ "2F939", "2219F",
+ "2F93A", "7610",
+ "2F93B", "24FA1",
+ "2F93C", "24FB8",
+ "2F93D", "25044",
+ "2F93E", "3FFC",
+ "2F93F", "4008",
+ "2F940", "76F4",
+ "2F941", "250F3",
+ "2F942", "250F2",
+ "2F943", "25119",
+ "2F944", "25133",
+ "2F945", "771E",
+ "2F946", "771F",
+ "2F947", "771F",
+ "2F948", "774A",
+ "2F949", "4039",
+ "2F94A", "778B",
+ "2F94B", "4046",
+ "2F94C", "4096",
+ "2F94D", "2541D",
+ "2F94E", "784E",
+ "2F94F", "788C",
+ "2F950", "78CC",
+ "2F951", "40E3",
+ "2F952", "25626",
+ "2F953", "7956",
+ "2F954", "2569A",
+ "2F955", "256C5",
+ "2F956", "798F",
+ "2F957", "79EB",
+ "2F958", "412F",
+ "2F959", "7A40",
+ "2F95A", "7A4A",
+ "2F95B", "7A4F",
+ "2F95C", "2597C",
+ "2F95D", "25AA7",
+ "2F95E", "25AA7",
+ "2F95F", "7AAE",
+ "2F960", "4202",
+ "2F961", "25BAB",
+ "2F962", "7BC6",
+ "2F963", "7BC9",
+ "2F964", "4227",
+ "2F965", "25C80",
+ "2F966", "7CD2",
+ "2F967", "42A0",
+ "2F968", "7CE8",
+ "2F969", "7CE3",
+ "2F96A", "7D00",
+ "2F96B", "25F86",
+ "2F96C", "7D63",
+ "2F96D", "4301",
+ "2F96E", "7DC7",
+ "2F96F", "7E02",
+ "2F970", "7E45",
+ "2F971", "4334",
+ "2F972", "26228",
+ "2F973", "26247",
+ "2F974", "4359",
+ "2F975", "262D9",
+ "2F976", "7F7A",
+ "2F977", "2633E",
+ "2F978", "7F95",
+ "2F979", "7FFA",
+ "2F97A", "8005",
+ "2F97B", "264DA",
+ "2F97C", "26523",
+ "2F97D", "8060",
+ "2F97E", "265A8",
+ "2F97F", "8070",
+ "2F980", "2335F",
+ "2F981", "43D5",
+ "2F982", "80B2",
+ "2F983", "8103",
+ "2F984", "440B",
+ "2F985", "813E",
+ "2F986", "5AB5",
+ "2F987", "267A7",
+ "2F988", "267B5",
+ "2F989", "23393",
+ "2F98A", "2339C",
+ "2F98B", "8201",
+ "2F98C", "8204",
+ "2F98D", "8F9E",
+ "2F98E", "446B",
+ "2F98F", "8291",
+ "2F990", "828B",
+ "2F991", "829D",
+ "2F992", "52B3",
+ "2F993", "82B1",
+ "2F994", "82B3",
+ "2F995", "82BD",
+ "2F996", "82E6",
+ "2F997", "26B3C",
+ "2F998", "82E5",
+ "2F999", "831D",
+ "2F99A", "8363",
+ "2F99B", "83AD",
+ "2F99C", "8323",
+ "2F99D", "83BD",
+ "2F99E", "83E7",
+ "2F99F", "8457",
+ "2F9A0", "8353",
+ "2F9A1", "83CA",
+ "2F9A2", "83CC",
+ "2F9A3", "83DC",
+ "2F9A4", "26C36",
+ "2F9A5", "26D6B",
+ "2F9A6", "26CD5",
+ "2F9A7", "452B",
+ "2F9A8", "84F1",
+ "2F9A9", "84F3",
+ "2F9AA", "8516",
+ "2F9AB", "273CA",
+ "2F9AC", "8564",
+ "2F9AD", "26F2C",
+ "2F9AE", "455D",
+ "2F9AF", "4561",
+ "2F9B0", "26FB1",
+ "2F9B1", "270D2",
+ "2F9B2", "456B",
+ "2F9B3", "8650",
+ "2F9B4", "865C",
+ "2F9B5", "8667",
+ "2F9B6", "8669",
+ "2F9B7", "86A9",
+ "2F9B8", "8688",
+ "2F9B9", "870E",
+ "2F9BA", "86E2",
+ "2F9BB", "8779",
+ "2F9BC", "8728",
+ "2F9BD", "876B",
+ "2F9BE", "8786",
+ "2F9BF", "4D57",
+ "2F9C0", "87E1",
+ "2F9C1", "8801",
+ "2F9C2", "45F9",
+ "2F9C3", "8860",
+ "2F9C4", "8863",
+ "2F9C5", "27667",
+ "2F9C6", "88D7",
+ "2F9C7", "88DE",
+ "2F9C8", "4635",
+ "2F9C9", "88FA",
+ "2F9CA", "34BB",
+ "2F9CB", "278AE",
+ "2F9CC", "27966",
+ "2F9CD", "46BE",
+ "2F9CE", "46C7",
+ "2F9CF", "8AA0",
+ "2F9D0", "8AED",
+ "2F9D1", "8B8A",
+ "2F9D2", "8C55",
+ "2F9D3", "27CA8",
+ "2F9D4", "8CAB",
+ "2F9D5", "8CC1",
+ "2F9D6", "8D1B",
+ "2F9D7", "8D77",
+ "2F9D8", "27F2F",
+ "2F9D9", "20804",
+ "2F9DA", "8DCB",
+ "2F9DB", "8DBC",
+ "2F9DC", "8DF0",
+ "2F9DD", "208DE",
+ "2F9DE", "8ED4",
+ "2F9DF", "8F38",
+ "2F9E0", "285D2",
+ "2F9E1", "285ED",
+ "2F9E2", "9094",
+ "2F9E3", "90F1",
+ "2F9E4", "9111",
+ "2F9E5", "2872E",
+ "2F9E6", "911B",
+ "2F9E7", "9238",
+ "2F9E8", "92D7",
+ "2F9E9", "92D8",
+ "2F9EA", "927C",
+ "2F9EB", "93F9",
+ "2F9EC", "9415",
+ "2F9ED", "28BFA",
+ "2F9EE", "958B",
+ "2F9EF", "4995",
+ "2F9F0", "95B7",
+ "2F9F1", "28D77",
+ "2F9F2", "49E6",
+ "2F9F3", "96C3",
+ "2F9F4", "5DB2",
+ "2F9F5", "9723",
+ "2F9F6", "29145",
+ "2F9F7", "2921A",
+ "2F9F8", "4A6E",
+ "2F9F9", "4A76",
+ "2F9FA", "97E0",
+ "2F9FB", "2940A",
+ "2F9FC", "4AB2",
+ "2F9FD", "29496",
+ "2F9FE", "980B",
+ "2F9FF", "980B",
+ "2FA00", "9829",
+ "2FA01", "295B6",
+ "2FA02", "98E2",
+ "2FA03", "4B33",
+ "2FA04", "9929",
+ "2FA05", "99A7",
+ "2FA06", "99C2",
+ "2FA07", "99FE",
+ "2FA08", "4BCE",
+ "2FA09", "29B30",
+ "2FA0A", "9B12",
+ "2FA0B", "9C40",
+ "2FA0C", "9CFD",
+ "2FA0D", "4CCE",
+ "2FA0E", "4CED",
+ "2FA0F", "9D67",
+ "2FA10", "2A0CE",
+ "2FA11", "4CF8",
+ "2FA12", "2A105",
+ "2FA13", "2A20E",
+ "2FA14", "2A291",
+ "2FA15", "9EBB",
+ "2FA16", "4D56",
+ "2FA17", "9EF9",
+ "2FA18", "9EFE",
+ "2FA19", "9F05",
+ "2FA1A", "9F0F",
+ "2FA1B", "9F16",
+ "2FA1C", "9F3B",
+ "2FA1D", "2A600",
);
-%AGL_to_unicode = (
- "A", "u0041",
- "AE", "u00C6",
- "AEacute", "u01FC",
- "AEmacron", "u01E2",
- "Aacute", "u00C1",
- "Abreve", "u0102",
- "Abreveacute", "u1EAE",
- "Abrevecyrillic", "u04D0",
- "Abrevedotbelow", "u1EB6",
- "Abrevegrave", "u1EB0",
- "Abrevehookabove", "u1EB2",
- "Abrevetilde", "u1EB4",
- "Acaron", "u01CD",
- "Acircle", "u24B6",
- "Acircumflex", "u00C2",
- "Acircumflexacute", "u1EA4",
- "Acircumflexdotbelow", "u1EAC",
- "Acircumflexgrave", "u1EA6",
- "Acircumflexhookabove", "u1EA8",
- "Acircumflextilde", "u1EAA",
- "Acyrillic", "u0410",
- "Adblgrave", "u0200",
- "Adieresis", "u00C4",
- "Adieresiscyrillic", "u04D2",
- "Adieresismacron", "u01DE",
- "Adotbelow", "u1EA0",
- "Adotmacron", "u01E0",
- "Agrave", "u00C0",
- "Ahookabove", "u1EA2",
- "Aiecyrillic", "u04D4",
- "Ainvertedbreve", "u0202",
- "Alpha", "u0391",
- "Alphatonos", "u0386",
- "Amacron", "u0100",
- "Amonospace", "uFF21",
- "Aogonek", "u0104",
- "Aring", "u00C5",
- "Aringacute", "u01FA",
- "Aringbelow", "u1E00",
- "Atilde", "u00C3",
- "Aybarmenian", "u0531",
- "B", "u0042",
- "Bcircle", "u24B7",
- "Bdotaccent", "u1E02",
- "Bdotbelow", "u1E04",
- "Becyrillic", "u0411",
- "Benarmenian", "u0532",
- "Beta", "u0392",
- "Bhook", "u0181",
- "Blinebelow", "u1E06",
- "Bmonospace", "uFF22",
- "Btopbar", "u0182",
- "C", "u0043",
- "Caarmenian", "u053E",
- "Cacute", "u0106",
- "Ccaron", "u010C",
- "Ccedilla", "u00C7",
- "Ccedillaacute", "u1E08",
- "Ccircle", "u24B8",
- "Ccircumflex", "u0108",
- "Cdot", "u010A",
- "Cdotaccent", "u010A",
- "Chaarmenian", "u0549",
- "Cheabkhasiancyrillic", "u04BC",
- "Checyrillic", "u0427",
- "Chedescenderabkhasiancyrillic", "u04BE",
- "Chedescendercyrillic", "u04B6",
- "Chedieresiscyrillic", "u04F4",
- "Cheharmenian", "u0543",
- "Chekhakassiancyrillic", "u04CB",
- "Cheverticalstrokecyrillic", "u04B8",
- "Chi", "u03A7",
- "Chook", "u0187",
- "Cmonospace", "uFF23",
- "Coarmenian", "u0551",
- "D", "u0044",
- "DZ", "u01F1",
- "DZcaron", "u01C4",
- "Daarmenian", "u0534",
- "Dafrican", "u0189",
- "Dcaron", "u010E",
- "Dcedilla", "u1E10",
- "Dcircle", "u24B9",
- "Dcircumflexbelow", "u1E12",
- "Dcroat", "u0110",
- "Ddotaccent", "u1E0A",
- "Ddotbelow", "u1E0C",
- "Decyrillic", "u0414",
- "Deicoptic", "u03EE",
- "Delta", "u2206",
- "Deltagreek", "u0394",
- "Dhook", "u018A",
- "Digammagreek", "u03DC",
- "Djecyrillic", "u0402",
- "Dlinebelow", "u1E0E",
- "Dmonospace", "uFF24",
- "Dslash", "u0110",
- "Dtopbar", "u018B",
- "Dz", "u01F2",
- "Dzcaron", "u01C5",
- "Dzeabkhasiancyrillic", "u04E0",
- "Dzecyrillic", "u0405",
- "Dzhecyrillic", "u040F",
- "E", "u0045",
- "Eacute", "u00C9",
- "Ebreve", "u0114",
- "Ecaron", "u011A",
- "Ecedillabreve", "u1E1C",
- "Echarmenian", "u0535",
- "Ecircle", "u24BA",
- "Ecircumflex", "u00CA",
- "Ecircumflexacute", "u1EBE",
- "Ecircumflexbelow", "u1E18",
- "Ecircumflexdotbelow", "u1EC6",
- "Ecircumflexgrave", "u1EC0",
- "Ecircumflexhookabove", "u1EC2",
- "Ecircumflextilde", "u1EC4",
- "Ecyrillic", "u0404",
- "Edblgrave", "u0204",
- "Edieresis", "u00CB",
- "Edot", "u0116",
- "Edotaccent", "u0116",
- "Edotbelow", "u1EB8",
- "Efcyrillic", "u0424",
- "Egrave", "u00C8",
- "Eharmenian", "u0537",
- "Ehookabove", "u1EBA",
- "Eightroman", "u2167",
- "Einvertedbreve", "u0206",
- "Eiotifiedcyrillic", "u0464",
- "Elcyrillic", "u041B",
- "Elevenroman", "u216A",
- "Emacron", "u0112",
- "Emacronacute", "u1E16",
- "Emacrongrave", "u1E14",
- "Emcyrillic", "u041C",
- "Emonospace", "uFF25",
- "Encyrillic", "u041D",
- "Endescendercyrillic", "u04A2",
- "Eng", "u014A",
- "Enghecyrillic", "u04A4",
- "Enhookcyrillic", "u04C7",
- "Eogonek", "u0118",
- "Eopen", "u0190",
- "Epsilon", "u0395",
- "Epsilontonos", "u0388",
- "Ercyrillic", "u0420",
- "Ereversed", "u018E",
- "Ereversedcyrillic", "u042D",
- "Escyrillic", "u0421",
- "Esdescendercyrillic", "u04AA",
- "Esh", "u01A9",
- "Eta", "u0397",
- "Etarmenian", "u0538",
- "Etatonos", "u0389",
- "Eth", "u00D0",
- "Etilde", "u1EBC",
- "Etildebelow", "u1E1A",
- "Euro", "u20AC",
- "Ezh", "u01B7",
- "Ezhcaron", "u01EE",
- "Ezhreversed", "u01B8",
- "F", "u0046",
- "Fcircle", "u24BB",
- "Fdotaccent", "u1E1E",
- "Feharmenian", "u0556",
- "Feicoptic", "u03E4",
- "Fhook", "u0191",
- "Fitacyrillic", "u0472",
- "Fiveroman", "u2164",
- "Fmonospace", "uFF26",
- "Fourroman", "u2163",
- "G", "u0047",
- "GBsquare", "u3387",
- "Gacute", "u01F4",
- "Gamma", "u0393",
- "Gammaafrican", "u0194",
- "Gangiacoptic", "u03EA",
- "Gbreve", "u011E",
- "Gcaron", "u01E6",
- "Gcedilla", "u0122",
- "Gcircle", "u24BC",
- "Gcircumflex", "u011C",
- "Gcommaaccent", "u0122",
- "Gdot", "u0120",
- "Gdotaccent", "u0120",
- "Gecyrillic", "u0413",
- "Ghadarmenian", "u0542",
- "Ghemiddlehookcyrillic", "u0494",
- "Ghestrokecyrillic", "u0492",
- "Gheupturncyrillic", "u0490",
- "Ghook", "u0193",
- "Gimarmenian", "u0533",
- "Gjecyrillic", "u0403",
- "Gmacron", "u1E20",
- "Gmonospace", "uFF27",
- "Gsmallhook", "u029B",
- "Gstroke", "u01E4",
- "H", "u0048",
- "H18533", "u25CF",
- "H18543", "u25AA",
- "H18551", "u25AB",
- "H22073", "u25A1",
- "HPsquare", "u33CB",
- "Haabkhasiancyrillic", "u04A8",
- "Hadescendercyrillic", "u04B2",
- "Hardsigncyrillic", "u042A",
- "Hbar", "u0126",
- "Hbrevebelow", "u1E2A",
- "Hcedilla", "u1E28",
- "Hcircle", "u24BD",
- "Hcircumflex", "u0124",
- "Hdieresis", "u1E26",
- "Hdotaccent", "u1E22",
- "Hdotbelow", "u1E24",
- "Hmonospace", "uFF28",
- "Hoarmenian", "u0540",
- "Horicoptic", "u03E8",
- "Hzsquare", "u3390",
- "I", "u0049",
- "IAcyrillic", "u042F",
- "IJ", "u0132",
- "IUcyrillic", "u042E",
- "Iacute", "u00CD",
- "Ibreve", "u012C",
- "Icaron", "u01CF",
- "Icircle", "u24BE",
- "Icircumflex", "u00CE",
- "Icyrillic", "u0406",
- "Idblgrave", "u0208",
- "Idieresis", "u00CF",
- "Idieresisacute", "u1E2E",
- "Idieresiscyrillic", "u04E4",
- "Idot", "u0130",
- "Idotaccent", "u0130",
- "Idotbelow", "u1ECA",
- "Iebrevecyrillic", "u04D6",
- "Iecyrillic", "u0415",
- "Ifraktur", "u2111",
- "Igrave", "u00CC",
- "Ihookabove", "u1EC8",
- "Iicyrillic", "u0418",
- "Iinvertedbreve", "u020A",
- "Iishortcyrillic", "u0419",
- "Imacron", "u012A",
- "Imacroncyrillic", "u04E2",
- "Imonospace", "uFF29",
- "Iniarmenian", "u053B",
- "Iocyrillic", "u0401",
- "Iogonek", "u012E",
- "Iota", "u0399",
- "Iotaafrican", "u0196",
- "Iotadieresis", "u03AA",
- "Iotatonos", "u038A",
- "Istroke", "u0197",
- "Itilde", "u0128",
- "Itildebelow", "u1E2C",
- "Izhitsacyrillic", "u0474",
- "Izhitsadblgravecyrillic", "u0476",
- "J", "u004A",
- "Jaarmenian", "u0541",
- "Jcircle", "u24BF",
- "Jcircumflex", "u0134",
- "Jecyrillic", "u0408",
- "Jheharmenian", "u054B",
- "Jmonospace", "uFF2A",
- "K", "u004B",
- "KBsquare", "u3385",
- "KKsquare", "u33CD",
- "Kabashkircyrillic", "u04A0",
- "Kacute", "u1E30",
- "Kacyrillic", "u041A",
- "Kadescendercyrillic", "u049A",
- "Kahookcyrillic", "u04C3",
- "Kappa", "u039A",
- "Kastrokecyrillic", "u049E",
- "Kaverticalstrokecyrillic", "u049C",
- "Kcaron", "u01E8",
- "Kcedilla", "u0136",
- "Kcircle", "u24C0",
- "Kcommaaccent", "u0136",
- "Kdotbelow", "u1E32",
- "Keharmenian", "u0554",
- "Kenarmenian", "u053F",
- "Khacyrillic", "u0425",
- "Kheicoptic", "u03E6",
- "Khook", "u0198",
- "Kjecyrillic", "u040C",
- "Klinebelow", "u1E34",
- "Kmonospace", "uFF2B",
- "Koppacyrillic", "u0480",
- "Koppagreek", "u03DE",
- "Ksicyrillic", "u046E",
- "L", "u004C",
- "LJ", "u01C7",
- "Lacute", "u0139",
- "Lambda", "u039B",
- "Lcaron", "u013D",
- "Lcedilla", "u013B",
- "Lcircle", "u24C1",
- "Lcircumflexbelow", "u1E3C",
- "Lcommaaccent", "u013B",
- "Ldot", "u013F",
- "Ldotaccent", "u013F",
- "Ldotbelow", "u1E36",
- "Ldotbelowmacron", "u1E38",
- "Liwnarmenian", "u053C",
- "Lj", "u01C8",
- "Ljecyrillic", "u0409",
- "Llinebelow", "u1E3A",
- "Lmonospace", "uFF2C",
- "Lslash", "u0141",
- "M", "u004D",
- "MBsquare", "u3386",
- "Macute", "u1E3E",
- "Mcircle", "u24C2",
- "Mdotaccent", "u1E40",
- "Mdotbelow", "u1E42",
- "Menarmenian", "u0544",
- "Mmonospace", "uFF2D",
- "Mturned", "u019C",
- "Mu", "u039C",
- "N", "u004E",
- "NJ", "u01CA",
- "Nacute", "u0143",
- "Ncaron", "u0147",
- "Ncedilla", "u0145",
- "Ncircle", "u24C3",
- "Ncircumflexbelow", "u1E4A",
- "Ncommaaccent", "u0145",
- "Ndotaccent", "u1E44",
- "Ndotbelow", "u1E46",
- "Nhookleft", "u019D",
- "Nineroman", "u2168",
- "Nj", "u01CB",
- "Njecyrillic", "u040A",
- "Nlinebelow", "u1E48",
- "Nmonospace", "uFF2E",
- "Nowarmenian", "u0546",
- "Ntilde", "u00D1",
- "Nu", "u039D",
- "O", "u004F",
- "OE", "u0152",
- "Oacute", "u00D3",
- "Obarredcyrillic", "u04E8",
- "Obarreddieresiscyrillic", "u04EA",
- "Obreve", "u014E",
- "Ocaron", "u01D1",
- "Ocenteredtilde", "u019F",
- "Ocircle", "u24C4",
- "Ocircumflex", "u00D4",
- "Ocircumflexacute", "u1ED0",
- "Ocircumflexdotbelow", "u1ED8",
- "Ocircumflexgrave", "u1ED2",
- "Ocircumflexhookabove", "u1ED4",
- "Ocircumflextilde", "u1ED6",
- "Ocyrillic", "u041E",
- "Odblacute", "u0150",
- "Odblgrave", "u020C",
- "Odieresis", "u00D6",
- "Odieresiscyrillic", "u04E6",
- "Odotbelow", "u1ECC",
- "Ograve", "u00D2",
- "Oharmenian", "u0555",
- "Ohm", "u2126",
- "Ohookabove", "u1ECE",
- "Ohorn", "u01A0",
- "Ohornacute", "u1EDA",
- "Ohorndotbelow", "u1EE2",
- "Ohorngrave", "u1EDC",
- "Ohornhookabove", "u1EDE",
- "Ohorntilde", "u1EE0",
- "Ohungarumlaut", "u0150",
- "Oi", "u01A2",
- "Oinvertedbreve", "u020E",
- "Omacron", "u014C",
- "Omacronacute", "u1E52",
- "Omacrongrave", "u1E50",
- "Omega", "u2126",
- "Omegacyrillic", "u0460",
- "Omegagreek", "u03A9",
- "Omegaroundcyrillic", "u047A",
- "Omegatitlocyrillic", "u047C",
- "Omegatonos", "u038F",
- "Omicron", "u039F",
- "Omicrontonos", "u038C",
- "Omonospace", "uFF2F",
- "Oneroman", "u2160",
- "Oogonek", "u01EA",
- "Oogonekmacron", "u01EC",
- "Oopen", "u0186",
- "Oslash", "u00D8",
- "Oslashacute", "u01FE",
- "Ostrokeacute", "u01FE",
- "Otcyrillic", "u047E",
- "Otilde", "u00D5",
- "Otildeacute", "u1E4C",
- "Otildedieresis", "u1E4E",
- "P", "u0050",
- "Pacute", "u1E54",
- "Pcircle", "u24C5",
- "Pdotaccent", "u1E56",
- "Pecyrillic", "u041F",
- "Peharmenian", "u054A",
- "Pemiddlehookcyrillic", "u04A6",
- "Phi", "u03A6",
- "Phook", "u01A4",
- "Pi", "u03A0",
- "Piwrarmenian", "u0553",
- "Pmonospace", "uFF30",
- "Psi", "u03A8",
- "Psicyrillic", "u0470",
- "Q", "u0051",
- "Qcircle", "u24C6",
- "Qmonospace", "uFF31",
- "R", "u0052",
- "Raarmenian", "u054C",
- "Racute", "u0154",
- "Rcaron", "u0158",
- "Rcedilla", "u0156",
- "Rcircle", "u24C7",
- "Rcommaaccent", "u0156",
- "Rdblgrave", "u0210",
- "Rdotaccent", "u1E58",
- "Rdotbelow", "u1E5A",
- "Rdotbelowmacron", "u1E5C",
- "Reharmenian", "u0550",
- "Rfraktur", "u211C",
- "Rho", "u03A1",
- "Rinvertedbreve", "u0212",
- "Rlinebelow", "u1E5E",
- "Rmonospace", "uFF32",
- "Rsmallinverted", "u0281",
- "Rsmallinvertedsuperior", "u02B6",
- "S", "u0053",
- "SF010000", "u250C",
- "SF020000", "u2514",
- "SF030000", "u2510",
- "SF040000", "u2518",
- "SF050000", "u253C",
- "SF060000", "u252C",
- "SF070000", "u2534",
- "SF080000", "u251C",
- "SF090000", "u2524",
- "SF100000", "u2500",
- "SF110000", "u2502",
- "SF190000", "u2561",
- "SF200000", "u2562",
- "SF210000", "u2556",
- "SF220000", "u2555",
- "SF230000", "u2563",
- "SF240000", "u2551",
- "SF250000", "u2557",
- "SF260000", "u255D",
- "SF270000", "u255C",
- "SF280000", "u255B",
- "SF360000", "u255E",
- "SF370000", "u255F",
- "SF380000", "u255A",
- "SF390000", "u2554",
- "SF400000", "u2569",
- "SF410000", "u2566",
- "SF420000", "u2560",
- "SF430000", "u2550",
- "SF440000", "u256C",
- "SF450000", "u2567",
- "SF460000", "u2568",
- "SF470000", "u2564",
- "SF480000", "u2565",
- "SF490000", "u2559",
- "SF500000", "u2558",
- "SF510000", "u2552",
- "SF520000", "u2553",
- "SF530000", "u256B",
- "SF540000", "u256A",
- "Sacute", "u015A",
- "Sacutedotaccent", "u1E64",
- "Sampigreek", "u03E0",
- "Scaron", "u0160",
- "Scarondotaccent", "u1E66",
- "Scedilla", "u015E",
- "Schwa", "u018F",
- "Schwacyrillic", "u04D8",
- "Schwadieresiscyrillic", "u04DA",
- "Scircle", "u24C8",
- "Scircumflex", "u015C",
- "Scommaaccent", "u0218",
- "Sdotaccent", "u1E60",
- "Sdotbelow", "u1E62",
- "Sdotbelowdotaccent", "u1E68",
- "Seharmenian", "u054D",
- "Sevenroman", "u2166",
- "Shaarmenian", "u0547",
- "Shacyrillic", "u0428",
- "Shchacyrillic", "u0429",
- "Sheicoptic", "u03E2",
- "Shhacyrillic", "u04BA",
- "Shimacoptic", "u03EC",
- "Sigma", "u03A3",
- "Sixroman", "u2165",
- "Smonospace", "uFF33",
- "Softsigncyrillic", "u042C",
- "Stigmagreek", "u03DA",
- "T", "u0054",
- "Tau", "u03A4",
- "Tbar", "u0166",
- "Tcaron", "u0164",
- "Tcedilla", "u0162",
- "Tcircle", "u24C9",
- "Tcircumflexbelow", "u1E70",
- "Tcommaaccent", "u0162",
- "Tdotaccent", "u1E6A",
- "Tdotbelow", "u1E6C",
- "Tecyrillic", "u0422",
- "Tedescendercyrillic", "u04AC",
- "Tenroman", "u2169",
- "Tetsecyrillic", "u04B4",
- "Theta", "u0398",
- "Thook", "u01AC",
- "Thorn", "u00DE",
- "Threeroman", "u2162",
- "Tiwnarmenian", "u054F",
- "Tlinebelow", "u1E6E",
- "Tmonospace", "uFF34",
- "Toarmenian", "u0539",
- "Tonefive", "u01BC",
- "Tonesix", "u0184",
- "Tonetwo", "u01A7",
- "Tretroflexhook", "u01AE",
- "Tsecyrillic", "u0426",
- "Tshecyrillic", "u040B",
- "Twelveroman", "u216B",
- "Tworoman", "u2161",
- "U", "u0055",
- "Uacute", "u00DA",
- "Ubreve", "u016C",
- "Ucaron", "u01D3",
- "Ucircle", "u24CA",
- "Ucircumflex", "u00DB",
- "Ucircumflexbelow", "u1E76",
- "Ucyrillic", "u0423",
- "Udblacute", "u0170",
- "Udblgrave", "u0214",
- "Udieresis", "u00DC",
- "Udieresisacute", "u01D7",
- "Udieresisbelow", "u1E72",
- "Udieresiscaron", "u01D9",
- "Udieresiscyrillic", "u04F0",
- "Udieresisgrave", "u01DB",
- "Udieresismacron", "u01D5",
- "Udotbelow", "u1EE4",
- "Ugrave", "u00D9",
- "Uhookabove", "u1EE6",
- "Uhorn", "u01AF",
- "Uhornacute", "u1EE8",
- "Uhorndotbelow", "u1EF0",
- "Uhorngrave", "u1EEA",
- "Uhornhookabove", "u1EEC",
- "Uhorntilde", "u1EEE",
- "Uhungarumlaut", "u0170",
- "Uhungarumlautcyrillic", "u04F2",
- "Uinvertedbreve", "u0216",
- "Ukcyrillic", "u0478",
- "Umacron", "u016A",
- "Umacroncyrillic", "u04EE",
- "Umacrondieresis", "u1E7A",
- "Umonospace", "uFF35",
- "Uogonek", "u0172",
- "Upsilon", "u03A5",
- "Upsilon1", "u03D2",
- "Upsilonacutehooksymbolgreek", "u03D3",
- "Upsilonafrican", "u01B1",
- "Upsilondieresis", "u03AB",
- "Upsilondieresishooksymbolgreek", "u03D4",
- "Upsilonhooksymbol", "u03D2",
- "Upsilontonos", "u038E",
- "Uring", "u016E",
- "Ushortcyrillic", "u040E",
- "Ustraightcyrillic", "u04AE",
- "Ustraightstrokecyrillic", "u04B0",
- "Utilde", "u0168",
- "Utildeacute", "u1E78",
- "Utildebelow", "u1E74",
- "V", "u0056",
- "Vcircle", "u24CB",
- "Vdotbelow", "u1E7E",
- "Vecyrillic", "u0412",
- "Vewarmenian", "u054E",
- "Vhook", "u01B2",
- "Vmonospace", "uFF36",
- "Voarmenian", "u0548",
- "Vtilde", "u1E7C",
- "W", "u0057",
- "Wacute", "u1E82",
- "Wcircle", "u24CC",
- "Wcircumflex", "u0174",
- "Wdieresis", "u1E84",
- "Wdotaccent", "u1E86",
- "Wdotbelow", "u1E88",
- "Wgrave", "u1E80",
- "Wmonospace", "uFF37",
- "X", "u0058",
- "Xcircle", "u24CD",
- "Xdieresis", "u1E8C",
- "Xdotaccent", "u1E8A",
- "Xeharmenian", "u053D",
- "Xi", "u039E",
- "Xmonospace", "uFF38",
- "Y", "u0059",
- "Yacute", "u00DD",
- "Yatcyrillic", "u0462",
- "Ycircle", "u24CE",
- "Ycircumflex", "u0176",
- "Ydieresis", "u0178",
- "Ydotaccent", "u1E8E",
- "Ydotbelow", "u1EF4",
- "Yericyrillic", "u042B",
- "Yerudieresiscyrillic", "u04F8",
- "Ygrave", "u1EF2",
- "Yhook", "u01B3",
- "Yhookabove", "u1EF6",
- "Yiarmenian", "u0545",
- "Yicyrillic", "u0407",
- "Yiwnarmenian", "u0552",
- "Ymonospace", "uFF39",
- "Ytilde", "u1EF8",
- "Yusbigcyrillic", "u046A",
- "Yusbigiotifiedcyrillic", "u046C",
- "Yuslittlecyrillic", "u0466",
- "Yuslittleiotifiedcyrillic", "u0468",
- "Z", "u005A",
- "Zaarmenian", "u0536",
- "Zacute", "u0179",
- "Zcaron", "u017D",
- "Zcircle", "u24CF",
- "Zcircumflex", "u1E90",
- "Zdot", "u017B",
- "Zdotaccent", "u017B",
- "Zdotbelow", "u1E92",
- "Zecyrillic", "u0417",
- "Zedescendercyrillic", "u0498",
- "Zedieresiscyrillic", "u04DE",
- "Zeta", "u0396",
- "Zhearmenian", "u053A",
- "Zhebrevecyrillic", "u04C1",
- "Zhecyrillic", "u0416",
- "Zhedescendercyrillic", "u0496",
- "Zhedieresiscyrillic", "u04DC",
- "Zlinebelow", "u1E94",
- "Zmonospace", "uFF3A",
- "Zstroke", "u01B5",
- "a", "u0061",
- "aabengali", "u0986",
- "aacute", "u00E1",
- "aadeva", "u0906",
- "aagujarati", "u0A86",
- "aagurmukhi", "u0A06",
- "aamatragurmukhi", "u0A3E",
- "aarusquare", "u3303",
- "aavowelsignbengali", "u09BE",
- "aavowelsigndeva", "u093E",
- "aavowelsigngujarati", "u0ABE",
- "abbreviationmarkarmenian", "u055F",
- "abbreviationsigndeva", "u0970",
- "abengali", "u0985",
- "abopomofo", "u311A",
- "abreve", "u0103",
- "abreveacute", "u1EAF",
- "abrevecyrillic", "u04D1",
- "abrevedotbelow", "u1EB7",
- "abrevegrave", "u1EB1",
- "abrevehookabove", "u1EB3",
- "abrevetilde", "u1EB5",
- "acaron", "u01CE",
- "acircle", "u24D0",
- "acircumflex", "u00E2",
- "acircumflexacute", "u1EA5",
- "acircumflexdotbelow", "u1EAD",
- "acircumflexgrave", "u1EA7",
- "acircumflexhookabove", "u1EA9",
- "acircumflextilde", "u1EAB",
- "acute", "u00B4",
- "acutebelowcmb", "u0317",
- "acutecmb", "u0301",
- "acutecomb", "u0301",
- "acutedeva", "u0954",
- "acutelowmod", "u02CF",
- "acutetonecmb", "u0341",
- "acyrillic", "u0430",
- "adblgrave", "u0201",
- "addakgurmukhi", "u0A71",
- "adeva", "u0905",
- "adieresis", "u00E4",
- "adieresiscyrillic", "u04D3",
- "adieresismacron", "u01DF",
- "adotbelow", "u1EA1",
- "adotmacron", "u01E1",
- "ae", "u00E6",
- "aeacute", "u01FD",
- "aekorean", "u3150",
- "aemacron", "u01E3",
- "afii00208", "u2015",
- "afii08941", "u20A4",
- "afii10017", "u0410",
- "afii10018", "u0411",
- "afii10019", "u0412",
- "afii10020", "u0413",
- "afii10021", "u0414",
- "afii10022", "u0415",
- "afii10023", "u0401",
- "afii10024", "u0416",
- "afii10025", "u0417",
- "afii10026", "u0418",
- "afii10027", "u0419",
- "afii10028", "u041A",
- "afii10029", "u041B",
- "afii10030", "u041C",
- "afii10031", "u041D",
- "afii10032", "u041E",
- "afii10033", "u041F",
- "afii10034", "u0420",
- "afii10035", "u0421",
- "afii10036", "u0422",
- "afii10037", "u0423",
- "afii10038", "u0424",
- "afii10039", "u0425",
- "afii10040", "u0426",
- "afii10041", "u0427",
- "afii10042", "u0428",
- "afii10043", "u0429",
- "afii10044", "u042A",
- "afii10045", "u042B",
- "afii10046", "u042C",
- "afii10047", "u042D",
- "afii10048", "u042E",
- "afii10049", "u042F",
- "afii10050", "u0490",
- "afii10051", "u0402",
- "afii10052", "u0403",
- "afii10053", "u0404",
- "afii10054", "u0405",
- "afii10055", "u0406",
- "afii10056", "u0407",
- "afii10057", "u0408",
- "afii10058", "u0409",
- "afii10059", "u040A",
- "afii10060", "u040B",
- "afii10061", "u040C",
- "afii10062", "u040E",
- "afii10065", "u0430",
- "afii10066", "u0431",
- "afii10067", "u0432",
- "afii10068", "u0433",
- "afii10069", "u0434",
- "afii10070", "u0435",
- "afii10071", "u0451",
- "afii10072", "u0436",
- "afii10073", "u0437",
- "afii10074", "u0438",
- "afii10075", "u0439",
- "afii10076", "u043A",
- "afii10077", "u043B",
- "afii10078", "u043C",
- "afii10079", "u043D",
- "afii10080", "u043E",
- "afii10081", "u043F",
- "afii10082", "u0440",
- "afii10083", "u0441",
- "afii10084", "u0442",
- "afii10085", "u0443",
- "afii10086", "u0444",
- "afii10087", "u0445",
- "afii10088", "u0446",
- "afii10089", "u0447",
- "afii10090", "u0448",
- "afii10091", "u0449",
- "afii10092", "u044A",
- "afii10093", "u044B",
- "afii10094", "u044C",
- "afii10095", "u044D",
- "afii10096", "u044E",
- "afii10097", "u044F",
- "afii10098", "u0491",
- "afii10099", "u0452",
- "afii10100", "u0453",
- "afii10101", "u0454",
- "afii10102", "u0455",
- "afii10103", "u0456",
- "afii10104", "u0457",
- "afii10105", "u0458",
- "afii10106", "u0459",
- "afii10107", "u045A",
- "afii10108", "u045B",
- "afii10109", "u045C",
- "afii10110", "u045E",
- "afii10145", "u040F",
- "afii10146", "u0462",
- "afii10147", "u0472",
- "afii10148", "u0474",
- "afii10193", "u045F",
- "afii10194", "u0463",
- "afii10195", "u0473",
- "afii10196", "u0475",
- "afii10846", "u04D9",
- "afii299", "u200E",
- "afii300", "u200F",
- "afii301", "u200D",
- "afii57381", "u066A",
- "afii57388", "u060C",
- "afii57392", "u0660",
- "afii57393", "u0661",
- "afii57394", "u0662",
- "afii57395", "u0663",
- "afii57396", "u0664",
- "afii57397", "u0665",
- "afii57398", "u0666",
- "afii57399", "u0667",
- "afii57400", "u0668",
- "afii57401", "u0669",
- "afii57403", "u061B",
- "afii57407", "u061F",
- "afii57409", "u0621",
- "afii57410", "u0622",
- "afii57411", "u0623",
- "afii57412", "u0624",
- "afii57413", "u0625",
- "afii57414", "u0626",
- "afii57415", "u0627",
- "afii57416", "u0628",
- "afii57417", "u0629",
- "afii57418", "u062A",
- "afii57419", "u062B",
- "afii57420", "u062C",
- "afii57421", "u062D",
- "afii57422", "u062E",
- "afii57423", "u062F",
- "afii57424", "u0630",
- "afii57425", "u0631",
- "afii57426", "u0632",
- "afii57427", "u0633",
- "afii57428", "u0634",
- "afii57429", "u0635",
- "afii57430", "u0636",
- "afii57431", "u0637",
- "afii57432", "u0638",
- "afii57433", "u0639",
- "afii57434", "u063A",
- "afii57440", "u0640",
- "afii57441", "u0641",
- "afii57442", "u0642",
- "afii57443", "u0643",
- "afii57444", "u0644",
- "afii57445", "u0645",
- "afii57446", "u0646",
- "afii57448", "u0648",
- "afii57449", "u0649",
- "afii57450", "u064A",
- "afii57451", "u064B",
- "afii57452", "u064C",
- "afii57453", "u064D",
- "afii57454", "u064E",
- "afii57455", "u064F",
- "afii57456", "u0650",
- "afii57457", "u0651",
- "afii57458", "u0652",
- "afii57470", "u0647",
- "afii57505", "u06A4",
- "afii57506", "u067E",
- "afii57507", "u0686",
- "afii57508", "u0698",
- "afii57509", "u06AF",
- "afii57511", "u0679",
- "afii57512", "u0688",
- "afii57513", "u0691",
- "afii57514", "u06BA",
- "afii57519", "u06D2",
- "afii57534", "u06D5",
- "afii57636", "u20AA",
- "afii57645", "u05BE",
- "afii57658", "u05C3",
- "afii57664", "u05D0",
- "afii57665", "u05D1",
- "afii57666", "u05D2",
- "afii57667", "u05D3",
- "afii57668", "u05D4",
- "afii57669", "u05D5",
- "afii57670", "u05D6",
- "afii57671", "u05D7",
- "afii57672", "u05D8",
- "afii57673", "u05D9",
- "afii57674", "u05DA",
- "afii57675", "u05DB",
- "afii57676", "u05DC",
- "afii57677", "u05DD",
- "afii57678", "u05DE",
- "afii57679", "u05DF",
- "afii57680", "u05E0",
- "afii57681", "u05E1",
- "afii57682", "u05E2",
- "afii57683", "u05E3",
- "afii57684", "u05E4",
- "afii57685", "u05E5",
- "afii57686", "u05E6",
- "afii57687", "u05E7",
- "afii57688", "u05E8",
- "afii57689", "u05E9",
- "afii57690", "u05EA",
- "afii57694", "uFB2A",
- "afii57695", "uFB2B",
- "afii57700", "uFB4B",
- "afii57705", "uFB1F",
- "afii57716", "u05F0",
- "afii57717", "u05F1",
- "afii57718", "u05F2",
- "afii57723", "uFB35",
- "afii57793", "u05B4",
- "afii57794", "u05B5",
- "afii57795", "u05B6",
- "afii57796", "u05BB",
- "afii57797", "u05B8",
- "afii57798", "u05B7",
- "afii57799", "u05B0",
- "afii57800", "u05B2",
- "afii57801", "u05B1",
- "afii57802", "u05B3",
- "afii57803", "u05C2",
- "afii57804", "u05C1",
- "afii57806", "u05B9",
- "afii57807", "u05BC",
- "afii57839", "u05BD",
- "afii57841", "u05BF",
- "afii57842", "u05C0",
- "afii57929", "u02BC",
- "afii61248", "u2105",
- "afii61289", "u2113",
- "afii61352", "u2116",
- "afii61573", "u202C",
- "afii61574", "u202D",
- "afii61575", "u202E",
- "afii61664", "u200C",
- "afii63167", "u066D",
- "afii64937", "u02BD",
- "agrave", "u00E0",
- "agujarati", "u0A85",
- "agurmukhi", "u0A05",
- "ahiragana", "u3042",
- "ahookabove", "u1EA3",
- "aibengali", "u0990",
- "aibopomofo", "u311E",
- "aideva", "u0910",
- "aiecyrillic", "u04D5",
- "aigujarati", "u0A90",
- "aigurmukhi", "u0A10",
- "aimatragurmukhi", "u0A48",
- "ainarabic", "u0639",
- "ainfinalarabic", "uFECA",
- "aininitialarabic", "uFECB",
- "ainmedialarabic", "uFECC",
- "ainvertedbreve", "u0203",
- "aivowelsignbengali", "u09C8",
- "aivowelsigndeva", "u0948",
- "aivowelsigngujarati", "u0AC8",
- "akatakana", "u30A2",
- "akatakanahalfwidth", "uFF71",
- "akorean", "u314F",
- "alef", "u05D0",
- "alefarabic", "u0627",
- "alefdageshhebrew", "uFB30",
- "aleffinalarabic", "uFE8E",
- "alefhamzaabovearabic", "u0623",
- "alefhamzaabovefinalarabic", "uFE84",
- "alefhamzabelowarabic", "u0625",
- "alefhamzabelowfinalarabic", "uFE88",
- "alefhebrew", "u05D0",
- "aleflamedhebrew", "uFB4F",
- "alefmaddaabovearabic", "u0622",
- "alefmaddaabovefinalarabic", "uFE82",
- "alefmaksuraarabic", "u0649",
- "alefmaksurafinalarabic", "uFEF0",
- "alefmaksurainitialarabic", "uFEF3",
- "alefmaksuramedialarabic", "uFEF4",
- "alefpatahhebrew", "uFB2E",
- "alefqamatshebrew", "uFB2F",
- "aleph", "u2135",
- "allequal", "u224C",
- "alpha", "u03B1",
- "alphatonos", "u03AC",
- "amacron", "u0101",
- "amonospace", "uFF41",
- "ampersand", "u0026",
- "ampersandmonospace", "uFF06",
- "amsquare", "u33C2",
- "anbopomofo", "u3122",
- "angbopomofo", "u3124",
- "angkhankhuthai", "u0E5A",
- "angle", "u2220",
- "anglebracketleft", "u3008",
- "anglebracketleftvertical", "uFE3F",
- "anglebracketright", "u3009",
- "anglebracketrightvertical", "uFE40",
- "angleleft", "u2329",
- "angleright", "u232A",
- "angstrom", "u212B",
- "anoteleia", "u0387",
- "anudattadeva", "u0952",
- "anusvarabengali", "u0982",
- "anusvaradeva", "u0902",
- "anusvaragujarati", "u0A82",
- "aogonek", "u0105",
- "apaatosquare", "u3300",
- "aparen", "u249C",
- "apostrophearmenian", "u055A",
- "apostrophemod", "u02BC",
- "approaches", "u2250",
- "approxequal", "u2248",
- "approxequalorimage", "u2252",
- "approximatelyequal", "u2245",
- "araeaekorean", "u318E",
- "araeakorean", "u318D",
- "arc", "u2312",
- "arighthalfring", "u1E9A",
- "aring", "u00E5",
- "aringacute", "u01FB",
- "aringbelow", "u1E01",
- "arrowboth", "u2194",
- "arrowdashdown", "u21E3",
- "arrowdashleft", "u21E0",
- "arrowdashright", "u21E2",
- "arrowdashup", "u21E1",
- "arrowdblboth", "u21D4",
- "arrowdbldown", "u21D3",
- "arrowdblleft", "u21D0",
- "arrowdblright", "u21D2",
- "arrowdblup", "u21D1",
- "arrowdown", "u2193",
- "arrowdownleft", "u2199",
- "arrowdownright", "u2198",
- "arrowdownwhite", "u21E9",
- "arrowheaddownmod", "u02C5",
- "arrowheadleftmod", "u02C2",
- "arrowheadrightmod", "u02C3",
- "arrowheadupmod", "u02C4",
- "arrowleft", "u2190",
- "arrowleftdbl", "u21D0",
- "arrowleftdblstroke", "u21CD",
- "arrowleftoverright", "u21C6",
- "arrowleftwhite", "u21E6",
- "arrowright", "u2192",
- "arrowrightdblstroke", "u21CF",
- "arrowrightheavy", "u279E",
- "arrowrightoverleft", "u21C4",
- "arrowrightwhite", "u21E8",
- "arrowtableft", "u21E4",
- "arrowtabright", "u21E5",
- "arrowup", "u2191",
- "arrowupdn", "u2195",
- "arrowupdnbse", "u21A8",
- "arrowupdownbase", "u21A8",
- "arrowupleft", "u2196",
- "arrowupleftofdown", "u21C5",
- "arrowupright", "u2197",
- "arrowupwhite", "u21E7",
- "asciicircum", "u005E",
- "asciicircummonospace", "uFF3E",
- "asciitilde", "u007E",
- "asciitildemonospace", "uFF5E",
- "ascript", "u0251",
- "ascriptturned", "u0252",
- "asmallhiragana", "u3041",
- "asmallkatakana", "u30A1",
- "asmallkatakanahalfwidth", "uFF67",
- "asterisk", "u002A",
- "asteriskaltonearabic", "u066D",
- "asteriskarabic", "u066D",
- "asteriskmath", "u2217",
- "asteriskmonospace", "uFF0A",
- "asterisksmall", "uFE61",
- "asterism", "u2042",
- "asymptoticallyequal", "u2243",
- "at", "u0040",
- "atilde", "u00E3",
- "atmonospace", "uFF20",
- "atsmall", "uFE6B",
- "aturned", "u0250",
- "aubengali", "u0994",
- "aubopomofo", "u3120",
- "audeva", "u0914",
- "augujarati", "u0A94",
- "augurmukhi", "u0A14",
- "aulengthmarkbengali", "u09D7",
- "aumatragurmukhi", "u0A4C",
- "auvowelsignbengali", "u09CC",
- "auvowelsigndeva", "u094C",
- "auvowelsigngujarati", "u0ACC",
- "avagrahadeva", "u093D",
- "aybarmenian", "u0561",
- "ayin", "u05E2",
- "ayinaltonehebrew", "uFB20",
- "ayinhebrew", "u05E2",
- "b", "u0062",
- "babengali", "u09AC",
- "backslash", "u005C",
- "backslashmonospace", "uFF3C",
- "badeva", "u092C",
- "bagujarati", "u0AAC",
- "bagurmukhi", "u0A2C",
- "bahiragana", "u3070",
- "bahtthai", "u0E3F",
- "bakatakana", "u30D0",
- "bar", "u007C",
- "barmonospace", "uFF5C",
- "bbopomofo", "u3105",
- "bcircle", "u24D1",
- "bdotaccent", "u1E03",
- "bdotbelow", "u1E05",
- "beamedsixteenthnotes", "u266C",
- "because", "u2235",
- "becyrillic", "u0431",
- "beharabic", "u0628",
- "behfinalarabic", "uFE90",
- "behinitialarabic", "uFE91",
- "behiragana", "u3079",
- "behmedialarabic", "uFE92",
- "behmeeminitialarabic", "uFC9F",
- "behmeemisolatedarabic", "uFC08",
- "behnoonfinalarabic", "uFC6D",
- "bekatakana", "u30D9",
- "benarmenian", "u0562",
- "bet", "u05D1",
- "beta", "u03B2",
- "betasymbolgreek", "u03D0",
- "betdagesh", "uFB31",
- "betdageshhebrew", "uFB31",
- "bethebrew", "u05D1",
- "betrafehebrew", "uFB4C",
- "bhabengali", "u09AD",
- "bhadeva", "u092D",
- "bhagujarati", "u0AAD",
- "bhagurmukhi", "u0A2D",
- "bhook", "u0253",
- "bihiragana", "u3073",
- "bikatakana", "u30D3",
- "bilabialclick", "u0298",
- "bindigurmukhi", "u0A02",
- "birusquare", "u3331",
- "blackcircle", "u25CF",
- "blackdiamond", "u25C6",
- "blackdownpointingtriangle", "u25BC",
- "blackleftpointingpointer", "u25C4",
- "blackleftpointingtriangle", "u25C0",
- "blacklenticularbracketleft", "u3010",
- "blacklenticularbracketleftvertical", "uFE3B",
- "blacklenticularbracketright", "u3011",
- "blacklenticularbracketrightvertical", "uFE3C",
- "blacklowerlefttriangle", "u25E3",
- "blacklowerrighttriangle", "u25E2",
- "blackrectangle", "u25AC",
- "blackrightpointingpointer", "u25BA",
- "blackrightpointingtriangle", "u25B6",
- "blacksmallsquare", "u25AA",
- "blacksmilingface", "u263B",
- "blacksquare", "u25A0",
- "blackstar", "u2605",
- "blackupperlefttriangle", "u25E4",
- "blackupperrighttriangle", "u25E5",
- "blackuppointingsmalltriangle", "u25B4",
- "blackuppointingtriangle", "u25B2",
- "blank", "u2423",
- "blinebelow", "u1E07",
- "block", "u2588",
- "bmonospace", "uFF42",
- "bobaimaithai", "u0E1A",
- "bohiragana", "u307C",
- "bokatakana", "u30DC",
- "bparen", "u249D",
- "bqsquare", "u33C3",
- "braceleft", "u007B",
- "braceleftmonospace", "uFF5B",
- "braceleftsmall", "uFE5B",
- "braceleftvertical", "uFE37",
- "braceright", "u007D",
- "bracerightmonospace", "uFF5D",
- "bracerightsmall", "uFE5C",
- "bracerightvertical", "uFE38",
- "bracketleft", "u005B",
- "bracketleftmonospace", "uFF3B",
- "bracketright", "u005D",
- "bracketrightmonospace", "uFF3D",
- "breve", "u02D8",
- "brevebelowcmb", "u032E",
- "brevecmb", "u0306",
- "breveinvertedbelowcmb", "u032F",
- "breveinvertedcmb", "u0311",
- "breveinverteddoublecmb", "u0361",
- "bridgebelowcmb", "u032A",
- "bridgeinvertedbelowcmb", "u033A",
- "brokenbar", "u00A6",
- "bstroke", "u0180",
- "btopbar", "u0183",
- "buhiragana", "u3076",
- "bukatakana", "u30D6",
- "bullet", "u2022",
- "bulletinverse", "u25D8",
- "bulletoperator", "u2219",
- "bullseye", "u25CE",
- "c", "u0063",
- "caarmenian", "u056E",
- "cabengali", "u099A",
- "cacute", "u0107",
- "cadeva", "u091A",
- "cagujarati", "u0A9A",
- "cagurmukhi", "u0A1A",
- "calsquare", "u3388",
- "candrabindubengali", "u0981",
- "candrabinducmb", "u0310",
- "candrabindudeva", "u0901",
- "candrabindugujarati", "u0A81",
- "capslock", "u21EA",
- "careof", "u2105",
- "caron", "u02C7",
- "caronbelowcmb", "u032C",
- "caroncmb", "u030C",
- "carriagereturn", "u21B5",
- "cbopomofo", "u3118",
- "ccaron", "u010D",
- "ccedilla", "u00E7",
- "ccedillaacute", "u1E09",
- "ccircle", "u24D2",
- "ccircumflex", "u0109",
- "ccurl", "u0255",
- "cdot", "u010B",
- "cdotaccent", "u010B",
- "cdsquare", "u33C5",
- "cedilla", "u00B8",
- "cedillacmb", "u0327",
- "cent", "u00A2",
- "centigrade", "u2103",
- "centmonospace", "uFFE0",
- "chaarmenian", "u0579",
- "chabengali", "u099B",
- "chadeva", "u091B",
- "chagujarati", "u0A9B",
- "chagurmukhi", "u0A1B",
- "chbopomofo", "u3114",
- "cheabkhasiancyrillic", "u04BD",
- "checkmark", "u2713",
- "checyrillic", "u0447",
- "chedescenderabkhasiancyrillic", "u04BF",
- "chedescendercyrillic", "u04B7",
- "chedieresiscyrillic", "u04F5",
- "cheharmenian", "u0573",
- "chekhakassiancyrillic", "u04CC",
- "cheverticalstrokecyrillic", "u04B9",
- "chi", "u03C7",
- "chieuchacirclekorean", "u3277",
- "chieuchaparenkorean", "u3217",
- "chieuchcirclekorean", "u3269",
- "chieuchkorean", "u314A",
- "chieuchparenkorean", "u3209",
- "chochangthai", "u0E0A",
- "chochanthai", "u0E08",
- "chochingthai", "u0E09",
- "chochoethai", "u0E0C",
- "chook", "u0188",
- "cieucacirclekorean", "u3276",
- "cieucaparenkorean", "u3216",
- "cieuccirclekorean", "u3268",
- "cieuckorean", "u3148",
- "cieucparenkorean", "u3208",
- "cieucuparenkorean", "u321C",
- "circle", "u25CB",
- "circlemultiply", "u2297",
- "circleot", "u2299",
- "circleplus", "u2295",
- "circlepostalmark", "u3036",
- "circlewithlefthalfblack", "u25D0",
- "circlewithrighthalfblack", "u25D1",
- "circumflex", "u02C6",
- "circumflexbelowcmb", "u032D",
- "circumflexcmb", "u0302",
- "clear", "u2327",
- "clickalveolar", "u01C2",
- "clickdental", "u01C0",
- "clicklateral", "u01C1",
- "clickretroflex", "u01C3",
- "club", "u2663",
- "clubsuitblack", "u2663",
- "clubsuitwhite", "u2667",
- "cmcubedsquare", "u33A4",
- "cmonospace", "uFF43",
- "cmsquaredsquare", "u33A0",
- "coarmenian", "u0581",
- "colon", "u003A",
- "colonmonetary", "u20A1",
- "colonmonospace", "uFF1A",
- "colonsign", "u20A1",
- "colonsmall", "uFE55",
- "colontriangularhalfmod", "u02D1",
- "colontriangularmod", "u02D0",
- "comma", "u002C",
- "commaabovecmb", "u0313",
- "commaaboverightcmb", "u0315",
- "commaarabic", "u060C",
- "commaarmenian", "u055D",
- "commamonospace", "uFF0C",
- "commareversedabovecmb", "u0314",
- "commareversedmod", "u02BD",
- "commasmall", "uFE50",
- "commaturnedabovecmb", "u0312",
- "commaturnedmod", "u02BB",
- "compass", "u263C",
- "congruent", "u2245",
- "contourintegral", "u222E",
- "control", "u2303",
- "controlACK", "u0006",
- "controlBEL", "u0007",
- "controlBS", "u0008",
- "controlCAN", "u0018",
- "controlCR", "u000D",
- "controlDC1", "u0011",
- "controlDC2", "u0012",
- "controlDC3", "u0013",
- "controlDC4", "u0014",
- "controlDEL", "u007F",
- "controlDLE", "u0010",
- "controlEM", "u0019",
- "controlENQ", "u0005",
- "controlEOT", "u0004",
- "controlESC", "u001B",
- "controlETB", "u0017",
- "controlETX", "u0003",
- "controlFF", "u000C",
- "controlFS", "u001C",
- "controlGS", "u001D",
- "controlHT", "u0009",
- "controlLF", "u000A",
- "controlNAK", "u0015",
- "controlRS", "u001E",
- "controlSI", "u000F",
- "controlSO", "u000E",
- "controlSOT", "u0002",
- "controlSTX", "u0001",
- "controlSUB", "u001A",
- "controlSYN", "u0016",
- "controlUS", "u001F",
- "controlVT", "u000B",
- "copyright", "u00A9",
- "cornerbracketleft", "u300C",
- "cornerbracketlefthalfwidth", "uFF62",
- "cornerbracketleftvertical", "uFE41",
- "cornerbracketright", "u300D",
- "cornerbracketrighthalfwidth", "uFF63",
- "cornerbracketrightvertical", "uFE42",
- "corporationsquare", "u337F",
- "cosquare", "u33C7",
- "coverkgsquare", "u33C6",
- "cparen", "u249E",
- "cruzeiro", "u20A2",
- "cstretched", "u0297",
- "curlyand", "u22CF",
- "curlyor", "u22CE",
- "currency", "u00A4",
- "d", "u0064",
- "daarmenian", "u0564",
- "dabengali", "u09A6",
- "dadarabic", "u0636",
- "dadeva", "u0926",
- "dadfinalarabic", "uFEBE",
- "dadinitialarabic", "uFEBF",
- "dadmedialarabic", "uFEC0",
- "dagesh", "u05BC",
- "dageshhebrew", "u05BC",
- "dagger", "u2020",
- "daggerdbl", "u2021",
- "dagujarati", "u0AA6",
- "dagurmukhi", "u0A26",
- "dahiragana", "u3060",
- "dakatakana", "u30C0",
- "dalarabic", "u062F",
- "dalet", "u05D3",
- "daletdagesh", "uFB33",
- "daletdageshhebrew", "uFB33",
- "dalethatafpatah", "u05D3_05B2",
- "dalethatafpatahhebrew", "u05D3_05B2",
- "dalethatafsegol", "u05D3_05B1",
- "dalethatafsegolhebrew", "u05D3_05B1",
- "dalethebrew", "u05D3",
- "dalethiriq", "u05D3_05B4",
- "dalethiriqhebrew", "u05D3_05B4",
- "daletholam", "u05D3_05B9",
- "daletholamhebrew", "u05D3_05B9",
- "daletpatah", "u05D3_05B7",
- "daletpatahhebrew", "u05D3_05B7",
- "daletqamats", "u05D3_05B8",
- "daletqamatshebrew", "u05D3_05B8",
- "daletqubuts", "u05D3_05BB",
- "daletqubutshebrew", "u05D3_05BB",
- "daletsegol", "u05D3_05B6",
- "daletsegolhebrew", "u05D3_05B6",
- "daletsheva", "u05D3_05B0",
- "daletshevahebrew", "u05D3_05B0",
- "dalettsere", "u05D3_05B5",
- "dalettserehebrew", "u05D3_05B5",
- "dalfinalarabic", "uFEAA",
- "dammaarabic", "u064F",
- "dammalowarabic", "u064F",
- "dammatanaltonearabic", "u064C",
- "dammatanarabic", "u064C",
- "danda", "u0964",
- "dargahebrew", "u05A7",
- "dargalefthebrew", "u05A7",
- "dasiapneumatacyrilliccmb", "u0485",
- "dblanglebracketleft", "u300A",
- "dblanglebracketleftvertical", "uFE3D",
- "dblanglebracketright", "u300B",
- "dblanglebracketrightvertical", "uFE3E",
- "dblarchinvertedbelowcmb", "u032B",
- "dblarrowleft", "u21D4",
- "dblarrowright", "u21D2",
- "dbldanda", "u0965",
- "dblgravecmb", "u030F",
- "dblintegral", "u222C",
- "dbllowline", "u2017",
- "dbllowlinecmb", "u0333",
- "dbloverlinecmb", "u033F",
- "dblprimemod", "u02BA",
- "dblverticalbar", "u2016",
- "dblverticallineabovecmb", "u030E",
- "dbopomofo", "u3109",
- "dbsquare", "u33C8",
- "dcaron", "u010F",
- "dcedilla", "u1E11",
- "dcircle", "u24D3",
- "dcircumflexbelow", "u1E13",
- "dcroat", "u0111",
- "ddabengali", "u09A1",
- "ddadeva", "u0921",
- "ddagujarati", "u0AA1",
- "ddagurmukhi", "u0A21",
- "ddalarabic", "u0688",
- "ddalfinalarabic", "uFB89",
- "dddhadeva", "u095C",
- "ddhabengali", "u09A2",
- "ddhadeva", "u0922",
- "ddhagujarati", "u0AA2",
- "ddhagurmukhi", "u0A22",
- "ddotaccent", "u1E0B",
- "ddotbelow", "u1E0D",
- "decimalseparatorarabic", "u066B",
- "decimalseparatorpersian", "u066B",
- "decyrillic", "u0434",
- "degree", "u00B0",
- "dehihebrew", "u05AD",
- "dehiragana", "u3067",
- "deicoptic", "u03EF",
- "dekatakana", "u30C7",
- "deleteleft", "u232B",
- "deleteright", "u2326",
- "delta", "u03B4",
- "deltaturned", "u018D",
- "denominatorminusonenumeratorbengali", "u09F8",
- "dezh", "u02A4",
- "dhabengali", "u09A7",
- "dhadeva", "u0927",
- "dhagujarati", "u0AA7",
- "dhagurmukhi", "u0A27",
- "dhook", "u0257",
- "dialytikatonos", "u0385",
- "dialytikatonoscmb", "u0344",
- "diamond", "u2666",
- "diamondsuitwhite", "u2662",
- "dieresis", "u00A8",
- "dieresisbelowcmb", "u0324",
- "dieresiscmb", "u0308",
- "dieresistonos", "u0385",
- "dihiragana", "u3062",
- "dikatakana", "u30C2",
- "dittomark", "u3003",
- "divide", "u00F7",
- "divides", "u2223",
- "divisionslash", "u2215",
- "djecyrillic", "u0452",
- "dkshade", "u2593",
- "dlinebelow", "u1E0F",
- "dlsquare", "u3397",
- "dmacron", "u0111",
- "dmonospace", "uFF44",
- "dnblock", "u2584",
- "dochadathai", "u0E0E",
- "dodekthai", "u0E14",
- "dohiragana", "u3069",
- "dokatakana", "u30C9",
- "dollar", "u0024",
- "dollarmonospace", "uFF04",
- "dollarsmall", "uFE69",
- "dong", "u20AB",
- "dorusquare", "u3326",
- "dotaccent", "u02D9",
- "dotaccentcmb", "u0307",
- "dotbelowcmb", "u0323",
- "dotbelowcomb", "u0323",
- "dotkatakana", "u30FB",
- "dotlessi", "u0131",
- "dotlessjstrokehook", "u0284",
- "dotmath", "u22C5",
- "dottedcircle", "u25CC",
- "doubleyodpatah", "uFB1F",
- "doubleyodpatahhebrew", "uFB1F",
- "downtackbelowcmb", "u031E",
- "downtackmod", "u02D5",
- "dparen", "u249F",
- "dtail", "u0256",
- "dtopbar", "u018C",
- "duhiragana", "u3065",
- "dukatakana", "u30C5",
- "dz", "u01F3",
- "dzaltone", "u02A3",
- "dzcaron", "u01C6",
- "dzcurl", "u02A5",
- "dzeabkhasiancyrillic", "u04E1",
- "dzecyrillic", "u0455",
- "dzhecyrillic", "u045F",
- "e", "u0065",
- "eacute", "u00E9",
- "earth", "u2641",
- "ebengali", "u098F",
- "ebopomofo", "u311C",
- "ebreve", "u0115",
- "ecandradeva", "u090D",
- "ecandragujarati", "u0A8D",
- "ecandravowelsigndeva", "u0945",
- "ecandravowelsigngujarati", "u0AC5",
- "ecaron", "u011B",
- "ecedillabreve", "u1E1D",
- "echarmenian", "u0565",
- "echyiwnarmenian", "u0587",
- "ecircle", "u24D4",
- "ecircumflex", "u00EA",
- "ecircumflexacute", "u1EBF",
- "ecircumflexbelow", "u1E19",
- "ecircumflexdotbelow", "u1EC7",
- "ecircumflexgrave", "u1EC1",
- "ecircumflexhookabove", "u1EC3",
- "ecircumflextilde", "u1EC5",
- "ecyrillic", "u0454",
- "edblgrave", "u0205",
- "edeva", "u090F",
- "edieresis", "u00EB",
- "edot", "u0117",
- "edotaccent", "u0117",
- "edotbelow", "u1EB9",
- "eegurmukhi", "u0A0F",
- "eematragurmukhi", "u0A47",
- "efcyrillic", "u0444",
- "egrave", "u00E8",
- "egujarati", "u0A8F",
- "eharmenian", "u0567",
- "ehbopomofo", "u311D",
- "ehiragana", "u3048",
- "ehookabove", "u1EBB",
- "eibopomofo", "u311F",
- "eight", "u0038",
- "eightarabic", "u0668",
- "eightbengali", "u09EE",
- "eightcircle", "u2467",
- "eightcircleinversesansserif", "u2791",
- "eightdeva", "u096E",
- "eighteencircle", "u2471",
- "eighteenparen", "u2485",
- "eighteenperiod", "u2499",
- "eightgujarati", "u0AEE",
- "eightgurmukhi", "u0A6E",
- "eighthackarabic", "u0668",
- "eighthangzhou", "u3028",
- "eighthnotebeamed", "u266B",
- "eightideographicparen", "u3227",
- "eightinferior", "u2088",
- "eightmonospace", "uFF18",
- "eightparen", "u247B",
- "eightperiod", "u248F",
- "eightpersian", "u06F8",
- "eightroman", "u2177",
- "eightsuperior", "u2078",
- "eightthai", "u0E58",
- "einvertedbreve", "u0207",
- "eiotifiedcyrillic", "u0465",
- "ekatakana", "u30A8",
- "ekatakanahalfwidth", "uFF74",
- "ekonkargurmukhi", "u0A74",
- "ekorean", "u3154",
- "elcyrillic", "u043B",
- "element", "u2208",
- "elevencircle", "u246A",
- "elevenparen", "u247E",
- "elevenperiod", "u2492",
- "elevenroman", "u217A",
- "ellipsis", "u2026",
- "ellipsisvertical", "u22EE",
- "emacron", "u0113",
- "emacronacute", "u1E17",
- "emacrongrave", "u1E15",
- "emcyrillic", "u043C",
- "emdash", "u2014",
- "emdashvertical", "uFE31",
- "emonospace", "uFF45",
- "emphasismarkarmenian", "u055B",
- "emptyset", "u2205",
- "enbopomofo", "u3123",
- "encyrillic", "u043D",
- "endash", "u2013",
- "endashvertical", "uFE32",
- "endescendercyrillic", "u04A3",
- "eng", "u014B",
- "engbopomofo", "u3125",
- "enghecyrillic", "u04A5",
- "enhookcyrillic", "u04C8",
- "enspace", "u2002",
- "eogonek", "u0119",
- "eokorean", "u3153",
- "eopen", "u025B",
- "eopenclosed", "u029A",
- "eopenreversed", "u025C",
- "eopenreversedclosed", "u025E",
- "eopenreversedhook", "u025D",
- "eparen", "u24A0",
- "epsilon", "u03B5",
- "epsilontonos", "u03AD",
- "equal", "u003D",
- "equalmonospace", "uFF1D",
- "equalsmall", "uFE66",
- "equalsuperior", "u207C",
- "equivalence", "u2261",
- "erbopomofo", "u3126",
- "ercyrillic", "u0440",
- "ereversed", "u0258",
- "ereversedcyrillic", "u044D",
- "escyrillic", "u0441",
- "esdescendercyrillic", "u04AB",
- "esh", "u0283",
- "eshcurl", "u0286",
- "eshortdeva", "u090E",
- "eshortvowelsigndeva", "u0946",
- "eshreversedloop", "u01AA",
- "eshsquatreversed", "u0285",
- "esmallhiragana", "u3047",
- "esmallkatakana", "u30A7",
- "esmallkatakanahalfwidth", "uFF6A",
- "estimated", "u212E",
- "eta", "u03B7",
- "etarmenian", "u0568",
- "etatonos", "u03AE",
- "eth", "u00F0",
- "etilde", "u1EBD",
- "etildebelow", "u1E1B",
- "etnahtafoukhhebrew", "u0591",
- "etnahtafoukhlefthebrew", "u0591",
- "etnahtahebrew", "u0591",
- "etnahtalefthebrew", "u0591",
- "eturned", "u01DD",
- "eukorean", "u3161",
- "euro", "u20AC",
- "evowelsignbengali", "u09C7",
- "evowelsigndeva", "u0947",
- "evowelsigngujarati", "u0AC7",
- "exclam", "u0021",
- "exclamarmenian", "u055C",
- "exclamdbl", "u203C",
- "exclamdown", "u00A1",
- "exclammonospace", "uFF01",
- "existential", "u2203",
- "ezh", "u0292",
- "ezhcaron", "u01EF",
- "ezhcurl", "u0293",
- "ezhreversed", "u01B9",
- "ezhtail", "u01BA",
- "f", "u0066",
- "fadeva", "u095E",
- "fagurmukhi", "u0A5E",
- "fahrenheit", "u2109",
- "fathaarabic", "u064E",
- "fathalowarabic", "u064E",
- "fathatanarabic", "u064B",
- "fbopomofo", "u3108",
- "fcircle", "u24D5",
- "fdotaccent", "u1E1F",
- "feharabic", "u0641",
- "feharmenian", "u0586",
- "fehfinalarabic", "uFED2",
- "fehinitialarabic", "uFED3",
- "fehmedialarabic", "uFED4",
- "feicoptic", "u03E5",
- "female", "u2640",
- "ff", "uFB00",
- "ffi", "uFB03",
- "ffl", "uFB04",
- "fi", "uFB01",
- "fifteencircle", "u246E",
- "fifteenparen", "u2482",
- "fifteenperiod", "u2496",
- "figuredash", "u2012",
- "filledbox", "u25A0",
- "filledrect", "u25AC",
- "finalkaf", "u05DA",
- "finalkafdagesh", "uFB3A",
- "finalkafdageshhebrew", "uFB3A",
- "finalkafhebrew", "u05DA",
- "finalkafqamats", "u05DA_05B8",
- "finalkafqamatshebrew", "u05DA_05B8",
- "finalkafsheva", "u05DA_05B0",
- "finalkafshevahebrew", "u05DA_05B0",
- "finalmem", "u05DD",
- "finalmemhebrew", "u05DD",
- "finalnun", "u05DF",
- "finalnunhebrew", "u05DF",
- "finalpe", "u05E3",
- "finalpehebrew", "u05E3",
- "finaltsadi", "u05E5",
- "finaltsadihebrew", "u05E5",
- "firsttonechinese", "u02C9",
- "fisheye", "u25C9",
- "fitacyrillic", "u0473",
- "five", "u0035",
- "fivearabic", "u0665",
- "fivebengali", "u09EB",
- "fivecircle", "u2464",
- "fivecircleinversesansserif", "u278E",
- "fivedeva", "u096B",
- "fiveeighths", "u215D",
- "fivegujarati", "u0AEB",
- "fivegurmukhi", "u0A6B",
- "fivehackarabic", "u0665",
- "fivehangzhou", "u3025",
- "fiveideographicparen", "u3224",
- "fiveinferior", "u2085",
- "fivemonospace", "uFF15",
- "fiveparen", "u2478",
- "fiveperiod", "u248C",
- "fivepersian", "u06F5",
- "fiveroman", "u2174",
- "fivesuperior", "u2075",
- "fivethai", "u0E55",
- "fl", "uFB02",
- "florin", "u0192",
- "fmonospace", "uFF46",
- "fmsquare", "u3399",
- "fofanthai", "u0E1F",
- "fofathai", "u0E1D",
- "fongmanthai", "u0E4F",
- "forall", "u2200",
- "four", "u0034",
- "fourarabic", "u0664",
- "fourbengali", "u09EA",
- "fourcircle", "u2463",
- "fourcircleinversesansserif", "u278D",
- "fourdeva", "u096A",
- "fourgujarati", "u0AEA",
- "fourgurmukhi", "u0A6A",
- "fourhackarabic", "u0664",
- "fourhangzhou", "u3024",
- "fourideographicparen", "u3223",
- "fourinferior", "u2084",
- "fourmonospace", "uFF14",
- "fournumeratorbengali", "u09F7",
- "fourparen", "u2477",
- "fourperiod", "u248B",
- "fourpersian", "u06F4",
- "fourroman", "u2173",
- "foursuperior", "u2074",
- "fourteencircle", "u246D",
- "fourteenparen", "u2481",
- "fourteenperiod", "u2495",
- "fourthai", "u0E54",
- "fourthtonechinese", "u02CB",
- "fparen", "u24A1",
- "fraction", "u2044",
- "franc", "u20A3",
- "g", "u0067",
- "gabengali", "u0997",
- "gacute", "u01F5",
- "gadeva", "u0917",
- "gafarabic", "u06AF",
- "gaffinalarabic", "uFB93",
- "gafinitialarabic", "uFB94",
- "gafmedialarabic", "uFB95",
- "gagujarati", "u0A97",
- "gagurmukhi", "u0A17",
- "gahiragana", "u304C",
- "gakatakana", "u30AC",
- "gamma", "u03B3",
- "gammalatinsmall", "u0263",
- "gammasuperior", "u02E0",
- "gangiacoptic", "u03EB",
- "gbopomofo", "u310D",
- "gbreve", "u011F",
- "gcaron", "u01E7",
- "gcedilla", "u0123",
- "gcircle", "u24D6",
- "gcircumflex", "u011D",
- "gcommaaccent", "u0123",
- "gdot", "u0121",
- "gdotaccent", "u0121",
- "gecyrillic", "u0433",
- "gehiragana", "u3052",
- "gekatakana", "u30B2",
- "geometricallyequal", "u2251",
- "gereshaccenthebrew", "u059C",
- "gereshhebrew", "u05F3",
- "gereshmuqdamhebrew", "u059D",
- "germandbls", "u00DF",
- "gershayimaccenthebrew", "u059E",
- "gershayimhebrew", "u05F4",
- "getamark", "u3013",
- "ghabengali", "u0998",
- "ghadarmenian", "u0572",
- "ghadeva", "u0918",
- "ghagujarati", "u0A98",
- "ghagurmukhi", "u0A18",
- "ghainarabic", "u063A",
- "ghainfinalarabic", "uFECE",
- "ghaininitialarabic", "uFECF",
- "ghainmedialarabic", "uFED0",
- "ghemiddlehookcyrillic", "u0495",
- "ghestrokecyrillic", "u0493",
- "gheupturncyrillic", "u0491",
- "ghhadeva", "u095A",
- "ghhagurmukhi", "u0A5A",
- "ghook", "u0260",
- "ghzsquare", "u3393",
- "gihiragana", "u304E",
- "gikatakana", "u30AE",
- "gimarmenian", "u0563",
- "gimel", "u05D2",
- "gimeldagesh", "uFB32",
- "gimeldageshhebrew", "uFB32",
- "gimelhebrew", "u05D2",
- "gjecyrillic", "u0453",
- "glottalinvertedstroke", "u01BE",
- "glottalstop", "u0294",
- "glottalstopinverted", "u0296",
- "glottalstopmod", "u02C0",
- "glottalstopreversed", "u0295",
- "glottalstopreversedmod", "u02C1",
- "glottalstopreversedsuperior", "u02E4",
- "glottalstopstroke", "u02A1",
- "glottalstopstrokereversed", "u02A2",
- "gmacron", "u1E21",
- "gmonospace", "uFF47",
- "gohiragana", "u3054",
- "gokatakana", "u30B4",
- "gparen", "u24A2",
- "gpasquare", "u33AC",
- "gradient", "u2207",
- "grave", "u0060",
- "gravebelowcmb", "u0316",
- "gravecmb", "u0300",
- "gravecomb", "u0300",
- "gravedeva", "u0953",
- "gravelowmod", "u02CE",
- "gravemonospace", "uFF40",
- "gravetonecmb", "u0340",
- "greater", "u003E",
- "greaterequal", "u2265",
- "greaterequalorless", "u22DB",
- "greatermonospace", "uFF1E",
- "greaterorequivalent", "u2273",
- "greaterorless", "u2277",
- "greateroverequal", "u2267",
- "greatersmall", "uFE65",
- "gscript", "u0261",
- "gstroke", "u01E5",
- "guhiragana", "u3050",
- "guillemotleft", "u00AB",
- "guillemotright", "u00BB",
- "guilsinglleft", "u2039",
- "guilsinglright", "u203A",
- "gukatakana", "u30B0",
- "guramusquare", "u3318",
- "gysquare", "u33C9",
- "h", "u0068",
- "haabkhasiancyrillic", "u04A9",
- "haaltonearabic", "u06C1",
- "habengali", "u09B9",
- "hadescendercyrillic", "u04B3",
- "hadeva", "u0939",
- "hagujarati", "u0AB9",
- "hagurmukhi", "u0A39",
- "haharabic", "u062D",
- "hahfinalarabic", "uFEA2",
- "hahinitialarabic", "uFEA3",
- "hahiragana", "u306F",
- "hahmedialarabic", "uFEA4",
- "haitusquare", "u332A",
- "hakatakana", "u30CF",
- "hakatakanahalfwidth", "uFF8A",
- "halantgurmukhi", "u0A4D",
- "hamzaarabic", "u0621",
- "hamzadammaarabic", "u0621_064F",
- "hamzadammatanarabic", "u0621_064C",
- "hamzafathaarabic", "u0621_064E",
- "hamzafathatanarabic", "u0621_064B",
- "hamzalowarabic", "u0621",
- "hamzalowkasraarabic", "u0621_0650",
- "hamzalowkasratanarabic", "u0621_064D",
- "hamzasukunarabic", "u0621_0652",
- "hangulfiller", "u3164",
- "hardsigncyrillic", "u044A",
- "harpoonleftbarbup", "u21BC",
- "harpoonrightbarbup", "u21C0",
- "hasquare", "u33CA",
- "hatafpatah", "u05B2",
- "hatafpatah16", "u05B2",
- "hatafpatah23", "u05B2",
- "hatafpatah2f", "u05B2",
- "hatafpatahhebrew", "u05B2",
- "hatafpatahnarrowhebrew", "u05B2",
- "hatafpatahquarterhebrew", "u05B2",
- "hatafpatahwidehebrew", "u05B2",
- "hatafqamats", "u05B3",
- "hatafqamats1b", "u05B3",
- "hatafqamats28", "u05B3",
- "hatafqamats34", "u05B3",
- "hatafqamatshebrew", "u05B3",
- "hatafqamatsnarrowhebrew", "u05B3",
- "hatafqamatsquarterhebrew", "u05B3",
- "hatafqamatswidehebrew", "u05B3",
- "hatafsegol", "u05B1",
- "hatafsegol17", "u05B1",
- "hatafsegol24", "u05B1",
- "hatafsegol30", "u05B1",
- "hatafsegolhebrew", "u05B1",
- "hatafsegolnarrowhebrew", "u05B1",
- "hatafsegolquarterhebrew", "u05B1",
- "hatafsegolwidehebrew", "u05B1",
- "hbar", "u0127",
- "hbopomofo", "u310F",
- "hbrevebelow", "u1E2B",
- "hcedilla", "u1E29",
- "hcircle", "u24D7",
- "hcircumflex", "u0125",
- "hdieresis", "u1E27",
- "hdotaccent", "u1E23",
- "hdotbelow", "u1E25",
- "he", "u05D4",
- "heart", "u2665",
- "heartsuitblack", "u2665",
- "heartsuitwhite", "u2661",
- "hedagesh", "uFB34",
- "hedageshhebrew", "uFB34",
- "hehaltonearabic", "u06C1",
- "heharabic", "u0647",
- "hehebrew", "u05D4",
- "hehfinalaltonearabic", "uFBA7",
- "hehfinalalttwoarabic", "uFEEA",
- "hehfinalarabic", "uFEEA",
- "hehhamzaabovefinalarabic", "uFBA5",
- "hehhamzaaboveisolatedarabic", "uFBA4",
- "hehinitialaltonearabic", "uFBA8",
- "hehinitialarabic", "uFEEB",
- "hehiragana", "u3078",
- "hehmedialaltonearabic", "uFBA9",
- "hehmedialarabic", "uFEEC",
- "heiseierasquare", "u337B",
- "hekatakana", "u30D8",
- "hekatakanahalfwidth", "uFF8D",
- "hekutaarusquare", "u3336",
- "henghook", "u0267",
- "herutusquare", "u3339",
- "het", "u05D7",
- "hethebrew", "u05D7",
- "hhook", "u0266",
- "hhooksuperior", "u02B1",
- "hieuhacirclekorean", "u327B",
- "hieuhaparenkorean", "u321B",
- "hieuhcirclekorean", "u326D",
- "hieuhkorean", "u314E",
- "hieuhparenkorean", "u320D",
- "hihiragana", "u3072",
- "hikatakana", "u30D2",
- "hikatakanahalfwidth", "uFF8B",
- "hiriq", "u05B4",
- "hiriq14", "u05B4",
- "hiriq21", "u05B4",
- "hiriq2d", "u05B4",
- "hiriqhebrew", "u05B4",
- "hiriqnarrowhebrew", "u05B4",
- "hiriqquarterhebrew", "u05B4",
- "hiriqwidehebrew", "u05B4",
- "hlinebelow", "u1E96",
- "hmonospace", "uFF48",
- "hoarmenian", "u0570",
- "hohipthai", "u0E2B",
- "hohiragana", "u307B",
- "hokatakana", "u30DB",
- "hokatakanahalfwidth", "uFF8E",
- "holam", "u05B9",
- "holam19", "u05B9",
- "holam26", "u05B9",
- "holam32", "u05B9",
- "holamhebrew", "u05B9",
- "holamnarrowhebrew", "u05B9",
- "holamquarterhebrew", "u05B9",
- "holamwidehebrew", "u05B9",
- "honokhukthai", "u0E2E",
- "hookabovecomb", "u0309",
- "hookcmb", "u0309",
- "hookpalatalizedbelowcmb", "u0321",
- "hookretroflexbelowcmb", "u0322",
- "hoonsquare", "u3342",
- "horicoptic", "u03E9",
- "horizontalbar", "u2015",
- "horncmb", "u031B",
- "hotsprings", "u2668",
- "house", "u2302",
- "hparen", "u24A3",
- "hsuperior", "u02B0",
- "hturned", "u0265",
- "huhiragana", "u3075",
- "huiitosquare", "u3333",
- "hukatakana", "u30D5",
- "hukatakanahalfwidth", "uFF8C",
- "hungarumlaut", "u02DD",
- "hungarumlautcmb", "u030B",
- "hv", "u0195",
- "hyphen", "u002D",
- "hyphenmonospace", "uFF0D",
- "hyphensmall", "uFE63",
- "hyphentwo", "u2010",
- "i", "u0069",
- "iacute", "u00ED",
- "iacyrillic", "u044F",
- "ibengali", "u0987",
- "ibopomofo", "u3127",
- "ibreve", "u012D",
- "icaron", "u01D0",
- "icircle", "u24D8",
- "icircumflex", "u00EE",
- "icyrillic", "u0456",
- "idblgrave", "u0209",
- "ideographearthcircle", "u328F",
- "ideographfirecircle", "u328B",
- "ideographicallianceparen", "u323F",
- "ideographiccallparen", "u323A",
- "ideographiccentrecircle", "u32A5",
- "ideographicclose", "u3006",
- "ideographiccomma", "u3001",
- "ideographiccommaleft", "uFF64",
- "ideographiccongratulationparen", "u3237",
- "ideographiccorrectcircle", "u32A3",
- "ideographicearthparen", "u322F",
- "ideographicenterpriseparen", "u323D",
- "ideographicexcellentcircle", "u329D",
- "ideographicfestivalparen", "u3240",
- "ideographicfinancialcircle", "u3296",
- "ideographicfinancialparen", "u3236",
- "ideographicfireparen", "u322B",
- "ideographichaveparen", "u3232",
- "ideographichighcircle", "u32A4",
- "ideographiciterationmark", "u3005",
- "ideographiclaborcircle", "u3298",
- "ideographiclaborparen", "u3238",
- "ideographicleftcircle", "u32A7",
- "ideographiclowcircle", "u32A6",
- "ideographicmedicinecircle", "u32A9",
- "ideographicmetalparen", "u322E",
- "ideographicmoonparen", "u322A",
- "ideographicnameparen", "u3234",
- "ideographicperiod", "u3002",
- "ideographicprintcircle", "u329E",
- "ideographicreachparen", "u3243",
- "ideographicrepresentparen", "u3239",
- "ideographicresourceparen", "u323E",
- "ideographicrightcircle", "u32A8",
- "ideographicsecretcircle", "u3299",
- "ideographicselfparen", "u3242",
- "ideographicsocietyparen", "u3233",
- "ideographicspace", "u3000",
- "ideographicspecialparen", "u3235",
- "ideographicstockparen", "u3231",
- "ideographicstudyparen", "u323B",
- "ideographicsunparen", "u3230",
- "ideographicsuperviseparen", "u323C",
- "ideographicwaterparen", "u322C",
- "ideographicwoodparen", "u322D",
- "ideographiczero", "u3007",
- "ideographmetalcircle", "u328E",
- "ideographmooncircle", "u328A",
- "ideographnamecircle", "u3294",
- "ideographsuncircle", "u3290",
- "ideographwatercircle", "u328C",
- "ideographwoodcircle", "u328D",
- "ideva", "u0907",
- "idieresis", "u00EF",
- "idieresisacute", "u1E2F",
- "idieresiscyrillic", "u04E5",
- "idotbelow", "u1ECB",
- "iebrevecyrillic", "u04D7",
- "iecyrillic", "u0435",
- "ieungacirclekorean", "u3275",
- "ieungaparenkorean", "u3215",
- "ieungcirclekorean", "u3267",
- "ieungkorean", "u3147",
- "ieungparenkorean", "u3207",
- "igrave", "u00EC",
- "igujarati", "u0A87",
- "igurmukhi", "u0A07",
- "ihiragana", "u3044",
- "ihookabove", "u1EC9",
- "iibengali", "u0988",
- "iicyrillic", "u0438",
- "iideva", "u0908",
- "iigujarati", "u0A88",
- "iigurmukhi", "u0A08",
- "iimatragurmukhi", "u0A40",
- "iinvertedbreve", "u020B",
- "iishortcyrillic", "u0439",
- "iivowelsignbengali", "u09C0",
- "iivowelsigndeva", "u0940",
- "iivowelsigngujarati", "u0AC0",
- "ij", "u0133",
- "ikatakana", "u30A4",
- "ikatakanahalfwidth", "uFF72",
- "ikorean", "u3163",
- "ilde", "u02DC",
- "iluyhebrew", "u05AC",
- "imacron", "u012B",
- "imacroncyrillic", "u04E3",
- "imageorapproximatelyequal", "u2253",
- "imatragurmukhi", "u0A3F",
- "imonospace", "uFF49",
- "increment", "u2206",
- "infinity", "u221E",
- "iniarmenian", "u056B",
- "integral", "u222B",
- "integralbottom", "u2321",
- "integralbt", "u2321",
- "integraltop", "u2320",
- "integraltp", "u2320",
- "intersection", "u2229",
- "intisquare", "u3305",
- "invbullet", "u25D8",
- "invcircle", "u25D9",
- "invsmileface", "u263B",
- "iocyrillic", "u0451",
- "iogonek", "u012F",
- "iota", "u03B9",
- "iotadieresis", "u03CA",
- "iotadieresistonos", "u0390",
- "iotalatin", "u0269",
- "iotatonos", "u03AF",
- "iparen", "u24A4",
- "irigurmukhi", "u0A72",
- "ismallhiragana", "u3043",
- "ismallkatakana", "u30A3",
- "ismallkatakanahalfwidth", "uFF68",
- "issharbengali", "u09FA",
- "istroke", "u0268",
- "iterationhiragana", "u309D",
- "iterationkatakana", "u30FD",
- "itilde", "u0129",
- "itildebelow", "u1E2D",
- "iubopomofo", "u3129",
- "iucyrillic", "u044E",
- "ivowelsignbengali", "u09BF",
- "ivowelsigndeva", "u093F",
- "ivowelsigngujarati", "u0ABF",
- "izhitsacyrillic", "u0475",
- "izhitsadblgravecyrillic", "u0477",
- "j", "u006A",
- "jaarmenian", "u0571",
- "jabengali", "u099C",
- "jadeva", "u091C",
- "jagujarati", "u0A9C",
- "jagurmukhi", "u0A1C",
- "jbopomofo", "u3110",
- "jcaron", "u01F0",
- "jcircle", "u24D9",
- "jcircumflex", "u0135",
- "jcrossedtail", "u029D",
- "jdotlessstroke", "u025F",
- "jecyrillic", "u0458",
- "jeemarabic", "u062C",
- "jeemfinalarabic", "uFE9E",
- "jeeminitialarabic", "uFE9F",
- "jeemmedialarabic", "uFEA0",
- "jeharabic", "u0698",
- "jehfinalarabic", "uFB8B",
- "jhabengali", "u099D",
- "jhadeva", "u091D",
- "jhagujarati", "u0A9D",
- "jhagurmukhi", "u0A1D",
- "jheharmenian", "u057B",
- "jis", "u3004",
- "jmonospace", "uFF4A",
- "jparen", "u24A5",
- "jsuperior", "u02B2",
- "k", "u006B",
- "kabashkircyrillic", "u04A1",
- "kabengali", "u0995",
- "kacute", "u1E31",
- "kacyrillic", "u043A",
- "kadescendercyrillic", "u049B",
- "kadeva", "u0915",
- "kaf", "u05DB",
- "kafarabic", "u0643",
- "kafdagesh", "uFB3B",
- "kafdageshhebrew", "uFB3B",
- "kaffinalarabic", "uFEDA",
- "kafhebrew", "u05DB",
- "kafinitialarabic", "uFEDB",
- "kafmedialarabic", "uFEDC",
- "kafrafehebrew", "uFB4D",
- "kagujarati", "u0A95",
- "kagurmukhi", "u0A15",
- "kahiragana", "u304B",
- "kahookcyrillic", "u04C4",
- "kakatakana", "u30AB",
- "kakatakanahalfwidth", "uFF76",
- "kappa", "u03BA",
- "kappasymbolgreek", "u03F0",
- "kapyeounmieumkorean", "u3171",
- "kapyeounphieuphkorean", "u3184",
- "kapyeounpieupkorean", "u3178",
- "kapyeounssangpieupkorean", "u3179",
- "karoriisquare", "u330D",
- "kashidaautoarabic", "u0640",
- "kashidaautonosidebearingarabic", "u0640",
- "kasmallkatakana", "u30F5",
- "kasquare", "u3384",
- "kasraarabic", "u0650",
- "kasratanarabic", "u064D",
- "kastrokecyrillic", "u049F",
- "katahiraprolongmarkhalfwidth", "uFF70",
- "kaverticalstrokecyrillic", "u049D",
- "kbopomofo", "u310E",
- "kcalsquare", "u3389",
- "kcaron", "u01E9",
- "kcedilla", "u0137",
- "kcircle", "u24DA",
- "kcommaaccent", "u0137",
- "kdotbelow", "u1E33",
- "keharmenian", "u0584",
- "kehiragana", "u3051",
- "kekatakana", "u30B1",
- "kekatakanahalfwidth", "uFF79",
- "kenarmenian", "u056F",
- "kesmallkatakana", "u30F6",
- "kgreenlandic", "u0138",
- "khabengali", "u0996",
- "khacyrillic", "u0445",
- "khadeva", "u0916",
- "khagujarati", "u0A96",
- "khagurmukhi", "u0A16",
- "khaharabic", "u062E",
- "khahfinalarabic", "uFEA6",
- "khahinitialarabic", "uFEA7",
- "khahmedialarabic", "uFEA8",
- "kheicoptic", "u03E7",
- "khhadeva", "u0959",
- "khhagurmukhi", "u0A59",
- "khieukhacirclekorean", "u3278",
- "khieukhaparenkorean", "u3218",
- "khieukhcirclekorean", "u326A",
- "khieukhkorean", "u314B",
- "khieukhparenkorean", "u320A",
- "khokhaithai", "u0E02",
- "khokhonthai", "u0E05",
- "khokhuatthai", "u0E03",
- "khokhwaithai", "u0E04",
- "khomutthai", "u0E5B",
- "khook", "u0199",
- "khorakhangthai", "u0E06",
- "khzsquare", "u3391",
- "kihiragana", "u304D",
- "kikatakana", "u30AD",
- "kikatakanahalfwidth", "uFF77",
- "kiroguramusquare", "u3315",
- "kiromeetorusquare", "u3316",
- "kirosquare", "u3314",
- "kiyeokacirclekorean", "u326E",
- "kiyeokaparenkorean", "u320E",
- "kiyeokcirclekorean", "u3260",
- "kiyeokkorean", "u3131",
- "kiyeokparenkorean", "u3200",
- "kiyeoksioskorean", "u3133",
- "kjecyrillic", "u045C",
- "klinebelow", "u1E35",
- "klsquare", "u3398",
- "kmcubedsquare", "u33A6",
- "kmonospace", "uFF4B",
- "kmsquaredsquare", "u33A2",
- "kohiragana", "u3053",
- "kohmsquare", "u33C0",
- "kokaithai", "u0E01",
- "kokatakana", "u30B3",
- "kokatakanahalfwidth", "uFF7A",
- "kooposquare", "u331E",
- "koppacyrillic", "u0481",
- "koreanstandardsymbol", "u327F",
- "koroniscmb", "u0343",
- "kparen", "u24A6",
- "kpasquare", "u33AA",
- "ksicyrillic", "u046F",
- "ktsquare", "u33CF",
- "kturned", "u029E",
- "kuhiragana", "u304F",
- "kukatakana", "u30AF",
- "kukatakanahalfwidth", "uFF78",
- "kvsquare", "u33B8",
- "kwsquare", "u33BE",
- "l", "u006C",
- "labengali", "u09B2",
- "lacute", "u013A",
- "ladeva", "u0932",
- "lagujarati", "u0AB2",
- "lagurmukhi", "u0A32",
- "lakkhangyaothai", "u0E45",
- "lamaleffinalarabic", "uFEFC",
- "lamalefhamzaabovefinalarabic", "uFEF8",
- "lamalefhamzaaboveisolatedarabic", "uFEF7",
- "lamalefhamzabelowfinalarabic", "uFEFA",
- "lamalefhamzabelowisolatedarabic", "uFEF9",
- "lamalefisolatedarabic", "uFEFB",
- "lamalefmaddaabovefinalarabic", "uFEF6",
- "lamalefmaddaaboveisolatedarabic", "uFEF5",
- "lamarabic", "u0644",
- "lambda", "u03BB",
- "lambdastroke", "u019B",
- "lamed", "u05DC",
- "lameddagesh", "uFB3C",
- "lameddageshhebrew", "uFB3C",
- "lamedhebrew", "u05DC",
- "lamedholam", "u05DC_05B9",
- "lamedholamdagesh", "u05DC_05B9_05BC",
- "lamedholamdageshhebrew", "u05DC_05B9_05BC",
- "lamedholamhebrew", "u05DC_05B9",
- "lamfinalarabic", "uFEDE",
- "lamhahinitialarabic", "uFCCA",
- "laminitialarabic", "uFEDF",
- "lamjeeminitialarabic", "uFCC9",
- "lamkhahinitialarabic", "uFCCB",
- "lamlamhehisolatedarabic", "uFDF2",
- "lammedialarabic", "uFEE0",
- "lammeemhahinitialarabic", "uFD88",
- "lammeeminitialarabic", "uFCCC",
- "lammeemjeeminitialarabic", "uFEDF_FEE4_FEA0",
- "lammeemkhahinitialarabic", "uFEDF_FEE4_FEA8",
- "largecircle", "u25EF",
- "lbar", "u019A",
- "lbelt", "u026C",
- "lbopomofo", "u310C",
- "lcaron", "u013E",
- "lcedilla", "u013C",
- "lcircle", "u24DB",
- "lcircumflexbelow", "u1E3D",
- "lcommaaccent", "u013C",
- "ldot", "u0140",
- "ldotaccent", "u0140",
- "ldotbelow", "u1E37",
- "ldotbelowmacron", "u1E39",
- "leftangleabovecmb", "u031A",
- "lefttackbelowcmb", "u0318",
- "less", "u003C",
- "lessequal", "u2264",
- "lessequalorgreater", "u22DA",
- "lessmonospace", "uFF1C",
- "lessorequivalent", "u2272",
- "lessorgreater", "u2276",
- "lessoverequal", "u2266",
- "lesssmall", "uFE64",
- "lezh", "u026E",
- "lfblock", "u258C",
- "lhookretroflex", "u026D",
- "lira", "u20A4",
- "liwnarmenian", "u056C",
- "lj", "u01C9",
- "ljecyrillic", "u0459",
- "lladeva", "u0933",
- "llagujarati", "u0AB3",
- "llinebelow", "u1E3B",
- "llladeva", "u0934",
- "llvocalicbengali", "u09E1",
- "llvocalicdeva", "u0961",
- "llvocalicvowelsignbengali", "u09E3",
- "llvocalicvowelsigndeva", "u0963",
- "lmiddletilde", "u026B",
- "lmonospace", "uFF4C",
- "lmsquare", "u33D0",
- "lochulathai", "u0E2C",
- "logicaland", "u2227",
- "logicalnot", "u00AC",
- "logicalnotreversed", "u2310",
- "logicalor", "u2228",
- "lolingthai", "u0E25",
- "longs", "u017F",
- "lowlinecenterline", "uFE4E",
- "lowlinecmb", "u0332",
- "lowlinedashed", "uFE4D",
- "lozenge", "u25CA",
- "lparen", "u24A7",
- "lslash", "u0142",
- "lsquare", "u2113",
- "ltshade", "u2591",
- "luthai", "u0E26",
- "lvocalicbengali", "u098C",
- "lvocalicdeva", "u090C",
- "lvocalicvowelsignbengali", "u09E2",
- "lvocalicvowelsigndeva", "u0962",
- "lxsquare", "u33D3",
- "m", "u006D",
- "mabengali", "u09AE",
- "macron", "u00AF",
- "macronbelowcmb", "u0331",
- "macroncmb", "u0304",
- "macronlowmod", "u02CD",
- "macronmonospace", "uFFE3",
- "macute", "u1E3F",
- "madeva", "u092E",
- "magujarati", "u0AAE",
- "magurmukhi", "u0A2E",
- "mahapakhhebrew", "u05A4",
- "mahapakhlefthebrew", "u05A4",
- "mahiragana", "u307E",
- "maichattawathai", "u0E4B",
- "maiekthai", "u0E48",
- "maihanakatthai", "u0E31",
- "maitaikhuthai", "u0E47",
- "maithothai", "u0E49",
- "maitrithai", "u0E4A",
- "maiyamokthai", "u0E46",
- "makatakana", "u30DE",
- "makatakanahalfwidth", "uFF8F",
- "male", "u2642",
- "mansyonsquare", "u3347",
- "maqafhebrew", "u05BE",
- "mars", "u2642",
- "masoracirclehebrew", "u05AF",
- "masquare", "u3383",
- "mbopomofo", "u3107",
- "mbsquare", "u33D4",
- "mcircle", "u24DC",
- "mcubedsquare", "u33A5",
- "mdotaccent", "u1E41",
- "mdotbelow", "u1E43",
- "meemarabic", "u0645",
- "meemfinalarabic", "uFEE2",
- "meeminitialarabic", "uFEE3",
- "meemmedialarabic", "uFEE4",
- "meemmeeminitialarabic", "uFCD1",
- "meemmeemisolatedarabic", "uFC48",
- "meetorusquare", "u334D",
- "mehiragana", "u3081",
- "meizierasquare", "u337E",
- "mekatakana", "u30E1",
- "mekatakanahalfwidth", "uFF92",
- "mem", "u05DE",
- "memdagesh", "uFB3E",
- "memdageshhebrew", "uFB3E",
- "memhebrew", "u05DE",
- "menarmenian", "u0574",
- "merkhahebrew", "u05A5",
- "merkhakefulahebrew", "u05A6",
- "merkhakefulalefthebrew", "u05A6",
- "merkhalefthebrew", "u05A5",
- "mhook", "u0271",
- "mhzsquare", "u3392",
- "middledotkatakanahalfwidth", "uFF65",
- "middot", "u00B7",
- "mieumacirclekorean", "u3272",
- "mieumaparenkorean", "u3212",
- "mieumcirclekorean", "u3264",
- "mieumkorean", "u3141",
- "mieumpansioskorean", "u3170",
- "mieumparenkorean", "u3204",
- "mieumpieupkorean", "u316E",
- "mieumsioskorean", "u316F",
- "mihiragana", "u307F",
- "mikatakana", "u30DF",
- "mikatakanahalfwidth", "uFF90",
- "minus", "u2212",
- "minusbelowcmb", "u0320",
- "minuscircle", "u2296",
- "minusmod", "u02D7",
- "minusplus", "u2213",
- "minute", "u2032",
- "miribaarusquare", "u334A",
- "mirisquare", "u3349",
- "mlonglegturned", "u0270",
- "mlsquare", "u3396",
- "mmcubedsquare", "u33A3",
- "mmonospace", "uFF4D",
- "mmsquaredsquare", "u339F",
- "mohiragana", "u3082",
- "mohmsquare", "u33C1",
- "mokatakana", "u30E2",
- "mokatakanahalfwidth", "uFF93",
- "molsquare", "u33D6",
- "momathai", "u0E21",
- "moverssquare", "u33A7",
- "moverssquaredsquare", "u33A8",
- "mparen", "u24A8",
- "mpasquare", "u33AB",
- "mssquare", "u33B3",
- "mturned", "u026F",
- "mu", "u00B5",
- "mu1", "u00B5",
- "muasquare", "u3382",
- "muchgreater", "u226B",
- "muchless", "u226A",
- "mufsquare", "u338C",
- "mugreek", "u03BC",
- "mugsquare", "u338D",
- "muhiragana", "u3080",
- "mukatakana", "u30E0",
- "mukatakanahalfwidth", "uFF91",
- "mulsquare", "u3395",
- "multiply", "u00D7",
- "mumsquare", "u339B",
- "munahhebrew", "u05A3",
- "munahlefthebrew", "u05A3",
- "musicalnote", "u266A",
- "musicalnotedbl", "u266B",
- "musicflatsign", "u266D",
- "musicsharpsign", "u266F",
- "mussquare", "u33B2",
- "muvsquare", "u33B6",
- "muwsquare", "u33BC",
- "mvmegasquare", "u33B9",
- "mvsquare", "u33B7",
- "mwmegasquare", "u33BF",
- "mwsquare", "u33BD",
- "n", "u006E",
- "nabengali", "u09A8",
- "nabla", "u2207",
- "nacute", "u0144",
- "nadeva", "u0928",
- "nagujarati", "u0AA8",
- "nagurmukhi", "u0A28",
- "nahiragana", "u306A",
- "nakatakana", "u30CA",
- "nakatakanahalfwidth", "uFF85",
- "napostrophe", "u0149",
- "nasquare", "u3381",
- "nbopomofo", "u310B",
- "nbspace", "u00A0",
- "ncaron", "u0148",
- "ncedilla", "u0146",
- "ncircle", "u24DD",
- "ncircumflexbelow", "u1E4B",
- "ncommaaccent", "u0146",
- "ndotaccent", "u1E45",
- "ndotbelow", "u1E47",
- "nehiragana", "u306D",
- "nekatakana", "u30CD",
- "nekatakanahalfwidth", "uFF88",
- "newsheqelsign", "u20AA",
- "nfsquare", "u338B",
- "ngabengali", "u0999",
- "ngadeva", "u0919",
- "ngagujarati", "u0A99",
- "ngagurmukhi", "u0A19",
- "ngonguthai", "u0E07",
- "nhiragana", "u3093",
- "nhookleft", "u0272",
- "nhookretroflex", "u0273",
- "nieunacirclekorean", "u326F",
- "nieunaparenkorean", "u320F",
- "nieuncieuckorean", "u3135",
- "nieuncirclekorean", "u3261",
- "nieunhieuhkorean", "u3136",
- "nieunkorean", "u3134",
- "nieunpansioskorean", "u3168",
- "nieunparenkorean", "u3201",
- "nieunsioskorean", "u3167",
- "nieuntikeutkorean", "u3166",
- "nihiragana", "u306B",
- "nikatakana", "u30CB",
- "nikatakanahalfwidth", "uFF86",
- "nikhahitthai", "u0E4D",
- "nine", "u0039",
- "ninearabic", "u0669",
- "ninebengali", "u09EF",
- "ninecircle", "u2468",
- "ninecircleinversesansserif", "u2792",
- "ninedeva", "u096F",
- "ninegujarati", "u0AEF",
- "ninegurmukhi", "u0A6F",
- "ninehackarabic", "u0669",
- "ninehangzhou", "u3029",
- "nineideographicparen", "u3228",
- "nineinferior", "u2089",
- "ninemonospace", "uFF19",
- "nineparen", "u247C",
- "nineperiod", "u2490",
- "ninepersian", "u06F9",
- "nineroman", "u2178",
- "ninesuperior", "u2079",
- "nineteencircle", "u2472",
- "nineteenparen", "u2486",
- "nineteenperiod", "u249A",
- "ninethai", "u0E59",
- "nj", "u01CC",
- "njecyrillic", "u045A",
- "nkatakana", "u30F3",
- "nkatakanahalfwidth", "uFF9D",
- "nlegrightlong", "u019E",
- "nlinebelow", "u1E49",
- "nmonospace", "uFF4E",
- "nmsquare", "u339A",
- "nnabengali", "u09A3",
- "nnadeva", "u0923",
- "nnagujarati", "u0AA3",
- "nnagurmukhi", "u0A23",
- "nnnadeva", "u0929",
- "nohiragana", "u306E",
- "nokatakana", "u30CE",
- "nokatakanahalfwidth", "uFF89",
- "nonbreakingspace", "u00A0",
- "nonenthai", "u0E13",
- "nonuthai", "u0E19",
- "noonarabic", "u0646",
- "noonfinalarabic", "uFEE6",
- "noonghunnaarabic", "u06BA",
- "noonghunnafinalarabic", "uFB9F",
- "noonhehinitialarabic", "uFEE7_FEEC",
- "nooninitialarabic", "uFEE7",
- "noonjeeminitialarabic", "uFCD2",
- "noonjeemisolatedarabic", "uFC4B",
- "noonmedialarabic", "uFEE8",
- "noonmeeminitialarabic", "uFCD5",
- "noonmeemisolatedarabic", "uFC4E",
- "noonnoonfinalarabic", "uFC8D",
- "notcontains", "u220C",
- "notelement", "u2209",
- "notelementof", "u2209",
- "notequal", "u2260",
- "notgreater", "u226F",
- "notgreaternorequal", "u2271",
- "notgreaternorless", "u2279",
- "notidentical", "u2262",
- "notless", "u226E",
- "notlessnorequal", "u2270",
- "notparallel", "u2226",
- "notprecedes", "u2280",
- "notsubset", "u2284",
- "notsucceeds", "u2281",
- "notsuperset", "u2285",
- "nowarmenian", "u0576",
- "nparen", "u24A9",
- "nssquare", "u33B1",
- "nsuperior", "u207F",
- "ntilde", "u00F1",
- "nu", "u03BD",
- "nuhiragana", "u306C",
- "nukatakana", "u30CC",
- "nukatakanahalfwidth", "uFF87",
- "nuktabengali", "u09BC",
- "nuktadeva", "u093C",
- "nuktagujarati", "u0ABC",
- "nuktagurmukhi", "u0A3C",
- "numbersign", "u0023",
- "numbersignmonospace", "uFF03",
- "numbersignsmall", "uFE5F",
- "numeralsigngreek", "u0374",
- "numeralsignlowergreek", "u0375",
- "numero", "u2116",
- "nun", "u05E0",
- "nundagesh", "uFB40",
- "nundageshhebrew", "uFB40",
- "nunhebrew", "u05E0",
- "nvsquare", "u33B5",
- "nwsquare", "u33BB",
- "nyabengali", "u099E",
- "nyadeva", "u091E",
- "nyagujarati", "u0A9E",
- "nyagurmukhi", "u0A1E",
- "o", "u006F",
- "oacute", "u00F3",
- "oangthai", "u0E2D",
- "obarred", "u0275",
- "obarredcyrillic", "u04E9",
- "obarreddieresiscyrillic", "u04EB",
- "obengali", "u0993",
- "obopomofo", "u311B",
- "obreve", "u014F",
- "ocandradeva", "u0911",
- "ocandragujarati", "u0A91",
- "ocandravowelsigndeva", "u0949",
- "ocandravowelsigngujarati", "u0AC9",
- "ocaron", "u01D2",
- "ocircle", "u24DE",
- "ocircumflex", "u00F4",
- "ocircumflexacute", "u1ED1",
- "ocircumflexdotbelow", "u1ED9",
- "ocircumflexgrave", "u1ED3",
- "ocircumflexhookabove", "u1ED5",
- "ocircumflextilde", "u1ED7",
- "ocyrillic", "u043E",
- "odblacute", "u0151",
- "odblgrave", "u020D",
- "odeva", "u0913",
- "odieresis", "u00F6",
- "odieresiscyrillic", "u04E7",
- "odotbelow", "u1ECD",
- "oe", "u0153",
- "oekorean", "u315A",
- "ogonek", "u02DB",
- "ogonekcmb", "u0328",
- "ograve", "u00F2",
- "ogujarati", "u0A93",
- "oharmenian", "u0585",
- "ohiragana", "u304A",
- "ohookabove", "u1ECF",
- "ohorn", "u01A1",
- "ohornacute", "u1EDB",
- "ohorndotbelow", "u1EE3",
- "ohorngrave", "u1EDD",
- "ohornhookabove", "u1EDF",
- "ohorntilde", "u1EE1",
- "ohungarumlaut", "u0151",
- "oi", "u01A3",
- "oinvertedbreve", "u020F",
- "okatakana", "u30AA",
- "okatakanahalfwidth", "uFF75",
- "okorean", "u3157",
- "olehebrew", "u05AB",
- "omacron", "u014D",
- "omacronacute", "u1E53",
- "omacrongrave", "u1E51",
- "omdeva", "u0950",
- "omega", "u03C9",
- "omega1", "u03D6",
- "omegacyrillic", "u0461",
- "omegalatinclosed", "u0277",
- "omegaroundcyrillic", "u047B",
- "omegatitlocyrillic", "u047D",
- "omegatonos", "u03CE",
- "omgujarati", "u0AD0",
- "omicron", "u03BF",
- "omicrontonos", "u03CC",
- "omonospace", "uFF4F",
- "one", "u0031",
- "onearabic", "u0661",
- "onebengali", "u09E7",
- "onecircle", "u2460",
- "onecircleinversesansserif", "u278A",
- "onedeva", "u0967",
- "onedotenleader", "u2024",
- "oneeighth", "u215B",
- "onegujarati", "u0AE7",
- "onegurmukhi", "u0A67",
- "onehackarabic", "u0661",
- "onehalf", "u00BD",
- "onehangzhou", "u3021",
- "oneideographicparen", "u3220",
- "oneinferior", "u2081",
- "onemonospace", "uFF11",
- "onenumeratorbengali", "u09F4",
- "oneparen", "u2474",
- "oneperiod", "u2488",
- "onepersian", "u06F1",
- "onequarter", "u00BC",
- "oneroman", "u2170",
- "onesuperior", "u00B9",
- "onethai", "u0E51",
- "onethird", "u2153",
- "oogonek", "u01EB",
- "oogonekmacron", "u01ED",
- "oogurmukhi", "u0A13",
- "oomatragurmukhi", "u0A4B",
- "oopen", "u0254",
- "oparen", "u24AA",
- "openbullet", "u25E6",
- "option", "u2325",
- "ordfeminine", "u00AA",
- "ordmasculine", "u00BA",
- "orthogonal", "u221F",
- "oshortdeva", "u0912",
- "oshortvowelsigndeva", "u094A",
- "oslash", "u00F8",
- "oslashacute", "u01FF",
- "osmallhiragana", "u3049",
- "osmallkatakana", "u30A9",
- "osmallkatakanahalfwidth", "uFF6B",
- "ostrokeacute", "u01FF",
- "otcyrillic", "u047F",
- "otilde", "u00F5",
- "otildeacute", "u1E4D",
- "otildedieresis", "u1E4F",
- "oubopomofo", "u3121",
- "overline", "u203E",
- "overlinecenterline", "uFE4A",
- "overlinecmb", "u0305",
- "overlinedashed", "uFE49",
- "overlinedblwavy", "uFE4C",
- "overlinewavy", "uFE4B",
- "overscore", "u00AF",
- "ovowelsignbengali", "u09CB",
- "ovowelsigndeva", "u094B",
- "ovowelsigngujarati", "u0ACB",
- "p", "u0070",
- "paampssquare", "u3380",
- "paasentosquare", "u332B",
- "pabengali", "u09AA",
- "pacute", "u1E55",
- "padeva", "u092A",
- "pagedown", "u21DF",
- "pageup", "u21DE",
- "pagujarati", "u0AAA",
- "pagurmukhi", "u0A2A",
- "pahiragana", "u3071",
- "paiyannoithai", "u0E2F",
- "pakatakana", "u30D1",
- "palatalizationcyrilliccmb", "u0484",
- "palochkacyrillic", "u04C0",
- "pansioskorean", "u317F",
- "paragraph", "u00B6",
- "parallel", "u2225",
- "parenleft", "u0028",
- "parenleftaltonearabic", "uFD3E",
- "parenleftinferior", "u208D",
- "parenleftmonospace", "uFF08",
- "parenleftsmall", "uFE59",
- "parenleftsuperior", "u207D",
- "parenleftvertical", "uFE35",
- "parenright", "u0029",
- "parenrightaltonearabic", "uFD3F",
- "parenrightinferior", "u208E",
- "parenrightmonospace", "uFF09",
- "parenrightsmall", "uFE5A",
- "parenrightsuperior", "u207E",
- "parenrightvertical", "uFE36",
- "partialdiff", "u2202",
- "paseqhebrew", "u05C0",
- "pashtahebrew", "u0599",
- "pasquare", "u33A9",
- "patah", "u05B7",
- "patah11", "u05B7",
- "patah1d", "u05B7",
- "patah2a", "u05B7",
- "patahhebrew", "u05B7",
- "patahnarrowhebrew", "u05B7",
- "patahquarterhebrew", "u05B7",
- "patahwidehebrew", "u05B7",
- "pazerhebrew", "u05A1",
- "pbopomofo", "u3106",
- "pcircle", "u24DF",
- "pdotaccent", "u1E57",
- "pe", "u05E4",
- "pecyrillic", "u043F",
- "pedagesh", "uFB44",
- "pedageshhebrew", "uFB44",
- "peezisquare", "u333B",
- "pefinaldageshhebrew", "uFB43",
- "peharabic", "u067E",
- "peharmenian", "u057A",
- "pehebrew", "u05E4",
- "pehfinalarabic", "uFB57",
- "pehinitialarabic", "uFB58",
- "pehiragana", "u307A",
- "pehmedialarabic", "uFB59",
- "pekatakana", "u30DA",
- "pemiddlehookcyrillic", "u04A7",
- "perafehebrew", "uFB4E",
- "percent", "u0025",
- "percentarabic", "u066A",
- "percentmonospace", "uFF05",
- "percentsmall", "uFE6A",
- "period", "u002E",
- "periodarmenian", "u0589",
- "periodcentered", "u00B7",
- "periodhalfwidth", "uFF61",
- "periodmonospace", "uFF0E",
- "periodsmall", "uFE52",
- "perispomenigreekcmb", "u0342",
- "perpendicular", "u22A5",
- "perthousand", "u2030",
- "peseta", "u20A7",
- "pfsquare", "u338A",
- "phabengali", "u09AB",
- "phadeva", "u092B",
- "phagujarati", "u0AAB",
- "phagurmukhi", "u0A2B",
- "phi", "u03C6",
- "phi1", "u03D5",
- "phieuphacirclekorean", "u327A",
- "phieuphaparenkorean", "u321A",
- "phieuphcirclekorean", "u326C",
- "phieuphkorean", "u314D",
- "phieuphparenkorean", "u320C",
- "philatin", "u0278",
- "phinthuthai", "u0E3A",
- "phisymbolgreek", "u03D5",
- "phook", "u01A5",
- "phophanthai", "u0E1E",
- "phophungthai", "u0E1C",
- "phosamphaothai", "u0E20",
- "pi", "u03C0",
- "pieupacirclekorean", "u3273",
- "pieupaparenkorean", "u3213",
- "pieupcieuckorean", "u3176",
- "pieupcirclekorean", "u3265",
- "pieupkiyeokkorean", "u3172",
- "pieupkorean", "u3142",
- "pieupparenkorean", "u3205",
- "pieupsioskiyeokkorean", "u3174",
- "pieupsioskorean", "u3144",
- "pieupsiostikeutkorean", "u3175",
- "pieupthieuthkorean", "u3177",
- "pieuptikeutkorean", "u3173",
- "pihiragana", "u3074",
- "pikatakana", "u30D4",
- "pisymbolgreek", "u03D6",
- "piwrarmenian", "u0583",
- "plus", "u002B",
- "plusbelowcmb", "u031F",
- "pluscircle", "u2295",
- "plusminus", "u00B1",
- "plusmod", "u02D6",
- "plusmonospace", "uFF0B",
- "plussmall", "uFE62",
- "plussuperior", "u207A",
- "pmonospace", "uFF50",
- "pmsquare", "u33D8",
- "pohiragana", "u307D",
- "pointingindexdownwhite", "u261F",
- "pointingindexleftwhite", "u261C",
- "pointingindexrightwhite", "u261E",
- "pointingindexupwhite", "u261D",
- "pokatakana", "u30DD",
- "poplathai", "u0E1B",
- "postalmark", "u3012",
- "postalmarkface", "u3020",
- "pparen", "u24AB",
- "precedes", "u227A",
- "prescription", "u211E",
- "primemod", "u02B9",
- "primereversed", "u2035",
- "product", "u220F",
- "projective", "u2305",
- "prolongedkana", "u30FC",
- "propellor", "u2318",
- "propersubset", "u2282",
- "propersuperset", "u2283",
- "proportion", "u2237",
- "proportional", "u221D",
- "psi", "u03C8",
- "psicyrillic", "u0471",
- "psilipneumatacyrilliccmb", "u0486",
- "pssquare", "u33B0",
- "puhiragana", "u3077",
- "pukatakana", "u30D7",
- "pvsquare", "u33B4",
- "pwsquare", "u33BA",
- "q", "u0071",
- "qadeva", "u0958",
- "qadmahebrew", "u05A8",
- "qafarabic", "u0642",
- "qaffinalarabic", "uFED6",
- "qafinitialarabic", "uFED7",
- "qafmedialarabic", "uFED8",
- "qamats", "u05B8",
- "qamats10", "u05B8",
- "qamats1a", "u05B8",
- "qamats1c", "u05B8",
- "qamats27", "u05B8",
- "qamats29", "u05B8",
- "qamats33", "u05B8",
- "qamatsde", "u05B8",
- "qamatshebrew", "u05B8",
- "qamatsnarrowhebrew", "u05B8",
- "qamatsqatanhebrew", "u05B8",
- "qamatsqatannarrowhebrew", "u05B8",
- "qamatsqatanquarterhebrew", "u05B8",
- "qamatsqatanwidehebrew", "u05B8",
- "qamatsquarterhebrew", "u05B8",
- "qamatswidehebrew", "u05B8",
- "qarneyparahebrew", "u059F",
- "qbopomofo", "u3111",
- "qcircle", "u24E0",
- "qhook", "u02A0",
- "qmonospace", "uFF51",
- "qof", "u05E7",
- "qofdagesh", "uFB47",
- "qofdageshhebrew", "uFB47",
- "qofhatafpatah", "u05E7_05B2",
- "qofhatafpatahhebrew", "u05E7_05B2",
- "qofhatafsegol", "u05E7_05B1",
- "qofhatafsegolhebrew", "u05E7_05B1",
- "qofhebrew", "u05E7",
- "qofhiriq", "u05E7_05B4",
- "qofhiriqhebrew", "u05E7_05B4",
- "qofholam", "u05E7_05B9",
- "qofholamhebrew", "u05E7_05B9",
- "qofpatah", "u05E7_05B7",
- "qofpatahhebrew", "u05E7_05B7",
- "qofqamats", "u05E7_05B8",
- "qofqamatshebrew", "u05E7_05B8",
- "qofqubuts", "u05E7_05BB",
- "qofqubutshebrew", "u05E7_05BB",
- "qofsegol", "u05E7_05B6",
- "qofsegolhebrew", "u05E7_05B6",
- "qofsheva", "u05E7_05B0",
- "qofshevahebrew", "u05E7_05B0",
- "qoftsere", "u05E7_05B5",
- "qoftserehebrew", "u05E7_05B5",
- "qparen", "u24AC",
- "quarternote", "u2669",
- "qubuts", "u05BB",
- "qubuts18", "u05BB",
- "qubuts25", "u05BB",
- "qubuts31", "u05BB",
- "qubutshebrew", "u05BB",
- "qubutsnarrowhebrew", "u05BB",
- "qubutsquarterhebrew", "u05BB",
- "qubutswidehebrew", "u05BB",
- "question", "u003F",
- "questionarabic", "u061F",
- "questionarmenian", "u055E",
- "questiondown", "u00BF",
- "questiongreek", "u037E",
- "questionmonospace", "uFF1F",
- "quotedbl", "u0022",
- "quotedblbase", "u201E",
- "quotedblleft", "u201C",
- "quotedblmonospace", "uFF02",
- "quotedblprime", "u301E",
- "quotedblprimereversed", "u301D",
- "quotedblright", "u201D",
- "quoteleft", "u2018",
- "quoteleftreversed", "u201B",
- "quotereversed", "u201B",
- "quoteright", "u2019",
- "quoterightn", "u0149",
- "quotesinglbase", "u201A",
- "quotesingle", "u0027",
- "quotesinglemonospace", "uFF07",
- "r", "u0072",
- "raarmenian", "u057C",
- "rabengali", "u09B0",
- "racute", "u0155",
- "radeva", "u0930",
- "radical", "u221A",
- "radoverssquare", "u33AE",
- "radoverssquaredsquare", "u33AF",
- "radsquare", "u33AD",
- "rafe", "u05BF",
- "rafehebrew", "u05BF",
- "ragujarati", "u0AB0",
- "ragurmukhi", "u0A30",
- "rahiragana", "u3089",
- "rakatakana", "u30E9",
- "rakatakanahalfwidth", "uFF97",
- "ralowerdiagonalbengali", "u09F1",
- "ramiddlediagonalbengali", "u09F0",
- "ramshorn", "u0264",
- "ratio", "u2236",
- "rbopomofo", "u3116",
- "rcaron", "u0159",
- "rcedilla", "u0157",
- "rcircle", "u24E1",
- "rcommaaccent", "u0157",
- "rdblgrave", "u0211",
- "rdotaccent", "u1E59",
- "rdotbelow", "u1E5B",
- "rdotbelowmacron", "u1E5D",
- "referencemark", "u203B",
- "reflexsubset", "u2286",
- "reflexsuperset", "u2287",
- "registered", "u00AE",
- "reharabic", "u0631",
- "reharmenian", "u0580",
- "rehfinalarabic", "uFEAE",
- "rehiragana", "u308C",
- "rehyehaleflamarabic", "u0631_FEF3_FE8E_0644",
- "rekatakana", "u30EC",
- "rekatakanahalfwidth", "uFF9A",
- "resh", "u05E8",
- "reshdageshhebrew", "uFB48",
- "reshhatafpatah", "u05E8_05B2",
- "reshhatafpatahhebrew", "u05E8_05B2",
- "reshhatafsegol", "u05E8_05B1",
- "reshhatafsegolhebrew", "u05E8_05B1",
- "reshhebrew", "u05E8",
- "reshhiriq", "u05E8_05B4",
- "reshhiriqhebrew", "u05E8_05B4",
- "reshholam", "u05E8_05B9",
- "reshholamhebrew", "u05E8_05B9",
- "reshpatah", "u05E8_05B7",
- "reshpatahhebrew", "u05E8_05B7",
- "reshqamats", "u05E8_05B8",
- "reshqamatshebrew", "u05E8_05B8",
- "reshqubuts", "u05E8_05BB",
- "reshqubutshebrew", "u05E8_05BB",
- "reshsegol", "u05E8_05B6",
- "reshsegolhebrew", "u05E8_05B6",
- "reshsheva", "u05E8_05B0",
- "reshshevahebrew", "u05E8_05B0",
- "reshtsere", "u05E8_05B5",
- "reshtserehebrew", "u05E8_05B5",
- "reversedtilde", "u223D",
- "reviahebrew", "u0597",
- "reviamugrashhebrew", "u0597",
- "revlogicalnot", "u2310",
- "rfishhook", "u027E",
- "rfishhookreversed", "u027F",
- "rhabengali", "u09DD",
- "rhadeva", "u095D",
- "rho", "u03C1",
- "rhook", "u027D",
- "rhookturned", "u027B",
- "rhookturnedsuperior", "u02B5",
- "rhosymbolgreek", "u03F1",
- "rhotichookmod", "u02DE",
- "rieulacirclekorean", "u3271",
- "rieulaparenkorean", "u3211",
- "rieulcirclekorean", "u3263",
- "rieulhieuhkorean", "u3140",
- "rieulkiyeokkorean", "u313A",
- "rieulkiyeoksioskorean", "u3169",
- "rieulkorean", "u3139",
- "rieulmieumkorean", "u313B",
- "rieulpansioskorean", "u316C",
- "rieulparenkorean", "u3203",
- "rieulphieuphkorean", "u313F",
- "rieulpieupkorean", "u313C",
- "rieulpieupsioskorean", "u316B",
- "rieulsioskorean", "u313D",
- "rieulthieuthkorean", "u313E",
- "rieultikeutkorean", "u316A",
- "rieulyeorinhieuhkorean", "u316D",
- "rightangle", "u221F",
- "righttackbelowcmb", "u0319",
- "righttriangle", "u22BF",
- "rihiragana", "u308A",
- "rikatakana", "u30EA",
- "rikatakanahalfwidth", "uFF98",
- "ring", "u02DA",
- "ringbelowcmb", "u0325",
- "ringcmb", "u030A",
- "ringhalfleft", "u02BF",
- "ringhalfleftarmenian", "u0559",
- "ringhalfleftbelowcmb", "u031C",
- "ringhalfleftcentered", "u02D3",
- "ringhalfright", "u02BE",
- "ringhalfrightbelowcmb", "u0339",
- "ringhalfrightcentered", "u02D2",
- "rinvertedbreve", "u0213",
- "rittorusquare", "u3351",
- "rlinebelow", "u1E5F",
- "rlongleg", "u027C",
- "rlonglegturned", "u027A",
- "rmonospace", "uFF52",
- "rohiragana", "u308D",
- "rokatakana", "u30ED",
- "rokatakanahalfwidth", "uFF9B",
- "roruathai", "u0E23",
- "rparen", "u24AD",
- "rrabengali", "u09DC",
- "rradeva", "u0931",
- "rragurmukhi", "u0A5C",
- "rreharabic", "u0691",
- "rrehfinalarabic", "uFB8D",
- "rrvocalicbengali", "u09E0",
- "rrvocalicdeva", "u0960",
- "rrvocalicgujarati", "u0AE0",
- "rrvocalicvowelsignbengali", "u09C4",
- "rrvocalicvowelsigndeva", "u0944",
- "rrvocalicvowelsigngujarati", "u0AC4",
- "rtblock", "u2590",
- "rturned", "u0279",
- "rturnedsuperior", "u02B4",
- "ruhiragana", "u308B",
- "rukatakana", "u30EB",
- "rukatakanahalfwidth", "uFF99",
- "rupeemarkbengali", "u09F2",
- "rupeesignbengali", "u09F3",
- "ruthai", "u0E24",
- "rvocalicbengali", "u098B",
- "rvocalicdeva", "u090B",
- "rvocalicgujarati", "u0A8B",
- "rvocalicvowelsignbengali", "u09C3",
- "rvocalicvowelsigndeva", "u0943",
- "rvocalicvowelsigngujarati", "u0AC3",
- "s", "u0073",
- "sabengali", "u09B8",
- "sacute", "u015B",
- "sacutedotaccent", "u1E65",
- "sadarabic", "u0635",
- "sadeva", "u0938",
- "sadfinalarabic", "uFEBA",
- "sadinitialarabic", "uFEBB",
- "sadmedialarabic", "uFEBC",
- "sagujarati", "u0AB8",
- "sagurmukhi", "u0A38",
- "sahiragana", "u3055",
- "sakatakana", "u30B5",
- "sakatakanahalfwidth", "uFF7B",
- "sallallahoualayhewasallamarabic", "uFDFA",
- "samekh", "u05E1",
- "samekhdagesh", "uFB41",
- "samekhdageshhebrew", "uFB41",
- "samekhhebrew", "u05E1",
- "saraaathai", "u0E32",
- "saraaethai", "u0E41",
- "saraaimaimalaithai", "u0E44",
- "saraaimaimuanthai", "u0E43",
- "saraamthai", "u0E33",
- "saraathai", "u0E30",
- "saraethai", "u0E40",
- "saraiithai", "u0E35",
- "saraithai", "u0E34",
- "saraothai", "u0E42",
- "saraueethai", "u0E37",
- "sarauethai", "u0E36",
- "sarauthai", "u0E38",
- "sarauuthai", "u0E39",
- "sbopomofo", "u3119",
- "scaron", "u0161",
- "scarondotaccent", "u1E67",
- "scedilla", "u015F",
- "schwa", "u0259",
- "schwacyrillic", "u04D9",
- "schwadieresiscyrillic", "u04DB",
- "schwahook", "u025A",
- "scircle", "u24E2",
- "scircumflex", "u015D",
- "scommaaccent", "u0219",
- "sdotaccent", "u1E61",
- "sdotbelow", "u1E63",
- "sdotbelowdotaccent", "u1E69",
- "seagullbelowcmb", "u033C",
- "second", "u2033",
- "secondtonechinese", "u02CA",
- "section", "u00A7",
- "seenarabic", "u0633",
- "seenfinalarabic", "uFEB2",
- "seeninitialarabic", "uFEB3",
- "seenmedialarabic", "uFEB4",
- "segol", "u05B6",
- "segol13", "u05B6",
- "segol1f", "u05B6",
- "segol2c", "u05B6",
- "segolhebrew", "u05B6",
- "segolnarrowhebrew", "u05B6",
- "segolquarterhebrew", "u05B6",
- "segoltahebrew", "u0592",
- "segolwidehebrew", "u05B6",
- "seharmenian", "u057D",
- "sehiragana", "u305B",
- "sekatakana", "u30BB",
- "sekatakanahalfwidth", "uFF7E",
- "semicolon", "u003B",
- "semicolonarabic", "u061B",
- "semicolonmonospace", "uFF1B",
- "semicolonsmall", "uFE54",
- "semivoicedmarkkana", "u309C",
- "semivoicedmarkkanahalfwidth", "uFF9F",
- "sentisquare", "u3322",
- "sentosquare", "u3323",
- "seven", "u0037",
- "sevenarabic", "u0667",
- "sevenbengali", "u09ED",
- "sevencircle", "u2466",
- "sevencircleinversesansserif", "u2790",
- "sevendeva", "u096D",
- "seveneighths", "u215E",
- "sevengujarati", "u0AED",
- "sevengurmukhi", "u0A6D",
- "sevenhackarabic", "u0667",
- "sevenhangzhou", "u3027",
- "sevenideographicparen", "u3226",
- "seveninferior", "u2087",
- "sevenmonospace", "uFF17",
- "sevenparen", "u247A",
- "sevenperiod", "u248E",
- "sevenpersian", "u06F7",
- "sevenroman", "u2176",
- "sevensuperior", "u2077",
- "seventeencircle", "u2470",
- "seventeenparen", "u2484",
- "seventeenperiod", "u2498",
- "seventhai", "u0E57",
- "sfthyphen", "u00AD",
- "shaarmenian", "u0577",
- "shabengali", "u09B6",
- "shacyrillic", "u0448",
- "shaddaarabic", "u0651",
- "shaddadammaarabic", "uFC61",
- "shaddadammatanarabic", "uFC5E",
- "shaddafathaarabic", "uFC60",
- "shaddafathatanarabic", "u0651_064B",
- "shaddakasraarabic", "uFC62",
- "shaddakasratanarabic", "uFC5F",
- "shade", "u2592",
- "shadedark", "u2593",
- "shadelight", "u2591",
- "shademedium", "u2592",
- "shadeva", "u0936",
- "shagujarati", "u0AB6",
- "shagurmukhi", "u0A36",
- "shalshelethebrew", "u0593",
- "shbopomofo", "u3115",
- "shchacyrillic", "u0449",
- "sheenarabic", "u0634",
- "sheenfinalarabic", "uFEB6",
- "sheeninitialarabic", "uFEB7",
- "sheenmedialarabic", "uFEB8",
- "sheicoptic", "u03E3",
- "sheqel", "u20AA",
- "sheqelhebrew", "u20AA",
- "sheva", "u05B0",
- "sheva115", "u05B0",
- "sheva15", "u05B0",
- "sheva22", "u05B0",
- "sheva2e", "u05B0",
- "shevahebrew", "u05B0",
- "shevanarrowhebrew", "u05B0",
- "shevaquarterhebrew", "u05B0",
- "shevawidehebrew", "u05B0",
- "shhacyrillic", "u04BB",
- "shimacoptic", "u03ED",
- "shin", "u05E9",
- "shindagesh", "uFB49",
- "shindageshhebrew", "uFB49",
- "shindageshshindot", "uFB2C",
- "shindageshshindothebrew", "uFB2C",
- "shindageshsindot", "uFB2D",
- "shindageshsindothebrew", "uFB2D",
- "shindothebrew", "u05C1",
- "shinhebrew", "u05E9",
- "shinshindot", "uFB2A",
- "shinshindothebrew", "uFB2A",
- "shinsindot", "uFB2B",
- "shinsindothebrew", "uFB2B",
- "shook", "u0282",
- "sigma", "u03C3",
- "sigma1", "u03C2",
- "sigmafinal", "u03C2",
- "sigmalunatesymbolgreek", "u03F2",
- "sihiragana", "u3057",
- "sikatakana", "u30B7",
- "sikatakanahalfwidth", "uFF7C",
- "siluqhebrew", "u05BD",
- "siluqlefthebrew", "u05BD",
- "similar", "u223C",
- "sindothebrew", "u05C2",
- "siosacirclekorean", "u3274",
- "siosaparenkorean", "u3214",
- "sioscieuckorean", "u317E",
- "sioscirclekorean", "u3266",
- "sioskiyeokkorean", "u317A",
- "sioskorean", "u3145",
- "siosnieunkorean", "u317B",
- "siosparenkorean", "u3206",
- "siospieupkorean", "u317D",
- "siostikeutkorean", "u317C",
- "six", "u0036",
- "sixarabic", "u0666",
- "sixbengali", "u09EC",
- "sixcircle", "u2465",
- "sixcircleinversesansserif", "u278F",
- "sixdeva", "u096C",
- "sixgujarati", "u0AEC",
- "sixgurmukhi", "u0A6C",
- "sixhackarabic", "u0666",
- "sixhangzhou", "u3026",
- "sixideographicparen", "u3225",
- "sixinferior", "u2086",
- "sixmonospace", "uFF16",
- "sixparen", "u2479",
- "sixperiod", "u248D",
- "sixpersian", "u06F6",
- "sixroman", "u2175",
- "sixsuperior", "u2076",
- "sixteencircle", "u246F",
- "sixteencurrencydenominatorbengali", "u09F9",
- "sixteenparen", "u2483",
- "sixteenperiod", "u2497",
- "sixthai", "u0E56",
- "slash", "u002F",
- "slashmonospace", "uFF0F",
- "slong", "u017F",
- "slongdotaccent", "u1E9B",
- "smileface", "u263A",
- "smonospace", "uFF53",
- "sofpasuqhebrew", "u05C3",
- "softhyphen", "u00AD",
- "softsigncyrillic", "u044C",
- "sohiragana", "u305D",
- "sokatakana", "u30BD",
- "sokatakanahalfwidth", "uFF7F",
- "soliduslongoverlaycmb", "u0338",
- "solidusshortoverlaycmb", "u0337",
- "sorusithai", "u0E29",
- "sosalathai", "u0E28",
- "sosothai", "u0E0B",
- "sosuathai", "u0E2A",
- "space", "u0020",
- "spacehackarabic", "u0020",
- "spade", "u2660",
- "spadesuitblack", "u2660",
- "spadesuitwhite", "u2664",
- "sparen", "u24AE",
- "squarebelowcmb", "u033B",
- "squarecc", "u33C4",
- "squarecm", "u339D",
- "squarediagonalcrosshatchfill", "u25A9",
- "squarehorizontalfill", "u25A4",
- "squarekg", "u338F",
- "squarekm", "u339E",
- "squarekmcapital", "u33CE",
- "squareln", "u33D1",
- "squarelog", "u33D2",
- "squaremg", "u338E",
- "squaremil", "u33D5",
- "squaremm", "u339C",
- "squaremsquared", "u33A1",
- "squareorthogonalcrosshatchfill", "u25A6",
- "squareupperlefttolowerrightfill", "u25A7",
- "squareupperrighttolowerleftfill", "u25A8",
- "squareverticalfill", "u25A5",
- "squarewhitewithsmallblack", "u25A3",
- "srsquare", "u33DB",
- "ssabengali", "u09B7",
- "ssadeva", "u0937",
- "ssagujarati", "u0AB7",
- "ssangcieuckorean", "u3149",
- "ssanghieuhkorean", "u3185",
- "ssangieungkorean", "u3180",
- "ssangkiyeokkorean", "u3132",
- "ssangnieunkorean", "u3165",
- "ssangpieupkorean", "u3143",
- "ssangsioskorean", "u3146",
- "ssangtikeutkorean", "u3138",
- "sterling", "u00A3",
- "sterlingmonospace", "uFFE1",
- "strokelongoverlaycmb", "u0336",
- "strokeshortoverlaycmb", "u0335",
- "subset", "u2282",
- "subsetnotequal", "u228A",
- "subsetorequal", "u2286",
- "succeeds", "u227B",
- "suchthat", "u220B",
- "suhiragana", "u3059",
- "sukatakana", "u30B9",
- "sukatakanahalfwidth", "uFF7D",
- "sukunarabic", "u0652",
- "summation", "u2211",
- "sun", "u263C",
- "superset", "u2283",
- "supersetnotequal", "u228B",
- "supersetorequal", "u2287",
- "svsquare", "u33DC",
- "syouwaerasquare", "u337C",
- "t", "u0074",
- "tabengali", "u09A4",
- "tackdown", "u22A4",
- "tackleft", "u22A3",
- "tadeva", "u0924",
- "tagujarati", "u0AA4",
- "tagurmukhi", "u0A24",
- "taharabic", "u0637",
- "tahfinalarabic", "uFEC2",
- "tahinitialarabic", "uFEC3",
- "tahiragana", "u305F",
- "tahmedialarabic", "uFEC4",
- "taisyouerasquare", "u337D",
- "takatakana", "u30BF",
- "takatakanahalfwidth", "uFF80",
- "tatweelarabic", "u0640",
- "tau", "u03C4",
- "tav", "u05EA",
- "tavdages", "uFB4A",
- "tavdagesh", "uFB4A",
- "tavdageshhebrew", "uFB4A",
- "tavhebrew", "u05EA",
- "tbar", "u0167",
- "tbopomofo", "u310A",
- "tcaron", "u0165",
- "tccurl", "u02A8",
- "tcedilla", "u0163",
- "tcheharabic", "u0686",
- "tchehfinalarabic", "uFB7B",
- "tchehinitialarabic", "uFB7C",
- "tchehmedialarabic", "uFB7D",
- "tchehmeeminitialarabic", "uFB7C_FEE4",
- "tcircle", "u24E3",
- "tcircumflexbelow", "u1E71",
- "tcommaaccent", "u0163",
- "tdieresis", "u1E97",
- "tdotaccent", "u1E6B",
- "tdotbelow", "u1E6D",
- "tecyrillic", "u0442",
- "tedescendercyrillic", "u04AD",
- "teharabic", "u062A",
- "tehfinalarabic", "uFE96",
- "tehhahinitialarabic", "uFCA2",
- "tehhahisolatedarabic", "uFC0C",
- "tehinitialarabic", "uFE97",
- "tehiragana", "u3066",
- "tehjeeminitialarabic", "uFCA1",
- "tehjeemisolatedarabic", "uFC0B",
- "tehmarbutaarabic", "u0629",
- "tehmarbutafinalarabic", "uFE94",
- "tehmedialarabic", "uFE98",
- "tehmeeminitialarabic", "uFCA4",
- "tehmeemisolatedarabic", "uFC0E",
- "tehnoonfinalarabic", "uFC73",
- "tekatakana", "u30C6",
- "tekatakanahalfwidth", "uFF83",
- "telephone", "u2121",
- "telephoneblack", "u260E",
- "telishagedolahebrew", "u05A0",
- "telishaqetanahebrew", "u05A9",
- "tencircle", "u2469",
- "tenideographicparen", "u3229",
- "tenparen", "u247D",
- "tenperiod", "u2491",
- "tenroman", "u2179",
- "tesh", "u02A7",
- "tet", "u05D8",
- "tetdagesh", "uFB38",
- "tetdageshhebrew", "uFB38",
- "tethebrew", "u05D8",
- "tetsecyrillic", "u04B5",
- "tevirhebrew", "u059B",
- "tevirlefthebrew", "u059B",
- "thabengali", "u09A5",
- "thadeva", "u0925",
- "thagujarati", "u0AA5",
- "thagurmukhi", "u0A25",
- "thalarabic", "u0630",
- "thalfinalarabic", "uFEAC",
- "thanthakhatthai", "u0E4C",
- "theharabic", "u062B",
- "thehfinalarabic", "uFE9A",
- "thehinitialarabic", "uFE9B",
- "thehmedialarabic", "uFE9C",
- "thereexists", "u2203",
- "therefore", "u2234",
- "theta", "u03B8",
- "theta1", "u03D1",
- "thetasymbolgreek", "u03D1",
- "thieuthacirclekorean", "u3279",
- "thieuthaparenkorean", "u3219",
- "thieuthcirclekorean", "u326B",
- "thieuthkorean", "u314C",
- "thieuthparenkorean", "u320B",
- "thirteencircle", "u246C",
- "thirteenparen", "u2480",
- "thirteenperiod", "u2494",
- "thonangmonthothai", "u0E11",
- "thook", "u01AD",
- "thophuthaothai", "u0E12",
- "thorn", "u00FE",
- "thothahanthai", "u0E17",
- "thothanthai", "u0E10",
- "thothongthai", "u0E18",
- "thothungthai", "u0E16",
- "thousandcyrillic", "u0482",
- "thousandsseparatorarabic", "u066C",
- "thousandsseparatorpersian", "u066C",
- "three", "u0033",
- "threearabic", "u0663",
- "threebengali", "u09E9",
- "threecircle", "u2462",
- "threecircleinversesansserif", "u278C",
- "threedeva", "u0969",
- "threeeighths", "u215C",
- "threegujarati", "u0AE9",
- "threegurmukhi", "u0A69",
- "threehackarabic", "u0663",
- "threehangzhou", "u3023",
- "threeideographicparen", "u3222",
- "threeinferior", "u2083",
- "threemonospace", "uFF13",
- "threenumeratorbengali", "u09F6",
- "threeparen", "u2476",
- "threeperiod", "u248A",
- "threepersian", "u06F3",
- "threequarters", "u00BE",
- "threeroman", "u2172",
- "threesuperior", "u00B3",
- "threethai", "u0E53",
- "thzsquare", "u3394",
- "tihiragana", "u3061",
- "tikatakana", "u30C1",
- "tikatakanahalfwidth", "uFF81",
- "tikeutacirclekorean", "u3270",
- "tikeutaparenkorean", "u3210",
- "tikeutcirclekorean", "u3262",
- "tikeutkorean", "u3137",
- "tikeutparenkorean", "u3202",
- "tilde", "u02DC",
- "tildebelowcmb", "u0330",
- "tildecmb", "u0303",
- "tildecomb", "u0303",
- "tildedoublecmb", "u0360",
- "tildeoperator", "u223C",
- "tildeoverlaycmb", "u0334",
- "tildeverticalcmb", "u033E",
- "timescircle", "u2297",
- "tipehahebrew", "u0596",
- "tipehalefthebrew", "u0596",
- "tippigurmukhi", "u0A70",
- "titlocyrilliccmb", "u0483",
- "tiwnarmenian", "u057F",
- "tlinebelow", "u1E6F",
- "tmonospace", "uFF54",
- "toarmenian", "u0569",
- "tohiragana", "u3068",
- "tokatakana", "u30C8",
- "tokatakanahalfwidth", "uFF84",
- "tonebarextrahighmod", "u02E5",
- "tonebarextralowmod", "u02E9",
- "tonebarhighmod", "u02E6",
- "tonebarlowmod", "u02E8",
- "tonebarmidmod", "u02E7",
- "tonefive", "u01BD",
- "tonesix", "u0185",
- "tonetwo", "u01A8",
- "tonos", "u0384",
- "tonsquare", "u3327",
- "topatakthai", "u0E0F",
- "tortoiseshellbracketleft", "u3014",
- "tortoiseshellbracketleftsmall", "uFE5D",
- "tortoiseshellbracketleftvertical", "uFE39",
- "tortoiseshellbracketright", "u3015",
- "tortoiseshellbracketrightsmall", "uFE5E",
- "tortoiseshellbracketrightvertical", "uFE3A",
- "totaothai", "u0E15",
- "tpalatalhook", "u01AB",
- "tparen", "u24AF",
- "trademark", "u2122",
- "tretroflexhook", "u0288",
- "triagdn", "u25BC",
- "triaglf", "u25C4",
- "triagrt", "u25BA",
- "triagup", "u25B2",
- "ts", "u02A6",
- "tsadi", "u05E6",
- "tsadidagesh", "uFB46",
- "tsadidageshhebrew", "uFB46",
- "tsadihebrew", "u05E6",
- "tsecyrillic", "u0446",
- "tsere", "u05B5",
- "tsere12", "u05B5",
- "tsere1e", "u05B5",
- "tsere2b", "u05B5",
- "tserehebrew", "u05B5",
- "tserenarrowhebrew", "u05B5",
- "tserequarterhebrew", "u05B5",
- "tserewidehebrew", "u05B5",
- "tshecyrillic", "u045B",
- "ttabengali", "u099F",
- "ttadeva", "u091F",
- "ttagujarati", "u0A9F",
- "ttagurmukhi", "u0A1F",
- "tteharabic", "u0679",
- "ttehfinalarabic", "uFB67",
- "ttehinitialarabic", "uFB68",
- "ttehmedialarabic", "uFB69",
- "tthabengali", "u09A0",
- "tthadeva", "u0920",
- "tthagujarati", "u0AA0",
- "tthagurmukhi", "u0A20",
- "tturned", "u0287",
- "tuhiragana", "u3064",
- "tukatakana", "u30C4",
- "tukatakanahalfwidth", "uFF82",
- "tusmallhiragana", "u3063",
- "tusmallkatakana", "u30C3",
- "tusmallkatakanahalfwidth", "uFF6F",
- "twelvecircle", "u246B",
- "twelveparen", "u247F",
- "twelveperiod", "u2493",
- "twelveroman", "u217B",
- "twentycircle", "u2473",
- "twentyhangzhou", "u5344",
- "twentyparen", "u2487",
- "twentyperiod", "u249B",
- "two", "u0032",
- "twoarabic", "u0662",
- "twobengali", "u09E8",
- "twocircle", "u2461",
- "twocircleinversesansserif", "u278B",
- "twodeva", "u0968",
- "twodotenleader", "u2025",
- "twodotleader", "u2025",
- "twodotleadervertical", "uFE30",
- "twogujarati", "u0AE8",
- "twogurmukhi", "u0A68",
- "twohackarabic", "u0662",
- "twohangzhou", "u3022",
- "twoideographicparen", "u3221",
- "twoinferior", "u2082",
- "twomonospace", "uFF12",
- "twonumeratorbengali", "u09F5",
- "twoparen", "u2475",
- "twoperiod", "u2489",
- "twopersian", "u06F2",
- "tworoman", "u2171",
- "twostroke", "u01BB",
- "twosuperior", "u00B2",
- "twothai", "u0E52",
- "twothirds", "u2154",
- "u", "u0075",
- "uacute", "u00FA",
- "ubar", "u0289",
- "ubengali", "u0989",
- "ubopomofo", "u3128",
- "ubreve", "u016D",
- "ucaron", "u01D4",
- "ucircle", "u24E4",
- "ucircumflex", "u00FB",
- "ucircumflexbelow", "u1E77",
- "ucyrillic", "u0443",
- "udattadeva", "u0951",
- "udblacute", "u0171",
- "udblgrave", "u0215",
- "udeva", "u0909",
- "udieresis", "u00FC",
- "udieresisacute", "u01D8",
- "udieresisbelow", "u1E73",
- "udieresiscaron", "u01DA",
- "udieresiscyrillic", "u04F1",
- "udieresisgrave", "u01DC",
- "udieresismacron", "u01D6",
- "udotbelow", "u1EE5",
- "ugrave", "u00F9",
- "ugujarati", "u0A89",
- "ugurmukhi", "u0A09",
- "uhiragana", "u3046",
- "uhookabove", "u1EE7",
- "uhorn", "u01B0",
- "uhornacute", "u1EE9",
- "uhorndotbelow", "u1EF1",
- "uhorngrave", "u1EEB",
- "uhornhookabove", "u1EED",
- "uhorntilde", "u1EEF",
- "uhungarumlaut", "u0171",
- "uhungarumlautcyrillic", "u04F3",
- "uinvertedbreve", "u0217",
- "ukatakana", "u30A6",
- "ukatakanahalfwidth", "uFF73",
- "ukcyrillic", "u0479",
- "ukorean", "u315C",
- "umacron", "u016B",
- "umacroncyrillic", "u04EF",
- "umacrondieresis", "u1E7B",
- "umatragurmukhi", "u0A41",
- "umonospace", "uFF55",
- "underscore", "u005F",
- "underscoredbl", "u2017",
- "underscoremonospace", "uFF3F",
- "underscorevertical", "uFE33",
- "underscorewavy", "uFE4F",
- "union", "u222A",
- "universal", "u2200",
- "uogonek", "u0173",
- "uparen", "u24B0",
- "upblock", "u2580",
- "upperdothebrew", "u05C4",
- "upsilon", "u03C5",
- "upsilondieresis", "u03CB",
- "upsilondieresistonos", "u03B0",
- "upsilonlatin", "u028A",
- "upsilontonos", "u03CD",
- "uptackbelowcmb", "u031D",
- "uptackmod", "u02D4",
- "uragurmukhi", "u0A73",
- "uring", "u016F",
- "ushortcyrillic", "u045E",
- "usmallhiragana", "u3045",
- "usmallkatakana", "u30A5",
- "usmallkatakanahalfwidth", "uFF69",
- "ustraightcyrillic", "u04AF",
- "ustraightstrokecyrillic", "u04B1",
- "utilde", "u0169",
- "utildeacute", "u1E79",
- "utildebelow", "u1E75",
- "uubengali", "u098A",
- "uudeva", "u090A",
- "uugujarati", "u0A8A",
- "uugurmukhi", "u0A0A",
- "uumatragurmukhi", "u0A42",
- "uuvowelsignbengali", "u09C2",
- "uuvowelsigndeva", "u0942",
- "uuvowelsigngujarati", "u0AC2",
- "uvowelsignbengali", "u09C1",
- "uvowelsigndeva", "u0941",
- "uvowelsigngujarati", "u0AC1",
- "v", "u0076",
- "vadeva", "u0935",
- "vagujarati", "u0AB5",
- "vagurmukhi", "u0A35",
- "vakatakana", "u30F7",
- "vav", "u05D5",
- "vavdagesh", "uFB35",
- "vavdagesh65", "uFB35",
- "vavdageshhebrew", "uFB35",
- "vavhebrew", "u05D5",
- "vavholam", "uFB4B",
- "vavholamhebrew", "uFB4B",
- "vavvavhebrew", "u05F0",
- "vavyodhebrew", "u05F1",
- "vcircle", "u24E5",
- "vdotbelow", "u1E7F",
- "vecyrillic", "u0432",
- "veharabic", "u06A4",
- "vehfinalarabic", "uFB6B",
- "vehinitialarabic", "uFB6C",
- "vehmedialarabic", "uFB6D",
- "vekatakana", "u30F9",
- "venus", "u2640",
- "verticalbar", "u007C",
- "verticallineabovecmb", "u030D",
- "verticallinebelowcmb", "u0329",
- "verticallinelowmod", "u02CC",
- "verticallinemod", "u02C8",
- "vewarmenian", "u057E",
- "vhook", "u028B",
- "vikatakana", "u30F8",
- "viramabengali", "u09CD",
- "viramadeva", "u094D",
- "viramagujarati", "u0ACD",
- "visargabengali", "u0983",
- "visargadeva", "u0903",
- "visargagujarati", "u0A83",
- "vmonospace", "uFF56",
- "voarmenian", "u0578",
- "voicediterationhiragana", "u309E",
- "voicediterationkatakana", "u30FE",
- "voicedmarkkana", "u309B",
- "voicedmarkkanahalfwidth", "uFF9E",
- "vokatakana", "u30FA",
- "vparen", "u24B1",
- "vtilde", "u1E7D",
- "vturned", "u028C",
- "vuhiragana", "u3094",
- "vukatakana", "u30F4",
- "w", "u0077",
- "wacute", "u1E83",
- "waekorean", "u3159",
- "wahiragana", "u308F",
- "wakatakana", "u30EF",
- "wakatakanahalfwidth", "uFF9C",
- "wakorean", "u3158",
- "wasmallhiragana", "u308E",
- "wasmallkatakana", "u30EE",
- "wattosquare", "u3357",
- "wavedash", "u301C",
- "wavyunderscorevertical", "uFE34",
- "wawarabic", "u0648",
- "wawfinalarabic", "uFEEE",
- "wawhamzaabovearabic", "u0624",
- "wawhamzaabovefinalarabic", "uFE86",
- "wbsquare", "u33DD",
- "wcircle", "u24E6",
- "wcircumflex", "u0175",
- "wdieresis", "u1E85",
- "wdotaccent", "u1E87",
- "wdotbelow", "u1E89",
- "wehiragana", "u3091",
- "weierstrass", "u2118",
- "wekatakana", "u30F1",
- "wekorean", "u315E",
- "weokorean", "u315D",
- "wgrave", "u1E81",
- "whitebullet", "u25E6",
- "whitecircle", "u25CB",
- "whitecircleinverse", "u25D9",
- "whitecornerbracketleft", "u300E",
- "whitecornerbracketleftvertical", "uFE43",
- "whitecornerbracketright", "u300F",
- "whitecornerbracketrightvertical", "uFE44",
- "whitediamond", "u25C7",
- "whitediamondcontainingblacksmalldiamond", "u25C8",
- "whitedownpointingsmalltriangle", "u25BF",
- "whitedownpointingtriangle", "u25BD",
- "whiteleftpointingsmalltriangle", "u25C3",
- "whiteleftpointingtriangle", "u25C1",
- "whitelenticularbracketleft", "u3016",
- "whitelenticularbracketright", "u3017",
- "whiterightpointingsmalltriangle", "u25B9",
- "whiterightpointingtriangle", "u25B7",
- "whitesmallsquare", "u25AB",
- "whitesmilingface", "u263A",
- "whitesquare", "u25A1",
- "whitestar", "u2606",
- "whitetelephone", "u260F",
- "whitetortoiseshellbracketleft", "u3018",
- "whitetortoiseshellbracketright", "u3019",
- "whiteuppointingsmalltriangle", "u25B5",
- "whiteuppointingtriangle", "u25B3",
- "wihiragana", "u3090",
- "wikatakana", "u30F0",
- "wikorean", "u315F",
- "wmonospace", "uFF57",
- "wohiragana", "u3092",
- "wokatakana", "u30F2",
- "wokatakanahalfwidth", "uFF66",
- "won", "u20A9",
- "wonmonospace", "uFFE6",
- "wowaenthai", "u0E27",
- "wparen", "u24B2",
- "wring", "u1E98",
- "wsuperior", "u02B7",
- "wturned", "u028D",
- "wynn", "u01BF",
- "x", "u0078",
- "xabovecmb", "u033D",
- "xbopomofo", "u3112",
- "xcircle", "u24E7",
- "xdieresis", "u1E8D",
- "xdotaccent", "u1E8B",
- "xeharmenian", "u056D",
- "xi", "u03BE",
- "xmonospace", "uFF58",
- "xparen", "u24B3",
- "xsuperior", "u02E3",
- "y", "u0079",
- "yaadosquare", "u334E",
- "yabengali", "u09AF",
- "yacute", "u00FD",
- "yadeva", "u092F",
- "yaekorean", "u3152",
- "yagujarati", "u0AAF",
- "yagurmukhi", "u0A2F",
- "yahiragana", "u3084",
- "yakatakana", "u30E4",
- "yakatakanahalfwidth", "uFF94",
- "yakorean", "u3151",
- "yamakkanthai", "u0E4E",
- "yasmallhiragana", "u3083",
- "yasmallkatakana", "u30E3",
- "yasmallkatakanahalfwidth", "uFF6C",
- "yatcyrillic", "u0463",
- "ycircle", "u24E8",
- "ycircumflex", "u0177",
- "ydieresis", "u00FF",
- "ydotaccent", "u1E8F",
- "ydotbelow", "u1EF5",
- "yeharabic", "u064A",
- "yehbarreearabic", "u06D2",
- "yehbarreefinalarabic", "uFBAF",
- "yehfinalarabic", "uFEF2",
- "yehhamzaabovearabic", "u0626",
- "yehhamzaabovefinalarabic", "uFE8A",
- "yehhamzaaboveinitialarabic", "uFE8B",
- "yehhamzaabovemedialarabic", "uFE8C",
- "yehinitialarabic", "uFEF3",
- "yehmedialarabic", "uFEF4",
- "yehmeeminitialarabic", "uFCDD",
- "yehmeemisolatedarabic", "uFC58",
- "yehnoonfinalarabic", "uFC94",
- "yehthreedotsbelowarabic", "u06D1",
- "yekorean", "u3156",
- "yen", "u00A5",
- "yenmonospace", "uFFE5",
- "yeokorean", "u3155",
- "yeorinhieuhkorean", "u3186",
- "yerahbenyomohebrew", "u05AA",
- "yerahbenyomolefthebrew", "u05AA",
- "yericyrillic", "u044B",
- "yerudieresiscyrillic", "u04F9",
- "yesieungkorean", "u3181",
- "yesieungpansioskorean", "u3183",
- "yesieungsioskorean", "u3182",
- "yetivhebrew", "u059A",
- "ygrave", "u1EF3",
- "yhook", "u01B4",
- "yhookabove", "u1EF7",
- "yiarmenian", "u0575",
- "yicyrillic", "u0457",
- "yikorean", "u3162",
- "yinyang", "u262F",
- "yiwnarmenian", "u0582",
- "ymonospace", "uFF59",
- "yod", "u05D9",
- "yoddagesh", "uFB39",
- "yoddageshhebrew", "uFB39",
- "yodhebrew", "u05D9",
- "yodyodhebrew", "u05F2",
- "yodyodpatahhebrew", "uFB1F",
- "yohiragana", "u3088",
- "yoikorean", "u3189",
- "yokatakana", "u30E8",
- "yokatakanahalfwidth", "uFF96",
- "yokorean", "u315B",
- "yosmallhiragana", "u3087",
- "yosmallkatakana", "u30E7",
- "yosmallkatakanahalfwidth", "uFF6E",
- "yotgreek", "u03F3",
- "yoyaekorean", "u3188",
- "yoyakorean", "u3187",
- "yoyakthai", "u0E22",
- "yoyingthai", "u0E0D",
- "yparen", "u24B4",
- "ypogegrammeni", "u037A",
- "ypogegrammenigreekcmb", "u0345",
- "yr", "u01A6",
- "yring", "u1E99",
- "ysuperior", "u02B8",
- "ytilde", "u1EF9",
- "yturned", "u028E",
- "yuhiragana", "u3086",
- "yuikorean", "u318C",
- "yukatakana", "u30E6",
- "yukatakanahalfwidth", "uFF95",
- "yukorean", "u3160",
- "yusbigcyrillic", "u046B",
- "yusbigiotifiedcyrillic", "u046D",
- "yuslittlecyrillic", "u0467",
- "yuslittleiotifiedcyrillic", "u0469",
- "yusmallhiragana", "u3085",
- "yusmallkatakana", "u30E5",
- "yusmallkatakanahalfwidth", "uFF6D",
- "yuyekorean", "u318B",
- "yuyeokorean", "u318A",
- "yyabengali", "u09DF",
- "yyadeva", "u095F",
- "z", "u007A",
- "zaarmenian", "u0566",
- "zacute", "u017A",
- "zadeva", "u095B",
- "zagurmukhi", "u0A5B",
- "zaharabic", "u0638",
- "zahfinalarabic", "uFEC6",
- "zahinitialarabic", "uFEC7",
- "zahiragana", "u3056",
- "zahmedialarabic", "uFEC8",
- "zainarabic", "u0632",
- "zainfinalarabic", "uFEB0",
- "zakatakana", "u30B6",
- "zaqefgadolhebrew", "u0595",
- "zaqefqatanhebrew", "u0594",
- "zarqahebrew", "u0598",
- "zayin", "u05D6",
- "zayindagesh", "uFB36",
- "zayindageshhebrew", "uFB36",
- "zayinhebrew", "u05D6",
- "zbopomofo", "u3117",
- "zcaron", "u017E",
- "zcircle", "u24E9",
- "zcircumflex", "u1E91",
- "zcurl", "u0291",
- "zdot", "u017C",
- "zdotaccent", "u017C",
- "zdotbelow", "u1E93",
- "zecyrillic", "u0437",
- "zedescendercyrillic", "u0499",
- "zedieresiscyrillic", "u04DF",
- "zehiragana", "u305C",
- "zekatakana", "u30BC",
- "zero", "u0030",
- "zeroarabic", "u0660",
- "zerobengali", "u09E6",
- "zerodeva", "u0966",
- "zerogujarati", "u0AE6",
- "zerogurmukhi", "u0A66",
- "zerohackarabic", "u0660",
- "zeroinferior", "u2080",
- "zeromonospace", "uFF10",
- "zeropersian", "u06F0",
- "zerosuperior", "u2070",
- "zerothai", "u0E50",
- "zerowidthjoiner", "uFEFF",
- "zerowidthnonjoiner", "u200C",
- "zerowidthspace", "u200B",
- "zeta", "u03B6",
- "zhbopomofo", "u3113",
- "zhearmenian", "u056A",
- "zhebrevecyrillic", "u04C2",
- "zhecyrillic", "u0436",
- "zhedescendercyrillic", "u0497",
- "zhedieresiscyrillic", "u04DD",
- "zihiragana", "u3058",
- "zikatakana", "u30B8",
- "zinorhebrew", "u05AE",
- "zlinebelow", "u1E95",
- "zmonospace", "uFF5A",
- "zohiragana", "u305E",
- "zokatakana", "u30BE",
- "zparen", "u24B5",
- "zretroflexhook", "u0290",
- "zstroke", "u01B6",
- "zuhiragana", "u305A",
- "zukatakana", "u30BA",
+my %AGL_to_unicode = (
+ "A", "0041",
+ "AE", "00C6",
+ "AEacute", "01FC",
+ "AEmacron", "01E2",
+ "Aacute", "00C1",
+ "Abreve", "0102",
+ "Abreveacute", "1EAE",
+ "Abrevecyrillic", "04D0",
+ "Abrevedotbelow", "1EB6",
+ "Abrevegrave", "1EB0",
+ "Abrevehookabove", "1EB2",
+ "Abrevetilde", "1EB4",
+ "Acaron", "01CD",
+ "Acircle", "24B6",
+ "Acircumflex", "00C2",
+ "Acircumflexacute", "1EA4",
+ "Acircumflexdotbelow", "1EAC",
+ "Acircumflexgrave", "1EA6",
+ "Acircumflexhookabove", "1EA8",
+ "Acircumflextilde", "1EAA",
+ "Acyrillic", "0410",
+ "Adblgrave", "0200",
+ "Adieresis", "00C4",
+ "Adieresiscyrillic", "04D2",
+ "Adieresismacron", "01DE",
+ "Adotbelow", "1EA0",
+ "Adotmacron", "01E0",
+ "Agrave", "00C0",
+ "Ahookabove", "1EA2",
+ "Aiecyrillic", "04D4",
+ "Ainvertedbreve", "0202",
+ "Alpha", "0391",
+ "Alphatonos", "0386",
+ "Amacron", "0100",
+ "Amonospace", "FF21",
+ "Aogonek", "0104",
+ "Aring", "00C5",
+ "Aringacute", "01FA",
+ "Aringbelow", "1E00",
+ "Atilde", "00C3",
+ "Aybarmenian", "0531",
+ "B", "0042",
+ "Bcircle", "24B7",
+ "Bdotaccent", "1E02",
+ "Bdotbelow", "1E04",
+ "Becyrillic", "0411",
+ "Benarmenian", "0532",
+ "Beta", "0392",
+ "Bhook", "0181",
+ "Blinebelow", "1E06",
+ "Bmonospace", "FF22",
+ "Btopbar", "0182",
+ "C", "0043",
+ "Caarmenian", "053E",
+ "Cacute", "0106",
+ "Ccaron", "010C",
+ "Ccedilla", "00C7",
+ "Ccedillaacute", "1E08",
+ "Ccircle", "24B8",
+ "Ccircumflex", "0108",
+ "Cdot", "010A",
+ "Cdotaccent", "010A",
+ "Chaarmenian", "0549",
+ "Cheabkhasiancyrillic", "04BC",
+ "Checyrillic", "0427",
+ "Chedescenderabkhasiancyrillic", "04BE",
+ "Chedescendercyrillic", "04B6",
+ "Chedieresiscyrillic", "04F4",
+ "Cheharmenian", "0543",
+ "Chekhakassiancyrillic", "04CB",
+ "Cheverticalstrokecyrillic", "04B8",
+ "Chi", "03A7",
+ "Chook", "0187",
+ "Cmonospace", "FF23",
+ "Coarmenian", "0551",
+ "D", "0044",
+ "DZ", "01F1",
+ "DZcaron", "01C4",
+ "Daarmenian", "0534",
+ "Dafrican", "0189",
+ "Dcaron", "010E",
+ "Dcedilla", "1E10",
+ "Dcircle", "24B9",
+ "Dcircumflexbelow", "1E12",
+ "Dcroat", "0110",
+ "Ddotaccent", "1E0A",
+ "Ddotbelow", "1E0C",
+ "Decyrillic", "0414",
+ "Deicoptic", "03EE",
+ "Delta", "2206",
+ "Deltagreek", "0394",
+ "Dhook", "018A",
+ "Digammagreek", "03DC",
+ "Djecyrillic", "0402",
+ "Dlinebelow", "1E0E",
+ "Dmonospace", "FF24",
+ "Dslash", "0110",
+ "Dtopbar", "018B",
+ "Dz", "01F2",
+ "Dzcaron", "01C5",
+ "Dzeabkhasiancyrillic", "04E0",
+ "Dzecyrillic", "0405",
+ "Dzhecyrillic", "040F",
+ "E", "0045",
+ "Eacute", "00C9",
+ "Ebreve", "0114",
+ "Ecaron", "011A",
+ "Ecedillabreve", "1E1C",
+ "Echarmenian", "0535",
+ "Ecircle", "24BA",
+ "Ecircumflex", "00CA",
+ "Ecircumflexacute", "1EBE",
+ "Ecircumflexbelow", "1E18",
+ "Ecircumflexdotbelow", "1EC6",
+ "Ecircumflexgrave", "1EC0",
+ "Ecircumflexhookabove", "1EC2",
+ "Ecircumflextilde", "1EC4",
+ "Ecyrillic", "0404",
+ "Edblgrave", "0204",
+ "Edieresis", "00CB",
+ "Edot", "0116",
+ "Edotaccent", "0116",
+ "Edotbelow", "1EB8",
+ "Efcyrillic", "0424",
+ "Egrave", "00C8",
+ "Eharmenian", "0537",
+ "Ehookabove", "1EBA",
+ "Eightroman", "2167",
+ "Einvertedbreve", "0206",
+ "Eiotifiedcyrillic", "0464",
+ "Elcyrillic", "041B",
+ "Elevenroman", "216A",
+ "Emacron", "0112",
+ "Emacronacute", "1E16",
+ "Emacrongrave", "1E14",
+ "Emcyrillic", "041C",
+ "Emonospace", "FF25",
+ "Encyrillic", "041D",
+ "Endescendercyrillic", "04A2",
+ "Eng", "014A",
+ "Enghecyrillic", "04A4",
+ "Enhookcyrillic", "04C7",
+ "Eogonek", "0118",
+ "Eopen", "0190",
+ "Epsilon", "0395",
+ "Epsilontonos", "0388",
+ "Ercyrillic", "0420",
+ "Ereversed", "018E",
+ "Ereversedcyrillic", "042D",
+ "Escyrillic", "0421",
+ "Esdescendercyrillic", "04AA",
+ "Esh", "01A9",
+ "Eta", "0397",
+ "Etarmenian", "0538",
+ "Etatonos", "0389",
+ "Eth", "00D0",
+ "Etilde", "1EBC",
+ "Etildebelow", "1E1A",
+ "Euro", "20AC",
+ "Ezh", "01B7",
+ "Ezhcaron", "01EE",
+ "Ezhreversed", "01B8",
+ "F", "0046",
+ "Fcircle", "24BB",
+ "Fdotaccent", "1E1E",
+ "Feharmenian", "0556",
+ "Feicoptic", "03E4",
+ "Fhook", "0191",
+ "Fitacyrillic", "0472",
+ "Fiveroman", "2164",
+ "Fmonospace", "FF26",
+ "Fourroman", "2163",
+ "G", "0047",
+ "GBsquare", "3387",
+ "Gacute", "01F4",
+ "Gamma", "0393",
+ "Gammaafrican", "0194",
+ "Gangiacoptic", "03EA",
+ "Gbreve", "011E",
+ "Gcaron", "01E6",
+ "Gcedilla", "0122",
+ "Gcircle", "24BC",
+ "Gcircumflex", "011C",
+ "Gcommaaccent", "0122",
+ "Gdot", "0120",
+ "Gdotaccent", "0120",
+ "Gecyrillic", "0413",
+ "Ghadarmenian", "0542",
+ "Ghemiddlehookcyrillic", "0494",
+ "Ghestrokecyrillic", "0492",
+ "Gheupturncyrillic", "0490",
+ "Ghook", "0193",
+ "Gimarmenian", "0533",
+ "Gjecyrillic", "0403",
+ "Gmacron", "1E20",
+ "Gmonospace", "FF27",
+ "Gsmallhook", "029B",
+ "Gstroke", "01E4",
+ "H", "0048",
+ "H18533", "25CF",
+ "H18543", "25AA",
+ "H18551", "25AB",
+ "H22073", "25A1",
+ "HPsquare", "33CB",
+ "Haabkhasiancyrillic", "04A8",
+ "Hadescendercyrillic", "04B2",
+ "Hardsigncyrillic", "042A",
+ "Hbar", "0126",
+ "Hbrevebelow", "1E2A",
+ "Hcedilla", "1E28",
+ "Hcircle", "24BD",
+ "Hcircumflex", "0124",
+ "Hdieresis", "1E26",
+ "Hdotaccent", "1E22",
+ "Hdotbelow", "1E24",
+ "Hmonospace", "FF28",
+ "Hoarmenian", "0540",
+ "Horicoptic", "03E8",
+ "Hzsquare", "3390",
+ "I", "0049",
+ "IAcyrillic", "042F",
+ "IJ", "0132",
+ "IUcyrillic", "042E",
+ "Iacute", "00CD",
+ "Ibreve", "012C",
+ "Icaron", "01CF",
+ "Icircle", "24BE",
+ "Icircumflex", "00CE",
+ "Icyrillic", "0406",
+ "Idblgrave", "0208",
+ "Idieresis", "00CF",
+ "Idieresisacute", "1E2E",
+ "Idieresiscyrillic", "04E4",
+ "Idot", "0130",
+ "Idotaccent", "0130",
+ "Idotbelow", "1ECA",
+ "Iebrevecyrillic", "04D6",
+ "Iecyrillic", "0415",
+ "Ifraktur", "2111",
+ "Igrave", "00CC",
+ "Ihookabove", "1EC8",
+ "Iicyrillic", "0418",
+ "Iinvertedbreve", "020A",
+ "Iishortcyrillic", "0419",
+ "Imacron", "012A",
+ "Imacroncyrillic", "04E2",
+ "Imonospace", "FF29",
+ "Iniarmenian", "053B",
+ "Iocyrillic", "0401",
+ "Iogonek", "012E",
+ "Iota", "0399",
+ "Iotaafrican", "0196",
+ "Iotadieresis", "03AA",
+ "Iotatonos", "038A",
+ "Istroke", "0197",
+ "Itilde", "0128",
+ "Itildebelow", "1E2C",
+ "Izhitsacyrillic", "0474",
+ "Izhitsadblgravecyrillic", "0476",
+ "J", "004A",
+ "Jaarmenian", "0541",
+ "Jcircle", "24BF",
+ "Jcircumflex", "0134",
+ "Jecyrillic", "0408",
+ "Jheharmenian", "054B",
+ "Jmonospace", "FF2A",
+ "K", "004B",
+ "KBsquare", "3385",
+ "KKsquare", "33CD",
+ "Kabashkircyrillic", "04A0",
+ "Kacute", "1E30",
+ "Kacyrillic", "041A",
+ "Kadescendercyrillic", "049A",
+ "Kahookcyrillic", "04C3",
+ "Kappa", "039A",
+ "Kastrokecyrillic", "049E",
+ "Kaverticalstrokecyrillic", "049C",
+ "Kcaron", "01E8",
+ "Kcedilla", "0136",
+ "Kcircle", "24C0",
+ "Kcommaaccent", "0136",
+ "Kdotbelow", "1E32",
+ "Keharmenian", "0554",
+ "Kenarmenian", "053F",
+ "Khacyrillic", "0425",
+ "Kheicoptic", "03E6",
+ "Khook", "0198",
+ "Kjecyrillic", "040C",
+ "Klinebelow", "1E34",
+ "Kmonospace", "FF2B",
+ "Koppacyrillic", "0480",
+ "Koppagreek", "03DE",
+ "Ksicyrillic", "046E",
+ "L", "004C",
+ "LJ", "01C7",
+ "Lacute", "0139",
+ "Lambda", "039B",
+ "Lcaron", "013D",
+ "Lcedilla", "013B",
+ "Lcircle", "24C1",
+ "Lcircumflexbelow", "1E3C",
+ "Lcommaaccent", "013B",
+ "Ldot", "013F",
+ "Ldotaccent", "013F",
+ "Ldotbelow", "1E36",
+ "Ldotbelowmacron", "1E38",
+ "Liwnarmenian", "053C",
+ "Lj", "01C8",
+ "Ljecyrillic", "0409",
+ "Llinebelow", "1E3A",
+ "Lmonospace", "FF2C",
+ "Lslash", "0141",
+ "M", "004D",
+ "MBsquare", "3386",
+ "Macute", "1E3E",
+ "Mcircle", "24C2",
+ "Mdotaccent", "1E40",
+ "Mdotbelow", "1E42",
+ "Menarmenian", "0544",
+ "Mmonospace", "FF2D",
+ "Mturned", "019C",
+ "Mu", "039C",
+ "N", "004E",
+ "NJ", "01CA",
+ "Nacute", "0143",
+ "Ncaron", "0147",
+ "Ncedilla", "0145",
+ "Ncircle", "24C3",
+ "Ncircumflexbelow", "1E4A",
+ "Ncommaaccent", "0145",
+ "Ndotaccent", "1E44",
+ "Ndotbelow", "1E46",
+ "Nhookleft", "019D",
+ "Nineroman", "2168",
+ "Nj", "01CB",
+ "Njecyrillic", "040A",
+ "Nlinebelow", "1E48",
+ "Nmonospace", "FF2E",
+ "Nowarmenian", "0546",
+ "Ntilde", "00D1",
+ "Nu", "039D",
+ "O", "004F",
+ "OE", "0152",
+ "Oacute", "00D3",
+ "Obarredcyrillic", "04E8",
+ "Obarreddieresiscyrillic", "04EA",
+ "Obreve", "014E",
+ "Ocaron", "01D1",
+ "Ocenteredtilde", "019F",
+ "Ocircle", "24C4",
+ "Ocircumflex", "00D4",
+ "Ocircumflexacute", "1ED0",
+ "Ocircumflexdotbelow", "1ED8",
+ "Ocircumflexgrave", "1ED2",
+ "Ocircumflexhookabove", "1ED4",
+ "Ocircumflextilde", "1ED6",
+ "Ocyrillic", "041E",
+ "Odblacute", "0150",
+ "Odblgrave", "020C",
+ "Odieresis", "00D6",
+ "Odieresiscyrillic", "04E6",
+ "Odotbelow", "1ECC",
+ "Ograve", "00D2",
+ "Oharmenian", "0555",
+ "Ohm", "2126",
+ "Ohookabove", "1ECE",
+ "Ohorn", "01A0",
+ "Ohornacute", "1EDA",
+ "Ohorndotbelow", "1EE2",
+ "Ohorngrave", "1EDC",
+ "Ohornhookabove", "1EDE",
+ "Ohorntilde", "1EE0",
+ "Ohungarumlaut", "0150",
+ "Oi", "01A2",
+ "Oinvertedbreve", "020E",
+ "Omacron", "014C",
+ "Omacronacute", "1E52",
+ "Omacrongrave", "1E50",
+ "Omega", "2126",
+ "Omegacyrillic", "0460",
+ "Omegagreek", "03A9",
+ "Omegaroundcyrillic", "047A",
+ "Omegatitlocyrillic", "047C",
+ "Omegatonos", "038F",
+ "Omicron", "039F",
+ "Omicrontonos", "038C",
+ "Omonospace", "FF2F",
+ "Oneroman", "2160",
+ "Oogonek", "01EA",
+ "Oogonekmacron", "01EC",
+ "Oopen", "0186",
+ "Oslash", "00D8",
+ "Oslashacute", "01FE",
+ "Ostrokeacute", "01FE",
+ "Otcyrillic", "047E",
+ "Otilde", "00D5",
+ "Otildeacute", "1E4C",
+ "Otildedieresis", "1E4E",
+ "P", "0050",
+ "Pacute", "1E54",
+ "Pcircle", "24C5",
+ "Pdotaccent", "1E56",
+ "Pecyrillic", "041F",
+ "Peharmenian", "054A",
+ "Pemiddlehookcyrillic", "04A6",
+ "Phi", "03A6",
+ "Phook", "01A4",
+ "Pi", "03A0",
+ "Piwrarmenian", "0553",
+ "Pmonospace", "FF30",
+ "Psi", "03A8",
+ "Psicyrillic", "0470",
+ "Q", "0051",
+ "Qcircle", "24C6",
+ "Qmonospace", "FF31",
+ "R", "0052",
+ "Raarmenian", "054C",
+ "Racute", "0154",
+ "Rcaron", "0158",
+ "Rcedilla", "0156",
+ "Rcircle", "24C7",
+ "Rcommaaccent", "0156",
+ "Rdblgrave", "0210",
+ "Rdotaccent", "1E58",
+ "Rdotbelow", "1E5A",
+ "Rdotbelowmacron", "1E5C",
+ "Reharmenian", "0550",
+ "Rfraktur", "211C",
+ "Rho", "03A1",
+ "Rinvertedbreve", "0212",
+ "Rlinebelow", "1E5E",
+ "Rmonospace", "FF32",
+ "Rsmallinverted", "0281",
+ "Rsmallinvertedsuperior", "02B6",
+ "S", "0053",
+ "SF010000", "250C",
+ "SF020000", "2514",
+ "SF030000", "2510",
+ "SF040000", "2518",
+ "SF050000", "253C",
+ "SF060000", "252C",
+ "SF070000", "2534",
+ "SF080000", "251C",
+ "SF090000", "2524",
+ "SF100000", "2500",
+ "SF110000", "2502",
+ "SF190000", "2561",
+ "SF200000", "2562",
+ "SF210000", "2556",
+ "SF220000", "2555",
+ "SF230000", "2563",
+ "SF240000", "2551",
+ "SF250000", "2557",
+ "SF260000", "255D",
+ "SF270000", "255C",
+ "SF280000", "255B",
+ "SF360000", "255E",
+ "SF370000", "255F",
+ "SF380000", "255A",
+ "SF390000", "2554",
+ "SF400000", "2569",
+ "SF410000", "2566",
+ "SF420000", "2560",
+ "SF430000", "2550",
+ "SF440000", "256C",
+ "SF450000", "2567",
+ "SF460000", "2568",
+ "SF470000", "2564",
+ "SF480000", "2565",
+ "SF490000", "2559",
+ "SF500000", "2558",
+ "SF510000", "2552",
+ "SF520000", "2553",
+ "SF530000", "256B",
+ "SF540000", "256A",
+ "Sacute", "015A",
+ "Sacutedotaccent", "1E64",
+ "Sampigreek", "03E0",
+ "Scaron", "0160",
+ "Scarondotaccent", "1E66",
+ "Scedilla", "015E",
+ "Schwa", "018F",
+ "Schwacyrillic", "04D8",
+ "Schwadieresiscyrillic", "04DA",
+ "Scircle", "24C8",
+ "Scircumflex", "015C",
+ "Scommaaccent", "0218",
+ "Sdotaccent", "1E60",
+ "Sdotbelow", "1E62",
+ "Sdotbelowdotaccent", "1E68",
+ "Seharmenian", "054D",
+ "Sevenroman", "2166",
+ "Shaarmenian", "0547",
+ "Shacyrillic", "0428",
+ "Shchacyrillic", "0429",
+ "Sheicoptic", "03E2",
+ "Shhacyrillic", "04BA",
+ "Shimacoptic", "03EC",
+ "Sigma", "03A3",
+ "Sixroman", "2165",
+ "Smonospace", "FF33",
+ "Softsigncyrillic", "042C",
+ "Stigmagreek", "03DA",
+ "T", "0054",
+ "Tau", "03A4",
+ "Tbar", "0166",
+ "Tcaron", "0164",
+ "Tcedilla", "0162",
+ "Tcircle", "24C9",
+ "Tcircumflexbelow", "1E70",
+ "Tcommaaccent", "0162",
+ "Tdotaccent", "1E6A",
+ "Tdotbelow", "1E6C",
+ "Tecyrillic", "0422",
+ "Tedescendercyrillic", "04AC",
+ "Tenroman", "2169",
+ "Tetsecyrillic", "04B4",
+ "Theta", "0398",
+ "Thook", "01AC",
+ "Thorn", "00DE",
+ "Threeroman", "2162",
+ "Tiwnarmenian", "054F",
+ "Tlinebelow", "1E6E",
+ "Tmonospace", "FF34",
+ "Toarmenian", "0539",
+ "Tonefive", "01BC",
+ "Tonesix", "0184",
+ "Tonetwo", "01A7",
+ "Tretroflexhook", "01AE",
+ "Tsecyrillic", "0426",
+ "Tshecyrillic", "040B",
+ "Twelveroman", "216B",
+ "Tworoman", "2161",
+ "U", "0055",
+ "Uacute", "00DA",
+ "Ubreve", "016C",
+ "Ucaron", "01D3",
+ "Ucircle", "24CA",
+ "Ucircumflex", "00DB",
+ "Ucircumflexbelow", "1E76",
+ "Ucyrillic", "0423",
+ "Udblacute", "0170",
+ "Udblgrave", "0214",
+ "Udieresis", "00DC",
+ "Udieresisacute", "01D7",
+ "Udieresisbelow", "1E72",
+ "Udieresiscaron", "01D9",
+ "Udieresiscyrillic", "04F0",
+ "Udieresisgrave", "01DB",
+ "Udieresismacron", "01D5",
+ "Udotbelow", "1EE4",
+ "Ugrave", "00D9",
+ "Uhookabove", "1EE6",
+ "Uhorn", "01AF",
+ "Uhornacute", "1EE8",
+ "Uhorndotbelow", "1EF0",
+ "Uhorngrave", "1EEA",
+ "Uhornhookabove", "1EEC",
+ "Uhorntilde", "1EEE",
+ "Uhungarumlaut", "0170",
+ "Uhungarumlautcyrillic", "04F2",
+ "Uinvertedbreve", "0216",
+ "Ukcyrillic", "0478",
+ "Umacron", "016A",
+ "Umacroncyrillic", "04EE",
+ "Umacrondieresis", "1E7A",
+ "Umonospace", "FF35",
+ "Uogonek", "0172",
+ "Upsilon", "03A5",
+ "Upsilon1", "03D2",
+ "Upsilonacutehooksymbolgreek", "03D3",
+ "Upsilonafrican", "01B1",
+ "Upsilondieresis", "03AB",
+ "Upsilondieresishooksymbolgreek", "03D4",
+ "Upsilonhooksymbol", "03D2",
+ "Upsilontonos", "038E",
+ "Uring", "016E",
+ "Ushortcyrillic", "040E",
+ "Ustraightcyrillic", "04AE",
+ "Ustraightstrokecyrillic", "04B0",
+ "Utilde", "0168",
+ "Utildeacute", "1E78",
+ "Utildebelow", "1E74",
+ "V", "0056",
+ "Vcircle", "24CB",
+ "Vdotbelow", "1E7E",
+ "Vecyrillic", "0412",
+ "Vewarmenian", "054E",
+ "Vhook", "01B2",
+ "Vmonospace", "FF36",
+ "Voarmenian", "0548",
+ "Vtilde", "1E7C",
+ "W", "0057",
+ "Wacute", "1E82",
+ "Wcircle", "24CC",
+ "Wcircumflex", "0174",
+ "Wdieresis", "1E84",
+ "Wdotaccent", "1E86",
+ "Wdotbelow", "1E88",
+ "Wgrave", "1E80",
+ "Wmonospace", "FF37",
+ "X", "0058",
+ "Xcircle", "24CD",
+ "Xdieresis", "1E8C",
+ "Xdotaccent", "1E8A",
+ "Xeharmenian", "053D",
+ "Xi", "039E",
+ "Xmonospace", "FF38",
+ "Y", "0059",
+ "Yacute", "00DD",
+ "Yatcyrillic", "0462",
+ "Ycircle", "24CE",
+ "Ycircumflex", "0176",
+ "Ydieresis", "0178",
+ "Ydotaccent", "1E8E",
+ "Ydotbelow", "1EF4",
+ "Yericyrillic", "042B",
+ "Yerudieresiscyrillic", "04F8",
+ "Ygrave", "1EF2",
+ "Yhook", "01B3",
+ "Yhookabove", "1EF6",
+ "Yiarmenian", "0545",
+ "Yicyrillic", "0407",
+ "Yiwnarmenian", "0552",
+ "Ymonospace", "FF39",
+ "Ytilde", "1EF8",
+ "Yusbigcyrillic", "046A",
+ "Yusbigiotifiedcyrillic", "046C",
+ "Yuslittlecyrillic", "0466",
+ "Yuslittleiotifiedcyrillic", "0468",
+ "Z", "005A",
+ "Zaarmenian", "0536",
+ "Zacute", "0179",
+ "Zcaron", "017D",
+ "Zcircle", "24CF",
+ "Zcircumflex", "1E90",
+ "Zdot", "017B",
+ "Zdotaccent", "017B",
+ "Zdotbelow", "1E92",
+ "Zecyrillic", "0417",
+ "Zedescendercyrillic", "0498",
+ "Zedieresiscyrillic", "04DE",
+ "Zeta", "0396",
+ "Zhearmenian", "053A",
+ "Zhebrevecyrillic", "04C1",
+ "Zhecyrillic", "0416",
+ "Zhedescendercyrillic", "0496",
+ "Zhedieresiscyrillic", "04DC",
+ "Zlinebelow", "1E94",
+ "Zmonospace", "FF3A",
+ "Zstroke", "01B5",
+ "a", "0061",
+ "aabengali", "0986",
+ "aacute", "00E1",
+ "aadeva", "0906",
+ "aagujarati", "0A86",
+ "aagurmukhi", "0A06",
+ "aamatragurmukhi", "0A3E",
+ "aarusquare", "3303",
+ "aavowelsignbengali", "09BE",
+ "aavowelsigndeva", "093E",
+ "aavowelsigngujarati", "0ABE",
+ "abbreviationmarkarmenian", "055F",
+ "abbreviationsigndeva", "0970",
+ "abengali", "0985",
+ "abopomofo", "311A",
+ "abreve", "0103",
+ "abreveacute", "1EAF",
+ "abrevecyrillic", "04D1",
+ "abrevedotbelow", "1EB7",
+ "abrevegrave", "1EB1",
+ "abrevehookabove", "1EB3",
+ "abrevetilde", "1EB5",
+ "acaron", "01CE",
+ "acircle", "24D0",
+ "acircumflex", "00E2",
+ "acircumflexacute", "1EA5",
+ "acircumflexdotbelow", "1EAD",
+ "acircumflexgrave", "1EA7",
+ "acircumflexhookabove", "1EA9",
+ "acircumflextilde", "1EAB",
+ "acute", "00B4",
+ "acutebelowcmb", "0317",
+ "acutecmb", "0301",
+ "acutecomb", "0301",
+ "acutedeva", "0954",
+ "acutelowmod", "02CF",
+ "acutetonecmb", "0341",
+ "acyrillic", "0430",
+ "adblgrave", "0201",
+ "addakgurmukhi", "0A71",
+ "adeva", "0905",
+ "adieresis", "00E4",
+ "adieresiscyrillic", "04D3",
+ "adieresismacron", "01DF",
+ "adotbelow", "1EA1",
+ "adotmacron", "01E1",
+ "ae", "00E6",
+ "aeacute", "01FD",
+ "aekorean", "3150",
+ "aemacron", "01E3",
+ "afii00208", "2015",
+ "afii08941", "20A4",
+ "afii10017", "0410",
+ "afii10018", "0411",
+ "afii10019", "0412",
+ "afii10020", "0413",
+ "afii10021", "0414",
+ "afii10022", "0415",
+ "afii10023", "0401",
+ "afii10024", "0416",
+ "afii10025", "0417",
+ "afii10026", "0418",
+ "afii10027", "0419",
+ "afii10028", "041A",
+ "afii10029", "041B",
+ "afii10030", "041C",
+ "afii10031", "041D",
+ "afii10032", "041E",
+ "afii10033", "041F",
+ "afii10034", "0420",
+ "afii10035", "0421",
+ "afii10036", "0422",
+ "afii10037", "0423",
+ "afii10038", "0424",
+ "afii10039", "0425",
+ "afii10040", "0426",
+ "afii10041", "0427",
+ "afii10042", "0428",
+ "afii10043", "0429",
+ "afii10044", "042A",
+ "afii10045", "042B",
+ "afii10046", "042C",
+ "afii10047", "042D",
+ "afii10048", "042E",
+ "afii10049", "042F",
+ "afii10050", "0490",
+ "afii10051", "0402",
+ "afii10052", "0403",
+ "afii10053", "0404",
+ "afii10054", "0405",
+ "afii10055", "0406",
+ "afii10056", "0407",
+ "afii10057", "0408",
+ "afii10058", "0409",
+ "afii10059", "040A",
+ "afii10060", "040B",
+ "afii10061", "040C",
+ "afii10062", "040E",
+ "afii10065", "0430",
+ "afii10066", "0431",
+ "afii10067", "0432",
+ "afii10068", "0433",
+ "afii10069", "0434",
+ "afii10070", "0435",
+ "afii10071", "0451",
+ "afii10072", "0436",
+ "afii10073", "0437",
+ "afii10074", "0438",
+ "afii10075", "0439",
+ "afii10076", "043A",
+ "afii10077", "043B",
+ "afii10078", "043C",
+ "afii10079", "043D",
+ "afii10080", "043E",
+ "afii10081", "043F",
+ "afii10082", "0440",
+ "afii10083", "0441",
+ "afii10084", "0442",
+ "afii10085", "0443",
+ "afii10086", "0444",
+ "afii10087", "0445",
+ "afii10088", "0446",
+ "afii10089", "0447",
+ "afii10090", "0448",
+ "afii10091", "0449",
+ "afii10092", "044A",
+ "afii10093", "044B",
+ "afii10094", "044C",
+ "afii10095", "044D",
+ "afii10096", "044E",
+ "afii10097", "044F",
+ "afii10098", "0491",
+ "afii10099", "0452",
+ "afii10100", "0453",
+ "afii10101", "0454",
+ "afii10102", "0455",
+ "afii10103", "0456",
+ "afii10104", "0457",
+ "afii10105", "0458",
+ "afii10106", "0459",
+ "afii10107", "045A",
+ "afii10108", "045B",
+ "afii10109", "045C",
+ "afii10110", "045E",
+ "afii10145", "040F",
+ "afii10146", "0462",
+ "afii10147", "0472",
+ "afii10148", "0474",
+ "afii10193", "045F",
+ "afii10194", "0463",
+ "afii10195", "0473",
+ "afii10196", "0475",
+ "afii10846", "04D9",
+ "afii299", "200E",
+ "afii300", "200F",
+ "afii301", "200D",
+ "afii57381", "066A",
+ "afii57388", "060C",
+ "afii57392", "0660",
+ "afii57393", "0661",
+ "afii57394", "0662",
+ "afii57395", "0663",
+ "afii57396", "0664",
+ "afii57397", "0665",
+ "afii57398", "0666",
+ "afii57399", "0667",
+ "afii57400", "0668",
+ "afii57401", "0669",
+ "afii57403", "061B",
+ "afii57407", "061F",
+ "afii57409", "0621",
+ "afii57410", "0622",
+ "afii57411", "0623",
+ "afii57412", "0624",
+ "afii57413", "0625",
+ "afii57414", "0626",
+ "afii57415", "0627",
+ "afii57416", "0628",
+ "afii57417", "0629",
+ "afii57418", "062A",
+ "afii57419", "062B",
+ "afii57420", "062C",
+ "afii57421", "062D",
+ "afii57422", "062E",
+ "afii57423", "062F",
+ "afii57424", "0630",
+ "afii57425", "0631",
+ "afii57426", "0632",
+ "afii57427", "0633",
+ "afii57428", "0634",
+ "afii57429", "0635",
+ "afii57430", "0636",
+ "afii57431", "0637",
+ "afii57432", "0638",
+ "afii57433", "0639",
+ "afii57434", "063A",
+ "afii57440", "0640",
+ "afii57441", "0641",
+ "afii57442", "0642",
+ "afii57443", "0643",
+ "afii57444", "0644",
+ "afii57445", "0645",
+ "afii57446", "0646",
+ "afii57448", "0648",
+ "afii57449", "0649",
+ "afii57450", "064A",
+ "afii57451", "064B",
+ "afii57452", "064C",
+ "afii57453", "064D",
+ "afii57454", "064E",
+ "afii57455", "064F",
+ "afii57456", "0650",
+ "afii57457", "0651",
+ "afii57458", "0652",
+ "afii57470", "0647",
+ "afii57505", "06A4",
+ "afii57506", "067E",
+ "afii57507", "0686",
+ "afii57508", "0698",
+ "afii57509", "06AF",
+ "afii57511", "0679",
+ "afii57512", "0688",
+ "afii57513", "0691",
+ "afii57514", "06BA",
+ "afii57519", "06D2",
+ "afii57534", "06D5",
+ "afii57636", "20AA",
+ "afii57645", "05BE",
+ "afii57658", "05C3",
+ "afii57664", "05D0",
+ "afii57665", "05D1",
+ "afii57666", "05D2",
+ "afii57667", "05D3",
+ "afii57668", "05D4",
+ "afii57669", "05D5",
+ "afii57670", "05D6",
+ "afii57671", "05D7",
+ "afii57672", "05D8",
+ "afii57673", "05D9",
+ "afii57674", "05DA",
+ "afii57675", "05DB",
+ "afii57676", "05DC",
+ "afii57677", "05DD",
+ "afii57678", "05DE",
+ "afii57679", "05DF",
+ "afii57680", "05E0",
+ "afii57681", "05E1",
+ "afii57682", "05E2",
+ "afii57683", "05E3",
+ "afii57684", "05E4",
+ "afii57685", "05E5",
+ "afii57686", "05E6",
+ "afii57687", "05E7",
+ "afii57688", "05E8",
+ "afii57689", "05E9",
+ "afii57690", "05EA",
+ "afii57694", "FB2A",
+ "afii57695", "FB2B",
+ "afii57700", "FB4B",
+ "afii57705", "FB1F",
+ "afii57716", "05F0",
+ "afii57717", "05F1",
+ "afii57718", "05F2",
+ "afii57723", "FB35",
+ "afii57793", "05B4",
+ "afii57794", "05B5",
+ "afii57795", "05B6",
+ "afii57796", "05BB",
+ "afii57797", "05B8",
+ "afii57798", "05B7",
+ "afii57799", "05B0",
+ "afii57800", "05B2",
+ "afii57801", "05B1",
+ "afii57802", "05B3",
+ "afii57803", "05C2",
+ "afii57804", "05C1",
+ "afii57806", "05B9",
+ "afii57807", "05BC",
+ "afii57839", "05BD",
+ "afii57841", "05BF",
+ "afii57842", "05C0",
+ "afii57929", "02BC",
+ "afii61248", "2105",
+ "afii61289", "2113",
+ "afii61352", "2116",
+ "afii61573", "202C",
+ "afii61574", "202D",
+ "afii61575", "202E",
+ "afii61664", "200C",
+ "afii63167", "066D",
+ "afii64937", "02BD",
+ "agrave", "00E0",
+ "agujarati", "0A85",
+ "agurmukhi", "0A05",
+ "ahiragana", "3042",
+ "ahookabove", "1EA3",
+ "aibengali", "0990",
+ "aibopomofo", "311E",
+ "aideva", "0910",
+ "aiecyrillic", "04D5",
+ "aigujarati", "0A90",
+ "aigurmukhi", "0A10",
+ "aimatragurmukhi", "0A48",
+ "ainarabic", "0639",
+ "ainfinalarabic", "FECA",
+ "aininitialarabic", "FECB",
+ "ainmedialarabic", "FECC",
+ "ainvertedbreve", "0203",
+ "aivowelsignbengali", "09C8",
+ "aivowelsigndeva", "0948",
+ "aivowelsigngujarati", "0AC8",
+ "akatakana", "30A2",
+ "akatakanahalfwidth", "FF71",
+ "akorean", "314F",
+ "alef", "05D0",
+ "alefarabic", "0627",
+ "alefdageshhebrew", "FB30",
+ "aleffinalarabic", "FE8E",
+ "alefhamzaabovearabic", "0623",
+ "alefhamzaabovefinalarabic", "FE84",
+ "alefhamzabelowarabic", "0625",
+ "alefhamzabelowfinalarabic", "FE88",
+ "alefhebrew", "05D0",
+ "aleflamedhebrew", "FB4F",
+ "alefmaddaabovearabic", "0622",
+ "alefmaddaabovefinalarabic", "FE82",
+ "alefmaksuraarabic", "0649",
+ "alefmaksurafinalarabic", "FEF0",
+ "alefmaksurainitialarabic", "FEF3",
+ "alefmaksuramedialarabic", "FEF4",
+ "alefpatahhebrew", "FB2E",
+ "alefqamatshebrew", "FB2F",
+ "aleph", "2135",
+ "allequal", "224C",
+ "alpha", "03B1",
+ "alphatonos", "03AC",
+ "amacron", "0101",
+ "amonospace", "FF41",
+ "ampersand", "0026",
+ "ampersandmonospace", "FF06",
+ "amsquare", "33C2",
+ "anbopomofo", "3122",
+ "angbopomofo", "3124",
+ "angkhankhuthai", "0E5A",
+ "angle", "2220",
+ "anglebracketleft", "3008",
+ "anglebracketleftvertical", "FE3F",
+ "anglebracketright", "3009",
+ "anglebracketrightvertical", "FE40",
+ "angleleft", "2329",
+ "angleright", "232A",
+ "angstrom", "212B",
+ "anoteleia", "0387",
+ "anudattadeva", "0952",
+ "anusvarabengali", "0982",
+ "anusvaradeva", "0902",
+ "anusvaragujarati", "0A82",
+ "aogonek", "0105",
+ "apaatosquare", "3300",
+ "aparen", "249C",
+ "apostrophearmenian", "055A",
+ "apostrophemod", "02BC",
+ "approaches", "2250",
+ "approxequal", "2248",
+ "approxequalorimage", "2252",
+ "approximatelyequal", "2245",
+ "araeaekorean", "318E",
+ "araeakorean", "318D",
+ "arc", "2312",
+ "arighthalfring", "1E9A",
+ "aring", "00E5",
+ "aringacute", "01FB",
+ "aringbelow", "1E01",
+ "arrowboth", "2194",
+ "arrowdashdown", "21E3",
+ "arrowdashleft", "21E0",
+ "arrowdashright", "21E2",
+ "arrowdashup", "21E1",
+ "arrowdblboth", "21D4",
+ "arrowdbldown", "21D3",
+ "arrowdblleft", "21D0",
+ "arrowdblright", "21D2",
+ "arrowdblup", "21D1",
+ "arrowdown", "2193",
+ "arrowdownleft", "2199",
+ "arrowdownright", "2198",
+ "arrowdownwhite", "21E9",
+ "arrowheaddownmod", "02C5",
+ "arrowheadleftmod", "02C2",
+ "arrowheadrightmod", "02C3",
+ "arrowheadupmod", "02C4",
+ "arrowleft", "2190",
+ "arrowleftdbl", "21D0",
+ "arrowleftdblstroke", "21CD",
+ "arrowleftoverright", "21C6",
+ "arrowleftwhite", "21E6",
+ "arrowright", "2192",
+ "arrowrightdblstroke", "21CF",
+ "arrowrightheavy", "279E",
+ "arrowrightoverleft", "21C4",
+ "arrowrightwhite", "21E8",
+ "arrowtableft", "21E4",
+ "arrowtabright", "21E5",
+ "arrowup", "2191",
+ "arrowupdn", "2195",
+ "arrowupdnbse", "21A8",
+ "arrowupdownbase", "21A8",
+ "arrowupleft", "2196",
+ "arrowupleftofdown", "21C5",
+ "arrowupright", "2197",
+ "arrowupwhite", "21E7",
+ "asciicircum", "005E",
+ "asciicircummonospace", "FF3E",
+ "asciitilde", "007E",
+ "asciitildemonospace", "FF5E",
+ "ascript", "0251",
+ "ascriptturned", "0252",
+ "asmallhiragana", "3041",
+ "asmallkatakana", "30A1",
+ "asmallkatakanahalfwidth", "FF67",
+ "asterisk", "002A",
+ "asteriskaltonearabic", "066D",
+ "asteriskarabic", "066D",
+ "asteriskmath", "2217",
+ "asteriskmonospace", "FF0A",
+ "asterisksmall", "FE61",
+ "asterism", "2042",
+ "asymptoticallyequal", "2243",
+ "at", "0040",
+ "atilde", "00E3",
+ "atmonospace", "FF20",
+ "atsmall", "FE6B",
+ "aturned", "0250",
+ "aubengali", "0994",
+ "aubopomofo", "3120",
+ "audeva", "0914",
+ "augujarati", "0A94",
+ "augurmukhi", "0A14",
+ "aulengthmarkbengali", "09D7",
+ "aumatragurmukhi", "0A4C",
+ "auvowelsignbengali", "09CC",
+ "auvowelsigndeva", "094C",
+ "auvowelsigngujarati", "0ACC",
+ "avagrahadeva", "093D",
+ "aybarmenian", "0561",
+ "ayin", "05E2",
+ "ayinaltonehebrew", "FB20",
+ "ayinhebrew", "05E2",
+ "b", "0062",
+ "babengali", "09AC",
+ "backslash", "005C",
+ "backslashmonospace", "FF3C",
+ "badeva", "092C",
+ "bagujarati", "0AAC",
+ "bagurmukhi", "0A2C",
+ "bahiragana", "3070",
+ "bahtthai", "0E3F",
+ "bakatakana", "30D0",
+ "bar", "007C",
+ "barmonospace", "FF5C",
+ "bbopomofo", "3105",
+ "bcircle", "24D1",
+ "bdotaccent", "1E03",
+ "bdotbelow", "1E05",
+ "beamedsixteenthnotes", "266C",
+ "because", "2235",
+ "becyrillic", "0431",
+ "beharabic", "0628",
+ "behfinalarabic", "FE90",
+ "behinitialarabic", "FE91",
+ "behiragana", "3079",
+ "behmedialarabic", "FE92",
+ "behmeeminitialarabic", "FC9F",
+ "behmeemisolatedarabic", "FC08",
+ "behnoonfinalarabic", "FC6D",
+ "bekatakana", "30D9",
+ "benarmenian", "0562",
+ "bet", "05D1",
+ "beta", "03B2",
+ "betasymbolgreek", "03D0",
+ "betdagesh", "FB31",
+ "betdageshhebrew", "FB31",
+ "bethebrew", "05D1",
+ "betrafehebrew", "FB4C",
+ "bhabengali", "09AD",
+ "bhadeva", "092D",
+ "bhagujarati", "0AAD",
+ "bhagurmukhi", "0A2D",
+ "bhook", "0253",
+ "bihiragana", "3073",
+ "bikatakana", "30D3",
+ "bilabialclick", "0298",
+ "bindigurmukhi", "0A02",
+ "birusquare", "3331",
+ "blackcircle", "25CF",
+ "blackdiamond", "25C6",
+ "blackdownpointingtriangle", "25BC",
+ "blackleftpointingpointer", "25C4",
+ "blackleftpointingtriangle", "25C0",
+ "blacklenticularbracketleft", "3010",
+ "blacklenticularbracketleftvertical", "FE3B",
+ "blacklenticularbracketright", "3011",
+ "blacklenticularbracketrightvertical", "FE3C",
+ "blacklowerlefttriangle", "25E3",
+ "blacklowerrighttriangle", "25E2",
+ "blackrectangle", "25AC",
+ "blackrightpointingpointer", "25BA",
+ "blackrightpointingtriangle", "25B6",
+ "blacksmallsquare", "25AA",
+ "blacksmilingface", "263B",
+ "blacksquare", "25A0",
+ "blackstar", "2605",
+ "blackupperlefttriangle", "25E4",
+ "blackupperrighttriangle", "25E5",
+ "blackuppointingsmalltriangle", "25B4",
+ "blackuppointingtriangle", "25B2",
+ "blank", "2423",
+ "blinebelow", "1E07",
+ "block", "2588",
+ "bmonospace", "FF42",
+ "bobaimaithai", "0E1A",
+ "bohiragana", "307C",
+ "bokatakana", "30DC",
+ "bparen", "249D",
+ "bqsquare", "33C3",
+ "braceleft", "007B",
+ "braceleftmonospace", "FF5B",
+ "braceleftsmall", "FE5B",
+ "braceleftvertical", "FE37",
+ "braceright", "007D",
+ "bracerightmonospace", "FF5D",
+ "bracerightsmall", "FE5C",
+ "bracerightvertical", "FE38",
+ "bracketleft", "005B",
+ "bracketleftmonospace", "FF3B",
+ "bracketright", "005D",
+ "bracketrightmonospace", "FF3D",
+ "breve", "02D8",
+ "brevebelowcmb", "032E",
+ "brevecmb", "0306",
+ "breveinvertedbelowcmb", "032F",
+ "breveinvertedcmb", "0311",
+ "breveinverteddoublecmb", "0361",
+ "bridgebelowcmb", "032A",
+ "bridgeinvertedbelowcmb", "033A",
+ "brokenbar", "00A6",
+ "bstroke", "0180",
+ "btopbar", "0183",
+ "buhiragana", "3076",
+ "bukatakana", "30D6",
+ "bullet", "2022",
+ "bulletinverse", "25D8",
+ "bulletoperator", "2219",
+ "bullseye", "25CE",
+ "c", "0063",
+ "caarmenian", "056E",
+ "cabengali", "099A",
+ "cacute", "0107",
+ "cadeva", "091A",
+ "cagujarati", "0A9A",
+ "cagurmukhi", "0A1A",
+ "calsquare", "3388",
+ "candrabindubengali", "0981",
+ "candrabinducmb", "0310",
+ "candrabindudeva", "0901",
+ "candrabindugujarati", "0A81",
+ "capslock", "21EA",
+ "careof", "2105",
+ "caron", "02C7",
+ "caronbelowcmb", "032C",
+ "caroncmb", "030C",
+ "carriagereturn", "21B5",
+ "cbopomofo", "3118",
+ "ccaron", "010D",
+ "ccedilla", "00E7",
+ "ccedillaacute", "1E09",
+ "ccircle", "24D2",
+ "ccircumflex", "0109",
+ "ccurl", "0255",
+ "cdot", "010B",
+ "cdotaccent", "010B",
+ "cdsquare", "33C5",
+ "cedilla", "00B8",
+ "cedillacmb", "0327",
+ "cent", "00A2",
+ "centigrade", "2103",
+ "centmonospace", "FFE0",
+ "chaarmenian", "0579",
+ "chabengali", "099B",
+ "chadeva", "091B",
+ "chagujarati", "0A9B",
+ "chagurmukhi", "0A1B",
+ "chbopomofo", "3114",
+ "cheabkhasiancyrillic", "04BD",
+ "checkmark", "2713",
+ "checyrillic", "0447",
+ "chedescenderabkhasiancyrillic", "04BF",
+ "chedescendercyrillic", "04B7",
+ "chedieresiscyrillic", "04F5",
+ "cheharmenian", "0573",
+ "chekhakassiancyrillic", "04CC",
+ "cheverticalstrokecyrillic", "04B9",
+ "chi", "03C7",
+ "chieuchacirclekorean", "3277",
+ "chieuchaparenkorean", "3217",
+ "chieuchcirclekorean", "3269",
+ "chieuchkorean", "314A",
+ "chieuchparenkorean", "3209",
+ "chochangthai", "0E0A",
+ "chochanthai", "0E08",
+ "chochingthai", "0E09",
+ "chochoethai", "0E0C",
+ "chook", "0188",
+ "cieucacirclekorean", "3276",
+ "cieucaparenkorean", "3216",
+ "cieuccirclekorean", "3268",
+ "cieuckorean", "3148",
+ "cieucparenkorean", "3208",
+ "cieucuparenkorean", "321C",
+ "circle", "25CB",
+ "circlemultiply", "2297",
+ "circleot", "2299",
+ "circleplus", "2295",
+ "circlepostalmark", "3036",
+ "circlewithlefthalfblack", "25D0",
+ "circlewithrighthalfblack", "25D1",
+ "circumflex", "02C6",
+ "circumflexbelowcmb", "032D",
+ "circumflexcmb", "0302",
+ "clear", "2327",
+ "clickalveolar", "01C2",
+ "clickdental", "01C0",
+ "clicklateral", "01C1",
+ "clickretroflex", "01C3",
+ "club", "2663",
+ "clubsuitblack", "2663",
+ "clubsuitwhite", "2667",
+ "cmcubedsquare", "33A4",
+ "cmonospace", "FF43",
+ "cmsquaredsquare", "33A0",
+ "coarmenian", "0581",
+ "colon", "003A",
+ "colonmonetary", "20A1",
+ "colonmonospace", "FF1A",
+ "colonsign", "20A1",
+ "colonsmall", "FE55",
+ "colontriangularhalfmod", "02D1",
+ "colontriangularmod", "02D0",
+ "comma", "002C",
+ "commaabovecmb", "0313",
+ "commaaboverightcmb", "0315",
+ "commaarabic", "060C",
+ "commaarmenian", "055D",
+ "commamonospace", "FF0C",
+ "commareversedabovecmb", "0314",
+ "commareversedmod", "02BD",
+ "commasmall", "FE50",
+ "commaturnedabovecmb", "0312",
+ "commaturnedmod", "02BB",
+ "compass", "263C",
+ "congruent", "2245",
+ "contourintegral", "222E",
+ "control", "2303",
+ "controlACK", "0006",
+ "controlBEL", "0007",
+ "controlBS", "0008",
+ "controlCAN", "0018",
+ "controlCR", "000D",
+ "controlDC1", "0011",
+ "controlDC2", "0012",
+ "controlDC3", "0013",
+ "controlDC4", "0014",
+ "controlDEL", "007F",
+ "controlDLE", "0010",
+ "controlEM", "0019",
+ "controlENQ", "0005",
+ "controlEOT", "0004",
+ "controlESC", "001B",
+ "controlETB", "0017",
+ "controlETX", "0003",
+ "controlFF", "000C",
+ "controlFS", "001C",
+ "controlGS", "001D",
+ "controlHT", "0009",
+ "controlLF", "000A",
+ "controlNAK", "0015",
+ "controlRS", "001E",
+ "controlSI", "000F",
+ "controlSO", "000E",
+ "controlSOT", "0002",
+ "controlSTX", "0001",
+ "controlSUB", "001A",
+ "controlSYN", "0016",
+ "controlUS", "001F",
+ "controlVT", "000B",
+ "copyright", "00A9",
+ "cornerbracketleft", "300C",
+ "cornerbracketlefthalfwidth", "FF62",
+ "cornerbracketleftvertical", "FE41",
+ "cornerbracketright", "300D",
+ "cornerbracketrighthalfwidth", "FF63",
+ "cornerbracketrightvertical", "FE42",
+ "corporationsquare", "337F",
+ "cosquare", "33C7",
+ "coverkgsquare", "33C6",
+ "cparen", "249E",
+ "cruzeiro", "20A2",
+ "cstretched", "0297",
+ "curlyand", "22CF",
+ "curlyor", "22CE",
+ "currency", "00A4",
+ "d", "0064",
+ "daarmenian", "0564",
+ "dabengali", "09A6",
+ "dadarabic", "0636",
+ "dadeva", "0926",
+ "dadfinalarabic", "FEBE",
+ "dadinitialarabic", "FEBF",
+ "dadmedialarabic", "FEC0",
+ "dagesh", "05BC",
+ "dageshhebrew", "05BC",
+ "dagger", "2020",
+ "daggerdbl", "2021",
+ "dagujarati", "0AA6",
+ "dagurmukhi", "0A26",
+ "dahiragana", "3060",
+ "dakatakana", "30C0",
+ "dalarabic", "062F",
+ "dalet", "05D3",
+ "daletdagesh", "FB33",
+ "daletdageshhebrew", "FB33",
+ "dalethatafpatah", "05D3_05B2",
+ "dalethatafpatahhebrew", "05D3_05B2",
+ "dalethatafsegol", "05D3_05B1",
+ "dalethatafsegolhebrew", "05D3_05B1",
+ "dalethebrew", "05D3",
+ "dalethiriq", "05D3_05B4",
+ "dalethiriqhebrew", "05D3_05B4",
+ "daletholam", "05D3_05B9",
+ "daletholamhebrew", "05D3_05B9",
+ "daletpatah", "05D3_05B7",
+ "daletpatahhebrew", "05D3_05B7",
+ "daletqamats", "05D3_05B8",
+ "daletqamatshebrew", "05D3_05B8",
+ "daletqubuts", "05D3_05BB",
+ "daletqubutshebrew", "05D3_05BB",
+ "daletsegol", "05D3_05B6",
+ "daletsegolhebrew", "05D3_05B6",
+ "daletsheva", "05D3_05B0",
+ "daletshevahebrew", "05D3_05B0",
+ "dalettsere", "05D3_05B5",
+ "dalettserehebrew", "05D3_05B5",
+ "dalfinalarabic", "FEAA",
+ "dammaarabic", "064F",
+ "dammalowarabic", "064F",
+ "dammatanaltonearabic", "064C",
+ "dammatanarabic", "064C",
+ "danda", "0964",
+ "dargahebrew", "05A7",
+ "dargalefthebrew", "05A7",
+ "dasiapneumatacyrilliccmb", "0485",
+ "dblanglebracketleft", "300A",
+ "dblanglebracketleftvertical", "FE3D",
+ "dblanglebracketright", "300B",
+ "dblanglebracketrightvertical", "FE3E",
+ "dblarchinvertedbelowcmb", "032B",
+ "dblarrowleft", "21D4",
+ "dblarrowright", "21D2",
+ "dbldanda", "0965",
+ "dblgravecmb", "030F",
+ "dblintegral", "222C",
+ "dbllowline", "2017",
+ "dbllowlinecmb", "0333",
+ "dbloverlinecmb", "033F",
+ "dblprimemod", "02BA",
+ "dblverticalbar", "2016",
+ "dblverticallineabovecmb", "030E",
+ "dbopomofo", "3109",
+ "dbsquare", "33C8",
+ "dcaron", "010F",
+ "dcedilla", "1E11",
+ "dcircle", "24D3",
+ "dcircumflexbelow", "1E13",
+ "dcroat", "0111",
+ "ddabengali", "09A1",
+ "ddadeva", "0921",
+ "ddagujarati", "0AA1",
+ "ddagurmukhi", "0A21",
+ "ddalarabic", "0688",
+ "ddalfinalarabic", "FB89",
+ "dddhadeva", "095C",
+ "ddhabengali", "09A2",
+ "ddhadeva", "0922",
+ "ddhagujarati", "0AA2",
+ "ddhagurmukhi", "0A22",
+ "ddotaccent", "1E0B",
+ "ddotbelow", "1E0D",
+ "decimalseparatorarabic", "066B",
+ "decimalseparatorpersian", "066B",
+ "decyrillic", "0434",
+ "degree", "00B0",
+ "dehihebrew", "05AD",
+ "dehiragana", "3067",
+ "deicoptic", "03EF",
+ "dekatakana", "30C7",
+ "deleteleft", "232B",
+ "deleteright", "2326",
+ "delta", "03B4",
+ "deltaturned", "018D",
+ "denominatorminusonenumeratorbengali", "09F8",
+ "dezh", "02A4",
+ "dhabengali", "09A7",
+ "dhadeva", "0927",
+ "dhagujarati", "0AA7",
+ "dhagurmukhi", "0A27",
+ "dhook", "0257",
+ "dialytikatonos", "0385",
+ "dialytikatonoscmb", "0344",
+ "diamond", "2666",
+ "diamondsuitwhite", "2662",
+ "dieresis", "00A8",
+ "dieresisbelowcmb", "0324",
+ "dieresiscmb", "0308",
+ "dieresistonos", "0385",
+ "dihiragana", "3062",
+ "dikatakana", "30C2",
+ "dittomark", "3003",
+ "divide", "00F7",
+ "divides", "2223",
+ "divisionslash", "2215",
+ "djecyrillic", "0452",
+ "dkshade", "2593",
+ "dlinebelow", "1E0F",
+ "dlsquare", "3397",
+ "dmacron", "0111",
+ "dmonospace", "FF44",
+ "dnblock", "2584",
+ "dochadathai", "0E0E",
+ "dodekthai", "0E14",
+ "dohiragana", "3069",
+ "dokatakana", "30C9",
+ "dollar", "0024",
+ "dollarmonospace", "FF04",
+ "dollarsmall", "FE69",
+ "dong", "20AB",
+ "dorusquare", "3326",
+ "dotaccent", "02D9",
+ "dotaccentcmb", "0307",
+ "dotbelowcmb", "0323",
+ "dotbelowcomb", "0323",
+ "dotkatakana", "30FB",
+ "dotlessi", "0131",
+ "dotlessjstrokehook", "0284",
+ "dotmath", "22C5",
+ "dottedcircle", "25CC",
+ "doubleyodpatah", "FB1F",
+ "doubleyodpatahhebrew", "FB1F",
+ "downtackbelowcmb", "031E",
+ "downtackmod", "02D5",
+ "dparen", "249F",
+ "dtail", "0256",
+ "dtopbar", "018C",
+ "duhiragana", "3065",
+ "dukatakana", "30C5",
+ "dz", "01F3",
+ "dzaltone", "02A3",
+ "dzcaron", "01C6",
+ "dzcurl", "02A5",
+ "dzeabkhasiancyrillic", "04E1",
+ "dzecyrillic", "0455",
+ "dzhecyrillic", "045F",
+ "e", "0065",
+ "eacute", "00E9",
+ "earth", "2641",
+ "ebengali", "098F",
+ "ebopomofo", "311C",
+ "ebreve", "0115",
+ "ecandradeva", "090D",
+ "ecandragujarati", "0A8D",
+ "ecandravowelsigndeva", "0945",
+ "ecandravowelsigngujarati", "0AC5",
+ "ecaron", "011B",
+ "ecedillabreve", "1E1D",
+ "echarmenian", "0565",
+ "echyiwnarmenian", "0587",
+ "ecircle", "24D4",
+ "ecircumflex", "00EA",
+ "ecircumflexacute", "1EBF",
+ "ecircumflexbelow", "1E19",
+ "ecircumflexdotbelow", "1EC7",
+ "ecircumflexgrave", "1EC1",
+ "ecircumflexhookabove", "1EC3",
+ "ecircumflextilde", "1EC5",
+ "ecyrillic", "0454",
+ "edblgrave", "0205",
+ "edeva", "090F",
+ "edieresis", "00EB",
+ "edot", "0117",
+ "edotaccent", "0117",
+ "edotbelow", "1EB9",
+ "eegurmukhi", "0A0F",
+ "eematragurmukhi", "0A47",
+ "efcyrillic", "0444",
+ "egrave", "00E8",
+ "egujarati", "0A8F",
+ "eharmenian", "0567",
+ "ehbopomofo", "311D",
+ "ehiragana", "3048",
+ "ehookabove", "1EBB",
+ "eibopomofo", "311F",
+ "eight", "0038",
+ "eightarabic", "0668",
+ "eightbengali", "09EE",
+ "eightcircle", "2467",
+ "eightcircleinversesansserif", "2791",
+ "eightdeva", "096E",
+ "eighteencircle", "2471",
+ "eighteenparen", "2485",
+ "eighteenperiod", "2499",
+ "eightgujarati", "0AEE",
+ "eightgurmukhi", "0A6E",
+ "eighthackarabic", "0668",
+ "eighthangzhou", "3028",
+ "eighthnotebeamed", "266B",
+ "eightideographicparen", "3227",
+ "eightinferior", "2088",
+ "eightmonospace", "FF18",
+ "eightparen", "247B",
+ "eightperiod", "248F",
+ "eightpersian", "06F8",
+ "eightroman", "2177",
+ "eightsuperior", "2078",
+ "eightthai", "0E58",
+ "einvertedbreve", "0207",
+ "eiotifiedcyrillic", "0465",
+ "ekatakana", "30A8",
+ "ekatakanahalfwidth", "FF74",
+ "ekonkargurmukhi", "0A74",
+ "ekorean", "3154",
+ "elcyrillic", "043B",
+ "element", "2208",
+ "elevencircle", "246A",
+ "elevenparen", "247E",
+ "elevenperiod", "2492",
+ "elevenroman", "217A",
+ "ellipsis", "2026",
+ "ellipsisvertical", "22EE",
+ "emacron", "0113",
+ "emacronacute", "1E17",
+ "emacrongrave", "1E15",
+ "emcyrillic", "043C",
+ "emdash", "2014",
+ "emdashvertical", "FE31",
+ "emonospace", "FF45",
+ "emphasismarkarmenian", "055B",
+ "emptyset", "2205",
+ "enbopomofo", "3123",
+ "encyrillic", "043D",
+ "endash", "2013",
+ "endashvertical", "FE32",
+ "endescendercyrillic", "04A3",
+ "eng", "014B",
+ "engbopomofo", "3125",
+ "enghecyrillic", "04A5",
+ "enhookcyrillic", "04C8",
+ "enspace", "2002",
+ "eogonek", "0119",
+ "eokorean", "3153",
+ "eopen", "025B",
+ "eopenclosed", "029A",
+ "eopenreversed", "025C",
+ "eopenreversedclosed", "025E",
+ "eopenreversedhook", "025D",
+ "eparen", "24A0",
+ "epsilon", "03B5",
+ "epsilontonos", "03AD",
+ "equal", "003D",
+ "equalmonospace", "FF1D",
+ "equalsmall", "FE66",
+ "equalsuperior", "207C",
+ "equivalence", "2261",
+ "erbopomofo", "3126",
+ "ercyrillic", "0440",
+ "ereversed", "0258",
+ "ereversedcyrillic", "044D",
+ "escyrillic", "0441",
+ "esdescendercyrillic", "04AB",
+ "esh", "0283",
+ "eshcurl", "0286",
+ "eshortdeva", "090E",
+ "eshortvowelsigndeva", "0946",
+ "eshreversedloop", "01AA",
+ "eshsquatreversed", "0285",
+ "esmallhiragana", "3047",
+ "esmallkatakana", "30A7",
+ "esmallkatakanahalfwidth", "FF6A",
+ "estimated", "212E",
+ "eta", "03B7",
+ "etarmenian", "0568",
+ "etatonos", "03AE",
+ "eth", "00F0",
+ "etilde", "1EBD",
+ "etildebelow", "1E1B",
+ "etnahtafoukhhebrew", "0591",
+ "etnahtafoukhlefthebrew", "0591",
+ "etnahtahebrew", "0591",
+ "etnahtalefthebrew", "0591",
+ "eturned", "01DD",
+ "eukorean", "3161",
+ "euro", "20AC",
+ "evowelsignbengali", "09C7",
+ "evowelsigndeva", "0947",
+ "evowelsigngujarati", "0AC7",
+ "exclam", "0021",
+ "exclamarmenian", "055C",
+ "exclamdbl", "203C",
+ "exclamdown", "00A1",
+ "exclammonospace", "FF01",
+ "existential", "2203",
+ "ezh", "0292",
+ "ezhcaron", "01EF",
+ "ezhcurl", "0293",
+ "ezhreversed", "01B9",
+ "ezhtail", "01BA",
+ "f", "0066",
+ "fadeva", "095E",
+ "fagurmukhi", "0A5E",
+ "fahrenheit", "2109",
+ "fathaarabic", "064E",
+ "fathalowarabic", "064E",
+ "fathatanarabic", "064B",
+ "fbopomofo", "3108",
+ "fcircle", "24D5",
+ "fdotaccent", "1E1F",
+ "feharabic", "0641",
+ "feharmenian", "0586",
+ "fehfinalarabic", "FED2",
+ "fehinitialarabic", "FED3",
+ "fehmedialarabic", "FED4",
+ "feicoptic", "03E5",
+ "female", "2640",
+ "ff", "FB00",
+ "ffi", "FB03",
+ "ffl", "FB04",
+ "fi", "FB01",
+ "fifteencircle", "246E",
+ "fifteenparen", "2482",
+ "fifteenperiod", "2496",
+ "figuredash", "2012",
+ "filledbox", "25A0",
+ "filledrect", "25AC",
+ "finalkaf", "05DA",
+ "finalkafdagesh", "FB3A",
+ "finalkafdageshhebrew", "FB3A",
+ "finalkafhebrew", "05DA",
+ "finalkafqamats", "05DA_05B8",
+ "finalkafqamatshebrew", "05DA_05B8",
+ "finalkafsheva", "05DA_05B0",
+ "finalkafshevahebrew", "05DA_05B0",
+ "finalmem", "05DD",
+ "finalmemhebrew", "05DD",
+ "finalnun", "05DF",
+ "finalnunhebrew", "05DF",
+ "finalpe", "05E3",
+ "finalpehebrew", "05E3",
+ "finaltsadi", "05E5",
+ "finaltsadihebrew", "05E5",
+ "firsttonechinese", "02C9",
+ "fisheye", "25C9",
+ "fitacyrillic", "0473",
+ "five", "0035",
+ "fivearabic", "0665",
+ "fivebengali", "09EB",
+ "fivecircle", "2464",
+ "fivecircleinversesansserif", "278E",
+ "fivedeva", "096B",
+ "fiveeighths", "215D",
+ "fivegujarati", "0AEB",
+ "fivegurmukhi", "0A6B",
+ "fivehackarabic", "0665",
+ "fivehangzhou", "3025",
+ "fiveideographicparen", "3224",
+ "fiveinferior", "2085",
+ "fivemonospace", "FF15",
+ "fiveparen", "2478",
+ "fiveperiod", "248C",
+ "fivepersian", "06F5",
+ "fiveroman", "2174",
+ "fivesuperior", "2075",
+ "fivethai", "0E55",
+ "fl", "FB02",
+ "florin", "0192",
+ "fmonospace", "FF46",
+ "fmsquare", "3399",
+ "fofanthai", "0E1F",
+ "fofathai", "0E1D",
+ "fongmanthai", "0E4F",
+ "forall", "2200",
+ "four", "0034",
+ "fourarabic", "0664",
+ "fourbengali", "09EA",
+ "fourcircle", "2463",
+ "fourcircleinversesansserif", "278D",
+ "fourdeva", "096A",
+ "fourgujarati", "0AEA",
+ "fourgurmukhi", "0A6A",
+ "fourhackarabic", "0664",
+ "fourhangzhou", "3024",
+ "fourideographicparen", "3223",
+ "fourinferior", "2084",
+ "fourmonospace", "FF14",
+ "fournumeratorbengali", "09F7",
+ "fourparen", "2477",
+ "fourperiod", "248B",
+ "fourpersian", "06F4",
+ "fourroman", "2173",
+ "foursuperior", "2074",
+ "fourteencircle", "246D",
+ "fourteenparen", "2481",
+ "fourteenperiod", "2495",
+ "fourthai", "0E54",
+ "fourthtonechinese", "02CB",
+ "fparen", "24A1",
+ "fraction", "2044",
+ "franc", "20A3",
+ "g", "0067",
+ "gabengali", "0997",
+ "gacute", "01F5",
+ "gadeva", "0917",
+ "gafarabic", "06AF",
+ "gaffinalarabic", "FB93",
+ "gafinitialarabic", "FB94",
+ "gafmedialarabic", "FB95",
+ "gagujarati", "0A97",
+ "gagurmukhi", "0A17",
+ "gahiragana", "304C",
+ "gakatakana", "30AC",
+ "gamma", "03B3",
+ "gammalatinsmall", "0263",
+ "gammasuperior", "02E0",
+ "gangiacoptic", "03EB",
+ "gbopomofo", "310D",
+ "gbreve", "011F",
+ "gcaron", "01E7",
+ "gcedilla", "0123",
+ "gcircle", "24D6",
+ "gcircumflex", "011D",
+ "gcommaaccent", "0123",
+ "gdot", "0121",
+ "gdotaccent", "0121",
+ "gecyrillic", "0433",
+ "gehiragana", "3052",
+ "gekatakana", "30B2",
+ "geometricallyequal", "2251",
+ "gereshaccenthebrew", "059C",
+ "gereshhebrew", "05F3",
+ "gereshmuqdamhebrew", "059D",
+ "germandbls", "00DF",
+ "gershayimaccenthebrew", "059E",
+ "gershayimhebrew", "05F4",
+ "getamark", "3013",
+ "ghabengali", "0998",
+ "ghadarmenian", "0572",
+ "ghadeva", "0918",
+ "ghagujarati", "0A98",
+ "ghagurmukhi", "0A18",
+ "ghainarabic", "063A",
+ "ghainfinalarabic", "FECE",
+ "ghaininitialarabic", "FECF",
+ "ghainmedialarabic", "FED0",
+ "ghemiddlehookcyrillic", "0495",
+ "ghestrokecyrillic", "0493",
+ "gheupturncyrillic", "0491",
+ "ghhadeva", "095A",
+ "ghhagurmukhi", "0A5A",
+ "ghook", "0260",
+ "ghzsquare", "3393",
+ "gihiragana", "304E",
+ "gikatakana", "30AE",
+ "gimarmenian", "0563",
+ "gimel", "05D2",
+ "gimeldagesh", "FB32",
+ "gimeldageshhebrew", "FB32",
+ "gimelhebrew", "05D2",
+ "gjecyrillic", "0453",
+ "glottalinvertedstroke", "01BE",
+ "glottalstop", "0294",
+ "glottalstopinverted", "0296",
+ "glottalstopmod", "02C0",
+ "glottalstopreversed", "0295",
+ "glottalstopreversedmod", "02C1",
+ "glottalstopreversedsuperior", "02E4",
+ "glottalstopstroke", "02A1",
+ "glottalstopstrokereversed", "02A2",
+ "gmacron", "1E21",
+ "gmonospace", "FF47",
+ "gohiragana", "3054",
+ "gokatakana", "30B4",
+ "gparen", "24A2",
+ "gpasquare", "33AC",
+ "gradient", "2207",
+ "grave", "0060",
+ "gravebelowcmb", "0316",
+ "gravecmb", "0300",
+ "gravecomb", "0300",
+ "gravedeva", "0953",
+ "gravelowmod", "02CE",
+ "gravemonospace", "FF40",
+ "gravetonecmb", "0340",
+ "greater", "003E",
+ "greaterequal", "2265",
+ "greaterequalorless", "22DB",
+ "greatermonospace", "FF1E",
+ "greaterorequivalent", "2273",
+ "greaterorless", "2277",
+ "greateroverequal", "2267",
+ "greatersmall", "FE65",
+ "gscript", "0261",
+ "gstroke", "01E5",
+ "guhiragana", "3050",
+ "guillemotleft", "00AB",
+ "guillemotright", "00BB",
+ "guilsinglleft", "2039",
+ "guilsinglright", "203A",
+ "gukatakana", "30B0",
+ "guramusquare", "3318",
+ "gysquare", "33C9",
+ "h", "0068",
+ "haabkhasiancyrillic", "04A9",
+ "haaltonearabic", "06C1",
+ "habengali", "09B9",
+ "hadescendercyrillic", "04B3",
+ "hadeva", "0939",
+ "hagujarati", "0AB9",
+ "hagurmukhi", "0A39",
+ "haharabic", "062D",
+ "hahfinalarabic", "FEA2",
+ "hahinitialarabic", "FEA3",
+ "hahiragana", "306F",
+ "hahmedialarabic", "FEA4",
+ "haitusquare", "332A",
+ "hakatakana", "30CF",
+ "hakatakanahalfwidth", "FF8A",
+ "halantgurmukhi", "0A4D",
+ "hamzaarabic", "0621",
+ "hamzadammaarabic", "0621_064F",
+ "hamzadammatanarabic", "0621_064C",
+ "hamzafathaarabic", "0621_064E",
+ "hamzafathatanarabic", "0621_064B",
+ "hamzalowarabic", "0621",
+ "hamzalowkasraarabic", "0621_0650",
+ "hamzalowkasratanarabic", "0621_064D",
+ "hamzasukunarabic", "0621_0652",
+ "hangulfiller", "3164",
+ "hardsigncyrillic", "044A",
+ "harpoonleftbarbup", "21BC",
+ "harpoonrightbarbup", "21C0",
+ "hasquare", "33CA",
+ "hatafpatah", "05B2",
+ "hatafpatah16", "05B2",
+ "hatafpatah23", "05B2",
+ "hatafpatah2f", "05B2",
+ "hatafpatahhebrew", "05B2",
+ "hatafpatahnarrowhebrew", "05B2",
+ "hatafpatahquarterhebrew", "05B2",
+ "hatafpatahwidehebrew", "05B2",
+ "hatafqamats", "05B3",
+ "hatafqamats1b", "05B3",
+ "hatafqamats28", "05B3",
+ "hatafqamats34", "05B3",
+ "hatafqamatshebrew", "05B3",
+ "hatafqamatsnarrowhebrew", "05B3",
+ "hatafqamatsquarterhebrew", "05B3",
+ "hatafqamatswidehebrew", "05B3",
+ "hatafsegol", "05B1",
+ "hatafsegol17", "05B1",
+ "hatafsegol24", "05B1",
+ "hatafsegol30", "05B1",
+ "hatafsegolhebrew", "05B1",
+ "hatafsegolnarrowhebrew", "05B1",
+ "hatafsegolquarterhebrew", "05B1",
+ "hatafsegolwidehebrew", "05B1",
+ "hbar", "0127",
+ "hbopomofo", "310F",
+ "hbrevebelow", "1E2B",
+ "hcedilla", "1E29",
+ "hcircle", "24D7",
+ "hcircumflex", "0125",
+ "hdieresis", "1E27",
+ "hdotaccent", "1E23",
+ "hdotbelow", "1E25",
+ "he", "05D4",
+ "heart", "2665",
+ "heartsuitblack", "2665",
+ "heartsuitwhite", "2661",
+ "hedagesh", "FB34",
+ "hedageshhebrew", "FB34",
+ "hehaltonearabic", "06C1",
+ "heharabic", "0647",
+ "hehebrew", "05D4",
+ "hehfinalaltonearabic", "FBA7",
+ "hehfinalalttwoarabic", "FEEA",
+ "hehfinalarabic", "FEEA",
+ "hehhamzaabovefinalarabic", "FBA5",
+ "hehhamzaaboveisolatedarabic", "FBA4",
+ "hehinitialaltonearabic", "FBA8",
+ "hehinitialarabic", "FEEB",
+ "hehiragana", "3078",
+ "hehmedialaltonearabic", "FBA9",
+ "hehmedialarabic", "FEEC",
+ "heiseierasquare", "337B",
+ "hekatakana", "30D8",
+ "hekatakanahalfwidth", "FF8D",
+ "hekutaarusquare", "3336",
+ "henghook", "0267",
+ "herutusquare", "3339",
+ "het", "05D7",
+ "hethebrew", "05D7",
+ "hhook", "0266",
+ "hhooksuperior", "02B1",
+ "hieuhacirclekorean", "327B",
+ "hieuhaparenkorean", "321B",
+ "hieuhcirclekorean", "326D",
+ "hieuhkorean", "314E",
+ "hieuhparenkorean", "320D",
+ "hihiragana", "3072",
+ "hikatakana", "30D2",
+ "hikatakanahalfwidth", "FF8B",
+ "hiriq", "05B4",
+ "hiriq14", "05B4",
+ "hiriq21", "05B4",
+ "hiriq2d", "05B4",
+ "hiriqhebrew", "05B4",
+ "hiriqnarrowhebrew", "05B4",
+ "hiriqquarterhebrew", "05B4",
+ "hiriqwidehebrew", "05B4",
+ "hlinebelow", "1E96",
+ "hmonospace", "FF48",
+ "hoarmenian", "0570",
+ "hohipthai", "0E2B",
+ "hohiragana", "307B",
+ "hokatakana", "30DB",
+ "hokatakanahalfwidth", "FF8E",
+ "holam", "05B9",
+ "holam19", "05B9",
+ "holam26", "05B9",
+ "holam32", "05B9",
+ "holamhebrew", "05B9",
+ "holamnarrowhebrew", "05B9",
+ "holamquarterhebrew", "05B9",
+ "holamwidehebrew", "05B9",
+ "honokhukthai", "0E2E",
+ "hookabovecomb", "0309",
+ "hookcmb", "0309",
+ "hookpalatalizedbelowcmb", "0321",
+ "hookretroflexbelowcmb", "0322",
+ "hoonsquare", "3342",
+ "horicoptic", "03E9",
+ "horizontalbar", "2015",
+ "horncmb", "031B",
+ "hotsprings", "2668",
+ "house", "2302",
+ "hparen", "24A3",
+ "hsuperior", "02B0",
+ "hturned", "0265",
+ "huhiragana", "3075",
+ "huiitosquare", "3333",
+ "hukatakana", "30D5",
+ "hukatakanahalfwidth", "FF8C",
+ "hungarumlaut", "02DD",
+ "hungarumlautcmb", "030B",
+ "hv", "0195",
+ "hyphen", "002D",
+ "hyphenmonospace", "FF0D",
+ "hyphensmall", "FE63",
+ "hyphentwo", "2010",
+ "i", "0069",
+ "iacute", "00ED",
+ "iacyrillic", "044F",
+ "ibengali", "0987",
+ "ibopomofo", "3127",
+ "ibreve", "012D",
+ "icaron", "01D0",
+ "icircle", "24D8",
+ "icircumflex", "00EE",
+ "icyrillic", "0456",
+ "idblgrave", "0209",
+ "ideographearthcircle", "328F",
+ "ideographfirecircle", "328B",
+ "ideographicallianceparen", "323F",
+ "ideographiccallparen", "323A",
+ "ideographiccentrecircle", "32A5",
+ "ideographicclose", "3006",
+ "ideographiccomma", "3001",
+ "ideographiccommaleft", "FF64",
+ "ideographiccongratulationparen", "3237",
+ "ideographiccorrectcircle", "32A3",
+ "ideographicearthparen", "322F",
+ "ideographicenterpriseparen", "323D",
+ "ideographicexcellentcircle", "329D",
+ "ideographicfestivalparen", "3240",
+ "ideographicfinancialcircle", "3296",
+ "ideographicfinancialparen", "3236",
+ "ideographicfireparen", "322B",
+ "ideographichaveparen", "3232",
+ "ideographichighcircle", "32A4",
+ "ideographiciterationmark", "3005",
+ "ideographiclaborcircle", "3298",
+ "ideographiclaborparen", "3238",
+ "ideographicleftcircle", "32A7",
+ "ideographiclowcircle", "32A6",
+ "ideographicmedicinecircle", "32A9",
+ "ideographicmetalparen", "322E",
+ "ideographicmoonparen", "322A",
+ "ideographicnameparen", "3234",
+ "ideographicperiod", "3002",
+ "ideographicprintcircle", "329E",
+ "ideographicreachparen", "3243",
+ "ideographicrepresentparen", "3239",
+ "ideographicresourceparen", "323E",
+ "ideographicrightcircle", "32A8",
+ "ideographicsecretcircle", "3299",
+ "ideographicselfparen", "3242",
+ "ideographicsocietyparen", "3233",
+ "ideographicspace", "3000",
+ "ideographicspecialparen", "3235",
+ "ideographicstockparen", "3231",
+ "ideographicstudyparen", "323B",
+ "ideographicsunparen", "3230",
+ "ideographicsuperviseparen", "323C",
+ "ideographicwaterparen", "322C",
+ "ideographicwoodparen", "322D",
+ "ideographiczero", "3007",
+ "ideographmetalcircle", "328E",
+ "ideographmooncircle", "328A",
+ "ideographnamecircle", "3294",
+ "ideographsuncircle", "3290",
+ "ideographwatercircle", "328C",
+ "ideographwoodcircle", "328D",
+ "ideva", "0907",
+ "idieresis", "00EF",
+ "idieresisacute", "1E2F",
+ "idieresiscyrillic", "04E5",
+ "idotbelow", "1ECB",
+ "iebrevecyrillic", "04D7",
+ "iecyrillic", "0435",
+ "ieungacirclekorean", "3275",
+ "ieungaparenkorean", "3215",
+ "ieungcirclekorean", "3267",
+ "ieungkorean", "3147",
+ "ieungparenkorean", "3207",
+ "igrave", "00EC",
+ "igujarati", "0A87",
+ "igurmukhi", "0A07",
+ "ihiragana", "3044",
+ "ihookabove", "1EC9",
+ "iibengali", "0988",
+ "iicyrillic", "0438",
+ "iideva", "0908",
+ "iigujarati", "0A88",
+ "iigurmukhi", "0A08",
+ "iimatragurmukhi", "0A40",
+ "iinvertedbreve", "020B",
+ "iishortcyrillic", "0439",
+ "iivowelsignbengali", "09C0",
+ "iivowelsigndeva", "0940",
+ "iivowelsigngujarati", "0AC0",
+ "ij", "0133",
+ "ikatakana", "30A4",
+ "ikatakanahalfwidth", "FF72",
+ "ikorean", "3163",
+ "ilde", "02DC",
+ "iluyhebrew", "05AC",
+ "imacron", "012B",
+ "imacroncyrillic", "04E3",
+ "imageorapproximatelyequal", "2253",
+ "imatragurmukhi", "0A3F",
+ "imonospace", "FF49",
+ "increment", "2206",
+ "infinity", "221E",
+ "iniarmenian", "056B",
+ "integral", "222B",
+ "integralbottom", "2321",
+ "integralbt", "2321",
+ "integraltop", "2320",
+ "integraltp", "2320",
+ "intersection", "2229",
+ "intisquare", "3305",
+ "invbullet", "25D8",
+ "invcircle", "25D9",
+ "invsmileface", "263B",
+ "iocyrillic", "0451",
+ "iogonek", "012F",
+ "iota", "03B9",
+ "iotadieresis", "03CA",
+ "iotadieresistonos", "0390",
+ "iotalatin", "0269",
+ "iotatonos", "03AF",
+ "iparen", "24A4",
+ "irigurmukhi", "0A72",
+ "ismallhiragana", "3043",
+ "ismallkatakana", "30A3",
+ "ismallkatakanahalfwidth", "FF68",
+ "issharbengali", "09FA",
+ "istroke", "0268",
+ "iterationhiragana", "309D",
+ "iterationkatakana", "30FD",
+ "itilde", "0129",
+ "itildebelow", "1E2D",
+ "iubopomofo", "3129",
+ "iucyrillic", "044E",
+ "ivowelsignbengali", "09BF",
+ "ivowelsigndeva", "093F",
+ "ivowelsigngujarati", "0ABF",
+ "izhitsacyrillic", "0475",
+ "izhitsadblgravecyrillic", "0477",
+ "j", "006A",
+ "jaarmenian", "0571",
+ "jabengali", "099C",
+ "jadeva", "091C",
+ "jagujarati", "0A9C",
+ "jagurmukhi", "0A1C",
+ "jbopomofo", "3110",
+ "jcaron", "01F0",
+ "jcircle", "24D9",
+ "jcircumflex", "0135",
+ "jcrossedtail", "029D",
+ "jdotlessstroke", "025F",
+ "jecyrillic", "0458",
+ "jeemarabic", "062C",
+ "jeemfinalarabic", "FE9E",
+ "jeeminitialarabic", "FE9F",
+ "jeemmedialarabic", "FEA0",
+ "jeharabic", "0698",
+ "jehfinalarabic", "FB8B",
+ "jhabengali", "099D",
+ "jhadeva", "091D",
+ "jhagujarati", "0A9D",
+ "jhagurmukhi", "0A1D",
+ "jheharmenian", "057B",
+ "jis", "3004",
+ "jmonospace", "FF4A",
+ "jparen", "24A5",
+ "jsuperior", "02B2",
+ "k", "006B",
+ "kabashkircyrillic", "04A1",
+ "kabengali", "0995",
+ "kacute", "1E31",
+ "kacyrillic", "043A",
+ "kadescendercyrillic", "049B",
+ "kadeva", "0915",
+ "kaf", "05DB",
+ "kafarabic", "0643",
+ "kafdagesh", "FB3B",
+ "kafdageshhebrew", "FB3B",
+ "kaffinalarabic", "FEDA",
+ "kafhebrew", "05DB",
+ "kafinitialarabic", "FEDB",
+ "kafmedialarabic", "FEDC",
+ "kafrafehebrew", "FB4D",
+ "kagujarati", "0A95",
+ "kagurmukhi", "0A15",
+ "kahiragana", "304B",
+ "kahookcyrillic", "04C4",
+ "kakatakana", "30AB",
+ "kakatakanahalfwidth", "FF76",
+ "kappa", "03BA",
+ "kappasymbolgreek", "03F0",
+ "kapyeounmieumkorean", "3171",
+ "kapyeounphieuphkorean", "3184",
+ "kapyeounpieupkorean", "3178",
+ "kapyeounssangpieupkorean", "3179",
+ "karoriisquare", "330D",
+ "kashidaautoarabic", "0640",
+ "kashidaautonosidebearingarabic", "0640",
+ "kasmallkatakana", "30F5",
+ "kasquare", "3384",
+ "kasraarabic", "0650",
+ "kasratanarabic", "064D",
+ "kastrokecyrillic", "049F",
+ "katahiraprolongmarkhalfwidth", "FF70",
+ "kaverticalstrokecyrillic", "049D",
+ "kbopomofo", "310E",
+ "kcalsquare", "3389",
+ "kcaron", "01E9",
+ "kcedilla", "0137",
+ "kcircle", "24DA",
+ "kcommaaccent", "0137",
+ "kdotbelow", "1E33",
+ "keharmenian", "0584",
+ "kehiragana", "3051",
+ "kekatakana", "30B1",
+ "kekatakanahalfwidth", "FF79",
+ "kenarmenian", "056F",
+ "kesmallkatakana", "30F6",
+ "kgreenlandic", "0138",
+ "khabengali", "0996",
+ "khacyrillic", "0445",
+ "khadeva", "0916",
+ "khagujarati", "0A96",
+ "khagurmukhi", "0A16",
+ "khaharabic", "062E",
+ "khahfinalarabic", "FEA6",
+ "khahinitialarabic", "FEA7",
+ "khahmedialarabic", "FEA8",
+ "kheicoptic", "03E7",
+ "khhadeva", "0959",
+ "khhagurmukhi", "0A59",
+ "khieukhacirclekorean", "3278",
+ "khieukhaparenkorean", "3218",
+ "khieukhcirclekorean", "326A",
+ "khieukhkorean", "314B",
+ "khieukhparenkorean", "320A",
+ "khokhaithai", "0E02",
+ "khokhonthai", "0E05",
+ "khokhuatthai", "0E03",
+ "khokhwaithai", "0E04",
+ "khomutthai", "0E5B",
+ "khook", "0199",
+ "khorakhangthai", "0E06",
+ "khzsquare", "3391",
+ "kihiragana", "304D",
+ "kikatakana", "30AD",
+ "kikatakanahalfwidth", "FF77",
+ "kiroguramusquare", "3315",
+ "kiromeetorusquare", "3316",
+ "kirosquare", "3314",
+ "kiyeokacirclekorean", "326E",
+ "kiyeokaparenkorean", "320E",
+ "kiyeokcirclekorean", "3260",
+ "kiyeokkorean", "3131",
+ "kiyeokparenkorean", "3200",
+ "kiyeoksioskorean", "3133",
+ "kjecyrillic", "045C",
+ "klinebelow", "1E35",
+ "klsquare", "3398",
+ "kmcubedsquare", "33A6",
+ "kmonospace", "FF4B",
+ "kmsquaredsquare", "33A2",
+ "kohiragana", "3053",
+ "kohmsquare", "33C0",
+ "kokaithai", "0E01",
+ "kokatakana", "30B3",
+ "kokatakanahalfwidth", "FF7A",
+ "kooposquare", "331E",
+ "koppacyrillic", "0481",
+ "koreanstandardsymbol", "327F",
+ "koroniscmb", "0343",
+ "kparen", "24A6",
+ "kpasquare", "33AA",
+ "ksicyrillic", "046F",
+ "ktsquare", "33CF",
+ "kturned", "029E",
+ "kuhiragana", "304F",
+ "kukatakana", "30AF",
+ "kukatakanahalfwidth", "FF78",
+ "kvsquare", "33B8",
+ "kwsquare", "33BE",
+ "l", "006C",
+ "labengali", "09B2",
+ "lacute", "013A",
+ "ladeva", "0932",
+ "lagujarati", "0AB2",
+ "lagurmukhi", "0A32",
+ "lakkhangyaothai", "0E45",
+ "lamaleffinalarabic", "FEFC",
+ "lamalefhamzaabovefinalarabic", "FEF8",
+ "lamalefhamzaaboveisolatedarabic", "FEF7",
+ "lamalefhamzabelowfinalarabic", "FEFA",
+ "lamalefhamzabelowisolatedarabic", "FEF9",
+ "lamalefisolatedarabic", "FEFB",
+ "lamalefmaddaabovefinalarabic", "FEF6",
+ "lamalefmaddaaboveisolatedarabic", "FEF5",
+ "lamarabic", "0644",
+ "lambda", "03BB",
+ "lambdastroke", "019B",
+ "lamed", "05DC",
+ "lameddagesh", "FB3C",
+ "lameddageshhebrew", "FB3C",
+ "lamedhebrew", "05DC",
+ "lamedholam", "05DC_05B9",
+ "lamedholamdagesh", "05DC_05B9_05BC",
+ "lamedholamdageshhebrew", "05DC_05B9_05BC",
+ "lamedholamhebrew", "05DC_05B9",
+ "lamfinalarabic", "FEDE",
+ "lamhahinitialarabic", "FCCA",
+ "laminitialarabic", "FEDF",
+ "lamjeeminitialarabic", "FCC9",
+ "lamkhahinitialarabic", "FCCB",
+ "lamlamhehisolatedarabic", "FDF2",
+ "lammedialarabic", "FEE0",
+ "lammeemhahinitialarabic", "FD88",
+ "lammeeminitialarabic", "FCCC",
+ "lammeemjeeminitialarabic", "FEDF_FEE4_FEA0",
+ "lammeemkhahinitialarabic", "FEDF_FEE4_FEA8",
+ "largecircle", "25EF",
+ "lbar", "019A",
+ "lbelt", "026C",
+ "lbopomofo", "310C",
+ "lcaron", "013E",
+ "lcedilla", "013C",
+ "lcircle", "24DB",
+ "lcircumflexbelow", "1E3D",
+ "lcommaaccent", "013C",
+ "ldot", "0140",
+ "ldotaccent", "0140",
+ "ldotbelow", "1E37",
+ "ldotbelowmacron", "1E39",
+ "leftangleabovecmb", "031A",
+ "lefttackbelowcmb", "0318",
+ "less", "003C",
+ "lessequal", "2264",
+ "lessequalorgreater", "22DA",
+ "lessmonospace", "FF1C",
+ "lessorequivalent", "2272",
+ "lessorgreater", "2276",
+ "lessoverequal", "2266",
+ "lesssmall", "FE64",
+ "lezh", "026E",
+ "lfblock", "258C",
+ "lhookretroflex", "026D",
+ "lira", "20A4",
+ "liwnarmenian", "056C",
+ "lj", "01C9",
+ "ljecyrillic", "0459",
+ "lladeva", "0933",
+ "llagujarati", "0AB3",
+ "llinebelow", "1E3B",
+ "llladeva", "0934",
+ "llvocalicbengali", "09E1",
+ "llvocalicdeva", "0961",
+ "llvocalicvowelsignbengali", "09E3",
+ "llvocalicvowelsigndeva", "0963",
+ "lmiddletilde", "026B",
+ "lmonospace", "FF4C",
+ "lmsquare", "33D0",
+ "lochulathai", "0E2C",
+ "logicaland", "2227",
+ "logicalnot", "00AC",
+ "logicalnotreversed", "2310",
+ "logicalor", "2228",
+ "lolingthai", "0E25",
+ "longs", "017F",
+ "lowlinecenterline", "FE4E",
+ "lowlinecmb", "0332",
+ "lowlinedashed", "FE4D",
+ "lozenge", "25CA",
+ "lparen", "24A7",
+ "lslash", "0142",
+ "lsquare", "2113",
+ "ltshade", "2591",
+ "luthai", "0E26",
+ "lvocalicbengali", "098C",
+ "lvocalicdeva", "090C",
+ "lvocalicvowelsignbengali", "09E2",
+ "lvocalicvowelsigndeva", "0962",
+ "lxsquare", "33D3",
+ "m", "006D",
+ "mabengali", "09AE",
+ "macron", "00AF",
+ "macronbelowcmb", "0331",
+ "macroncmb", "0304",
+ "macronlowmod", "02CD",
+ "macronmonospace", "FFE3",
+ "macute", "1E3F",
+ "madeva", "092E",
+ "magujarati", "0AAE",
+ "magurmukhi", "0A2E",
+ "mahapakhhebrew", "05A4",
+ "mahapakhlefthebrew", "05A4",
+ "mahiragana", "307E",
+ "maichattawathai", "0E4B",
+ "maiekthai", "0E48",
+ "maihanakatthai", "0E31",
+ "maitaikhuthai", "0E47",
+ "maithothai", "0E49",
+ "maitrithai", "0E4A",
+ "maiyamokthai", "0E46",
+ "makatakana", "30DE",
+ "makatakanahalfwidth", "FF8F",
+ "male", "2642",
+ "mansyonsquare", "3347",
+ "maqafhebrew", "05BE",
+ "mars", "2642",
+ "masoracirclehebrew", "05AF",
+ "masquare", "3383",
+ "mbopomofo", "3107",
+ "mbsquare", "33D4",
+ "mcircle", "24DC",
+ "mcubedsquare", "33A5",
+ "mdotaccent", "1E41",
+ "mdotbelow", "1E43",
+ "meemarabic", "0645",
+ "meemfinalarabic", "FEE2",
+ "meeminitialarabic", "FEE3",
+ "meemmedialarabic", "FEE4",
+ "meemmeeminitialarabic", "FCD1",
+ "meemmeemisolatedarabic", "FC48",
+ "meetorusquare", "334D",
+ "mehiragana", "3081",
+ "meizierasquare", "337E",
+ "mekatakana", "30E1",
+ "mekatakanahalfwidth", "FF92",
+ "mem", "05DE",
+ "memdagesh", "FB3E",
+ "memdageshhebrew", "FB3E",
+ "memhebrew", "05DE",
+ "menarmenian", "0574",
+ "merkhahebrew", "05A5",
+ "merkhakefulahebrew", "05A6",
+ "merkhakefulalefthebrew", "05A6",
+ "merkhalefthebrew", "05A5",
+ "mhook", "0271",
+ "mhzsquare", "3392",
+ "middledotkatakanahalfwidth", "FF65",
+ "middot", "00B7",
+ "mieumacirclekorean", "3272",
+ "mieumaparenkorean", "3212",
+ "mieumcirclekorean", "3264",
+ "mieumkorean", "3141",
+ "mieumpansioskorean", "3170",
+ "mieumparenkorean", "3204",
+ "mieumpieupkorean", "316E",
+ "mieumsioskorean", "316F",
+ "mihiragana", "307F",
+ "mikatakana", "30DF",
+ "mikatakanahalfwidth", "FF90",
+ "minus", "2212",
+ "minusbelowcmb", "0320",
+ "minuscircle", "2296",
+ "minusmod", "02D7",
+ "minusplus", "2213",
+ "minute", "2032",
+ "miribaarusquare", "334A",
+ "mirisquare", "3349",
+ "mlonglegturned", "0270",
+ "mlsquare", "3396",
+ "mmcubedsquare", "33A3",
+ "mmonospace", "FF4D",
+ "mmsquaredsquare", "339F",
+ "mohiragana", "3082",
+ "mohmsquare", "33C1",
+ "mokatakana", "30E2",
+ "mokatakanahalfwidth", "FF93",
+ "molsquare", "33D6",
+ "momathai", "0E21",
+ "moverssquare", "33A7",
+ "moverssquaredsquare", "33A8",
+ "mparen", "24A8",
+ "mpasquare", "33AB",
+ "mssquare", "33B3",
+ "mturned", "026F",
+ "mu", "00B5",
+ "mu1", "00B5",
+ "muasquare", "3382",
+ "muchgreater", "226B",
+ "muchless", "226A",
+ "mufsquare", "338C",
+ "mugreek", "03BC",
+ "mugsquare", "338D",
+ "muhiragana", "3080",
+ "mukatakana", "30E0",
+ "mukatakanahalfwidth", "FF91",
+ "mulsquare", "3395",
+ "multiply", "00D7",
+ "mumsquare", "339B",
+ "munahhebrew", "05A3",
+ "munahlefthebrew", "05A3",
+ "musicalnote", "266A",
+ "musicalnotedbl", "266B",
+ "musicflatsign", "266D",
+ "musicsharpsign", "266F",
+ "mussquare", "33B2",
+ "muvsquare", "33B6",
+ "muwsquare", "33BC",
+ "mvmegasquare", "33B9",
+ "mvsquare", "33B7",
+ "mwmegasquare", "33BF",
+ "mwsquare", "33BD",
+ "n", "006E",
+ "nabengali", "09A8",
+ "nabla", "2207",
+ "nacute", "0144",
+ "nadeva", "0928",
+ "nagujarati", "0AA8",
+ "nagurmukhi", "0A28",
+ "nahiragana", "306A",
+ "nakatakana", "30CA",
+ "nakatakanahalfwidth", "FF85",
+ "napostrophe", "0149",
+ "nasquare", "3381",
+ "nbopomofo", "310B",
+ "nbspace", "00A0",
+ "ncaron", "0148",
+ "ncedilla", "0146",
+ "ncircle", "24DD",
+ "ncircumflexbelow", "1E4B",
+ "ncommaaccent", "0146",
+ "ndotaccent", "1E45",
+ "ndotbelow", "1E47",
+ "nehiragana", "306D",
+ "nekatakana", "30CD",
+ "nekatakanahalfwidth", "FF88",
+ "newsheqelsign", "20AA",
+ "nfsquare", "338B",
+ "ngabengali", "0999",
+ "ngadeva", "0919",
+ "ngagujarati", "0A99",
+ "ngagurmukhi", "0A19",
+ "ngonguthai", "0E07",
+ "nhiragana", "3093",
+ "nhookleft", "0272",
+ "nhookretroflex", "0273",
+ "nieunacirclekorean", "326F",
+ "nieunaparenkorean", "320F",
+ "nieuncieuckorean", "3135",
+ "nieuncirclekorean", "3261",
+ "nieunhieuhkorean", "3136",
+ "nieunkorean", "3134",
+ "nieunpansioskorean", "3168",
+ "nieunparenkorean", "3201",
+ "nieunsioskorean", "3167",
+ "nieuntikeutkorean", "3166",
+ "nihiragana", "306B",
+ "nikatakana", "30CB",
+ "nikatakanahalfwidth", "FF86",
+ "nikhahitthai", "0E4D",
+ "nine", "0039",
+ "ninearabic", "0669",
+ "ninebengali", "09EF",
+ "ninecircle", "2468",
+ "ninecircleinversesansserif", "2792",
+ "ninedeva", "096F",
+ "ninegujarati", "0AEF",
+ "ninegurmukhi", "0A6F",
+ "ninehackarabic", "0669",
+ "ninehangzhou", "3029",
+ "nineideographicparen", "3228",
+ "nineinferior", "2089",
+ "ninemonospace", "FF19",
+ "nineparen", "247C",
+ "nineperiod", "2490",
+ "ninepersian", "06F9",
+ "nineroman", "2178",
+ "ninesuperior", "2079",
+ "nineteencircle", "2472",
+ "nineteenparen", "2486",
+ "nineteenperiod", "249A",
+ "ninethai", "0E59",
+ "nj", "01CC",
+ "njecyrillic", "045A",
+ "nkatakana", "30F3",
+ "nkatakanahalfwidth", "FF9D",
+ "nlegrightlong", "019E",
+ "nlinebelow", "1E49",
+ "nmonospace", "FF4E",
+ "nmsquare", "339A",
+ "nnabengali", "09A3",
+ "nnadeva", "0923",
+ "nnagujarati", "0AA3",
+ "nnagurmukhi", "0A23",
+ "nnnadeva", "0929",
+ "nohiragana", "306E",
+ "nokatakana", "30CE",
+ "nokatakanahalfwidth", "FF89",
+ "nonbreakingspace", "00A0",
+ "nonenthai", "0E13",
+ "nonuthai", "0E19",
+ "noonarabic", "0646",
+ "noonfinalarabic", "FEE6",
+ "noonghunnaarabic", "06BA",
+ "noonghunnafinalarabic", "FB9F",
+ "noonhehinitialarabic", "FEE7_FEEC",
+ "nooninitialarabic", "FEE7",
+ "noonjeeminitialarabic", "FCD2",
+ "noonjeemisolatedarabic", "FC4B",
+ "noonmedialarabic", "FEE8",
+ "noonmeeminitialarabic", "FCD5",
+ "noonmeemisolatedarabic", "FC4E",
+ "noonnoonfinalarabic", "FC8D",
+ "notcontains", "220C",
+ "notelement", "2209",
+ "notelementof", "2209",
+ "notequal", "2260",
+ "notgreater", "226F",
+ "notgreaternorequal", "2271",
+ "notgreaternorless", "2279",
+ "notidentical", "2262",
+ "notless", "226E",
+ "notlessnorequal", "2270",
+ "notparallel", "2226",
+ "notprecedes", "2280",
+ "notsubset", "2284",
+ "notsucceeds", "2281",
+ "notsuperset", "2285",
+ "nowarmenian", "0576",
+ "nparen", "24A9",
+ "nssquare", "33B1",
+ "nsuperior", "207F",
+ "ntilde", "00F1",
+ "nu", "03BD",
+ "nuhiragana", "306C",
+ "nukatakana", "30CC",
+ "nukatakanahalfwidth", "FF87",
+ "nuktabengali", "09BC",
+ "nuktadeva", "093C",
+ "nuktagujarati", "0ABC",
+ "nuktagurmukhi", "0A3C",
+ "numbersign", "0023",
+ "numbersignmonospace", "FF03",
+ "numbersignsmall", "FE5F",
+ "numeralsigngreek", "0374",
+ "numeralsignlowergreek", "0375",
+ "numero", "2116",
+ "nun", "05E0",
+ "nundagesh", "FB40",
+ "nundageshhebrew", "FB40",
+ "nunhebrew", "05E0",
+ "nvsquare", "33B5",
+ "nwsquare", "33BB",
+ "nyabengali", "099E",
+ "nyadeva", "091E",
+ "nyagujarati", "0A9E",
+ "nyagurmukhi", "0A1E",
+ "o", "006F",
+ "oacute", "00F3",
+ "oangthai", "0E2D",
+ "obarred", "0275",
+ "obarredcyrillic", "04E9",
+ "obarreddieresiscyrillic", "04EB",
+ "obengali", "0993",
+ "obopomofo", "311B",
+ "obreve", "014F",
+ "ocandradeva", "0911",
+ "ocandragujarati", "0A91",
+ "ocandravowelsigndeva", "0949",
+ "ocandravowelsigngujarati", "0AC9",
+ "ocaron", "01D2",
+ "ocircle", "24DE",
+ "ocircumflex", "00F4",
+ "ocircumflexacute", "1ED1",
+ "ocircumflexdotbelow", "1ED9",
+ "ocircumflexgrave", "1ED3",
+ "ocircumflexhookabove", "1ED5",
+ "ocircumflextilde", "1ED7",
+ "ocyrillic", "043E",
+ "odblacute", "0151",
+ "odblgrave", "020D",
+ "odeva", "0913",
+ "odieresis", "00F6",
+ "odieresiscyrillic", "04E7",
+ "odotbelow", "1ECD",
+ "oe", "0153",
+ "oekorean", "315A",
+ "ogonek", "02DB",
+ "ogonekcmb", "0328",
+ "ograve", "00F2",
+ "ogujarati", "0A93",
+ "oharmenian", "0585",
+ "ohiragana", "304A",
+ "ohookabove", "1ECF",
+ "ohorn", "01A1",
+ "ohornacute", "1EDB",
+ "ohorndotbelow", "1EE3",
+ "ohorngrave", "1EDD",
+ "ohornhookabove", "1EDF",
+ "ohorntilde", "1EE1",
+ "ohungarumlaut", "0151",
+ "oi", "01A3",
+ "oinvertedbreve", "020F",
+ "okatakana", "30AA",
+ "okatakanahalfwidth", "FF75",
+ "okorean", "3157",
+ "olehebrew", "05AB",
+ "omacron", "014D",
+ "omacronacute", "1E53",
+ "omacrongrave", "1E51",
+ "omdeva", "0950",
+ "omega", "03C9",
+ "omega1", "03D6",
+ "omegacyrillic", "0461",
+ "omegalatinclosed", "0277",
+ "omegaroundcyrillic", "047B",
+ "omegatitlocyrillic", "047D",
+ "omegatonos", "03CE",
+ "omgujarati", "0AD0",
+ "omicron", "03BF",
+ "omicrontonos", "03CC",
+ "omonospace", "FF4F",
+ "one", "0031",
+ "onearabic", "0661",
+ "onebengali", "09E7",
+ "onecircle", "2460",
+ "onecircleinversesansserif", "278A",
+ "onedeva", "0967",
+ "onedotenleader", "2024",
+ "oneeighth", "215B",
+ "onegujarati", "0AE7",
+ "onegurmukhi", "0A67",
+ "onehackarabic", "0661",
+ "onehalf", "00BD",
+ "onehangzhou", "3021",
+ "oneideographicparen", "3220",
+ "oneinferior", "2081",
+ "onemonospace", "FF11",
+ "onenumeratorbengali", "09F4",
+ "oneparen", "2474",
+ "oneperiod", "2488",
+ "onepersian", "06F1",
+ "onequarter", "00BC",
+ "oneroman", "2170",
+ "onesuperior", "00B9",
+ "onethai", "0E51",
+ "onethird", "2153",
+ "oogonek", "01EB",
+ "oogonekmacron", "01ED",
+ "oogurmukhi", "0A13",
+ "oomatragurmukhi", "0A4B",
+ "oopen", "0254",
+ "oparen", "24AA",
+ "openbullet", "25E6",
+ "option", "2325",
+ "ordfeminine", "00AA",
+ "ordmasculine", "00BA",
+ "orthogonal", "221F",
+ "oshortdeva", "0912",
+ "oshortvowelsigndeva", "094A",
+ "oslash", "00F8",
+ "oslashacute", "01FF",
+ "osmallhiragana", "3049",
+ "osmallkatakana", "30A9",
+ "osmallkatakanahalfwidth", "FF6B",
+ "ostrokeacute", "01FF",
+ "otcyrillic", "047F",
+ "otilde", "00F5",
+ "otildeacute", "1E4D",
+ "otildedieresis", "1E4F",
+ "oubopomofo", "3121",
+ "overline", "203E",
+ "overlinecenterline", "FE4A",
+ "overlinecmb", "0305",
+ "overlinedashed", "FE49",
+ "overlinedblwavy", "FE4C",
+ "overlinewavy", "FE4B",
+ "overscore", "00AF",
+ "ovowelsignbengali", "09CB",
+ "ovowelsigndeva", "094B",
+ "ovowelsigngujarati", "0ACB",
+ "p", "0070",
+ "paampssquare", "3380",
+ "paasentosquare", "332B",
+ "pabengali", "09AA",
+ "pacute", "1E55",
+ "padeva", "092A",
+ "pagedown", "21DF",
+ "pageup", "21DE",
+ "pagujarati", "0AAA",
+ "pagurmukhi", "0A2A",
+ "pahiragana", "3071",
+ "paiyannoithai", "0E2F",
+ "pakatakana", "30D1",
+ "palatalizationcyrilliccmb", "0484",
+ "palochkacyrillic", "04C0",
+ "pansioskorean", "317F",
+ "paragraph", "00B6",
+ "parallel", "2225",
+ "parenleft", "0028",
+ "parenleftaltonearabic", "FD3E",
+ "parenleftinferior", "208D",
+ "parenleftmonospace", "FF08",
+ "parenleftsmall", "FE59",
+ "parenleftsuperior", "207D",
+ "parenleftvertical", "FE35",
+ "parenright", "0029",
+ "parenrightaltonearabic", "FD3F",
+ "parenrightinferior", "208E",
+ "parenrightmonospace", "FF09",
+ "parenrightsmall", "FE5A",
+ "parenrightsuperior", "207E",
+ "parenrightvertical", "FE36",
+ "partialdiff", "2202",
+ "paseqhebrew", "05C0",
+ "pashtahebrew", "0599",
+ "pasquare", "33A9",
+ "patah", "05B7",
+ "patah11", "05B7",
+ "patah1d", "05B7",
+ "patah2a", "05B7",
+ "patahhebrew", "05B7",
+ "patahnarrowhebrew", "05B7",
+ "patahquarterhebrew", "05B7",
+ "patahwidehebrew", "05B7",
+ "pazerhebrew", "05A1",
+ "pbopomofo", "3106",
+ "pcircle", "24DF",
+ "pdotaccent", "1E57",
+ "pe", "05E4",
+ "pecyrillic", "043F",
+ "pedagesh", "FB44",
+ "pedageshhebrew", "FB44",
+ "peezisquare", "333B",
+ "pefinaldageshhebrew", "FB43",
+ "peharabic", "067E",
+ "peharmenian", "057A",
+ "pehebrew", "05E4",
+ "pehfinalarabic", "FB57",
+ "pehinitialarabic", "FB58",
+ "pehiragana", "307A",
+ "pehmedialarabic", "FB59",
+ "pekatakana", "30DA",
+ "pemiddlehookcyrillic", "04A7",
+ "perafehebrew", "FB4E",
+ "percent", "0025",
+ "percentarabic", "066A",
+ "percentmonospace", "FF05",
+ "percentsmall", "FE6A",
+ "period", "002E",
+ "periodarmenian", "0589",
+ "periodcentered", "00B7",
+ "periodhalfwidth", "FF61",
+ "periodmonospace", "FF0E",
+ "periodsmall", "FE52",
+ "perispomenigreekcmb", "0342",
+ "perpendicular", "22A5",
+ "perthousand", "2030",
+ "peseta", "20A7",
+ "pfsquare", "338A",
+ "phabengali", "09AB",
+ "phadeva", "092B",
+ "phagujarati", "0AAB",
+ "phagurmukhi", "0A2B",
+ "phi", "03C6",
+ "phi1", "03D5",
+ "phieuphacirclekorean", "327A",
+ "phieuphaparenkorean", "321A",
+ "phieuphcirclekorean", "326C",
+ "phieuphkorean", "314D",
+ "phieuphparenkorean", "320C",
+ "philatin", "0278",
+ "phinthuthai", "0E3A",
+ "phisymbolgreek", "03D5",
+ "phook", "01A5",
+ "phophanthai", "0E1E",
+ "phophungthai", "0E1C",
+ "phosamphaothai", "0E20",
+ "pi", "03C0",
+ "pieupacirclekorean", "3273",
+ "pieupaparenkorean", "3213",
+ "pieupcieuckorean", "3176",
+ "pieupcirclekorean", "3265",
+ "pieupkiyeokkorean", "3172",
+ "pieupkorean", "3142",
+ "pieupparenkorean", "3205",
+ "pieupsioskiyeokkorean", "3174",
+ "pieupsioskorean", "3144",
+ "pieupsiostikeutkorean", "3175",
+ "pieupthieuthkorean", "3177",
+ "pieuptikeutkorean", "3173",
+ "pihiragana", "3074",
+ "pikatakana", "30D4",
+ "pisymbolgreek", "03D6",
+ "piwrarmenian", "0583",
+ "plus", "002B",
+ "plusbelowcmb", "031F",
+ "pluscircle", "2295",
+ "plusminus", "00B1",
+ "plusmod", "02D6",
+ "plusmonospace", "FF0B",
+ "plussmall", "FE62",
+ "plussuperior", "207A",
+ "pmonospace", "FF50",
+ "pmsquare", "33D8",
+ "pohiragana", "307D",
+ "pointingindexdownwhite", "261F",
+ "pointingindexleftwhite", "261C",
+ "pointingindexrightwhite", "261E",
+ "pointingindexupwhite", "261D",
+ "pokatakana", "30DD",
+ "poplathai", "0E1B",
+ "postalmark", "3012",
+ "postalmarkface", "3020",
+ "pparen", "24AB",
+ "precedes", "227A",
+ "prescription", "211E",
+ "primemod", "02B9",
+ "primereversed", "2035",
+ "product", "220F",
+ "projective", "2305",
+ "prolongedkana", "30FC",
+ "propellor", "2318",
+ "propersubset", "2282",
+ "propersuperset", "2283",
+ "proportion", "2237",
+ "proportional", "221D",
+ "psi", "03C8",
+ "psicyrillic", "0471",
+ "psilipneumatacyrilliccmb", "0486",
+ "pssquare", "33B0",
+ "puhiragana", "3077",
+ "pukatakana", "30D7",
+ "pvsquare", "33B4",
+ "pwsquare", "33BA",
+ "q", "0071",
+ "qadeva", "0958",
+ "qadmahebrew", "05A8",
+ "qafarabic", "0642",
+ "qaffinalarabic", "FED6",
+ "qafinitialarabic", "FED7",
+ "qafmedialarabic", "FED8",
+ "qamats", "05B8",
+ "qamats10", "05B8",
+ "qamats1a", "05B8",
+ "qamats1c", "05B8",
+ "qamats27", "05B8",
+ "qamats29", "05B8",
+ "qamats33", "05B8",
+ "qamatsde", "05B8",
+ "qamatshebrew", "05B8",
+ "qamatsnarrowhebrew", "05B8",
+ "qamatsqatanhebrew", "05B8",
+ "qamatsqatannarrowhebrew", "05B8",
+ "qamatsqatanquarterhebrew", "05B8",
+ "qamatsqatanwidehebrew", "05B8",
+ "qamatsquarterhebrew", "05B8",
+ "qamatswidehebrew", "05B8",
+ "qarneyparahebrew", "059F",
+ "qbopomofo", "3111",
+ "qcircle", "24E0",
+ "qhook", "02A0",
+ "qmonospace", "FF51",
+ "qof", "05E7",
+ "qofdagesh", "FB47",
+ "qofdageshhebrew", "FB47",
+ "qofhatafpatah", "05E7_05B2",
+ "qofhatafpatahhebrew", "05E7_05B2",
+ "qofhatafsegol", "05E7_05B1",
+ "qofhatafsegolhebrew", "05E7_05B1",
+ "qofhebrew", "05E7",
+ "qofhiriq", "05E7_05B4",
+ "qofhiriqhebrew", "05E7_05B4",
+ "qofholam", "05E7_05B9",
+ "qofholamhebrew", "05E7_05B9",
+ "qofpatah", "05E7_05B7",
+ "qofpatahhebrew", "05E7_05B7",
+ "qofqamats", "05E7_05B8",
+ "qofqamatshebrew", "05E7_05B8",
+ "qofqubuts", "05E7_05BB",
+ "qofqubutshebrew", "05E7_05BB",
+ "qofsegol", "05E7_05B6",
+ "qofsegolhebrew", "05E7_05B6",
+ "qofsheva", "05E7_05B0",
+ "qofshevahebrew", "05E7_05B0",
+ "qoftsere", "05E7_05B5",
+ "qoftserehebrew", "05E7_05B5",
+ "qparen", "24AC",
+ "quarternote", "2669",
+ "qubuts", "05BB",
+ "qubuts18", "05BB",
+ "qubuts25", "05BB",
+ "qubuts31", "05BB",
+ "qubutshebrew", "05BB",
+ "qubutsnarrowhebrew", "05BB",
+ "qubutsquarterhebrew", "05BB",
+ "qubutswidehebrew", "05BB",
+ "question", "003F",
+ "questionarabic", "061F",
+ "questionarmenian", "055E",
+ "questiondown", "00BF",
+ "questiongreek", "037E",
+ "questionmonospace", "FF1F",
+ "quotedbl", "0022",
+ "quotedblbase", "201E",
+ "quotedblleft", "201C",
+ "quotedblmonospace", "FF02",
+ "quotedblprime", "301E",
+ "quotedblprimereversed", "301D",
+ "quotedblright", "201D",
+ "quoteleft", "2018",
+ "quoteleftreversed", "201B",
+ "quotereversed", "201B",
+ "quoteright", "2019",
+ "quoterightn", "0149",
+ "quotesinglbase", "201A",
+ "quotesingle", "0027",
+ "quotesinglemonospace", "FF07",
+ "r", "0072",
+ "raarmenian", "057C",
+ "rabengali", "09B0",
+ "racute", "0155",
+ "radeva", "0930",
+ "radical", "221A",
+ "radoverssquare", "33AE",
+ "radoverssquaredsquare", "33AF",
+ "radsquare", "33AD",
+ "rafe", "05BF",
+ "rafehebrew", "05BF",
+ "ragujarati", "0AB0",
+ "ragurmukhi", "0A30",
+ "rahiragana", "3089",
+ "rakatakana", "30E9",
+ "rakatakanahalfwidth", "FF97",
+ "ralowerdiagonalbengali", "09F1",
+ "ramiddlediagonalbengali", "09F0",
+ "ramshorn", "0264",
+ "ratio", "2236",
+ "rbopomofo", "3116",
+ "rcaron", "0159",
+ "rcedilla", "0157",
+ "rcircle", "24E1",
+ "rcommaaccent", "0157",
+ "rdblgrave", "0211",
+ "rdotaccent", "1E59",
+ "rdotbelow", "1E5B",
+ "rdotbelowmacron", "1E5D",
+ "referencemark", "203B",
+ "reflexsubset", "2286",
+ "reflexsuperset", "2287",
+ "registered", "00AE",
+ "reharabic", "0631",
+ "reharmenian", "0580",
+ "rehfinalarabic", "FEAE",
+ "rehiragana", "308C",
+ "rehyehaleflamarabic", "0631_FEF3_FE8E_0644",
+ "rekatakana", "30EC",
+ "rekatakanahalfwidth", "FF9A",
+ "resh", "05E8",
+ "reshdageshhebrew", "FB48",
+ "reshhatafpatah", "05E8_05B2",
+ "reshhatafpatahhebrew", "05E8_05B2",
+ "reshhatafsegol", "05E8_05B1",
+ "reshhatafsegolhebrew", "05E8_05B1",
+ "reshhebrew", "05E8",
+ "reshhiriq", "05E8_05B4",
+ "reshhiriqhebrew", "05E8_05B4",
+ "reshholam", "05E8_05B9",
+ "reshholamhebrew", "05E8_05B9",
+ "reshpatah", "05E8_05B7",
+ "reshpatahhebrew", "05E8_05B7",
+ "reshqamats", "05E8_05B8",
+ "reshqamatshebrew", "05E8_05B8",
+ "reshqubuts", "05E8_05BB",
+ "reshqubutshebrew", "05E8_05BB",
+ "reshsegol", "05E8_05B6",
+ "reshsegolhebrew", "05E8_05B6",
+ "reshsheva", "05E8_05B0",
+ "reshshevahebrew", "05E8_05B0",
+ "reshtsere", "05E8_05B5",
+ "reshtserehebrew", "05E8_05B5",
+ "reversedtilde", "223D",
+ "reviahebrew", "0597",
+ "reviamugrashhebrew", "0597",
+ "revlogicalnot", "2310",
+ "rfishhook", "027E",
+ "rfishhookreversed", "027F",
+ "rhabengali", "09DD",
+ "rhadeva", "095D",
+ "rho", "03C1",
+ "rhook", "027D",
+ "rhookturned", "027B",
+ "rhookturnedsuperior", "02B5",
+ "rhosymbolgreek", "03F1",
+ "rhotichookmod", "02DE",
+ "rieulacirclekorean", "3271",
+ "rieulaparenkorean", "3211",
+ "rieulcirclekorean", "3263",
+ "rieulhieuhkorean", "3140",
+ "rieulkiyeokkorean", "313A",
+ "rieulkiyeoksioskorean", "3169",
+ "rieulkorean", "3139",
+ "rieulmieumkorean", "313B",
+ "rieulpansioskorean", "316C",
+ "rieulparenkorean", "3203",
+ "rieulphieuphkorean", "313F",
+ "rieulpieupkorean", "313C",
+ "rieulpieupsioskorean", "316B",
+ "rieulsioskorean", "313D",
+ "rieulthieuthkorean", "313E",
+ "rieultikeutkorean", "316A",
+ "rieulyeorinhieuhkorean", "316D",
+ "rightangle", "221F",
+ "righttackbelowcmb", "0319",
+ "righttriangle", "22BF",
+ "rihiragana", "308A",
+ "rikatakana", "30EA",
+ "rikatakanahalfwidth", "FF98",
+ "ring", "02DA",
+ "ringbelowcmb", "0325",
+ "ringcmb", "030A",
+ "ringhalfleft", "02BF",
+ "ringhalfleftarmenian", "0559",
+ "ringhalfleftbelowcmb", "031C",
+ "ringhalfleftcentered", "02D3",
+ "ringhalfright", "02BE",
+ "ringhalfrightbelowcmb", "0339",
+ "ringhalfrightcentered", "02D2",
+ "rinvertedbreve", "0213",
+ "rittorusquare", "3351",
+ "rlinebelow", "1E5F",
+ "rlongleg", "027C",
+ "rlonglegturned", "027A",
+ "rmonospace", "FF52",
+ "rohiragana", "308D",
+ "rokatakana", "30ED",
+ "rokatakanahalfwidth", "FF9B",
+ "roruathai", "0E23",
+ "rparen", "24AD",
+ "rrabengali", "09DC",
+ "rradeva", "0931",
+ "rragurmukhi", "0A5C",
+ "rreharabic", "0691",
+ "rrehfinalarabic", "FB8D",
+ "rrvocalicbengali", "09E0",
+ "rrvocalicdeva", "0960",
+ "rrvocalicgujarati", "0AE0",
+ "rrvocalicvowelsignbengali", "09C4",
+ "rrvocalicvowelsigndeva", "0944",
+ "rrvocalicvowelsigngujarati", "0AC4",
+ "rtblock", "2590",
+ "rturned", "0279",
+ "rturnedsuperior", "02B4",
+ "ruhiragana", "308B",
+ "rukatakana", "30EB",
+ "rukatakanahalfwidth", "FF99",
+ "rupeemarkbengali", "09F2",
+ "rupeesignbengali", "09F3",
+ "ruthai", "0E24",
+ "rvocalicbengali", "098B",
+ "rvocalicdeva", "090B",
+ "rvocalicgujarati", "0A8B",
+ "rvocalicvowelsignbengali", "09C3",
+ "rvocalicvowelsigndeva", "0943",
+ "rvocalicvowelsigngujarati", "0AC3",
+ "s", "0073",
+ "sabengali", "09B8",
+ "sacute", "015B",
+ "sacutedotaccent", "1E65",
+ "sadarabic", "0635",
+ "sadeva", "0938",
+ "sadfinalarabic", "FEBA",
+ "sadinitialarabic", "FEBB",
+ "sadmedialarabic", "FEBC",
+ "sagujarati", "0AB8",
+ "sagurmukhi", "0A38",
+ "sahiragana", "3055",
+ "sakatakana", "30B5",
+ "sakatakanahalfwidth", "FF7B",
+ "sallallahoualayhewasallamarabic", "FDFA",
+ "samekh", "05E1",
+ "samekhdagesh", "FB41",
+ "samekhdageshhebrew", "FB41",
+ "samekhhebrew", "05E1",
+ "saraaathai", "0E32",
+ "saraaethai", "0E41",
+ "saraaimaimalaithai", "0E44",
+ "saraaimaimuanthai", "0E43",
+ "saraamthai", "0E33",
+ "saraathai", "0E30",
+ "saraethai", "0E40",
+ "saraiithai", "0E35",
+ "saraithai", "0E34",
+ "saraothai", "0E42",
+ "saraueethai", "0E37",
+ "sarauethai", "0E36",
+ "sarauthai", "0E38",
+ "sarauuthai", "0E39",
+ "sbopomofo", "3119",
+ "scaron", "0161",
+ "scarondotaccent", "1E67",
+ "scedilla", "015F",
+ "schwa", "0259",
+ "schwacyrillic", "04D9",
+ "schwadieresiscyrillic", "04DB",
+ "schwahook", "025A",
+ "scircle", "24E2",
+ "scircumflex", "015D",
+ "scommaaccent", "0219",
+ "sdotaccent", "1E61",
+ "sdotbelow", "1E63",
+ "sdotbelowdotaccent", "1E69",
+ "seagullbelowcmb", "033C",
+ "second", "2033",
+ "secondtonechinese", "02CA",
+ "section", "00A7",
+ "seenarabic", "0633",
+ "seenfinalarabic", "FEB2",
+ "seeninitialarabic", "FEB3",
+ "seenmedialarabic", "FEB4",
+ "segol", "05B6",
+ "segol13", "05B6",
+ "segol1f", "05B6",
+ "segol2c", "05B6",
+ "segolhebrew", "05B6",
+ "segolnarrowhebrew", "05B6",
+ "segolquarterhebrew", "05B6",
+ "segoltahebrew", "0592",
+ "segolwidehebrew", "05B6",
+ "seharmenian", "057D",
+ "sehiragana", "305B",
+ "sekatakana", "30BB",
+ "sekatakanahalfwidth", "FF7E",
+ "semicolon", "003B",
+ "semicolonarabic", "061B",
+ "semicolonmonospace", "FF1B",
+ "semicolonsmall", "FE54",
+ "semivoicedmarkkana", "309C",
+ "semivoicedmarkkanahalfwidth", "FF9F",
+ "sentisquare", "3322",
+ "sentosquare", "3323",
+ "seven", "0037",
+ "sevenarabic", "0667",
+ "sevenbengali", "09ED",
+ "sevencircle", "2466",
+ "sevencircleinversesansserif", "2790",
+ "sevendeva", "096D",
+ "seveneighths", "215E",
+ "sevengujarati", "0AED",
+ "sevengurmukhi", "0A6D",
+ "sevenhackarabic", "0667",
+ "sevenhangzhou", "3027",
+ "sevenideographicparen", "3226",
+ "seveninferior", "2087",
+ "sevenmonospace", "FF17",
+ "sevenparen", "247A",
+ "sevenperiod", "248E",
+ "sevenpersian", "06F7",
+ "sevenroman", "2176",
+ "sevensuperior", "2077",
+ "seventeencircle", "2470",
+ "seventeenparen", "2484",
+ "seventeenperiod", "2498",
+ "seventhai", "0E57",
+ "sfthyphen", "00AD",
+ "shaarmenian", "0577",
+ "shabengali", "09B6",
+ "shacyrillic", "0448",
+ "shaddaarabic", "0651",
+ "shaddadammaarabic", "FC61",
+ "shaddadammatanarabic", "FC5E",
+ "shaddafathaarabic", "FC60",
+ "shaddafathatanarabic", "0651_064B",
+ "shaddakasraarabic", "FC62",
+ "shaddakasratanarabic", "FC5F",
+ "shade", "2592",
+ "shadedark", "2593",
+ "shadelight", "2591",
+ "shademedium", "2592",
+ "shadeva", "0936",
+ "shagujarati", "0AB6",
+ "shagurmukhi", "0A36",
+ "shalshelethebrew", "0593",
+ "shbopomofo", "3115",
+ "shchacyrillic", "0449",
+ "sheenarabic", "0634",
+ "sheenfinalarabic", "FEB6",
+ "sheeninitialarabic", "FEB7",
+ "sheenmedialarabic", "FEB8",
+ "sheicoptic", "03E3",
+ "sheqel", "20AA",
+ "sheqelhebrew", "20AA",
+ "sheva", "05B0",
+ "sheva115", "05B0",
+ "sheva15", "05B0",
+ "sheva22", "05B0",
+ "sheva2e", "05B0",
+ "shevahebrew", "05B0",
+ "shevanarrowhebrew", "05B0",
+ "shevaquarterhebrew", "05B0",
+ "shevawidehebrew", "05B0",
+ "shhacyrillic", "04BB",
+ "shimacoptic", "03ED",
+ "shin", "05E9",
+ "shindagesh", "FB49",
+ "shindageshhebrew", "FB49",
+ "shindageshshindot", "FB2C",
+ "shindageshshindothebrew", "FB2C",
+ "shindageshsindot", "FB2D",
+ "shindageshsindothebrew", "FB2D",
+ "shindothebrew", "05C1",
+ "shinhebrew", "05E9",
+ "shinshindot", "FB2A",
+ "shinshindothebrew", "FB2A",
+ "shinsindot", "FB2B",
+ "shinsindothebrew", "FB2B",
+ "shook", "0282",
+ "sigma", "03C3",
+ "sigma1", "03C2",
+ "sigmafinal", "03C2",
+ "sigmalunatesymbolgreek", "03F2",
+ "sihiragana", "3057",
+ "sikatakana", "30B7",
+ "sikatakanahalfwidth", "FF7C",
+ "siluqhebrew", "05BD",
+ "siluqlefthebrew", "05BD",
+ "similar", "223C",
+ "sindothebrew", "05C2",
+ "siosacirclekorean", "3274",
+ "siosaparenkorean", "3214",
+ "sioscieuckorean", "317E",
+ "sioscirclekorean", "3266",
+ "sioskiyeokkorean", "317A",
+ "sioskorean", "3145",
+ "siosnieunkorean", "317B",
+ "siosparenkorean", "3206",
+ "siospieupkorean", "317D",
+ "siostikeutkorean", "317C",
+ "six", "0036",
+ "sixarabic", "0666",
+ "sixbengali", "09EC",
+ "sixcircle", "2465",
+ "sixcircleinversesansserif", "278F",
+ "sixdeva", "096C",
+ "sixgujarati", "0AEC",
+ "sixgurmukhi", "0A6C",
+ "sixhackarabic", "0666",
+ "sixhangzhou", "3026",
+ "sixideographicparen", "3225",
+ "sixinferior", "2086",
+ "sixmonospace", "FF16",
+ "sixparen", "2479",
+ "sixperiod", "248D",
+ "sixpersian", "06F6",
+ "sixroman", "2175",
+ "sixsuperior", "2076",
+ "sixteencircle", "246F",
+ "sixteencurrencydenominatorbengali", "09F9",
+ "sixteenparen", "2483",
+ "sixteenperiod", "2497",
+ "sixthai", "0E56",
+ "slash", "002F",
+ "slashmonospace", "FF0F",
+ "slong", "017F",
+ "slongdotaccent", "1E9B",
+ "smileface", "263A",
+ "smonospace", "FF53",
+ "sofpasuqhebrew", "05C3",
+ "softhyphen", "00AD",
+ "softsigncyrillic", "044C",
+ "sohiragana", "305D",
+ "sokatakana", "30BD",
+ "sokatakanahalfwidth", "FF7F",
+ "soliduslongoverlaycmb", "0338",
+ "solidusshortoverlaycmb", "0337",
+ "sorusithai", "0E29",
+ "sosalathai", "0E28",
+ "sosothai", "0E0B",
+ "sosuathai", "0E2A",
+ "space", "0020",
+ "spacehackarabic", "0020",
+ "spade", "2660",
+ "spadesuitblack", "2660",
+ "spadesuitwhite", "2664",
+ "sparen", "24AE",
+ "squarebelowcmb", "033B",
+ "squarecc", "33C4",
+ "squarecm", "339D",
+ "squarediagonalcrosshatchfill", "25A9",
+ "squarehorizontalfill", "25A4",
+ "squarekg", "338F",
+ "squarekm", "339E",
+ "squarekmcapital", "33CE",
+ "squareln", "33D1",
+ "squarelog", "33D2",
+ "squaremg", "338E",
+ "squaremil", "33D5",
+ "squaremm", "339C",
+ "squaremsquared", "33A1",
+ "squareorthogonalcrosshatchfill", "25A6",
+ "squareupperlefttolowerrightfill", "25A7",
+ "squareupperrighttolowerleftfill", "25A8",
+ "squareverticalfill", "25A5",
+ "squarewhitewithsmallblack", "25A3",
+ "srsquare", "33DB",
+ "ssabengali", "09B7",
+ "ssadeva", "0937",
+ "ssagujarati", "0AB7",
+ "ssangcieuckorean", "3149",
+ "ssanghieuhkorean", "3185",
+ "ssangieungkorean", "3180",
+ "ssangkiyeokkorean", "3132",
+ "ssangnieunkorean", "3165",
+ "ssangpieupkorean", "3143",
+ "ssangsioskorean", "3146",
+ "ssangtikeutkorean", "3138",
+ "sterling", "00A3",
+ "sterlingmonospace", "FFE1",
+ "strokelongoverlaycmb", "0336",
+ "strokeshortoverlaycmb", "0335",
+ "subset", "2282",
+ "subsetnotequal", "228A",
+ "subsetorequal", "2286",
+ "succeeds", "227B",
+ "suchthat", "220B",
+ "suhiragana", "3059",
+ "sukatakana", "30B9",
+ "sukatakanahalfwidth", "FF7D",
+ "sukunarabic", "0652",
+ "summation", "2211",
+ "sun", "263C",
+ "superset", "2283",
+ "supersetnotequal", "228B",
+ "supersetorequal", "2287",
+ "svsquare", "33DC",
+ "syouwaerasquare", "337C",
+ "t", "0074",
+ "tabengali", "09A4",
+ "tackdown", "22A4",
+ "tackleft", "22A3",
+ "tadeva", "0924",
+ "tagujarati", "0AA4",
+ "tagurmukhi", "0A24",
+ "taharabic", "0637",
+ "tahfinalarabic", "FEC2",
+ "tahinitialarabic", "FEC3",
+ "tahiragana", "305F",
+ "tahmedialarabic", "FEC4",
+ "taisyouerasquare", "337D",
+ "takatakana", "30BF",
+ "takatakanahalfwidth", "FF80",
+ "tatweelarabic", "0640",
+ "tau", "03C4",
+ "tav", "05EA",
+ "tavdages", "FB4A",
+ "tavdagesh", "FB4A",
+ "tavdageshhebrew", "FB4A",
+ "tavhebrew", "05EA",
+ "tbar", "0167",
+ "tbopomofo", "310A",
+ "tcaron", "0165",
+ "tccurl", "02A8",
+ "tcedilla", "0163",
+ "tcheharabic", "0686",
+ "tchehfinalarabic", "FB7B",
+ "tchehinitialarabic", "FB7C",
+ "tchehmedialarabic", "FB7D",
+ "tchehmeeminitialarabic", "FB7C_FEE4",
+ "tcircle", "24E3",
+ "tcircumflexbelow", "1E71",
+ "tcommaaccent", "0163",
+ "tdieresis", "1E97",
+ "tdotaccent", "1E6B",
+ "tdotbelow", "1E6D",
+ "tecyrillic", "0442",
+ "tedescendercyrillic", "04AD",
+ "teharabic", "062A",
+ "tehfinalarabic", "FE96",
+ "tehhahinitialarabic", "FCA2",
+ "tehhahisolatedarabic", "FC0C",
+ "tehinitialarabic", "FE97",
+ "tehiragana", "3066",
+ "tehjeeminitialarabic", "FCA1",
+ "tehjeemisolatedarabic", "FC0B",
+ "tehmarbutaarabic", "0629",
+ "tehmarbutafinalarabic", "FE94",
+ "tehmedialarabic", "FE98",
+ "tehmeeminitialarabic", "FCA4",
+ "tehmeemisolatedarabic", "FC0E",
+ "tehnoonfinalarabic", "FC73",
+ "tekatakana", "30C6",
+ "tekatakanahalfwidth", "FF83",
+ "telephone", "2121",
+ "telephoneblack", "260E",
+ "telishagedolahebrew", "05A0",
+ "telishaqetanahebrew", "05A9",
+ "tencircle", "2469",
+ "tenideographicparen", "3229",
+ "tenparen", "247D",
+ "tenperiod", "2491",
+ "tenroman", "2179",
+ "tesh", "02A7",
+ "tet", "05D8",
+ "tetdagesh", "FB38",
+ "tetdageshhebrew", "FB38",
+ "tethebrew", "05D8",
+ "tetsecyrillic", "04B5",
+ "tevirhebrew", "059B",
+ "tevirlefthebrew", "059B",
+ "thabengali", "09A5",
+ "thadeva", "0925",
+ "thagujarati", "0AA5",
+ "thagurmukhi", "0A25",
+ "thalarabic", "0630",
+ "thalfinalarabic", "FEAC",
+ "thanthakhatthai", "0E4C",
+ "theharabic", "062B",
+ "thehfinalarabic", "FE9A",
+ "thehinitialarabic", "FE9B",
+ "thehmedialarabic", "FE9C",
+ "thereexists", "2203",
+ "therefore", "2234",
+ "theta", "03B8",
+ "theta1", "03D1",
+ "thetasymbolgreek", "03D1",
+ "thieuthacirclekorean", "3279",
+ "thieuthaparenkorean", "3219",
+ "thieuthcirclekorean", "326B",
+ "thieuthkorean", "314C",
+ "thieuthparenkorean", "320B",
+ "thirteencircle", "246C",
+ "thirteenparen", "2480",
+ "thirteenperiod", "2494",
+ "thonangmonthothai", "0E11",
+ "thook", "01AD",
+ "thophuthaothai", "0E12",
+ "thorn", "00FE",
+ "thothahanthai", "0E17",
+ "thothanthai", "0E10",
+ "thothongthai", "0E18",
+ "thothungthai", "0E16",
+ "thousandcyrillic", "0482",
+ "thousandsseparatorarabic", "066C",
+ "thousandsseparatorpersian", "066C",
+ "three", "0033",
+ "threearabic", "0663",
+ "threebengali", "09E9",
+ "threecircle", "2462",
+ "threecircleinversesansserif", "278C",
+ "threedeva", "0969",
+ "threeeighths", "215C",
+ "threegujarati", "0AE9",
+ "threegurmukhi", "0A69",
+ "threehackarabic", "0663",
+ "threehangzhou", "3023",
+ "threeideographicparen", "3222",
+ "threeinferior", "2083",
+ "threemonospace", "FF13",
+ "threenumeratorbengali", "09F6",
+ "threeparen", "2476",
+ "threeperiod", "248A",
+ "threepersian", "06F3",
+ "threequarters", "00BE",
+ "threeroman", "2172",
+ "threesuperior", "00B3",
+ "threethai", "0E53",
+ "thzsquare", "3394",
+ "tihiragana", "3061",
+ "tikatakana", "30C1",
+ "tikatakanahalfwidth", "FF81",
+ "tikeutacirclekorean", "3270",
+ "tikeutaparenkorean", "3210",
+ "tikeutcirclekorean", "3262",
+ "tikeutkorean", "3137",
+ "tikeutparenkorean", "3202",
+ "tilde", "02DC",
+ "tildebelowcmb", "0330",
+ "tildecmb", "0303",
+ "tildecomb", "0303",
+ "tildedoublecmb", "0360",
+ "tildeoperator", "223C",
+ "tildeoverlaycmb", "0334",
+ "tildeverticalcmb", "033E",
+ "timescircle", "2297",
+ "tipehahebrew", "0596",
+ "tipehalefthebrew", "0596",
+ "tippigurmukhi", "0A70",
+ "titlocyrilliccmb", "0483",
+ "tiwnarmenian", "057F",
+ "tlinebelow", "1E6F",
+ "tmonospace", "FF54",
+ "toarmenian", "0569",
+ "tohiragana", "3068",
+ "tokatakana", "30C8",
+ "tokatakanahalfwidth", "FF84",
+ "tonebarextrahighmod", "02E5",
+ "tonebarextralowmod", "02E9",
+ "tonebarhighmod", "02E6",
+ "tonebarlowmod", "02E8",
+ "tonebarmidmod", "02E7",
+ "tonefive", "01BD",
+ "tonesix", "0185",
+ "tonetwo", "01A8",
+ "tonos", "0384",
+ "tonsquare", "3327",
+ "topatakthai", "0E0F",
+ "tortoiseshellbracketleft", "3014",
+ "tortoiseshellbracketleftsmall", "FE5D",
+ "tortoiseshellbracketleftvertical", "FE39",
+ "tortoiseshellbracketright", "3015",
+ "tortoiseshellbracketrightsmall", "FE5E",
+ "tortoiseshellbracketrightvertical", "FE3A",
+ "totaothai", "0E15",
+ "tpalatalhook", "01AB",
+ "tparen", "24AF",
+ "trademark", "2122",
+ "tretroflexhook", "0288",
+ "triagdn", "25BC",
+ "triaglf", "25C4",
+ "triagrt", "25BA",
+ "triagup", "25B2",
+ "ts", "02A6",
+ "tsadi", "05E6",
+ "tsadidagesh", "FB46",
+ "tsadidageshhebrew", "FB46",
+ "tsadihebrew", "05E6",
+ "tsecyrillic", "0446",
+ "tsere", "05B5",
+ "tsere12", "05B5",
+ "tsere1e", "05B5",
+ "tsere2b", "05B5",
+ "tserehebrew", "05B5",
+ "tserenarrowhebrew", "05B5",
+ "tserequarterhebrew", "05B5",
+ "tserewidehebrew", "05B5",
+ "tshecyrillic", "045B",
+ "ttabengali", "099F",
+ "ttadeva", "091F",
+ "ttagujarati", "0A9F",
+ "ttagurmukhi", "0A1F",
+ "tteharabic", "0679",
+ "ttehfinalarabic", "FB67",
+ "ttehinitialarabic", "FB68",
+ "ttehmedialarabic", "FB69",
+ "tthabengali", "09A0",
+ "tthadeva", "0920",
+ "tthagujarati", "0AA0",
+ "tthagurmukhi", "0A20",
+ "tturned", "0287",
+ "tuhiragana", "3064",
+ "tukatakana", "30C4",
+ "tukatakanahalfwidth", "FF82",
+ "tusmallhiragana", "3063",
+ "tusmallkatakana", "30C3",
+ "tusmallkatakanahalfwidth", "FF6F",
+ "twelvecircle", "246B",
+ "twelveparen", "247F",
+ "twelveperiod", "2493",
+ "twelveroman", "217B",
+ "twentycircle", "2473",
+ "twentyhangzhou", "5344",
+ "twentyparen", "2487",
+ "twentyperiod", "249B",
+ "two", "0032",
+ "twoarabic", "0662",
+ "twobengali", "09E8",
+ "twocircle", "2461",
+ "twocircleinversesansserif", "278B",
+ "twodeva", "0968",
+ "twodotenleader", "2025",
+ "twodotleader", "2025",
+ "twodotleadervertical", "FE30",
+ "twogujarati", "0AE8",
+ "twogurmukhi", "0A68",
+ "twohackarabic", "0662",
+ "twohangzhou", "3022",
+ "twoideographicparen", "3221",
+ "twoinferior", "2082",
+ "twomonospace", "FF12",
+ "twonumeratorbengali", "09F5",
+ "twoparen", "2475",
+ "twoperiod", "2489",
+ "twopersian", "06F2",
+ "tworoman", "2171",
+ "twostroke", "01BB",
+ "twosuperior", "00B2",
+ "twothai", "0E52",
+ "twothirds", "2154",
+ "u", "0075",
+ "uacute", "00FA",
+ "ubar", "0289",
+ "ubengali", "0989",
+ "ubopomofo", "3128",
+ "ubreve", "016D",
+ "ucaron", "01D4",
+ "ucircle", "24E4",
+ "ucircumflex", "00FB",
+ "ucircumflexbelow", "1E77",
+ "ucyrillic", "0443",
+ "udattadeva", "0951",
+ "udblacute", "0171",
+ "udblgrave", "0215",
+ "udeva", "0909",
+ "udieresis", "00FC",
+ "udieresisacute", "01D8",
+ "udieresisbelow", "1E73",
+ "udieresiscaron", "01DA",
+ "udieresiscyrillic", "04F1",
+ "udieresisgrave", "01DC",
+ "udieresismacron", "01D6",
+ "udotbelow", "1EE5",
+ "ugrave", "00F9",
+ "ugujarati", "0A89",
+ "ugurmukhi", "0A09",
+ "uhiragana", "3046",
+ "uhookabove", "1EE7",
+ "uhorn", "01B0",
+ "uhornacute", "1EE9",
+ "uhorndotbelow", "1EF1",
+ "uhorngrave", "1EEB",
+ "uhornhookabove", "1EED",
+ "uhorntilde", "1EEF",
+ "uhungarumlaut", "0171",
+ "uhungarumlautcyrillic", "04F3",
+ "uinvertedbreve", "0217",
+ "ukatakana", "30A6",
+ "ukatakanahalfwidth", "FF73",
+ "ukcyrillic", "0479",
+ "ukorean", "315C",
+ "umacron", "016B",
+ "umacroncyrillic", "04EF",
+ "umacrondieresis", "1E7B",
+ "umatragurmukhi", "0A41",
+ "umonospace", "FF55",
+ "underscore", "005F",
+ "underscoredbl", "2017",
+ "underscoremonospace", "FF3F",
+ "underscorevertical", "FE33",
+ "underscorewavy", "FE4F",
+ "union", "222A",
+ "universal", "2200",
+ "uogonek", "0173",
+ "uparen", "24B0",
+ "upblock", "2580",
+ "upperdothebrew", "05C4",
+ "upsilon", "03C5",
+ "upsilondieresis", "03CB",
+ "upsilondieresistonos", "03B0",
+ "upsilonlatin", "028A",
+ "upsilontonos", "03CD",
+ "uptackbelowcmb", "031D",
+ "uptackmod", "02D4",
+ "uragurmukhi", "0A73",
+ "uring", "016F",
+ "ushortcyrillic", "045E",
+ "usmallhiragana", "3045",
+ "usmallkatakana", "30A5",
+ "usmallkatakanahalfwidth", "FF69",
+ "ustraightcyrillic", "04AF",
+ "ustraightstrokecyrillic", "04B1",
+ "utilde", "0169",
+ "utildeacute", "1E79",
+ "utildebelow", "1E75",
+ "uubengali", "098A",
+ "uudeva", "090A",
+ "uugujarati", "0A8A",
+ "uugurmukhi", "0A0A",
+ "uumatragurmukhi", "0A42",
+ "uuvowelsignbengali", "09C2",
+ "uuvowelsigndeva", "0942",
+ "uuvowelsigngujarati", "0AC2",
+ "uvowelsignbengali", "09C1",
+ "uvowelsigndeva", "0941",
+ "uvowelsigngujarati", "0AC1",
+ "v", "0076",
+ "vadeva", "0935",
+ "vagujarati", "0AB5",
+ "vagurmukhi", "0A35",
+ "vakatakana", "30F7",
+ "vav", "05D5",
+ "vavdagesh", "FB35",
+ "vavdagesh65", "FB35",
+ "vavdageshhebrew", "FB35",
+ "vavhebrew", "05D5",
+ "vavholam", "FB4B",
+ "vavholamhebrew", "FB4B",
+ "vavvavhebrew", "05F0",
+ "vavyodhebrew", "05F1",
+ "vcircle", "24E5",
+ "vdotbelow", "1E7F",
+ "vecyrillic", "0432",
+ "veharabic", "06A4",
+ "vehfinalarabic", "FB6B",
+ "vehinitialarabic", "FB6C",
+ "vehmedialarabic", "FB6D",
+ "vekatakana", "30F9",
+ "venus", "2640",
+ "verticalbar", "007C",
+ "verticallineabovecmb", "030D",
+ "verticallinebelowcmb", "0329",
+ "verticallinelowmod", "02CC",
+ "verticallinemod", "02C8",
+ "vewarmenian", "057E",
+ "vhook", "028B",
+ "vikatakana", "30F8",
+ "viramabengali", "09CD",
+ "viramadeva", "094D",
+ "viramagujarati", "0ACD",
+ "visargabengali", "0983",
+ "visargadeva", "0903",
+ "visargagujarati", "0A83",
+ "vmonospace", "FF56",
+ "voarmenian", "0578",
+ "voicediterationhiragana", "309E",
+ "voicediterationkatakana", "30FE",
+ "voicedmarkkana", "309B",
+ "voicedmarkkanahalfwidth", "FF9E",
+ "vokatakana", "30FA",
+ "vparen", "24B1",
+ "vtilde", "1E7D",
+ "vturned", "028C",
+ "vuhiragana", "3094",
+ "vukatakana", "30F4",
+ "w", "0077",
+ "wacute", "1E83",
+ "waekorean", "3159",
+ "wahiragana", "308F",
+ "wakatakana", "30EF",
+ "wakatakanahalfwidth", "FF9C",
+ "wakorean", "3158",
+ "wasmallhiragana", "308E",
+ "wasmallkatakana", "30EE",
+ "wattosquare", "3357",
+ "wavedash", "301C",
+ "wavyunderscorevertical", "FE34",
+ "wawarabic", "0648",
+ "wawfinalarabic", "FEEE",
+ "wawhamzaabovearabic", "0624",
+ "wawhamzaabovefinalarabic", "FE86",
+ "wbsquare", "33DD",
+ "wcircle", "24E6",
+ "wcircumflex", "0175",
+ "wdieresis", "1E85",
+ "wdotaccent", "1E87",
+ "wdotbelow", "1E89",
+ "wehiragana", "3091",
+ "weierstrass", "2118",
+ "wekatakana", "30F1",
+ "wekorean", "315E",
+ "weokorean", "315D",
+ "wgrave", "1E81",
+ "whitebullet", "25E6",
+ "whitecircle", "25CB",
+ "whitecircleinverse", "25D9",
+ "whitecornerbracketleft", "300E",
+ "whitecornerbracketleftvertical", "FE43",
+ "whitecornerbracketright", "300F",
+ "whitecornerbracketrightvertical", "FE44",
+ "whitediamond", "25C7",
+ "whitediamondcontainingblacksmalldiamond", "25C8",
+ "whitedownpointingsmalltriangle", "25BF",
+ "whitedownpointingtriangle", "25BD",
+ "whiteleftpointingsmalltriangle", "25C3",
+ "whiteleftpointingtriangle", "25C1",
+ "whitelenticularbracketleft", "3016",
+ "whitelenticularbracketright", "3017",
+ "whiterightpointingsmalltriangle", "25B9",
+ "whiterightpointingtriangle", "25B7",
+ "whitesmallsquare", "25AB",
+ "whitesmilingface", "263A",
+ "whitesquare", "25A1",
+ "whitestar", "2606",
+ "whitetelephone", "260F",
+ "whitetortoiseshellbracketleft", "3018",
+ "whitetortoiseshellbracketright", "3019",
+ "whiteuppointingsmalltriangle", "25B5",
+ "whiteuppointingtriangle", "25B3",
+ "wihiragana", "3090",
+ "wikatakana", "30F0",
+ "wikorean", "315F",
+ "wmonospace", "FF57",
+ "wohiragana", "3092",
+ "wokatakana", "30F2",
+ "wokatakanahalfwidth", "FF66",
+ "won", "20A9",
+ "wonmonospace", "FFE6",
+ "wowaenthai", "0E27",
+ "wparen", "24B2",
+ "wring", "1E98",
+ "wsuperior", "02B7",
+ "wturned", "028D",
+ "wynn", "01BF",
+ "x", "0078",
+ "xabovecmb", "033D",
+ "xbopomofo", "3112",
+ "xcircle", "24E7",
+ "xdieresis", "1E8D",
+ "xdotaccent", "1E8B",
+ "xeharmenian", "056D",
+ "xi", "03BE",
+ "xmonospace", "FF58",
+ "xparen", "24B3",
+ "xsuperior", "02E3",
+ "y", "0079",
+ "yaadosquare", "334E",
+ "yabengali", "09AF",
+ "yacute", "00FD",
+ "yadeva", "092F",
+ "yaekorean", "3152",
+ "yagujarati", "0AAF",
+ "yagurmukhi", "0A2F",
+ "yahiragana", "3084",
+ "yakatakana", "30E4",
+ "yakatakanahalfwidth", "FF94",
+ "yakorean", "3151",
+ "yamakkanthai", "0E4E",
+ "yasmallhiragana", "3083",
+ "yasmallkatakana", "30E3",
+ "yasmallkatakanahalfwidth", "FF6C",
+ "yatcyrillic", "0463",
+ "ycircle", "24E8",
+ "ycircumflex", "0177",
+ "ydieresis", "00FF",
+ "ydotaccent", "1E8F",
+ "ydotbelow", "1EF5",
+ "yeharabic", "064A",
+ "yehbarreearabic", "06D2",
+ "yehbarreefinalarabic", "FBAF",
+ "yehfinalarabic", "FEF2",
+ "yehhamzaabovearabic", "0626",
+ "yehhamzaabovefinalarabic", "FE8A",
+ "yehhamzaaboveinitialarabic", "FE8B",
+ "yehhamzaabovemedialarabic", "FE8C",
+ "yehinitialarabic", "FEF3",
+ "yehmedialarabic", "FEF4",
+ "yehmeeminitialarabic", "FCDD",
+ "yehmeemisolatedarabic", "FC58",
+ "yehnoonfinalarabic", "FC94",
+ "yehthreedotsbelowarabic", "06D1",
+ "yekorean", "3156",
+ "yen", "00A5",
+ "yenmonospace", "FFE5",
+ "yeokorean", "3155",
+ "yeorinhieuhkorean", "3186",
+ "yerahbenyomohebrew", "05AA",
+ "yerahbenyomolefthebrew", "05AA",
+ "yericyrillic", "044B",
+ "yerudieresiscyrillic", "04F9",
+ "yesieungkorean", "3181",
+ "yesieungpansioskorean", "3183",
+ "yesieungsioskorean", "3182",
+ "yetivhebrew", "059A",
+ "ygrave", "1EF3",
+ "yhook", "01B4",
+ "yhookabove", "1EF7",
+ "yiarmenian", "0575",
+ "yicyrillic", "0457",
+ "yikorean", "3162",
+ "yinyang", "262F",
+ "yiwnarmenian", "0582",
+ "ymonospace", "FF59",
+ "yod", "05D9",
+ "yoddagesh", "FB39",
+ "yoddageshhebrew", "FB39",
+ "yodhebrew", "05D9",
+ "yodyodhebrew", "05F2",
+ "yodyodpatahhebrew", "FB1F",
+ "yohiragana", "3088",
+ "yoikorean", "3189",
+ "yokatakana", "30E8",
+ "yokatakanahalfwidth", "FF96",
+ "yokorean", "315B",
+ "yosmallhiragana", "3087",
+ "yosmallkatakana", "30E7",
+ "yosmallkatakanahalfwidth", "FF6E",
+ "yotgreek", "03F3",
+ "yoyaekorean", "3188",
+ "yoyakorean", "3187",
+ "yoyakthai", "0E22",
+ "yoyingthai", "0E0D",
+ "yparen", "24B4",
+ "ypogegrammeni", "037A",
+ "ypogegrammenigreekcmb", "0345",
+ "yr", "01A6",
+ "yring", "1E99",
+ "ysuperior", "02B8",
+ "ytilde", "1EF9",
+ "yturned", "028E",
+ "yuhiragana", "3086",
+ "yuikorean", "318C",
+ "yukatakana", "30E6",
+ "yukatakanahalfwidth", "FF95",
+ "yukorean", "3160",
+ "yusbigcyrillic", "046B",
+ "yusbigiotifiedcyrillic", "046D",
+ "yuslittlecyrillic", "0467",
+ "yuslittleiotifiedcyrillic", "0469",
+ "yusmallhiragana", "3085",
+ "yusmallkatakana", "30E5",
+ "yusmallkatakanahalfwidth", "FF6D",
+ "yuyekorean", "318B",
+ "yuyeokorean", "318A",
+ "yyabengali", "09DF",
+ "yyadeva", "095F",
+ "z", "007A",
+ "zaarmenian", "0566",
+ "zacute", "017A",
+ "zadeva", "095B",
+ "zagurmukhi", "0A5B",
+ "zaharabic", "0638",
+ "zahfinalarabic", "FEC6",
+ "zahinitialarabic", "FEC7",
+ "zahiragana", "3056",
+ "zahmedialarabic", "FEC8",
+ "zainarabic", "0632",
+ "zainfinalarabic", "FEB0",
+ "zakatakana", "30B6",
+ "zaqefgadolhebrew", "0595",
+ "zaqefqatanhebrew", "0594",
+ "zarqahebrew", "0598",
+ "zayin", "05D6",
+ "zayindagesh", "FB36",
+ "zayindageshhebrew", "FB36",
+ "zayinhebrew", "05D6",
+ "zbopomofo", "3117",
+ "zcaron", "017E",
+ "zcircle", "24E9",
+ "zcircumflex", "1E91",
+ "zcurl", "0291",
+ "zdot", "017C",
+ "zdotaccent", "017C",
+ "zdotbelow", "1E93",
+ "zecyrillic", "0437",
+ "zedescendercyrillic", "0499",
+ "zedieresiscyrillic", "04DF",
+ "zehiragana", "305C",
+ "zekatakana", "30BC",
+ "zero", "0030",
+ "zeroarabic", "0660",
+ "zerobengali", "09E6",
+ "zerodeva", "0966",
+ "zerogujarati", "0AE6",
+ "zerogurmukhi", "0A66",
+ "zerohackarabic", "0660",
+ "zeroinferior", "2080",
+ "zeromonospace", "FF10",
+ "zeropersian", "06F0",
+ "zerosuperior", "2070",
+ "zerothai", "0E50",
+ "zerowidthjoiner", "FEFF",
+ "zerowidthnonjoiner", "200C",
+ "zerowidthspace", "200B",
+ "zeta", "03B6",
+ "zhbopomofo", "3113",
+ "zhearmenian", "056A",
+ "zhebrevecyrillic", "04C2",
+ "zhecyrillic", "0436",
+ "zhedescendercyrillic", "0497",
+ "zhedieresiscyrillic", "04DD",
+ "zihiragana", "3058",
+ "zikatakana", "30B8",
+ "zinorhebrew", "05AE",
+ "zlinebelow", "1E95",
+ "zmonospace", "FF5A",
+ "zohiragana", "305E",
+ "zokatakana", "30BE",
+ "zparen", "24B5",
+ "zretroflexhook", "0290",
+ "zstroke", "01B6",
+ "zuhiragana", "305A",
+ "zukatakana", "30BA",
);
-$prog = $0;
+
+my $prog = $0;
$prog =~ s@.*/@@;
-$groff_sys_fontdir = "@FONTDIR@";
+my $groff_sys_fontdir = "@FONTDIR@";
+
+use Getopt::Std;
+getopts('a:d:e:i:mnsvx');
-do 'getopts.pl';
-do Getopts('a:d:e:i:mnsv');
+our ($opt_a, $opt_d, $opt_e, $opt_i, $opt_m, $opt_n, $opt_s, $opt_v, $opt_x);
if ($opt_v) {
print "GNU afmtodit (groff) version @VERSION@\n";
@@ -6054,24 +6060,36 @@ if ($opt_v) {
}
if ($#ARGV != 2) {
- die "usage: $prog [-mnsv] [-a angle] [-d DESC] [-e encoding]\n" .
+ die "usage: $prog [-mnsvx] [-a angle] [-d DESC] [-e encoding]\n" .
" [-i n] afmfile mapfile font\n";
}
-$afm = $ARGV[0];
-$map = $ARGV[1];
-$font = $ARGV[2];
-$desc = $opt_d || "DESC";
-$sys_map = $groff_sys_fontdir . "/devps/generate/" . $map;
-$sys_desc = $groff_sys_fontdir . "/devps/" . $desc;
+my $afm = $ARGV[0];
+my $map = $ARGV[1];
+my $font = $ARGV[2];
+my $desc = $opt_d || "DESC";
+my $sys_map = $groff_sys_fontdir . "/devps/generate/" . $map;
+my $sys_desc = $groff_sys_fontdir . "/devps/" . $desc;
# read the afm file
+my $psname;
+my $italic_angle = 0;
+my (@kern1, @kern2, @kernx);
+my (%italic_correction, %left_italic_correction);
+my %subscript_correction;
+# my %ligs
+my %ligatures;
+my (@encoding, %in_encoding);
+my (%width, %height, %depth);
+my (%left_side_bearing, %right_side_bearing);
+
open(AFM, $afm) || die "$prog: can't open \`$ARGV[0]': $!\n";
while (<AFM>) {
chop;
- @field = split(' ');
+ my @field = split(' ');
+ next if $#field < 0;
if ($field[0] eq "FontName") {
$psname = $field[1];
}
@@ -6080,9 +6098,9 @@ while (<AFM>) {
}
elsif ($field[0] eq "KPX") {
if ($#field == 3) {
- push(kern1, $field[1]);
- push(kern2, $field[2]);
- push(kernx, $field[3]);
+ push(@kern1, $field[1]);
+ push(@kern2, $field[2]);
+ push(@kernx, $field[3]);
}
}
elsif ($field[0] eq "italicCorrection") {
@@ -6097,18 +6115,19 @@ while (<AFM>) {
elsif ($field[0] eq "StartCharMetrics") {
while (<AFM>) {
@field = split(' ');
+ next if $#field < 0;
last if ($field[0] eq "EndCharMetrics");
if ($field[0] eq "C") {
- $c = -1;
- $wx = 0;
- $n = "";
- %ligs = ();
- $lly = 0;
- $ury = 0;
- $llx = 0;
- $urx = 0;
- $c = $field[1];
- $i = 2;
+ my $w;
+ my $wx = 0;
+ my $n = "";
+# %ligs = ();
+ my $lly = 0;
+ my $ury = 0;
+ my $llx = 0;
+ my $urx = 0;
+ my $c = $field[1];
+ my $i = 2;
while ($i <= $#field) {
if ($field[$i] eq "WX") {
$w = $field[$i + 1];
@@ -6125,10 +6144,10 @@ while (<AFM>) {
$ury = $field[$i + 4];
$i += 5;
}
- elsif ($field[$i] eq "L") {
- $ligs{$field[$i + 2]} = $field[$i + 1];
- $i += 3;
- }
+# elsif ($field[$i] eq "L") {
+# $ligs{$field[$i + 2]} = $field[$i + 1];
+# $i += 3;
+# }
else {
while ($i <= $#field && $field[$i] ne ";") {
$i++;
@@ -6145,9 +6164,9 @@ while (<AFM>) {
$depth{$n} = -$lly;
$left_side_bearing{$n} = -$llx;
$right_side_bearing{$n} = $urx - $w;
- while (($lig, $glyph2) = each %ligs) {
- $ligatures{$lig} = $n . " " . $glyph2;
- }
+# while ((my $lig, my $glyph2) = each %ligs) {
+# $ligatures{$lig} = $n . " " . $glyph2;
+# }
}
}
}
@@ -6156,6 +6175,7 @@ close(AFM);
# read the DESC file
+my ($sizescale, $resolution, $unitwidth);
$sizescale = 1;
open(DESC, $desc) || open(DESC, $sys_desc) ||
@@ -6163,24 +6183,32 @@ open(DESC, $desc) || open(DESC, $sys_desc) ||
while (<DESC>) {
next if /^#/;
chop;
- @field = split(' ');
+ my @field = split(' ');
+ next if $#field < 0;
last if $field[0] eq "charset";
- if ($field[0] eq "res") { $resolution = $field[1]; }
- if ($field[0] eq "unitwidth") { $unitwidth = $field[1]; }
- if ($field[0] eq "sizescale") { $sizescale = $field[1]; }
+ if ($field[0] eq "res") {
+ $resolution = $field[1];
+ }
+ elsif ($field[0] eq "unitwidth") {
+ $unitwidth = $field[1];
+ }
+ elsif ($field[0] eq "sizescale") {
+ $sizescale = $field[1];
+ }
}
close(DESC);
if ($opt_e) {
# read the encoding file
- $sys_opt_e = $groff_sys_fontdir . "/devps/" . $opt_e;
+ my $sys_opt_e = $groff_sys_fontdir . "/devps/" . $opt_e;
open(ENCODING, $opt_e) || open(ENCODING, $sys_opt_e) ||
die "$prog: can't open \`$opt_e' or \`$sys_opt_e': $!\n";
while (<ENCODING>) {
next if /^#/;
chop;
- @field = split(' ');
+ my @field = split(' ');
+ next if $#field < 0;
if ($#field == 1) {
if ($field[1] >= 0 && defined $width{$field[0]}) {
$encoding[$field[1]] = $field[0];
@@ -6193,29 +6221,41 @@ if ($opt_e) {
# read the map file
+my (%nmap, %map);
+
open(MAP, $map) || open(MAP, $sys_map) ||
die "$prog: can't open \`$map' or \`$sys_map': $!\n";
while (<MAP>) {
next if /^#/;
chop;
- @field = split(' ');
+ my @field = split(' ');
+ next if $#field < 0;
if ($#field == 1) {
- if (defined $mapped{$field[1]}) {
- warn "Both $mapped{$field[1]} and $field[0] map to $field[1]";
- }
- elsif ($field[1] eq "space") {
- # the PostScript character "space" is automatically mapped
- # to the groff character "space"; this is for grops
- warn "you are not allowed to map to the groff character `space'";
+ if ($field[1] eq "space") {
+ # The PostScript character "space" is automatically mapped
+ # to the groff character "space"; this is for grops.
+ warn "you are not allowed to map to " .
+ "the groff character \`space'";
}
elsif ($field[0] eq "space") {
- warn "you are not allowed to map the PostScript character `space'";
+ warn "you are not allowed to map " .
+ "the PostScript character \`space'";
}
else {
$nmap{$field[0]} += 0;
- $map{$field[0],$nmap{$field[0]}} = $field[1];
+ $map{$field[0], $nmap{$field[0]}} = $field[1];
$nmap{$field[0]} += 1;
- $mapped{$field[1]} = $field[0];
+
+ # There is more then one way to make a PS glyph name;
+ # let us try unicode names with `uni' and `u' prefixes.
+ my $utmp = $AGL_to_unicode{$field[0]};
+ if (defined $utmp && $utmp =~ /^[0-9A-F]{4}$/) {
+ foreach my $unicodepsname ("uni" . $utmp, "u" . $utmp) {
+ $nmap{$unicodepsname} += 0;
+ $map{$unicodepsname, $nmap{$unicodepsname}} = $field[1];
+ $nmap{$unicodepsname} += 1;
+ }
+ }
}
}
}
@@ -6223,32 +6263,142 @@ close(MAP);
$italic_angle = $opt_a if $opt_a;
-# add unencoded characters
-$i = ($#encoding > 256) ? ($#encoding + 1) : 256;
-while ($ch = each %width) {
- if (!$in_encoding{$ch}) {
- $encoding[$i] = $ch;
- $i++;
- if (!$nmap{$ch}) {
- $nmap{$ch} += 1;
- $u1 = $AGL_to_unicode{$ch};
- if ($u1) {
- $u2 = $unicode_decomposed{$u1};
- $u = $u2 ? $u2 : $u1;
+if (!$opt_x) {
+ my %mapped;
+ my $i = ($#encoding > 256) ? ($#encoding + 1) : 256;
+ while (my $ch = each %width) {
+ # add unencoded characters
+ if (!$in_encoding{$ch}) {
+ $encoding[$i] = $ch;
+ $i++;
+ }
+ if ($nmap{$ch}) {
+ for (my $j = 0; $j < $nmap{$ch}; $j++) {
+ if (defined $mapped{$map{$ch, $j}}) {
+ warn "both $mapped{$map{$ch, $j}} and $ch " .
+ "map to $map{$ch, $j}";
+ }
+ else {
+ $mapped{$map{$ch, $j}} = $ch;
+ }
}
- else {
- $u = "---";
+ }
+ else {
+ my $u = ""; # the resulting groff glyph name
+ my $ucomp = ""; # Unicode string before decomposition
+ my $utmp = ""; # temporary value
+ my $component = "";
+ my $nv = 0;
+
+ # Step 1:
+ # Drop all characters from the glyph name starting with the
+ # first occurrence of a period (U+002E FULL STOP), if any.
+ # ?? We avoid mapping of glyphs with periods, since they are
+ # likely to be variant glyphs, leading to a `many ps glyphs --
+ # one groff glyph' conflict.
+ #
+ # If multiple glyphs in the font represent the same character
+ # in the Unicode standard, as do `A' and `A.swash', for example,
+ # they can be differentiated by using the same base name with
+ # different suffixes. This suffix (the part of glyph name that
+ # follows the first period) does not participate in the
+ # computation of a character sequence. It can be used by font
+ # designers to indicate some characteristics of the glyph. The
+ # suffix may contain periods or any other permitted characters.
+ # Small cap A, for example, could be named `uni0041.sc' or `A.sc'.
+
+ next if $ch =~ /\./;
+
+ # Step 2:
+ # Split the remaining string into a sequence of components,
+ # using the underscore character (U+005F LOW LINE) as the
+ # delimiter.
+
+ while ($ch =~ /([^_]+)/g) {
+ $component = $1;
+
+ # Step 3:
+ # Map each component to a character string according to the
+ # procedure below:
+ #
+ # * If the component is in the Adobe Glyph List, then map
+ # it to the corresponding character in that list.
+
+ $utmp = $AGL_to_unicode{$component};
+ if ($utmp) {
+ $utmp = "U+" . $utmp;
+ }
+
+ # * Otherwise, if the component is of the form `uni'
+ # (U+0075 U+006E U+0069) followed by a sequence of
+ # uppercase hexadecimal digits (0 .. 9, A .. F, i.e.,
+ # U+0030 .. U+0039, U+0041 .. U+0046), the length of
+ # that sequence is a multiple of four, and each group of
+ # four digits represents a number in the set {0x0000 ..
+ # 0xD7FF, 0xE000 .. 0xFFFF}, then interpret each such
+ # number as a Unicode scalar value and map the component
+ # to the string made of those scalar values.
+
+ elsif ($component =~ /^uni([0-9A-F]{4})+$/) {
+ while ($component =~ /([0-9A-F]{4})/g) {
+ $nv = hex("0x" . $1);
+ if ($nv <= 0xD7FF || $nv >= 0xE000) {
+ $utmp .= "U+" . $1;
+ }
+ else {
+ $utmp = "";
+ last;
+ }
+ }
+ }
+
+ # * Otherwise, if the component is of the form `u' (U+0075)
+ # followed by a sequence of four to six uppercase
+ # hexadecimal digits {0 .. 9, A .. F} (U+0030 .. U+0039,
+ # U+0041 .. U+0046), and those digits represent a number
+ # in {0x0000 .. 0xD7FF, 0xE000 .. 0x10FFFF}, then
+ # interpret this number as a Unicode scalar value and map
+ # the component to the string made of this scalar value.
+
+ elsif ($component =~ /^u([0-9A-F]{4,6})$/) {
+ $nv = hex("0x" . $1);
+ if ($nv <= 0xD7FF || ($nv >= 0xE000 && $nv <= 0x10FFFF)) {
+ $utmp .= "U+" . $1;
+ }
+ }
+
+ # Finally, concatenate those strings; the result is the
+ # character string to which the glyph name is mapped.
+
+ $ucomp .= $utmp if $utmp;
+ }
+
+ # Unicode decomposition
+ while ($ucomp =~ /([0-9A-F]{4,6})/g) {
+ $component = $1;
+ $utmp = $unicode_decomposed{$component};
+ $u .= "_" . ($utmp ? $utmp : $component);
+ }
+ $u =~ s/^_/u/;
+ if ($u) {
+ if (defined $mapped{$u}) {
+ warn "both $mapped{$u} and $ch map to $u";
+ }
+ else {
+ $mapped{$u} = $ch;
+ }
+ $nmap{$ch} += 1;
+ $map{$ch, "0"} = $u;
}
- $map{$ch,"0"} = $u;
}
}
}
-# check explicitly for groff's standard ligatures -- many afm files don't
-# have proper `L' entries
+# Check explicitly for groff's standard ligatures -- many afm files don't
+# have proper `L' entries.
-%default_ligatures = (
+my %default_ligatures = (
"fi", "f i",
"fl", "f l",
"ff", "f f",
@@ -6256,7 +6406,7 @@ while ($ch = each %width) {
"ffl", "ff l",
);
-while (($lig, $components) = each %default_ligatures) {
+while (my ($lig, $components) = each %default_ligatures) {
if (defined $width{$lig} && !defined $ligatures{$lig}) {
$ligatures{$lig} = $components;
}
@@ -6271,17 +6421,17 @@ print("name $font\n");
print("internalname $psname\n") if $psname;
print("special\n") if $opt_s;
printf("slant %g\n", $italic_angle) if $italic_angle != 0;
-printf("spacewidth %d\n", do conv($width{"space"})) if defined $width{"space"};
+printf("spacewidth %d\n", conv($width{"space"})) if defined $width{"space"};
if ($opt_e) {
- $e = $opt_e;
+ my $e = $opt_e;
$e =~ s@.*/@@;
print("encoding $e\n");
}
if (!$opt_n && %ligatures) {
print("ligatures");
- while ($lig = each %ligatures) {
+ while (my $lig = each %ligatures) {
print(" $lig");
}
print(" 0\n");
@@ -6290,17 +6440,17 @@ if (!$opt_n && %ligatures) {
if ($#kern1 >= 0) {
print("kernpairs\n");
- for ($i = 0; $i <= $#kern1; $i++) {
- $c1 = $kern1[$i];
- $c2 = $kern2[$i];
+ for (my $i = 0; $i <= $#kern1; $i++) {
+ my $c1 = $kern1[$i];
+ my $c2 = $kern2[$i];
if ($nmap{$c1} != 0 && $nmap{$c2} != 0) {
- for ($j = 0; $j < $nmap{$c1}; $j++) {
- for ($k = 0; $k < $nmap{$c2}; $k++) {
+ for (my $j = 0; $j < $nmap{$c1}; $j++) {
+ for (my $k = 0; $k < $nmap{$c2}; $k++) {
if ($kernx[$i] != 0) {
printf("%s %s %d\n",
- $map{$c1,$j},
- $map{$c2,$k},
- do conv($kernx[$i]));
+ $map{$c1, $j},
+ $map{$c2, $k},
+ conv($kernx[$i]));
}
}
}
@@ -6308,17 +6458,22 @@ if ($#kern1 >= 0) {
}
}
+my ($asc_boundary, $desc_boundary, $xheight, $slant);
+
# characters not shorter than asc_boundary are considered to have ascenders
-$asc_boundary = $height{"t"} - 1;
+$asc_boundary = 0;
+$asc_boundary = $height{"t"} if defined $height{"t"};
+$asc_boundary -= 1;
# likewise for descenders
-$desc_boundary = $depth{"g"};
-$desc_boundary = $depth{"j"} if $depth{"j"} < $desc_boundary;
-$desc_boundary = $depth{"p"} if $depth{"p"} < $desc_boundary;
-$desc_boundary = $depth{"q"} if $depth{"q"} < $desc_boundary;
-$desc_boundary = $depth{"y"} if $depth{"y"} < $desc_boundary;
+$desc_boundary = 0;
+$desc_boundary = $depth{"g"} if defined $depth{"g"};
+$desc_boundary = $depth{"j"} if defined $depth{"g"} && $depth{"j"} < $desc_boundary;
+$desc_boundary = $depth{"p"} if defined $depth{"p"} && $depth{"p"} < $desc_boundary;
+$desc_boundary = $depth{"q"} if defined $depth{"q"} && $depth{"q"} < $desc_boundary;
+$desc_boundary = $depth{"y"} if defined $depth{"y"} && $depth{"y"} < $desc_boundary;
$desc_boundary -= 1;
if (defined $height{"x"}) {
@@ -6336,21 +6491,21 @@ $slant = sin($italic_angle)/cos($italic_angle);
$slant = 0 if $slant < 0;
print("charset\n");
-for ($i = 0; $i <= $#encoding; $i++) {
- $ch = $encoding[$i];
- if ($ch ne "" && $ch ne "space") {
- $map{$ch,"0"} = "---" if $nmap{$ch} == 0;
- $type = 0;
- $h = $height{$ch};
+for (my $i = 0; $i <= $#encoding; $i++) {
+ my $ch = $encoding[$i];
+ if (defined $ch && $ch ne "" && $ch ne "space") {
+ $map{$ch, "0"} = "---" if !defined $nmap{$ch} || $nmap{$ch} == 0;
+ my $type = 0;
+ my $h = $height{$ch};
$h = 0 if $h < 0;
- $d = $depth{$ch};
+ my $d = $depth{$ch};
$d = 0 if $d < 0;
$type = 1 if $d >= $desc_boundary;
$type += 2 if $h >= $asc_boundary;
- printf("%s\t%d", $map{$ch,"0"}, do conv($width{$ch}));
- $italic_correction = 0;
- $left_math_fit = 0;
- $subscript_correction = 0;
+ printf("%s\t%d", $map{$ch, "0"}, conv($width{$ch}));
+ my $italic_correction = 0;
+ my $left_math_fit = 0;
+ my $subscript_correction = 0;
if (defined $opt_i) {
$italic_correction = $right_side_bearing{$ch} + $opt_i;
$italic_correction = 0 if $italic_correction < 0;
@@ -6372,35 +6527,37 @@ for ($i = 0; $i <= $#encoding; $i++) {
$subscript_correction = $subscript_correction{$ch};
}
if ($subscript_correction != 0) {
- printf(",%d,%d", do conv($h), do conv($d));
- printf(",%d,%d,%d", do conv($italic_correction),
- do conv($left_math_fit),
- do conv($subscript_correction));
+ printf(",%d,%d", conv($h), conv($d));
+ printf(",%d,%d,%d", conv($italic_correction),
+ conv($left_math_fit),
+ conv($subscript_correction));
}
elsif ($left_math_fit != 0) {
- printf(",%d,%d", do conv($h), do conv($d));
- printf(",%d,%d", do conv($italic_correction),
- do conv($left_math_fit));
+ printf(",%d,%d", conv($h), conv($d));
+ printf(",%d,%d", conv($italic_correction),
+ conv($left_math_fit));
}
elsif ($italic_correction != 0) {
- printf(",%d,%d", do conv($h), do conv($d));
- printf(",%d", do conv($italic_correction));
+ printf(",%d,%d", conv($h), conv($d));
+ printf(",%d", conv($italic_correction));
}
elsif ($d != 0) {
- printf(",%d,%d", do conv($h), do conv($d));
+ printf(",%d,%d", conv($h), conv($d));
}
else {
# always put the height in to stop groff guessing
- printf(",%d", do conv($h));
+ printf(",%d", conv($h));
}
printf("\t%d", $type);
printf("\t%d\t%s\n", $i, $ch);
- for ($j = 1; $j < $nmap{$ch}; $j++) {
- printf("%s\t\"\n", $map{$ch,$j});
+ if (defined $nmap{$ch}) {
+ for (my $j = 1; $j < $nmap{$ch}; $j++) {
+ printf("%s\t\"\n", $map{$ch, $j});
+ }
}
}
- if ($ch eq "space" && defined $width{"space"}) {
- printf("space\t%d\t0\t%d\tspace\n", do conv($width{"space"}), $i);
+ if (defined $ch && $ch eq "space" && defined $width{"space"}) {
+ printf("space\t%d\t0\t%d\tspace\n", conv($width{"space"}), $i);
}
}
diff --git a/contrib/groff/src/utils/hpftodit/Makefile.sub b/contrib/groff/src/utils/hpftodit/Makefile.sub
index d83188c..6e80b47 100644
--- a/contrib/groff/src/utils/hpftodit/Makefile.sub
+++ b/contrib/groff/src/utils/hpftodit/Makefile.sub
@@ -2,5 +2,7 @@ PROG=hpftodit$(EXEEXT)
MAN1=hpftodit.n
XLIBS=$(LIBGROFF)
MLIB=$(LIBM)
-OBJS=hpftodit.$(OBJEXT)
-CCSRCS=$(srcdir)/hpftodit.cpp
+OBJS=hpftodit.$(OBJEXT) \
+ hpuni.$(OBJEXT)
+CCSRCS=$(srcdir)/hpftodit.cpp \
+ $(srcdir)/hpuni.cpp
diff --git a/contrib/groff/src/utils/hpftodit/hpftodit.cpp b/contrib/groff/src/utils/hpftodit/hpftodit.cpp
index fe512b6..5910fb2 100644
--- a/contrib/groff/src/utils/hpftodit/hpftodit.cpp
+++ b/contrib/groff/src/utils/hpftodit/hpftodit.cpp
@@ -1,5 +1,5 @@
// -*- C++ -*-
-/* Copyright (C) 1994, 2000, 2001, 2003 Free Software Foundation, Inc.
+/* Copyright (C) 1994, 2000, 2001, 2003, 2004 Free Software Foundation, Inc.
Written by James Clark (jjc@jclark.com)
This file is part of groff.
@@ -16,21 +16,21 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
/*
TODO
-put human readable font name in device file
devise new names for useful characters
-use --- for unnamed characters
option to specify symbol sets to look in
-make it work with TrueType fonts
put filename in error messages (or fix lib)
*/
#include "lib.h"
+#include <stdio.h>
#include <stdlib.h>
+#include <string.h>
+#include <ctype.h>
#include <math.h>
#include <errno.h>
#include "assert.h"
@@ -39,17 +39,31 @@ put filename in error messages (or fix lib)
#include "error.h"
#include "cset.h"
#include "nonposix.h"
+#include "unicode.h"
extern "C" const char *Version_string;
+extern const char *hp_msl_to_unicode_code(const char *);
#define SIZEOF(v) (sizeof(v)/sizeof(v[0]))
+#define equal(a, b) (strcmp(a, b) == 0)
+// only valid if is_uname(c) has returned true
+#define is_decomposed(c) strchr(c, '_')
-const int MULTIPLIER = 3;
+#define NO 0
+#define YES 1
+
+#define MSL 0
+#define SYMSET 1
+#define UNICODE 2
+
+#define UNNAMED "---"
+
+static double multiplier = 3.0; // make Agfa-based unitwidth an integer
inline
int scale(int n)
{
- return n * MULTIPLIER;
+ return int(n * multiplier + 0.5);
}
// tags in TFM file
@@ -57,39 +71,67 @@ int scale(int n)
enum tag_type {
min_tag = 400,
type_tag = 400,
+ copyright_tag = 401,
+ comment_tag = 402,
+ charcode_tag = 403, // MSL for Intellifont, Unicode for TrueType
symbol_set_tag = 404,
- msl_tag = 403,
+ unique_identifier_tag = 405,
inches_per_point_tag = 406,
+ nominal_point_size_tag = 407,
design_units_per_em_tag = 408,
posture_tag = 409,
+ type_structure_tag = 410,
stroke_weight_tag = 411,
spacing_tag = 412,
slant_tag = 413,
appearance_width_tag = 414,
+ serif_style_tag = 415,
+ font_name_tag = 417,
+ typeface_source_tag = 418,
+ average_width_tag = 419,
+ max_width_tag = 420,
word_spacing_tag = 421,
+ recommended_line_spacing_tag = 422,
+ cap_height_tag = 423,
x_height_tag = 424,
+ max_ascent_tag = 425,
+ max_descent_tag = 426,
lower_ascent_tag = 427,
lower_descent_tag = 428,
+ underscore_depth_tag = 429,
+ underscore_thickness_tag = 430,
+ uppercase_accent_height_tag = 431,
+ lowercase_accent_height_tag = 432,
width_tag = 433,
+ vertical_escapement_tag = 434,
left_extent_tag = 435,
right_extent_tag = 436,
ascent_tag = 437,
descent_tag = 438,
pair_kern_tag = 439,
+ sector_kern_tag = 440,
+ track_kern_tag = 441,
typeface_tag = 442,
+ panose_tag = 443,
max_tag = 443
- };
+};
-// types in TFM file
+const char *tag_name[] = {
+ "Symbol Set",
+ "Font Type" // MSL for Intellifont, Unicode for TrueType
+};
+// types in TFM file
enum {
- ENUM_TYPE = 1,
- BYTE_TYPE = 2,
+ BYTE_TYPE = 1,
+ ASCII_TYPE = 2, // NUL-terminated string
USHORT_TYPE = 3,
- FLOAT_TYPE = 5,
- SIGNED_SHORT_TYPE = 17
- };
-
+ LONG_TYPE = 4, // unused
+ RATIONAL_TYPE = 5, // 8-byte numerator + 8-byte denominator
+ SIGNED_BYTE_TYPE = 16, // unused
+ SIGNED_SHORT_TYPE = 17,
+ SIGNED_LONG_TYPE = 18 // unused
+};
typedef unsigned char byte;
typedef unsigned short uint16;
@@ -103,6 +145,7 @@ public:
byte get_byte();
uint16 get_uint16();
uint32 get_uint32();
+ uint32 get_uint32(char *orig);
void seek(uint32 n);
private:
unsigned char *buf_;
@@ -115,11 +158,12 @@ struct entry {
uint16 type;
uint32 count;
uint32 value;
+ char orig_value[4];
entry() : present(0) { }
};
struct char_info {
- uint16 msl;
+ uint16 charcode;
uint16 width;
int16 ascent;
int16 descent;
@@ -129,6 +173,7 @@ struct char_info {
unsigned char code;
};
+const uint16 NO_GLYPH = 0xffff;
const uint16 NO_SYMBOL_SET = 0;
struct name_list {
@@ -146,43 +191,74 @@ struct symbol_set {
#define SYMBOL_SET(n, c) ((n) * 32 + ((c) - 64))
uint16 text_symbol_sets[] = {
- SYMBOL_SET(0, 'N'), // Latin 1
+ SYMBOL_SET(19, 'U'), // Windows Latin 1 ("ANSI", code page 1252)
+ SYMBOL_SET(9, 'E'), // Windows Latin 2, Code Page 1250
+ SYMBOL_SET(5, 'T'), // Code Page 1254
+ SYMBOL_SET(7, 'J'), // Desktop
SYMBOL_SET(6, 'J'), // Microsoft Publishing
- SYMBOL_SET(2, 'N'), // Latin 2
+ SYMBOL_SET(0, 'N'), // Latin 1 (subset of 19U,
+ // so we should never get here)
+ SYMBOL_SET(2, 'N'), // Latin 2 (subset of 9E,
+ // so we should never get here)
+ SYMBOL_SET(8, 'U'), // HP Roman 8
+ SYMBOL_SET(10, 'J'), // PS Standard
+ SYMBOL_SET(9, 'U'), // Windows 3.0 "ANSI"
+ SYMBOL_SET(1, 'U'), // U.S. Legal
+
+ SYMBOL_SET(12, 'J'), // MC Text
+ SYMBOL_SET(10, 'U'), // PC Code Page 437
+ SYMBOL_SET(11, 'U'), // PC Code Page 437N
+ SYMBOL_SET(17, 'U'), // PC Code Page 852
+ SYMBOL_SET(12, 'U'), // PC Code Page 850
+ SYMBOL_SET(9, 'T'), // PC Code Page 437T
0
- };
+};
uint16 special_symbol_sets[] = {
- SYMBOL_SET(8, 'M'),
- SYMBOL_SET(5, 'M'),
- SYMBOL_SET(15, 'U'),
+ SYMBOL_SET(8, 'M'), // Math 8
+ SYMBOL_SET(5, 'M'), // PS Math
+ SYMBOL_SET(15, 'U'), // Pi font
+ SYMBOL_SET(13, 'J'), // Ventura International
+ SYMBOL_SET(19, 'M'), // Symbol font
+ SYMBOL_SET(579, 'L'), // Wingdings
0
- };
+};
entry tags[max_tag + 1 - min_tag];
char_info *char_table;
-uint32 nchars;
+uint32 nchars = 0;
-unsigned int msl_name_table_size = 0;
-name_list **msl_name_table = 0;
+unsigned int charcode_name_table_size = 0;
+name_list **charcode_name_table = NULL;
-unsigned int n_symbol_sets;
symbol_set *symbol_set_table;
+unsigned int n_symbol_sets;
-static int special_flag = 0;
-static int italic_flag = 0;
+static int debug_flag = NO;
+static int special_flag = NO; // not a special font
+static int italic_flag = NO; // don't add italic correction
static int italic_sep;
-
-static void usage(FILE *stream);
+static int all_flag = NO; // don't include glyphs not in mapfile
+static int quiet_flag = NO; // don't suppress warnings about symbols not found
+
+static char *hp_msl_to_ucode_name(int);
+static char *unicode_to_ucode_name(int);
+static int is_uname(char *);
+static char *show_symset(unsigned int);
+static void usage(FILE *);
static void usage();
static const char *xbasename(const char *);
static void read_tags(File &);
-static void check_type();
-static void check_units(File &);
-static int read_map(const char *);
+static int check_type();
+static void check_units(File &, const int, double *, double *);
+static int read_map(const char *, const int);
static void require_tag(tag_type);
-static void dump_tags(File &f);
+static void dump_ascii(File &, tag_type);
+static void dump_tags(File &);
+static void dump_symbol_sets(File &);
+static void dump_symbols(int);
+static void output_font_name(File &);
static void output_spacewidth();
static void output_pclweight();
static void output_pclproportional();
@@ -192,8 +268,8 @@ static void output_slant();
static void output_ligatures();
static void read_symbol_sets(File &);
static void read_and_output_kernpairs(File &);
-static void output_charset();
-static void read_char_table(File &f);
+static void output_charset(const int);
+static void read_char_table(File &);
inline
entry &tag_info(tag_type t)
@@ -201,35 +277,44 @@ entry &tag_info(tag_type t)
return tags[t - min_tag];
}
-int main(int argc, char **argv)
+int
+main(int argc, char **argv)
{
program_name = argv[0];
int opt;
- int debug_flag = 0;
+ int res = 1200; // PCL unit of measure for cursor moves
+ int scalesize = 4; // LaserJet 4 only allows 1/4 point increments
+ int unitwidth = 6350;
+ double ppi; // points per inch
+ double upem; // design units per em
static const struct option long_options[] = {
{ "help", no_argument, 0, CHAR_MAX + 1 },
{ "version", no_argument, 0, 'v' },
{ NULL, 0, 0, 0 }
};
- while ((opt = getopt_long(argc, argv, "dsvi:", long_options, NULL)) != EOF) {
+ while ((opt = getopt_long(argc, argv, "adsqvi:", long_options, NULL)) != EOF) {
switch (opt) {
+ case 'a':
+ all_flag = YES;
+ break;
case 'd':
- debug_flag = 1;
+ debug_flag = YES;
break;
case 's':
- special_flag = 1;
+ special_flag = YES;
break;
case 'i':
- italic_flag = 1;
- italic_sep = atoi(optarg);
+ italic_flag = YES;
+ italic_sep = atoi(optarg); // design units
+ break;
+ case 'q':
+ quiet_flag = YES; // suppress warnings about symbols not found
break;
case 'v':
- {
- printf("GNU hpftodit (groff) version %s\n", Version_string);
- exit(0);
- }
+ printf("GNU hpftodit (groff) version %s\n", Version_string);
+ exit(0);
break;
case CHAR_MAX + 1: // --help
usage(stdout);
@@ -242,46 +327,72 @@ int main(int argc, char **argv)
assert(0);
}
}
- if (argc - optind != 3)
+
+ if (debug_flag && argc - optind < 1)
+ usage();
+ else if (!debug_flag && argc - optind != 3)
usage();
File f(argv[optind]);
- if (!read_map(argv[optind + 1]))
- exit(1);
- current_filename = 0;
- current_lineno = -1; // no line numbers
- if (freopen(argv[optind + 2], "w", stdout) == 0)
- fatal("cannot open `%1': %2", argv[optind + 2], strerror(errno));
- current_filename = argv[optind];
- printf("name %s\n", xbasename(argv[optind + 2]));
- if (special_flag)
- printf("special\n");
read_tags(f);
- check_type();
- check_units(f);
+ int tfm_type = check_type();
if (debug_flag)
dump_tags(f);
+ if (!debug_flag && !read_map(argv[optind + 1], tfm_type))
+ exit(1);
+ else if (debug_flag && argc - optind > 1)
+ read_map(argv[optind + 1], tfm_type);
+ current_filename = NULL;
+ current_lineno = -1; // no line numbers
+ if (!debug_flag && !equal(argv[optind + 2], "-"))
+ if (freopen(argv[optind + 2], "w", stdout) == NULL)
+ fatal("cannot open `%1': %2", argv[optind + 2], strerror(errno));
+ current_filename = argv[optind];
+
+ check_units(f, tfm_type, &ppi, &upem);
+ if (tfm_type == UNICODE) // don't calculate for Intellifont TFMs
+ multiplier = double(res) / upem / ppi * unitwidth / scalesize;
+ if (italic_flag)
+ // convert from thousandths of an em to design units
+ italic_sep = int(italic_sep * upem / 1000 + 0.5);
+
read_char_table(f);
- output_spacewidth();
- output_slant();
- read_and_output_pcltypeface(f);
- output_pclproportional();
- output_pclweight();
- output_pclstyle();
+ if (nchars == 0)
+ fatal("no characters");
+
+ if (!debug_flag) {
+ output_font_name(f);
+ printf("name %s\n", xbasename(argv[optind + 2]));
+ if (special_flag)
+ printf("special\n");
+ output_spacewidth();
+ output_slant();
+ read_and_output_pcltypeface(f);
+ output_pclproportional();
+ output_pclweight();
+ output_pclstyle();
+ }
read_symbol_sets(f);
- output_ligatures();
- read_and_output_kernpairs(f);
- output_charset();
+ if (debug_flag)
+ dump_symbols(tfm_type);
+ else {
+ output_ligatures();
+ read_and_output_kernpairs(f);
+ output_charset(tfm_type);
+ }
return 0;
}
-static
-void usage(FILE *stream)
+static void
+usage(FILE *stream)
{
- fprintf(stream, "usage: %s [-s] [-i n] tfm_file map_file output_font\n",
- program_name);
+ fprintf(stream,
+ "usage: %s [-s] [-a] [-q] [-i n] tfm_file map_file output_font\n"
+ " %s -d tfm_file [map_file]\n",
+ program_name, program_name);
}
-static
-void usage()
+
+static void
+usage()
{
usage(stderr);
exit(1);
@@ -310,28 +421,32 @@ File::File(const char *s)
end_ = buf_ + sb.st_size;
}
-void File::skip(int n)
+void
+File::skip(int n)
{
if (end_ - ptr_ < n)
fatal("unexpected end of file");
ptr_ += n;
}
-void File::seek(uint32 n)
+void
+File::seek(uint32 n)
{
- if ((uint32)(end_ - buf_) < n)
+ if (uint32(end_ - buf_) < n)
fatal("unexpected end of file");
ptr_ = buf_ + n;
}
-byte File::get_byte()
+byte
+File::get_byte()
{
if (ptr_ >= end_)
fatal("unexpected end of file");
return *ptr_++;
}
-uint16 File::get_uint16()
+uint16
+File::get_uint16()
{
if (end_ - ptr_ < 2)
fatal("unexpected end of file");
@@ -339,7 +454,8 @@ uint16 File::get_uint16()
return n + (*ptr_++ << 8);
}
-uint32 File::get_uint32()
+uint32
+File::get_uint32()
{
if (end_ - ptr_ < 4)
fatal("unexpected end of file");
@@ -349,8 +465,24 @@ uint32 File::get_uint32()
return n;
}
-static
-void read_tags(File &f)
+uint32
+File::get_uint32(char *orig)
+{
+ if (end_ - ptr_ < 4)
+ fatal("unexpected end of file");
+ unsigned char v = *ptr_++;
+ uint32 n = v;
+ orig[0] = v;
+ for (int i = 1; i < 4; i++) {
+ v = *ptr_++;
+ orig[i] = v;
+ n += v << i*8;
+ }
+ return n;
+}
+
+static void
+read_tags(File &f)
{
if (f.get_byte() != 'I' || f.get_byte() != 'I')
fatal("not an Intel format TFM file");
@@ -367,85 +499,149 @@ void read_tags(File &f)
p->present = 1;
p->type = f.get_uint16();
p->count = f.get_uint32();
- p->value = f.get_uint32();
+ p->value = f.get_uint32(p->orig_value);
}
}
-static
-void check_type()
+static int
+check_type()
{
require_tag(type_tag);
- if (tag_info(type_tag).value != 0) {
- if (tag_info(type_tag).value == 2)
- fatal("cannot handle TrueType tfm files");
- fatal("unknown type tag %1", int(tag_info(type_tag).value));
+ int tfm_type = tag_info(type_tag).value;
+ switch (tfm_type) {
+ case MSL:
+ case UNICODE:
+ break;
+ case SYMSET:
+ fatal("cannot handle Symbol Set TFM files");
+ break;
+ default:
+ fatal("unknown type tag %1", tfm_type);
}
+ return tfm_type;
}
-static
-void check_units(File &f)
+static void
+check_units(File &f, const int tfm_type, double *ppi, double *upem)
{
require_tag(design_units_per_em_tag);
f.seek(tag_info(design_units_per_em_tag).value);
uint32 num = f.get_uint32();
uint32 den = f.get_uint32();
- if (num != 8782 || den != 1)
+ if (tfm_type == MSL && (num != 8782 || den != 1))
fatal("design units per em != 8782/1");
+ *upem = double(num) / den;
require_tag(inches_per_point_tag);
f.seek(tag_info(inches_per_point_tag).value);
num = f.get_uint32();
den = f.get_uint32();
- if (num != 100 || den != 7231)
+ if (tfm_type == MSL && (num != 100 || den != 7231))
fatal("inches per point not 100/7231");
+ *ppi = double(den) / num;
}
-static
-void require_tag(tag_type t)
+static void
+require_tag(tag_type t)
{
if (!tag_info(t).present)
fatal("tag %1 missing", int(t));
}
-static
-void output_spacewidth()
+// put a human-readable font name in the file
+static void
+output_font_name(File &f)
+{
+ char *p;
+
+ if (!tag_info(font_name_tag).present)
+ return;
+ int count = tag_info(font_name_tag).count;
+ char *font_name = new char[count];
+
+ if (count > 4) { // value is a file offset to the string
+ f.seek(tag_info(font_name_tag).value);
+ int n = count;
+ p = font_name;
+ while (--n)
+ *p++ = f.get_byte();
+ }
+ else // orig_value contains the string
+ sprintf(font_name, "%.*s",
+ count, tag_info(font_name_tag).orig_value);
+
+ // remove any trailing space
+ p = font_name + count - 1;
+ while (csspace(*--p))
+ ;
+ *(p + 1) = '\0';
+ printf("# %s\n", font_name);
+ delete font_name;
+}
+
+static void
+output_spacewidth()
{
require_tag(word_spacing_tag);
printf("spacewidth %d\n", scale(tag_info(word_spacing_tag).value));
}
-static
-void read_symbol_sets(File &f)
+static void
+read_symbol_sets(File &f)
{
uint32 symbol_set_dir_length = tag_info(symbol_set_tag).count;
+ uint16 *symbol_set_selectors;
n_symbol_sets = symbol_set_dir_length/14;
symbol_set_table = new symbol_set[n_symbol_sets];
unsigned int i;
+
+ for (i = 0; i < nchars; i++)
+ char_table[i].symbol_set = NO_SYMBOL_SET;
+
for (i = 0; i < n_symbol_sets; i++) {
f.seek(tag_info(symbol_set_tag).value + i*14);
- (void)f.get_uint32();
- uint32 off1 = f.get_uint32();
- uint32 off2 = f.get_uint32();
- (void)f.get_uint16(); // what's this for?
+ (void)f.get_uint32(); // offset to symbol set name
+ uint32 off1 = f.get_uint32(); // offset to selection string
+ uint32 off2 = f.get_uint32(); // offset to symbol set index array
+
f.seek(off1);
+ uint16 kind = 0; // HP-GL "Kind 1" symbol set value
unsigned int j;
- uint16 kind = 0;
for (j = 0; j < off2 - off1; j++) {
unsigned char c = f.get_byte();
- if ('0' <= c && c <= '9')
+ if ('0' <= c && c <= '9') // value
kind = kind*10 + (c - '0');
- else if ('A' <= c && c <= 'Z')
+ else if ('A' <= c && c <= 'Z') // terminator
kind = kind*32 + (c - 64);
}
symbol_set_table[i].select = kind;
for (j = 0; j < 256; j++)
symbol_set_table[i].index[j] = f.get_uint16();
}
- for (i = 0; i < nchars; i++)
- char_table[i].symbol_set = NO_SYMBOL_SET;
- uint16 *symbol_set_selectors = (special_flag
- ? special_symbol_sets
- : text_symbol_sets);
+ symbol_set_selectors = (special_flag ? special_symbol_sets
+ : text_symbol_sets);
+ for (i = 0; symbol_set_selectors[i] != 0; i++) {
+ unsigned int j;
+ for (j = 0; j < n_symbol_sets; j++)
+ if (symbol_set_table[j].select == symbol_set_selectors[i])
+ break;
+ if (j < n_symbol_sets) {
+ for (int k = 0; k < 256; k++) {
+ uint16 idx = symbol_set_table[j].index[k];
+ if (idx != NO_GLYPH
+ && char_table[idx].symbol_set == NO_SYMBOL_SET) {
+ char_table[idx].symbol_set = symbol_set_table[j].select;
+ char_table[idx].code = k;
+ }
+ }
+ }
+ }
+
+ if (all_flag)
+ return;
+
+ symbol_set_selectors = (special_flag ? text_symbol_sets
+ : special_symbol_sets);
for (i = 0; symbol_set_selectors[i] != 0; i++) {
unsigned int j;
for (j = 0; j < n_symbol_sets; j++)
@@ -453,29 +649,30 @@ void read_symbol_sets(File &f)
break;
if (j < n_symbol_sets) {
for (int k = 0; k < 256; k++) {
- uint16 index = symbol_set_table[j].index[k];
- if (index != 0xffff
- && char_table[index].symbol_set == NO_SYMBOL_SET) {
- char_table[index].symbol_set = symbol_set_table[j].select;
- char_table[index].code = k;
+ uint16 idx = symbol_set_table[j].index[k];
+ if (idx != NO_GLYPH
+ && char_table[idx].symbol_set == NO_SYMBOL_SET) {
+ char_table[idx].symbol_set = symbol_set_table[j].select;
+ char_table[idx].code = k;
}
}
}
}
+ return;
}
-static
-void read_char_table(File &f)
+static void
+read_char_table(File &f)
{
- require_tag(msl_tag);
- nchars = tag_info(msl_tag).count;
+ require_tag(charcode_tag);
+ nchars = tag_info(charcode_tag).count;
char_table = new char_info[nchars];
- f.seek(tag_info(msl_tag).value);
+ f.seek(tag_info(charcode_tag).value);
uint32 i;
for (i = 0; i < nchars; i++)
- char_table[i].msl = f.get_uint16();
-
+ char_table[i].charcode = f.get_uint16();
+
require_tag(width_tag);
f.seek(tag_info(width_tag).value);
for (i = 0; i < nchars; i++)
@@ -508,8 +705,8 @@ void read_char_table(File &f)
char_table[i].right_extent = f.get_uint16();
}
-static
-void output_pclweight()
+static void
+output_pclweight()
{
require_tag(stroke_weight_tag);
int stroke_weight = tag_info(stroke_weight_tag).value;
@@ -527,30 +724,34 @@ void output_pclweight()
printf("pclweight %d\n", pcl_stroke_weight);
}
-static
-void output_pclproportional()
+static void
+output_pclproportional()
{
require_tag(spacing_tag);
printf("pclproportional %d\n", tag_info(spacing_tag).value == 0);
}
-static
-void read_and_output_pcltypeface(File &f)
+static void
+read_and_output_pcltypeface(File &f)
{
printf("pcltypeface ");
require_tag(typeface_tag);
- f.seek(tag_info(typeface_tag).value);
- for (uint32 i = 0; i < tag_info(typeface_tag).count; i++) {
- unsigned char c = f.get_byte();
- if (c == '\0')
- break;
- putchar(c);
+ if (tag_info(typeface_tag).count > 4) {
+ f.seek(tag_info(typeface_tag).value);
+ for (uint32 i = 0; i < tag_info(typeface_tag).count; i++) {
+ unsigned char c = f.get_byte();
+ if (c == '\0')
+ break;
+ putchar(c);
+ }
}
+ else
+ printf("%.4s", tag_info(typeface_tag).orig_value);
printf("\n");
}
-static
-void output_pclstyle()
+static void
+output_pclstyle()
{
unsigned pcl_style = 0;
// older tfms don't have the posture tag
@@ -569,8 +770,8 @@ void output_pclstyle()
printf("pclstyle %d\n", pcl_style);
}
-static
-void output_slant()
+static void
+output_slant()
{
require_tag(slant_tag);
int slant = int16(tag_info(slant_tag).value);
@@ -578,8 +779,8 @@ void output_slant()
printf("slant %f\n", slant/100.0);
}
-static
-void output_ligatures()
+static void
+output_ligatures()
{
// don't use ligatures for fixed space font
require_tag(spacing_tag);
@@ -592,14 +793,14 @@ void output_ligatures()
static const char *ligature_chars[] = {
"fi", "fl", "ff", "Fi", "Fl"
};
-
+
unsigned ligature_mask = 0;
unsigned int i;
for (i = 0; i < nchars; i++) {
- uint16 msl = char_table[i].msl;
- if (msl < msl_name_table_size
+ uint16 charcode = char_table[i].charcode;
+ if (charcode < charcode_name_table_size
&& char_table[i].symbol_set != NO_SYMBOL_SET) {
- for (name_list *p = msl_name_table[msl]; p; p = p->next)
+ for (name_list *p = charcode_name_table[charcode]; p; p = p->next)
for (unsigned int j = 0; j < SIZEOF(ligature_chars); j++)
if (strcmp(p->name, ligature_chars[j]) == 0) {
ligature_mask |= 1 << j;
@@ -616,8 +817,8 @@ void output_ligatures()
}
}
-static
-void read_and_output_kernpairs(File &f)
+static void
+read_and_output_kernpairs(File &f)
{
if (tag_info(pair_kern_tag).present) {
printf("kernpairs\n");
@@ -629,112 +830,512 @@ void read_and_output_kernpairs(File &f)
int16 val = int16(f.get_uint16());
if (char_table[i1].symbol_set != NO_SYMBOL_SET
&& char_table[i2].symbol_set != NO_SYMBOL_SET
- && char_table[i1].msl < msl_name_table_size
- && char_table[i2].msl < msl_name_table_size) {
- for (name_list *p = msl_name_table[char_table[i1].msl];
+ && char_table[i1].charcode < charcode_name_table_size
+ && char_table[i2].charcode < charcode_name_table_size) {
+ for (name_list *p = charcode_name_table[char_table[i1].charcode];
p;
p = p->next)
- for (name_list *q = msl_name_table[char_table[i2].msl];
+ for (name_list *q = charcode_name_table[char_table[i2].charcode];
q;
q = q->next)
- printf("%s %s %d\n", p->name, q->name, scale(val));
+ if (!equal(p->name, UNNAMED) && !equal(q->name, UNNAMED))
+ printf("%s %s %d\n", p->name, q->name, scale(val));
}
}
}
}
-static
-void output_charset()
+static void
+output_charset(const int tfm_type)
{
require_tag(slant_tag);
double slant_angle = int16(tag_info(slant_tag).value)*PI/18000.0;
double slant = sin(slant_angle)/cos(slant_angle);
- require_tag(x_height_tag);
+ if (italic_flag)
+ require_tag(x_height_tag);
require_tag(lower_ascent_tag);
require_tag(lower_descent_tag);
printf("charset\n");
unsigned int i;
for (i = 0; i < nchars; i++) {
- uint16 msl = char_table[i].msl;
- if (msl < msl_name_table_size
- && msl_name_table[msl]) {
- if (char_table[i].symbol_set != NO_SYMBOL_SET) {
- printf("%s\t%d,%d",
- msl_name_table[msl]->name,
- scale(char_table[i].width),
- scale(char_table[i].ascent));
- int depth = scale(- char_table[i].descent);
- if (depth < 0)
- depth = 0;
- int italic_correction = 0;
- int left_italic_correction = 0;
- int subscript_correction = 0;
- if (italic_flag) {
- italic_correction = scale(char_table[i].right_extent
- - char_table[i].width
- + italic_sep);
- if (italic_correction < 0)
- italic_correction = 0;
- subscript_correction = int((tag_info(x_height_tag).value
- * slant * .8) + .5);
- if (subscript_correction > italic_correction)
- subscript_correction = italic_correction;
- left_italic_correction = scale(italic_sep
- - char_table[i].left_extent);
- }
- if (subscript_correction != 0)
- printf(",%d,%d,%d,%d",
- depth, italic_correction, left_italic_correction,
- subscript_correction);
- else if (left_italic_correction != 0)
- printf(",%d,%d,%d", depth, italic_correction, left_italic_correction);
- else if (italic_correction != 0)
- printf(",%d,%d", depth, italic_correction);
- else if (depth != 0)
- printf(",%d", depth);
- // This is fairly arbitrary. Fortunately it doesn't much matter.
- unsigned type = 0;
- if (char_table[i].ascent > (int16(tag_info(lower_ascent_tag).value)*9)/10)
- type |= 2;
- if (char_table[i].descent < (int16(tag_info(lower_descent_tag).value)*9)/10)
- type |= 1;
- printf("\t%d\t%d\n",
- type,
- char_table[i].symbol_set*256 + char_table[i].code);
- for (name_list *p = msl_name_table[msl]->next; p; p = p->next)
- printf("%s\t\"\n", p->name);
+ uint16 charcode = char_table[i].charcode;
+
+ // the glyph is bound to one of the searched symbol sets
+ if (char_table[i].symbol_set != NO_SYMBOL_SET) {
+ // the character was in the map file
+ if (charcode < charcode_name_table_size && charcode_name_table[charcode])
+ printf("%s", charcode_name_table[charcode]->name);
+ else if (!all_flag)
+ continue;
+ else if (tfm_type == MSL)
+ printf(hp_msl_to_ucode_name(charcode));
+ else
+ printf(unicode_to_ucode_name(charcode));
+
+ printf("\t%d,%d",
+ scale(char_table[i].width), scale(char_table[i].ascent));
+
+ int depth = scale(-char_table[i].descent);
+ if (depth < 0)
+ depth = 0;
+ int italic_correction = 0;
+ int left_italic_correction = 0;
+ int subscript_correction = 0;
+
+ if (italic_flag) {
+ italic_correction = scale(char_table[i].right_extent
+ - char_table[i].width
+ + italic_sep);
+ if (italic_correction < 0)
+ italic_correction = 0;
+ subscript_correction = int((tag_info(x_height_tag).value
+ * slant * .8) + .5);
+ if (subscript_correction > italic_correction)
+ subscript_correction = italic_correction;
+ left_italic_correction = scale(italic_sep
+ - char_table[i].left_extent);
+ }
+
+ if (subscript_correction != 0)
+ printf(",%d,%d,%d,%d",
+ depth, italic_correction, left_italic_correction,
+ subscript_correction);
+ else if (left_italic_correction != 0)
+ printf(",%d,%d,%d", depth, italic_correction, left_italic_correction);
+ else if (italic_correction != 0)
+ printf(",%d,%d", depth, italic_correction);
+ else if (depth != 0)
+ printf(",%d", depth);
+ // This is fairly arbitrary. Fortunately it doesn't much matter.
+ unsigned type = 0;
+ if (char_table[i].ascent > int16(tag_info(lower_ascent_tag).value)*9/10)
+ type |= 2;
+ if (char_table[i].descent < int16(tag_info(lower_descent_tag).value)*9/10)
+ type |= 1;
+ printf("\t%d\t%d", type,
+ char_table[i].symbol_set*256 + char_table[i].code);
+
+ if (tfm_type == UNICODE) {
+ if (charcode >= 0xE000 && charcode <= 0xF8FF)
+ printf("\t-- HP PUA U+%04X", charcode);
+ else
+ printf("\t-- U+%04X", charcode);
}
else
- warning("MSL %1 not in any of the searched symbol sets", msl);
+ printf("\t-- MSL %4d", charcode);
+ printf(" (%3s %3d)\n",
+ show_symset(char_table[i].symbol_set), char_table[i].code);
+
+ if (charcode < charcode_name_table_size
+ && charcode_name_table[charcode])
+ for (name_list *p = charcode_name_table[charcode]->next;
+ p; p = p->next)
+ printf("%s\t\"\n", p->name);
+ }
+ // warnings about characters in mapfile not found in TFM
+ else if (charcode < charcode_name_table_size
+ && charcode_name_table[charcode]) {
+ char *name = charcode_name_table[charcode]->name;
+ // don't warn about Unicode or unnamed glyphs
+ // that aren't in the the TFM file
+ if (tfm_type == UNICODE && !quiet_flag && !equal(name, UNNAMED)
+ && !is_uname(name)) {
+ fprintf(stderr, "%s: warning: symbol U+%04X (%s",
+ program_name, charcode, name);
+ for (name_list *p = charcode_name_table[charcode]->next;
+ p; p = p->next)
+ fprintf(stderr, ", %s", p->name);
+ fprintf(stderr, ") not in any searched symbol set\n");
+ }
+ else if (!quiet_flag && !equal(name, UNNAMED) && !is_uname(name)) {
+ fprintf(stderr, "%s: warning: symbol MSL %d (%s",
+ program_name, charcode, name);
+ for (name_list *p = charcode_name_table[charcode]->next;
+ p; p = p->next)
+ fprintf(stderr, ", %s", p->name);
+ fprintf(stderr, ") not in any searched symbol set\n");
+ }
}
}
}
-static
-void dump_tags(File &f)
+#define em_fract(a) (upem >= 0 ? double(a)/upem : 0)
+
+static void
+dump_tags(File &f)
{
- int i;
- for (i = min_tag; i <= max_tag; i++) {
+ double upem = -1.0;
+
+ printf("TFM tags\n"
+ "\n"
+ "tag# type count value\n"
+ "---------------------\n");
+
+ for (int i = min_tag; i <= max_tag; i++) {
enum tag_type t = tag_type(i);
if (tag_info(t).present) {
- fprintf(stderr,
- "%d %d %d %d\n", i, tag_info(t).type, tag_info(t).count,
- tag_info(t).value);
- if (tag_info(t).type == FLOAT_TYPE
- && tag_info(t).count == 1) {
- f.seek(tag_info(t).value);
- uint32 num = f.get_uint32();
- uint32 den = f.get_uint32();
- fprintf(stderr, "(%u/%u = %g)\n", num, den, (double)num/den);
+ printf("%4d %4d %5d", i, tag_info(t).type, tag_info(t).count);
+ switch (tag_info(t).type) {
+ case BYTE_TYPE:
+ case USHORT_TYPE:
+ printf(" %5u", tag_info(t).value);
+ switch (i) {
+ case type_tag:
+ printf(" Font Type ");
+ switch (tag_info(t).value) {
+ case MSL:
+ case SYMSET:
+ printf("(Intellifont)");
+ break;
+ case UNICODE:
+ printf("(TrueType)");
+ }
+ break;
+ case charcode_tag:
+ printf(" Number of Symbols (%u)", tag_info(t).count);
+ break;
+ case symbol_set_tag:
+ printf(" Symbol Sets (%u): ",
+ tag_info(symbol_set_tag).count / 14);
+ dump_symbol_sets(f);
+ break;
+ case type_structure_tag:
+ printf(" Type Structure (%u)", tag_info(t).value);
+ break;
+ case stroke_weight_tag:
+ printf(" Stroke Weight (%u)", tag_info(t).value);
+ break;
+ case spacing_tag:
+ printf(" Spacing ");
+ switch (tag_info(t).value) {
+ case 0:
+ printf("(Proportional)");
+ break;
+ case 1:
+ printf("(Fixed Pitch: %u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ }
+ break;
+ case appearance_width_tag:
+ printf(" Appearance Width (%u)", tag_info(t).value);
+ break;
+ case serif_style_tag:
+ printf(" Serif Style (%u)", tag_info(t).value);
+ break;
+ case posture_tag:
+ printf(" Posture (%s)", tag_info(t).value == 0
+ ? "Upright"
+ : tag_info(t).value == 1
+ ? "Italic"
+ : "Alternate Italic");
+ break;
+ case max_width_tag:
+ printf(" Maximum Width (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case word_spacing_tag:
+ printf(" Interword Spacing (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case recommended_line_spacing_tag:
+ printf(" Recommended Line Spacing (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case x_height_tag:
+ printf(" x-Height (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case cap_height_tag:
+ printf(" Cap Height (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case max_ascent_tag:
+ printf(" Maximum Ascent (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case lower_ascent_tag:
+ printf(" Lowercase Ascent (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case underscore_thickness_tag:
+ printf(" Underscore Thickness (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case uppercase_accent_height_tag:
+ printf(" Uppercase Accent Height (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case lowercase_accent_height_tag:
+ printf(" Lowercase Accent Height (%u DU: %.2f em)", tag_info(t).value,
+ em_fract(tag_info(t).value));
+ break;
+ case width_tag:
+ printf(" Horizontal Escapement array");
+ break;
+ case vertical_escapement_tag:
+ printf(" Vertical Escapement array");
+ break;
+ case right_extent_tag:
+ printf(" Right Extent array");
+ break;
+ case ascent_tag:
+ printf(" Character Ascent array");
+ break;
+ case pair_kern_tag:
+ f.seek(tag_info(t).value);
+ printf(" Kern Pairs (%u)", f.get_uint16());
+ break;
+ case panose_tag:
+ printf(" PANOSE Classification array");
+ break;
+ }
+ break;
+ case SIGNED_SHORT_TYPE:
+ printf(" %5d", int16(tag_info(t).value));
+ switch (i) {
+ case slant_tag:
+ printf(" Slant (%.2f degrees)", double(tag_info(t).value) / 100);
+ break;
+ case max_descent_tag:
+ printf(" Maximum Descent (%d DU: %.2f em)", int16(tag_info(t).value),
+ em_fract(int16(tag_info(t).value)));
+ break;
+ case lower_descent_tag:
+ printf(" Lowercase Descent (%d DU: %.2f em)", int16(tag_info(t).value),
+ em_fract(int16(tag_info(t).value)));
+ break;
+ case underscore_depth_tag:
+ printf(" Underscore Depth (%d DU: %.2f em)", int16(tag_info(t).value),
+ em_fract(int16(tag_info(t).value)));
+ break;
+ case left_extent_tag:
+ printf(" Left Extent array");
+ break;
+ // The type of this tag has changed from SHORT to SIGNED SHORT
+ // in TFM version 1.3.0.
+ case ascent_tag:
+ printf(" Character Ascent array");
+ break;
+ case descent_tag:
+ printf(" Character Descent array");
+ break;
+ }
+ break;
+ case RATIONAL_TYPE:
+ printf(" %5u", tag_info(t).value);
+ switch (i) {
+ case inches_per_point_tag:
+ printf(" Inches per Point");
+ break;
+ case nominal_point_size_tag:
+ printf(" Nominal Point Size");
+ break;
+ case design_units_per_em_tag:
+ printf(" Design Units per Em");
+ break;
+ case average_width_tag:
+ printf(" Average Width");
+ break;
+ }
+ if (tag_info(t).count == 1) {
+ f.seek(tag_info(t).value);
+ uint32 num = f.get_uint32();
+ uint32 den = f.get_uint32();
+ if (i == design_units_per_em_tag)
+ upem = double(num) / den;
+ printf(" (%u/%u = %g)", num, den, double(num)/den);
+ }
+ break;
+ case ASCII_TYPE:
+ printf(" %5u ", tag_info(t).value);
+ switch (i) {
+ case comment_tag:
+ printf("Comment ");
+ break;
+ case copyright_tag:
+ printf("Copyright ");
+ break;
+ case unique_identifier_tag:
+ printf("Unique ID ");
+ break;
+ case font_name_tag:
+ printf("Typeface Name ");
+ break;
+ case typeface_source_tag:
+ printf("Typeface Source ");
+ break;
+ case typeface_tag:
+ printf("PCL Typeface ");
+ break;
+ }
+ dump_ascii(f, t);
+ }
+ putchar('\n');
+ }
+ }
+ putchar('\n');
+}
+#undef em_fract
+
+static void
+dump_ascii(File &f, tag_type t)
+{
+ putchar('"');
+ if (tag_info(t).count > 4) {
+ int count = tag_info(t).count;
+ f.seek(tag_info(t).value);
+ while (--count)
+ printf("%c", f.get_byte());
+ }
+ else
+ printf("%.4s", tag_info(t).orig_value);
+ putchar('"');
+}
+
+static void
+dump_symbol_sets(File &f)
+{
+ uint32 symbol_set_dir_length = tag_info(symbol_set_tag).count;
+ uint32 num_symbol_sets = symbol_set_dir_length / 14;
+
+ for (uint32 i = 0; i < num_symbol_sets; i++) {
+ f.seek(tag_info(symbol_set_tag).value + i * 14);
+ (void)f.get_uint32(); // offset to symbol set name
+ uint32 off1 = f.get_uint32(); // offset to selection string
+ uint32 off2 = f.get_uint32(); // offset to symbol set index array
+ f.seek(off1);
+ for (uint32 j = 0; j < off2 - off1; j++) {
+ unsigned char c = f.get_byte();
+ if ('0' <= c && c <= '9')
+ putchar(c);
+ else if ('A' <= c && c <= 'Z')
+ printf(i < num_symbol_sets - 1 ? "%c," : "%c", c);
+ }
+ }
+}
+
+static void
+dump_symbols(int tfm_type)
+{
+ printf("Symbols:\n"
+ "\n"
+ " glyph id# symbol set name(s)\n"
+ "----------------------------------\n");
+ for (uint32 i = 0; i < nchars; i++) {
+ uint16 charcode = char_table[i].charcode;
+ if (charcode < charcode_name_table_size
+ && charcode_name_table[charcode]) {
+ if (char_table[i].symbol_set != NO_SYMBOL_SET) {
+ printf(tfm_type == UNICODE ? "%4d (U+%04X) (%3s %3d) %s"
+ : "%4d (MSL %4d) (%3s %3d) %s",
+ i, charcode,
+ show_symset(char_table[i].symbol_set),
+ char_table[i].code,
+ charcode_name_table[charcode]->name);
+ for (name_list *p = charcode_name_table[charcode]->next;
+ p; p = p->next)
+ printf(", %s", p->name);
+ putchar('\n');
}
}
+ else {
+ printf(tfm_type == UNICODE ? "%4d (U+%04X) "
+ : "%4d (MSL %4d) ",
+ i, charcode);
+ if (char_table[i].symbol_set != NO_SYMBOL_SET)
+ printf("(%3s %3d)",
+ show_symset(char_table[i].symbol_set), char_table[i].code);
+ putchar('\n');
+ }
+ }
+ putchar('\n');
+}
+
+static char *
+show_symset(unsigned int symset)
+{
+ static char symset_str[8];
+
+ sprintf(symset_str, "%d%c", symset / 32, (symset & 31) + 64);
+ return symset_str;
+}
+
+static char *
+hp_msl_to_ucode_name(int msl)
+{
+ char codestr[8];
+
+ sprintf(codestr, "%d", msl);
+ const char *ustr = hp_msl_to_unicode_code(codestr);
+ if (ustr == NULL)
+ ustr = UNNAMED;
+ else {
+ char *nonum;
+ int ucode = int(strtol(ustr, &nonum, 16));
+ // don't allow PUA code points as Unicode names
+ if (ucode >= 0xE000 && ucode <= 0xF8FF)
+ ustr = UNNAMED;
+ }
+ if (!equal(ustr, UNNAMED)) {
+ const char *uname_decomposed = decompose_unicode(ustr);
+ if (uname_decomposed)
+ // 1st char is the number of components
+ ustr = uname_decomposed + 1;
+ }
+ char *value = new char[strlen(ustr) + 1];
+ sprintf(value, equal(ustr, UNNAMED) ? ustr : "u%s", ustr);
+ return value;
+}
+
+static char *
+unicode_to_ucode_name(int ucode)
+{
+ const char *ustr;
+ char codestr[8];
+
+ // don't allow PUA code points as Unicode names
+ if (ucode >= 0xE000 && ucode <= 0xF8FF)
+ ustr = UNNAMED;
+ else {
+ sprintf(codestr, "%04X", ucode);
+ ustr = codestr;
}
+ if (!equal(ustr, UNNAMED)) {
+ const char *uname_decomposed = decompose_unicode(ustr);
+ if (uname_decomposed)
+ // 1st char is the number of components
+ ustr = uname_decomposed + 1;
+ }
+ char *value = new char[strlen(ustr) + 1];
+ sprintf(value, equal(ustr, UNNAMED) ? ustr : "u%s", ustr);
+ return value;
+}
+
+static int
+is_uname(char *name)
+{
+ size_t i;
+ size_t len = strlen(name);
+ if (len % 5)
+ return 0;
+
+ if (name[0] != 'u')
+ return 0;
+ for (i = 1; i < 4; i++)
+ if (!csxdigit(name[i]))
+ return 0;
+ for (i = 5; i < len; i++)
+ if (i % 5 ? !csxdigit(name[i]) : name[i] != '_')
+ return 0;
+
+ return 1;
}
-static
-int read_map(const char *file)
+static int
+read_map(const char *file, const int tfm_type)
{
errno = 0;
FILE *fp = fopen(file, "r");
@@ -745,6 +1346,7 @@ int read_map(const char *file)
current_filename = file;
char buf[512];
current_lineno = 0;
+ char *nonum;
while (fgets(buf, int(sizeof(buf)), fp)) {
current_lineno++;
char *ptr = buf;
@@ -755,44 +1357,85 @@ int read_map(const char *file)
ptr = strtok(ptr, " \n\t");
if (!ptr)
continue;
- int n;
- if (sscanf(ptr, "%d", &n) != 1) {
- error("bad map file");
+
+ int msl_code = int(strtol(ptr, &nonum, 10));
+ if (*nonum != '\0') {
+ if (csxdigit(*nonum))
+ error("bad MSL map: got hex code (%1)", ptr);
+ else if (ptr == nonum)
+ error("bad MSL map: bad MSL code (%1)", ptr);
+ else
+ error("bad MSL map");
+ fclose(fp);
+ return 0;
+ }
+
+ ptr = strtok(NULL, " \n\t");
+ if (!ptr)
+ continue;
+ int unicode = int(strtol(ptr, &nonum, 16));
+ if (*nonum != '\0') {
+ if (ptr == nonum)
+ error("bad Unicode value (%1)", ptr);
+ else
+ error("bad Unicode map");
fclose(fp);
return 0;
}
- if (n < 0) {
- error("negative code");
+ if (strlen(ptr) != 4) {
+ error("bad Unicode value (%1)", ptr);
+ return 0;
+ }
+
+ int n = tfm_type == MSL ? msl_code : unicode;
+ if (tfm_type == UNICODE && n > 0xFFFF) {
+ // greatest value supported by TFM files
+ error("bad Unicode value (%1): greatest value is 0xFFFF", ptr);
fclose(fp);
return 0;
}
- if ((size_t)n >= msl_name_table_size) {
- size_t old_size = msl_name_table_size;
- name_list **old_table = msl_name_table;
- msl_name_table_size = n + 256;
- msl_name_table = new name_list *[msl_name_table_size];
+ else if (n < 0) {
+ error("negative code value (%1)", ptr);
+ fclose(fp);
+ return 0;
+ }
+
+ ptr = strtok(NULL, " \n\t");
+ if (!ptr) { // groff name
+ error("missing name(s)");
+ fclose(fp);
+ return 0;
+ }
+ // leave decomposed Unicode values alone
+ else if (is_uname(ptr) && !is_decomposed(ptr))
+ ptr = unicode_to_ucode_name(strtol(ptr + 1, &nonum, 16));
+
+ if (size_t(n) >= charcode_name_table_size) {
+ size_t old_size = charcode_name_table_size;
+ name_list **old_table = charcode_name_table;
+ charcode_name_table_size = n + 256;
+ charcode_name_table = new name_list *[charcode_name_table_size];
if (old_table) {
- memcpy(msl_name_table, old_table, old_size*sizeof(name_list *));
+ memcpy(charcode_name_table, old_table, old_size*sizeof(name_list *));
a_delete old_table;
}
- for (size_t i = old_size; i < msl_name_table_size; i++)
- msl_name_table[i] = 0;
+ for (size_t i = old_size; i < charcode_name_table_size; i++)
+ charcode_name_table[i] = NULL;
}
- ptr = strtok(0, " \n\t");
- if (!ptr) {
- error("missing names");
- fclose(fp);
- return 0;
+
+ // a '#' that isn't the first groff name begins a comment
+ for (int names = 1; ptr; ptr = strtok(NULL, " \n\t")) {
+ if (names++ > 1 && *ptr == '#')
+ break;
+ charcode_name_table[n] = new name_list(ptr, charcode_name_table[n]);
}
- for (; ptr; ptr = strtok(0, " \n\t"))
- msl_name_table[n] = new name_list(ptr, msl_name_table[n]);
}
fclose(fp);
return 1;
}
-static
-const char *xbasename(const char *s)
+static const char *
+xbasename(const char *s)
{
// DIR_SEPS[] are possible directory separator characters, see
// nonposix.h. We want the rightmost separator of all possible
diff --git a/contrib/groff/src/utils/hpftodit/hpftodit.man b/contrib/groff/src/utils/hpftodit/hpftodit.man
index c069752..429f516 100644
--- a/contrib/groff/src/utils/hpftodit/hpftodit.man
+++ b/contrib/groff/src/utils/hpftodit/hpftodit.man
@@ -1,5 +1,6 @@
+.tr ~
.ig
-Copyright (C) 1994-2000, 2001, 2003 Free Software Foundation, Inc.
+Copyright (C) 1994-2000, 2001, 2003, 2004 Free Software Foundation, Inc.
Permission is granted to make and distribute verbatim copies of
this manual provided the copyright notice and this permission notice
@@ -22,13 +23,22 @@ the original English.
.ie \\n(.$=0:((0\\$1)*2u>(\\n(.lu-\\n(.iu)) .TP
.el .TP "\\$1"
..
+.de CW
+.ie \\n(.$>2 \&\\$1\f(CR\\$2\fP\\$3
+.el \&\f(CR\\$1\fP\\$2
+..
+.tr ~
.TH HPFTODIT @MAN1EXT@ "@MDATE@" "Groff Version @VERSION@"
+.\" --------------------------------------------------------------------------
.SH NAME
+.\" --------------------------------------------------------------------------
hpftodit \- create font description files for use with groff \-Tlj4
+.\" --------------------------------------------------------------------------
.SH SYNOPSIS
+.\" --------------------------------------------------------------------------
.B hpftodit
[
-.B \-sv
+.B \-adqsv
]
[
.BI \-i n
@@ -39,33 +49,91 @@ hpftodit \- create font description files for use with groff \-Tlj4
.PP
It is possible to have whitespace between the
.B \-i
-command line option and its parameter.
+option and its parameter.
+.\" --------------------------------------------------------------------------
.SH DESCRIPTION
+.\" --------------------------------------------------------------------------
.B hpftodit
-creates a font file for use with
-.B
-groff \-Tlj4\fR
-from an HP tagged font metric file.
+creates a font file for use with a Hewlett-Packard LaserJet~4\(enseries
+(or newer) printer with
+.BR "groff \-Tlj4" ,
+using data from an HP tagged font metric (TFM) file.
.I tfm_file
-is the name of the tagged font metric file for the font.
+is the name of the TFM file for the font; Intellifont and
+TrueType TFM files are supported, but symbol set TFM files are not.
.I map_file
-is a file giving the groff names for characters in the font;
-this file should consist of a sequence of lines of the form:
+is a file giving the groff names for characters in the font; this file
+should consist of a sequence of lines of the form:
.IP
.I
-n c1 c2 \fR.\|.\|.
+m u c1 c2 \fR.\|.\|. [
+.CW #
+.I comment
+]
.LP
where
-.I n
+.I m
is a decimal integer giving the MSL number of the character,
+.I u
+is a hexadecimal integer giving the Unicode value of the character,
and
.IR c1 ,
-.IR c2 ,.\|.\|.
+.IR c2 ", .\|.\|."
are the groff names of the character.
+The values can be separated by any whitespace; the Unicode value must
+use uppercase digits A\^\(en\^F, and must be without a leading
+.CW ` 0x ',
+.CW ` u ',
+or
+.CW ` U+ '.
+Unicode values corresponding to composite glyphs are decomposed; e.g.,
+.CW ` u00C0 '
+becomes
+.CW ` u0041_0300 '.
+The name for a glyph without a groff name may be given as
+.CW u \fIXXXX\fP
+if the glyph corresponds to a Unicode value, or as an unnamed glyph
+.CW ` --- '.
+If the given Unicode value is in the Private Use Area
+(0xE000\^\(en\^0xF8FF), the glyph is included as an unnamed glyph.
+Refer to
+.BR groff_diff (@MAN1EXT@)
+for additional information about unnamed glyphs and how to access them.
+.LP
+Blank lines and lines beginning with
+.CW ` # '
+are ignored.
+A
+.CW ` # '
+following one or more groff names begins a comment.
+Because
+.CW ` # '
+is a valid groff name, it must appear first in a list of
+groff names if a comment is included, e.g.,
+.IP
+.CW "3 0023 # # number sign"
+.LP
+or
+.IP
+.CW "3 0023 # sh # number sign"
+.LP
+rather than
+.IP
+.CW "3 0023 sh # # number sign"
+.LP
+which will treat the first
+.CW ` # '
+as the beginning of the comment.
+.LP
.I font
is the name of the groff font file.
The groff font file is written to
-.IR font .
+.IR font ;
+if
+.I font
+is specified as
+.CW ` - ',
+the output is written to the standard output.
.LP
The
.B \-s
@@ -75,7 +143,7 @@ option should be given if the font is special
if
.B troff
should search it whenever
-a character is not found in the current font.)
+a character is not found in the current font).
If the font is special,
it should be listed in the
.B fonts
@@ -88,33 +156,116 @@ If the
.B \-i
option is used,
.B hpftodit
-will automatically generate an italic correction,
+automatically will generate an italic correction,
a left italic correction and a subscript correction
for each character
(the significance of these parameters is explained in
.BR groff_font (@MAN5EXT@)).
+.\" --------------------------------------------------------------------------
.SH OPTIONS
+.\" --------------------------------------------------------------------------
+.TP
+.B \-a
+Include characters in the TFM file that are not included in the map
+file.
+A glyph with corresponding Unicode value is given the name
+.RI u XXXX ;
+a glyph without a Unicode value is included as an unnamed glyph
+\&`\-\^\-\^\-'.
+A glyph with a Unicode value in the Private Use Area
+(0xE000\^\(en\^0xF8FF) also is included as an unnamed glyph.
+.IP
+This option provides a simple means of adding Unicode-named and unnamed
+glyphs to a font without including them in the map file, but it affords
+little control over which glyphs are placed in a regular font and which
+are placed in a special font.
+The presence or absence of the
+.B \-s
+option has some effect on which glyphs are included: without the
+.B \-s
+option, only the \(lqtext\(rq symbol sets are searched for matching
+glyphs; with the
+.B \-s
+option, only the \(lqmathematical\(rq symbol sets
+are searched.
+Nonetheless, restricting the symbol sets searched isn't very
+selective\(emmany glyphs are placed in both regular and special fonts.
+Normally, the
+.B \-a
+option should be used only as a last resort.
+.\" --------------------------------------------------------------------------
+.TP
+.B \-d
+Dump information about the TFM file to the standard output; this option
+can be useful for ensuring that a TFM file is a proper match for a font,
+and that the contents of the TFM file are suitable.
+The information includes the values of important TFM tags, and a listing
+(by MSL number for Intellifont TFM files or by Unicode value for
+TrueType TFM files) of the glyphs included in the TFM file.
+The unit of measure `DU' for some tags indicates design units; there are
+8782 design units per em for Intellifont fonts, and 2048 design units
+per em for TrueType fonts.
+Note that the accessibility of a glyph depends on its inclusion in a
+symbol set; some TFM files list many glyphs but only a few symbol sets.
+.IP
+The glyph listing includes the glyph index within the TFM file, the MSL
+or Unicode value, and the symbol set and character code that will be
+used to print the glyph.
+If
+.I map_file
+is given,
+groff names are given for matching glyphs.
+If only the glyph index and MSL or Unicode value are given, the glyph
+does not appear in any supported symbol set and cannot be printed.
+.IP
+With the
+.B \-d
+option,
+.I map_file
+is optional, and
+.I font
+is ignored if given.
+.\" --------------------------------------------------------------------------
+.TP
+.B \-q
+Suppress warnings about characters in the map file that were not found
+in the TFM file.
+Warnings never are given for unnamed glyphs or by glyphs named by their
+Unicode values.
+This option is useful when sending the output of
+.B hpftodit
+to the standard output.
+.\" --------------------------------------------------------------------------
.TP
.B \-v
-Print the version number.
+Print the
+.B hpftodit
+version number.
+.\" --------------------------------------------------------------------------
.TP
.B \-s
The font is special.
-The effect of this option is to add the
+This option adds the
.B special
-command to the font file.
+command to the font file, and affects the order in which HP symbol sets
+are searched for each glyph.
+Without the
+.B \-s
+option, the \(lqtext\(rq sets are searched before
+the \(lqmathematical\(rq symbol sets.
+With the
+.B \-s
+option, the search order is reversed.
+.\" --------------------------------------------------------------------------
.TP
.BI \-i n
-Generate an italic correction for each character so that
-the character's width plus the character's italic correction
-is equal to
+Generate an italic correction for each character so that the character's
+width plus the character's italic correction is equal to
.I n
-design units
-plus the amount by which the right edge of the character's bounding
-is to the right of the character's origin.
-If this would result in a negative italic correction, use a zero
-italic correction instead.
-There are 8782 design units per em for Intellifont fonts.
+thousandths of an em plus the amount by which the right edge of the
+character's bounding is to the right of the character's origin.
+If this would result in a negative italic correction, use a zero italic
+correction instead.
.IP
Also generate a subscript correction equal to the
product of the tangent of the slant of the font and
@@ -126,33 +277,34 @@ instead.
Also generate a left italic correction for each character
equal to
.I n
-design units
-plus the amount by which the left edge of the character's bounding box
-is to the left of the character's origin.
+thousandths of an em plus the amount by which the left edge of the
+character's bounding box is to the left of the character's origin.
The left italic correction may be negative.
.IP
-This option is normally needed only with italic (or oblique) fonts.
+This option normally is needed only with italic or oblique fonts;
+a value of 50 (0.05 em) usually is a reasonable choice.
+.\" --------------------------------------------------------------------------
.SH FILES
-.Tp \w'\fB@FONTDIR@/devlj4/DESC'u+2n
+.\" --------------------------------------------------------------------------
+.ad 0
+.TP \w'\fB@FONTDIR@/devlj4/generate/\fP\fI*\fP.map'u+2n
.B @FONTDIR@/devlj4/DESC
Device description file.
.TP
.BI @FONTDIR@/devlj4/ F
Font description file for font
.IR F .
-.SH BUGS
-.LP
-This program was written without the benefit of complete, official
-documentation on the tagged font metric format.
-It is therefore likely that it will fail to work on tfm files that are
-dissimilar to those for the internal fonts on the Laserjet 4,
-with which it was tested.
-.LP
-TrueType tfm files are not supported.
+.TP
+.BI @FONTDIR@/devlj4/generate/ * .map
+Symbol mapping files
+.\" --------------------------------------------------------------------------
.SH "SEE ALSO"
+.\" --------------------------------------------------------------------------
.BR groff (@MAN1EXT@),
+.BR groff_diff (@MAN1EXT@),
.BR grolj4 (@MAN1EXT@),
-.BR groff_font (@MAN5EXT@)
+.BR groff_font (@MAN5EXT@),
+.BR lj4_font (@MAN5EXT@)
.
.\" Local Variables:
.\" mode: nroff
diff --git a/contrib/groff/src/utils/hpftodit/hpuni.cpp b/contrib/groff/src/utils/hpftodit/hpuni.cpp
new file mode 100644
index 0000000..23a1eb0
--- /dev/null
+++ b/contrib/groff/src/utils/hpftodit/hpuni.cpp
@@ -0,0 +1,698 @@
+// -*- C++ -*-
+/* Copyright (C) 2003, 2004 Free Software Foundation, Inc.
+ Written by Jeff Conrad (jeff_conrad@msn.com)
+
+This file is part of groff.
+
+groff is free software; you can redistribute it and/or modify it under
+the terms of the GNU General Public License as published by the Free
+Software Foundation; either version 2, or (at your option) any later
+version.
+
+groff is distributed in the hope that it will be useful, but WITHOUT ANY
+WARRANTY; without even the implied warranty of MERCHANTABILITY or
+FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
+for more details.
+
+You should have received a copy of the GNU General Public License along
+with groff; see the file COPYING. If not, write to the Free Software
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
+
+#include "lib.h"
+#include "stringclass.h"
+#include "ptable.h"
+
+#include "unicode.h"
+
+struct hp_msl_to_unicode {
+ char *value;
+};
+
+declare_ptable(hp_msl_to_unicode)
+implement_ptable(hp_msl_to_unicode)
+
+PTABLE(hp_msl_to_unicode) hp_msl_to_unicode_table;
+
+struct S {
+ const char *key;
+ const char *value;
+} hp_msl_to_unicode_list[] = {
+ { "1", "0021", }, // Exclamation Mark
+ { "2", "0022", }, // Neutral Double Quote
+ { "3", "0023", }, // Number Sign
+ { "4", "0024", }, // Dollar Sign
+ { "5", "0025", }, // Per Cent Sign
+ { "6", "0026", }, // Ampersand
+ { "8", "2019", }, // Single Close Quote (9)
+ { "9", "0028", }, // Left Parenthesis
+ { "10", "0029", }, // Right Parenthesis
+ { "11", "002A", }, // Asterisk
+ { "12", "002B", }, // Plus Sign
+ { "13", "002C", }, // Comma, or Decimal Separator
+ { "14", "002D", }, // Hyphen
+ { "15", "002E", }, // Period, or Full Stop
+ { "16", "002F", }, // Solidus, or Slash
+ { "17", "0030", }, // Numeral Zero
+ { "18", "0031", }, // Numeral One
+ { "19", "0032", }, // Numeral Two
+ { "20", "0033", }, // Numeral Three
+ { "21", "0034", }, // Numeral Four
+ { "22", "0035", }, // Numeral Five
+ { "23", "0036", }, // Numeral Six
+ { "24", "0037", }, // Numeral Seven
+ { "25", "0038", }, // Numeral Eight
+ { "26", "0039", }, // Numeral Nine
+ { "27", "003A", }, // Colon
+ { "28", "003B", }, // Semicolon
+ { "29", "003C", }, // Less Than Sign
+ { "30", "003D", }, // Equals Sign
+ { "31", "003E", }, // Greater Than Sign
+ { "32", "003F", }, // Question Mark
+ { "33", "0040", }, // Commercial At
+ { "34", "0041", }, // Uppercase A
+ { "35", "0042", }, // Uppercase B
+ { "36", "0043", }, // Uppercase C
+ { "37", "0044", }, // Uppercase D
+ { "38", "0045", }, // Uppercase E
+ { "39", "0046", }, // Uppercase F
+ { "40", "0047", }, // Uppercase G
+ { "41", "0048", }, // Uppercase H
+ { "42", "0049", }, // Uppercase I
+ { "43", "004A", }, // Uppercase J
+ { "44", "004B", }, // Uppercase K
+ { "45", "004C", }, // Uppercase L
+ { "46", "004D", }, // Uppercase M
+ { "47", "004E", }, // Uppercase N
+ { "48", "004F", }, // Uppercase O
+ { "49", "0050", }, // Uppercase P
+ { "50", "0051", }, // Uppercase Q
+ { "51", "0052", }, // Uppercase R
+ { "52", "0053", }, // Uppercase S
+ { "53", "0054", }, // Uppercase T
+ { "54", "0055", }, // Uppercase U
+ { "55", "0056", }, // Uppercase V
+ { "56", "0057", }, // Uppercase W
+ { "57", "0058", }, // Uppercase X
+ { "58", "0059", }, // Uppercase Y
+ { "59", "005A", }, // Uppercase Z
+ { "60", "005B", }, // Left Bracket
+ { "61", "005C", }, // Reverse Solidus, or Backslash
+ { "62", "005D", }, // Right Bracket
+ { "63", "005E", }, // Circumflex, Exponent, or Pointer
+ { "64", "005F", }, // Underline or Underscore Character
+ { "66", "2018", }, // Single Open Quote (6)
+ { "67", "0061", }, // Lowercase A
+ { "68", "0062", }, // Lowercase B
+ { "69", "0063", }, // Lowercase C
+ { "70", "0064", }, // Lowercase D
+ { "71", "0065", }, // Lowercase E
+ { "72", "0066", }, // Lowercase F
+ { "73", "0067", }, // Lowercase G
+ { "74", "0068", }, // Lowercase H
+ { "75", "0069", }, // Lowercase I
+ { "76", "006A", }, // Lowercase J
+ { "77", "006B", }, // Lowercase K
+ { "78", "006C", }, // Lowercase L
+ { "79", "006D", }, // Lowercase M
+ { "80", "006E", }, // Lowercase N
+ { "81", "006F", }, // Lowercase O
+ { "82", "0070", }, // Lowercase P
+ { "83", "0071", }, // Lowercase Q
+ { "84", "0072", }, // Lowercase R
+ { "85", "0073", }, // Lowercase S
+ { "86", "0074", }, // Lowercase T
+ { "87", "0075", }, // Lowercase U
+ { "88", "0076", }, // Lowercase V
+ { "89", "0077", }, // Lowercase W
+ { "90", "0078", }, // Lowercase X
+ { "91", "0079", }, // Lowercase Y
+ { "92", "007A", }, // Lowercase Z
+ { "93", "007B", }, // Left Brace
+ { "94", "007C", }, // Long Vertical Mark
+ { "95", "007D", }, // Right Brace
+ { "96", "007E", }, // One Wavy Line Approximate
+ { "97", "2592", }, // Medium Shading Character
+ { "99", "00C0", }, // Uppercase A Grave
+ { "100", "00C2", }, // Uppercase A Circumflex
+ { "101", "00C8", }, // Uppercase E Grave
+ { "102", "00CA", }, // Uppercase E Circumflex
+ { "103", "00CB", }, // Uppercase E Dieresis
+ { "104", "00CE", }, // Uppercase I Circumflex
+ { "105", "00CF", }, // Uppercase I Dieresis
+ { "106", "00B4", }, // Lowercase Acute Accent (Spacing)
+ { "107", "0060", }, // Lowercase Grave Accent (Spacing)
+ { "108", "02C6", }, // Lowercase Circumflex Accent (Spacing)
+ { "109", "00A8", }, // Lowercase Dieresis Accent (Spacing)
+ { "110", "02DC", }, // Lowercase Tilde Accent (Spacing)
+ { "111", "00D9", }, // Uppercase U Grave
+ { "112", "00DB", }, // Uppercase U Circumflex
+ { "113", "00AF", }, // Overline, or Overscore Character
+ { "114", "00DD", }, // Uppercase Y Acute
+ { "115", "00FD", }, // Lowercase Y Acute
+ { "116", "00B0", }, // Degree Sign
+ { "117", "00C7", }, // Uppercase C Cedilla
+ { "118", "00E7", }, // Lowercase C Cedilla
+ { "119", "00D1", }, // Uppercase N Tilde
+ { "120", "00F1", }, // Lowercase N Tilde
+ { "121", "00A1", }, // Inverted Exclamation
+ { "122", "00BF", }, // Inverted Question Mark
+ { "123", "00A4", }, // Currency Symbol
+ { "124", "00A3", }, // Pound Sterling Sign
+ { "125", "00A5", }, // Yen Sign
+ { "126", "00A7", }, // Section Mark
+ { "127", "0192", }, // Florin Sign
+ { "128", "00A2", }, // Cent Sign
+ { "129", "00E2", }, // Lowercase A Circumflex
+ { "130", "00EA", }, // Lowercase E Circumflex
+ { "131", "00F4", }, // Lowercase O Circumflex
+ { "132", "00FB", }, // Lowercase U Circumflex
+ { "133", "00E1", }, // Lowercase A Acute
+ { "134", "00E9", }, // Lowercase E Acute
+ { "135", "00F3", }, // Lowercase O Acute
+ { "136", "00FA", }, // Lowercase U Acute
+ { "137", "00E0", }, // Lowercase A Grave
+ { "138", "00E8", }, // Lowercase E Grave
+ { "139", "00F2", }, // Lowercase O Grave
+ { "140", "00F9", }, // Lowercase U Grave
+ { "141", "00E4", }, // Lowercase A Dieresis
+ { "142", "00EB", }, // Lowercase E Dieresis
+ { "143", "00F6", }, // Lowercase O Dieresis
+ { "144", "00FC", }, // Lowercase U Dieresis
+ { "145", "00C5", }, // Uppercase A Ring
+ { "146", "00EE", }, // Lowercase I Circumflex
+ { "147", "00D8", }, // Uppercase O Oblique
+ { "148", "00C6", }, // Uppercase AE Diphthong
+ { "149", "00E5", }, // Lowercase A Ring
+ { "150", "00ED", }, // Lowercase I Acute
+ { "151", "00F8", }, // Lowercase O Oblique
+ { "152", "00E6", }, // Lowercase AE Diphthong
+ { "153", "00C4", }, // Uppercase A Dieresis
+ { "154", "00EC", }, // Lowercase I Grave
+ { "155", "00D6", }, // Uppercase O Dieresis
+ { "156", "00DC", }, // Uppercase U Dieresis
+ { "157", "00C9", }, // Uppercase E Acute
+ { "158", "00EF", }, // Lowercase I Dieresis
+ { "159", "00DF", }, // Lowercase Es-zet Ligature
+ { "160", "00D4", }, // Uppercase O Circumflex
+ { "161", "00C1", }, // Uppercase A Acute
+ { "162", "00C3", }, // Uppercase A Tilde
+ { "163", "00E3", }, // Lowercase A Tilde
+ { "164", "00D0", }, // Uppercase Eth
+//{ "164", "0110", }, // Uppercase D-Stroke
+ { "165", "00F0", }, // Lowercase Eth
+ { "166", "00CD", }, // Uppercase I Acute
+ { "167", "00CC", }, // Uppercase I Grave
+ { "168", "00D3", }, // Uppercase O Acute
+ { "169", "00D2", }, // Uppercase O Grave
+ { "170", "00D5", }, // Uppercase O Tilde
+ { "171", "00F5", }, // Lowercase O Tilde
+ { "172", "0160", }, // Uppercase S Hacek
+ { "173", "0161", }, // Lowercase S Hacek
+ { "174", "00DA", }, // Uppercase U Acute
+ { "175", "0178", }, // Uppercase Y Dieresis
+ { "176", "00FF", }, // Lowercase Y Dieresis
+ { "177", "00DE", }, // Uppercase Thorn
+ { "178", "00FE", }, // Lowercase Thorn
+ { "180", "00B5", }, // Lowercase Greek Mu, or Micro
+ { "181", "00B6", }, // Pilcrow, or Paragraph Sign
+ { "182", "00BE", }, // Vulgar Fraction 3/4
+ { "183", "2212", }, // Minus Sign
+ { "184", "00BC", }, // Vulgar Fraction 1/4
+ { "185", "00BD", }, // Vulgar Fraction 1/2
+ { "186", "00AA", }, // Female Ordinal
+ { "187", "00BA", }, // Male Ordinal
+ { "188", "00AB", }, // Left Pointing Double Angle Quote
+ { "189", "25A0", }, // Medium Solid Square Box
+ { "190", "00BB", }, // Right Pointing Double Angle Quote
+ { "191", "00B1", }, // Plus Over Minus Sign
+ { "192", "00A6", }, // Broken Vertical Mark
+ { "193", "00A9", }, // Copyright Sign
+ { "194", "00AC", }, // Not Sign
+ { "195", "00AD", }, // Soft Hyphen
+ { "196", "00AE", }, // Registered Sign
+ { "197", "00B2", }, // Superior Numeral 2
+ { "198", "00B3", }, // Superior Numeral 3
+ { "199", "00B8", }, // Lowercase Cedilla (Spacing)
+ { "200", "00B9", }, // Superior Numeral 1
+ { "201", "00D7", }, // Multiply Sign
+ { "202", "00F7", }, // Divide Sign
+ { "203", "263A", }, // Open Smiling Face
+ { "204", "263B", }, // Solid Smiling Face
+ { "205", "2665", }, // Solid Heart, Card Suit
+ { "206", "2666", }, // Solid Diamond, Card Suit
+ { "207", "2663", }, // Solid Club, Card Suit
+ { "208", "2660", }, // Solid Spade, Card Suit
+ { "209", "25CF", }, // Medium Solid Round Bullet
+ { "210", "25D8", }, // Large Solid square with White Dot
+ { "211", "EFFD", }, // Large Open Round Bullet
+ { "212", "25D9", }, // Large Solid square with White Circle
+ { "213", "2642", }, // Male Symbol
+ { "214", "2640", }, // Female Symbol
+ { "215", "266A", }, // Musical Note
+ { "216", "266B", }, // Pair Of Musical Notes
+ { "217", "263C", }, // Compass, or Eight Pointed Sun
+ { "218", "25BA", }, // Right Solid Arrowhead
+ { "219", "25C4", }, // Left Solid Arrowhead
+ { "220", "2195", }, // Up/Down Arrow
+ { "221", "203C", }, // Double Exclamation Mark
+ { "222", "25AC", }, // Thick Horizontal Mark
+ { "223", "21A8", }, // Up/Down Arrow Baseline
+ { "224", "2191", }, // Up Arrow
+ { "225", "2193", }, // Down Arrow
+ { "226", "2192", }, // Right Arrow
+ { "227", "2190", }, // Left Arrow
+ { "229", "2194", }, // Left/Right Arrow
+ { "230", "25B2", }, // Up Solid Arrowhead
+ { "231", "25BC", }, // Down Solid Arrowhead
+ { "232", "20A7", }, // Pesetas Sign
+ { "233", "2310", }, // Reversed Not Sign
+ { "234", "2591", }, // Light Shading Character
+ { "235", "2593", }, // Dark Shading Character
+ { "236", "2502", }, // Box Draw Line, Vert. 1
+ { "237", "2524", }, // Box Draw Right Tee, Vert. 1 Horiz. 1
+ { "238", "2561", }, // Box Draw Right Tee, Vert. 1 Horiz. 2
+ { "239", "2562", }, // Box Draw Right Tee, Vert. 2 Horiz. 1
+ { "240", "2556", }, // Box Draw Upper Right Corner, Vert. 2 Horiz. 1
+ { "241", "2555", }, // Box Draw Upper Right Corner, Vert. 1 Horiz. 2
+ { "242", "2563", }, // Box Draw Right Tee, Vert. 2 Horiz. 2
+ { "243", "2551", }, // Box Draw Lines, Vert. 2
+ { "244", "2557", }, // Box Draw Upper Right Corner, Vert. 2 Horiz. 2
+ { "245", "255D", }, // Box Draw Lower Right Corner, Vert. 2 Horiz. 2
+ { "246", "255C", }, // Box Draw Lower Right Corner, Vert. 2 Horiz. 1
+ { "247", "255B", }, // Box Draw Lower Right Corner, Vert. 1 Horiz. 2
+ { "248", "2510", }, // Box Draw Upper Right Corner, Vert. 1, Horiz. 1
+ { "249", "2514", }, // Box Draw Lower Left Corner, Vert. 1, Horiz. 1
+ { "250", "2534", }, // Box Draw Bottom Tee, Vert. 1 Horiz. 1
+ { "251", "252C", }, // Box Draw Top Tee, Vert. 1 Horiz. 1
+ { "252", "251C", }, // Box Draw Left Tee, Vert. 1 Horiz. 1
+ { "253", "2500", }, // Box Draw Line, Horiz. 1
+ { "254", "253C", }, // Box Draw Cross, Vert. 1 Horiz. 1
+ { "255", "255E", }, // Box Draw Left Tee, Vert. 1 Horiz. 2
+ { "256", "255F", }, // Box Draw Left Tee, Vert. 2 Horz. 1
+ { "257", "255A", }, // Box Draw Lower Left Corner, Vert. 2 Horiz. 2
+ { "258", "2554", }, // Box Draw Upper Left Corner, Vert. 2 Horiz. 2
+ { "259", "2569", }, // Box Draw Bottom Tee, Vert. 2 Horiz. 2
+ { "260", "2566", }, // Box Draw Top Tee, Vert. 2 Horiz. 2
+ { "261", "2560", }, // Box Draw Left Tee, Vert. 2 Horiz. 2
+ { "262", "2550", }, // Box Draw Lines, Horiz. 2
+ { "263", "256C", }, // Box Draw Cross Open Center, Vert. 2 Horiz. 2
+ { "264", "2567", }, // Box Draw Bottom Tee, Vert. 1 Horiz. 2
+ { "265", "2568", }, // Box Draw Bottom Tee, Vert. 2 Horiz. 1
+ { "266", "2564", }, // Box Draw Top Tee, Vert. 1 Horiz. 2
+ { "267", "2565", }, // Box Draw Top Tee, Vert. 2 Horiz. 1
+ { "268", "2559", }, // Box Draw Lower Left Corner, Vert. 2 Horiz. 1
+ { "269", "2558", }, // Box Draw Lower Left Corner, Vert. 1 Horiz. 2
+ { "270", "2552", }, // Box Draw Upper Left Corner, Vert. 1 Horiz. 2
+ { "271", "2553", }, // Box Draw Upper Left Corner, Vert. 2 Horiz. 1
+ { "272", "256B", }, // Box Draw Cross, Vert. 2 Horiz. 1
+ { "273", "256A", }, // Box Draw Cross, Vert. 1 Horiz. 2
+ { "274", "2518", }, // Box Draw Lower Right Corner, Vert. 1 Horiz. 1
+ { "275", "250C", }, // Box Draw Upper Left Corner, Vert. 1, Horiz. 1
+ { "276", "2588", }, // Solid Full High/Wide
+ { "277", "2584", }, // Bottom Half Solid Rectangle
+ { "278", "258C", }, // Left Half Solid Rectangle
+ { "279", "2590", }, // Right Half Solid Rectangle
+ { "280", "2580", }, // Top Half Solid Rectangle
+ { "290", "2126", }, // Uppercase Greek Omega, or Ohms
+ { "292", "221E", }, // Infinity Symbol
+ { "295", "2229", }, // Set Intersection Symbol
+ { "296", "2261", }, // Exactly Equals Sign
+ { "297", "2265", }, // Greater Than or Equal Sign
+ { "298", "2264", }, // Less Than or Equal Sign
+ { "299", "2320", }, // Top Integral
+ { "300", "2321", }, // Bottom Integral
+ { "301", "2248", }, // Two Wavy Line Approximate Sign
+//{ "302", "00B7", }, // Middle Dot, or Centered Period (see 2219)
+//{ "302", "2219", }, // Centered Period, Middle Dot
+ { "302", "2219", }, // Math Dot, Centered Period
+ { "303", "221A", }, // Radical Symbol, Standalone Diagonal
+ { "305", "25AA", }, // Small Solid Square Box
+ { "306", "013F", }, // Uppercase L-Dot
+ { "307", "0140", }, // Lowercase L-Dot
+ { "308", "2113", }, // Litre Symbol
+ { "309", "0149", }, // Lowercase Apostrophe-N
+ { "310", "2032", }, // Prime, Minutes, or Feet Symbol
+ { "311", "2033", }, // Double Prime, Seconds, or Inches Symbol
+ { "312", "2020", }, // Dagger Symbol
+ { "313", "2122", }, // Trademark Sign
+ { "314", "2017", }, // Double Underline Character
+ { "315", "02C7", }, // Lowercase Hacek Accent (Spacing)
+ { "316", "02DA", }, // Lowercase Ring Accent (Spacing)
+ { "317", "EFF9", }, // Uppercase Acute Accent (Spacing)
+ { "318", "EFF8", }, // Uppercase Grave Accent (Spacing)
+ { "319", "EFF7", }, // Uppercase Circumflex Accent (Spacing)
+ { "320", "EFF6", }, // Uppercase Dieresis Accent (Spacing)
+ { "321", "EFF5", }, // Uppercase Tilde Accent (Spacing)
+ { "322", "EFF4", }, // Uppercase Hacek Accent (Spacing)
+ { "323", "EFF3", }, // Uppercase Ring Accent (Spacing)
+ { "324", "2215", }, // Vulgar Fraction Bar
+ { "325", "2014", }, // Em Dash
+ { "326", "2013", }, // En Dash
+ { "327", "2021", }, // Double Dagger Symbol
+ { "328", "0131", }, // Lowercase Undotted I
+ { "329", "0027", }, // Neutral Single Quote
+ { "330", "EFF2", }, // Uppercase Cedilla (Spacing)
+ { "331", "2022", }, // Small Solid Round Bullet
+ { "332", "207F", }, // Superior Lowercase N
+ { "333", "2302", }, // Home Plate
+ { "335", "0138", }, // Lowercase Kra
+ { "338", "0166", }, // Uppercase T-Stroke
+ { "339", "0167", }, // Lowercase T-Stroke
+ { "340", "014A", }, // Uppercase Eng
+ { "341", "014B", }, // Lowercase Eng
+ { "342", "0111", }, // Lowercase D-Stroke
+ { "400", "0102", }, // Uppercase A Breve
+ { "401", "0103", }, // Lowercase A Breve
+ { "402", "0100", }, // Uppercase A Macron
+ { "403", "0101", }, // Lowercase A Macron
+ { "404", "0104", }, // Uppercase A Ogonek
+ { "405", "0105", }, // Lowercase A Ogonek
+ { "406", "0106", }, // Uppercase C Acute
+ { "407", "0107", }, // Lowercase C Acute
+ { "410", "010C", }, // Uppercase C Hacek
+ { "411", "010D", }, // Lowercase C Hacek
+ { "414", "010E", }, // Uppercase D Hacek
+ { "415", "010F", }, // Lowercase D Hacek
+ { "416", "011A", }, // Uppercase E Hacek
+ { "417", "011B", }, // Lowercase E Hacek
+ { "418", "0116", }, // Uppercase E Overdot
+ { "419", "0117", }, // Lowercase E Overdot
+ { "420", "0112", }, // Uppercase E Macron
+ { "421", "0113", }, // Lowercase E Macron
+ { "422", "0118", }, // Uppercase E Ogonek
+ { "423", "0119", }, // Lowercase E Ogonek
+ { "428", "0122", }, // Uppercase G Cedilla
+ { "429", "0123", }, // Lowercase G Cedilla
+ { "432", "012E", }, // Uppercase I Ogonek
+ { "433", "012F", }, // Lowercase I Ogonek
+ { "434", "012A", }, // Uppercase I Macron
+ { "435", "012B", }, // Lowercase I Macron
+ { "438", "0136", }, // Uppercase K Cedilla
+ { "439", "0137", }, // Lowercase K Cedilla
+ { "440", "0139", }, // Uppercase L Acute
+ { "441", "013A", }, // Lowercase L Acute
+ { "442", "013D", }, // Uppercase L Hacek
+ { "443", "013E", }, // Lowercase L Hacek
+ { "444", "013B", }, // Uppercase L Cedilla
+ { "445", "013C", }, // Lowercase L Cedilla
+ { "446", "0143", }, // Uppercase N Acute
+ { "447", "0144", }, // Lowercase N Acute
+ { "448", "0147", }, // Uppercase N Hacek
+ { "449", "0148", }, // Lowercase N Hacek
+ { "450", "0145", }, // Uppercase N Cedilla
+ { "451", "0146", }, // Lowercase N Cedilla
+ { "452", "0150", }, // Uppercase O Double Acute
+ { "453", "0151", }, // Lowercase O Double Acute
+ { "454", "014C", }, // Uppercase O Macron
+ { "455", "014D", }, // Lowercase O Macron
+ { "456", "0154", }, // Uppercase R Acute
+ { "457", "0155", }, // Lowercase R Acute
+ { "458", "0158", }, // Uppercase R Hacek
+ { "459", "0159", }, // Lowercase R Hacek
+ { "460", "0156", }, // Uppercase R Cedilla
+ { "461", "0157", }, // Lowercase R Cedilla
+ { "462", "015A", }, // Uppercase S Acute
+ { "463", "015B", }, // Lowercase S Acute
+ { "466", "0164", }, // Uppercase T Hacek
+ { "467", "0165", }, // Lowercase T Hacek
+ { "468", "0162", }, // Uppercase T Cedilla
+ { "469", "0163", }, // Lowercase T Cedilla
+ { "470", "0168", }, // Uppercase U Tilde
+ { "471", "0169", }, // Lowercase U Tilde
+ { "474", "0170", }, // Uppercase U Double Acute
+ { "475", "0171", }, // Lowercase U Double Acute
+ { "476", "016E", }, // Uppercase U Ring
+ { "477", "016F", }, // Lowercase U Ring
+ { "478", "016A", }, // Uppercase U Macron
+ { "479", "016B", }, // Lowercase U Macron
+ { "480", "0172", }, // Uppercase U Ogonek
+ { "481", "0173", }, // Lowercase U Ogonek
+ { "482", "0179", }, // Uppercase Z Acute
+ { "483", "017A", }, // Lowercase Z Acute
+ { "484", "017B", }, // Uppercase Z Overdot
+ { "485", "017C", }, // Lowercase Z Overdot
+ { "486", "0128", }, // Uppercase I Tilde
+ { "487", "0129", }, // Lowercase I Tilde
+ { "500", "EFBF", }, // Radical, Diagonal, Composite
+ { "501", "221D", }, // Proportional To Symbol
+ { "502", "212F", }, // Napierian (italic e)
+ { "503", "03F5", }, // Alternate Lowercase Greek Epsilon
+//{ "503", "EFEC", }, // Alternate Lowercase Greek Epsilon
+ { "504", "2234", }, // Therefore Symbol
+ { "505", "0393", }, // Uppercase Greek Gamma
+ { "506", "2206", }, // Increment Symbol (Delta)
+ { "507", "0398", }, // Uppercase Greek Theta
+ { "508", "039B", }, // Uppercase Greek Lambda
+ { "509", "039E", }, // Uppercase Greek Xi
+ { "510", "03A0", }, // Uppercase Greek Pi
+ { "511", "03A3", }, // Uppercase Greek Sigma
+ { "512", "03A5", }, // Uppercase Greek Upsilon
+ { "513", "03A6", }, // Uppercase Greek Phi
+ { "514", "03A8", }, // Uppercase Greek Psi
+ { "515", "03A9", }, // Uppercase Greek Omega
+ { "516", "2207", }, // Nabla Symbol (inverted Delta)
+ { "517", "2202", }, // Partial Differential Delta Symbol
+ { "518", "03C2", }, // Lowercase Sigma, Terminal
+ { "519", "2260", }, // Not Equal To Symbol
+ { "520", "EFEB", }, // Underline, Composite
+ { "521", "2235", }, // Because Symbol
+ { "522", "03B1", }, // Lowercase Greek Alpha
+ { "523", "03B2", }, // Lowercase Greek Beta
+ { "524", "03B3", }, // Lowercase Greek Gamma
+ { "525", "03B4", }, // Lowercase Greek Delta
+ { "526", "03B5", }, // Lowercase Greek Epsilon
+ { "527", "03B6", }, // Lowercase Greek Zeta
+ { "528", "03B7", }, // Lowercase Greek Eta
+ { "529", "03B8", }, // Lowercase Greek Theta
+ { "530", "03B9", }, // Lowercase Greek Iota
+ { "531", "03BA", }, // Lowercase Greek Kappa
+ { "532", "03BB", }, // Lowercase Greek Lambda
+ { "533", "03BC", }, // Lowercase Greek Mu
+ { "534", "03BD", }, // Lowercase Greek Nu
+ { "535", "03BE", }, // Lowercase Greek Xi
+ { "536", "03BF", }, // Lowercase Greek Omicron
+ { "537", "03C0", }, // Lowercase Greek Pi
+ { "538", "03C1", }, // Lowercase Greek Rho
+ { "539", "03C3", }, // Lowercase Greek Sigma
+ { "540", "03C4", }, // Lowercase Greek Tau
+ { "541", "03C5", }, // Lowercase Greek Upsilon
+ { "542", "03C6", }, // Lowercase Greek Phi
+ { "543", "03C7", }, // Lowercase Greek Chi
+ { "544", "03C8", }, // Lowercase Greek Psi
+ { "545", "03C9", }, // Lowercase Greek Omega
+ { "546", "03D1", }, // Lowercase Greek Theta, Open
+ { "547", "03D5", }, // Lowercase Greek Phi, Open
+ { "548", "03D6", }, // Lowercase Pi, Alternate
+ { "549", "2243", }, // Wavy Over Straight Approximate Symbol
+ { "550", "2262", }, // Not Exactly Equal To Symbol
+ { "551", "21D1", }, // Up Arrow Double Stroke
+ { "552", "21D2", }, // Right Arrow Double Stroke
+ { "553", "21D3", }, // Down Arrow Double Stroke
+ { "554", "21D0", }, // Left Arrow Double Stroke
+ { "555", "21D5", }, // Up/Down Arrow Double Stroke
+ { "556", "21D4", }, // Left/Right Arrow Double Stroke
+ { "557", "21C4", }, // Right Over Left Arrow
+ { "558", "21C6", }, // Left Over Right Arrow
+ { "559", "EFE9", }, // Vector Symbol
+ { "560", "0305", }, // Overline, Composite
+ { "561", "2200", }, // For All Symbol, or Universal (inverted A)
+ { "562", "2203", }, // There Exists Symbol, or Existential (inverted E)
+ { "563", "22A4", }, // Top Symbol
+ { "564", "22A5", }, // Bottom Symbol
+ { "565", "222A", }, // Set Union Symbol
+ { "566", "2208", }, // Element-Of Symbol
+ { "567", "220B", }, // Contains Symbol
+ { "568", "2209", }, // Not-Element-Of Symbol
+ { "569", "2282", }, // Proper Subset Symbol
+ { "570", "2283", }, // Proper Superset Symbol
+ { "571", "2284", }, // Not Proper Subset Symbol
+ { "572", "2285", }, // Not Proper Superset Symbol
+ { "573", "2286", }, // Subset Symbol
+ { "574", "2287", }, // Superset Symbol
+ { "575", "2295", }, // Plus In Circle Symbol
+ { "576", "2299", }, // Dot In Circle Symbol
+ { "577", "2297", }, // Times In Circle Symbol
+ { "578", "2296", }, // Minus In Circle Symbol
+ { "579", "2298", }, // Slash In Circle Symbol
+ { "580", "2227", }, // Logical And Symbol
+ { "581", "2228", }, // Logical Or Symbol
+ { "582", "22BB", }, // Exclusive Or Symbol
+ { "583", "2218", }, // Functional Composition Symbol
+ { "584", "20DD", }, // Large Open Circle
+ { "585", "22A3", }, // Assertion Symbol
+ { "586", "22A2", }, // Backwards Assertion Symbol
+ { "587", "222B", }, // Integral Symbol
+ { "588", "222E", }, // Curvilinear Integral Symbol
+ { "589", "2220", }, // Angle Symbol
+ { "590", "2205", }, // Empty Set Symbol
+ { "591", "2135", }, // Hebrew Aleph
+ { "592", "2136", }, // Hebrew Beth
+ { "593", "2137", }, // Hebrew Gimmel
+ { "594", "212D", }, // Fraktur Uppercase C
+ { "595", "2111", }, // Fraktur Uppercase I
+ { "596", "211C", }, // Fraktur Uppercase R
+ { "597", "2128", }, // Fraktur Uppercase Z
+ { "598", "23A1", }, // Top Segment Left Bracket (Left Square Bracket Upper Corner)
+ { "599", "23A3", }, // Bottom Segment Left Bracket (Left Square Bracket Lower Corner)
+ { "600", "239B", }, // Top Segment Left Brace (Left Parenthesis Upper Hook)
+//{ "600", "23A7", }, // Top Segment Left Brace (Right Curly Bracket Upper Hook)
+ { "601", "23A8", }, // Middle Segment Left Brace (Right Curly Bracket Middle Piece)
+ { "602", "239D", }, // Bottom Segment LeftBrace (Left Parenthesis Lower Hook)
+//{ "602", "23A9", }, // Bottom Segment Left Brace (Right Curly Bracket Lower Hook)
+ { "603", "EFD4", }, // Middle Segment Curvilinear Integral
+ { "604", "EFD3", }, // Top Left Segment Summation
+ { "605", "2225", }, // Double Vertical Line, Composite
+ { "606", "EFD2", }, // Bottom Left Segment Summation
+ { "607", "EFD1", }, // Bottom Diagonal Summation
+ { "608", "23A4", }, // Top Segment Right Bracket (Right Square Bracket Upper Corner)
+ { "609", "23A6", }, // Bottom Segment Right Bracket (Right Square Bracket Lower Corner)
+ { "610", "239E", }, // Top Segment Right Brace (Right Parenthesis Upper Hook)
+//{ "610", "23AB", }, // Top Segment Right Brace (Right Curly Bracket Upper Hook)
+ { "611", "23AC", }, // Middle Segment Right Brace (Right Curly Bracket Middle Piece)
+ { "612", "23A0", }, // Bottom Segment Right ( Right Parenthesis Lower Hook)
+//{ "612", "23AD", }, // Bottom Segment Right Brace (Right Curly Bracket Lower Hook)
+ { "613", "239C", }, // Thick Vertical Line, Composite (Left Parenthesis Extension)
+//{ "613", "239F", }, // Thick Vertical Line, Composite (Right Parenthesis Extension)
+//{ "613", "23AA", }, // Thick Vertical Line, Composite (Curly Bracket Extension)
+//{ "613", "23AE", }, // Thick Vertical Line, Composite (Integral Extension)
+ { "614", "2223", }, // Thin Vertical Line, Composite
+ { "615", "EFDC", }, // Bottom Segment of Vertical Radical
+ { "616", "EFD0", }, // Top Right Segment Summation
+ { "617", "EFCF", }, // Middle Segment Summation
+ { "618", "EFCE", }, // Bottom Right Segment Summation
+ { "619", "EFCD", }, // Top Diagonal Summation
+ { "620", "2213", }, // Minus Over Plus Sign
+ { "621", "2329", }, // Left Angle Bracket
+ { "622", "232A", }, // Right Angle Bracket
+ { "623", "EFFF", }, // Mask Symbol
+ { "624", "2245", }, // Wavy Over Two Straight Approximate Symbol
+ { "625", "2197", }, // 45 Degree Arrow
+ { "626", "2198", }, // -45 Degree Arrow
+ { "627", "2199", }, // -135 Degree Arrow
+ { "628", "2196", }, // 135 Degree Arrow
+ { "629", "25B5", }, // Up Open Triangle
+ { "630", "25B9", }, // Right Open Triangle
+ { "631", "25BF", }, // Down Open Triangle
+ { "632", "25C3", }, // Left Open Triangle
+ { "633", "226A", }, // Much Less Than Sign
+ { "634", "226B", }, // Much Greater Than Sign
+ { "635", "2237", }, // Proportional To Symbol (4 dots)
+ { "636", "225C", }, // Defined As Symbol
+ { "637", "03DD", }, // Lowercase Greek Digamma
+ { "638", "210F", }, // Planck's Constant divided by 2 pi
+ { "639", "2112", }, // Laplace Transform Symbol
+ { "640", "EFFE", }, // Power Set
+ { "641", "2118", }, // Weierstrassian Symbol
+ { "642", "2211", }, // Summation Symbol (large Sigma)
+ { "643", "301A", }, // Left Double Bracket
+ { "644", "EFC9", }, // Middle Segment Double Bracket
+ { "645", "301B", }, // Right Double Bracket
+ { "646", "256D", }, // Box Draw Left Top Round Corner
+ { "647", "2570", }, // Box Draw Left Bottom Round Corner
+ { "648", "EFC8", }, // Extender Large Union/Product
+ { "649", "EFC7", }, // Bottom Segment Large Union
+ { "650", "EFC6", }, // Top Segment Large Intersection
+ { "651", "EFC5", }, // Top Segment Left Double Bracket
+ { "652", "EFC4", }, // Bottom Segment Left Double Bracket
+ { "653", "EFFC", }, // Large Open Square Box
+ { "654", "25C7", }, // Open Diamond
+ { "655", "256E", }, // Box Draw Right Top Round Corner
+ { "656", "256F", }, // Box Draw Right Bottom Round Corner
+ { "657", "EFC3", }, // Bottom Segment Large Bottom Product
+ { "658", "EFC2", }, // Top Segment Large Top Product
+ { "659", "EFC1", }, // Top Segment Right Double Bracket
+ { "660", "EFC0", }, // Bottom Segment Right Double Bracket
+ { "661", "EFFB", }, // Large Solid Square Box
+ { "662", "25C6", }, // Solid Diamond
+ { "663", "220D", }, // Such That Symbol (rotated lc epsilon)
+ { "664", "2217", }, // Math Asterisk
+ { "665", "23AF", }, // Horizontal Arrow Extender (Horizontal Line Extension)
+ { "666", "EFCB", }, // Double Horizontal Arrow Extender
+ { "667", "EFCC", }, // Inverted Complement of 0xEFCF or MSL 617
+ { "668", "221F", }, // Right Angle Symbol
+ { "669", "220F", }, // Product Symbol (large Pi)
+ { "684", "25CA", }, // Lozenge, Diamond
+ { "1000", "2070", }, // Superior Numeral 0
+ { "1001", "2074", }, // Superior Numeral 4
+ { "1002", "2075", }, // Superior Numeral 5
+ { "1003", "2076", }, // Superior Numeral 6
+ { "1004", "2077", }, // Superior Numeral 7
+ { "1005", "2078", }, // Superior Numeral 8
+ { "1006", "2079", }, // Superior Numeral 9
+ { "1017", "201C", }, // Double Open Quote (6)
+ { "1018", "201D", }, // Double Close Quote (9)
+ { "1019", "201E", }, // Double Baseline Quote (9)
+ { "1020", "2003", }, // Em Space
+ { "1021", "2002", }, // En Space
+ { "1023", "2009", }, // Thin Space
+ { "1028", "2026", }, // Ellipsis
+ { "1030", "EFF1", }, // Uppercase Ogonek (Spacing)
+ { "1031", "017E", }, // Lowercase Z Hacek
+ { "1034", "2120", }, // Service Mark
+ { "1036", "211E", }, // Prescription Sign
+//{ "1040", "F001", }, // Lowercase FI Ligature
+ { "1040", "FB01", }, // Lowercase FI Ligature
+//{ "1041", "F002", }, // Lowercase FL Ligature
+ { "1041", "FB02", }, // Lowercase FL Ligature
+ { "1042", "FB00", }, // Lowercase FF Ligature
+ { "1043", "FB03", }, // Lowercase FFI Ligature
+ { "1044", "FB04", }, // Lowercase FFL Ligature
+ { "1045", "EFF0", }, // Uppercase Double Acute Accent (Spacing)
+ { "1047", "0133", }, // Lowercase IJ Ligature
+ { "1060", "2105", }, // Care Of Symbol
+ { "1061", "011E", }, // Uppercase G Breve
+ { "1062", "011F", }, // Lowercase G Breve
+ { "1063", "015E", }, // Uppercase S Cedilla
+ { "1064", "015F", }, // Lowercase S Cedilla
+ { "1065", "0130", }, // Uppercase I Overdot
+ { "1067", "201A", }, // Single Baseline Quote (9)
+ { "1068", "2030", }, // Per Mill Sign
+ { "1069", "20AC", }, // Euro
+ { "1084", "02C9", }, // Lowercase Macron Accent (Spacing)
+ { "1086", "02D8", }, // Lowercase Breve Accent (Spacing)
+ { "1088", "02D9", }, // Lowercase Overdot Accent (Spacing)
+ { "1090", "0153", }, // Lowercase OE Ligature
+ { "1091", "0152", }, // Uppercase OE Ligature
+ { "1092", "2039", }, // Left Pointing Single Angle Quote
+ { "1093", "203A", }, // Right Pointing Single Angle Quote
+ { "1094", "25A1", }, // Medium Open Square Box
+ { "1095", "0141", }, // Uppercase L-Stroke
+ { "1096", "0142", }, // Lowercase L-Stroke
+ { "1097", "02DD", }, // Lowercase Double Acute Accent (Spacing)
+ { "1098", "02DB", }, // Lowercase Ogonek (Spacing)
+ { "1099", "21B5", }, // Carriage Return Symbol
+ { "1100", "EFDB", }, // Full Size Serif Registered
+ { "1101", "EFDA", }, // Full Size Serif Copyright
+ { "1102", "EFD9", }, // Full Size Serif Trademark
+ { "1103", "EFD8", }, // Full Size Sans Registered
+ { "1104", "EFD7", }, // Full Size Sans Copyright
+ { "1105", "EFD6", }, // Full Size Sans Trademark
+ { "1106", "017D", }, // Uppercase Z Hacek
+ { "1107", "0132", }, // Uppercase IJ Ligature
+ { "1108", "25AB", }, // Small Open Square Box
+ { "1109", "25E6", }, // Small Open Round Bullet
+ { "1110", "25CB", }, // Medium Open Round Bullet
+ { "1111", "EFFA", }, // Large Solid Round Bullet
+ { "3812", "F000", }, // Ornament, Apple
+};
+
+// global constructor
+static struct hp_msl_to_unicode_init {
+ hp_msl_to_unicode_init();
+} _hp_msl_to_unicode_init;
+
+hp_msl_to_unicode_init::hp_msl_to_unicode_init() {
+ for (unsigned int i = 0;
+ i < sizeof(hp_msl_to_unicode_list)/sizeof(hp_msl_to_unicode_list[0]);
+ i++) {
+ hp_msl_to_unicode *ptu = new hp_msl_to_unicode[1];
+ ptu->value = (char *)hp_msl_to_unicode_list[i].value;
+ hp_msl_to_unicode_table.define(hp_msl_to_unicode_list[i].key, ptu);
+ }
+}
+
+const char *hp_msl_to_unicode_code(const char *s)
+{
+ hp_msl_to_unicode *result = hp_msl_to_unicode_table.lookup(s);
+ return result ? result->value : 0;
+}
diff --git a/contrib/groff/src/utils/indxbib/Makefile.sub b/contrib/groff/src/utils/indxbib/Makefile.sub
index 7736e48..e8f1e6f 100644
--- a/contrib/groff/src/utils/indxbib/Makefile.sub
+++ b/contrib/groff/src/utils/indxbib/Makefile.sub
@@ -11,7 +11,7 @@ CSRCS=\
$(srcdir)/signal.c
NAMEPREFIX=$(g)
-install_data: eign
+install_data: $(srcdir)/eign
-test -d $(datadir) || $(mkinstalldirs) $(datadir)
-test -d $(dataprogramdir) || $(mkinstalldirs) $(dataprogramdir)
-test -d $(datasubdir) || $(mkinstalldirs) $(datasubdir)
diff --git a/contrib/groff/src/utils/indxbib/indxbib.cpp b/contrib/groff/src/utils/indxbib/indxbib.cpp
index 2a60c15..00e9944 100644
--- a/contrib/groff/src/utils/indxbib/indxbib.cpp
+++ b/contrib/groff/src/utils/indxbib/indxbib.cpp
@@ -1,5 +1,5 @@
// -*- C++ -*-
-/* Copyright (C) 1989-1992, 2000, 2001, 2002, 2003
+/* Copyright (C) 1989-1992, 2000, 2001, 2002, 2003, 2004
Free Software Foundation, Inc.
Written by James Clark (jjc@jclark.com)
@@ -17,7 +17,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
#include "lib.h"
@@ -119,7 +119,7 @@ int main(int argc, char **argv)
static char stderr_buf[BUFSIZ];
setbuf(stderr, stderr_buf);
- const char *basename = 0;
+ const char *base_name = 0;
typedef int (*parser_t)(const char *);
parser_t parser = do_file;
const char *directory = 0;
@@ -164,7 +164,7 @@ int main(int argc, char **argv)
check_integer_arg('n', optarg, 0, &n_ignore_words);
break;
case 'o':
- basename = optarg;
+ base_name = optarg;
break;
case 't':
check_integer_arg('t', optarg, 1, &truncate_len);
@@ -202,33 +202,33 @@ int main(int argc, char **argv)
store_filename(ignore_fields);
key_buffer = new char[truncate_len];
read_common_words_file();
- if (!basename)
- basename = optind < argc ? argv[optind] : DEFAULT_INDEX_NAME;
- const char *p = strrchr(basename, DIR_SEPS[0]), *p1;
+ if (!base_name)
+ base_name = optind < argc ? argv[optind] : DEFAULT_INDEX_NAME;
+ const char *p = strrchr(base_name, DIR_SEPS[0]), *p1;
const char *sep = &DIR_SEPS[1];
while (*sep) {
- p1 = strrchr(basename, *sep);
+ p1 = strrchr(base_name, *sep);
if (p1 && (!p || p1 > p))
p = p1;
sep++;
}
size_t name_max;
if (p) {
- char *dir = strsave(basename);
- dir[p - basename] = '\0';
+ char *dir = strsave(base_name);
+ dir[p - base_name] = '\0';
name_max = file_name_max(dir);
a_delete dir;
}
else
name_max = file_name_max(".");
- const char *filename = p ? p + 1 : basename;
+ const char *filename = p ? p + 1 : base_name;
if (strlen(filename) + sizeof(INDEX_SUFFIX) - 1 > name_max)
fatal("`%1.%2' is too long for a filename", filename, INDEX_SUFFIX);
if (p) {
p++;
- temp_index_file = new char[p - basename + sizeof(TEMP_INDEX_TEMPLATE)];
- memcpy(temp_index_file, basename, p - basename);
- strcpy(temp_index_file + (p - basename), TEMP_INDEX_TEMPLATE);
+ temp_index_file = new char[p - base_name + sizeof(TEMP_INDEX_TEMPLATE)];
+ memcpy(temp_index_file, base_name, p - base_name);
+ strcpy(temp_index_file + (p - base_name), TEMP_INDEX_TEMPLATE);
}
else {
temp_index_file = strsave(TEMP_INDEX_TEMPLATE);
@@ -281,8 +281,8 @@ int main(int argc, char **argv)
write_hash_table();
if (fclose(indxfp) < 0)
fatal("error closing temporary index file: %1", strerror(errno));
- char *index_file = new char[strlen(basename) + sizeof(INDEX_SUFFIX)];
- strcpy(index_file, basename);
+ char *index_file = new char[strlen(base_name) + sizeof(INDEX_SUFFIX)];
+ strcpy(index_file, base_name);
strcat(index_file, INDEX_SUFFIX);
#ifdef HAVE_RENAME
#ifdef __EMX__
@@ -293,7 +293,7 @@ int main(int argc, char **argv)
#ifdef __MSDOS__
// RENAME could fail on plain MSDOS filesystems because
// INDEX_FILE is an invalid filename, e.g. it has multiple dots.
- char *fname = p ? index_file + (p - basename) : 0;
+ char *fname = p ? index_file + (p - base_name) : 0;
char *dot = 0;
// Replace the dot with an underscore and try again.
diff --git a/contrib/groff/src/utils/indxbib/signal.c b/contrib/groff/src/utils/indxbib/signal.c
index fccd289..20dfd90 100644
--- a/contrib/groff/src/utils/indxbib/signal.c
+++ b/contrib/groff/src/utils/indxbib/signal.c
@@ -1,4 +1,4 @@
-/* Copyright (C) 1992, 2001 Free Software Foundation, Inc.
+/* Copyright (C) 1992, 2001, 2003, 2004 Free Software Foundation, Inc.
Written by James Clark (jjc@jclark.com)
This file is part of groff.
@@ -15,11 +15,13 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
/* Unfortunately vendors seem to have problems writing a <signal.h>
that is correct for C++, so we implement all signal handling in C. */
+#include <stdlib.h>
+
#ifdef HAVE_CONFIG_H
#include <config.h>
#endif
@@ -30,21 +32,26 @@ that is correct for C++, so we implement all signal handling in C. */
#include <unistd.h>
#endif
-#ifndef RETSIGTYPE
-#define RETSIGTYPE void
+#ifdef __cplusplus
+extern "C" {
#endif
-extern void cleanup();
+extern void cleanup(void);
-static RETSIGTYPE handle_fatal_signal(signum)
- int signum;
+static RETSIGTYPE handle_fatal_signal(int signum)
{
signal(signum, SIG_DFL);
cleanup();
+#ifdef HAVE_KILL
kill(getpid(), signum);
+#else
+ /* MS-DOS and Win32 don't have kill(); the best compromise is
+ probably to use exit() instead. */
+ exit(signum);
+#endif
}
-void catch_fatal_signals()
+void catch_fatal_signals(void)
{
#ifdef SIGHUP
signal(SIGHUP, handle_fatal_signal);
@@ -53,6 +60,10 @@ void catch_fatal_signals()
signal(SIGTERM, handle_fatal_signal);
}
+#ifdef __cplusplus
+}
+#endif
+
#ifndef HAVE_RENAME
void ignore_fatal_signals()
diff --git a/contrib/groff/src/utils/lkbib/lkbib.cpp b/contrib/groff/src/utils/lkbib/lkbib.cpp
index 42156ea..b44f245 100644
--- a/contrib/groff/src/utils/lkbib/lkbib.cpp
+++ b/contrib/groff/src/utils/lkbib/lkbib.cpp
@@ -16,7 +16,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
#include "lib.h"
diff --git a/contrib/groff/src/utils/lkbib/lkbib.man b/contrib/groff/src/utils/lkbib/lkbib.man
index 81067d1..29831ee 100644
--- a/contrib/groff/src/utils/lkbib/lkbib.man
+++ b/contrib/groff/src/utils/lkbib/lkbib.man
@@ -1,5 +1,5 @@
.ig
-Copyright (C) 1989-2000, 2001 Free Software Foundation, Inc.
+Copyright (C) 1989-2000, 2001, 2004 Free Software Foundation, Inc.
Permission is granted to make and distribute verbatim copies of
this manual provided the copyright notice and this permission notice
@@ -16,17 +16,23 @@ versions, except that this permission notice may be included in
translations approved by the Free Software Foundation instead of in
the original English.
..
-.ds g \" empty
-.ds G \" empty
+.
+.
.\" Like TP, but if specified indent is more than half
.\" the current line-length - indent, use the default indent.
.de Tp
-.ie \\n(.$=0:((0\\$1)*2u>(\\n(.lu-\\n(.iu)) .TP
-.el .TP "\\$1"
+. ie \\n(.$=0:((0\\$1)*2u>(\\n(.lu-\\n(.iu)) .TP
+. el .TP "\\$1"
..
+.
+.
.TH LKBIB @MAN1EXT@ "@MDATE@" "Groff Version @VERSION@"
+.
+.
.SH NAME
lkbib \- search bibliographic databases
+.
+.
.SH SYNOPSIS
.B lkbib
[
@@ -42,13 +48,16 @@ lkbib \- search bibliographic databases
.BI \-t n
]
.IR key \|.\|.\|.
+.
.PP
It is possible to have whitespace between a command line option and its
parameter.
+.
+.
.SH DESCRIPTION
.B lkbib
searches bibliographic databases for references that contain the keys
-.IR key \|.\|.\|.
+.IR key \|.\|.\|.\&
and prints any references found on the standard output.
.B lkbib
will search any databases given by
@@ -68,10 +77,13 @@ created by
.BR @g@indxbib (@MAN1EXT@)
exists, then it will be searched instead;
each index can cover multiple databases.
+.
+.
.SH OPTIONS
.TP
.B \-v
Print the version number.
+.
.TP
.BI \-p filename
Search
@@ -79,11 +91,13 @@ Search
Multiple
.B \-p
options can be used.
+.
.TP
.BI \-i string
When searching files for which no index exists,
ignore the contents of fields whose names are in
.IR string .
+.
.TP
.BI \-t n
Only require the first
@@ -91,19 +105,27 @@ Only require the first
characters of keys to be given.
Initially
.I n
-is 6.
+is\~6.
+.
+.
.SH ENVIRONMENT
.TP \w'\fBREFER'u+2n
.SB REFER
Default database.
+.
+.
.SH FILES
.Tp \w'\fB@DEFAULT_INDEX@'u+2n
.B @DEFAULT_INDEX@
Default database to be used if the
.SB REFER
environment variable is not set.
+.
+.TP
.IB filename @INDEX_SUFFIX@
Index files.
+.
+.
.SH "SEE ALSO"
.BR @g@refer (@MAN1EXT@),
.BR @g@lookbib (@MAN1EXT@),
diff --git a/contrib/groff/src/utils/lookbib/lookbib.cpp b/contrib/groff/src/utils/lookbib/lookbib.cpp
index 65e89bc..a573c5f 100644
--- a/contrib/groff/src/utils/lookbib/lookbib.cpp
+++ b/contrib/groff/src/utils/lookbib/lookbib.cpp
@@ -1,5 +1,6 @@
// -*- C++ -*-
-/* Copyright (C) 1989-1992, 2000, 2001 Free Software Foundation, Inc.
+/* Copyright (C) 1989-1992, 2000, 2001, 2002, 2003
+ Free Software Foundation, Inc.
Written by James Clark (jjc@jclark.com)
This file is part of groff.
@@ -16,7 +17,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
#include "lib.h"
@@ -33,6 +34,7 @@ Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
/* for isatty() */
#include "posix.h"
+#include "nonposix.h"
extern "C" {
const char *Version_string;
diff --git a/contrib/groff/src/utils/lookbib/lookbib.man b/contrib/groff/src/utils/lookbib/lookbib.man
index 3d8ba44..baade0f 100644
--- a/contrib/groff/src/utils/lookbib/lookbib.man
+++ b/contrib/groff/src/utils/lookbib/lookbib.man
@@ -1,5 +1,5 @@
.ig
-Copyright (C) 1989-2000, 2001 Free Software Foundation, Inc.
+Copyright (C) 1989-2000, 2001, 2004 Free Software Foundation, Inc.
Permission is granted to make and distribute verbatim copies of
this manual provided the copyright notice and this permission notice
@@ -16,9 +16,15 @@ versions, except that this permission notice may be included in
translations approved by the Free Software Foundation instead of in
the original English.
..
+.
+.
.TH @G@LOOKBIB @MAN1EXT@ "@MDATE@" "Groff Version @VERSION@"
+.
+.
.SH NAME
@g@lookbib \- search bibliographic databases
+.
+.
.SH SYNOPSIS
.B @g@lookbib
[
@@ -31,14 +37,19 @@ the original English.
.BI \-t n
]
.IR filename \|.\|.\|.
+.
.PP
It is possible to have whitespace between a command line option and its
parameter.
+.
+.
.SH DESCRIPTION
-@g@lookbib prints a prompt on the standard error (unless the standard input is not a terminal),
+.B @g@lookbib
+prints a prompt on the standard error (unless the standard input is not
+a terminal),
reads from the standard input a line containing a set of keywords,
searches the bibliographic databases
-.IR filename \|.\|.\|.
+.IR filename \|.\|.\|.\&
for references containing those keywords,
prints any references found on the standard output,
and repeats this process until the end of input.
@@ -51,15 +62,19 @@ created by
.BR @g@indxbib (@MAN1EXT@)
exists, then it will be searched instead;
each index can cover multiple databases.
+.
+.
.SH OPTIONS
.TP
.B \-v
Print the version number.
+.
.TP
.BI \-i string
When searching files for which no index exists,
ignore the contents of fields whose names are in
.IR string .
+.
.TP
.BI \-t n
Only require the first
@@ -67,11 +82,15 @@ Only require the first
characters of keys to be given.
Initially
.I n
-is 6.
+is\~6.
+.
+.
.SH FILES
.TP \w'\fIfilename\fB@INDEX_SUFFIX@'u+2n
.IB filename @INDEX_SUFFIX@
Index files.
+.
+.
.SH "SEE ALSO"
.BR @g@refer (@MAN1EXT@),
.BR lkbib (@MAN1EXT@),
diff --git a/contrib/groff/src/utils/pfbtops/Makefile.sub b/contrib/groff/src/utils/pfbtops/Makefile.sub
index a8ed92a..451b519 100644
--- a/contrib/groff/src/utils/pfbtops/Makefile.sub
+++ b/contrib/groff/src/utils/pfbtops/Makefile.sub
@@ -4,3 +4,4 @@ OBJS=pfbtops.$(OBJEXT)
CSRCS=$(srcdir)/pfbtops.c
XLIBS=$(LIBGROFF)
MLIB=$(LIBM)
+LINK.c=$(CCC) $(CCFLAGS) $(LDFLAGS)
diff --git a/contrib/groff/src/utils/pfbtops/pfbtops.c b/contrib/groff/src/utils/pfbtops/pfbtops.c
index 821d901..8b394d5 100644
--- a/contrib/groff/src/utils/pfbtops/pfbtops.c
+++ b/contrib/groff/src/utils/pfbtops/pfbtops.c
@@ -1,4 +1,4 @@
-/* Copyright (C) 1992, 2001, 2003 Free Software Foundation, Inc.
+/* Copyright (C) 1992, 2001, 2003, 2004, 2005 Free Software Foundation, Inc.
Written by James Clark (jjc@jclark.com)
This file is part of groff.
@@ -15,7 +15,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
/* This translates ps fonts in .pfb format to ASCII ps files. */
@@ -25,9 +25,11 @@ Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
#include <stdio.h>
#include <stdlib.h>
-#include <getopt.h>
#include <limits.h>
+#define __GETOPT_PREFIX groff_
+#include <getopt.h>
+
#include "nonposix.h"
/* Binary bytes per output line. */
@@ -35,10 +37,11 @@ Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
#define MAX_LINE_LENGTH 78
#define HEX_DIGITS "0123456789abcdef"
+extern const char *Version_string;
+
static char *program_name;
-static void error(s)
- char *s;
+static void error(const char *s)
{
fprintf(stderr, "%s: %s\n", program_name, s);
exit(2);
@@ -51,7 +54,7 @@ static void usage(FILE *stream)
static void get_text(int n)
{
- int c, c1;
+ int c = 0, c1;
int in_string = 0;
int is_comment = 0;
int count = 0;
@@ -67,19 +70,27 @@ static void get_text(int n)
else if (c == '\\' && in_string) {
count++;
putchar(c);
+ if (n-- == 0)
+ break;
c = getchar();
/* don't split octal character representations */
if (c >= '0' && c <= '7') {
count++;
putchar(c);
+ if (n-- == 0)
+ break;
c = getchar();
if (c >= '0' && c <= '7') {
count++;
putchar(c);
+ if (n-- == 0)
+ break;
c = getchar();
if (c >= '0' && c <= '7') {
count++;
putchar(c);
+ if (n-- == 0)
+ break;
c = getchar();
}
}
@@ -88,9 +99,13 @@ static void get_text(int n)
if (c == EOF)
error("end of file in text packet");
else if (c == '\r') {
+ if (n-- == 0)
+ break;
c1 = getchar();
- if (c1 != '\n')
+ if (c1 != '\n') {
ungetc(c1, stdin);
+ n++;
+ }
c = '\n';
}
if (c == '\n') {
@@ -112,6 +127,8 @@ static void get_text(int n)
/* split at the next whitespace character */
while (c != ' ' && c != '\t' && c != '\f') {
putchar(c);
+ if (n-- == 0)
+ break;
c = getchar();
}
count = 0;
@@ -146,12 +163,9 @@ static void get_binary(int n)
putchar('\n');
}
-int main(argc, argv)
- int argc;
- char **argv;
+int main(int argc, char **argv)
{
int opt;
- extern int optind;
static const struct option long_options[] = {
{ "help", no_argument, 0, CHAR_MAX + 1 },
{ "version", no_argument, 0, 'v' },
@@ -163,12 +177,9 @@ int main(argc, argv)
while ((opt = getopt_long(argc, argv, "v", long_options, NULL)) != EOF) {
switch (opt) {
case 'v':
- {
- extern const char *Version_string;
- printf("GNU pfbtops (groff) version %s\n", Version_string);
- exit(0);
- break;
- }
+ printf("GNU pfbtops (groff) version %s\n", Version_string);
+ exit(0);
+ break;
case CHAR_MAX + 1: /* --help */
usage(stdout);
exit(0);
diff --git a/contrib/groff/src/utils/pfbtops/pfbtops.man b/contrib/groff/src/utils/pfbtops/pfbtops.man
index 627e5c5..c97a297 100644
--- a/contrib/groff/src/utils/pfbtops/pfbtops.man
+++ b/contrib/groff/src/utils/pfbtops/pfbtops.man
@@ -1,5 +1,5 @@
.ig
-Copyright (C) 1989-1995, 2001, 2003 Free Software Foundation, Inc.
+Copyright (C) 1989-1995, 2001, 2003, 2004 Free Software Foundation, Inc.
Permission is granted to make and distribute verbatim copies of
this manual provided the copyright notice and this permission notice
@@ -16,14 +16,25 @@ versions, except that this permission notice may be included in
translations approved by the Free Software Foundation instead of in
the original English.
..
+.
+.
.TH PFBTOPS @MAN1EXT@ "@MDATE@" "Groff Version @VERSION@"
+.
+.
.SH NAME
pfbtops \- translate a PostScript font in .pfb format to ASCII
+.
+.
.SH SYNOPSIS
.B pfbtops
[
+.B \-v
+]
+[
.I pfb_file
]
+.
+.
.SH DESCRIPTION
.B pfbtops
translates a PostScript font in
@@ -37,10 +48,18 @@ The ASCII format PostScript font will be written on the standard output.
PostScript fonts for MS-DOS are normally supplied in
.B .pfb
format.
+.
.LP
The resulting ASCII format PostScript font can be used with groff.
It must first be listed in
.BR @FONTDIR@/devps/download .
+.
+.SH OPTIONS
+.TP
+.B \-v
+Print the version number.
+.
+.
.SH "SEE ALSO"
.BR grops (@MAN1EXT@)
.
diff --git a/contrib/groff/src/utils/tfmtodit/tfmtodit.cpp b/contrib/groff/src/utils/tfmtodit/tfmtodit.cpp
index 9fbbe25..ccf995a 100644
--- a/contrib/groff/src/utils/tfmtodit/tfmtodit.cpp
+++ b/contrib/groff/src/utils/tfmtodit/tfmtodit.cpp
@@ -1,5 +1,5 @@
// -*- C++ -*-
-/* Copyright (C) 1989-1992, 2000, 2001 Free Software Foundation, Inc.
+/* Copyright (C) 1989-1992, 2000, 2001, 2004 Free Software Foundation, Inc.
Written by James Clark (jjc@jclark.com)
This file is part of groff.
@@ -16,7 +16,7 @@ for more details.
You should have received a copy of the GNU General Public License along
with groff; see the file COPYING. If not, write to the Free Software
-Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. */
+Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA. */
/* I have tried to incorporate the changes needed for TeX 3.0 tfm files,
but I haven't tested them. */
@@ -412,7 +412,7 @@ int gf::load(const char *file)
};
int got_an_adjustment = 0;
int pending_adjustment = 0;
- int left_adj, right_adj;
+ int left_adj = 0, right_adj = 0; // pacify compiler
const int gf_id_byte = 131;
errno = 0;
FILE *fp = fopen(file, FOPEN_RB);
@@ -650,7 +650,7 @@ lig_chars table. `ch' gives the full-name of the character, `name'
gives the groff name of the character, `i' gives its index in
the encoding, which is filled in later (-1 if it does not appear). */
-struct {
+struct S {
const char *ch;
int i;
} lig_chars[] = {
@@ -670,7 +670,7 @@ enum { CH_f, CH_i, CH_l, CH_ff, CH_fi, CH_fl, CH_ffi, CH_ffl };
// Each possible ligature appears in this table.
-struct {
+struct S2 {
unsigned char c1, c2, res;
const char *ch;
} lig_table[] = {
diff --git a/contrib/groff/src/utils/xtotroff/Makefile.in b/contrib/groff/src/utils/xtotroff/Makefile.in
new file mode 100644
index 0000000..4b3a7e6
--- /dev/null
+++ b/contrib/groff/src/utils/xtotroff/Makefile.in
@@ -0,0 +1,62 @@
+# Copyright (C) 2004
+# Free Software Foundation, Inc.
+# Written by James Clark (jjc@jclark.com)
+#
+# This file is part of groff.
+#
+# groff is free software; you can redistribute it and/or modify it under
+# the terms of the GNU General Public License as published by the Free
+# Software Foundation; either version 2, or (at your option) any later
+# version.
+#
+# groff is distributed in the hope that it will be useful, but WITHOUT ANY
+# WARRANTY; without even the implied warranty of MERCHANTABILITY or
+# FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
+# for more details.
+#
+# You should have received a copy of the GNU General Public License along
+# with groff; see the file COPYING. If not, write to the Free Software
+# Foundation, 51 Franklin St - Fifth Floor, Boston, MA 02110-1301, USA.
+
+builddir=@abs_builddir@
+top_srcdir=@abs_top_srcdir@
+top_builddir=@abs_top_builddir@
+SHELL=@SHELL@
+
+devdir=$(top_builddir)/font
+driverdir=$(top_srcdir)/src/devices/xditview
+mkinstalldirs=$(SHELL) $(top_srcdir)/mkinstalldirs
+
+xtotroff=$(builddir)/xtotroff
+DPIS=75 100
+
+all:
+ @echo "Say \`make fonts' to generate fonts for gxditview."
+
+fonts: $(xtotroff) $(driverdir)/DESC.in $(driverdir)/FontMap
+ fonts=`sed -e 's/[ ].*//' $(driverdir)/FontMap`; \
+ for dpi in $(DPIS); do \
+ echo Making devX$$dpi; \
+ test -d $(devdir)/devX$$dpi || \
+ $(mkinstalldirs) $(devdir)/devX$$dpi; \
+ rm -f $(devdir)/devX$$dpi/DESC; \
+ sed -e "s/res 75/res $$dpi/" $(driverdir)/DESC.in \
+ >$(devdir)/devX$$dpi/DESC; \
+ (cd $(devdir)/devX$$dpi; \
+ rm -f Makefile.sub; \
+ echo DEV=X$$dpi >Makefile.sub; \
+ echo DEVFILES=DESC $$fonts >>Makefile.sub; \
+ $(xtotroff) -r $$dpi -s 10 $(driverdir)/FontMap); \
+ echo Making devX$$dpi-12; \
+ test -d $(devdir)/devX$$dpi-12 || \
+ $(mkinstalldirs) $(devdir)/devX$$dpi-12; \
+ rm -f $(devdir)/devX$$dpi-12/DESC; \
+ sed -e "s/res 75/res $$dpi/" \
+ -e 's/unitwidth 10/unitwidth 12/' $(driverdir)/DESC.in \
+ >$(devdir)/devX$$dpi-12/DESC; \
+ (cd $(devdir)/devX$$dpi-12; \
+ rm -f Makefile.sub; \
+ echo DEV=X$$dpi-12 >Makefile.sub; \
+ echo DEVFILES=DESC $$fonts >>Makefile.sub; \
+ $(xtotroff) -r $$dpi -s 12 $(driverdir)/FontMap); \
+ done
diff --git a/contrib/groff/src/utils/xtotroff/Makefile.sub b/contrib/groff/src/utils/xtotroff/Makefile.sub
new file mode 100644
index 0000000..fc0d76a
--- /dev/null
+++ b/contrib/groff/src/utils/xtotroff/Makefile.sub
@@ -0,0 +1,8 @@
+PROG=xtotroff$(EXEEXT)
+MAN1=xtotroff.n
+MLIB=$(LIBM)
+XLIBS=$(LIBXUTIL) $(LIBGROFF)
+EXTRA_CFLAGS=$(X_CFLAGS)
+EXTRA_LDFLAGS=$(X_LIBS) $(X_PRE_LIBS) -lXaw -lXt -lX11 $(X_EXTRA_LIBS)
+OBJS=xtotroff.$(OBJEXT)
+CSRCS=$(srcdir)/xtotroff.c
diff --git a/contrib/groff/src/utils/xtotroff/xtotroff.c b/contrib/groff/src/utils/xtotroff/xtotroff.c
new file mode 100644
index 0000000..dafff04
--- /dev/null
+++ b/contrib/groff/src/utils/xtotroff/xtotroff.c
@@ -0,0 +1,299 @@
+/*
+ * xtotroff
+ *
+ * convert X font metrics into troff font metrics
+ */
+
+#ifdef HAVE_CONFIG_H
+#include <config.h>
+#endif
+
+#include <X11/Xlib.h>
+#include <stdio.h>
+#include <ctype.h>
+#include <unistd.h>
+#include <stdlib.h>
+#include <string.h>
+#include <fcntl.h>
+#include <limits.h>
+
+#define __GETOPT_PREFIX groff_
+#include <getopt.h>
+
+#include "XFontName.h"
+#include "DviChar.h"
+
+#define charWidth(fi,c) \
+ ((fi)->per_char[(c) - (fi)->min_char_or_byte2].width)
+#define charHeight(fi,c) \
+ ((fi)->per_char[(c) - (fi)->min_char_or_byte2].ascent)
+#define charDepth(fi,c) \
+ ((fi)->per_char[(c) - (fi)->min_char_or_byte2].descent)
+#define charLBearing(fi,c) \
+ ((fi)->per_char[(c) - (fi)->min_char_or_byte2].lbearing)
+#define charRBearing(fi,c) \
+ ((fi)->per_char[(c) - (fi)->min_char_or_byte2].rbearing)
+
+extern const char *Version_string;
+static char *program_name;
+
+Display *dpy;
+unsigned resolution = 75;
+unsigned point_size = 10;
+
+int charExists(XFontStruct * fi, int c)
+{
+ XCharStruct *p;
+
+ /* `c' is always >= 0 */
+ if ((unsigned int) c < fi->min_char_or_byte2
+ || (unsigned int) c > fi->max_char_or_byte2)
+ return 0;
+ p = fi->per_char + (c - fi->min_char_or_byte2);
+ return p->lbearing != 0 || p->rbearing != 0 || p->width != 0
+ || p->ascent != 0 || p->descent != 0 || p->attributes != 0;
+}
+
+/* Canonicalize the font name by replacing scalable parts by *s. */
+
+static int CanonicalizeFontName(char *font_name, char *canon_font_name)
+{
+ unsigned int attributes;
+ XFontName parsed;
+
+ if (!XParseFontName(font_name, &parsed, &attributes)) {
+ fprintf(stderr, "not a standard name: %s\n", font_name);
+ return 0;
+ }
+
+ attributes &= ~(FontNamePixelSize | FontNameAverageWidth
+ | FontNamePointSize
+ | FontNameResolutionX | FontNameResolutionY);
+ XFormatFontName(&parsed, attributes, canon_font_name);
+ return 1;
+}
+
+static int
+FontNamesAmbiguous(const char *font_name, char **names, int count)
+{
+ char name1[2048], name2[2048];
+ int i;
+
+ if (count == 1)
+ return 0;
+
+ for (i = 0; i < count; i++) {
+ if (!CanonicalizeFontName(names[i], i == 0 ? name1 : name2)) {
+ fprintf(stderr, "bad font name: %s\n", names[i]);
+ return 1;
+ }
+ if (i > 0 && strcmp(name1, name2) != 0) {
+ fprintf(stderr, "ambiguous font name: %s\n", font_name);
+ fprintf(stderr, " matches %s\n", names[0]);
+ fprintf(stderr, " and %s\n", names[i]);
+ return 1;
+ }
+ }
+ return 0;
+}
+
+static int MapFont(char *font_name, const char *troff_name)
+{
+ XFontStruct *fi;
+ int count;
+ char **names;
+ FILE *out;
+ unsigned int c;
+ unsigned int attributes;
+ XFontName parsed;
+ int j, k;
+ DviCharNameMap *char_map;
+ char encoding[256];
+ char *s;
+ int wid;
+ char name_string[2048];
+
+ if (!XParseFontName(font_name, &parsed, &attributes)) {
+ fprintf(stderr, "not a standard name: %s\n", font_name);
+ return 0;
+ }
+
+ attributes &= ~(FontNamePixelSize | FontNameAverageWidth);
+ attributes |= FontNameResolutionX;
+ attributes |= FontNameResolutionY;
+ attributes |= FontNamePointSize;
+ parsed.ResolutionX = resolution;
+ parsed.ResolutionY = resolution;
+ parsed.PointSize = point_size * 10;
+ XFormatFontName(&parsed, attributes, name_string);
+
+ names = XListFonts(dpy, name_string, 100000, &count);
+ if (count < 1) {
+ fprintf(stderr, "bad font name: %s\n", font_name);
+ return 0;
+ }
+
+ if (FontNamesAmbiguous(font_name, names, count))
+ return 0;
+
+ XParseFontName(names[0], &parsed, &attributes);
+ sprintf(encoding, "%s-%s", parsed.CharSetRegistry,
+ parsed.CharSetEncoding);
+ for (s = encoding; *s; s++)
+ if (isupper(*s))
+ *s = tolower(*s);
+ char_map = DviFindMap(encoding);
+ if (!char_map) {
+ fprintf(stderr, "not a standard encoding: %s\n", encoding);
+ return 0;
+ }
+
+ fi = XLoadQueryFont(dpy, names[0]);
+ if (!fi) {
+ fprintf(stderr, "font does not exist: %s\n", names[0]);
+ return 0;
+ }
+
+ printf("%s -> %s\n", names[0], troff_name);
+
+ { /* Avoid race while opening file */
+ int fd;
+ (void) unlink(troff_name);
+ fd = open(troff_name, O_WRONLY | O_CREAT | O_EXCL, 0600);
+ out = fdopen(fd, "w");
+ }
+
+ if (!out) {
+ perror(troff_name);
+ return 0;
+ }
+ fprintf(out, "name %s\n", troff_name);
+ if (!strcmp(char_map->encoding, "adobe-fontspecific"))
+ fprintf(out, "special\n");
+ if (charExists(fi, ' ')) {
+ int w = charWidth(fi, ' ');
+ if (w > 0)
+ fprintf(out, "spacewidth %d\n", w);
+ }
+ fprintf(out, "charset\n");
+ for (c = fi->min_char_or_byte2; c <= fi->max_char_or_byte2; c++) {
+ const char *name = DviCharName(char_map, c, 0);
+ if (charExists(fi, c)) {
+ int param[5];
+
+ wid = charWidth(fi, c);
+
+ fprintf(out, "%s\t%d", name ? name : "---", wid);
+ param[0] = charHeight(fi, c);
+ param[1] = charDepth(fi, c);
+ param[2] = 0; /* charRBearing (fi, c) - wid */
+ param[3] = 0; /* charLBearing (fi, c) */
+ param[4] = 0; /* XXX */
+ for (j = 0; j < 5; j++)
+ if (param[j] < 0)
+ param[j] = 0;
+ for (j = 4; j >= 0; j--)
+ if (param[j] != 0)
+ break;
+ for (k = 0; k <= j; k++)
+ fprintf(out, ",%d", param[k]);
+ fprintf(out, "\t0\t0%o\n", c);
+
+ if (name) {
+ for (k = 1; DviCharName(char_map, c, k); k++) {
+ fprintf(out, "%s\t\"\n", DviCharName(char_map, c, k));
+ }
+ }
+ }
+ }
+ XUnloadFont(dpy, fi->fid);
+ fclose(out);
+ return 1;
+}
+
+static void usage(FILE *stream)
+{
+ fprintf(stream,
+ "usage: %s [-r resolution] [-s pointsize] FontMap\n",
+ program_name);
+}
+
+int main(int argc, char **argv)
+{
+ char troff_name[1024];
+ char font_name[1024];
+ char line[1024];
+ char *a, *b, c;
+ FILE *map;
+ int opt;
+ static const struct option long_options[] = {
+ { "help", no_argument, 0, CHAR_MAX + 1 },
+ { "version", no_argument, 0, 'v' },
+ { NULL, 0, 0, 0 }
+ };
+
+ program_name = argv[0];
+
+ while ((opt = getopt_long(argc, argv, "gr:s:v", long_options,
+ NULL)) != EOF) {
+ switch (opt) {
+ case 'g':
+ /* unused; just for compatibility */
+ break;
+ case 'r':
+ sscanf(optarg, "%u", &resolution);
+ break;
+ case 's':
+ sscanf(optarg, "%u", &point_size);
+ break;
+ case 'v':
+ printf("xtotroff (groff) version %s\n", Version_string);
+ exit(0);
+ break;
+ case CHAR_MAX + 1: /* --help */
+ usage(stdout);
+ exit(0);
+ break;
+ case '?':
+ usage(stderr);
+ exit(1);
+ break;
+ }
+ }
+ if (argc - optind != 1) {
+ usage(stderr);
+ exit(1);
+ }
+
+ dpy = XOpenDisplay(0);
+ if (!dpy) {
+ fprintf(stderr, "Can't connect to the X server.\n");
+ fprintf(stderr,
+ "Make sure the DISPLAY environment variable is set correctly.\n");
+ exit(1);
+ }
+
+ map = fopen(argv[optind], "r");
+ if (map == NULL) {
+ perror(argv[optind]);
+ exit(1);
+ }
+
+ while (fgets(line, sizeof(line), map)) {
+ for (a = line, b = troff_name; *a; a++, b++) {
+ c = (*b = *a);
+ if (c == ' ' || c == '\t')
+ break;
+ }
+ *b = '\0';
+ while (*a && (*a == ' ' || *a == '\t'))
+ ++a;
+ for (b = font_name; *a; a++, b++)
+ if ((*b = *a) == '\n')
+ break;
+ *b = '\0';
+ if (!MapFont(font_name, troff_name))
+ exit(1);
+ }
+ exit(0);
+}
diff --git a/contrib/groff/src/utils/xtotroff/xtotroff.man b/contrib/groff/src/utils/xtotroff/xtotroff.man
new file mode 100644
index 0000000..d21bb5c
--- /dev/null
+++ b/contrib/groff/src/utils/xtotroff/xtotroff.man
@@ -0,0 +1,109 @@
+.ig
+Copyright (C) 2004 Free Software Foundation, Inc.
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided that the
+entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this
+manual into another language, under the above conditions for modified
+versions, except that this permission notice may be included in
+translations approved by the Free Software Foundation instead of in
+the original English.
+..
+.
+.
+.TH XTOTROFF @MAN1EXT@ "@MDATE@" "Groff Version @VERSION@"
+.
+.
+.SH NAME
+xtotroff \- convert X font metrics into GNU troff font metrics
+.
+.
+.SH SYNOPSIS
+.B xtotroff
+[
+.BI \-r \%resolution
+]
+[
+.BI \-s \%point-size
+]
+[
+.B \-v
+]
+.I FontMap
+.
+.PP
+It is possible to have whitespace between a command line option and its
+parameter.
+.
+.
+.SH DESCRIPTION
+.B xtotroff
+takes a
+.IR FontMap ,
+which maps
+.B groff
+fonts to X11 fonts,
+creates GNU
+.B troff
+metric files for all fonts listed.
+Each line in
+.I FontMap
+consists of GNU
+.B troff
+font name and an X font name (XLFD) pattern, separated by whitespace.
+Example:
+.
+.PP
+.in +2n
+.nf
+TB -adobe-times-bold-r-normal--*-*-*-*-p-*-iso8859-1
+.fi
+.in
+.
+.PP
+The wildcards in the patterns are filled with the arguments to the
+.B \-r
+and
+.B \-s
+switches.
+If a font name is still ambiguous,
+.B xtotroff
+aborts.
+.
+.
+.SH OPTIONS
+.TP
+.BI \-r resolution
+Set the resolution for all font patterns in
+.IR FontMap .
+The value is used for both the horizontal and vertical resolution.
+If not specified, a resolution of 75dpi is assumed.
+.
+.TP
+.BI \-s point-size
+Set the point size for all font patterns in
+.IR FontMap .
+If not specified, a size of 10pt is assumed.
+.
+.TP
+.B \-v
+Print the version number.
+.
+.
+.SH BUGS
+The only supported font encodings are `iso8859-1' and `adobe-fontspecific'.
+.
+.
+.SH "SEE ALSO"
+.BR gxditview (@MAN1EXT@)
+.
+.\" Local Variables:
+.\" mode: nroff
+.\" End:
OpenPOWER on IntegriCloud